If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Aminobenzaldehyde phenylhydrazone | C(=NNc1ccccc1)c2ccccc2N |
3-Aminobenzaldehyde | C(=O)c1cccc(N)c1 |
4-Aminobenzaldehyde thiosemicarbazone | C(=NNC(N)=S)c1ccc(N)cc1 |
4-Aminobenzaldehyde | C(=O)c1ccc(N)cc1 |
4-Bis(2-chloroethyl)aminobenzaldehyde | N(CCCl)(CCCl)c1ccc(C=O)cc1 |
N, N-Dimethyl-p-aminobenzaldehyde | N(C)(C)c1ccc(C=O)cc1 |
m-Aminobenzaldehyde | C(=O)c1cccc(N)c1 |
p-Aminobenzaldehyde thiosemicarbazone | C(=NNC(N)=S)c1ccc(N)cc1 |
p-Aminobenzaldehyde | C(=O)c1ccc(N)cc1 |
p-Bis(2-chloroethyl)aminobenzaldehyde | N(CCCl)(CCCl)c1ccc(C=O)cc1 |
p-Bis(BETA_-chloroethyl)aminobenzaldehyde | N(CCCl)(CCCl)c1ccc(C=O)cc1 |
p-Bis(BETA_-cyanoethyl)aminobenzaldehyde | N(CCC#N)(CCC#N)c1ccc(C=O)cc1 |