If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Furfural | C(=O)C1=CC=CO1 |
5-(Hydroxymethyl)-2-furfural | C(O)C1=CC=C(C=O)O1 |
5-(Hydroxymethyl)furfural | C(O)C1=CC=C(C=O)O1 |
5-Nitro-2-furfural diacetate | C(OC(C)=O)(OC(C)=O)C1=CC=C(O1)[N+](=O)[O-] |
5-Nitro-2-furfural semicarbazone | [N+](=O)([O-])C1=CC=C(O1)C=NNC(N)=O |
5-Nitro-2-furfural thiosemicarbazone | [N+](=O)([O-])C1=CC=C(O1)C=NNC(N)=S |
BETA_-Furfural oxime | C(=NO)C1=CC=CO1 |
Butadien-furfural copolymer | C(=O)C12CC=CCC1C3CC=CCC3O2 |
FURFURAL | C(=O)C1=CC=CO1 |
Furfural acetone | C(=CC(C)=O)C1=CC=CO1 |
Furfural oxime | C(=NO)C1=CC=CO1 |
Furfural phenylhydrazone | C(=NNc1ccccc1)C2=CC=CO2 |
Furfural propylene glycol acetal | CC1COC(O1)C2=CC=CO2 |
Furfural | C(=O)C1=CC=CO1 |