If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Propanol, 1-(4-cyclohexylphenoxy)- | O(CC(C)O)c1ccc(cc1)C2CCCCC2 |
2-Propanol, 1-(p-cyclohexylphenoxy)- | O(CC(C)O)c1ccc(cc1)C2CCCCC2 |
2-Propanol__1-(p-cyclohexylphenoxy)- | O(CC(C)O)c1ccc(cc1)C2CCCCC2 |
Ethanol, 2-(4-cyclohexylphenoxy)- | O(CCO)c1ccc(cc1)C2CCCCC2 |
Ethanol, 2-(p-cyclohexylphenoxy)- | O(CCO)c1ccc(cc1)C2CCCCC2 |
Ethanol__2-(p-cyclohexylphenoxy)- | O(CCO)c1ccc(cc1)C2CCCCC2 |