If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Nyloquinone Blue 2J | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Nyloquinone Blue 4J | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Nyloquinone Blue NP | N(CCO)c1ccc(NCCO)c2C(=O)c3ccccc3C(=O)c12 |
Nyloquinone Orange JR | O=C1c2ccccc2C(=O)c3ccc(C)c(N)c13 |
Nyloquinone Pink B | O=C1c2ccccc2C(=O)c3c(O)cc(OC)c(N)c13 |
Nyloquinone Pure Blue R | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Nyloquinone Pure Blue | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Nyloquinone Red N | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Nyloquinone Violet R | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Nyloquinone Yellow 2R | [N+](=O)([O-])c1cc(ccc1Nc2ccc(O)cc2)[N+](=O)[O-] |
Nyloquinone Yellow 3R | N(=Nc1ccc(O)cc1)c2ccc(cc2)N=Nc3ccccc3 |