If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
WLN: WSQR &-NA- | S(=O)(=O)(O)c1ccccc1 |
WLN: WSQR B1 ENW | S(=O)(=O)(O)c1cc(ccc1C)[N+](=O)[O-] |
WLN: WSQR BNW DNW | [N+](=O)([O-])c1cc(ccc1S(=O)(=O)O)[N+](=O)[O-] |
WLN: WSQR BQ EG CNUNR BQ DQ | N(=Nc1ccc(O)cc1O)c2cc(Cl)cc(c2O)S(=O)(=O)O |
WLN: WSQR BZ DMV1 | S(=O)(=O)(O)c1ccc(NC(C)=O)cc1N |
WLN: WSQR BZ DSWQ | S(=O)(=O)(O)c1ccc(c(N)c1)S(=O)(=O)O |
WLN: WSQR BZ ENUNR DSWQ | N(=Nc1ccc(cc1)S(=O)(=O)O)c2ccc(N)c(c2)S(=O)(=O)O |
WLN: WSQR BZ ENW | S(=O)(=O)(O)c1cc(ccc1N)[N+](=O)[O-] |
WLN: WSQR CZ BQ ENW | S(=O)(=O)(O)c1cc(cc(N)c1O)[N+](=O)[O-] |
WLN: WSQR CZ F- 2 | S(=O)(=O)(O)c1cc(N)ccc1c2ccc(N)cc2S(=O)(=O)O |
WLN: WSQR D1 | S(=O)(=O)(O)c1ccc(C)cc1 |
WLN: WSQR DMYUM&MYZUM | N(C(=N)NC(=N)N)c1ccc(cc1)S(=O)(=O)O |
WLN: WSQR DQ CNUNR BQ DN2&2 | N(CC)(CC)c1ccc(N=Nc2cc(ccc2O)S(=O)(=O)O)c(O)c1 |
WLN: WSQR DQ CVQ | C(=O)(O)c1cc(ccc1O)S(=O)(=O)O |