If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Atomic sulfur | S |
Bis(2-carboxyphenyl)sulfur dihydroxide dilactone | O=C1OS2(OC(=O)c3ccccc23)c4ccccc14 |
Bis(2-carboxyphenyl)sulfur_dihydroxide_dilactone | O=C1OS2(OC(=O)c3ccccc23)c4ccccc14 |
Colloidal sulfur | S |
Flour sulfur | S |
Flowers of sulfur | S |
Ground vocle sulfur | S |
Half sulfur mustard | S(CCCl)CCO |
Methanamine, N,N-dimethyl-, compd. with sulfur trioxide (1:1) | N(C)(C)C.O=S(=O)=O |
Methanamine__N_N-dimethyl-__compd._with_sulfur_trioxide_(1:1) | N(C)(C)C.O=S(=O)=O |
Precipitated sulfur | S |
Pyridine compound with sulfur trioxide (1:1) | c1ccncc1.O=S(=O)=O |
Pyridine, compd. with sulfur trioxide (1:1) | c1ccncc1.O=S(=O)=O |
Pyridine-sulfur trioxide complex (1:1) | c1ccncc1.O=S(=O)=O |
Pyridine-sulfur trioxide complex | c1ccncc1.O=S(=O)=O |
Pyridine_compound_with_sulfur_trioxide_(1:1) | c1ccncc1.O=S(=O)=O |
Sublimed sulfur | S |
Sulfur atom | S |
Sulfur half-mustard | S(CCCl)CCO |
Sulfur ointment | S |
Sulfur trioxide pyridine complex | c1ccncc1.O=S(=O)=O |
Sulfur trioxide-trimethylamine complex (VAN) | N(C)(C)C.O=S(=O)=O |
Sulfur trioxide-trimethylamine | N(C)(C)C.O=S(=O)=O |
Sulfur vapor | S |
Sulfur | S |
Sulfur, ((2-chloro-4-oxo-2-oxetanyl)methyl)pentafluoro-, (OC-6-21)- | C(C1(Cl)CC(=O)O1)S(F)(F)(F)(F)F |
Sulfur, monoclinic | S |
Sulfur, pentafluoro(2-oxopropyl)-, (OC-6-21)- | C(C(C)=O)S(F)(F)(F)(F)F |
Sulfur, pharmaceutical | S |
Sulfur, precipitated | S |
Sulfur, rhombic | S |
Sulfur, solid | S |
Sulfur, sublimed | S |
Sulfur__((2-chloro-4-oxo-2-oxetanyl)methyl)pentafluoro-__(OC-6-21)- | C(C1(Cl)CC(=O)O1)S(F)(F)(F)(F)F |
Sulfur__pentafluoro(2-oxopropyl)-__(OC-6-21)- | C(C(C)=O)S(F)(F)(F)(F)F |
Trimethylamine compound with sulfur trioxide | N(C)(C)C.O=S(=O)=O |
Trimethylamine sulfur trioxide | N(C)(C)C.O=S(=O)=O |
Trimethylamine, compd. with sulfur trioxide (1:1) | N(C)(C)C.O=S(=O)=O |
Ultra Sulfur | S |