If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-(1-Metil-butil)-4, 6-dinitro-fenolo (ITALIAN) | C(C)(CCC)c1cc(cc([N+](=O)[O-])c1O)[N+](=O)[O-] |
2-(1-Metil-butil)-4__6-dinitro-fenolo_(ITALIAN) | C(C)(CCC)c1cc(cc([N+](=O)[O-])c1O)[N+](=O)[O-] |
6-(1-Metil-propil)-2,4-dinitro-fenolo (ITALIAN) | C(C)(CC)c1cc(cc([N+](=O)[O-])c1O)[N+](=O)[O-] |
6-Cicloesil-2,4-dinitr-fenolo(ITALIAN) | Oc1c(cc(cc1C2CCCCC2)[N+](=O)[O-])[N+](=O)[O-] |
6-Cicloesil-2_4-dinitr-fenolo(ITALIAN) | Oc1c(cc(cc1C2CCCCC2)[N+](=O)[O-])[N+](=O)[O-] |
Fenolo(ITALIAN) | Oc1ccccc1 |
O, O-Metilen-bis(4-cloro-fenolo)(ITALIAN) | C(c1cc(Cl)ccc1O)c2cc(Cl)ccc2O |