If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Oxo-2-pyridinethiol sodium salt | Sc1ccccn1=O |
2-Pyridinethiol N-oxide sodium salt | Sc1ccccn1=O |
2-Pyridinethiol | Sc1ccccn1 |
2-Pyridinethiol, 1-oxide, sodium salt | Sc1ccccn1=O |
2-Pyridinethiol, 1-oxide-, sodium salt | Sc1ccccn1=O |
2-Pyridinethiol, N-oxide, sodium salt | Sc1ccccn1=O |
2-Pyridinethiol-1-oxide sodium salt | Sc1ccccn1=O |
2-Pyridinethiol-1-oxide, zinc salt | [Zn]123ON4C=CC=CC4=S1.O2N5C=CC=CC5=S3 |
4-Pyridinethiol | Sc1ccncc1 |
Sodium 2-pyridinethiol 1-oxide | Sc1ccccn1=O |
Sodium 2-pyridinethiol N-oxide | Sc1ccccn1=O |
Zinc 2-pyridinethiol 1-oxide | [Zn]123ON4C=CC=CC4=S1.O2N5C=CC=CC5=S3 |