If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Aero cyanamid granular | C(N)#N |
Aero cyanamid special grade | C(N)#N |
American Cyanamid 3422 | P(=S)(OCC)(OCC)Oc1ccc(cc1)[N+](=O)[O-] |
American Cyanamid 4,049 | C(CC(=O)OCC)(SP(=S)(OC)OC)C(=O)OCC |
American Cyanamid CL-26,691 | P(=S)(OC)(OC)Oc1ccc(cc1)S(N)(=O)=O |
American Cyanamid KPAM | C(N)(=O)C=C |
American Cyanamid P-250 | C(N)(=O)C=C |
American cyanamid cl-24055 | N(C(C)=O)c1ccc(cc1)N=NN(C)C |
Calcium cyanamid | C(N)#N |
Cyanamid 24055 | N(C(C)=O)c1ccc(cc1)N=NN(C)C |
Cyanamid granular | C(N)#N |
Cyanamid special grade | C(N)#N |
Cyanamid | C(N)#N |