If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 2,4,5,6,7,8,8-Octachloro-3a,4,7,7a-tetrahydro-4,7-methanoindan | ClC12C(Cl)=C(Cl)C(Cl)(C3C(Cl)C(Cl)CC13)C2(Cl)Cl |
1,2:5,6-Diepoxy-3a,4,5,6,7, 7a-hexahydro-4,7-methanoindan | C12C3OC3CC2C4CC1C5OC45 |
1,2:5,6-Diepoxyhexahydro-4, 7-methanoindan | C12C3OC3CC2C4CC1C5OC45 |
4, 7-Methanoindan, 1,2,4,5,6,7,8,8-octachloro-3a,4,7,7a-tetrahydro- | ClC12C(Cl)=C(Cl)C(Cl)(C3C(Cl)C(Cl)CC13)C2(Cl)Cl |
4, 7-Methanoindan, 1,2:5,6-diepoxy-3a,4,5,6,7,7a-hexahydro- | C12C3OC3CC2C4CC1C5OC45 |
4, 7-Methanoindan, 1,2:5,6-diepoxyhexahydro- | C12C3OC3CC2C4CC1C5OC45 |
4, 7-Methanoindan, hexahydro-2-hydroxymethyl- | C(O)C1CC2C3CCC(C3)C2C1 |
4, 7-Methanoindan-5-ol, hexahydro- | OC1CC2CC1C3CCCC23 |
4,7-Methanoindan, 1,2:5,6-diepoxyhexahydro-, mixed isomers | C12C3OC3CC2C4CC1C5OC45 |
4,7-Methanoindan, 3a,4, 5,6,7,7a-hexahydro-1,2:5,6-diepoxy- | C12C3OC3CC2C4CC1C5OC45 |
4,7-Methanoindan, hexahydro- | C12CCCC1C3CC2CC3 |
4,7-Methanoindan-5(4H)-one, tetrahydro- | O=C1CC2CC1C3CCCC23 |
4_7-Methanoindan-5(4H)-one__tetrahydro- | O=C1CC2CC1C3CCCC23 |
Hexahydro-2-hydroxymethyl-4,7-methanoindan | C(O)C1CC2C3CCC(C3)C2C1 |
Hexahydro-4, 7-methanoindan | C12CCCC1C3CC2CC3 |