If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
29H, 31H-Phthalocyanine, dilithium salt | c12ccccc1C3=NC2=NC4=NC(=NC5=NC(=NC6=NC(=N3)c7ccccc67)c8ccccc58)c9ccccc49 |
29H__31H-Phthalocyanine__dilithium_salt | c12ccccc1C3=NC2=NC4=NC(=NC5=NC(=NC6=NC(=N3)c7ccccc67)c8ccccc58)c9ccccc49 |
Carbonic acid, dilithium salt | C(=O)(O)O |
Dilithium carbonate | C(=O)(O)O |
Dilithium oxalate | C(=O)(O)C(=O)O |
Dilithium phthalocyanine | c12ccccc1C3=NC2=NC4=NC(=NC5=NC(=NC6=NC(=N3)c7ccccc67)c8ccccc58)c9ccccc49 |
Ethanedioic acid, dilithium salt | C(=O)(O)C(=O)O |
Ethanedioic_acid__dilithium_salt | C(=O)(O)C(=O)O |
Oxalic acid, dilithium salt | C(=O)(O)C(=O)O |
Phosphoramidic acid, (chloroacetyl)-, dilithium salt | N(C(=O)CCl)P(=O)(O)O |
Phosphoramidic_acid__(chloroacetyl)-__dilithium_salt | N(C(=O)CCl)P(=O)(O)O |
Phthalocyanine, dilithium salt | c12ccccc1C3=NC2=NC4=NC(=NC5=NC(=NC6=NC(=N3)c7ccccc67)c8ccccc58)c9ccccc49 |