If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(7-Nitrofluoren-2-yl)-3-propylurea | [N+](=O)([O-])c1ccc2c(c1)Cc3cc(ccc23)NC(=O)NCCC |
1-(p-Chlorobenzenesulfonyl)-3-propylurea | S(=O)(=O)(NC(=O)NCCC)c1ccc(Cl)cc1 |
1-(p-Chlorophenylsulfonyl)-3-propylurea | S(=O)(=O)(NC(=O)NCCC)c1ccc(Cl)cc1 |
1-Nitroso-1-propylurea | N(N=O)(CCC)C(N)=O |
1-Propylurea | N(CCC)C(N)=O |
N-(4-Chlorophenylsulfonyl)-N'-propylurea | S(=O)(=O)(NC(=O)NCCC)c1ccc(Cl)cc1 |
N-(p-Chlorobenzenesulfonyl)-N'-propylurea | S(=O)(=O)(NC(=O)NCCC)c1ccc(Cl)cc1 |
N-Nitroso-N-propylurea | N(N=O)(CCC)C(N)=O |
N-Propylurea | N(CCC)C(N)=O |
Propylurea | N(CCC)C(N)=O |