If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Supracet Blue Green B | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Supracet Brilliant Blue 2GN | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Supracet Brilliant Blue BG | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Supracet Brilliant Red 2B | O=C1c2ccccc2C(=O)c3c(O)ccc(N)c13 |
Supracet Brilliant Violet 3R | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Supracet Deep Blue R | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Supracet Fast Blue 2G | O=C1c2ccccc2C(=O)c3c(NC)ccc(NC)c13 |
Supracet Fast Green Blue B | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Supracet Fast Pink 2R | O=C1c2ccccc2C(=O)c3c(O)cc(OC)c(N)c13 |
Supracet Fast Pink 3B | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Supracet Fast Scarlet B | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Supracet Fast Violet B | O=C1c2c(N)ccc(N)c2C(=O)c3cccc([N+](=O)[O-])c13 |
Supracet Fast Yellow 2R | [N+](=O)([O-])c1cc(ccc1Nc2ccc(O)cc2)[N+](=O)[O-] |
Supracet Fast Yellow 4R | N(=Nc1ccc(cc1)N=Nc2ccccc2)c3ccc(O)c(C)c3 |
Supracet Orange R | O=C1c2ccccc2C(=O)c3ccc(C)c(N)c13 |
Supracet Pink R | O=C1c2ccccc2C(=O)c3cccc(NC)c13 |
Supracet Yellow 3G | N(c1ccccc1)c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
Supracet Yellow 5RD | [N+](=O)([O-])c1cc(ccc1Nc2ccc(N)cc2)[N+](=O)[O-] |
Supracet Yellow RR | [N+](=O)([O-])c1cc(ccc1Nc2ccc(O)cc2)[N+](=O)[O-] |