If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(4-Methylphenyl)phenylmethane | C(c1ccccc1)c2ccc(C)cc2 |
(p-Chlorophenyl)phenylmethane | C(c1ccccc1)c2ccc(Cl)cc2 |
(p-Nitrophenyl)phenylmethane | C(c1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
4,4'-Bis(N, N-dimethylaminophenyl)phenylmethane | C(c1ccccc1)(c2ccc(cc2)N(C)C)c3ccc(cc3)N(C)C |
Bis(p-(N, N-dimethylamino)phenyl)phenylmethane | C(c1ccccc1)(c2ccc(cc2)N(C)C)c3ccc(cc3)N(C)C |
Bis(p-dimethylaminophenyl)phenylmethane | C(c1ccccc1)(c2ccc(cc2)N(C)C)c3ccc(cc3)N(C)C |
Chloro(p-chlorophenyl)phenylmethane | C(Cl)(c1ccccc1)c2ccc(Cl)cc2 |
Phenylmethane | Cc1ccccc1 |