If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1,3, 5-Tris(2-hydroxyethyl)isocyanuric acid | C(CO)N1C(=O)N(CCO)C(=O)N(CCO)C1=O |
Isocyanuric acid | Oc1nc(O)nc(O)n1 |
Isocyanuric acid, dichloro-, potassium salt | ClN1C(=O)NC(=O)N(Cl)C1=O |
Isocyanuric acid, triallyl ester | C(C=C)N1C(=O)N(CC=C)C(=O)N(CC=C)C1=O |
Isocyanuric acid, trimethyl ester | O=C1N(C)C(=O)N(C)C(=O)N1C |
Isocyanuric chloride | O=C1N(Cl)C(=O)N(Cl)C(=O)N1Cl |
Trichlorinated isocyanuric acid | O=C1N(Cl)C(=O)N(Cl)C(=O)N1Cl |