If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Diethylene glycol lauric acid monoester | C(=O)(OCCOCCO)CCCCCCCCCCC |
Diethylene glycol, monoester with stearic acid | C(=O)(OCCOCCO)CCCCCCCCCCCCCCCCC |
Dodecanoic acid, monoester with 1,2,3-propanetriol | C(CCCCCCCC)CCC(=O)O.OCC(O)CO |
Dodecanoic_acid__monoester_with_1_2_3-propanetriol | C(CCCCCCCC)CCC(=O)O.OCC(O)CO |
Glycol monoester ricinoleate | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Octadecanoic acid, monoester with 1,2-propanediol | C(CCCCCCCCCCC)CCCCCC(=O)O.OCC(C)O |
Octadecanoic_acid__monoester_with_1_2-propanediol | C(CCCCCCCCCCC)CCCCCC(=O)O.OCC(C)O |
Palmitic acid sucrose monoester | C(CCCCCCCCCC)CCCCC(=O)O.OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(O)C(O)C1O |
Polyethylene glycol 400 monoester of ricinoleic acid | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Polyethylene glycol-ricinoleic acid monoester | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Ricinoleic acid, monoester with polyethylene glycol | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Stearic acid, monoester with 1,2-propanediol | C(CCCCCCCCCCC)CCCCCC(=O)O.OCC(C)O |
Stearic acid, monoester with nonaethylene glycol | O(CCOCCOCCOCCOCCOCCOCCOCCOCCO)C(=O)CCCCCCCCCCCCCCCCC |
Stearic acid, monoester with pentaerythritol | C(CO)(CO)(CO)COC(=O)CCCCCCCCCCCCCCCCC |