If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(+ )-Methylamphetamine | C(C(C)NC)c1ccccc1 |
(+)-Methylamphetamine hydrochloride | C(C(C)NC)c1ccccc1 |
(+)-N-Methylamphetamine hydrochloride | C(C(C)NC)c1ccccc1 |
(+)-N-Methylamphetamine | C(C(C)NC)c1ccccc1 |
ALPHA_-Methylamphetamine hydrochloride | C(c1ccccc1)C(C)(C)N |
Methylamphetamine hydrochloride | C(C(C)NC)c1ccccc1 |
Methylamphetamine | C(C(C)NC)c1ccccc1 |
N-Methylamphetamine hydrochloride | C(C(C)NC)c1ccccc1 |
N-Methylamphetamine | C(C(C)NC)c1ccccc1 |
R(-)-N-Methylamphetamine | C(C(C)NC)c1ccccc1 |
d-Methylamphetamine | C(C(C)NC)c1ccccc1 |
d-N-Methylamphetamine | C(C(C)NC)c1ccccc1 |
l-Methylamphetamine | C(C(C)NC)c1ccccc1 |
p-Hydroxy-N-methylamphetamine hydrogen sulfate | S(=O)(=O)(O)O.CNC(C)Cc1ccc(O)cc1 |