If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1-(3-Chloroallyl)-3,5,7-triaza-1-azoniaadamantane chloride | C(C=CCl)N12CN3CN(C1)CN(C2)C3 |
1-(3-Chloroallyl)-3,5,7-triazo-1-azoniaadamantane chloride | C(C=CCl)N12CN3CN(C1)CN(C2)C3 |
2-Chloroallyl N,N-diethyldithiocarbamate | N(CC)(CC)C(=S)SCC(=C)Cl |
2-Chloroallyl alcohol | C(=C)(Cl)CO |
2-Chloroallyl chloride | C(=C)(Cl)CCl |
2-Chloroallyl diethyldithiocarbamate | N(CC)(CC)C(=S)SCC(=C)Cl |
3,5,7-Triaza-1-azoniaadamantane, 1-(3-chloroallyl)-, chloride | C(C=CCl)N12CN3CN(C1)CN(C2)C3 |
ALPHA_-Chloroallyl chloride | C(CCl)=CCl |
Acetic acid, 2,2-bis(2-chloroallyl)hydrazide | N(CC(=C)Cl)(CC(=C)Cl)NC(C)=O |
Acetic acid, phenyl-, 2,2-bis(2-chloroallyl)hydrazide | N(CC(=C)Cl)(CC(=C)Cl)NC(=O)Cc1ccccc1 |
Acetic_acid__2_2-bis(2-chloroallyl)hydrazide | N(CC(=C)Cl)(CC(=C)Cl)NC(C)=O |
Acetic_acid__phenyl-__2_2-bis(2-chloroallyl)hydrazide | N(CC(=C)Cl)(CC(=C)Cl)NC(=O)Cc1ccccc1 |
Acrylic acid, 3-chloroallyl ester | C(=O)(C=C)OCC=CCl |
BETA_-Chloroallyl alcohol | C(=C)(Cl)CO |
BETA_-Chloroallyl-N-methylamine | C(NC)C(=C)Cl |
BETA_-Chloroallyl_alcohol | C(=C)(Cl)CO |
Benzene, (3-chloroallyl)- | C(C=CCl)c1ccccc1 |
Benzene__(3-chloroallyl)- | C(C=CCl)c1ccccc1 |
Carbamic acid, diethyldithio-, 2-chloroallyl ester | N(CC)(CC)C(=S)SCC(=C)Cl |
Diethyldithiocarbamic acid 2-chloroallyl ester | N(CC)(CC)C(=S)SCC(=C)Cl |
Ether, bis(2-chloroallyl) | O(CC(=C)Cl)CC(=C)Cl |
GAMMA_-Chloroallyl chloride | C(CCl)=CCl |
Lactic acid, 2-chloroallyl ester | C(=O)(OCC(=C)Cl)C(C)O |
N-(3-Chloroallyl)hexaminium chloride | C(C=CCl)N12CN3CN(C1)CN(C2)C3 |
Phenylacetic acid 2,2-bis(2-chloroallyl) hydrazide | N(CC(=C)Cl)(CC(=C)Cl)NC(=O)Cc1ccccc1 |