If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(-)-chiro-Inositol | OC1C(O)C(O)C(O)C(O)C1O |
1-L-chiro-Inositol | OC1C(O)C(O)C(O)C(O)C1O |
D-chiro-Inositol, 3-O-methyl- | O(C)C1C(O)C(O)C(O)C(O)C1O |
Inositol, 2-O-methyl-, L-chiro- | O(C)C1C(O)C(O)C(O)C(O)C1O |
Inositol, 3-O-methyl-, D-chiro- | O(C)C1C(O)C(O)C(O)C(O)C1O |
Inositol, L-chiro- | OC1C(O)C(O)C(O)C(O)C1O |
Inositol__2-O-methyl-__L-chiro- | O(C)C1C(O)C(O)C(O)C(O)C1O |
Inositol__3-O-methyl-__D-chiro- | O(C)C1C(O)C(O)C(O)C(O)C1O |
L-chiro-Inositol | OC1C(O)C(O)C(O)C(O)C1O |
L-chiro-Inositol, 2-O-methyl- | O(C)C1C(O)C(O)C(O)C(O)C1O |