If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 1'-Sulfonylbis(2,4,6-trimethylbenzene) | S(=O)(=O)(c1c(C)cc(C)cc1C)c2c(C)cc(C)cc2C |
1,2, 3-Trimethylbenzene, 90.5% | Cc1c(C)cccc1C |
1,2, 4-Trimethylbenzene | Cc1cc(C)ccc1C |
1,2,3-Trimethylbenzene | Cc1c(C)cccc1C |
1,2,5-Trimethylbenzene | Cc1cc(C)ccc1C |
1,3, 5-Trimethylbenzene | Cc1cc(C)cc(C)c1 |
1,3,4-Trimethylbenzene | Cc1cc(C)ccc1C |
1,3,5-Trichloro-2,4,6-trimethylbenzene | Cc1c(Cl)c(C)c(Cl)c(C)c1Cl |
1-(3-Methylbutyryl)-2,4,6-trimethylbenzene | C(=O)(CC(C)C)c1c(C)cc(C)cc1C |
1-(3-Methylbutyryl)-2_4_6-trimethylbenzene | C(=O)(CC(C)C)c1c(C)cc(C)cc1C |
1-Bromo-2,4, 6-trimethylbenzene | Brc1c(C)cc(C)cc1C |
1-Chloro-2,4,6-trimethylbenzene | Clc1c(C)cc(C)cc1C |
1-Hydroxy-2, 3,5-trimethylbenzene | Cc1c(C)cc(C)cc1O |
1-Hydroxy-2,3, 6-trimethylbenzene | Cc1c(C)ccc(C)c1O |
1-Hydroxy-2,4, 5-trimethylbenzene | Cc1cc(C)c(O)cc1C |
1-Hydroxy-2,4,6-trimethylbenzene | Oc1c(C)cc(C)cc1C |
1-Hydroxy-2_3__6-trimethylbenzene | Cc1c(C)ccc(C)c1O |
1-Hydroxy-2_4_6-trimethylbenzene | Oc1c(C)cc(C)cc1C |
1-Hydroxy-2_4__5-trimethylbenzene | Cc1cc(C)c(O)cc1C |
1-Hydroxy-2__3_5-trimethylbenzene | Cc1c(C)cc(C)cc1O |
1-Hydroxy-3,4, 5-trimethylbenzene | Cc1c(C)cc(O)cc1C |
1-Hydroxy-3_4__5-trimethylbenzene | Cc1c(C)cc(O)cc1C |
1_2__3-Trimethylbenzene__90.5% | Cc1c(C)cccc1C |
2,4, 6-(Trimethylbenzene)sulfonyl chloride | S(Cl)(=O)(=O)c1c(C)cc(C)cc1C |
2-Chloro-1,3,5-trimethylbenzene | Clc1c(C)cc(C)cc1C |
5-Hydroxy-1,2,3-trimethylbenzene | Cc1c(C)cc(O)cc1C |
as-Trimethylbenzene | Cc1cc(C)ccc1C |
sym-Trimethylbenzene | Cc1cc(C)cc(C)c1 |