If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Ceres Black BN | N(=Nc1ccc(N=Nc2ccccc2)c3ccccc13)c4ccc5NC(C)(C)Nc6cccc4c56 |
Ceres Blue BHR | [Cu]123N4C5=C6C=CC=CC6=C4N=C7N2=C(N=C8N1C(=NC9=N3C(=N5)c%10ccccc9%10)c%11ccccc8%11)c%12ccccc7%12 |
Ceres Blue GN | N(c1cccc(C)c1)c2ccc(NC)c3C(=O)c4ccccc4C(=O)c23 |
Ceres Orange G | N(=Nc1ccccc1)c2ccc(O)cc2O |
Ceres Orange R | N(=Nc1ccccc1)c2c(O)ccc3ccccc23 |
Ceres Orange RR | N(=Nc1ccc(C)cc1C)c2c(O)ccc3ccccc23 |
Ceres Red 7B | N(=Nc1ccc(cc1)N=Nc2ccccc2)c3c(NCC)ccc4ccccc34 |
Ceres Red B | N(=Nc1ccc(N=Nc2cccc(C)c2)c(C)c1)c3c(O)ccc4ccccc34 |
Ceres Red BB | N(=Nc1ccc(N=Nc2ccccc2C)cc1C)c3c(O)ccc4ccccc34 |
Ceres Red G 102 | N(=Nc1ccccc1OC)c2c(O)ccc3ccccc23 |
Ceres Red G | N(=Nc1ccccc1OC)c2c(O)ccc3ccccc23 |
Ceres Yellow GGN | N(CC)(CC)c1ccc(cc1)N=Nc2ccccc2 |
Ceres Yellow R | N(=Nc1ccccc1)c2ccc(N)cc2 |
Ceres orange GN | N(=Nc1ccccc1)c2ccc(O)cc2O |
Ceres oranges RR | N(=Nc1ccc(C)cc1C)c2c(O)ccc3ccccc23 |