If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Nitrophthalic acid | C(=O)(O)c1c(cccc1[N+](=O)[O-])C(=O)O |
3-Nitrophthalic anhydride | [N+](=O)([O-])c1cccc2C(=O)OC(=O)c12 |
4-Nitrophthalic acid | C(=O)(O)c1cc(ccc1C(=O)O)[N+](=O)[O-] |
4-Nitrophthalic anhydride | O=C1OC(=O)c2ccc(cc12)[N+](=O)[O-] |
4-nitrophthalic acid dimethyl ester | C(=O)(OC)c1cc(ccc1C(=O)OC)[N+](=O)[O-] |
5-Nitrophthalic acid | C(=O)(O)c1cc(ccc1C(=O)O)[N+](=O)[O-] |