If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
WLN: T666 1A M AN CN GN KNTJ CVMR BG& GVMR BG& KVMR BG | C(=O)(Nc1ccccc1Cl)N2CCC3N(CCC4N(CCC2N34)C(=O)Nc5ccccc5Cl)C(=O)Nc6ccccc6Cl |
WLN: T6O DS BUTJ B1 CVMR | C(=O)(Nc1ccccc1)C2=C(C)OCCS2 |
WLN: T6O DSW BUTJ B1 CVMR | C(=O)(Nc1ccccc1)C2=C(C)OCCS2(=O)=O |
WLN: WNR BQ CVMR DG | C(=O)(Nc1ccc(Cl)cc1)c2cccc([N+](=O)[O-])c2O |
WLN: WNR DQ CVMR CG | C(=O)(Nc1cccc(Cl)c1)c2cc(ccc2O)[N+](=O)[O-] |
WLN: WNR DQ CVMR DE | C(=O)(Nc1ccc(Br)cc1)c2cc(ccc2O)[N+](=O)[O-] |
WLN: WNR DQ CVMR DG | C(=O)(Nc1ccc(Cl)cc1)c2cc(ccc2O)[N+](=O)[O-] |