If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(+)-(S)-Isocorydine | O(C)c1c(OC)cc2CCN(C)C3Cc4ccc(OC)c(O)c4c1c23 |
ISOCORYDINE | O(C)c1c(OC)cc2CCN(C)C3Cc4ccc(OC)c(O)c4c1c23 |
Isocorydine methiodide | O(C)c1c(OC)cc2CCN(C)(C)C3Cc4ccc(OC)c(O)c4c1c23 |
Isocorydine | O(C)c1c(OC)cc2CCN(C)C3Cc4ccc(OC)c(O)c4c1c23 |
Isocorydine_methiodide | O(C)c1c(OC)cc2CCN(C)(C)C3Cc4ccc(OC)c(O)c4c1c23 |
L-(+)-Isocorydine | O(C)c1c(OC)cc2CCN(C)C3Cc4ccc(OC)c(O)c4c1c23 |
S-(+)-Isocorydine | O(C)c1c(OC)cc2CCN(C)C3Cc4ccc(OC)c(O)c4c1c23 |
d-Isocorydine | O(C)c1c(OC)cc2CCN(C)C3Cc4ccc(OC)c(O)c4c1c23 |