Alphabetical Indicies

If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.

If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.

Select from

Antimony cobalt ammine chloride [Co](N)(N)(N)(N)(N)N.Cl[Sb](Cl)(Cl)(Cl)(Cl)Cl
Chromium ammine nitrate N(O)(O)O.N[Cr](N)(N)(N)(N)N
Cobalt ammine chloride cyanide [Co](N)(N)(N)(N)(N)C#N
Cobalt ammine chloride [Co](Cl)(Cl)(N)(N)(N)N
Cobalt ammine cyanide chloride [Co](N)(N)(N)(N)(N)C#N
Copper ammine sulfate S(=O)(=O)(O)O.N[Cu](N)(N)N
Iridium ammine chloride [Ir](Cl)(Cl)(Cl)(N)(N)N
Mercury ammine chloride Cl.Cl.N.N
Nickel ammine bromide [Ni](N)(N)(N)(N)(N)N
Palladium ammine chloride [Pd](Cl)(Cl)(N)N
Platinum ammine chloride [Pt](Cl)(N)(N)N
Platinum ammine nitrite [Pt](N)(N)([N+](=O)[O-])[N+](=O)[O-]
Potassium platinum ammine chloride [Pt](Cl)(Cl)(Cl)N
Rhenium ammine chloride [Rh](Cl)(Cl)(Cl)(N)(N)N
Ruthenium ammine chloride [Ru](Cl)(N)(N)(N)(N)N


The Random Factory - 2001