If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Methyl-2(1H)-quinolone | CN1C(=O)C=Cc2ccccc12 |
1-Methyl-2-quinolone | CN1C(=O)C=Cc2ccccc12 |
2(1H)-Quinolone | Oc1ccc2ccccc2n1 |
4(1H)-Quinolone, 1-methyl-, hydrochloride | O=C1C=CN(C)c2ccccc12 |
4(1H)-Quinolone, 2,3-dihydro-1-(p-tolylsulfonyl)- | S(=O)(=O)(c1ccc(C)cc1)N2CCC(=O)c3ccccc23 |
4(1H)-Quinolone, 5,6,7,8-tetrahydro-2-phenyl- | O=C1C=C(NC2=C1CCCC2)c3ccccc3 |
4(1H)-Quinolone__5_6_7_8-tetrahydro-2-phenyl- | O=C1C=C(NC2=C1CCCC2)c3ccccc3 |
4-Hydroxy-1-methyl-2(1H)-quinolone | CN1C(=O)C=C(O)c2ccccc12 |
4-Hydroxy-1-methyl-2-quinolone | CN1C(=O)C=C(O)c2ccccc12 |
4-Hydroxy-2-quinolone | Oc1cc(O)nc2ccccc12 |
4-Methyl-2-quinolone | Cc1cc(O)nc2ccccc12 |
ALPHA_-Quinolone | Oc1ccc2ccccc2n1 |