If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 2-Cyclohexanediol | OC1CCCCC1O |
1, 2-Cyclohexanediol, 1-methyl-4-(1-methylethyl)- | C(C)(C)C1CCC(C)(O)C(O)C1 |
1, 2-trans-Cyclohexanediol | OC1CCCCC1O |
1, 4-Cyclohexanediol, trans- | OC1CCC(O)CC1 |
1,2-Cyclohexanediol, 1-methyl-, trans- | OC1CCCCC1(C)O |
1,2-Cyclohexanediol, cis- | OC1CCCCC1O |
1,2-Cyclohexanediol, dimethanesulfonate, cis- | O(C1CCCCC1OS(C)(=O)=O)S(C)(=O)=O |
1,2-Cyclohexanediol, trans- | OC1CCCCC1O |
1,3-Cyclohexanediol | OC1CCCC(O)C1 |
1,4-Cyclohexanediol | OC1CCC(O)CC1 |
1,4-Cyclohexanediol, diacetate, cis- | O(C(C)=O)C1CCC(CC1)OC(C)=O |
1,4-Cyclohexanediol, diacetate, trans- | O(C(C)=O)C1CCC(CC1)OC(C)=O |
1_2-Cyclohexanediol__1-methyl-__trans- | OC1CCCCC1(C)O |
1_2-Cyclohexanediol__dimethanesulfonate__cis- | O(C1CCCCC1OS(C)(=O)=O)S(C)(=O)=O |
1_4-Cyclohexanediol | OC1CCC(O)CC1 |
1_4-Cyclohexanediol__diacetate__cis- | O(C(C)=O)C1CCC(CC1)OC(C)=O |
1_4-Cyclohexanediol__diacetate__trans- | O(C(C)=O)C1CCC(CC1)OC(C)=O |
1__2-Cyclohexanediol__1-methyl-4-(1-methylethyl)- | C(C)(C)C1CCC(C)(O)C(O)C1 |
cis-1,2-Cyclohexanediol | OC1CCCCC1O |
trans-1,2-Cyclohexanediol | OC1CCCCC1O |
trans-1,4-Cyclohexanediol | OC1CCC(O)CC1 |
trans-1-Methyl-1,2-cyclohexanediol | OC1CCCCC1(C)O |