If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2,4-Dichlorophenyl diethyl phosphorothionate | O(c1ccc(Cl)cc1Cl)P(=S)(OCC)OCC |
4-Bromo-2, 5-dichlorophenyl dimethyl phosphorothionate | O(c1cc(Cl)c(Br)cc1Cl)P(=S)(OC)OC |
Diethyl (2-(ethylthio)ethyl) phosphorothionate | P(=S)(OCC)(OCC)OCCSCC |
Diethyl 2,4-dichlorophenyl phosphorothionate | O(c1ccc(Cl)cc1Cl)P(=S)(OCC)OCC |
Diethyl 4-(2-isopropyl-6-methylpyrimidinyl)phosphorothionate | O(c1cc(C)nc(n1)C(C)C)P(=S)(OCC)OCC |
Diethyl 4-nitrophenyl phosphorothionate | P(=S)(OCC)(OCC)Oc1ccc(cc1)[N+](=O)[O-] |
Diethyl p-nitrophenyl phosphorothionate | P(=S)(OCC)(OCC)Oc1ccc(cc1)[N+](=O)[O-] |
Dimethyl (2,4,5-trichlorophenyl) phosphorothionate | O(c1cc(Cl)c(Cl)cc1Cl)P(=S)(OC)OC |
O,O-Diethyl O-(2-(ethylthio)ethyl) phosphorothionate | P(=S)(OCC)(OCC)OCCSCC |
Phosphinic acid, diethyl-, anhydride with diethyl phosphorothionate | P(=S)(OCC)(OCC)OP(=O)(CC)CC |
Phosphonic acid, diethyl-, anhydride with diethyl phosphorothionate | P(=S)(OCC)(OCC)OP(=O)(CC)OCC |
Triethyl phosphorothionate | P(=S)(OCC)(OCC)OCC |
Triphenyl phosphorothionate | P(=S)(Oc1ccccc1)(Oc2ccccc2)Oc3ccccc3 |