If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Dithio-m-hydroxycarbanilic acid S-methyl ester methylcarbamate | N(C(=S)SC)c1cccc(c1)OC(=O)NC |
m-Hydroxycarbanilic acid 2-methoxyethyl ester methylcarbamate | N(C(=O)OCCOC)c1cccc(c1)OC(=O)NC |
m-Hydroxycarbanilic acid 2-propynyl ester methylcarbamate | N(C(=O)OCC#C)c1cccc(c1)OC(=O)NC |
m-Hydroxycarbanilic acid allyl ester | N(C(=O)OCC=C)c1cccc(O)c1 |
m-Hydroxycarbanilic acid cyclohexyl ester | N(C(=O)OC1CCCCC1)c2cccc(O)c2 |
m-Hydroxycarbanilic acid ethyl ester | N(C(=O)OCC)c1cccc(O)c1 |
m-Hydroxycarbanilic acid isopentyl ester | N(C(=O)OCCC(C)C)c1cccc(O)c1 |
m-Hydroxycarbanilic acid propyl ester | N(C(=O)OCCC)c1cccc(O)c1 |