If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(2-Chloroethyl)-1-nitroso-3-(2-norbornyl)urea | N(C(=O)N(N=O)CCCl)C1CC2CCC1C2 |
2-Norbornyl acetate | O(C(C)=O)C1CC2CCC1C2 |
2-Norbornyl ketone | C(=O)(C1CC2CCC1C2)C3CC4CCC3C4 |
2-Norbornyl_ketone | C(=O)(C1CC2CCC1C2)C3CC4CCC3C4 |
2-exo-Norbornyl bromide | BrC1CC2CCC1C2 |
8-(2-Norbornyl)theophylline | O=C1N(C)C(=O)N(C)C2=C1N=C(N2)C3CC4CCC3C4 |
Carbamic acid, 2-norbornyl-, ethyl ester | N(C(=O)OCC)C1CC2CCC1C2 |
Norbornyl acetate | O(C(C)=O)C1CC2CCC1C2 |
Norbornyl alcohol | OC1CC2CCC1C2 |
Phosphonic acid, 2-norbornyl-, dimethyl ester, exo- | P(=O)(OC)(OC)C1CC2CCC1C2 |
Theophylline, 8-(2-norbornyl)- | O=C1N(C)C(=O)N(C)C2=C1N=C(N2)C3CC4CCC3C4 |
Urea, 1-(2-chloroethyl)-1-nitroso-3-(2-norbornyl)- | N(C(=O)N(N=O)CCCl)C1CC2CCC1C2 |
Urea, 1-(2-chloroethyl)-3-(2-norbornyl)-1-nitroso- | N(C(=O)N(N=O)CCCl)C1CC2CCC1C2 |
Urea, 1-(2-fluoroethyl)-1-nitroso-3-(2-norbornyl)- | N(C(=O)N(N=O)CCF)C1CC2CCC1C2 |
exo-2-Norbornyl alcohol | OC1CC2CCC1C2 |
exo-Norbornyl alcohol | OC1CC2CCC1C2 |
exo-Norbornyl bromide | BrC1CC2CCC1C2 |