If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Lilly 01516 | C(C(C)N(C)C)N1c2ccccc2Sc3ccccc13 |
Lilly 1516 | C(C(C)N(C)C)N1c2ccccc2Sc3ccccc13 |
Lilly 16726 | C(N(C)CCCCCC)c1ccc(cc1)OCCOc2ccc(cc2)CN(C)CCCCCC |
Lilly 20522 | C(O)(CNC(C)C)c1ccc(Cl)c(Cl)c1 |
Lilly 26475 | C(C)(O)(c1cccc(Cl)c1)C(C)(C)O |
Lilly 28002 | C(C1CO1)N2CCC(CC2)C3CCN(CC3)CC4CO4 |
Lilly 32379 | CC12CC(C)C(=O)CC2CCC3C1CCC4(C)C(CCC34)OC(=O)CC |
Lilly 32645 | C(C)C12C=CCN3CCC4(c5cc(c(OC)cc5N(C)C4C(O)(C(=O)OC)C2OC(C)=O)C6(CC7CN(CCC8=C6Nc9ccccc89)CC%10(CC)OC7%10)C(=O)OC)C13.O=S(=O)(O)O |
Lilly 37231 | S(=O)(=O)(O)O.COC(=O)C1(O)C(OC(C)=O)C2(CC)C=CCN3CCC4(c5cc(c(OC)cc5N(C=O)C14)C6(CC7CN(CCC8=C6Nc9ccccc89)CC(O)(CC)C7)C(=O)OC)C23 |
Lilly 38489 | C(CCNC)=C1c2ccccc2CCc3ccccc13 |
Lilly 47663 | O(C1OC(CO)C(O)C(N)C1O)C2C(N)CC(N)C(OC3OC(CN)C(O)CC3N)C2O |
Lilly 51641 | O(CCNC1CC1)c2ccccc2Cl |
Lilly 59156 | C(C#C)(OC(=O)NC1CCCCC1)(c2ccccc2)c3ccccc3 |
Lilly 68618 | Cc1c(OC)c(CC=C(C)CCC(=O)O)c(O)c2C(=O)OCc12 |
Lilly Res. No. 28002 | C(C1CO1)N2CCC(CC2)C3CCN(CC3)CC4CO4 |