If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-Methyl-3-(3, 4-methylenedioxyphenyl)-2-propenal | C(=C(C)C=O)c1ccc2OCOc2c1 |
2-Methyl-3-(3__4-methylenedioxyphenyl)-2-propenal | C(=C(C)C=O)c1ccc2OCOc2c1 |
2-Methyl-3-(4-methoxyphenyl)-2-propenal | C(=C(C)C=O)c1ccc(OC)cc1 |
2-Methyl-3-phenyl-2-propenal | C(=C(C)C=O)c1ccccc1 |
2-Propenal dimer | C(=O)C1CCC=CO1 |
2-Propenal | C(=C)C=O |
2-Propenal, (2, 4-dinitrophenyl)hydrazone | N(N=CC=C)c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
2-Propenal, 2-bromo-3-phenyl- | C(=C(Br)C=O)c1ccccc1 |
2-Propenal, 2-methyl- | C(C)(=C)C=O |
2-Propenal, 2-methyl-3-phenyl- | C(=C(C)C=O)c1ccccc1 |
2-Propenal, 3,3-diphenyl- | C(=CC=O)(c1ccccc1)c2ccccc2 |
2-Propenal, 3-(1,3-benzodioxol-5-yl)-2-methyl- | C(=C(C)C=O)c1ccc2OCOc2c1 |
2-Propenal, 3-(2-furanyl)- | C(=CC=O)C1=CC=CO1 |
2-Propenal, 3-(2-methoxyphenyl)- | C(=CC=O)c1ccccc1OC |
2-Propenal, 3-(2-nitrophenyl)- | C(=CC=O)c1ccccc1[N+](=O)[O-] |
2-Propenal, 3-(3,4, 5-trimethoxyphenyl)- | O(C)c1cc(C=CC=O)cc(OC)c1OC |
2-Propenal, 3-(4-(dimethylamino)phenyl)- | N(C)(C)c1ccc(C=CC=O)cc1 |
2-Propenal, 3-(4-methoxyphenyl)- | C(=CC=O)c1ccc(OC)cc1 |
2-Propenal, 3-(4-methoxyphenyl)-2-methyl- | C(=C(C)C=O)c1ccc(OC)cc1 |
2-Propenal, 3-(4-nitrophenyl)- | [N+](=O)([O-])c1ccc(C=CC=O)cc1 |
2-Propenal, 3-phenyl- | C(=CC=O)c1ccccc1 |
2-Propenal, 3-phenyl-, phenylhydrazone | C(=CC=NNc1ccccc1)c2ccccc2 |
2-Propenal, phenylhydrazone | N(N=CC=C)c1ccccc1 |
2-Propenal, polymer with formaldehyde | C(=C)C=O.C=O |
2-Propenal__(2__4-dinitrophenyl)hydrazone | N(N=CC=C)c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
2-Propenal__3-(2-furanyl)- | C(=CC=O)C1=CC=CO1 |
2-Propenal__3-(2-nitrophenyl)- | C(=CC=O)c1ccccc1[N+](=O)[O-] |
2-Propenal__3-(3_4__5-trimethoxyphenyl)- | O(C)c1cc(C=CC=O)cc(OC)c1OC |
2-Propenal__3-(4-(dimethylamino)phenyl)- | N(C)(C)c1ccc(C=CC=O)cc1 |
2-Propenal__3-(4-methoxyphenyl)- | C(=CC=O)c1ccc(OC)cc1 |
2-Propenal__3-(4-nitrophenyl)- | [N+](=O)([O-])c1ccc(C=CC=O)cc1 |
2-Propenal__3-phenyl-__phenylhydrazone | C(=CC=NNc1ccccc1)c2ccccc2 |
2-Propenal__phenylhydrazone | N(N=CC=C)c1ccccc1 |
2-Propenal__polymer_with_formaldehyde | C(=C)C=O.C=O |
2-Propenoic acid, polymer with 2-propenal | C(=C)C=O.C=CC(=O)O |
2-Propenoic_acid__polymer_with_2-propenal | C(=C)C=O.C=CC(=O)O |
3-(ALPHA_-Furyl)propenal | C(=CC=O)C1=CC=CO1 |
3-Phenyl-2-propenal dimethyl acetal | C(=C(C=O)CCCCCC)c1ccccc1 |
3-Phenyl-2-propenal | C(=CC=O)c1ccccc1 |
Propenal diethyl acetal | C(C=C)(OCC)OCC |
Propenal | C(=C)C=O |