If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
3-(2-Thienyl)-L-serine | C(O)(C1=CC=CS1)C(N)C(=O)O |
ALPHA_-Methyl-DL-serine | C(C)(N)(CO)C(=O)O |
Acetic acid, diazo-, ester with serine | O(CC(N)C(=O)O)C(=O)C=N=N |
Acetic_acid__diazo-__ester_with_serine | O(CC(N)C(=O)O)C(=O)C=N=N |
BETA_-(2-Thienyl)serine | C(O)(C1=CC=CS1)C(N)C(=O)O |
CARBOXYMETHYL-L-SERINE, N- | C(CO)(NCC(=O)O)C(=O)O |
CARBOXYMETHYL-L-SERINE__N- | C(CO)(NCC(=O)O)C(=O)O |
Carbamic acid, bis(2-chloroethyl)-, ester with DL-serine | N(CCCl)(CCCl)C(=O)OCC(N)C(=O)O |
Carbamic acid, bis(2-chloropropyl)-, ester with DL-serine | N(CC(C)Cl)(CC(C)Cl)C(=O)OCC(N)C(=O)O |
Carbamic_acid__bis(2-chloroethyl)-__ester_with_DL-serine | N(CCCl)(CCCl)C(=O)OCC(N)C(=O)O |
Carbamic_acid__bis(2-chloropropyl)-__ester_with_DL-serine | N(CC(C)Cl)(CC(C)Cl)C(=O)OCC(N)C(=O)O |
Cyclo-D-serine | NC1CONC1=O |
D-Serine | C(N)(CO)C(=O)O |
DL-Serine | C(N)(CO)C(=O)O |
DL-Serine, 2-methyl- | C(C)(N)(CO)C(=O)O |
DL-Serine, N-((phenylmethoxy)carbonyl)- | C(OC(=O)NC(CO)C(=O)O)c1ccccc1 |
DL-Serine, N-(dichloroacetyl)- | C(CO)(NC(=O)C(Cl)Cl)C(=O)O |
DL-Serine, N-acetyl- | C(CO)(NC(C)=O)C(=O)O |
DL-Serine, N-dichloroacetyl-, sodium salt | C(CO)(NC(=O)C(Cl)Cl)C(=O)O |
DL-Serine__N-((phenylmethoxy)carbonyl)- | C(OC(=O)NC(CO)C(=O)O)c1ccccc1 |
DL-Serine__N-dichloroacetyl-__sodium_salt | C(CO)(NC(=O)C(Cl)Cl)C(=O)O |
Diazoacetate(ester) L-serine | O(CC(N)C(=O)O)C(=O)C=N=N |
L-(-)-Serine | C(N)(CO)C(=O)O |
L-Diazoacetate(ester) serine | O(CC(N)C(=O)O)C(=O)C=N=N |
L-Serine | C(N)(CO)C(=O)O |
L-Serine, N-((1,1-dimethylethoxy)carbonyl)- | C(CO)(NC(=O)OC(C)(C)C)C(=O)O |
L-Serine, N-((1,1-dimethylethoxy)carbonyl)-O-(phenylmethyl)- | C(OCC(NC(=O)OC(C)(C)C)C(=O)O)c1ccccc1 |
L-Serine, N-((phenylmethoxy)carbonyl)- | C(OC(=O)NC(CO)C(=O)O)c1ccccc1 |
L-Serine, O-(triphenylmethyl)- | C(OCC(N)C(=O)O)(c1ccccc1)(c2ccccc2)c3ccccc3 |
L-Serine, diazoacetate (ester) | O(CC(N)C(=O)O)C(=O)C=N=N |
L-Serine, diazoacetate | O(CC(N)C(=O)O)C(=O)C=N=N |
L-Serine, methyl ester, hydrochloride | C(N)(CO)C(=O)OC |
L-Serine__N-((1_1-dimethylethoxy)carbonyl)- | C(CO)(NC(=O)OC(C)(C)C)C(=O)O |
L-Serine__N-((1_1-dimethylethoxy)carbonyl)-O-(phenylmethyl)- | C(OCC(NC(=O)OC(C)(C)C)C(=O)O)c1ccccc1 |
L-Serine__N-((phenylmethoxy)carbonyl)- | C(OC(=O)NC(CO)C(=O)O)c1ccccc1 |
L-Serine__O-(triphenylmethyl)- | C(OCC(N)C(=O)O)(c1ccccc1)(c2ccccc2)c3ccccc3 |
L-Serine__methyl_ester__hydrochloride | C(N)(CO)C(=O)OC |
N-((1,1-Dimethylethoxy)carbonyl)-O-(phenylmethyl)-L-serine | C(OCC(NC(=O)OC(C)(C)C)C(=O)O)c1ccccc1 |
N-(Dichloroacetyl)-DL-serine | C(CO)(NC(=O)C(Cl)Cl)C(=O)O |
N-Acetyl-DL-serine | C(CO)(NC(C)=O)C(=O)O |
N-Carbobenzoxy-DL-serine | C(OC(=O)NC(CO)C(=O)O)c1ccccc1 |
O-Diazoacetyl-L-serine | O(CC(N)C(=O)O)C(=O)C=N=N |
SERINE, (L) | C(N)(CO)C(=O)O |
Serine (VAN) | C(N)(CO)C(=O)O |
Serine carbamoyl mustard | N(CCCl)(CCCl)C(=O)OCC(N)C(=O)O |
Serine, 2-methyl-, DL- | C(C)(N)(CO)C(=O)O |
Serine, D- | C(N)(CO)C(=O)O |
Serine, DL- | C(N)(CO)C(=O)O |
Serine, L- | C(N)(CO)C(=O)O |
Serine, N-(dichloroacetyl)-, DL- | C(CO)(NC(=O)C(Cl)Cl)C(=O)O |
Serine, N-acetyl-, DL- | C(CO)(NC(C)=O)C(=O)O |
Serine, N-carboxy-, N-benzyl ester, DL- | C(OC(=O)NC(CO)C(=O)O)c1ccccc1 |
Serine, diazoacetate (ester), L- | O(CC(N)C(=O)O)C(=O)C=N=N |
Serine, diazoacetate(ester) | O(CC(N)C(=O)O)C(=O)C=N=N |
Serine__D- | C(N)(CO)C(=O)O |
Serine__DL- | C(N)(CO)C(=O)O |
Serine__N-(dichloroacetyl)-__DL- | C(CO)(NC(=O)C(Cl)Cl)C(=O)O |
Serine__N-acetyl-__DL- | C(CO)(NC(C)=O)C(=O)O |
o-Diazoacetyl-L-serine | O(CC(N)C(=O)O)C(=O)C=N=N |