If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Vancide 20S | S=C1Nc2ccccc2S1.NCCO |
Vancide 26 EC | S=C1Sc2ccc(Cl)cc2N1.CCCCCCCCCCCCn3ccccc3 |
Vancide 26 | S=C1Sc2ccc(Cl)cc2N1.CCCCCCCCCCCCn3ccccc3 |
Vancide 51 | S=C1Nc2ccccc2S1 |
Vancide 89 | S(N1C(=O)C2CC=CCC2C1=O)C(Cl)(Cl)Cl |
Vancide 89RE | S(N1C(=O)C2CC=CCC2C1=O)C(Cl)(Cl)Cl |
Vancide BL | S(c1cc(Cl)cc(Cl)c1O)c2cc(Cl)cc(Cl)c2O |
Vancide FP | C(=O)(Nc1cccc(c1)C(F)(F)F)c2cc(Br)cc(Br)c2O |
Vancide P | [Zn]123ON4C=CC=CC4=S1.O2N5C=CC=CC5=S3 |
Vancide PA | S(=O)(=O)(CCC)C=CS(=O)(=O)CCC |
Vancide PB | [N+](=O)([O-])c1cc([N+](=O)[O-])c(Cl)c(Cl)c1Cl |
Vancide TBS | C(=O)(Nc1ccc(Br)cc1)c2cc(Br)cc(Br)c2O |
Vancide TH | C(C)N1CN(CC)CN(CC)C1 |
Vancide ZP | [Zn]123ON4C=CC=CC4=S1.O2N5C=CC=CC5=S3 |
Vancide ks | [Sn](O)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Vancide mz-96 | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |