If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Methoxy-5-methylbenzenamine | O(C)c1ccc(C)cc1N |
2-Methylbenzenamine | Cc1ccccc1N |
3-Chloro-4-methylbenzenamine | Clc1cc(N)ccc1C |
3-Methylbenzenamine | Cc1cccc(N)c1 |
4, 4'-Methylenebis(2-methylbenzenamine) | C(c1ccc(N)c(C)c1)c2ccc(N)c(C)c2 |
4-Chloro-2-methylbenzenamine hydrochloride | Cc1cc(Cl)ccc1N |
4-Methoxy-2-methylbenzenamine | O(C)c1ccc(N)c(C)c1 |
4-Methoxy-N-methylbenzenamine | N(C)c1ccc(OC)cc1 |
4-Methylbenzenamine | Cc1ccc(N)cc1 |
N-Ethyl-3-methylbenzenamine | N(CC)c1cccc(C)c1 |
N-Methylbenzenamine | N(C)c1ccccc1 |
m-Methylbenzenamine | Cc1cccc(N)c1 |
o-Methylbenzenamine | Cc1ccccc1N |
p-Methylbenzenamine | Cc1ccc(N)cc1 |