If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Propanol, 3-(triphenylplumbyl)- | [Pb](CCCO)(c1ccccc1)(c2ccccc2)c3ccccc3 |
1-Propanol__3-(triphenylplumbyl)- | [Pb](CCCO)(c1ccccc1)(c2ccccc2)c3ccccc3 |
1H-Indole, 1-(triphenylplumbyl)- | [Pb](c1ccccc1)(c2ccccc2)(c3ccccc3)N4C=Cc5ccccc45 |
1H-Indole__1-(triphenylplumbyl)- | [Pb](c1ccccc1)(c2ccccc2)(c3ccccc3)N4C=Cc5ccccc45 |
1H-Pyrrole, 1-(triphenylplumbyl)- | [Pb](N1C=CC=C1)(c2ccccc2)(c3ccccc3)c4ccccc4 |
1H-Pyrrole__1-(triphenylplumbyl)- | [Pb](N1C=CC=C1)(c2ccccc2)(c3ccccc3)c4ccccc4 |
9H-Carbazole, 9-(triphenylplumbyl)- | [Pb](c1ccccc1)(c2ccccc2)(c3ccccc3)N4c5ccccc5c6ccccc46 |
9H-Carbazole__9-(triphenylplumbyl)- | [Pb](c1ccccc1)(c2ccccc2)(c3ccccc3)N4c5ccccc5c6ccccc46 |