If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Phenylquinoline methiodide | Cn1c2ccccc2ccc1c3ccccc3 |
2-Phenylquinoline | c1(ccc2ccccc2n1)c3ccccc3 |
2-Phenylquinoline-4-carboxylic acid | C(=O)(O)c1cc(nc2ccccc12)c3ccccc3 |
4-Methyl-2-phenylquinoline | Cc1cc(nc2ccccc12)c3ccccc3 |
6-Methyl-2-phenylquinoline-4-carboxylic acid, ethyl ester | C(=O)(OCC)c1cc(nc2ccc(C)cc12)c3ccccc3 |
ALPHA_-Phenylquinoline | c1(ccc2ccccc2n1)c3ccccc3 |