If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Nitrodiphenyl ether | O(c1ccccc1)c2ccccc2[N+](=O)[O-] |
2-Nitrodiphenyl sulfide | S(c1ccccc1)c2ccccc2[N+](=O)[O-] |
2-Nitrodiphenyl | [N+](=O)([O-])c1ccccc1c2ccccc2 |
3-Chloro-4'-nitrodiphenyl ether | O(c1ccc(cc1)[N+](=O)[O-])c2cccc(Cl)c2 |
3-Nitrodiphenyl ether | O(c1ccccc1)c2cccc(c2)[N+](=O)[O-] |
4'-Nitrodiphenyl-4-carboxylic acid | C(=O)(O)c1ccc(cc1)c2ccc(cc2)[N+](=O)[O-] |
4, 4'-Dichloro-2-nitrodiphenyl ether | O(c1ccc(Cl)cc1)c2ccc(Cl)cc2[N+](=O)[O-] |
4-Amino-4'-nitrodiphenyl sulfide | S(c1ccc(N)cc1)c2ccc(cc2)[N+](=O)[O-] |
4-Nitrodiphenyl ether | O(c1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
4-Nitrodiphenyl sulfide | S(c1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
4-Nitrodiphenyl | [N+](=O)([O-])c1ccc(cc1)c2ccccc2 |
m-Nitrodiphenyl ether | O(c1ccccc1)c2cccc(c2)[N+](=O)[O-] |
o-Nitrodiphenyl | [N+](=O)([O-])c1ccccc1c2ccccc2 |
p-Nitrodiphenyl ether | O(c1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
p-Nitrodiphenyl sulfide | S(c1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
p-Nitrodiphenyl | [N+](=O)([O-])c1ccc(cc1)c2ccccc2 |