Alphabetical Indicies

If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.

If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.

Select from

2,4-Diamino-5-methylbenzenesulfonic acid S(=O)(=O)(O)c1cc(C)c(N)cc1N
2-Amino-5-methylbenzenesulfonic acid S(=O)(=O)(O)c1cc(C)ccc1N
3, 5-Diamino-4-methylbenzenesulfonic acid S(=O)(=O)(O)c1cc(N)c(C)c(N)c1
3-Amino-4-methylbenzenesulfonic acid S(=O)(=O)(O)c1ccc(C)c(N)c1
3-Amino-6-methylbenzenesulfonic acid S(=O)(=O)(O)c1cc(N)ccc1C
4-Amino-3-methylbenzenesulfonic acid S(=O)(=O)(O)c1ccc(N)c(C)c1
4-Methylbenzenesulfonic acid hydrazide S(=O)(=O)(NN)c1ccc(C)cc1
4-Methylbenzenesulfonic acid S(=O)(=O)(O)c1ccc(C)cc1
5-Amino-2-methylbenzenesulfonic acid S(=O)(=O)(O)c1cc(N)ccc1C
Methylbenzenesulfonic acid S(=O)(=O)(O)c1ccc(C)cc1
p-Methylbenzenesulfonic acid hydrazide S(=O)(=O)(NN)c1ccc(C)cc1
p-Methylbenzenesulfonic acid S(=O)(=O)(O)c1ccc(C)cc1


The Random Factory - 2001