If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Cyclopropane, (1,2-dimethylpropyl)- | C(C)(C(C)C)C1CC1 |
Cyclopropane, (1-ethylvinyl)- | C(=C)(CC)C1CC1 |
Cyclopropane, (1-methyl-1-butenyl)- | C(C)(=CCC)C1CC1 |
Cyclopropane, (1-methylenepropyl)- | C(=C)(CC)C1CC1 |
Cyclopropane, (1-methylethenyl)- | C(C)(=C)C1CC1 |
Cyclopropane, (1-methylethyl)- | C(C)(C)C1CC1 |
Cyclopropane, (1-methylpropenyl)- | C(C)(=CC)C1CC1 |
Cyclopropane, 1, 1-dichloro-2-vinyl- | C(=C)C1CC1(Cl)Cl |
Cyclopropane, 1, 2-diphenyl-, trans- | C1(CC1c2ccccc2)c3ccccc3 |
Cyclopropane, 1,1,2-trimethyl- | CC1(C)CC1C |
Cyclopropane, 1,1-dibromo-2,2-dimethyl- | BrC1(Br)CC1(C)C |
Cyclopropane, 1,1-dibromo-2,2-diphenyl- | BrC1(Br)CC1(c2ccccc2)c3ccccc3 |
Cyclopropane, 1,1-dichloro-2-ethenyl- | C(=C)C1CC1(Cl)Cl |
Cyclopropane, 1,2-dimethyl-, cis- | CC1CC1C |
Cyclopropane, 1,2-diphenyl-, cis- | C1(CC1c2ccccc2)c3ccccc3 |
Cyclopropane, bromo- | BrC1CC1 |
Cyclopropane, butyl- | C(CCC)C1CC1 |
Cyclopropane, cyclopropyl- | C1(CC1)C2CC2 |
Cyclopropane, ethyl- | C(C)C1CC1 |
Cyclopropane, hexachloro- | ClC1(Cl)C(Cl)(Cl)C1(Cl)Cl |
Cyclopropane, isopropyl- | C(C)(C)C1CC1 |
Cyclopropane, pentachloro- | ClC1(Cl)C(Cl)C1(Cl)Cl |
Cyclopropane, phenyl- | C1(CC1)c2ccccc2 |
Cyclopropane, sec-butyl- | C(C)(CC)C1CC1 |
Cyclopropane__(1-methyl-1-butenyl)- | C(C)(=CCC)C1CC1 |
Cyclopropane__(1-methylenepropyl)- | C(=C)(CC)C1CC1 |
Cyclopropane__(1-methylethenyl)- | C(C)(=C)C1CC1 |
Cyclopropane__(1-methylethyl)- | C(C)(C)C1CC1 |
Cyclopropane__(1-methylpropenyl)- | C(C)(=CC)C1CC1 |
Cyclopropane__(1_2-dimethylpropyl)- | C(C)(C(C)C)C1CC1 |
Cyclopropane__1_1-dibromo-2_2-dimethyl- | BrC1(Br)CC1(C)C |
Cyclopropane__1_1-dichloro-2-ethenyl- | C(=C)C1CC1(Cl)Cl |
Cyclopropane__1_1_2-trimethyl- | CC1(C)CC1C |
Cyclopropane__1_2-dimethyl-__cis- | CC1CC1C |
Cyclopropane__bromo- | BrC1CC1 |
Cyclopropane__cyclopropyl- | C1(CC1)C2CC2 |
Cyclopropane__ethyl- | C(C)C1CC1 |
Cyclopropane__hexachloro- | ClC1(Cl)C(Cl)(Cl)C1(Cl)Cl |
Cyclopropane__pentachloro- | ClC1(Cl)C(Cl)C1(Cl)Cl |
Cyclopropane__sec-butyl- | C(C)(CC)C1CC1 |