If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Ethynylcyclohexyl carbanilate | O(C(=O)Nc1ccccc1)C2(C#C)CCCCC2 |
2-Propyn-1-ol, carbanilate | N(C(=O)OCC#C)c1ccccc1 |
Benzyl alcohol, p, ALPHA_-dimethyl-, carbanilate | C(C)(OC(=O)Nc1ccccc1)c2ccc(C)cc2 |
Butyl carbanilate | N(C(=O)OCCCC)c1ccccc1 |
Ethanol, 2-chloro-, carbanilate | N(C(=O)OCCCl)c1ccccc1 |
Ethyl carbanilate | N(C(=O)OCC)c1ccccc1 |
Isopropyl carbanilate | N(C(=O)OC(C)C)c1ccccc1 |
Methyl carbanilate | N(C(=O)OC)c1ccccc1 |
N-Methylscopolammonium bromide, carbanilate | CN1(C)C2CC(OC(=O)C(COC(=O)Nc3ccccc3)c4ccccc4)CC1C5OC25 |
Phenol, 3,4, 6-trichloro-2-nitro-, carbanilate ester | O(C(=O)Nc1ccccc1)c2c(Cl)cc(Cl)c(Cl)c2[N+](=O)[O-] |
Phenol, p-cyclohexyl-, carbanilate | O(C(=O)Nc1ccccc1)c2ccc(cc2)C3CCCCC3 |
Phenyl N-(2-diethylaminoethyl)carbanilate hydrochloride | N(CCN(CC)CC)(C(=O)Oc1ccccc1)c2ccccc2 |
Phenyl carbanilate | N(C(=O)Oc1ccccc1)c2ccccc2 |
Propyl carbanilate | N(C(=O)OCCC)c1ccccc1 |
Scopolammonium, N-methyl-, bromide, carbanilate | CN1(C)C2CC(OC(=O)C(COC(=O)Nc3ccccc3)c4ccccc4)CC1C5OC25 |
Spiro(2.4)heptan-4-ol, carbanilate | O(C(=O)Nc1ccccc1)C2CCCC23CC3 |