If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Chlor-4-nitrobenzol(GERMAN) | [N+](=O)([O-])c1ccc(Cl)cc1 |
2,3,5, 6-Tetrachlor-3-nitrobenzol(GERMAN) | [N+](=O)([O-])c1c(Cl)c(Cl)cc(Cl)c1Cl |
2_3_5__6-Tetrachlor-3-nitrobenzol(GERMAN) | [N+](=O)([O-])c1c(Cl)c(Cl)cc(Cl)c1Cl |
Nitrobenzol | [N+](=O)([O-])c1ccccc1 |
Nitrobenzol, liquid(DOT) | [N+](=O)([O-])c1ccccc1 |
Nitrobenzol__liquid(DOT) | [N+](=O)([O-])c1ccccc1 |