If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Chromaven Brilliant Blue B | C(c1cc(C)c(O)c(c1)C(=O)O)(=C2C=C(C)C(=O)C(=C2)C(=O)O)c3c(Cl)cccc3Cl |
Chromaven Brilliant Blue BN | C(c1cc(C)c(O)c(c1)C(=O)O)(=C2C=C(C)C(=O)C(=C2)C(=O)O)c3c(Cl)cccc3Cl |
Chromaven Brilliant Blue BNG | C(c1cc(C)c(O)c(c1)C(=O)O)(=C2C=C(C)C(=O)C(=C2)C(=O)O)c3c(Cl)cccc3Cl |
Chromaven Brown EB | N(=Nc1cc(N=Nc2cc(ccc2O)[N+](=O)[O-])c(N)cc1N)c3cccc4c3cccc4S(=O)(=O)O |
Chromaven Brown RH | N(=Nc1cc(ccc1O)[N+](=O)[O-])c2cc(c(N)cc2N)S(=O)(=O)O |
Chromaven Fast Red B | N(=NC1C(C)=NN(C1=O)c2ccccc2)c3c(O)cc(c4ccccc34)S(=O)(=O)O |
Chromaven Milling Orange G | N(=Nc1ccc(cc1)N=Nc2ccc(cc2)S(=O)(=O)O)c3ccc(O)c(c3)C(=O)O |
Chromaven Violet B | N(=Nc1cc(ccc1O)S(=O)(=O)O)c2c(O)ccc3ccccc23 |
Chromaven Yellow LSW | S(=O)(=O)(O)c1ccc2cc(N=Nc3ccc(O)c(c3)C(=O)O)ccc2c1 |