If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Picolinaldehyde | C(=O)c1ccccn1 |
6-Methyl-2-picolinaldehyde | C(=O)c1cccc(C)n1 |
Picolinaldehyde | C(=O)c1ccccn1 |
Picolinaldehyde, 2-pyridylhydrazone | C(=NNc1ccccn1)c2ccccn2 |
Picolinaldehyde, 2-quinolylhydrazone | N(N=Cc1ccccn1)c2ccc3ccccc3n2 |
Picolinaldehyde, 3-hydroxy-, thiosemicarbazone | C(=NNC(N)=S)c1ncccc1O |
Picolinaldehyde, 5-(dimethylamino)-, thiosemicarbazone | C(=NNC(N)=S)c1ccc(cn1)N(C)C |
Picolinaldehyde, 5-hydroxy-, thiosemicarbazone | C(=NNC(N)=S)c1ccc(O)cn1 |
Picolinaldehyde, 5-hydroxy-, thiosemicarbazone, acetate (ester) | O(C(C)=O)c1ccc(nc1)C=NNC(N)=S |
Picolinaldehyde, 6-methyl- | C(=O)c1cccc(C)n1 |
Picolinaldehyde, azine | C(=NN=Cc1ccccn1)c2ccccn2 |
Picolinaldehyde, cyclic ethylene acetal | C1(OCCO1)c2ccccn2 |
Picolinaldehyde, oxime | C(=NO)c1ccccn1 |
Picolinaldehyde, thiosemicarbazone | C(=NNC(N)=S)c1ccccn1 |
Picolinaldehyde__5-(dimethylamino)-__thiosemicarbazone | C(=NNC(N)=S)c1ccc(cn1)N(C)C |