If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Octanesulfonic acid, heptadecafluoro-, potassium salt | C(F)(F)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O |
1-Octanesulfonic acid, sodium salt | C(CCCCCCC)S(=O)(=O)O |
1-Octanesulfonic acid, thio-, S-hexadecyl ester | S(CCCCCCCCCCCCCCCC)S(=O)(=O)CCCCCCCC |
1-Octanesulfonic acid, thio-, S-methyl ester | C(CCCCCC)CS(=O)(=O)SC |
1-Octanesulfonic_acid__sodium_salt | C(CCCCCCC)S(=O)(=O)O |
1-Octanesulfonic_acid__thio-__S-hexadecyl_ester | S(CCCCCCCCCCCCCCCC)S(=O)(=O)CCCCCCCC |
1-Octanesulfonic_acid__thio-__S-methyl_ester | C(CCCCCC)CS(=O)(=O)SC |
Octanesulfonic acid, thio-, S-hexadecyl ester | S(CCCCCCCCCCCCCCCC)S(=O)(=O)CCCCCCCC |
Octanesulfonic acid, thio-, S-methyl ester | C(CCCCCC)CS(=O)(=O)SC |
Octanesulfonic acid, thio-, S-octyl ester | S(CCCCCCCC)S(=O)(=O)CCCCCCCC |
Octanesulfonic_acid__thio-__S-octyl_ester | S(CCCCCCCC)S(=O)(=O)CCCCCCCC |