If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(2-Aminoethyl)ethylenimine | C(CN)N1CC1 |
1-(2-Cyanoethyl)ethylenimine | C(CC#N)N1CC1 |
1-(2-Hydroxyethyl)ethylenimine | C(CO)N1CC1 |
1-(2-Methoxycarbonylethyl)ethylenimine | C(CC(=O)OC)N1CC1 |
2,3,5-Ethylenimine-1, 4-benzoquinone | O=C1C(=CC(=O)C(N2CC2)=C1N3CC3)N4CC4 |
Ethoxycarbonyl-1-ethylenimine | C(=O)(OCC)N1CC1 |
Ethylenimine polymer | C1CN1 |
Ethylenimine quinone | O=C1C=C(C(=O)C=C1N2CC2)N3CC3 |
Ethylenimine resins | C1CN1 |
Ethylenimine, homopolymer | C1CN1 |
Ethylenimine, polymers | C1CN1 |
N-(2-Hydroxyethyl)ethylenimine | C(CO)N1CC1 |
N-(BETA_-Aminoethyl)ethylenimine | C(CN)N1CC1 |
N-(BETA_-Cyanoethyl)ethylenimine | C(CC#N)N1CC1 |
Poly(ethylenimine) | C1CN1 |
Terephthaloylbis(1-ethylenimine) | C(=O)(N1CC1)c2ccc(cc2)C(=O)N3CC3 |