If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Amino-4-methoxytoluene | O(C)c1ccc(C)c(N)c1 |
2-Methoxytoluene | O(C)c1ccccc1C |
3-Acetylamino-4-methoxytoluene | N(C(C)=O)c1cc(C)ccc1OC |
3-Amino-4-methoxytoluene | O(C)c1ccc(C)cc1N |
3-Methoxytoluene | O(C)c1cccc(C)c1 |
4,6-Dinitro-3-methoxytoluene | [N+](=O)([O-])c1cc([N+](=O)[O-])c(C)cc1OC |
4-Chloro-3-methoxytoluene | O(C)c1cc(C)ccc1Cl |
4-Hydroxy-3-methoxytoluene | O(C)c1cc(C)ccc1O |
4-Isopropyl-3-methoxytoluene | O(C)c1cc(C)ccc1C(C)C |
4-Methoxytoluene | O(C)c1ccc(C)cc1 |
ALPHA_-Chloro-4-methoxytoluene | C(Cl)c1ccc(OC)cc1 |
ALPHA_-Methoxytoluene | C(OC)c1ccccc1 |
m-Methoxytoluene | O(C)c1cccc(C)c1 |
o-Methoxytoluene | O(C)c1ccccc1C |
p-Methoxytoluene | O(C)c1ccc(C)cc1 |