If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,1-Dicyano-2,2-diphenylethylene | C(=C(C#N)C#N)(c1ccccc1)c2ccccc2 |
1,1-Dicyano-2-phenylpropene | C(C)(=C(C#N)C#N)c1ccccc1 |
1,4-Dicyano-2-butene | C(CC#N)=CCC#N |
2,2-Dicyano-1-phenylethylene | C(=C(C#N)C#N)c1ccccc1 |
2,3-Dicyano-1, 4-dithiaanthraquinone | O=C1c2ccccc2C(=O)C3=C1SC(C#N)=C(C#N)S3 |
2,3-Dicyano-5,6-dichlorobenzoquinone | C(#N)C1=C(C#N)C(=O)C(Cl)=C(Cl)C1=O |
2,3-Dicyano-p-hydroquinone | C(#N)c1c(O)ccc(O)c1C#N |
ALPHA_,GAMMA_-dicyano-BETA_-methyl glutaramide | C(C#N)(C(N)=O)C(C)C(C#N)C(N)=O |
ALPHA__GAMMA_-dicyano-BETA_-methyl_glutaramide | C(C#N)(C(N)=O)C(C)C(C#N)C(N)=O |
Aurate(1-), dicyano-, potassium | [Au](C#N)C#N |
BETA_,BETA_-Dicyano-o-chlorostyrene | C(=C(C#N)C#N)c1ccccc1Cl |
Diethylamine, 2,2'-dicyano- | N(CCC#N)CCC#N |
Ethane, 1,2-dicyano- | C(C#N)CC#N |
Glutaramide, 2, 4-dicyano-3-methyl- | C(C#N)(C(N)=O)C(C)C(C#N)C(N)=O |
Heptanedioic acid, 4,4-dicyano-, di-2-propenyl ester | C(C#N)(C#N)(CCC(=O)OCC=C)CCC(=O)OCC=C |
Heptanedioic acid, 4,4-dicyano-, diallyl ester | C(C#N)(C#N)(CCC(=O)OCC=C)CCC(=O)OCC=C |
Heptanedioic_acid__4_4-dicyano-__di-2-propenyl_ester | C(C#N)(C#N)(CCC(=O)OCC=C)CCC(=O)OCC=C |
Methane, dicyano- | C(C#N)C#N |
Pentanediamide, 2,4-dicyano-3-methyl- | C(C#N)(C(N)=O)C(C)C(C#N)C(N)=O |