If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(-)-Armepavine | C(c1ccc(O)cc1)C2N(C)CCc3cc(OC)c(OC)cc23 |
(R)-(-)-Armepavine | C(c1ccc(O)cc1)C2N(C)CCc3cc(OC)c(OC)cc23 |
Armepavine | C(c1ccc(O)cc1)C2N(C)CCc3cc(OC)c(OC)cc23 |
DL-Armepavine, O-methyl- | C(c1ccc(OC)cc1)C2N(C)CCc3cc(OC)c(OC)cc23 |
DL-Armepavine__O-methyl- | C(c1ccc(OC)cc1)C2N(C)CCc3cc(OC)c(OC)cc23 |
R-(-)-Armepavine | C(c1ccc(O)cc1)C2N(C)CCc3cc(OC)c(OC)cc23 |