If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Azogen Developer A | Oc1ccc2ccccc2c1 |
C.I. Developer 1 | O=C1CC(C)=NN1c2ccccc2 |
C.I. Developer 11 | Nc1cccc(N)c1 |
C.I. Developer 13 | Nc1ccc(N)cc1 |
C.I. Developer 15 | N(c1ccccc1)c2ccc(N)cc2 |
C.I. Developer 17 | [N+](=O)([O-])c1ccc(N)cc1 |
C.I. Developer 20 | C(=O)(O)c1cc2ccccc2cc1O |
C.I. Developer 21 | C(=O)(Nc1ccccc1C)c2cc3ccccc3cc2O |
C.I. Developer 22 | C(=O)(Nc1ccccc1OC)c2cc3ccccc3cc2O |
C.I. Developer 23 | C(=O)(Nc1ccc2ccccc2c1)c3cc4ccccc4cc3O |
C.I. Developer 3 | Oc1cc(cc2ccc(N)cc12)S(=O)(=O)O |
C.I. Developer 4 | Oc1cccc(O)c1 |
C.I. Developer 5 | Oc1ccc2ccccc2c1 |
Developer 11 | Nc1cccc(N)c1 |
Developer 13 | Nc1ccc(N)cc1 |
Developer A | Oc1ccc2ccccc2c1 |
Developer AMS | Oc1ccc2ccccc2c1 |
Developer BN | Oc1ccc2ccccc2c1 |
Developer BON | C(=O)(O)c1cc2ccccc2cc1O |
Developer C | Nc1cccc(N)c1 |
Developer H | Nc1cccc(N)c1 |
Developer M | Nc1cccc(N)c1 |
Developer O | Oc1cccc(O)c1 |
Developer P | [N+](=O)([O-])c1ccc(N)cc1 |
Developer PF | Nc1ccc(N)cc1 |
Developer R | Oc1cccc(O)c1 |
Developer RS | Oc1cccc(O)c1 |
Developer Z | O=C1CC(C)=NN1c2ccccc2 |
Developer sodium | Oc1ccc2ccccc2c1 |
Dianix Developer ND | C(=O)(Nc1ccccc1C)c2cc3ccccc3cc2O |
Durafur Developer CFouramine PCH | Oc1ccccc1O |
Durafur Developer D | Oc1cccc2ccccc12 |
Durafur Developer E | Oc1cccc2c(O)cccc12 |
Durafur Developer G | Oc1cccc(O)c1 |
Durafur_Developer_CFouramine_PCH | Oc1ccccc1O |
Elon (developer) | N(C)c1ccc(O)cc1.O=S(=O)(O)O |
Lake Developer A | C(=O)(Nc1ccccc1)c2cc3ccccc3cc2O |
Miketazol Developer NDF | C(=O)(Nc1ccccc1C)c2cc3ccccc3cc2O |
Miketazol Developer NLF | C(=O)(Nc1ccccc1OC)c2cc3ccccc3cc2O |
Miketazol Developer ONS | C(=O)(O)c1cc2ccccc2cc1O |
Miketazol Developer hydrofluoride | C(=O)(Nc1ccc2ccccc2c1)c3cc4ccccc4cc3O |