If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Eban 710 | C1CO1.CC2CO2 |
EBDC, disodium salt | C(CNC(=S)S)NC(=S)S |
ebelactone | A sub-index is available for ebelactone... |
Eberpine | C(=O)(OC)C1C(OC)C(OC(=O)c2cc(OC)c(OC)c(OC)c2)CC3CN4CCC5=C(Nc6cc(OC)ccc56)C4CC13 |
Eberspine | C(=O)(OC)C1C(OC)C(OC(=O)c2cc(OC)c(OC)c(OC)c2)CC3CN4CCC5=C(Nc6cc(OC)ccc56)C4CC13 |
Ebert-Merz BETA_-acid | S(=O)(=O)(O)c1ccc2cc(ccc2c1)S(=O)(=O)O |
Ebidene | C(=O)(NN)c1ccncc1 |
Ebifuramin | Oc1c(cnc2OC(C=NN3CC(OC3=O)CN4CCOCC4)=Cc12)C(=O)OCC |
Chromate Brown EBNL | N(=Nc1cc(N=Nc2cc(ccc2O)[N+](=O)[O-])c(N)cc1N)c3cccc4c3cccc4S(=O)(=O)O |
Ebrantil | O(C)c1ccccc1N2CCN(CCCNC3=CC(=O)N(C)C(=O)N3C)CC2 |
Ebufac | C(C)(C(=O)O)c1ccc(cc1)CC(C)C |
EBURICOIC ACID | CC12CCC(C(CCC(=C)C(C)C)C(=O)O)C2(C)CCC3=C1CCC4C(C)(C)C(O)CCC34C |
Eburicoic_acid | CC12CCC(C(CCC(=C)C(C)C)C(=O)O)C2(C)CCC3=C1CCC4C(C)(C)C(O)CCC34C |