If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Propiolic acid | C(=O)(O)C#C |
Propiolic acid, (m-chlorophenyl)- | C(#CC(=O)O)c1cccc(Cl)c1 |
Propiolic acid, (o-chlorophenyl)- | C(#CC(=O)O)c1ccccc1Cl |
Propiolic acid, (o-nitrophenyl)- | C(#CC(=O)O)c1ccccc1[N+](=O)[O-] |
Propiolic acid, (p-chlorophenyl)- | C(#CC(=O)O)c1ccc(Cl)cc1 |
Propiolic acid, (p-nitrophenyl)-, methyl ester | C(#CC(=O)OC)c1ccc(cc1)[N+](=O)[O-] |
Propiolic acid, 3-phenyl- | C(#CC(=O)O)c1ccccc1 |
Propiolic acid, allyl ester | C(=O)(C#C)OCC=C |
Propiolic acid, bromo-, methyl ester | C(=O)(OC)C#CBr |
Propiolic acid, ethyl ester | C(=O)(C#C)OCC |
Propiolic acid, methyl ester | C(=O)(C#C)OC |
Propiolic acid, pentyl ester | C(CCCCC)#CC(=O)O |
Propiolic acid, pentyl- | C(CCCCC)#CC(=O)O |
Propiolic acid, phenyl- | C(#CC(=O)O)c1ccccc1 |
Propiolic acid, phenyl-, ethyl ester | C(#CC(=O)OCC)c1ccccc1 |
Propiolic acid, triphenylstannyl ester | [Sn](OC(=O)C#C)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Propiolic_acid__(p-nitrophenyl)-__methyl_ester | C(#CC(=O)OC)c1ccc(cc1)[N+](=O)[O-] |
Propiolic_acid__pentyl_ester | C(CCCCC)#CC(=O)O |