If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Phenylethyl ALPHA_-toluate | C(C(=O)OCCc1ccccc1)c2ccccc2 |
Benzylcarbinyl ALPHA_-toluate | C(C(=O)OCCc1ccccc1)c2ccccc2 |
Butyl p-toluate | C(=O)(OCCCC)c1ccc(C)cc1 |
Ethyl ALPHA_-toluate | C(C(=O)OCC)c1ccccc1 |
Ethyl o-toluate | C(=O)(OCC)c1ccccc1C |
Ethyl p-toluate | C(=O)(OCC)c1ccc(C)cc1 |
Geranyl ALPHA_-toluate | C(C(=O)OCC=C(C)CCC=C(C)C)c1ccccc1 |
Isobutyl ALPHA_-toluate | C(C(=O)OCC(C)C)c1ccccc1 |
Methyl 3-toluate | C(=O)(OC)c1cccc(C)c1 |
Methyl 4-toluate | C(=O)(OC)c1ccc(C)cc1 |
Methyl ALPHA_-toluate | C(C(=O)OC)c1ccccc1 |
Methyl m-toluate | C(=O)(OC)c1cccc(C)c1 |
Methyl o-toluate | C(=O)(OC)c1ccccc1C |
Methyl p-toluate | C(=O)(OC)c1ccc(C)cc1 |
Phenethyl ALPHA_-toluate | C(C(=O)OCCc1ccccc1)c2ccccc2 |
m-Cresyl ALPHA_-toluate | O(C(=O)Cc1ccccc1)c2cccc(C)c2 |
p-Cresyl ALPHA_-toluate | O(C(=O)Cc1ccccc1)c2ccc(C)cc2 |
p-Tolyl ALPHA_-toluate | O(C(=O)Cc1ccccc1)c2ccc(C)cc2 |