If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Amino-N,N-dimethylbenzenesulfonamide | S(=O)(=O)(N(C)C)c1ccc(N)cc1 |
4-Chloro-3-nitro-N,N-dimethylbenzenesulfonamide | S(=O)(=O)(N(C)C)c1ccc(Cl)c(c1)[N+](=O)[O-] |
N, 4-Dimethylbenzenesulfonamide | S(=O)(=O)(NC)c1ccc(C)cc1 |
N,N-Dimethylbenzenesulfonamide | S(=O)(=O)(N(C)C)c1ccccc1 |
p-Amino-N, N-dimethylbenzenesulfonamide | S(=O)(=O)(N(C)C)c1ccc(N)cc1 |
p-Bromo-N,N-dimethylbenzenesulfonamide | S(=O)(=O)(N(C)C)c1ccc(Br)cc1 |