If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Bromo-4-phenoxybenzene | O(c1ccccc1)c2ccc(Br)cc2 |
1-Chloro-4-phenoxybenzene | O(c1ccccc1)c2ccc(Cl)cc2 |
1-Methoxy-3-phenoxybenzene | O(c1ccccc1)c2cccc(OC)c2 |
1-Nitro-2-phenoxybenzene | O(c1ccccc1)c2ccccc2[N+](=O)[O-] |
1-Nitro-4-phenoxybenzene | O(c1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
2, 4-Dinitro-1-phenoxybenzene | O(c1ccccc1)c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
4-Amino-1-phenoxybenzene | O(c1ccccc1)c2ccc(N)cc2 |
Phenoxybenzene | O(c1ccccc1)c2ccccc2 |
Phenoxybenzene-4, 4'-disulfonyl chloride | S(Cl)(=O)(=O)c1ccc(cc1)Oc2ccc(cc2)S(Cl)(=O)=O |
Phenoxybenzene-4__4'-disulfonyl_chloride | S(Cl)(=O)(=O)c1ccc(cc1)Oc2ccc(cc2)S(Cl)(=O)=O |