If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Cytidine 5'-diphosphoric choline | OC1C(O)C(COP(=O)(O)OP(=O)(O)OCCN(C)(C)C)OC1N2C=CC(=N)NC2=O |
Diethylstilbestrol 4,4'-diphosphoric ester, disodium salt | C(CC)(c1ccc(cc1)OP(=O)(O)O)=C(CC)c2ccc(cc2)OP(=O)(O)O |
Diethylstilbestrol diphosphoric acid ester disodium salt | C(CC)(c1ccc(cc1)OP(=O)(O)O)=C(CC)c2ccc(cc2)OP(=O)(O)O |
Diphosphoric acid, P,P'-dimethyl ester | O(P(=O)(O)OC)P(=O)(O)OC |
Diphosphoric acid, dimethyl ester | O(P(=O)(O)OC)P(=O)(O)OC |
Diphosphoric acid, tetraethyl ester | O(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
Diphosphoric acid, tetrakis((4-nitrophenyl)methyl) ester | O(P(=O)(OCc1ccc(cc1)[N+](=O)[O-])OCc2ccc(cc2)[N+](=O)[O-])P(=O)(OCc3ccc(cc3)[N+](=O)[O-])OCc4ccc(cc4)[N+](=O)[O-] |
Diphosphoric acid, tetrasodium salt | O(P(=O)(O)O)P(=O)(O)O |
Diphosphoric_acid__P_P'-dimethyl_ester | O(P(=O)(O)OC)P(=O)(O)OC |
Diphosphoric_acid__tetrakis((4-nitrophenyl)methyl)_ester | O(P(=O)(OCc1ccc(cc1)[N+](=O)[O-])OCc2ccc(cc2)[N+](=O)[O-])P(=O)(OCc3ccc(cc3)[N+](=O)[O-])OCc4ccc(cc4)[N+](=O)[O-] |