If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Aminoacetanilide | N(C(=O)CN)c1ccccc1 |
3'-Aminoacetanilide | N(C(C)=O)c1cccc(N)c1 |
3-Aminoacetanilide-4-sulfonic acid | S(=O)(=O)(O)c1ccc(NC(C)=O)cc1N |
4'-Aminoacetanilide | N(C(C)=O)c1ccc(N)cc1 |
4-Aminoacetanilide | N(C(C)=O)c1ccc(N)cc1 |
4-Aminoacetanilide-3-sulfonic acid | S(=O)(=O)(O)c1cc(ccc1N)NC(C)=O |
m-Aminoacetanilide | N(C(C)=O)c1cccc(N)c1 |
p-Aminoacetanilide | N(C(C)=O)c1ccc(N)cc1 |