If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Acid Yellow Geigy | N(=Nc1ccc(cc1)S(=O)(=O)O)c2ccc(N)c(c2)S(=O)(=O)O |
Ciba Geigy MY 750 | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
Fruit Red A Extra Yellowish Geigy | S(=O)(=O)(O)c1ccc(N=Nc2cc(c3ccccc3c2O)S(=O)(=O)O)c4ccccc14 |
Fruit Red A Geigy | N(=Nc1ccc(c2ccccc12)S(=O)(=O)O)c3c(O)c(cc4cc(ccc34)S(=O)(=O)O)S(=O)(=O)O |
Geigy 24480 | O(c1cc(C)nc(n1)C(C)C)P(=S)(OCC)OCC |
Geigy 27, 692 | N(CC)c1nc(Cl)nc(NCC)n1 |
Geigy 30,027 | N(C(C)C)c1nc(Cl)nc(NCC)n1 |
Geigy 30,028 | N(C(C)C)c1nc(Cl)nc(n1)NC(C)C |
Geigy 30,044 | N(CC)c1nc(OC)nc(NCC)n1 |
Geigy 32,293 | N(C(C)C)c1nc(OC)nc(NCC)n1 |
Geigy 32883 | C(N)(=O)N1c2ccccc2C=Cc3ccccc13 |
Geigy 337 | C(O)(COCC)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
Geigy 338 | C(O)(C(=O)OCC)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
Geigy 444E | N(CC)(CC)c1nc(Cl)nc(n1)N(CC)CC |
Geigy Blue 536, Med | Nc1c2c(O)c(N=Nc3ccc(cc3C)c4ccc(N=Nc5ccc6c(c5O)c(N)c(cc6S(=O)(=O)O)S(=O)(=O)O)c(C)c4)ccc2c(cc1S(=O)(=O)O)S(=O)(=O)O |
Geigy G-22008 | O(C(=O)N(C)C)C1=CC(C)=NN1c2ccccc2 |
Geigy Herbicide 444E | N(CC)(CC)c1nc(Cl)nc(n1)N(CC)CC |
Geigy g-29288 | S(CSP(=S)(OC)OC)c1ccc(Cl)cc1 |
Geigy | N(CC)(CC)c1nc(Cl)nc(n1)NC(C)C |
Geigy-444e | ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O |
Geigy-blau 536 | Nc1c2c(O)c(N=Nc3ccc(cc3C)c4ccc(N=Nc5ccc6c(c5O)c(N)c(cc6S(=O)(=O)O)S(=O)(=O)O)c(C)c4)ccc2c(cc1S(=O)(=O)O)S(=O)(=O)O |
Grape Blue A Geigy | O=C1c2cc(ccc2NC1=C3Nc4ccc(cc4C3=O)S(=O)(=O)O)S(=O)(=O)O |
Lemon Yellow A Geigy | O=C1C(N=Nc2ccc(cc2)S(=O)(=O)O)C(=NN1c3ccc(cc3)S(=O)(=O)O)C(=O)O |
Oxazolidin-Geigy | O=C1C(CCCC)C(=O)N(c2ccccc2)N1c3ccc(O)cc3 |
Strawberry Red A Geigy | N(=Nc1ccc(c2ccccc12)S(=O)(=O)O)c3c(O)ccc4cc(cc(c34)S(=O)(=O)O)S(=O)(=O)O |