If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
9-Acridinamine, N-(4-azidophenyl)-, monohydrochloride | N(c1ccc(N=N=N)cc1)c2c3ccccc3nc4ccccc24 |
9-Acridinamine__N-(4-azidophenyl)-__monohydrochloride | N(c1ccc(N=N=N)cc1)c2c3ccccc3nc4ccccc24 |
s-Triazine, 2,4-diamino-6-(o-azidophenyl)- | N(=N=N)c1ccccc1c2nc(N)nc(N)n2 |
s-Triazine__2_4-diamino-6-(o-azidophenyl)- | N(=N=N)c1ccccc1c2nc(N)nc(N)n2 |