If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(p-Nitrophenyl)-3,3-dimethyltriazen (GERMAN) | [N+](=O)([O-])c1ccc(cc1)N=NN(C)C |
1-(p-Nitrophenyl)-3_3-dimethyltriazen_(GERMAN) | [N+](=O)([O-])c1ccc(cc1)N=NN(C)C |
1-p-Bromfenyl-3, 3-dimethyltriazen (CZECH) | N(=NN(C)C)c1ccc(Br)cc1 |
1-p-Chlorfenyl-3,3-dimethyltriazen (CZECH) | N(=NN(C)C)c1ccc(Cl)cc1 |
1-p-Karboxyfenyl-3, 3-dimethyltriazen (CZECH) | C(=O)(O)c1ccc(cc1)N=NN(C)C |
1-p-Karboxyfenyl-3__3-dimethyltriazen_(CZECH) | C(=O)(O)c1ccc(cc1)N=NN(C)C |
1-p-Methoxyfenyl-3, 3-dimethyltriazen (CZECH) | N(=NN(C)C)c1ccc(OC)cc1 |
1-p-Methylfenyl-3, 3-dimethyltriazen (CZECH) | N(=NN(C)C)c1ccc(C)cc1 |
1-p-Nitrofenyl-3,3-dimethyltriazen (CZECH) | [N+](=O)([O-])c1ccc(cc1)N=NN(C)C |