If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 4-Di(mesyloxyethylamino)erythritol | C(O)(CNCCOS(C)(=O)=O)C(O)CNCCOS(C)(=O)=O |
1, 4-Dibromo-1,4-dideoxy-L-+-erythritol | C(O)(CBr)C(O)CBr |
1,4-Bis mesyl ester of erythritol | C(O)(COS(C)(=O)=O)C(O)COS(C)(=O)=O |
1,4-Di(methanesulfonate)erythritol | C(O)(COS(C)(=O)=O)C(O)COS(C)(=O)=O |
1,4-Dibromo-1,4-dideoxy-meso-erythritol | C(O)(CBr)C(O)CBr |
Dibromo-meso-erythritol | C(O)(CBr)C(O)CBr |
Dimesyl-meso-erythritol | C(O)(COS(C)(=O)=O)C(O)COS(C)(=O)=O |
ERYTHRITOL | C(O)(CO)C(O)CO |
Erythritol anhydride | C1(CO1)C2CO2 |
Erythritol aziridine | C(C(O)C(O)CN1CC1)N2CC2 |
Erythritol tetranitrate | C(CO[N+](=O)[O-])(O[N+](=O)[O-])C(CO[N+](=O)[O-])O[N+](=O)[O-] |
Erythritol | C(O)(CO)C(O)CO |
Erythritol, 1, 4-dimethanesulfonate | C(O)(COS(C)(=O)=O)C(O)COS(C)(=O)=O |
Erythritol, 1,2:3,4-dianhydro- | C1(CO1)C2CO2 |
Erythritol, 1,4-bis(methanesulfonate) | C(O)(COS(C)(=O)=O)C(O)COS(C)(=O)=O |
Erythritol, 1,4-dibromo-1,4-dideoxy-, (O)-(+)- | C(O)(CBr)C(O)CBr |
Erythritol, 1,4-dibromo-1,4-dideoxy-, (meso)- | C(O)(CBr)C(O)CBr |
Erythritol, 1,4-dimethanesulfonate, (+ )- | C(O)(COS(C)(=O)=O)C(O)COS(C)(=O)=O |
Erythritol, 1,4-dimethanesulfonate, (meso)- | C(O)(COS(C)(=O)=O)C(O)COS(C)(=O)=O |
Erythritol, dimesyl-, meso- | C(O)(COS(C)(=O)=O)C(O)COS(C)(=O)=O |
Erythritol, meso- | C(O)(CO)C(O)CO |
Erythritol, tetranitrate | C(CO[N+](=O)[O-])(O[N+](=O)[O-])C(CO[N+](=O)[O-])O[N+](=O)[O-] |
Erythritol__1_4-dibromo-1_4-dideoxy-__(O)-(+)- | C(O)(CBr)C(O)CBr |
Erythritol__1_4-dibromo-1_4-dideoxy-__(meso)- | C(O)(CBr)C(O)CBr |
meso-Erythritol tetranitrate | C(CO[N+](=O)[O-])(O[N+](=O)[O-])C(CO[N+](=O)[O-])O[N+](=O)[O-] |
meso-Erythritol | C(O)(CO)C(O)CO |