If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(E)-1,2-Dichloroethylene | C(Cl)=CCl |
(Z)-1,2-Dichloroethylene | C(Cl)=CCl |
1, 1-Bis(p-chlorophenyl)-2,2-dichloroethylene | C(=C(Cl)Cl)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
1, 2-Dichloroethylene carbonate | ClC1OC(=O)OC1Cl |
1,1-Bis(p-methoxyphenyl)-2,2-dichloroethylene | C(=C(Cl)Cl)(c1ccc(OC)cc1)c2ccc(OC)cc2 |
1,2-cis-Dichloroethylene | C(Cl)=CCl |
1,2-trans-Dichloroethylene | C(Cl)=CCl |
2, 2-Bis(4-chlorophenyl)-1,1-dichloroethylene | C(=C(Cl)Cl)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
2, 2-Bis(p-chlorophenyl)-1,1-dichloroethylene | C(=C(Cl)Cl)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
2,2-Bis(p-methoxyphenyl)-1, 1-dichloroethylene | C(=C(Cl)Cl)(c1ccc(OC)cc1)c2ccc(OC)cc2 |
2-(2-Chlorophenyl)-2-(4-chlorophenyl)-1,1-dichloroethylene | C(=C(Cl)Cl)(c1ccc(Cl)cc1)c2ccccc2Cl |
Carbonic acid, cyclic 1,2-dichloroethylene ester | ClC1OC(=O)OC1Cl |
Carbonic_acid__cyclic_1_2-dichloroethylene_ester | ClC1OC(=O)OC1Cl |
Cyclic 1, 2-dichloroethylene carbonate | ClC1OC(=O)OC1Cl |
Dichloroethylene, cis- | C(Cl)=CCl |
Dichloroethylene, trans- | C(Cl)=CCl |
cis-1,2-Dichloroethylene | C(Cl)=CCl |
cis-Dichloroethylene | C(Cl)=CCl |
p, p'-(Dichlorodiphenyl)dichloroethylene | C(=C(Cl)Cl)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
p,p'-(Dichlorodiphenyl)-2,2-dichloroethylene | C(=C(Cl)Cl)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
trans-1,2-Dichloroethylene | C(Cl)=CCl |
trans-Dichloroethylene | C(Cl)=CCl |