If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Bromobutyric acid | C(Br)(CC)C(=O)O |
4-Benzoyl-4-bromobutyric acid | C(=O)(C(Br)CCC(=O)O)c1ccccc1 |
4-Bromobutyric acid | C(CCBr)C(=O)O |
ALPHA_-Bromobutyric acid | C(Br)(CC)C(=O)O |
ALPHA_-Bromobutyric acid, GAMMA_-lactone | BrC1CCOC1=O |
ALPHA_-Bromobutyric_acid__GAMMA_-lactone | BrC1CCOC1=O |
BETA_-Bromobutyric acid ethyl ester | C(C(Br)C)C(=O)OCC |