If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-(Tribromomethyl)-4(3H)-quinazolinone | Oc1nc(nc2ccccc12)C(Br)(Br)Br |
2-(Tribromomethyl)quinoxaline | C(Br)(Br)(Br)c1cnc2ccccc2n1 |
2-Tribromomethyl-2-propanol | C(Br)(Br)(Br)C(C)(C)O |
4(1H)-Quinazolinone, 2-(tribromomethyl)- | Oc1nc(nc2ccccc12)C(Br)(Br)Br |
4(1H)-Quinazolinone__2-(tribromomethyl)- | Oc1nc(nc2ccccc12)C(Br)(Br)Br |
4(3H)-Quinazolinone, 2-(tribromomethyl)- | Oc1nc(nc2ccccc12)C(Br)(Br)Br |
Mercury, phenyl(tribromomethyl)- | C(Br)(Br)Br.c1ccccc1 |
Mercury__phenyl(tribromomethyl)- | C(Br)(Br)Br.c1ccccc1 |
Quinoline, 2-(tribromomethyl)- | C(Br)(Br)(Br)c1ccc2ccccc2n1 |
Quinoline__2-(tribromomethyl)- | C(Br)(Br)(Br)c1ccc2ccccc2n1 |
Quinoxaline, 2-(tribromomethyl)- | C(Br)(Br)(Br)c1cnc2ccccc2n1 |
Quinoxaline__2-(tribromomethyl)- | C(Br)(Br)(Br)c1cnc2ccccc2n1 |