If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
6-Thioinosine 5'-monophosphate | OC1C(O)C(COP(=O)(O)O)OC1N2C=Nc3c(S)ncnc23 |
6-Thioinosine 5'-phosphate (VAN) | OC1C(O)C(COP(=O)(O)O)OC1N2C=Nc3c(S)ncnc23 |
6-Thioinosine | OC1C(O)C(CO)OC1N2C=Nc3c(S)ncnc23 |
Platinum, dichloro(6-thioinosine-N(7),S(6))-, (SP-4-3)- | Cl[Pt]1(Cl)S=C2N=CNC3=C2N1=CN3C4OC(CO)C(O)C4O |
Platinum__dichloro(6-thioinosine-N(7)_S(6))-__(SP-4-3)- | Cl[Pt]1(Cl)S=C2N=CNC3=C2N1=CN3C4OC(CO)C(O)C4O |
Thioinosine | OC1C(O)C(CO)OC1N2C=Nc3c(S)ncnc23 |