If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2, 4-Bis(ALPHA_-methylbenzyl)anisole | C(C)(c1ccccc1)c2cc(ccc2OC)C(C)c3ccccc3 |
2-(3-Hydroxy-2-naphthamido)anisole | C(=O)(Nc1ccccc1OC)c2cc3ccccc3cc2O |
4-(Methylthio)anisole | O(C)c1ccc(SC)cc1 |
ANISOLE, P-ALLYL- | C(C=C)c1ccc(OC)cc1 |
Anisole | O(C)c1ccccc1 |
Anisole, 2,3,4,5,6-pentafluoro- | O(C)c1c(F)c(F)c(F)c(F)c1F |
Anisole, 2,3,5,6-tetrachloro- | O(C)c1c(Cl)c(Cl)cc(Cl)c1Cl |
Anisole, 2,3,5,6-tetrachloro-4-nitro- | [N+](=O)([O-])c1c(Cl)c(Cl)c(OC)c(Cl)c1Cl |
Anisole, 2,4,5-trichloro- | O(C)c1cc(Cl)c(Cl)cc1Cl |
Anisole, 2,4,6-tribromo- | O(C)c1c(Br)cc(Br)cc1Br |
Anisole, 2,4,6-trichloro- | O(C)c1c(Cl)cc(Cl)cc1Cl |
Anisole, 2,4,6-trinitro- | O(C)c1c(cc(cc1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
Anisole, 2,4-bis(ALPHA_-methylbenzyl)- | C(C)(c1ccccc1)c2cc(ccc2OC)C(C)c3ccccc3 |
Anisole, 2,4-dichloro- | O(C)c1ccc(Cl)cc1Cl |
Anisole, 2,4-dinitro- | [N+](=O)([O-])c1cc(ccc1OC)[N+](=O)[O-] |
Anisole, 2-amino-5-nitro- | O(C)c1cc(ccc1N)[N+](=O)[O-] |
Anisole, 2-isopropyl-5-methyl- | O(C)c1cc(C)ccc1C(C)C |
Anisole, 2-methyl-5-nitro- | O(C)c1cc(ccc1C)[N+](=O)[O-] |
Anisole, 2-nitro-5-chloro- | O(C)c1cc(Cl)ccc1[N+](=O)[O-] |
Anisole, 3,5-dinitro- | [N+](=O)([O-])c1cc(OC)cc(c1)[N+](=O)[O-] |
Anisole, 4,4'-(1,2-diethylethylene)di- | C(CC)(c1ccc(OC)cc1)C(CC)c2ccc(OC)cc2 |
Anisole, 4,4'-dithiodi- | S(Sc1ccc(OC)cc1)c2ccc(OC)cc2 |
Anisole, 4-chloro-2-fluoro- | O(C)c1ccc(Cl)cc1F |
Anisole, 4-chloro-2-nitro- | [N+](=O)([O-])c1cc(Cl)ccc1OC |
Anisole, 4-chloro-3-nitro- | [N+](=O)([O-])c1cc(OC)ccc1Cl |
Anisole, 5-chloro-2-methyl- | O(C)c1cc(Cl)ccc1C |
Anisole, 5-chloro-2-nitro- | O(C)c1cc(Cl)ccc1[N+](=O)[O-] |
Anisole, 5-isopropyl-2-methyl- | O(C)c1cc(ccc1C)C(C)C |
Anisole, 5-methyl-2,4-dinitro- | [N+](=O)([O-])c1cc([N+](=O)[O-])c(C)cc1OC |
Anisole, 6-tert-butyl-3-methyl-2,4-dinitro- | O(C)c1c(cc([N+](=O)[O-])c(C)c1[N+](=O)[O-])C(C)(C)C |
Anisole, ALPHA_-phenyl- | C(Oc1ccccc1)c2ccccc2 |
Anisole, m-(2-nitropropyl)- | C(C(C)[N+](=O)[O-])c1cccc(OC)c1 |
Anisole, m-(2-nitrovinyl)- | C(=C[N+](=O)[O-])c1cccc(OC)c1 |
Anisole, m-(chloromethyl)- | C(Cl)c1cccc(OC)c1 |
Anisole, m-(methylthio)- | O(C)c1cccc(SC)c1 |
Anisole, m-bromo- | O(C)c1cccc(Br)c1 |
Anisole, m-heptadecyl- | C(CCCCCCCCCCCCCCCC)c1cccc(OC)c1 |
Anisole, m-iodo- | O(C)c1cccc(I)c1 |
Anisole, m-methyl- | O(C)c1cccc(C)c1 |
Anisole, m-nitro- | [N+](=O)([O-])c1cccc(OC)c1 |
Anisole, m-phenyl- | O(C)c1cccc(c1)c2ccccc2 |
Anisole, o-bromo- | O(C)c1ccccc1Br |
Anisole, o-chloro- | O(C)c1ccccc1Cl |
Anisole, o-cyclohexyl- | O(C)c1ccccc1C2CCCCC2 |
Anisole, o-fluoro- | O(C)c1ccccc1F |
Anisole, o-iodo- | O(C)c1ccccc1I |
Anisole, o-isopropyl- | O(C)c1ccccc1C(C)C |
Anisole, o-methyl- | O(C)c1ccccc1C |
Anisole, o-nitro- | O(C)c1ccccc1[N+](=O)[O-] |
Anisole, o-phenyl- | O(C)c1ccccc1c2ccccc2 |
Anisole, p-((chloromethyl)sulfonyl)- | S(=O)(=O)(CCl)c1ccc(OC)cc1 |
Anisole, p-(2,4-dinitrostyryl)- | [N+](=O)([O-])c1cc(ccc1C=Cc2ccc(OC)cc2)[N+](=O)[O-] |
Anisole, p-(2-bromoethyl)- | C(CBr)c1ccc(OC)cc1 |
Anisole, p-(chloromethyl)- | C(Cl)c1ccc(OC)cc1 |
Anisole, p-(methylsulfonyl)- | S(C)(=O)(=O)c1ccc(OC)cc1 |
Anisole, p-(methylthio)- | O(C)c1ccc(SC)cc1 |
Anisole, p-1-cyclohexen-1-yl- | O(C)c1ccc(cc1)C2=CCCCC2 |
Anisole, p-allyl- | C(C=C)c1ccc(OC)cc1 |
Anisole, p-amino- | O(C)c1ccc(N)cc1 |
Anisole, p-benzyl- | C(c1ccccc1)c2ccc(OC)cc2 |
Anisole, p-bromo- | O(C)c1ccc(Br)cc1 |
Anisole, p-chloro- | O(C)c1ccc(Cl)cc1 |
Anisole, p-ethyl- | C(C)c1ccc(OC)cc1 |
Anisole, p-fluoro- | O(C)c1ccc(F)cc1 |
Anisole, p-iodo- | O(C)c1ccc(I)cc1 |
Anisole, p-isopropenyl- | C(C)(=C)c1ccc(OC)cc1 |
Anisole, p-methyl- | O(C)c1ccc(C)cc1 |
Anisole, p-nitro- | [N+](=O)([O-])c1ccc(OC)cc1 |
Anisole, p-phenethyl- | C(Cc1ccccc1)c2ccc(OC)cc2 |
Anisole, p-phenyl- | O(C)c1ccc(cc1)c2ccccc2 |
Anisole, p-propenyl- | C(=CC)c1ccc(OC)cc1 |
Anisole, p-propenyl-, (E)- | C(=CC)c1ccc(OC)cc1 |
Anisole, p-propenyl-, trans- | C(=CC)c1ccc(OC)cc1 |
Anisole, p-propyl- | C(CC)c1ccc(OC)cc1 |
Anisole, p-styryl- | C(=Cc1ccccc1)c2ccc(OC)cc2 |
Anisole, p-styryl-, (E)- | C(=Cc1ccccc1)c2ccc(OC)cc2 |
Anisole, p-tert-butyl- | C(C)(C)(C)c1ccc(OC)cc1 |
Anisole, p-vinyl- | C(=C)c1ccc(OC)cc1 |
Anisole, thio- | S(C)c1ccccc1 |
Anisole-2-azo-BETA_-naphthol | N(=Nc1ccccc1OC)c2c(O)ccc3ccccc23 |
Anisole__2_3_4_5_6-pentafluoro- | O(C)c1c(F)c(F)c(F)c(F)c1F |
Anisole__2_4-bis(ALPHA_-methylbenzyl)- | C(C)(c1ccccc1)c2cc(ccc2OC)C(C)c3ccccc3 |
Anisole__5-chloro-2-methyl- | O(C)c1cc(Cl)ccc1C |
Anisole__m-(2-nitropropyl)- | C(C(C)[N+](=O)[O-])c1cccc(OC)c1 |
Anisole__m-(2-nitrovinyl)- | C(=C[N+](=O)[O-])c1cccc(OC)c1 |
Anisole__m-heptadecyl- | C(CCCCCCCCCCCCCCCC)c1cccc(OC)c1 |
Anisole__p-(2_4-dinitrostyryl)- | [N+](=O)([O-])c1cc(ccc1C=Cc2ccc(OC)cc2)[N+](=O)[O-] |
m-(Chloromethyl)anisole | C(Cl)c1cccc(OC)c1 |
p-(2-Bromoethyl)anisole | C(CBr)c1ccc(OC)cc1 |
p-(2-Nitropropenyl)anisole | C(=C(C)[N+](=O)[O-])c1ccc(OC)cc1 |
p-(Chloromercuri)anisole | Cl.COc1ccccc1 |
p-(Chloromethyl)anisole | C(Cl)c1ccc(OC)cc1 |
p-(Methylsulfonyl)anisole | S(C)(=O)(=O)c1ccc(OC)cc1 |
p-(Methylthio)anisole | O(C)c1ccc(SC)cc1 |