If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Oxazolamine, 4,5-dihydro-5-phenyl- | N=C1NCC(O1)c2ccccc2 |
2-Oxazolamine, 5-(((3,4-dichlorophenyl)thio)methyl)-4,5-dihydro- | S(CC1CNC(=N)O1)c2ccc(Cl)c(Cl)c2 |
2-Oxazolamine, 5-(4-chlorophenyl)-4,5-dihydro- | N=C1NCC(O1)c2ccc(Cl)cc2 |
2-Oxazolamine, N-(2-chloroethyl)-4,5-dihydro-, monohydrochloride | N(CCCl)C1=NCCO1 |
2-Oxazolamine__4_5-dihydro-5-phenyl- | N=C1NCC(O1)c2ccccc2 |
2-Oxazolamine__5-(((3_4-dichlorophenyl)thio)methyl)-4_5-dihydro- | S(CC1CNC(=N)O1)c2ccc(Cl)c(Cl)c2 |
2-Oxazolamine__5-(4-chlorophenyl)-4_5-dihydro- | N=C1NCC(O1)c2ccc(Cl)cc2 |
2-Oxazolamine__N-(2-chloroethyl)-4_5-dihydro-__monohydrochloride | N(CCCl)C1=NCCO1 |