If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Methyl-6-thiopurine | S=C1N(C)C=NC2=C1N=CN2 |
2-Methyl-6-thiopurine | Sc1nc(C)nc2NC=Nc12 |
6-(1-Methyl-p-nitro-5-imidazolyl)-thiopurine | S(c1ncnc2NC=Nc12)C3=C(N=CN3C)[N+](=O)[O-] |
6-(1-Methyl-p-nitro-5-imidazolyl)thiopurine | S(c1ncnc2NC=Nc12)C3=C(N=CN3C)[N+](=O)[O-] |
6-(Methyl-p-nitro-5-imidazolyl)-thiopurine | S(c1ncnc2NC=Nc12)C3=C(N=CN3C)[N+](=O)[O-] |
6-(Methyl-p-nitro-5-imidazolyl)thiopurine | S(c1ncnc2NC=Nc12)C3=C(N=CN3C)[N+](=O)[O-] |
6-Thiopurine ribonucleoside | OC1C(O)C(CO)OC1N2C=Nc3c(S)ncnc23 |
6-Thiopurine riboside | OC1C(O)C(CO)OC1N2C=Nc3c(S)ncnc23 |
6-Thiopurine | Sc1ncnc2NC=Nc12 |
7-Methyl-6-thiopurine | Sc1ncnc2N=CN(C)c12 |
8-Methyl-6-thiopurine | Sc1ncnc2NC(C)=Nc12 |
9-Methyl-6-thiopurine | Sc1ncnc2N(C)C=Nc12 |
Ribosyl-6-thiopurine | OC1C(O)C(CO)OC1N2C=Nc3c(S)ncnc23 |