If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Fluoroaniline | Fc1ccccc1N |
3-Chloro-4-fluoroaniline | Clc1cc(N)ccc1F |
3-Fluoroaniline | Fc1cccc(N)c1 |
3-Nitro-4-fluoroaniline | [N+](=O)([O-])c1cc(N)ccc1F |
4-Fluoroaniline | Fc1ccc(N)cc1 |
N-Acetyl-3-nitro-4-fluoroaniline | N(C(C)=O)c1ccc(F)c(c1)[N+](=O)[O-] |
m-Fluoroaniline | Fc1cccc(N)c1 |
o-Fluoroaniline | Fc1ccccc1N |
p-Fluoroaniline | Fc1ccc(N)cc1 |