If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(E)-2-Octene | C(CCC)CC=CC |
(E)-3-Octene | C(CCC)C=CCC |
(E)-4-Octene | C(CCC)=CCCC |
(Z)-2-Octene | C(CCC)CC=CC |
1-Octene epoxide | C(CCCCC)C1CO1 |
1-Octene oxide | C(CCCCC)C1CO1 |
1-Octene | C(CCC)CCC=C |
1-Octene, 2-methyl- | C(CCCC)CC(C)=C |
1-Octene, 3,7-dimethyl- | C(C)(C=C)CCCC(C)C |
1-Octene__2-methyl- | C(CCCC)CC(C)=C |
1-Octene__3_7-dimethyl- | C(C)(C=C)CCCC(C)C |
2,6-Dimethyl-2-octene | C(C)(CC)CCC=C(C)C |
2,6-Dimethyl-7-octene | C(C)(C=C)CCCC(C)C |
2-Methyl-1-octene | C(CCCC)CC(C)=C |
2-Octene | C(CCC)CC=CC |
2-Octene(mixed cis, trans isomers) | C(CCC)CC=CC |
2-Octene(mixed_cis__trans_isomers) | C(CCC)CC=CC |
2-Octene, (E)- | C(CCC)CC=CC |
2-Octene, (Z)- | C(CCC)CC=CC |
2-Octene, 2,6-dimethyl- | C(C)(CC)CCC=C(C)C |
2-Octene, 2-(3,5-dimethoxyphenyl)-3-methyl- | C(C)(=C(C)CCCCC)c1cc(OC)cc(OC)c1 |
2-Octene, cis- | C(CCC)CC=CC |
2-Octene__(Z)- | C(CCC)CC=CC |
2-Octene__2_6-dimethyl- | C(C)(CC)CCC=C(C)C |
3-Hydroxy-1-octene | C(O)(C=C)CCCCC |
3-Octene, (E)- | C(CCC)C=CCC |
4-Octene, (E)- | C(CCC)=CCCC |
4-Octene-3,6-diol, 3,6-dimethyl- | C(C)(O)(CC)C=CC(C)(O)CC |
4-Octene-3_6-diol__3_6-dimethyl- | C(C)(O)(CC)C=CC(C)(O)CC |
ALPHA_-Octene | C(CCC)CCC=C |
Bicyclo(2.2.2)octene-2,3-endo-dicarboxylic anhydride | O=C1OC(=O)C2C3CCC(C=C3)C12 |
E-2-Octene | C(CCC)CC=CC |
OCTENE-1 | C(CCC)CCC=C |
OCTENE-2 | C(CCC)CC=CC |
Octene-1,2-oxide | C(CCCCC)C1CO1 |
Z-2-Octene | C(CCC)CC=CC |
cis-2-Octene | C(CCC)CC=CC |
n-1-Octene | C(CCC)CCC=C |
n-Octene-1,2-oxide | C(CCCCC)C1CO1 |
n-trans-4-Octene | C(CCC)=CCCC |
trans-2-Octene | C(CCC)CC=CC |
trans-3-Octene | C(CCC)C=CCC |
trans-4-Octene | C(CCC)=CCCC |
trans-n-4-Octene | C(CCC)=CCCC |