If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-(3,4-Dichlor-phenyl)-1, 1-dimethyl-harnstoff(GERMAN) | N(C(=O)N(C)C)c1ccc(Cl)c(Cl)c1 |
3-(3_4-Dichlor-phenyl)-1__1-dimethyl-harnstoff(GERMAN) | N(C(=O)N(C)C)c1ccc(Cl)c(Cl)c1 |
3-(4-Chlor-phenyl)-1, 1-dimethyl-harnstoff(GERMAN) | N(C(=O)N(C)C)c1ccc(Cl)cc1 |
3-(4-Chlor-phenyl)-1__1-dimethyl-harnstoff(GERMAN) | N(C(=O)N(C)C)c1ccc(Cl)cc1 |
Aethylnitroso-harnstoff (GERMAN) | N(CC)(N=O)C(N)=O |
Aethylnitroso-harnstoff_(GERMAN) | N(CC)(N=O)C(N)=O |
Methylnitroso-harnstoff (GERMAN) | N(C)(N=O)C(N)=O |
N-Methyl-N-nitroso-harnstoff (GERMAN) | N(C)(N=O)C(N)=O |
N-Methyl-N-nitroso-harnstoff_(GERMAN) | N(C)(N=O)C(N)=O |
N-Nitroso-N-methyl-harnstoff (GERMAN) | N(C)(N=O)C(N)=O |