If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Tertropigment Fast Yellow VG | Clc1cc(ccc1N=NC(C(C)=O)C(=O)Nc2ccccc2C)c3ccc(N=NC(C(C)=O)C(=O)Nc4ccccc4C)c(Cl)c3 |
Tertropigment Fast Yellow VGR | Clc1cc(ccc1N=NC(C(C)=O)C(=O)Nc2ccc(C)cc2C)c3ccc(N=NC(C(C)=O)C(=O)Nc4ccc(C)cc4C)c(Cl)c3 |
Tertropigment Orange LRN | N(=Nc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Tertropigment PGR | Clc1cc(ccc1N=NC(C(C)=O)C(=O)Nc2ccc(C)cc2C)c3ccc(N=NC(C(C)=O)C(=O)Nc4ccc(C)cc4C)c(Cl)c3 |
Tertropigment Red HAB | N(=Nc1ccc(C)cc1[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Tertropigment Red P2G | N(=Nc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Tertropigment Red PAB | N(=Nc1ccc(cc1)[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Tertropigment Scarlet LRN | N(=Nc1ccc(C)cc1[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Tertropigment Yellow 10G | N(=NC(C(C)=O)C(=O)Nc1ccccc1Cl)c2ccc(Cl)cc2[N+](=O)[O-] |
Tertropigment Yellow 10GT | N(=NC(C(C)=O)C(=O)Nc1ccccc1Cl)c2ccc(Cl)cc2[N+](=O)[O-] |
Tertropigment Yellow BG | Clc1cc(ccc1N=NC(C(C)=O)C(=O)Nc2ccccc2C)c3ccc(N=NC(C(C)=O)C(=O)Nc4ccccc4C)c(Cl)c3 |
Tertropigment Yellow G | N(=NC(C(C)=O)C(=O)Nc1ccccc1)c2ccc(C)cc2[N+](=O)[O-] |