If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Azabenz(b)azulene | C12=C3C=CC=CC=C3N=C2C=CC=C1 |
3,8-Dimethyl-5-(2-propyl)azulene | CC1=C2C=C(C=CC(C)=C2C=C1)C(C)C |
Azulene | C12=CC=CC1=CC=CC=C2 |
Azulene, 1,4-dimethyl-7-(1-methylethyl)- | CC1=C2C=C(C=CC(C)=C2C=C1)C(C)C |
Azulene, 1,4-dimethyl-7-isopropyl- | CC1=C2C=C(C=CC(C)=C2C=C1)C(C)C |
Azulene, 4,6,8-trimethyl- | CC1=C2C=CC=C2C(C)=CC(C)=C1 |
Azulene, 7-isopropyl-1, 4-dimethyl- | CC1=C2C=C(C=CC(C)=C2C=C1)C(C)C |
Azulene__1_4-dimethyl-7-(1-methylethyl)- | CC1=C2C=C(C=CC(C)=C2C=C1)C(C)C |