If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Trimellitic acid 1, 2-anhydride | O=C1OC(=O)c2ccc(cc12)C(=O)O |
Trimellitic acid anhydride 4-monoacid chloride | O=C1OC(=O)c2ccc(cc12)C(Cl)=O |
Trimellitic acid anhydride chloride | O=C1OC(=O)c2ccc(cc12)C(Cl)=O |
Trimellitic acid anhydride | O=C1OC(=O)c2ccc(cc12)C(=O)O |
Trimellitic acid | C(=O)(O)c1cc(ccc1C(=O)O)C(=O)O |
Trimellitic acid, cyclic 1,2-anhydride | O=C1OC(=O)c2ccc(cc12)C(=O)O |
Trimellitic anhydride acid chloride | O=C1OC(=O)c2ccc(cc12)C(Cl)=O |
Trimellitic anhydride chloride | O=C1OC(=O)c2ccc(cc12)C(Cl)=O |
Trimellitic anhydride monoacid chloride | O=C1OC(=O)c2ccc(cc12)C(Cl)=O |
Trimellitic anhydride monochloride | O=C1OC(=O)c2ccc(cc12)C(Cl)=O |