If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Cyclohexene-1,2-dicarboximide, N-(trichloromethylthio)- | S(N1C(=O)C2CC=CCC2C1=O)C(Cl)(Cl)Cl |
5,5-Diphenyl-3-(trichloromethylthio)hydantoin | O=C1N(SC(Cl)(Cl)Cl)C(=O)NC1(c2ccccc2)c3ccccc3 |
Hydantoin, 5,5-diphenyl-3-(trichloromethylthio)- | O=C1N(SC(Cl)(Cl)Cl)C(=O)NC1(c2ccccc2)c3ccccc3 |
N-(Trichloromethylthio)succinimide | S(N1C(=O)CCC1=O)C(Cl)(Cl)Cl |
N-Trichloromethylthio-3a,4,7,7a-tetrahydrophthalimide | S(N1C(=O)C2CC=CCC2C1=O)C(Cl)(Cl)Cl |
Succinimide, N-(trichloromethylthio)- | S(N1C(=O)CCC1=O)C(Cl)(Cl)Cl |