If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Aminoimidazole-5-carbonitrile | C(#N)C1=C(N)NC=N1 |
4-Aminoimidazole-5-carboxamide hydrochoride | C(N)(=O)C1=C(N)NC=N1 |
4-Aminoimidazole-5-carboxamide | C(N)(=O)C1=C(N)NC=N1 |
4-Carbamoyl-5-aminoimidazole | C(N)(=O)C1=C(N)NC=N1 |
4-Carboxamido-5-aminoimidazole | C(N)(=O)C1=C(N)NC=N1 |
5-Aminoimidazole-4-carboxamide hydrochloride | C(N)(=O)C1=C(N)NC=N1 |
5-Aminoimidazole-4-carboxamide ribonucleoside | OC1C(O)C(CO)OC1N2C=NC(C(N)=O)=C2N |
5-Aminoimidazole-4-carboxamide riboside | OC1C(O)C(CO)OC1N2C=NC(C(N)=O)=C2N |
5-Aminoimidazole-4-carboxamide | C(N)(=O)C1=C(N)NC=N1 |
5-Cyano-4-aminoimidazole | C(#N)C1=C(N)NC=N1 |