If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Chloro-5-hydroxytoluene | Cc1cc(O)ccc1Cl |
2-Chloro-6-hydroxytoluene | Cc1c(Cl)cccc1O |
2-Chloro-hydroxytoluene | Cc1cc(O)ccc1Cl |
2-Dimethylamino-4-hydroxytoluene | N(C)(C)c1cc(O)ccc1C |
2-Hydroxytoluene | Cc1ccccc1O |
2-Nitro-5-hydroxytoluene | [N+](=O)([O-])c1ccc(O)cc1C |
3, 5-Dinitro-2-hydroxytoluene | [N+](=O)([O-])c1cc(cc(C)c1O)[N+](=O)[O-] |
3,5-Di-tert-butyl-4-hydroxytoluene | C(C)(C)(C)c1cc(C)cc(c1O)C(C)(C)C |
3-Amino-4-hydroxytoluene | Nc1cc(C)ccc1O |
3-Hydroxytoluene | Cc1cccc(O)c1 |
3-Methoxy-4-hydroxytoluene | O(C)c1cc(C)ccc1O |
4-Hydroxytoluene | Cc1ccc(O)cc1 |
6-Chloro-3-hydroxytoluene | Cc1cc(O)ccc1Cl |
ALPHA_-Hydroxytoluene | C(O)c1ccccc1 |
Butylated hydroxytoluene | C(C)(C)(C)c1cc(C)cc(c1O)C(C)(C)C |
Dibutylated hydroxytoluene | C(C)(C)(C)c1cc(C)cc(c1O)C(C)(C)C |
m-Hydroxytoluene | Cc1cccc(O)c1 |
o-Hydroxytoluene | Cc1ccccc1O |
p-Hydroxytoluene | Cc1ccc(O)cc1 |