If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 3-Butylene diacetate | C(C)(CCOC(C)=O)OC(C)=O |
1, 4-Butylene-bis-phenyl isothiuronium dihydrobromide | N(C(=N)SCCCCSC(=N)Nc1ccccc1)c2ccccc2 |
1,2-Butylene glycol | C(O)(CC)CO |
1,2-Butylene oxide | C(C)C1CO1 |
1,3-Butylene glycol diacetate | C(C)(CCOC(C)=O)OC(C)=O |
1,3-Butylene glycol | C(CO)C(C)O |
1,3-Butylene sulphite | CC1CCOS(=O)O1 |
1,4-Butanediamine, N,N-(1,4-butylene)bis((N,N-diethyl- 4-methyl)- | N(CC)(CC)CCCC(C)NCCCCNC(C)CCCN(CC)CC |
1,4-Butylene (dichloromethyl)phosphonate | C(Cl)(Cl)P1(=O)OCCCCO1 |
1,4-Butylene glycol diacetate | C(CCCOC(C)=O)OC(C)=O |
1,4-Butylene glycol | C(CO)CCO |
1-Butylene oxide | C(C)C1CO1 |
1_3-Butylene_glycol_diacetate | C(C)(CCOC(C)=O)OC(C)=O |
1_4-Butanediamine__N_N-(1_4-butylene)bis((N_N-diethyl-_4-methyl)- | N(CC)(CC)CCCC(C)NCCCCNC(C)CCCN(CC)CC |
1_4-Butylene_glycol_diacetate | C(CCCOC(C)=O)OC(C)=O |
2,3,4, 5-Bis(.DELTA.2-butylene)tetrahydrofurfural | C(=O)C12CC=CCC1C3CC=CCC3O2 |
2,3,4, 5-Bis(2-butylene)tetrahydro-2-furaldehyde | C(=O)C12CC=CCC1C3CC=CCC3O2 |
2,3,4, 5-Bis(DELTA_(sup 2)butylene)tetrahydrofurfural | C(=O)C12CC=CCC1C3CC=CCC3O2 |
2,3,4, 5-Bis(DELTA_-2-butylene)tetrahydrofurfural | C(=O)C12CC=CCC1C3CC=CCC3O2 |
2,3,4,5-Bis(2-butylene tetrahydrofurfural) | C(=O)C12CC=CCC1C3CC=CCC3O2 |
ALPHA_-Butylene dibromide | C(Br)(CBr)CC |
ALPHA_-Butylene glycol | C(O)(CC)CO |
ALPHA_-Butylene oxide | C(C)C1CO1 |
ALPHA_-Butylene_dibromide | C(Br)(CBr)CC |
ALPHA_-Butylene_glycol | C(O)(CC)CO |
BETA_-Butylene chlorohydrin | C(C)(Cl)C(C)O |
BETA_-Butylene glycol | C(CO)C(C)O |
BETA_-Butylene_chlorohydrin | C(C)(Cl)C(C)O |
Bis(DELTA_(sup 2)butylene)tetrahydrofurfural | C(=O)C12CC=CCC1C3CC=CCC3O2 |
Butylene glycol diacetate | C(CCCOC(C)=O)OC(C)=O |
Butylene glycol ethyl ether | C(CCO)COCC |
Butylene glycol methyl ether | C(CCO)COC |
Butylene glycol monoethyl ether | C(CCO)COCC |
Butylene glycol monomethyl ether | C(CCO)COC |
Butylene hydrate | C(C)(O)CC |
Butylene oxide | C(C)C1CO1 |
Butylene-1,4-bisisothiourea dihydrobromide | C(CCCSC(=N)N)SC(=N)N |
Butylene_glycol_monoethyl_ether | C(CCO)COCC |
Butylene_glycol_monomethyl_ether | C(CCO)COC |
Butyraldehyde-1,3-butylene glycol acetal | C(CC)C1OCCC(C)O1 |
Butyraldehyde-1_3-butylene_glycol_acetal | C(CC)C1OCCC(C)O1 |
Cinnamaldehyde-1,3-butylene glycol acetal | C(=Cc1ccccc1)C2OCCC(C)O2 |
GAMMA_-Chloro-ALPHA_-butylene | C(C)(Cl)C=C |
Heptaldehyde-1,3-butylene glycol acetal | C(CCCCC)C1OCCC(C)O1 |
Hexaldehyde-1,3-butylene glycol acetal | C(CCCC)C1OCCC(C)O1 |
Hexaldehyde-1_3-butylene_glycol_acetal | C(CCCC)C1OCCC(C)O1 |
Methyl-1,3-butylene glycol acetate | C(C)(OC)CCOC(C)=O |
Methyl-1_3-butylene_glycol_acetate | C(C)(OC)CCOC(C)=O |
Tris(N-1',2'-butylene)trimesamide | C(=O)(c1cc(cc(c1)C(=O)N2CC2CC)C(=O)N3CC3CC)N4CC4CC |
Vanillin 1, 3-butylene glycol acetal | O(C)c1cc(ccc1O)C2OCCC(C)O2 |