If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Methyl-2-(methylthio)-benzothiazolium p-toluenesulfonate | S(=O)(=O)(O)c1ccc(C)cc1.CSC2=N(C)c3ccccc3S2 |
Benzothiazolium ethiodide | C(C)N1=CSc2ccccc12 |
Benzothiazolium, 3-ethyl-, iodide | C(C)N1=CSc2ccccc12 |
Benzothiazolium, 3-methyl-, iodide | CN1=CSc2ccccc12 |
Benzothiazolium, 3-methyl-2-methylthio-, p-toluenesulfonate | S(=O)(=O)(O)c1ccc(C)cc1.CSC2=N(C)c3ccccc3S2 |
Benzothiazolium__3-ethyl-__iodide | C(C)N1=CSc2ccccc12 |
Benzothiazolium__3-methyl-__iodide | CN1=CSc2ccccc12 |