If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-Ethylbutyric acid, diester with triethylene glycol | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
2-Ethylbutyric acid, triethylene glycol diester | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
Acetic acid, triethylene glycol diester | C(COCCOCCOC(C)=O)OC(C)=O |
Butyric acid, 2-ethyl-, diester with triethylene glycol | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
Melamine, triethylene- | c1(nc(nc(n1)N2CC2)N3CC3)N4CC4 |
Methacrylic acid, diester with triethylene glycol | O(CCOCCOCCOC(=O)C(C)=C)C(=O)C(C)=C |
Octanoic acid, diester with triethylene glycol | C(=O)(CCCCCCC)OCCOCCOCCOC(=O)CCCCCCC |
Phosphoramide, N,N',N -triethylene- | P(=O)(N1CC1)(N2CC2)N3CC3 |
Phosphoramide, N,N',N-triethylene- | P(=O)(N1CC1)(N2CC2)N3CC3 |
Phosphoric acid triethylene imide | P(=O)(N1CC1)(N2CC2)N3CC3 |
Phosphoric triamide, N,N', N-triethylene- | P(=O)(N1CC1)(N2CC2)N3CC3 |
Phosphoric triamide, N,N',N -triethylene- | P(=O)(N1CC1)(N2CC2)N3CC3 |
Phosphorothioic triamide, N,N',N''-triethylene | P(=S)(N1CC1)(N2CC2)N3CC3 |
Thiophosphoramide, N,N',N'' -triethylene- | P(=S)(N1CC1)(N2CC2)N3CC3 |
Triethylene dimethacrylate | O(CCOCCOCCOC(=O)C(C)=C)C(=O)C(C)=C |
Triethylene glycol bis(2-ethyl butyrate) | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
Triethylene glycol bis(2-ethylbutyrate) | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
Triethylene glycol di(2-ethyl butyrate) | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
Triethylene glycol di-2-ethylbutyrate | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
Triethylene glycol diacetate | C(COCCOCCOC(C)=O)OC(C)=O |
Triethylene glycol dibenzoate | C(=O)(OCCOCCOCCOC(=O)c1ccccc1)c2ccccc2 |
Triethylene glycol dicaprylate | C(=O)(CCCCCCC)OCCOCCOCCOC(=O)CCCCCCC |
Triethylene glycol diglycidyl ether | C(OCCOCCOCCOCC1CO1)C2CO2 |
Triethylene glycol dimethacrylate | O(CCOCCOCCOC(=O)C(C)=C)C(=O)C(C)=C |
Triethylene glycol dimethyl ether | C(OCCOC)COCCOC |
Triethylene glycol dioctanoate | C(=O)(CCCCCCC)OCCOCCOCCOC(=O)CCCCCCC |
Triethylene glycol methyl ether | C(COCCO)OCCOC |
Triethylene glycol mono-n-butyl ether | C(COCCCC)OCCOCCO |
Triethylene glycol monobutyl ether | C(COCCCC)OCCOCCO |
Triethylene glycol monochloride | C(OCCCl)COCCO |
Triethylene glycol monomethyl ether acetate | C(OCCOCCOC)COC(C)=O |
Triethylene glycol monomethyl ether | C(COCCO)OCCOC |
Triethylene glycol n-butyl ether | C(COCCCC)OCCOCCO |
Triethylene glycol | C(OCCO)COCCO |
Triethylene glycol, bis(2,3-epoxypropyl) ether | C(OCCOCCOCCOCC1CO1)C2CO2 |
Triethylene glycol, diacetate | C(COCCOCCOC(C)=O)OC(C)=O |
Triethylene glycol, dibenzoate | C(=O)(OCCOCCOCCOC(=O)c1ccccc1)c2ccccc2 |
Triethylene phophoramide | P(=O)(N1CC1)(N2CC2)N3CC3 |
Triethylene phosphoramide | P(=O)(N1CC1)(N2CC2)N3CC3 |
Triethylene thiophosphoramide | P(=S)(N1CC1)(N2CC2)N3CC3 |