If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
5-Pyrimidinesulfonic acid, 4, 6-diamino-2-hydroxy- | S(=O)(=O)(O)c1c(N)nc(O)nc1N |
5-Pyrimidinesulfonic acid, 4,6-diamino-1, 2-dihydro-2-oxo- | S(=O)(=O)(O)c1c(N)nc(O)nc1N |
5-Pyrimidinesulfonic acid, 4,6-diamino-2-(methylthio)- | S(=O)(=O)(O)c1c(N)nc(SC)nc1N |
5-Pyrimidinesulfonic acid, 4,6-diamino-2-methylthio- | S(=O)(=O)(O)c1c(N)nc(SC)nc1N |
5-Pyrimidinesulfonic_acid__4_6-diamino-1__2-dihydro-2-oxo- | S(=O)(=O)(O)c1c(N)nc(O)nc1N |
5-Pyrimidinesulfonic_acid__4_6-diamino-2-(methylthio)- | S(=O)(=O)(O)c1c(N)nc(SC)nc1N |