If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Aciventral forte | C(C(=O)O)N(C)(C)C |
Acterol forte | C(CN1CCOCC1)N2C=NC=C2[N+](=O)[O-] |
Birutan Forte | c1cc(cc(O)c1O)C2=C(OC3OC(COC4OC(C)C(O)C(O)C4O)C(O)C(O)C3O)C(=O)c5c(O)cc(O)cc5O2 |
Dioctyl-Medo forte | C(CC(=O)OCCCCCCCC)(C(=O)OCCCCCCCC)S(=O)(=O)O |
Marisan forte | N(=O)(=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
Neolutin forte | O(C(=O)CCCCC)C1(CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C)C(C)=O |
Pomarsol Z-forte | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Pomarsol forte | C(=S)(SSC(=S)N(C)C)N(C)C |
Pomarzol Z-forte | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Pred Forte TM 1% | CC12CC(O)C3C(CCC4=CC(=O)C=CC34C)C1CCC2(O)C(=O)COC(C)=O |
Pred Forte | CC12CC(O)C3C(CCC4=CC(=O)C=CC34C)C1CCC2(O)C(=O)COC(C)=O |
Stirpan forte | C(C)(C)(C)c1cc(cc([N+](=O)[O-])c1O)[N+](=O)[O-] |
component of Endoglobin Forte | C(C(O)C(O)C(O)CO)N1c2cc(C)c(C)cc2N=C3C(=O)NC(=O)N=C13 |
component of Parafon Forte | O=C1Oc2ccc(Cl)cc2N1 |