If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Acetyl-2-thiohydantoin | C(C)(=O)N1CC(=O)NC1=S |
1-Benzoyl-2-thiohydantoin | C(=O)(c1ccccc1)N2CC(=O)NC2=S |
1-Ethyl-3-methyl-2-thiohydantoin | C(C)N1CC(=O)N(C)C1=S |
2-Thiohydantoin | O=C1CNC(=S)N1 |
3-(2-Aminoethyl)-2-thiohydantoin | C(CN)N1C(=O)CNC1=S |
3-Phenyl-5-(p-hydroxybenzyl)-2-thiohydantoin | O=C1C(NC(=S)N1c2ccccc2)Cc3ccc(O)cc3 |
5, 5-Diphenyl-2-thiohydantoin | O=C1NC(=S)NC1(c2ccccc2)c3ccccc3 |
5-Benzyl-2-thiohydantoin | C(c1ccccc1)C2NC(=S)NC2=O |
Leucine 3-phenyl-2-thiohydantoin | O=C1C(CC(C)C)NC(=S)N1c2ccccc2 |
Leucine, 3-phenyl-2-thiohydantoin | O=C1C(CC(C)C)NC(=S)N1c2ccccc2 |
Thiohydantoin | O=C1CNC(=S)N1 |
Throsine, 3-phenyl-2-thiohydantoin | O=C1C(NC(=S)N1c2ccccc2)Cc3ccc(O)cc3 |
Tyrosine, 3-phenyl-2-thiohydantoin | O=C1C(NC(=S)N1c2ccccc2)Cc3ccc(O)cc3 |
pseudo-Thiohydantoin | O=C1CSC(=N)N1 |