If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Methylbenzhydrol | C(O)(c1ccccc1)c2ccccc2C |
4, 4'-Dichloro-ALPHA_-methylbenzhydrol | C(C)(O)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
4-Methylbenzhydrol | C(O)(c1ccccc1)c2ccc(C)cc2 |
ALPHA_-(p-Chlorobenzyl)-4-diethylaminoethoxy-4'-methylbenzhydrol | C(O)(Cc1ccc(Cl)cc1)(c2ccc(C)cc2)c3ccc(cc3)OCCN(CC)CC |
ALPHA_-Methylbenzhydrol | C(C)(O)(c1ccccc1)c2ccccc2 |
o-Methylbenzhydrol | C(O)(c1ccccc1)c2ccccc2C |
p-Methylbenzhydrol | C(O)(c1ccccc1)c2ccc(C)cc2 |