If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(Diethylamino)ethyl acrylate | N(CC)(CC)CCOC(=O)C=C |
1, 3-Butadiene-methyl acrylate adduct | C(=O)(OC)C1CCC=CC1 |
1-Hexanol, 2-ethyl-, acrylate | C(CC)(CCCC)COC(=O)C=C |
1-Propanol, 2,3-epoxy-, acrylate | C(OC(=O)C=C)C1CO1 |
2,2,2-Trifluoroethyl acrylate | O(CC(F)(F)F)C(=O)C=C |
2,2-Dimethyltrimethylene acrylate | C(OC(=O)C=C)C(C)(C)COC(=O)C=C |
2,2-Dinitropropyl acrylate | C(C)(COC(=O)C=C)([N+](=O)[O-])[N+](=O)[O-] |
2,3-Epoxypropyl acrylate | C(OC(=O)C=C)C1CO1 |
2-(Diethylamino)ethyl acrylate | N(CC)(CC)CCOC(=O)C=C |
2-(Dimethylamino)ethyl acrylate | C(=O)(C=C)OCCN(C)C |
2-Butoxyethoxy acrylate | C(OCCCC)COC(=O)C=C |
2-Butoxyethyl acrylate | C(OCCCC)COC(=O)C=C |
2-Chloroethyl acrylate | C(=O)(C=C)OCCCl |
2-Cyanoethyl acrylate | C(=O)(C=C)OCCC#N |
2-Ethoxyethyl acrylate | C(=O)(C=C)OCCOCC |
2-Ethyl-1-hexyl acrylate | C(CC)(CCCC)COC(=O)C=C |
2-Ethylbutyl acrylate | C(CC)(CC)COC(=O)C=C |
2-Ethylhexyl acrylate | C(CC)(CCCC)COC(=O)C=C |
2-Methoxyethanol, acrylate | C(=O)(C=C)OCCOC |
2-Methoxyethoxy acrylate | C(=O)(C=C)OCCOC |
2-Methoxyethyl acrylate | C(=O)(C=C)OCCOC |
Acrylamide-acrylate copolymer | C(=O)(O)C=C.C=CC(N)=O |
Acrylamide-acrylate polymer | C(=O)(O)C=C.C=CC(N)=O |
Acrylate d'ethyle(FRENCH) | C(=O)(C=C)OCC |
Acrylate de methyle (FRENCH) | C(=O)(C=C)OC |
Allyl acrylate | C(=O)(C=C)OCC=C |
Amyl acrylate | C(=O)(C=C)OCCCCC |
BETA_-(Diethylamino)ethyl acrylate | N(CC)(CC)CCOC(=O)C=C |
BETA_-Chloroethyl acrylate | C(=O)(C=C)OCCCl |
Benzyl acrylate | C(OC(=O)C=C)c1ccccc1 |
Butyl acrylate | C(=O)(C=C)OCCCC |
Butyl cellosolve acrylate | C(OCCCC)COC(=O)C=C |
Calcium acrylate | C(=O)(O)C=C |
Cellosolve acrylate | C(=O)(C=C)OCCOCC |
Cetyl acrylate | C(CCCCCCCCCCCC)CCCOC(=O)C=C |
Chloroethyl acrylate | C(=O)(C=C)OCCCl |
Choline, chloride, imidazole-4-acrylate, monohydrochloride | C(=CC(=O)OCCN(C)(C)C)C1=CNC=N1 |
Choline, hydroxide, imidazole-4-acrylate | C(=CC(=O)OCCN(C)(C)C)C1=CNC=N1 |
Cyanoethyl acrylate | C(=O)(C=C)OCCC#N |
Cyclohexyl acrylate | O(C(=O)C=C)C1CCCCC1 |
Decyl acrylate | C(CCCCCCCC)COC(=O)C=C |
Dimethylaminoethyl acrylate | C(=O)(C=C)OCCN(C)C |
Dodecyl acrylate | C(CCCCCCCCCC)COC(=O)C=C |
Ethanol, 2-chloro-, acrylate | C(=O)(C=C)OCCCl |
Ethanol, 2-ethoxy-, acrylate | C(=O)(C=C)OCCOCC |
Ethanol, 2-methoxy-, acrylate | C(=O)(C=C)OCCOC |
Ethoxyethyl acrylate | C(=O)(C=C)OCCOCC |
Ethyl 3-(5-nitro-2-furyl)acrylate | C(=CC(=O)OCC)C1=CC=C(O1)[N+](=O)[O-] |
Ethyl ALPHA_-methyl acrylate | C(=O)(OCC)C(C)=C |
Ethyl BETA_-(2-furyl)acrylate | C(=CC(=O)OCC)C1=CC=CO1 |
Ethyl BETA_-(5-nitro-2-furyl)acrylate | C(=CC(=O)OCC)C1=CC=C(O1)[N+](=O)[O-] |
Ethyl acrylate | C(=O)(C=C)OCC |
Ethyl acrylate, inhibited | C(=O)(C=C)OCC |
Ethyl-2-cyano-3-(4-(diethylamino)phenyl)acrylate | N(CC)(CC)c1ccc(cc1)C=C(C#N)C(=O)OCC |
Ethylene acrylate | O(CCOC(=O)C=C)C(=O)C=C |
Ethylene glycol monoethyl ether acrylate | C(=O)(C=C)OCCOCC |
Ethylene glycol monomethyl ether acrylate | C(=O)(C=C)OCCOC |
Ethylene_glycol_monomethyl_ether_acrylate | C(=O)(C=C)OCCOC |
Glycidyl acrylate | C(OC(=O)C=C)C1CO1 |
Glycol monomethyl ether acrylate | C(=O)(C=C)OCCOC |
Heptyl acrylate | C(CCCCC)COC(=O)C=C |
Hexadecyl acrylate | C(CCCCCCCCCCCC)CCCOC(=O)C=C |
Hexyl acrylate | C(CCCCC)OC(=O)C=C |
Hydracrylonitrile acrylate | C(=O)(C=C)OCCC#N |
Isobutyl acrylate | C(=O)(C=C)OCC(C)C |
Isopropyl acrylate | C(=O)(C=C)OC(C)C |
Lauryl acrylate | C(CCCCCCCCCC)COC(=O)C=C |
Methoxyethyl acrylate | C(=O)(C=C)OCCOC |
Methyl 2-allyl acrylate | C(=C)(CC=C)C(=O)OC |
Methyl acrylate | C(=O)(C=C)OC |
Methyl cellosolve acrylate | C(=O)(C=C)OCCOC |
Methyl-BETA_-(4-pyridyl)acrylate | C(=CC(=O)OC)c1ccncc1 |
N,N-(Diethylamino)ethyl acrylate | N(CC)(CC)CCOC(=O)C=C |
Octyl acrylate | O(CCCCCCCC)C(=O)C=C |
Palmityl acrylate | C(CCCCCCCCCCCC)CCCOC(=O)C=C |
Pamityl acrylate | C(CCCCCCCCCCCC)CCCOC(=O)C=C |
Pentyl acrylate | C(=O)(C=C)OCCCCC |
Propyl acrylate | C(=O)(C=C)OCCC |
Tetrahydrofurfuryl acrylate | C(OC(=O)C=C)C1CCCO1 |
Tridecyl acrylate | C(CCCCCCCCCCC)COC(=O)C=C |
Trimethyllead acrylate | O(C(=O)C=C)[Pb](C)(C)C |
Vinyl acrylate | C(=O)(C=C)OC=C |
n-Amyl acrylate | C(=O)(C=C)OCCCCC |
n-Butyl acrylate | C(=O)(C=C)OCCCC |
n-Decyl acrylate | C(CCCCCCCC)COC(=O)C=C |
n-Dodecyl acrylate | C(CCCCCCCCCC)COC(=O)C=C |
n-Heptyl acrylate | C(CCCCC)COC(=O)C=C |
n-Hexyl acrylate | C(CCCCC)OC(=O)C=C |
n-Lauryl acrylate | C(CCCCCCCCCC)COC(=O)C=C |
n-Octyl acrylate | O(CCCCCCCC)C(=O)C=C |
n-Pentyl acrylate | C(=O)(C=C)OCCCCC |
n-Propyl acrylate | C(=O)(C=C)OCCC |
sec-Butyl acrylate | O(C(C)CC)C(=O)C=C |
tert-Butyl acrylate | O(C(=O)C=C)C(C)(C)C |
z-Methylpropyl acrylate | C(=O)(C=C)OCC(C)C |