If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Acetyl-1-phenyl 4-methoxybenzoate | O(C(=O)c1ccc(OC)cc1)c2ccccc2C(C)=O |
Ethyl 4-hydroxy-3-methoxybenzoate | C(=O)(OCC)c1ccc(O)c(OC)c1 |
Ethyl 4-methoxybenzoate | C(=O)(OCC)c1ccc(OC)cc1 |
Ethyl p-methoxybenzoate | C(=O)(OCC)c1ccc(OC)cc1 |
Methyl 2-methoxybenzoate | C(=O)(OC)c1ccccc1OC |
Methyl 3-methoxybenzoate | C(=O)(OC)c1cccc(OC)c1 |
Methyl 4-hydroxy-3-methoxybenzoate | C(=O)(OC)c1ccc(O)c(OC)c1 |
Methyl 4-methoxybenzoate | C(=O)(OC)c1ccc(OC)cc1 |
Methyl m-methoxybenzoate | C(=O)(OC)c1cccc(OC)c1 |
Methyl o-methoxybenzoate | C(=O)(OC)c1ccccc1OC |
Methyl p-methoxybenzoate | C(=O)(OC)c1ccc(OC)cc1 |
Propyl p-methoxybenzoate | C(=O)(OCCC)c1ccc(OC)cc1 |