If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(Dimethylamino)ethanethiol hydrochloride | C(CS)N(C)C |
1, 2-Ethanethiol | C(S)CS |
2, 2'-Oxydi-1-ethanethiol | O(CCS)CCS |
2-((2-Octyl)amino)ethanethiol hydrogen sulfate (ester) | N(CCSS(=O)(=O)O)C(C)CCCCCC |
2-(Decylamino)ethanethiol hydrogen sulfate (ester) | C(NCCCCCCCCCC)CSS(=O)(=O)O |
2-(Decylamino)ethanethiol | C(CCCCCC)CCCNCCS |
2-(Diethylamino)ethanethiol | N(CC)(CC)CCS |
2-(Dimethylamino)ethanethiol hydrochloride | C(CS)N(C)C |
2-(n-Decylamino)ethanethiol | C(CCCCCC)CCCNCCS |
2-Hydroxy-1-ethanethiol | C(O)CS |
Ethanethiol | C(C)S |
Ethanethiol, 2,2'-(1, 2-ethanediylbis(oxy))bis- | C(OCCS)COCCS |
Ethanethiol, 2,2'-(ethylenedioxy)di- | C(OCCS)COCCS |
Ethanethiol, 2,2'-oxybis- | O(CCS)CCS |
Ethanethiol, 2,2'-oxydi- | O(CCS)CCS |
Ethanethiol, 2,2'-thiobis- | S(CCS)CCS |
Ethanethiol, 2,2'-thiodi- | S(CCS)CCS |
Ethanethiol, 2-((1-methylheptyl)amino)-, hydrogen sulfate (ester) | N(CCSS(=O)(=O)O)C(C)CCCCCC |
Ethanethiol, 2-((2-octyl)amino)-, hydrogen sulfate (ester) | N(CCSS(=O)(=O)O)C(C)CCCCCC |
Ethanethiol, 2-((3-aminopropyl)amino)-, dihydrochloride | C(CCN)NCCS |
Ethanethiol, 2-((4-phenylbutyl)amino)-, hydrogen sulfate (ester) | C(CCCNCCSS(=O)(=O)O)c1ccccc1 |
Ethanethiol, 2-((4-phenylbutyl)amino)-,hydrogen sulfate (ester) | C(CCCNCCSS(=O)(=O)O)c1ccccc1 |
Ethanethiol, 2-(acetylamino)- | N(CCS)C(C)=O |
Ethanethiol, 2-(decylamino)- (8CI 9CI) | C(CCCCCC)CCCNCCS |
Ethanethiol, 2-(decylamino)-, hydrogen sulfate (ester) | C(NCCCCCCCCCC)CSS(=O)(=O)O |
Ethanethiol, 2-(diethylamino)- | N(CC)(CC)CCS |
Ethanethiol, 2-(dimethylamino)-, hydrochloride | C(CS)N(C)C |
Ethanethiol, 2-amino-, dihydrogen phosphate, monosodium salt | S(CCN)P(=O)(O)O |
Ethanethiol, 2-amino-, hydrochloride | C(N)CS |
Ethanethiol, 2-amino-N-carboxymethyl-, hydrochloride | C(NCCS)C(=O)O |
Ethanethiol, 2-phenoxy- | O(CCS)c1ccccc1 |
Ethanethiol, 2-phthalimido- | O=C1N(CCS)C(=O)c2ccccc12 |
Ethanethiol__2-((3-aminopropyl)amino)-__dihydrochloride | C(CCN)NCCS |
Ethanethiol__2-(decylamino)-_(8CI_9CI) | C(CCCCCC)CCCNCCS |
Ethanethiol__2-(dimethylamino)-__hydrochloride | C(CS)N(C)C |
Ethanethiol__2-phenoxy- | O(CCS)c1ccccc1 |
Ethanethiol__2_2'-(1__2-ethanediylbis(oxy))bis- | C(OCCS)COCCS |