If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-(Diphenylmethylene)-1,1-dimethylpiperidinium methylsulfate | S(=O)(=O)(O)OC.CN1(C)CCC(CC1)=C(c2ccccc2)c3ccccc3 |
5-Methylphenazine methylsulfate | S(=O)(=O)(O)OC.Cn1c2ccccc2nc3ccccc13 |
Ammonium O-methylsulfate | S(=O)(=O)(O)OC |
N, N-Dimethyl-4-piperidylidene-1,1-diphenylmethane methylsulfate | S(=O)(=O)(O)OC.CN1(C)CCC(CC1)=C(c2ccccc2)c3ccccc3 |
Prantal methylsulfate | S(=O)(=O)(O)OC.CN1(C)CCC(CC1)=C(c2ccccc2)c3ccccc3 |