If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
10H-Dibenzo(b,e)thiopyran-10-one 5-oxide | O=C1c2ccccc2S(=O)c3ccccc13 |
10H-Dibenzo(b_e)thiopyran-10-one_5-oxide | O=C1c2ccccc2S(=O)c3ccccc13 |
1H,3H-Naphtho(1,8-cd)thiopyran | c12c3cccc2CSCc1ccc3 |
1H_3H-Naphtho(1_8-cd)thiopyran | c12c3cccc2CSCc1ccc3 |
2H-Thiopyran, 3,4-dihydro- | C1CCSC=C1 |
2H-Thiopyran, D-glucopyranose deriv. | C(O)C1SC(O)C(O)C(O)C1O |
2H-Thiopyran, tetrahydro- | C1CCSCC1 |
2H-Thiopyran, tetrahydro-, 1,1-dioxide | O=S1(=O)CCCCC1 |
2H-Thiopyran__3_4-dihydro- | C1CCSC=C1 |
2H-Thiopyran__D-glucopyranose_deriv. | C(O)C1SC(O)C(O)C(O)C1O |
2H-Thiopyran__tetrahydro- | C1CCSCC1 |
2H-Thiopyran__tetrahydro-__1_1-dioxide | O=S1(=O)CCCCC1 |
4H-Thiopyran, 4-oxo- | O=C1C=CSC=C1 |
4H-Thiopyran-4-one | O=C1C=CSC=C1 |
4H-Thiopyran-4-one, 2,6-diphenyl-, 1,1-dioxide | O=S1(=O)C(=CC(=O)C=C1c2ccccc2)c3ccccc3 |
4H-Thiopyran-4-one, tetrahydro- | O=C1CCSCC1 |
4H-Thiopyran-4-one, tetrahydro-, 1,1-dioxide | O=S1(=O)CCC(=O)CC1 |
4H-Thiopyran-4-one__2_6-diphenyl-__1_1-dioxide | O=S1(=O)C(=CC(=O)C=C1c2ccccc2)c3ccccc3 |
4H-Thiopyran-4-one__tetrahydro-__1_1-dioxide | O=S1(=O)CCC(=O)CC1 |
4H-Thiopyran__4-oxo- | O=C1C=CSC=C1 |
6H-Dibenzo(b,d)thiopyran | c12ccccc2CSc3c1cccc3 |
6H-Dibenzo(b_d)thiopyran | c12ccccc2CSc3c1cccc3 |
Tetrahydro-2H-thiopyran | C1CCSCC1 |
Tetrahydro-4H-thiopyran-4-one | O=C1CCSCC1 |
Thiopyran-4-one | O=C1C=CSC=C1 |
Urea, 1-(2-chloroethyl)-1-nitroso-3-(tetrahydro-2H-thiopyran-4-yl)- | N(C(=O)N(N=O)CCCl)C1CCSCC1 |
Urea, 1-(2-fluoroethyl)-1-nitroso-3-(tetrahydro-2H-thiopyran-4-yl)- | N(C(=O)N(N=O)CCF)C1CCSCC1 |