If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Sulfamic acid | S(N)(=O)(=O)O |
Sulfamic acid, 1,7-heptanediyl ester | O(CCCCCCCOS(N)(=O)=O)S(N)(=O)=O |
Sulfamic acid, N, N-dimethyl-, p-propionamidophenyl ester | O(c1ccc(cc1)NC(=O)CC)S(=O)(=O)N(C)C |
Sulfamic acid, N,N-dimethyl-, o-aminophenyl ester | O(c1ccccc1N)S(=O)(=O)N(C)C |
Sulfamic acid, cyclohexyl- | N(C1CCCCC1)S(=O)(=O)O |
Sulfamic acid, cyclohexyl-, monosodium salt | N(C1CCCCC1)S(=O)(=O)O |
Sulfamic acid, dimethyl- | S(=O)(=O)(O)N(C)C |
Sulfamic acid, dimethyl-, 2-aminophenyl ester | O(c1ccccc1N)S(=O)(=O)N(C)C |
Sulfamic acid, dimethyl-, 4-((1-oxopropyl)amino)phenyl ester | O(c1ccc(cc1)NC(=O)CC)S(=O)(=O)N(C)C |
Sulfamic acid, monosilver(1+) salt | S(N)(=O)(=O)O |
Sulfamic acid, nickel(2+) salt (2:1) | S(N)(=O)(=O)O |
Sulfamic acid, silver(1+) salt (AgOSO2NH2) | S(N)(=O)(=O)O |
Sulfamic_acid__1_7-heptanediyl_ester | O(CCCCCCCOS(N)(=O)=O)S(N)(=O)=O |
Sulfamic_acid__N_N-dimethyl-__o-aminophenyl_ester | O(c1ccccc1N)S(=O)(=O)N(C)C |
Sulfamic_acid__cyclohexyl-__monosodium_salt | N(C1CCCCC1)S(=O)(=O)O |
Sulfamic_acid__dimethyl- | S(=O)(=O)(O)N(C)C |
Sulfamic_acid__dimethyl-__4-((1-oxopropyl)amino)phenyl_ester | O(c1ccc(cc1)NC(=O)CC)S(=O)(=O)N(C)C |
Sulfamic_acid__nickel(2+)_salt_(2:1) | S(N)(=O)(=O)O |
Sulfamic_acid__silver(1+)_salt_(AgOSO2NH2) | S(N)(=O)(=O)O |