If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(3,4-Dimethoxybenzyl)-6,7-dimethoxyisoquinoline hydrochloride | C(c1ccc(OC)c(OC)c1)c2nccc3cc(OC)c(OC)cc23 |
2,4-Diamino-5-(3, 4-dimethoxybenzyl)pyrimidine | C(c1ccc(OC)c(OC)c1)c2cnc(N)nc2N |
3, 4-Dimethoxybenzyl alcohol | O(C)c1cc(CO)ccc1OC |
3,4-Dimethoxybenzyl cyanide | O(C)c1cc(CC#N)ccc1OC |
VOACANGINE 11-(3,4-DIMETHOXYBENZYL) | c1cc(OC)c(Cc2ccc(OC)c(OC)c2)c3c1NC4=C3CCN5CC6CC(CC)C5C4(C6)C(=O)OC |
VOACANGINE 13-(3,4-DIMETHOXYBENZYL) | c1c(Cc2ccc(OC)c(OC)c2)c(OC)cc3c1NC4=C3CCN5CC6CC(CC)C5C4(C6)C(=O)OC |
VOACANGINE_11-(3_4-DIMETHOXYBENZYL) | c1cc(OC)c(Cc2ccc(OC)c(OC)c2)c3c1NC4=C3CCN5CC6CC(CC)C5C4(C6)C(=O)OC |
VOACANGINE_13-(3_4-DIMETHOXYBENZYL) | c1c(Cc2ccc(OC)c(OC)c2)c(OC)cc3c1NC4=C3CCN5CC6CC(CC)C5C4(C6)C(=O)OC |