If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Serisol Brilliant Blue 2B | N(CCO)c1ccc(NCCO)c2C(=O)c3ccccc3C(=O)c12 |
Serisol Brilliant Blue BG | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Serisol Brilliant Blue BP | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Serisol Brilliant Blue FF | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Serisol Brilliant Blue G | O=C1c2ccccc2C(=O)c3c(NC)ccc(NC)c13 |
Serisol Brilliant Blue R | O=C1c2ccccc2C(=O)c3c(O)ccc(NC)c13 |
Serisol Brilliant Red X 3B | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Serisol Brilliant Red X3B | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Serisol Brilliant Violet 2R | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Serisol Fast Blue Green B | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Serisol Fast Red 2B | O=C1c2ccccc2C(=O)c3c(O)ccc(N)c13 |
Serisol Fast Scarlet BD | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Serisol Fast Violet B | O=C1c2c(N)ccc(N)c2C(=O)c3cccc([N+](=O)[O-])c13 |
Serisol Fast Yellow A | [N+](=O)([O-])c1cc(ccc1Nc2ccc(O)cc2)[N+](=O)[O-] |
Serisol Fast Yellow N5RD | N(=Nc1ccc(cc1)N=Nc2ccccc2)c3ccc(O)c(C)c3 |
Serisol Fast Yellow PL | [N+](=O)([O-])c1cc(ccc1Nc2ccc(N)cc2)[N+](=O)[O-] |
Serisol Orange YL | O=C1c2ccccc2C(=O)c3ccc(C)c(N)c13 |
Serisol Yellow 2G | N(c1ccccc1)c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |