If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Benzoyl-1,2-dihydrobenzo(f)quinaldonitrile | C(=O)(c1ccccc1)N2C(C#N)C=Cc3c2ccc4ccccc34 |
2,3-Dihydrobenzo(b)thiophene 1,1-dioxide | O=S1(=O)CCc2ccccc12 |
4-Oxo-2-(BETA_-chloroethyl)-2,3-dihydrobenzo-1,3-oxazine | O=C1NC(CCCl)Oc2ccccc12 |
5,12-Dihydrobenzo(b)phenazine-2-carboxylic acid ethyl ester | C(=O)(OCC)c1ccc2Nc3cc4ccccc4cc3Nc2c1 |
6, 7-Dihydrobenzo(b)thiophen-4(5H)-one | O=C1CCCC2=C1C=CS2 |