If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Ma-4oeaa (russian) | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
OeKolp | C(CC)(c1ccc(O)cc1)=C(CC)c2ccc(O)cc2 |
Oelsauere | C(CC=CCCCCCCCC)CCCCCC(=O)O |
Oenanthal | C(CCC)CCC=O |
Oenanthaldehyde | C(CCC)CCC=O |
Ethyl oenanthate | C(=O)(OCC)CCCCCC |
Testosterone oenanthate | CC12CCC(=O)C=C2CCC3C1CCC4(C)C(CCC34)OC(=O)CCCCCC |
Oenanthic acid | C(CCCC)CC(=O)O |
Oenanthic aldehyde | C(CCC)CCC=O |
Oenanthic ether | C(=O)(OCC)CCCCCC |
Oenanthic_aldehyde | C(CCC)CCC=O |
Aether oenanthicus | C(=O)(OCC)CCCCCC |
Oenanthol | C(CCC)CCC=O |
Ethyl oenanthylate | C(=O)(OCC)CCCCCC |
Oenanthylic acid | C(CCCC)CC(=O)O |
Oenethyl | C(C)(NC)CCCCC |
Oenidin | Oc1cc2c(O)cc(O)cc2oc1c3cc(OC)c(O)c(OC)c3 |
OENIN | O(C1OC(CO)C(O)C(O)C1O)c2cc3c(O)cc(O)cc3oc2c4cc(OC)c(O)c(OC)c4 |
Oestergon | CC12CCC3c4ccc(O)cc4CCC3C1CCC2O |
oestra | A sub-index is available for oestra... |
oestradiol | A sub-index is available for oestradiol... |
Neo-Oestranol I | C(CC)(c1ccc(O)cc1)=C(CC)c2ccc(O)cc2 |
neo-Oestranol 1 | C(CC)(c1ccc(O)cc1)=C(CC)c2ccc(O)cc2 |
Oestrasid | C(=CC)(c1ccc(O)cc1)C(=CC)c2ccc(O)cc2 |
17-Ethynyl-3-methoxy-1,3,5(10)-oestratien-17BETA_-ol | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
1,3, 5(10)-Oestratrien-3-ol-17-one | CC12CCC3c4ccc(O)cc4CCC3C1CCC2=O |
3-Hydroxy-1,3,5(10)-oestratrien-17-one | CC12CCC3c4ccc(O)cc4CCC3C1CCC2=O |
3-Methoxy-17ALPHA_-ethynyl-1,3,5(10)-oestratrien-17BETA_-ol | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
DELTA_-1,3, 5-Oestratrien-3BETA_-ol-17-one | CC12CCC3c4ccc(O)cc4CCC3C1CCC2=O |
DELTA_-1_3__5-Oestratrien-3BETA_-ol-17-one | CC12CCC3c4ccc(O)cc4CCC3C1CCC2=O |
oestratriene | A sub-index is available for oestratriene... |
Oestratriol | CC12CCC3c4ccc(O)cc4CCC3C1CC(O)C2O |
17ALPHA_-Allyl-4-oestrene-17BETA_-ol | CC12CCC3C4CCCC=C4CCC3C1CCC2(O)CC=C |
Oestrenolon | CC12CCC3C4CCC(=O)C=C4CCC3C1CCC2O |
Oestrin | CC12CCC3c4ccc(O)cc4CCC3C1CCC2=O |
16ALPHA_,17BETA_-Oestriol | CC12CCC3c4ccc(O)cc4CCC3C1CC(O)C2O |
Oestriol | CC12CCC3c4ccc(O)cc4CCC3C1CC(O)C2O |
Oestrodiene | C(=CC)(c1ccc(O)cc1)C(=CC)c2ccc(O)cc2 |
Oestroform (BDH) | CC12CCC3c4ccc(OC(=O)c5ccccc5)cc4CCC3C1CCC2O |
Oestroform | CC12CCC3c4ccc(OC(=O)c5ccccc5)cc4CCC3C1CCC2O |
Oestrogenine | C(CC)(c1ccc(O)cc1)=C(CC)c2ccc(O)cc2 |
Percutatrine oestrogenique iscovesco | C(CC)(c1ccc(O)cc1)=C(CC)c2ccc(O)cc2 |
Oestroglandol | CC12CCC3c4ccc(O)cc4CCC3C1CCC2O |
Oestromenin | C(CC)(c1ccc(O)cc1)=C(CC)c2ccc(O)cc2 |
Depot-Oestromenine | C(CC)(c1ccc(OC)cc1)=C(CC)c2ccc(OC)cc2 |
Oestromensyl | C(CC)(c1ccc(O)cc1)=C(CC)c2ccc(O)cc2 |
Oestromienin | C(CC)(c1ccc(O)cc1)=C(CC)c2ccc(O)cc2 |
Depot-Oestromon | C(CC)(c1ccc(OC)cc1)=C(CC)c2ccc(OC)cc2 |
OESTRONE | CC12CCC3c4ccc(O)cc4CCC3C1CCC2=O |
Oestrone methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2=O |
Oestrone | CC12CCC3c4ccc(O)cc4CCC3C1CCC2=O |
Oestroperos | CC12CCC3c4ccc(O)cc4CCC3C1CCC2=O |
Oestroral | C(=CC)(c1ccc(O)cc1)C(=CC)c2ccc(O)cc2 |