If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
BMK (fungicide) | N(C(=O)OC)C1=Nc2ccccc2N1 |
Crag fruit fungicide 34 | C(CCCCCCCCCCCCCCCC)C1=NCCN1 |
Crag fungicide 974 | CN1CN(C)CSC1=S |
DCNA (fungicide) | [N+](=O)([O-])c1cc(Cl)c(N)c(Cl)c1 |
Dichloran (amine fungicide) | [N+](=O)([O-])c1cc(Cl)c(N)c(Cl)c1 |
Dow dormant fungicide | Clc1c(Cl)c(Cl)c(O)c(Cl)c1Cl |
Esso fungicide 406 | S(N1C(=O)C2CC=CCC2C1=O)C(Cl)(Cl)Cl |
Ethazole (fungicide) | C(Cl)(Cl)(Cl)C1=NSC(OCC)=N1 |
F 220 (fungicide) | C(CCCCCCCCCCCC)N1CC(C)OC(C)C1 |
Fungicide 1991 | C(=O)(NCCCC)N1C(NC(=O)OC)=Nc2ccccc12 |
Fungicide 337 | C(CCCCCCCCCCCCCCCC)C1=NCCN1CCO |
Fungicide D-1991 | C(=O)(NCCCC)N1C(NC(=O)OC)=Nc2ccccc12 |
Fungicide GM | C(c1cc(Cl)ccc1O)c2cc(Cl)ccc2O |
Fungicide M | C(c1cc(Cl)ccc1O)c2cc(Cl)ccc2O |
Fungicide R | OC(C)=O.c1ccccc1 |
Hexasan, fungicide | OC(C)=O.c1ccccc1 |
NF 35, fungicide | N(C(=S)NC(=O)OCC)c1ccccc1NC(=S)NC(=O)OCC |
R 8 (fungicide) | C(N)(=N)NC#N.C |
Soil Fungicide 1823 | O(C)c1cc(Cl)c(OC)cc1Cl |
Tag Fungicide | OC(C)=O.c1ccccc1 |
VPM (fungicide) | C(=S)(S)NC |