If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Erionyl Blue S5R | N(c1ccccc1)c2ccc(N=Nc3ccc(N=Nc4cccc(c4)S(=O)(=O)O)c5ccccc35)c6cccc(c26)S(=O)(=O)O |
Erionyl Blue SGR | N(c1ccc(C)cc1)c2ccc(N=Nc3ccc(N=Nc4cccc(c4)S(=O)(=O)O)c5ccccc35)c6cccc(c26)S(=O)(=O)O |
Erionyl Cyanine E-JR | N(c1ccc(O)c2C(=O)c3ccccc3C(=O)c12)c4ccc(C)cc4S(=O)(=O)O |
Erionyl Green GL | N(c1ccc(Nc2ccc(C)cc2S(=O)(=O)O)c3C(=O)c4ccccc4C(=O)c13)c5ccc(C)cc5S(=O)(=O)O |
Erionyl Red E-GR | N(=Nc1ccc(cc1)N=Nc2ccccc2)c3c(O)ccc4cc(cc(c34)S(=O)(=O)O)S(=O)(=O)O |
Erionyl Rubine E-2BFL | N(c1ccc2N(C)C(=O)C=C3c4ccccc4C(=O)c1c23)c5ccc(C)cc5S(=O)(=O)O |
Erionyl Rubine ER | N(c1ccc2N(C)C(=O)C=C3c4ccccc4C(=O)c1c23)c5ccc(C)cc5S(=O)(=O)O |
Erionyl Yellow 2G | S(=O)(=O)(O)c1cc(Cl)ccc1N2N=C(C)C(N=Nc3ccc(cc3)OS(=O)(=O)c4ccc(C)cc4)C2=O |
Erionyl Yellow E-RL | O=C1C(N=Nc2ccc(C)c(c2)S(=O)(=O)Nc3ccccc3)C(C)=NN1c4ccc(cc4)S(=O)(=O)O |