If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
6-(Dimethylamino)quinaldine | N(C)(C)c1ccc2nc(C)ccc2c1 |
Quinaldine 1-oxide | O=n1c(C)ccc2ccccc12 |
Quinaldine Blue (USAN) | C(C)N1C(=CC=Cc2ccc3ccccc3n2CC)C=Cc4ccccc14 |
Quinaldine N-oxide | O=n1c(C)ccc2ccccc12 |
Quinaldine Red | C(C)n1c(C=Cc2ccc(cc2)N(C)C)ccc3ccccc13 |
Quinaldine blue | C(C)N1C(=CC=Cc2ccc3ccccc3n2CC)C=Cc4ccccc14 |
Quinaldine ethiodide | C(C)n1c(C)ccc2ccccc12 |
Quinaldine | Cc1ccc2ccccc2n1 |
Quinaldine, 1,2,3,4-tetrahydro- | CC1CCc2ccccc2N1 |
Quinaldine, 1-oxide | O=n1c(C)ccc2ccccc12 |
Quinaldine, 4-chloro- | Clc1cc(C)nc2ccccc12 |
Quinaldine, 4-nitro-, 1-oxide | [N+](=O)([O-])c1cc(C)n(=O)c2ccccc12 |
Quinaldine, 5,8-dinitro-6-methoxy- | [N+](=O)([O-])c1c(OC)cc([N+](=O)[O-])c2nc(C)ccc12 |
Quinaldine, 5-((p-(dimethylamino)phenyl)azo)- | N(=Nc1ccc(cc1)N(C)C)c2cccc3nc(C)ccc23 |
Quinaldine, 6-(dimethylamino)- | N(C)(C)c1ccc2nc(C)ccc2c1 |
Quinaldine, 6-ethoxy- | O(CC)c1ccc2nc(C)ccc2c1 |
Quinaldine, 6-methoxy- | O(C)c1ccc2nc(C)ccc2c1 |
Quinaldine, 8-chloro- | Clc1cccc2ccc(C)nc12 |
Quinaldine, 8-nitro- | [N+](=O)([O-])c1cccc2ccc(C)nc12 |