If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Isoamyl glycerol ether | C(OCCC(C)C)C(O)CO |
1-Isoamyl-3,7-dimethylxanthine | O=C1N(CCC(C)C)C(=O)N(C)C2=C1N(C)C=N2 |
5-Isoamyl-5-ethylbarbituric acid | C(CC(C)C)C1(CC)C(=O)NC(=O)NC1=O |
ALPHA_-Isoamyl-GAMMA_-butyrolactone | C(CC(C)C)C1CCOC1=O |
Benzyl isoamyl ether | C(OCCC(C)C)c1ccccc1 |
Isoamyl acetate | C(CC(C)C)OC(C)=O |
Isoamyl alcohol | C(CO)C(C)C |
Isoamyl alkohol(CZECH) | C(CO)C(C)C |
Isoamyl benzoate | C(=O)(OCCC(C)C)c1ccccc1 |
Isoamyl benzyl ether | C(OCCC(C)C)c1ccccc1 |
Isoamyl bromide | C(CBr)C(C)C |
Isoamyl butanoate | C(=O)(CCC)OCCC(C)C |
Isoamyl butylate | C(=O)(CCC)OCCC(C)C |
Isoamyl butyrate | C(=O)(CCC)OCCC(C)C |
Isoamyl chloride | C(CCl)C(C)C |
Isoamyl cyanide | C(CC#N)C(C)C |
Isoamyl disulfide | C(SSCCC(C)C)CC(C)C |
Isoamyl ethanoate | C(CC(C)C)OC(C)=O |
Isoamyl ether | C(OCCC(C)C)CC(C)C |
Isoamyl formate | C(COC=O)C(C)C |
Isoamyl isovalerate | C(=O)(OCCC(C)C)CC(C)C |
Isoamyl laurate | C(=O)(CCCCCCCCCCC)OCCC(C)C |
Isoamyl mandelate | C(O)(C(=O)OCCC(C)C)c1ccccc1 |
Isoamyl methanoate | C(COC=O)C(C)C |
Isoamyl nitrite | C(CON=O)C(C)C |
Isoamyl o-hydroxybenzoate | C(=O)(OCCC(C)C)c1ccccc1O |
Isoamyl oxide | C(OCCC(C)C)CC(C)C |
Isoamyl phenylacetate | C(C(=O)OCCC(C)C)c1ccccc1 |
Isoamyl propanoate | C(=O)(CC)OCCC(C)C |
Isoamyl propionate | C(=O)(CC)OCCC(C)C |
Isoamyl salicylate | C(=O)(OCCC(C)C)c1ccccc1O |
Isoamyl sulfoxide | S(=O)(CCC(C)C)CCC(C)C |
Isoamyl valerianate | C(=O)(OCCC(C)C)CC(C)C |
Mandelic acid isoamyl ester | C(O)(C(=O)OCCC(C)C)c1ccccc1 |
sec-Isoamyl alcohol | C(C)(C)C(C)O |
tert-Isoamyl alcohol | C(C)(C)(O)CC |