If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
6-Hexadecanoyl-L-ascorbic acid | C(O)(COC(=O)CCCCCCCCCCCCCCC)C1OC(=O)C(O)=C1O |
ASCORBIC ACID | C(O)(CO)C1OC(=O)C(O)=C1O |
Ascorbic acid nicotinamide complex | C(N)(=O)c1cccnc1.OCC(O)C2OC(=O)C(O)=C2O |
Ascorbic acid palmitate | C(O)(COC(=O)CCCCCCCCCCCCCCC)C1OC(=O)C(O)=C1O |
Ascorbic acid | C(O)(CO)C1OC(=O)C(O)=C1O |
Ascorbic acid, compd. with nicotinamide (2:1) | C(N)(=O)c1cccnc1.OCC(O)C2OC(=O)C(O)=C2O |
Ascorbic palmitate | C(O)(COC(=O)CCCCCCCCCCCCCCC)C1OC(=O)C(O)=C1O |
D-ASCORBIC ACID, ISO | C(O)(CO)C1OC(=O)C(O)=C1O |
Iron-ascorbic acid complexes | C(O)(CO)C1OC(=O)C(O)=C1O |
L(+)-Ascorbic acid | C(O)(CO)C1OC(=O)C(O)=C1O |
L-Ascorbic acid | C(O)(CO)C1OC(=O)C(O)=C1O |
L-Ascorbic acid, 6-hexadecanoate | C(O)(COC(=O)CCCCCCCCCCCCCCC)C1OC(=O)C(O)=C1O |
L-Ascorbic acid, 6-palmitate | C(O)(COC(=O)CCCCCCCCCCCCCCC)C1OC(=O)C(O)=C1O |
L-Ascorbic acid, compd. with 3-pyridinecarboxamide | C(N)(=O)c1cccnc1.OCC(O)C2OC(=O)C(O)=C2O |
L-Ascorbic acid, compd. with nicotinamide | C(N)(=O)c1cccnc1.OCC(O)C2OC(=O)C(O)=C2O |
L-Ascorbic acid, iron(2+) salt | C(O)(CO)C1OC(=O)C(O)=C1O |
L-Ascorbic acid-iron complexes | C(O)(CO)C1OC(=O)C(O)=C1O |
L-Ascorbic_acid__compd._with_3-pyridinecarboxamide | C(N)(=O)c1cccnc1.OCC(O)C2OC(=O)C(O)=C2O |
Nicotinamide, compd. with ascorbic acid (1:1) | C(N)(=O)c1cccnc1.OCC(O)C2OC(=O)C(O)=C2O |
Palmitic acid, ester with ascorbic acid | C(O)(COC(=O)CCCCCCCCCCCCCCC)C1OC(=O)C(O)=C1O |
Palmitic_acid__ester_with_ascorbic_acid | C(O)(COC(=O)CCCCCCCCCCCCCCC)C1OC(=O)C(O)=C1O |
Palmitoyl L-ascorbic acid | C(O)(COC(=O)CCCCCCCCCCCCCCC)C1OC(=O)C(O)=C1O |