If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Methyl-endo-norbornanol | CC1(O)CC2CCC1C2 |
2-Norbornanol | OC1CC2CCC1C2 |
2-Norbornanol, 1,3, 3-trimethyl-, acetate | CC12CCC(C2)C(C)(C)C1OC(C)=O |
2-Norbornanol, 2-methyl-, stereoisomer (VAN8CI) | CC1(O)CC2CCC1C2 |
2-Norbornanol, 3-(benzylmethylaminomethyl)- | C(N(C)Cc1ccccc1)C2C(O)C3CCC2C3 |
2-Norbornanol, endo- | C1C(O)C2CC1CC2 |
2-Norbornanol, exo- | OC1CC2CCC1C2 |
2-Norbornanol__2-methyl-__stereoisomer_(VAN8CI) | CC1(O)CC2CCC1C2 |
2-endo-Norbornanol | C1C(O)C2CC1CC2 |
2-exo-Norbornanol | OC1CC2CCC1C2 |
3-(N-Benzyl-N-methylaminomethyl)-2-norbornanol | C(N(C)Cc1ccccc1)C2C(O)C3CCC2C3 |
endo-2-Methyl-2-norbornanol | CC1(O)CC2CCC1C2 |
endo-2-Norbornanol | C1C(O)C2CC1CC2 |
endo-Norbornanol | C1C(O)C2CC1CC2 |
exo-2-Methyl-2-norbornanol | CC1(O)CC2CCC1C2 |
exo-2-Norbornanol | OC1CC2CCC1C2 |
exo-Norbornanol | OC1CC2CCC1C2 |