If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,5-Dimethyl-1-vinyl-4-hexen-1-yl benzoate | C(C)(C=C)(CCC=C(C)C)OC(=O)c1ccccc1 |
1-Hexen-3-ol | C(O)(C=C)CCC |
1-Hexen-3-one, 5-methyl-1-phenyl- | C(=CC(=O)CC(C)C)c1ccccc1 |
1-Hexen-3-one__5-methyl-1-phenyl- | C(=CC(=O)CC(C)C)c1ccccc1 |
1-Hexen-5-one | C(CC=C)C(C)=O |
2-Ethyl-2-hexen-1-al | C(CC)(C=O)=CCCC |
2-Hexen-1-ol | C(CCC)=CCO |
2-Hexen-4-ol | C(O)(CC)C=CC |
2-Hexen-4-one | C(=O)(CC)C=CC |
3-Hexen-1-ol | C(=CCC)CCO |
3-Hexen-1-ol, (Z)- | C(=CCC)CCO |
3-Hexen-1-ol, cis- | C(=CCC)CCO |
4-Hexen-1-ol | C(C=CC)CCO |
4-Hexen-1-ol, 1,5-dimethyl-1-vinyl-, benzoate | C(C)(C=C)(CCC=C(C)C)OC(=O)c1ccccc1 |
4-Hexen-1-ol__1_5-dimethyl-1-vinyl-__benzoate | C(C)(C=C)(CCC=C(C)C)OC(=O)c1ccccc1 |
4-Hexen-3-ol | C(O)(CC)C=CC |
4-Hexen-3-one | C(=O)(CC)C=CC |
4-Hexen-3-one, 5-methyl- | C(=O)(CC)C=C(C)C |
4-Hexen-3-one__5-methyl- | C(=O)(CC)C=C(C)C |
5-Hexen-1-ol, 5-nitro-6-(9-phenanthryl)-, acetate | C(=C(CCCCOC(C)=O)[N+](=O)[O-])c1cc2ccccc2c3ccccc13 |
5-Hexen-1-ol__5-nitro-6-(9-phenanthryl)-__acetate | C(=C(CCCCOC(C)=O)[N+](=O)[O-])c1cc2ccccc2c3ccccc13 |
5-Hexen-2-one | C(CC=C)C(C)=O |
5-Hexen-2-one, 5-methyl- | C(CC(C)=O)C(C)=C |
5-Hexen-2-one__5-methyl- | C(CC(C)=O)C(C)=C |
5-Hexen-3-ol, 3-ethyl- | C(O)(CC)(CC)CC=C |
5-Hexen-3-ol__3-ethyl- | C(O)(CC)(CC)CC=C |
5-Hexen-3-one, 4,4,5-trimethyl-, (2,4-dinitrophenyl)hydrazone | N(N=C(CC)C(C)(C)C(C)=C)c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
5-Hexen-3-one__4_4_5-trimethyl-__(2_4-dinitrophenyl)hydrazone | N(N=C(CC)C(C)(C)C(C)=C)c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
5-Methyl-1-phenyl-1-hexen-3-one | C(=CC(=O)CC(C)C)c1ccccc1 |
HEXEN-30L-1 | C(=CCC)CCO |
cis-3-Hexen-1-ol | C(=CCC)CCO |