If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Naphthylacetamide | C(C(N)=O)c1cccc2ccccc12 |
2-Mercapto-N-2-naphthylacetamide | N(C(=O)CS)c1ccc2ccccc2c1 |
ALPHA_-Naphthylacetamide | C(C(N)=O)c1cccc2ccccc12 |
N-(2-Aminoethyl)-1-naphthylacetamide hydrochloride | C(C(=O)NCCN)c1cccc2ccccc12 |
N-1-Naphthylacetamide | N(C(C)=O)c1cccc2ccccc12 |
N-ALPHA_-Naphthylacetamide | N(C(C)=O)c1cccc2ccccc12 |