If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2,3,4-Trihydroxybenzoic acid | C(=O)(O)c1ccc(O)c(O)c1O |
2,4,6-Trihydroxybenzoic acid | C(=O)(O)c1c(O)cc(O)cc1O |
3,4, 5-Trihydroxybenzoic acid ethyl ester | C(=O)(OCC)c1cc(O)c(O)c(O)c1 |
3,4, 5-Trihydroxybenzoic acid, propyl ester | C(=O)(OCCC)c1cc(O)c(O)c(O)c1 |
3,4,5-Trihydroxybenzoic acid | C(=O)(O)c1cc(O)c(O)c(O)c1 |
n-Octyl ester of 3,4,5-trihydroxybenzoic acid | C(=O)(OCCCCCCCC)c1cc(O)c(O)c(O)c1 |
n-Octyl_ester_of_3_4_5-trihydroxybenzoic_acid | C(=O)(OCCCCCCCC)c1cc(O)c(O)c(O)c1 |
n-Propyl ester of 3,4,5-trihydroxybenzoic acid | C(=O)(OCCC)c1cc(O)c(O)c(O)c1 |
n-Propyl_ester_of_3_4_5-trihydroxybenzoic_acid | C(=O)(OCCC)c1cc(O)c(O)c(O)c1 |