If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Naphthamide | C(N)(=O)c1cccc2ccccc12 |
1-Naphthamide, N, N-diethyl- | C(=O)(N(CC)CC)c1cccc2ccccc12 |
1-Naphthamide, N-methyl- | C(=O)(NC)c1cccc2ccccc12 |
2-Hydroxy-3-naphthamide | C(N)(=O)c1cc2ccccc2cc1O |
2-Naphthamide, 3-hydroxy- | C(N)(=O)c1cc2ccccc2cc1O |
2-Naphthamide, 3-hydroxy-N-(2-hydroxyethyl)- | C(=O)(NCCO)c1cc2ccccc2cc1O |
2-Naphthamide, 3-hydroxy-N-1-naphthyl- | N(C(=O)c1cc2ccccc2cc1O)c3cccc4ccccc34 |
2-Naphthamide, 3-hydroxy-N-2-naphthyl- | C(=O)(Nc1ccc2ccccc2c1)c3cc4ccccc4cc3O |
3-Hydroxy-2-naphthamide | C(N)(=O)c1cc2ccccc2cc1O |
N-Methyl-1-naphthamide | C(=O)(NC)c1cccc2ccccc12 |
N-Methyl-ALPHA_-naphthamide | C(=O)(NC)c1cccc2ccccc12 |