If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
5,6-Dihydroxy-3-carboxyphenyl ester of gallic acid | O(C(=O)c1cc(O)c(O)c(O)c1)c2cc(cc(O)c2O)C(=O)O |
GALLIC ACID | C(=O)(O)c1cc(O)c(O)c(O)c1 |
Gallic acid 3-monogallate | O(C(=O)c1cc(O)c(O)c(O)c1)c2cc(cc(O)c2O)C(=O)O |
Gallic acid ethyl ester | C(=O)(OCC)c1cc(O)c(O)c(O)c1 |
Gallic acid octyl ester | C(=O)(OCCCCCCCC)c1cc(O)c(O)c(O)c1 |
Gallic acid trimethyl ether | O(C)c1c(OC)cc(cc1OC)C(=O)O |
Gallic acid | C(=O)(O)c1cc(O)c(O)c(O)c1 |
Gallic acid, 3-gallate | O(C(=O)c1cc(O)c(O)c(O)c1)c2cc(cc(O)c2O)C(=O)O |
Gallic acid, butyl ester | C(=O)(OCCCC)c1cc(O)c(O)c(O)c1 |
Gallic acid, dodecyl ester | C(=O)(OCCCCCCCCCCCC)c1cc(O)c(O)c(O)c1 |
Gallic acid, ethyl ester | C(=O)(OCC)c1cc(O)c(O)c(O)c1 |
Gallic acid, lauryl ester | C(=O)(OCCCCCCCCCCCC)c1cc(O)c(O)c(O)c1 |
Gallic acid, octyl ester | C(=O)(OCCCCCCCC)c1cc(O)c(O)c(O)c1 |
Gallic acid, propyl ester | C(=O)(OCCC)c1cc(O)c(O)c(O)c1 |
Gallic acid, tech. | C(=O)(O)c1cc(O)c(O)c(O)c1 |