If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1-Butanal, 3-methyl- | C(C=O)C(C)C |
2-Methyl-1-butanal | C(C)(CC)C=O |
Butanal oxime | C(CC)C=NO |
Butanal | C(CC)C=O |
Butanal, (2,4-dinitrophenyl)hydrazone | [N+](=O)([O-])c1cc(ccc1NN=CCCC)[N+](=O)[O-] |
Butanal, 2,2, 3-trichloro- | C(Cl)(Cl)(C=O)C(C)Cl |
Butanal, 2-(phenylmethylene)- | C(=C(CC)C=O)c1ccccc1 |
Butanal, 2-ethyl- | C(CC)(CC)C=O |
Butanal, 2-ethyl-, (2,4-dinitrophenyl)hydrazone | [N+](=O)([O-])c1cc(ccc1NN=CC(CC)CC)[N+](=O)[O-] |
Butanal, 2-hydroxy-3-methyl- | C(O)(C=O)C(C)C |
Butanal, 2-methyl- | C(C)(CC)C=O |
Butanal, 3-hydroxy- | C(C=O)C(C)O |
Butanal, 3-methoxy- | C(C)(OC)CC=O |
Butanal, 3-methyl- | C(C=O)C(C)C |
Butanal, 3-methyl-, (2,4-dinitrophenyl)hydrazone | N(N=CCC(C)C)c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
Butanal, 3-methyl-, N-formyl-N-methylhydrazone | N(C)(C=O)N=CCC(C)C |
Butanal, cyclic 1,2-ethanediyl acetal | C(CC)C1OCCO1 |
Butanal, oxime | C(CC)C=NO |
Butanal__2-(phenylmethylene)- | C(=C(CC)C=O)c1ccccc1 |
Butanal__2-ethyl-__(2_4-dinitrophenyl)hydrazone | [N+](=O)([O-])c1cc(ccc1NN=CC(CC)CC)[N+](=O)[O-] |
Butanal__2-hydroxy-3-methyl- | C(O)(C=O)C(C)C |
Butanal__cyclic_1_2-ethanediyl_acetal | C(CC)C1OCCO1 |
n-Butanal(CZECH) | C(CC)C=O |