If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Nihonthrene Blue BC | O=C1c2ccccc2C(=O)c3cc(Cl)c4Nc5c(Nc4c13)c(Cl)cc6C(=O)c7ccccc7C(=O)c56 |
Nihonthrene Blue RSN | O=C1c2ccccc2C(=O)c3ccc4Nc5c(ccc6C(=O)c7ccccc7C(=O)c56)Nc4c13 |
Nihonthrene Brilliant Blue RCL | O=C1c2ccccc2C(=O)c3cc(Cl)c4Nc5c(Nc4c13)c(Cl)cc6C(=O)c7ccccc7C(=O)c56 |
Nihonthrene Brilliant Blue RP | O=C1c2ccccc2C(=O)c3ccc4Nc5c(ccc6C(=O)c7ccccc7C(=O)c56)Nc4c13 |
Nihonthrene Dark Blue BO | O=C1c2ccccc2c3ccc4c5ccc6c7ccccc7C(=O)c8ccc(c9ccc1c3c49)c5c68 |
Nihonthrene Dark Blue BOA | O=C1c2ccccc2c3ccc4c5ccc6c7ccccc7C(=O)c8ccc(c9ccc1c3c49)c5c68 |
Nihonthrene Fast Orange R | O=C1c2ccc(OCC)cc2SC1=C3Sc4cc(OCC)ccc4C3=O |
Nihonthrene Golden Orange G | O=C1c2ccccc2C3=Cc4ccc5C(=O)c6ccccc6c7cc8ccc1c3c8c4c57 |
Nihonthrene Golden Yellow GK | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Nihonthrene Golden Yellow | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Nihonthrene Olive R | O=C1c2ccccc2C(=O)c3c(NC(=O)c4ccccc4)cc5c6cc(NC(=O)c7ccccc7)c8C(=O)c9ccccc9C(=O)c8c6Nc5c13 |
Nihonthrene Red FBB | Nc1c(ccc2C(=O)c3ccccc3C(=O)c12)C4=Nc5cc6C(=O)c7ccccc7C(=O)c6cc5O4 |
Nihonthrene Red Violet RH | O=C1c2cc(Cl)cc(C)c2SC1=C3Sc4c(C)cc(Cl)cc4C3=O |
Nihonthrene Yellow 4GFF | C(=O)(Nc1cccc2C(=O)c3ccccc3C(=O)c12)c4ccc5C(=O)c6ccccc6c7ncnc4c57 |