If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 4-Epidioxy-p-menth-2-ene | C(C)(C)C12CCC(C)(C=C1)OO2 |
1, 4-Peroxy-p-menth-2-ene | C(C)(C)C12CCC(C)(C=C1)OO2 |
1,4-Epidioxy-p-menth-2-ene | C(C)(C)C12CCC(C)(C=C1)OO2 |
1-Propanone, 1-p-menth-6-en-2-yl- | C(=O)(CC)C1CC(CC=C1C)C(C)C |
Acetic acid, p-menth-3-yl ester, L- | C(C)(C)C1CCC(C)CC1OC(C)=O |
L-p-Menth-3-yl acetate | C(C)(C)C1CCC(C)CC1OC(C)=O |
d-p-Menth-4(8)-en-3-one | C(C)(C)=C1CCC(C)CC1=O |
m-Menth-6-en-5-one | C(C)(C)C1CC(C)=CC(=O)C1 |
m-Menth-6-ene-2-carboxylic acid, 5-oxo-, ethyl ester | C(=O)(OCC)C1C(C)=CC(=O)CC1C(C)C |
p-Menth-1-en-3-one | C(C)(C)C1CCC(C)=CC1=O |
p-Menth-1-en-4-ol | C(C)(C)C1(O)CCC(C)=CC1 |
p-Menth-1-en-8-ol | C(C)(C)(O)C1CCC(C)=CC1 |
p-Menth-1-ene | C(C)(C)C1CCC(C)=CC1 |
p-Menth-1-ene, 6,8-epoxy- | CC1(C)OC2CC1CC=C2C |
p-Menth-2-ene, 1,4-epidioxy- | C(C)(C)C12CCC(C)(C=C1)OO2 |
p-Menth-4(8)-en-3-one | C(C)(C)=C1CCC(C)CC1=O |
p-Menth-4(8)-en-3-one, (R)-(+)- | C(C)(C)=C1CCC(C)CC1=O |
p-Menth-8-en-2-one, 1,6-epoxy-, (1R,4R, 6R)-(-)- | CC12OC1CC(CC2=O)C(C)=C |
p-Menth-8-en-3-ol | C(C)(=C)C1CCC(C)CC1O |
p-Menth-8-ene, 1,2-epoxy- (VAN8CI) | CC12CCC(CC1O2)C(C)=C |