If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(+ )-ALPHA_-(4-Chloro-2-methylphenoxy) propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1C |
(.+ -.)-2-(p-Isobutylphenyl)propionic acid | C(C)(C(=O)O)c1ccc(cc1)CC(C)C |
(4-Chloro-2-methylphenoxy)propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1C |
1, 3-Dioxolane-2-propionic acid, 2-methyl-, ethyl ester | C(CC(=O)OCC)C1(C)OCCO1 |
1,3-Dioxolane-2-propionic acid, 2,4-dimethyl-, ethyl ester | C(CC(=O)OCC)C1(C)OCC(C)O1 |
1H-Indazole-3-propionic acid, ALPHA_-amino- | C(C(N)C(=O)O)C1=NNc2ccccc12 |
1H-Indole-3-propionic acid | C(CC(=O)O)C1=CNc2ccccc12 |
1H-Indole-3-propionic acid, 5-(bis(2-chloroethyl)amino)- | C(CC(=O)O)C1=CNc2ccc(cc12)N(CCCl)CCCl |
1H-Indole-3-propionic_acid__5-(bis(2-chloroethyl)amino)- | C(CC(=O)O)C1=CNc2ccc(cc12)N(CCCl)CCCl |
1H-Pyrrolo(2,3-b)pyridine-3-propionic acid, ALPHA_-amino-, dl- | C(C(N)C(=O)O)C1=CNc2ncccc12 |
1__3-Dioxolane-2-propionic_acid__2-methyl-__ethyl_ester | C(CC(=O)OCC)C1(C)OCCO1 |
2, 2-Bis(hydroxymethyl)propionic acid | C(C)(CO)(CO)C(=O)O |
2, 4-Dichlorophenoxy-ALPHA_-propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1Cl |
2-(2'-Methyl-4'-chlorophenoxy)propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1C |
2-(2, 4-Dichlorophenoxy)propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1Cl |
2-(2, 5-Dichlorophenoxy)propionic acid | O(C(C)C(=O)O)c1cc(Cl)ccc1Cl |
2-(2-Methyl-4-chlorophenoxy)propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1C |
2-(4-Chloro-2-methylphenoxy)propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1C |
2-(4-Chlorophenoxy)propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1 |
2-(4-Chlorophenoxy-2-methyl)propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1C |
2-(p-Chloro-o-tolyloxy)propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1C |
2-(p-Chlorophenoxy)propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1 |
2-(p-Isobutylphenyl)propionic acid | C(C)(C(=O)O)c1ccc(cc1)CC(C)C |
2-Amino-3-(carboxymethylthio)propionic acid | C(SCC(=O)O)C(N)C(=O)O |
2-Amino-3-(carboxymethylthio)propionic_acid | C(SCC(=O)O)C(N)C(=O)O |
2-Amino-3-(hydroxynitrosamino)propionic acid, L- | C(N(O)N=O)C(N)C(=O)O |
2-Ethyl-3-(3-amino-2,4,6-triiodophenyl)propionic acid | C(C(CC)C(=O)O)c1c(I)cc(I)c(N)c1I |
2-Hydroxy-3-(p-hydroxyphenyl)propionic acid | C(C(O)C(=O)O)c1ccc(O)cc1 |
2-Hydroxy-3-(p-hydroxyphenyl)propionic_acid | C(C(O)C(=O)O)c1ccc(O)cc1 |
2-Methyl-4-chlorophenoxy-ALPHA_-propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1C |
3-(1-Aziridinyl)propionic acid decyl ester | C(CC(=O)OCCCCCCCCCC)N1CC1 |
3-(3, 4-Methylenedioxyphenyl)propionic acid | C(CC(=O)O)c1ccc2OCOc2c1 |
3-(3,4-Dihydroxyphenyl)propionic acid | C(CC(=O)O)c1ccc(O)c(O)c1 |
3-(3-Indole)propionic acid | C(CC(=O)O)C1=CNc2ccccc12 |
3-(3-Indolyl)propionic acid | C(CC(=O)O)C1=CNc2ccccc12 |
3-(3__4-Methylenedioxyphenyl)propionic_acid | C(CC(=O)O)c1ccc2OCOc2c1 |
3-(4-Hydroxyphenyl)propionic acid | C(CC(=O)O)c1ccc(O)cc1 |
3-(4-Methoxy-1-naphthoyl)propionic acid | C(=O)(CCC(=O)O)c1ccc(OC)c2ccccc12 |
3-(7H-Purin-6-ylthio)propionic acid | S(CCC(=O)O)c1ncnc2NC=Nc12 |
3-(Amidinothio)propionic acid | C(CC(=O)O)SC(=N)N |
3-(Benzylthio)propionic acid | C(SCCC(=O)O)c1ccccc1 |
3-(Dodecylamino)propionic acid | C(CCCCCCCCCC)CNCCC(=O)O |
3-(Methylthio)propionic acid ethylester | C(=O)(OCC)CCSC |
3-(N-Dodecylamino)propionic acid | C(CCCCCCCCCC)CNCCC(=O)O |
3-(Trimethylsilyl)propionic acid | C(CC(=O)O)[Si](C)(C)C |
3-(m-Hydroxyphenyl)propionic acid | C(CC(=O)O)c1cccc(O)c1 |
3-(m-Nitrobenzoyl)propionic acid | C(=O)(CCC(=O)O)c1cccc(c1)[N+](=O)[O-] |
3-(p-Hydroxyphenyl)propionic acid | C(CC(=O)O)c1ccc(O)cc1 |
3-(p-Tolylthio)propionic acid | S(CCC(=O)O)c1ccc(C)cc1 |
4-Chloro-2-methylphenoxy-ALPHA_-propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1C |
4-tert-Butylphenoxy-ALPHA_-propionic acid | C(C)(C)(C)c1ccc(cc1)OC(C)C(=O)O |
ALPHA_,ALPHA_-Bis(hydroxymethyl)propionic acid | C(C)(CO)(CO)C(=O)O |
ALPHA_-(2,4-Dichlorophenoxy)propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1Cl |
ALPHA_-(2,5-Dichlorophenoxy)propionic acid | O(C(C)C(=O)O)c1cc(Cl)ccc1Cl |
ALPHA_-(2-Methyl-4-chlorophenoxy)propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1C |
ALPHA_-(2_5-Dichlorophenoxy)propionic_acid | O(C(C)C(=O)O)c1cc(Cl)ccc1Cl |
ALPHA_-(4-Biphenylyloxy)propionic acid | O(C(C)C(=O)O)c1ccc(cc1)c2ccccc2 |
ALPHA_-(4-Chlorophenoxy)propionic acid | O(C(C)C(=O)O)c1ccc(Cl)cc1 |
ALPHA_-(4-Chlorophenoxy)propionic_acid | O(C(C)C(=O)O)c1ccc(Cl)cc1 |
ALPHA_-(4-Isobutylphenyl)propionic acid | C(C)(C(=O)O)c1ccc(cc1)CC(C)C |
ALPHA_-(p-isobutylphenyl)propionic acid | C(C)(C(=O)O)c1ccc(cc1)CC(C)C |
ALPHA_-Amino-BETA_-(2-methylenecyclopropyl)propionic acid | C(C(N)C(=O)O)C1CC1=C |
ALPHA_-Amino-BETA_-(4-hydroxyphenyl)propionic acid | C(C(N)C(=O)O)c1ccc(O)cc1 |
ALPHA_-Phenyl-BETA_-p-hydroxyphenyl propionic acid | C(Cc1ccc(O)cc1)(C(=O)O)c2ccccc2 |
ALPHA_-Phenyl-BETA_-p-hydroxyphenyl_propionic_acid | C(Cc1ccc(O)cc1)(C(=O)O)c2ccccc2 |
BETA_-(2,5-Dimethylbenzoyl)propionic acid | C(=O)(CCC(=O)O)c1cc(C)ccc1C |
BETA_-(3-Hydroxyphenyl)propionic acid | C(CC(=O)O)c1cccc(O)c1 |
BETA_-(3-Indolyl)propionic acid | C(CC(=O)O)C1=CNc2ccccc12 |
BETA_-(3-Indolyl)propionic_acid | C(CC(=O)O)C1=CNc2ccccc12 |
BETA_-(4,5-Diphenyloxazol-2-yl)propionic acid | C(CC(=O)O)C1=NC(c2ccccc2)=C(O1)c3ccccc3 |
BETA_-(4_5-Diphenyloxazol-2-yl)propionic_acid | C(CC(=O)O)C1=NC(c2ccccc2)=C(O1)c3ccccc3 |
BETA_-(Benzylthio)propionic acid | C(SCCC(=O)O)c1ccccc1 |
BETA_-(m-Hydroxyphenyl)propionic acid | C(CC(=O)O)c1cccc(O)c1 |
BETA_-(m-Hydroxyphenyl)propionic_acid | C(CC(=O)O)c1cccc(O)c1 |
BETA_-(p-Hydroxyphenyl)propionic acid | C(CC(=O)O)c1ccc(O)cc1 |
BETA_-(p-Hydroxyphenyl)propionic_acid | C(CC(=O)O)c1ccc(O)cc1 |
BETA_-Indole-3-propionic acid | C(CC(=O)O)C1=CNc2ccccc12 |
Bis(hydroxymethyl)propionic acid | C(C)(CO)(CO)C(=O)O |
Carbazole-9-propionic acid | C(C(=O)O)c1ccccc1F |
Carbazole-9-propionic_acid | C(C(=O)O)c1ccccc1F |
INDOLE-3-PROPIONIC ACID | C(CC(=O)O)C1=CNc2ccccc12 |
Indole-1-propionic acid | C(CC(=O)O)N1C=Cc2ccccc12 |
Indole-1-propionic_acid | C(CC(=O)O)N1C=Cc2ccccc12 |
Indole-3-propionic acid | C(CC(=O)O)C1=CNc2ccccc12 |
Indole-3-propionic acid, 5-(bis(2-chloroethyl)amino)- | C(CC(=O)O)C1=CNc2ccc(cc12)N(CCCl)CCCl |
Indole-3-propionic acid, 5-(bis(2-chloroethyl)amino)-, methyl ester | C(CC(=O)OC)C1=CNc2ccc(cc12)N(CCCl)CCCl |
Indole-3-propionic acid, BETA_-methyl- | C(C)(CC(=O)O)C1=CNc2ccccc12 |
Indole-3-propionic acid, methyl ester | C(CC(=O)OC)C1=CNc2ccccc12 |
L-2-Amino-3-((N-nitroso)hydroxylamino)propionic acid | C(N(O)N=O)C(N)C(=O)O |
L-2-Amino-3-(hydroxynitrosamino)propionic acid | C(N(O)N=O)C(N)C(=O)O |
PROPIONIC ACID | O(CC)C=O |
Phenothiazine-10-propionic acid | C(CC(=O)O)N1c2ccccc2Sc3ccccc13 |
Propionic acid 3, 4-dichloroanilide | N(C(=O)CC)c1ccc(Cl)c(Cl)c1 |
Propionic acid amide | C(N)(=O)CC |
Propionic acid chloride | C(Cl)(=O)CC |
Propionic acid, 2, 2'-thiodi-, dihydrazide | C(C)(SC(C)C(=O)NN)C(=O)NN |
Propionic acid, 2, 2-bis(hydroxymethyl)- | C(C)(CO)(CO)C(=O)O |
Propionic acid, 2, 2-dichloro- | C(C)(Cl)(Cl)C(=O)O |
Propionic acid, 2, 3-dichloro-, methyl ester | C(Cl)(CCl)C(=O)OC |
Propionic acid, 2, 3-dichloro-2-methyl- | C(C)(Cl)(CCl)C(=O)O |
Propionic acid, 2,2'-thiobis-, dihydrazide | C(C)(SC(C)C(=O)NN)C(=O)NN |
Propionic acid, 2,2,3-trichloro- | C(Cl)(Cl)(CCl)C(=O)O |
Propionic acid, 2,2-diethoxy-, ethyl ester | C(C)(OCC)(OCC)C(=O)OCC |
Propionic acid, 2,2-dimethyl- | C(C)(C)(C)C(=O)O |
Propionic acid, 2,3-diamino-, hydrochloride | C(N)(CN)C(=O)O |
Propionic acid, 2,3-diamino-, methyl ester, dihydrochloride | C(N)(CN)C(=O)OC |
Propionic acid, 2,3-dibromo- | C(Br)(CBr)C(=O)O |
Propionic acid, 2,3-dibromo-, ethyl ester | C(=O)(OCC)C(Br)CBr |
Propionic acid, 2,3-dibromo-, methyl ester | C(Br)(CBr)C(=O)OC |
Propionic acid, 2,3-dichloro | C(Cl)(CCl)C(=O)O |
Propionic acid, 2,3-dichloro- | C(Cl)(CCl)C(=O)O |
Propionic acid, 2,3-dichloro-, ethyl ester | C(=O)(OCC)C(Cl)CCl |
Propionic acid, 2-((4-chloro-o-tolyl)oxy)- | O(C(C)C(=O)O)c1ccc(Cl)cc1C |
Propionic acid, 2-(1-naphthoxy)- | O(C(C)C(=O)O)c1cccc2ccccc12 |
Propionic acid, 2-(1-naphthyloxy)- | O(C(C)C(=O)O)c1cccc2ccccc12 |
Propionic acid, 2-(2, 4-dichlorophenoxy)- | O(C(C)C(=O)O)c1ccc(Cl)cc1Cl |
Propionic acid, 2-(2, 5-dichlorophenoxy)- | O(C(C)C(=O)O)c1cc(Cl)ccc1Cl |
Propionic acid, 2-(2-methyl-4-chlorophenoxy)- | O(C(C)C(=O)O)c1ccc(Cl)cc1C |
Propionic acid, 2-(4-(4'-chlorophenoxy)phenoxy)-, isobutyl ester | O(c1ccc(Cl)cc1)c2ccc(cc2)OC(C)C(=O)OCC(C)C |
Propionic acid, 2-(4-biphenylyloxy)- | O(C(C)C(=O)O)c1ccc(cc1)c2ccccc2 |
Propionic acid, 2-(4-chloro-2-methylphenoxy) | O(C(C)C(=O)O)c1ccc(Cl)cc1C |
Propionic acid, 2-(4-chlorophenoxy)-2-methyl-, ethyl ester | O(c1ccc(Cl)cc1)C(C)(C)C(=O)OCC |
Propionic acid, 2-(p-chlorophenoxy)- | O(C(C)C(=O)O)c1ccc(Cl)cc1 |
Propionic acid, 2-(p-chlorophenoxy)-2-methyl- | O(c1ccc(Cl)cc1)C(C)(C)C(=O)O |
Propionic acid, 2-(p-chlorophenoxy)-2-methyl-, ethyl ester | O(c1ccc(Cl)cc1)C(C)(C)C(=O)OCC |
Propionic acid, 2-(p-tert-butylphenoxy)- | C(C)(C)(C)c1ccc(cc1)OC(C)C(=O)O |
Propionic acid, 2-(triphenylphosphoranylidene)-, ethyl ester | P(=C(C)C(=O)OCC)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Propionic acid, 2-amino-2-methyl- | C(C)(C)(N)C(=O)O |
Propionic acid, 2-amino-3-(hydroxynitrosamino)-, (L)- | C(N(O)N=O)C(N)C(=O)O |
Propionic acid, 2-amino-3-(hydroxynitrosamino)-, DL- | C(N(O)N=O)C(N)C(=O)O |
Propionic acid, 2-amino-3-(hydroxynitrosamino)-, L- | C(N(O)N=O)C(N)C(=O)O |
Propionic acid, 2-amino-3-(hydroxynitrosamino)-, monosodium salt | C(N(O)N=O)C(N)C(=O)O |
Propionic acid, 2-amino-3-indol-3-yl | C(C(N)C(=O)O)C1=CNc2ccccc12 |
Propionic acid, 2-amino-3-ureido- (VAN8CI) | C(N)(CNC(N)=O)C(=O)O |
Propionic acid, 2-benzyloxy- | C(OC(C)C(=O)O)c1ccccc1 |
Propionic acid, 2-bromo- | C(Br)(C)C(=O)O |
Propionic acid, 2-bromo-, ethyl ester | C(=O)(OCC)C(Br)C |
Propionic acid, 2-bromo-, methyl ester | C(=O)(OC)C(Br)C |
Propionic acid, 2-bromo-2-methyl- | C(Br)(C)(C)C(=O)O |
Propionic acid, 2-bromo-2-methyl-, ethyl ester | C(=O)(OCC)C(Br)(C)C |
Propionic acid, 2-chloro- | C(C)(Cl)C(=O)O |
Propionic acid, 2-chloro-, ethyl ester | C(=O)(OCC)C(C)Cl |
Propionic acid, 2-chloro-, methyl ester | C(=O)(OC)C(C)Cl |
Propionic acid, 2-methyl- | C(C)(C)C(=O)O |
Propionic acid, 2-methyl-, ethyl ester | C(=O)(OCC)C(C)C |
Propionic acid, 2-methyl-2-phenyl- | C(C)(C)(C(=O)O)c1ccccc1 |
Propionic acid, 2-methylene- | C(C)(=C)C(=O)O |
Propionic acid, 2-nitro-, ethyl ester | C(C)([N+](=O)[O-])C(=O)OCC |
Propionic acid, 2-phenoxy- (VAN8CI) | O(C(C)C(=O)O)c1ccccc1 |
Propionic acid, 2-phenoxyethyl ester | O(CCOC(=O)CC)c1ccccc1 |
Propionic acid, 2-phenylcarbamoyloxy- | N(C(=O)OC(C)C(=O)O)c1ccccc1 |
Propionic acid, 2-phenylethyl ester | C(COC(=O)CC)c1ccccc1 |
Propionic acid, 2-phenylhydrazide | N(NC(=O)CC)c1ccccc1 |
Propionic acid, 3, 3'-dithiodi- | C(SSCCC(=O)O)CC(=O)O |
Propionic acid, 3, 3'-fluoren-9-ylidenedi- | C(CC(=O)O)C1(CCC(=O)O)c2ccccc2c3ccccc13 |
Propionic acid, 3, 3'-thiodi-, didodecyl ester | C(=O)(OCCCCCCCCCCCC)CCSCCC(=O)OCCCCCCCCCCCC |
Propionic acid, 3,3'-(1, 3-dioxodigermoxanylene)di- | [Ge](=O)(CCC(=O)O)O[Ge](=O)CCC(=O)O |
Propionic acid, 3,3'-(nitroimino)di- | N(CCC(=O)O)(CCC(=O)O)[N+](=O)[O-] |
Propionic acid, 3,3'-dithiodi-, dioctadecyl ester | C(=O)(OCCCCCCCCCCCCCCCCCC)CCSSCCC(=O)OCCCCCCCCCCCCCCCCCC |
Propionic acid, 3,3'-thiobis-, didodecyl ester | C(=O)(OCCCCCCCCCCCC)CCSCCC(=O)OCCCCCCCCCCCC |
Propionic acid, 3,3'-thiodi- | C(SCCC(=O)O)CC(=O)O |
Propionic acid, 3,3'-thiodi-, dibutyl ester | C(CSCCC(=O)OCCCC)C(=O)OCCCC |
Propionic acid, 3,3'-thiodi-, diethyl ester | C(=O)(OCC)CCSCCC(=O)OCC |
Propionic acid, 3,3'-thiodi-, dimethyl ester | C(CSCCC(=O)OC)C(=O)OC |
Propionic acid, 3,3'-thiodi-, dioctadecyl ester | C(SCCC(=O)OCCCCCCCCCCCCCCCCCC)CC(=O)OCCCCCCCCCCCCCCCCCC |
Propionic acid, 3,3-diphenyl- | C(CC(=O)O)(c1ccccc1)c2ccccc2 |
Propionic acid, 3-(1-aziridinyl)-, allyl ester | C(CC(=O)OCC=C)N1CC1 |
Propionic acid, 3-(1-aziridinyl)-, decyl ester | C(CC(=O)OCCCCCCCCCC)N1CC1 |
Propionic acid, 3-(2, 5-dimethylbenzoyl)- | C(=O)(CCC(=O)O)c1cc(C)ccc1C |
Propionic acid, 3-(2,5-dimethylbenzoyl)-2-methyl- | C(=O)(CC(C)C(=O)O)c1cc(C)ccc1C |
Propionic acid, 3-(2-(bis(2-chloroethyl)amino)phenoxy)- | N(CCCl)(CCCl)c1ccccc1OCCC(=O)O |
Propionic acid, 3-(3-indolyl)-, methyl ester | C(CC(=O)OC)C1=CNc2ccccc12 |
Propionic acid, 3-(4-hydroxy-3, 5-diiodophenyl)-2-phenyl- | C(Cc1cc(I)c(O)c(I)c1)(C(=O)O)c2ccccc2 |
Propionic acid, 3-(4-methoxy-1-naphthoyl)- | C(=O)(CCC(=O)O)c1ccc(OC)c2ccccc12 |
Propionic acid, 3-(5,6,7,8-tetrahydro-2-naphthoyl)- | C(=O)(CCC(=O)O)c1ccc2CCCCc2c1 |
Propionic acid, 3-(amidinothio)- | C(CC(=O)O)SC(=N)N |
Propionic acid, 3-(benzyloxy)-, methyl ester | C(OCCC(=O)OC)c1ccccc1 |
Propionic acid, 3-(benzylthio)- | C(SCCC(=O)O)c1ccccc1 |
Propionic acid, 3-(benzylthio)-, methyl ester | C(SCCC(=O)OC)c1ccccc1 |
Propionic acid, 3-(butylthio)- | C(SCCCC)CC(=O)O |
Propionic acid, 3-(diethylamino)- | N(CC)(CC)CCC(=O)O |
Propionic acid, 3-(dodecylthio)- | C(CCCCCCCCCC)CSCCC(=O)O |
Propionic acid, 3-(ethylthio)- | C(CSCC)C(=O)O |
Propionic acid, 3-(ethylthio)-, methyl ester | C(=O)(OC)CCSCC |
Propionic acid, 3-(isopropylthio)- | C(CC(=O)O)SC(C)C |
Propionic acid, 3-(m-(bis(2-chloroethyl)amino)-phenoxy)- | N(CCCl)(CCCl)c1cccc(c1)OCCC(=O)O |
Propionic acid, 3-(m-nitrobenzoyl)- | C(=O)(CCC(=O)O)c1cccc(c1)[N+](=O)[O-] |
Propionic acid, 3-(methylthio)-, ethyl ester | C(=O)(OCC)CCSC |
Propionic acid, 3-(methylthio)-, methyl ester | C(=O)(OC)CCSC |
Propionic acid, 3-(octylthio)- | S(CCCCCCCC)CCC(=O)O |
Propionic acid, 3-(p-(bis(2-chloroethyl)amino)phenoxy)- | N(CCCl)(CCCl)c1ccc(cc1)OCCC(=O)O |
Propionic acid, 3-(p-hydroxyphenyl)-2-phenyl- | C(Cc1ccc(O)cc1)(C(=O)O)c2ccccc2 |
Propionic acid, 3-(phenylcarbamoyl)- | N(C(=O)CCC(=O)O)c1ccccc1 |
Propionic acid, 3-(propylthio)- | C(SCCC)CC(=O)O |
Propionic acid, 3-(purin-6-ylthio)- | S(CCC(=O)O)c1ncnc2NC=Nc12 |
Propionic acid, 3-(pyrrolidin-1-yl)-, ethyl ester | C(CC(=O)OCC)N1CCCC1 |
Propionic acid, 3-(trimethylsilyl)- | C(CC(=O)O)[Si](C)(C)C |
Propionic acid, 3-acetyl- | C(CC(=O)O)C(C)=O |
Propionic acid, 3-benzoyl- | C(=O)(CCC(=O)O)c1ccccc1 |
Propionic acid, 3-benzoyl-, methyl ester | C(=O)(CCC(=O)OC)c1ccccc1 |
Propionic acid, 3-bromo- | C(CBr)C(=O)O |
Propionic acid, 3-bromo-, ethyl ester | C(=O)(CCBr)OCC |
Propionic acid, 3-bromo-, methyl ester | C(=O)(OC)CCBr |
Propionic acid, 3-chloro- | C(CCl)C(=O)O |
Propionic acid, 3-chloro-, ethyl ester | C(=O)(CCCl)OCC |
Propionic acid, 3-chloro-, isopropyl ester | O(C(C)C)C(=O)CCCl |
Propionic acid, 3-chloro-, methyl ester | C(=O)(OC)CCCl |
Propionic acid, 3-chloro-2,2-dimethyl- | C(C)(C)(CCl)C(=O)O |
Propionic acid, 3-cyano-, ethyl ester | C(=O)(OCC)CCC#N |
Propionic acid, 3-cyano-, methyl ester | C(=O)(OC)CCC#N |
Propionic acid, 3-cyclopentyl- | C(CC(=O)O)C1CCCC1 |
Propionic acid, 3-ethoxy-, ethyl ester | C(COCC)C(=O)OCC |
Propionic acid, 3-hydrazino- | C(CNN)C(=O)O |
Propionic acid, 3-hydroxy-, BETA_-lactone | O=C1CCO1 |
Propionic acid, 3-iodo- | C(CI)C(=O)O |
Propionic acid, 3-mercapto- | C(CS)C(=O)O |
Propionic acid, 3-mercapto-, butyl ester | O(CCCC)C(=O)CCS |
Propionic acid, 3-mercapto-, dodecyl ester | C(CCCCCCCCCCC)OC(=O)CCS |
Propionic acid, 3-mercapto-, ethyl ester | C(=O)(CCS)OCC |
Propionic acid, 3-mercapto-, methyl ester | C(=O)(OC)CCS |
Propionic acid, 3-methoxy-, methyl ester | C(=O)(OC)CCOC |
Propionic acid, 3-nitro- | C(C[N+](=O)[O-])C(=O)O |
Propionic acid, 3-phenoxy-, methyl ester | O(CCC(=O)OC)c1ccccc1 |
Propionic acid, 3-selenino- | C(C[Se](=O)O)C(=O)O |
Propionic acid, 3-sulfo-, cyclic anhydride | O=S1(=O)CCC(=O)O1 |
Propionic acid, ALPHA_-chloro- | C(C)(Cl)C(=O)O |
Propionic acid, allyl ester | C(=O)(CC)OCC=C |
Propionic acid, benzyl ester | C(OC(=O)CC)c1ccccc1 |
Propionic acid, butyl ester | C(=O)(CC)OCCCC |
Propionic acid, cinnamyl ester | C(=CCOC(=O)CC)c1ccccc1 |
Propionic acid, cyclohexyl ester | O(C(=O)CC)C1CCCCC1 |
Propionic acid, decyl ester | C(CCCCCCCC)COC(=O)CC |
Propionic acid, dodecyl ester | C(CCCCCCCCCC)COC(=O)CC |
Propionic acid, ester with l,5-bis (tetrahydro-2-furyl)-3-pentanol | C(CCC1CCCO1)(CCC2CCCO2)OC(=O)CC |
Propionic acid, ester with tetrahydro-2-furanpropanol | C(CCOC(=O)CC)C1CCCO1 |
Propionic acid, ethyl ester | C(=O)(CC)OCC |
Propionic acid, isobutyl ester | C(=O)(CC)OCC(C)C |
Propionic acid, isopentyl ester | C(=O)(CC)OCCC(C)C |
Propionic acid, laurinyl ester | C(CCCCCCCCCC)COC(=O)CC |
Propionic acid, methyl ester | C(=O)(CC)OC |
Propionic acid, nickel(2+) salt | C(=O)(O)CC |
Propionic acid, octyl ester | O(CCCCCCCC)C(=O)CC |
Propionic acid, pentafluoro-, anhydride | C(F)(F)(C(=O)OC(=O)C(F)(F)C(F)(F)F)C(F)(F)F |
Propionic acid, pentafluoro-, silver salt | C(F)(F)(C(=O)O)C(F)(F)F |
Propionic acid, pentafluoro-, silver(1+) salt | C(F)(F)(C(=O)O)C(F)(F)F |
Propionic acid, pentamethylene ester (2:1) | C(=O)(CC)OCCCCCOC(=O)CC |
Propionic acid, pentyl ester | C(=O)(CC)OCCCCC |
Propionic acid, phenethyl ester | C(COC(=O)CC)c1ccccc1 |
Propionic acid, phenyl ester | O(C(=O)CC)c1ccccc1 |
Propionic acid, phenylmercury salt | OC(=O)CC.c1ccccc1 |
Propionic acid, propyl ester | C(=O)(CC)OCCC |
Propionic acid, vinyl ester | C(=O)(CC)OC=C |
Propionic aldehyde | C(C)C=O |
Propionic amide | C(N)(=O)CC |
Propionic chloride | C(Cl)(=O)CC |
Propionic ester | C(=O)(CC)OCC |
Propionic ether | C(=O)(CC)OCC |
Propionic nitrile | C(C)C#N |
Propionic_acid__2-amino-2-methyl- | C(C)(C)(N)C(=O)O |
Propionic_acid__2-amino-3-(hydroxynitrosamino)-__(L)- | C(N(O)N=O)C(N)C(=O)O |
Propionic_acid__2-amino-3-(hydroxynitrosamino)-__DL- | C(N(O)N=O)C(N)C(=O)O |
Propionic_acid__2-amino-3-(hydroxynitrosamino)-__monosodium_salt | C(N(O)N=O)C(N)C(=O)O |
Propionic_acid__2-amino-3-indol-3-yl | C(C(N)C(=O)O)C1=CNc2ccccc12 |
Propionic_acid__2-amino-3-ureido-_(VAN8CI) | C(N)(CNC(N)=O)C(=O)O |
Propionic_acid__2-methylene- | C(C)(=C)C(=O)O |
Propionic_acid__2-phenoxy-_(VAN8CI) | O(C(C)C(=O)O)c1ccccc1 |
Propionic_acid__2_2'-thiobis-__dihydrazide | C(C)(SC(C)C(=O)NN)C(=O)NN |
Propionic_acid__2_3-diamino-__hydrochloride | C(N)(CN)C(=O)O |
Propionic_acid__2__3-dichloro-2-methyl- | C(C)(Cl)(CCl)C(=O)O |
Propionic_acid__2__3-dichloro-__methyl_ester | C(Cl)(CCl)C(=O)OC |
Propionic_acid__3-(1-aziridinyl)-__allyl_ester | C(CC(=O)OCC=C)N1CC1 |
Propionic_acid__3-(1-aziridinyl)-__decyl_ester | C(CC(=O)OCCCCCCCCCC)N1CC1 |
Propionic_acid__3-(2-(bis(2-chloroethyl)amino)phenoxy)- | N(CCCl)(CCCl)c1ccccc1OCCC(=O)O |
Propionic_acid__3-(2_5-dimethylbenzoyl)-2-methyl- | C(=O)(CC(C)C(=O)O)c1cc(C)ccc1C |
Propionic_acid__3-(3-indolyl)-__methyl_ester | C(CC(=O)OC)C1=CNc2ccccc12 |
Propionic_acid__3-(diethylamino)- | N(CC)(CC)CCC(=O)O |
Propionic_acid__3-(m-(bis(2-chloroethyl)amino)-phenoxy)- | N(CCCl)(CCCl)c1cccc(c1)OCCC(=O)O |
Propionic_acid__3-(octylthio)- | S(CCCCCCCC)CCC(=O)O |
Propionic_acid__3-(p-(bis(2-chloroethyl)amino)phenoxy)- | N(CCCl)(CCCl)c1ccc(cc1)OCCC(=O)O |
Propionic_acid__3-(pyrrolidin-1-yl)-__ethyl_ester | C(CC(=O)OCC)N1CCCC1 |
Propionic_acid__3-cyclopentyl- | C(CC(=O)O)C1CCCC1 |
Propionic_acid__3-hydrazino- | C(CNN)C(=O)O |
Propionic_acid__3__3'-fluoren-9-ylidenedi- | C(CC(=O)O)C1(CCC(=O)O)c2ccccc2c3ccccc13 |
Propionic_acid__ALPHA_-chloro- | C(C)(Cl)C(=O)O |
Propionic_acid__ester_with_tetrahydro-2-furanpropanol | C(CCOC(=O)CC)C1CCCO1 |
Propionic_acid__laurinyl_ester | C(CCCCCCCCCC)COC(=O)CC |
Propionic_acid__pentamethylene_ester_(2:1) | C(=O)(CC)OCCCCCOC(=O)CC |
Propionic_acid__phenylmercury_salt | OC(=O)CC.c1ccccc1 |
Propionic_acid_chloride | C(Cl)(=O)CC |