If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Methylpropyl 2-methylpropionate | C(=O)(OCC(C)C)C(C)C |
Benzyl 2-methylpropionate | C(OC(=O)C(C)C)c1ccccc1 |
Ethyl 2-(4-chlorophenoxy)-2-methylpropionate | O(c1ccc(Cl)cc1)C(C)(C)C(=O)OCC |
Ethyl 2-(p-chlorophenoxy)-2-methylpropionate | O(c1ccc(Cl)cc1)C(C)(C)C(=O)OCC |
Ethyl 2-bromo-2-methylpropionate | C(=O)(OCC)C(Br)(C)C |
Ethyl 2-hydroxy-2-methylpropionate | C(=O)(OCC)C(C)(C)O |
Ethyl 2-methylpropionate | C(=O)(OCC)C(C)C |
Ethyl ALPHA_-(4-chlorophenoxy)-ALPHA_-methylpropionate | O(c1ccc(Cl)cc1)C(C)(C)C(=O)OCC |
Ethyl ALPHA_-(p-chlorophenoxy)-ALPHA_-methylpropionate | O(c1ccc(Cl)cc1)C(C)(C)C(=O)OCC |
Ethyl ALPHA_-bromo-ALPHA_-methylpropionate | C(=O)(OCC)C(Br)(C)C |
Methyl 2-hydroxy-2-methylpropionate | C(=O)(OC)C(C)(C)O |
Methyl 2-methylpropionate | C(=O)(OC)C(C)C |