If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-(1, 3-Dioxo-2-isoindoline)ethylthiuronium bromide | O=C1N(CCSC(=N)N)C(=O)c2ccccc12 |
2-(Diethylaminoethyl)isoindoline | C(CN(CC)CC)N1Cc2ccccc2C1 |
3a,4,7, 7a-Tetrahydro-2-(diethylaminoethyl)isoindoline | C(CN(CC)CC)N1CC2CC=CCC2C1 |
Isoindoline, 1,3-diimino- | N=C1NC(=N)c2ccccc12 |
Isoindoline, 2-(2-chloroethyl)-, hydrochloride | C(CCl)N1Cc2ccccc2C1 |
Isoindoline, 2-(diethylaminoethyl)- | C(CN(CC)CC)N1Cc2ccccc2C1 |
Isoindoline, 3a,4,7,7a-tetrahydro-2-(diethylaminoethyl)- | C(CN(CC)CC)N1CC2CC=CCC2C1 |