If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Ethynylcyclohexyl acetate | O(C(C)=O)C1(C#C)CCCCC1 |
1-Ethynylcyclohexyl carbamate | O(C(N)=O)C1(C#C)CCCCC1 |
1-Ethynylcyclohexyl carbanilate | O(C(=O)Nc1ccccc1)C2(C#C)CCCCC2 |
1-Ethynylcyclohexyl propionate | O(C(=O)CC)C1(C#C)CCCCC1 |
Carbamic acid, 1-ethynylcyclohexyl ester | O(C(N)=O)C1(C#C)CCCCC1 |
Carbamic_acid__1-ethynylcyclohexyl_ester | O(C(N)=O)C1(C#C)CCCCC1 |
Carbanilic acid, 1-ethynylcyclohexyl ester | O(C(=O)Nc1ccccc1)C2(C#C)CCCCC2 |
Carbanilic_acid__1-ethynylcyclohexyl_ester | O(C(=O)Nc1ccccc1)C2(C#C)CCCCC2 |