If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Propanesulfonamide, 3-bromo-N-(1,1,3, 3-tetramehthylbutyl)- | C(C)(C)(CC(C)(C)C)NS(=O)(=O)CCCBr |
1-Propanesulfonamide, 3-bromo-N-(1,1,3, 3-tetramethylbutyl)- | C(C)(C)(CC(C)(C)C)NS(=O)(=O)CCCBr |
1-Propanesulfonamide, 3-bromo-N-cyclohexyl- | N(C1CCCCC1)S(=O)(=O)CCCBr |
1-Propanesulfonamide__3-bromo-N-(1_1_3__3-tetramehthylbutyl)- | C(C)(C)(CC(C)(C)C)NS(=O)(=O)CCCBr |
1-Propanesulfonamide__3-bromo-N-cyclohexyl- | N(C1CCCCC1)S(=O)(=O)CCCBr |
3-Bromo-N-(1,1,3, 3-tetramethylbutyl)-1-propanesulfonamide | C(C)(C)(CC(C)(C)C)NS(=O)(=O)CCCBr |
3-Bromo-N-cyclohexyl-1-propanesulfonamide | N(C1CCCCC1)S(=O)(=O)CCCBr |