If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Aminopyridine | Nc1ccccn1 |
2-Chloro-3-aminopyridine | Nc1cccnc1Cl |
3, 5-Dichloro-2-aminopyridine | Clc1cc(Cl)cnc1N |
3-Aminopyridine | Nc1cccnc1 |
3-Methyl-2-aminopyridine | Cc1cccnc1N |
4-Aminopyridine 1-oxide | Nc1ccn(=O)cc1 |
4-Aminopyridine | Nc1ccncc1 |
4-Methyl-2-aminopyridine | Cc1ccnc(N)c1 |
5-Chloro-2-aminopyridine | Clc1ccc(N)nc1 |
5-Iodo-2-aminopyridine | Ic1ccc(N)nc1 |
5-Methyl-2-aminopyridine | Cc1ccc(N)nc1 |
5-Nitro-2-aminopyridine | [N+](=O)([O-])c1ccc(N)nc1 |
6-Methyl-2-aminopyridine | Cc1cccc(N)n1 |
ALPHA_-Aminopyridine | Nc1ccccn1 |
BETA_-Aminopyridine | Nc1cccnc1 |
GAMMA_-Aminopyridine | Nc1ccncc1 |
N-(Dimethylamino)ethyl-N-(p-methoxy)-ALPHA_-aminopyridine maleate | N(CCN(C)C)(Cc1ccc(OC)cc1)c2ccccn2.O=C(O)C=CC(=O)O |
N-Salicylidene-2-aminopyridine | C(=Nc1ccccn1)c2ccccc2O |
o-Aminopyridine | Nc1ccccn1 |
p-Aminopyridine | Nc1ccncc1 |