If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Tinon Blue GF | O=C1c2ccccc2C(=O)c3cc(Cl)c4Nc5c(Nc4c13)c(Cl)cc6C(=O)c7ccccc7C(=O)c56 |
Tinon Blue GL | O=C1c2ccccc2C(=O)c3cc(Cl)c4Nc5c(Nc4c13)c(Cl)cc6C(=O)c7ccccc7C(=O)c56 |
Tinon Blue RS | O=C1c2ccccc2C(=O)c3ccc4Nc5c(ccc6C(=O)c7ccccc7C(=O)c56)Nc4c13 |
Tinon Blue RSN | O=C1c2ccccc2C(=O)c3ccc4Nc5c(ccc6C(=O)c7ccccc7C(=O)c56)Nc4c13 |
Tinon Dark Blue BO | O=C1c2ccccc2c3ccc4c5ccc6c7ccccc7C(=O)c8ccc(c9ccc1c3c49)c5c68 |
Tinon Dark Blue BOA | O=C1c2ccccc2c3ccc4c5ccc6c7ccccc7C(=O)c8ccc(c9ccc1c3c49)c5c68 |
Tinon Dark Blue BOR | O=C1c2ccccc2c3ccc4c5ccc6c7ccccc7C(=O)c8ccc(c9ccc1c3c49)c5c68 |
Tinon Dark Blue MB | O=C1c2ccccc2c3ccc4c5ccc6c7ccccc7C(=O)c8ccc(c9ccc1c3c49)c5c68 |
Tinon Dark Blue MBA | O=C1c2ccccc2c3ccc4c5ccc6c7ccccc7C(=O)c8ccc(c9ccc1c3c49)c5c68 |
Tinon Golden Orange G | O=C1c2ccccc2C3=Cc4ccc5C(=O)c6ccccc6c7cc8ccc1c3c8c4c57 |
Tinon Golden Orange GN | O=C1c2ccccc2C3=Cc4ccc5C(=O)c6ccccc6c7cc8ccc1c3c8c4c57 |
Tinon Golden Yellow GK | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Tinon Golden Yellow | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Tinon Olive 2R | O=C1c2ccccc2C(=O)c3c(NC(=O)c4ccccc4)cc5c6cc(NC(=O)c7ccccc7)c8C(=O)c9ccccc9C(=O)c8c6Nc5c13 |
Tinon Red F2B | Nc1c(ccc2C(=O)c3ccccc3C(=O)c12)C4=Nc5cc6C(=O)c7ccccc7C(=O)c6cc5O4 |
Tinon Yellow GN | O=C1c2ccccc2C3=Nc4ccc5C(=O)c6ccccc6c7nc8ccc1c3c8c4c57 |