If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2,5-Xylenesulfonic acid, diester with 2-butyne-1,4-diol | S(=O)(=O)(OCC#CCOS(=O)(=O)c1cc(C)ccc1C)c2cc(C)ccc2C |
2-Ethylbutyric acid, diester with triethylene glycol | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
2-Ethylbutyric acid, triethylene glycol diester | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
2_5-Xylenesulfonic_acid__diester_with_2-butyne-1_4-diol | S(=O)(=O)(OCC#CCOS(=O)(=O)c1cc(C)ccc1C)c2cc(C)ccc2C |
Acetic acid, 2-methyl-2, 4-pentanediol diester | C(C(C)OC(C)=O)C(C)(C)OC(C)=O |
Acetic acid, 2-methyl-2-propene-1,1-diol diester | C(OC(C)=O)(OC(C)=O)C(C)=C |
Acetic acid, bromo-, diester with ethylene glycol | O(CCOC(=O)CBr)C(=O)CBr |
Acetic acid, iodo-, diester with ethylene glycol | O(CCOC(=O)CI)C(=O)CI |
Acetic acid, iodo-, diester with methyldiethanolamine, hydriodide | C(COC(=O)CI)N(C)CCOC(=O)CI |
Acetic acid, triethylene glycol diester | C(COCCOCCOC(C)=O)OC(C)=O |
Acetic_acid__2-methyl-2-propene-1_1-diol_diester | C(OC(C)=O)(OC(C)=O)C(C)=C |
Acetic_acid__2-methyl-2__4-pentanediol_diester | C(C(C)OC(C)=O)C(C)(C)OC(C)=O |
Acetic_acid__bromo-__diester_with_ethylene_glycol | O(CCOC(=O)CBr)C(=O)CBr |
Acetic_acid__iodo-__diester_with_ethylene_glycol | O(CCOC(=O)CI)C(=O)CI |
Acetic_acid__iodo-__diester_with_methyldiethanolamine__hydriodide | C(COC(=O)CI)N(C)CCOC(=O)CI |
Acrylic acid, 2,2-dimethyl-1,3-propanediol diester | C(OC(=O)C=C)C(C)(C)COC(=O)C=C |
Acrylic acid, diester with ethylene glycol | O(CCOC(=O)C=C)C(=O)C=C |
Acrylic acid, ethylene glycol diester | O(CCOC(=O)C=C)C(=O)C=C |
Acrylic_acid__diester_with_ethylene_glycol | O(CCOC(=O)C=C)C(=O)C=C |
Butyric acid, 2-ethyl-, diester with triethylene glycol | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
Carbonic acid, allyl ester, diester with diethylene glycol | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Carbonic acid, diester with 4'-hydroxyacetophenone | O(C(=O)Oc1ccc(cc1)C(C)=O)c2ccc(cc2)C(C)=O |
Carbonic acid, diester with ethyl salicylate | C(=O)(OCC)c1ccccc1OC(=O)Oc2ccccc2C(=O)OCC |
Carbonic acid, phenyl ester, diester with diethylene glycol | O(C(=O)OCCOCCOC(=O)Oc1ccccc1)c2ccccc2 |
Carbonic acid, trithio-, diester with mercaptoacetic acid | C(=S)(SCC(=O)O)SCC(=O)O |
Carbonic_acid__phenyl_ester__diester_with_diethylene_glycol | O(C(=O)OCCOCCOC(=O)Oc1ccccc1)c2ccccc2 |
Carbonic_acid__trithio-__diester_with_mercaptoacetic_acid | C(=S)(SCC(=O)O)SCC(=O)O |
Hydroquinone, diester with bis(1-aziridinyl) phosphinic acid | P(=O)(Oc1ccc(cc1)OP(=O)(N2CC2)N3CC3)(N4CC4)N5CC5 |
Isocyanic acid, diester with 1,6-hexanediol | C(CCN=C=O)CCCN=C=O |
Isocyanic_acid__diester_with_1_6-hexanediol | C(CCN=C=O)CCCN=C=O |
Itaconic acid, diester with allyl lactate | C(C(=O)OC(C)C(=O)OCC=C)C(=C)C(=O)OC(C)C(=O)OCC=C |
Methacrylic acid, diester with tetraethylene glycol | O(CCOCCOCCOCCOC(=O)C(C)=C)C(=O)C(C)=C |
Methacrylic acid, diester with triethylene glycol | O(CCOCCOCCOC(=O)C(C)=C)C(=O)C(C)=C |
Octanoic acid, diester with triethylene glycol | C(=O)(CCCCCCC)OCCOCCOCCOC(=O)CCCCCCC |
Succinic acid, diester with choline chloride | C(COC(=O)CCC(=O)OCCN(C)(C)C)N(C)(C)C |
Succinic acid, diester with choline iodide | C(COC(=O)CCC(=O)OCCN(C)(C)C)N(C)(C)C |
Succinic acid, diester with salicylic acid | C(=O)(O)c1ccccc1OC(=O)CCC(=O)Oc2ccccc2C(=O)O |
Sulfosuccinic acid, tridecyl alcohol diester, sodium salt | C(CC(=O)OCCCCCCCCCCCCC)(C(=O)OCCCCCCCCCCCCC)S(=O)(=O)O |
Thiocyanic acid, diester with p,p'-iminodiphenol | N(c1ccc(SC#N)cc1)c2ccc(SC#N)cc2 |
Thiocyanic_acid__diester_with_p_p'-iminodiphenol | N(c1ccc(SC#N)cc1)c2ccc(SC#N)cc2 |