If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Aminophenylacetic acid | C(C(=O)O)c1ccc(N)cc1 |
ALPHA_-Aminophenylacetic acid | C(N)(C(=O)O)c1ccccc1 |
DL-ALPHA_-Aminophenylacetic acid | C(N)(C(=O)O)c1ccccc1 |
L-(+ )-ALPHA_-Aminophenylacetic acid | C(N)(C(=O)O)c1ccccc1 |
N, N-Bis(2-chloroethyl)-p-aminophenylacetic acid | N(CCCl)(CCCl)c1ccc(cc1)CC(=O)O |
N,N-Bis(chloroethyl)-p-aminophenylacetic acid | N(CCCl)(CCCl)c1ccc(cc1)CC(=O)O |
p-Aminophenylacetic acid | C(C(=O)O)c1ccc(N)cc1 |
p-N, N-(Dichloroethyl)aminophenylacetic acid | N(CCCl)(CCCl)c1ccc(cc1)CC(=O)O |