If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Vulkacit 1000 | N(C(=N)NC(=N)N)c1ccccc1C |
Vulkacit CA | N(C(=S)Nc1ccccc1)c2ccccc2 |
Vulkacit CZ | S(NC1CCCCC1)C2=Nc3ccccc3S2 |
Vulkacit D | N(C(=N)Nc1ccccc1)c2ccccc2 |
Vulkacit DM | S(SC1=Nc2ccccc2S1)C3=Nc4ccccc4S3 |
Vulkacit DM/C | S(SC1=Nc2ccccc2S1)C3=Nc4ccccc4S3 |
Vulkacit DOTG | N(C(=N)Nc1ccccc1C)c2ccccc2C |
Vulkacit HX | N(CC)C1CCCCC1 |
Vulkacit J | N(C)(C(=S)SSC(=S)N(C)c1ccccc1)c2ccccc2 |
Vulkacit L | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Vulkacit LDA | N(CC)(CC)C1=S[Zn]2(S1)SC(=S2)N(CC)CC |
Vulkacit M | S=C1Nc2ccccc2S1 |
Vulkacit MOZ | S(N1CCOCC1)C2=Nc3ccccc3S2 |
Vulkacit Mercapto | S=C1Nc2ccccc2S1 |
Vulkacit Mercapto/C | S=C1Nc2ccccc2S1 |
Vulkacit NZ | S(NC(C)(C)C)C1=Nc2ccccc2S1 |
Vulkacit P | C(=S)(SN1CCCCC1)N2CCCCC2 |
Vulkacit TH | C(=S)(SSC(=S)N(C)C)N(C)C |
Vulkacit Thiuram MS | C(=S)(SC(=S)N(C)C)N(C)C |
Vulkacit ZDK | N(CC)(CC)C1=S[Zn]2(S1)SC(=S2)N(CC)CC |
Vulkacit mtic | C(=S)(SSC(=S)N(C)C)N(C)C |
Vulkacit thiuram | C(=S)(SSC(=S)N(C)C)N(C)C |