If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Monoanhydride with sulfuric acid | Cc1n2ccc3cc(OC)c(OC)cc3c2cc4cc(OC)c(OC)cc14.O=C(O)CS(=O)(=O)O |
Sulfuric acid aluminum(3+) salt (3:2) | S(=O)(=O)(O)O |
Sulfuric acid beryllium salt (1:1) | S(=O)(=O)(O)O |
Sulfuric acid copper(2+) salt (1:1) | S(=O)(=O)(O)O |
Sulfuric acid diammonium salt | S(=O)(=O)(O)O |
Sulfuric acid disodium salt | S(=O)(=O)(O)O |
Sulfuric acid iron salt (1:1) | S(=O)(=O)(O)O |
Sulfuric acid iron(2+) salt (1:1) | S(=O)(=O)(O)O |
Sulfuric acid magnesium salt (1:1) | S(=O)(=O)(O)O |
Sulfuric acid magnesium salt (VAN) | S(=O)(=O)(O)O |
Sulfuric acid monododecyl ester sodium salt | C(CCCCCCCCCC)COS(=O)(=O)O |
Sulfuric acid monopotassium salt | S(=O)(=O)(O)O |
Sulfuric acid monosodium salt | S(=O)(=O)(O)O |
Sulfuric acid nickel(2+) salt | S(=O)(=O)(O)O |
Sulfuric acid potassium salt (1:1) | S(=O)(=O)(O)O |
Sulfuric acid thallium(1+) salt (1:2) | S(=O)(=O)(O)O |
Sulfuric acid zinc salt (1:1) | S(=O)(=O)(O)O |
Sulfuric acid zinc salt (VAN) | S(=O)(=O)(O)O |
Sulfuric acid, aluminum ammonium salt (2:1:1) | S(=O)(=O)(O)O |
Sulfuric acid, aluminum salt (3:2) | S(=O)(=O)(O)O |
Sulfuric acid, aluminum(3+) salt (3:2) | S(=O)(=O)(O)O |
Sulfuric acid, ammonium iron(3+) salt (2:1:1) | S(=O)(=O)(O)O |
Sulfuric acid, beryllium salt (1:1) | S(=O)(=O)(O)O |
Sulfuric acid, calcium salt (1:1) | S(=O)(=O)(O)O |
Sulfuric acid, calcium salt (VAN) | S(=O)(=O)(O)O |
Sulfuric acid, chromium(3+) salt (3:2) | S(=O)(=O)(O)O |
Sulfuric acid, copper(2+) salt (1:1) | S(=O)(=O)(O)O |
Sulfuric acid, diammonium salt | S(=O)(=O)(O)O |
Sulfuric acid, diethyl ester | S(=O)(=O)(OCC)OCC |
Sulfuric acid, dimethyl ester | S(=O)(=O)(OC)OC |
Sulfuric acid, dirubidium salt | S(=O)(=O)(O)O |
Sulfuric acid, disodium salt | S(=O)(=O)(O)O |
Sulfuric acid, dithallium(1+) salt | S(=O)(=O)(O)O |
Sulfuric acid, europium(3+) salt (3:2) | S(=O)(=O)(O)O |
Sulfuric acid, gallium salt (3:2) (8CI 9CI) | S(=O)(=O)(O)O |
Sulfuric acid, indium salt | S(=O)(=O)(O)O |
Sulfuric acid, indium(3+) salt (3:2) | S(=O)(=O)(O)O |
Sulfuric acid, iron(2+) salt (1:1) | S(=O)(=O)(O)O |
Sulfuric acid, magnesium salt (1:1) | S(=O)(=O)(O)O |
Sulfuric acid, methyl ester ammonium salt | S(=O)(=O)(O)OC |
Sulfuric acid, mono(2-ethylhexyl) ester, sodium salt | C(CC)(CCCC)COS(=O)(=O)O |
Sulfuric acid, mono(4-nitrophenyl) ester, potassium salt | O(c1ccc(cc1)[N+](=O)[O-])S(=O)(=O)O |
Sulfuric acid, monododecyl ester, sodium salt | C(CCCCCCCCCC)COS(=O)(=O)O |
Sulfuric acid, monomethyl ester, ammonium salt | S(=O)(=O)(O)OC |
Sulfuric acid, monomethyl ester, potassium salt | S(=O)(=O)(O)OC |
Sulfuric acid, monopentyl ester, sodium salt | C(CCCC)OS(=O)(=O)O |
Sulfuric acid, monophenyl ester, potassium salt | O(c1ccccc1)S(=O)(=O)O |
Sulfuric acid, monopotassium salt | S(=O)(=O)(O)O |
Sulfuric acid, monopropyl ester, potassium salt | O(CCC)S(=O)(=O)O |
Sulfuric acid, monosodium salt | S(=O)(=O)(O)O |
Sulfuric acid, monotetradecyl ester, sodium salt | C(CCCCCCCCCCCC)COS(=O)(=O)O |
Sulfuric acid, myristyl ester, sodium salt | C(CCCCCCCCCCCC)COS(=O)(=O)O |
Sulfuric acid, nickel(2+) salt (1:1) | S(=O)(=O)(O)O |
Sulfuric acid, platinum complex | O=S1(=O)O[Pt]2(NCC3(CCCCC3)CN2)O1 |
Sulfuric acid, thallium(1+) salt (1:2) | S(=O)(=O)(O)O |
Sulfuric acid, vanadium(2+) salt (1:1) | S(=O)(=O)(O)O |
Sulfuric acid, zinc salt (1:1) | S(=O)(=O)(O)O |
Sulfuric acid, zirconium(4+) salt (2:1) | S(=O)(=O)(O)O |
Sulfuric diamide | S(N)(N)(=O)=O |
Sulfuric_acid__aluminum(3+)_salt_(3:2) | S(=O)(=O)(O)O |
Sulfuric_acid__aluminum_ammonium_salt_(2:1:1) | S(=O)(=O)(O)O |
Sulfuric_acid__ammonium_iron(3+)_salt_(2:1:1) | S(=O)(=O)(O)O |
Sulfuric_acid__beryllium_salt_(1:1) | S(=O)(=O)(O)O |
Sulfuric_acid__chromium(3+)_salt_(3:2) | S(=O)(=O)(O)O |
Sulfuric_acid__copper(2+)_salt_(1:1) | S(=O)(=O)(O)O |
Sulfuric_acid__diammonium_salt | S(=O)(=O)(O)O |
Sulfuric_acid__diethyl_ester | S(=O)(=O)(OCC)OCC |
Sulfuric_acid__dirubidium_salt | S(=O)(=O)(O)O |
Sulfuric_acid__disodium_salt | S(=O)(=O)(O)O |
Sulfuric_acid__europium(3+)_salt_(3:2) | S(=O)(=O)(O)O |
Sulfuric_acid__gallium_salt_(3:2)_(8CI_9CI) | S(=O)(=O)(O)O |
Sulfuric_acid__indium(3+)_salt_(3:2) | S(=O)(=O)(O)O |
Sulfuric_acid__iron(2+)_salt_(1:1) | S(=O)(=O)(O)O |
Sulfuric_acid__magnesium_salt_(1:1) | S(=O)(=O)(O)O |
Sulfuric_acid__mono(2-ethylhexyl)_ester__sodium_salt | C(CC)(CCCC)COS(=O)(=O)O |
Sulfuric_acid__monomethyl_ester__ammonium_salt | S(=O)(=O)(O)OC |
Sulfuric_acid__monomethyl_ester__potassium_salt | S(=O)(=O)(O)OC |
Sulfuric_acid__monopentyl_ester__sodium_salt | C(CCCC)OS(=O)(=O)O |
Sulfuric_acid__monophenyl_ester__potassium_salt | O(c1ccccc1)S(=O)(=O)O |
Sulfuric_acid__monopropyl_ester__potassium_salt | O(CCC)S(=O)(=O)O |
Sulfuric_acid__monotetradecyl_ester__sodium_salt | C(CCCCCCCCCCCC)COS(=O)(=O)O |
Sulfuric_acid__nickel(2+)_salt_(1:1) | S(=O)(=O)(O)O |
Sulfuric_acid__thallium(1+)_salt_(1:2) | S(=O)(=O)(O)O |
Sulfuric_acid__vanadium(2+)_salt_(1:1) | S(=O)(=O)(O)O |
Sulfuric_acid__zinc_salt_(1:1) | S(=O)(=O)(O)O |
Sulfuric_acid__zirconium(4+)_salt_(2:1) | S(=O)(=O)(O)O |
Sulfuric_acid_potassium_salt_(1:1) | S(=O)(=O)(O)O |