If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2,4, 6-Tris(hydroxymethyl)melamine | N(CO)c1nc(NCO)nc(NCO)n1 |
Hexa(hydroxymethyl)melamine | N(CO)(CO)c1nc(nc(n1)N(CO)CO)N(CO)CO |
Hexakis(hydroxymethyl)melamine | N(CO)(CO)c1nc(nc(n1)N(CO)CO)N(CO)CO |
Melamine cyanaurate | Nc1nc(N)nc(N)n1.Oc2nc(O)nc(O)n2 |
Melamine cyanurate | Nc1nc(N)nc(N)n1.Oc2nc(O)nc(O)n2 |
Melamine | Nc1nc(N)nc(N)n1 |
Melamine, N(2),N(4),N(6)-triphenyl- | N(c1ccccc1)c2nc(Nc3ccccc3)nc(n2)Nc4ccccc4 |
Melamine, N(sup2),N(sup4),N(sup6)-tris(hydroxymethyl)- | N(CO)c1nc(NCO)nc(NCO)n1 |
Melamine, N2, N2-dimethyl- | N(C)(C)c1nc(N)nc(N)n1 |
Melamine, N2,N2,N4,N4,N6-pentamethyl-, monohydrochloride | N(C)(C)c1nc(NC)nc(n1)N(C)C |
Melamine, N2,N2-diallyl- | N(CC=C)(CC=C)c1nc(N)nc(N)n1 |
Melamine, N2,N4, N6-trimethyl- | N(C)c1nc(NC)nc(NC)n1 |
Melamine, N2,N4,N6-trichloro- | N(Cl)c1nc(NCl)nc(NCl)n1 |
Melamine, hexakis(hydroxymethyl)- | N(CO)(CO)c1nc(nc(n1)N(CO)CO)N(CO)CO |
Melamine, hexamethyl- | N(C)(C)c1nc(nc(n1)N(C)C)N(C)C |
Melamine, n(sup2), n(sup2)-dimethyl- | N(C)(C)c1nc(N)nc(N)n1 |
Melamine, triethylene- | c1(nc(nc(n1)N2CC2)N3CC3)N4CC4 |
N,N', N''-(Trihydroxymethyl)melamine | N(CO)c1nc(NCO)nc(NCO)n1 |
N,N', N''-Tris(hydroxymethyl)melamine | N(CO)c1nc(NCO)nc(NCO)n1 |
Tris(hydroxymethyl)melamine | N(CO)c1nc(NCO)nc(NCO)n1 |