If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Chlor-4-toluidin (CZECH) | Clc1cc(C)ccc1N |
3-Chlor-2-toluidin (CZECH) | Cc1c(Cl)cccc1N |
3-Nitro-4-toluidin(CZECH) | [N+](=O)([O-])c1cc(N)ccc1C |
Kyselina 4-toluidin-3-sulfonova (CZECH) | S(=O)(=O)(O)c1cc(C)ccc1N |
m-Toluidin(CZECH) | Cc1cccc(N)c1 |
o-Toluidin (CZECH) | Cc1ccccc1N |
o-Toluol-azo-o-toluidin(GERMAN) | N(=Nc1ccc(N)c(C)c1)c2ccccc2C |
p-Toluidin(CZECH) | Cc1ccc(N)cc1 |