If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
S-Decyl p-toluenethiosulfonate | S(=O)(=O)(SCCCCCCCCCC)c1ccc(C)cc1 |
S-Hexadecyl p-toluenethiosulfonate | S(=O)(=O)(SCCCCCCCCCCCCCCCC)c1ccc(C)cc1 |
S-Hexyl p-toluenethiosulfonate | S(=O)(=O)(SCCCCCC)c1ccc(C)cc1 |
S-Methyl p-toluenethiosulfonate | S(=O)(=O)(SC)c1ccc(C)cc1 |
S-Octyl p-toluenethiosulfonate | S(=O)(=O)(SCCCCCCCC)c1ccc(C)cc1 |
S-Trichloromethyl p-toluenethiosulfonate | S(=O)(=O)(SC(Cl)(Cl)Cl)c1ccc(C)cc1 |
S-Trifluoromethyl p-toluenethiosulfonate | S(=O)(=O)(SC(F)(F)F)c1ccc(C)cc1 |
Sodium p-toluenethiosulfonate | S(=O)(=O)(S)c1ccc(C)cc1 |
p-Tolyl p-toluenethiosulfonate | S(=O)(=O)(Sc1ccc(C)cc1)c2ccc(C)cc2 |