If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Isoquinolinol | Oc1nccc2ccccc12 |
4-Isoquinolinol | Oc1cncc2ccccc12 |
5-Isoquinolinol | Oc1cccc2cnccc12 |
6-Isoquinolinol, 1,2,3, 4-tetrahydro-7-methoxy-2-methyl-1-veratryl- | C(c1ccc(OC)c(OC)c1)C2N(C)CCc3cc(O)c(OC)cc23 |
8-Isoquinolinol | Oc1cccc2ccncc12 |
8-Isoquinolinol, 4-benzyl-7-methoxy- | C(c1ccccc1)c2cncc3c(O)c(OC)ccc23 |
8-Isoquinolinol__4-benzyl-7-methoxy- | C(c1ccccc1)c2cncc3c(O)c(OC)ccc23 |