If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Ethylhexyl orthosilicate | [Si](OCC(CC)CCCC)(OCC(CC)CCCC)(OCC(CC)CCCC)OCC(CC)CCCC |
Ethyl orthosilicate | [Si](OCC)(OCC)(OCC)OCC |
Methyl orthosilicate | [Si](OC)(OC)(OC)OC |
Tetra(2-ethylhexyl) orthosilicate | [Si](OCC(CC)CCCC)(OCC(CC)CCCC)(OCC(CC)CCCC)OCC(CC)CCCC |
Tetrabutyl orthosilicate | [Si](OCCCC)(OCCCC)(OCCCC)OCCCC |
Tetraethyl orthosilicate | [Si](OCC)(OCC)(OCC)OCC |
Tetramethyl orthosilicate | [Si](OC)(OC)(OC)OC |