If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Thiouracil (VAN) | Oc1ccnc(S)n1 |
2-Thiouracil-4-carboxylic acid | C(=O)(O)c1cc(O)nc(S)n1 |
4,5-Diamino-2-thiouracil | Nc1c(N)nc(S)nc1O |
4-(Ethoxycarbonylmethyl)thiouracil | n1c(O)nccc1SCC(=O)OCC |
4-Amino-2-thiouracil | Nc1cc(O)nc(S)n1 |
4-Methyl-2-thiouracil | Cc1cc(O)nc(S)n1 |
4-Propyl-2-thiouracil | C(CC)c1cc(O)nc(S)n1 |
4-Thiouracil | Sc1ccnc(O)n1 |
5, 6-Dihydro-3-octyl-2-thiouracil | C(CCCCCCC)N1C(=O)CCNC1=S |
5-Methyl-2-thiouracil | Oc1nc(S)ncc1C |
5-Thiouracil | Oc1nc(O)ncc1S |
6-(p-Tolylhydrazino)-2-thiouracil | N(Nc1ccc(C)cc1)C2=NC(=S)NC(=O)C2 |
6-Amino-2-thiouracil | Nc1cc(O)nc(S)n1 |
6-Carboxy-2-thiouracil | C(=O)(O)c1cc(O)nc(S)n1 |
6-Methyl-2-thiouracil | Cc1cc(O)nc(S)n1 |
6-Propyl-2-thiouracil | C(CC)c1cc(O)nc(S)n1 |
6-Thiouracil | Oc1ccnc(S)n1 |
6-n-Propyl-2-thiouracil | C(CC)c1cc(O)nc(S)n1 |
Thiouracil | Oc1ccnc(S)n1 |