If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Bromodiphenyl ether | O(c1ccccc1)c2ccc(Br)cc2 |
4-Bromodiphenyl sulfone | S(=O)(=O)(c1ccccc1)c2ccc(Br)cc2 |
4-Bromodiphenyl | Brc1ccc(cc1)c2ccccc2 |
Methane, bromodiphenyl- (solution) | C(Br)(c1ccccc1)c2ccccc2 |
Methane, bromodiphenyl- | C(Br)(c1ccccc1)c2ccccc2 |
Stannane, methylenebis(bromodiphenyl- | [Sn](Br)(C[Sn](Br)(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Stannane__methylenebis(bromodiphenyl- | [Sn](Br)(C[Sn](Br)(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
p-Bromodiphenyl ether | O(c1ccccc1)c2ccc(Br)cc2 |