If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(+)-Sesbanine | O=C1NC(=O)c2cnccc2C13CCC(O)C3 |
(.+-.)-Sesbanine | O=C1NC(=O)c2cnccc2C13CCC(O)C3 |
SESBANINE (+) | O=C1NC(=O)c2cnccc2C13CCC(O)C3 |
SESBANINE, (+)- | O=C1NC(=O)c2cnccc2C13CCC(O)C3 |
SESBANINE, (+)-10-EPI- | O=C1NC(=O)c2cnccc2C13CCC(O)C3 |
SESBANINE__(+)-10-EPI- | O=C1NC(=O)c2cnccc2C13CCC(O)C3 |
Sesbanine | O=C1NC(=O)c2cnccc2C13CCC(O)C3 |