If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Mercaptopropionic acid methyl ester | C(=O)(OC)CCS |
3-Mercaptopropionic acid | C(CS)C(=O)O |
BETA_-Mercaptopropionic acid | C(CS)C(=O)O |
BETA_-Mercaptopropionic acid, butyl ester | O(CCCC)C(=O)CCS |
BETA_-Mercaptopropionic_acid | C(CS)C(=O)O |
BETA_-Mercaptopropionic_acid__butyl_ester | O(CCCC)C(=O)CCS |
Mercaptopropionic acid (VAN) | C(CS)C(=O)O |
Mercaptopropionic acid, dibutyltin salt | C(CCC)[Sn]1(CCCC)SCCC(=O)O1 |
S-Benzyl-BETA_-mercaptopropionic acid | C(SCCC(=O)O)c1ccccc1 |