If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Fenacet Blue G | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Fenacet Fast Blue FF | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Fenacet Fast Blue FFN | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Fenacet Fast Pink 3BE | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Fenacet Fast Pink B | O=C1c2ccccc2C(=O)c3c(O)ccc(N)c13 |
Fenacet Fast Pink RF | O=C1c2ccccc2C(=O)c3c(O)cc(OC)c(N)c13 |
Fenacet Fast Turquoise B | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Fenacet Fast Violet 5R | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Fenacet Fast Violet B | O=C1c2c(N)ccc(N)c2C(=O)c3cccc([N+](=O)[O-])c13 |
Fenacet Fast Yellow 2R | [N+](=O)([O-])c1cc(ccc1Nc2ccc(O)cc2)[N+](=O)[O-] |
Fenacet Fast Yellow 4R | N(=Nc1ccc(O)cc1)c2ccc(cc2)N=Nc3ccccc3 |
Fenacet Scarlet B | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |