If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-(1-Isobutenyl)-3,3-dimethylcyclopropanecarboxylic acid | C(=O)(O)C1C(C=C(C)C)C1(C)C |
3-Isobutenyl-2,2-dimethylcyclopropanecarboxylic acid | C(=O)(O)C1C(C=C(C)C)C1(C)C |
Barbituric acid, 5-ethyl-5-(1-isobutenyl)- | C(=C(C)C)C1(CC)C(=O)NC(=O)NC1=O |
Isobutenyl chloride | C(C)(=C)CCl |
Isobutenyl methyl ketone | C(=C(C)C)C(C)=O |
Methyl isobutenyl ketone | C(=C(C)C)C(C)=O |