If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-Oxaspiro(4.5)decan-3-one | O=C1OCC2(CCCCC2)C1 |
3-Methyl-1-phenyl-1,3, 8-triazaspiro(4.5)decan-4-one hydrochloride | O=C1N(C)CN(c2ccccc2)C13CCNCC3 |
Spiro(4.5)decan | C123CCCC1.C2CCCC3 |
Spiro(4.5)decan-1-ol | OC1CCCC12CCCCC2 |
Spiro(4.5)decan-6-one | O=C1CCCCC12CCCC2 |
Tricyclo(3.3.1.1(sup3,7))decan-1-amine | C1C2CC3CC1(N)CC(C2)C3 |
Tricyclo(3.3.1.1(sup3_7))decan-1-amine | C1C2CC3CC1(N)CC(C2)C3 |
Tricyclo(3.3.1.13,7)decan-1-amine, hydrochloride | NC12CC3CC(C1)CC(C2)C3 |
Tricyclo(3.3.1.13,7)decan-1-ol | OC12CC3CC(C1)CC(C2)C3 |
Tricyclo(3.3.1.13,7)decan-2-amine | NC1C2CC3CC1CC(C2)C3 |
Tricyclo(3.3.1.13,7)decan-2-ol | OC1C2CC3CC1CC(C2)C3 |
Tricyclo(3.3.1.13,7)decan-2-ol, 2-methyl- | CC1(O)C2CC3CC(C2)CC1C3 |
Tricyclo(3.3.1.13_7)decan-1-amine__hydrochloride | NC12CC3CC(C1)CC(C2)C3 |
Tricyclo(3.3.1.13_7)decan-1-ol | OC12CC3CC(C1)CC(C2)C3 |
Tricyclo(3.3.1.13_7)decan-2-amine | NC1C2CC3CC1CC(C2)C3 |
Tricyclo(3.3.1.13_7)decan-2-ol | OC1C2CC3CC1CC(C2)C3 |
Tricyclo(3.3.1.13_7)decan-2-ol__2-methyl- | CC1(O)C2CC3CC(C2)CC1C3 |
Tricyclo(4.2.2.01,6)decan-2-ol | OC1CCCC23CCC12CC3 |
Tricyclo(4.2.2.01_6)decan-2-ol | OC1CCCC23CCC12CC3 |
Tricyclo(5.2.1.0(2, 6))decan-8-ol | OC1CC2CC1C3CCCC23 |
Tricyclo(5.2.1.02, 6)decan-8-one | O=C1CC2CC1C3CCCC23 |
n-Decan-1-ol | C(CCCCC)CCCCO |