If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Butyl Carbitol | C(COCCO)OCCCC |
Butyl carbitol 6-propylpiperonyl ether | C(OCCOCCOCCCC)c1cc2OCOc2cc1CCC |
Butyl carbitol acetate | C(OCCOCCCC)COC(C)=O |
Butyl carbitol rhodanate | C(COCCCC)OCCSC#N |
Butyl carbitol thiocyanate | C(COCCCC)OCCSC#N |
Carbitol acetate | C(OCCOCC)COC(C)=O |
Carbitol cellosolve | C(COCC)OCCO |
Carbitol phthalate | C(=O)(OCCOCCOCC)c1ccccc1C(=O)OCCOCCOCC |
Carbitol solvent | C(COCC)OCCO |
Carbitol | C(COCC)OCCO |
Carbitol, diethyl | O(CCOCCO)CCOCCO |
Dimethyl carbitol | O(CCOC)CCOC |
Ethyl carbitol | C(COCC)OCCO |
Hexol carbitol | O(CCCCCC)CCOCCO |
Hexyl carbitol | O(CCCCCC)CCOCCO |
Methyl Carbitol | C(COC)OCCO |
Phenyl carbitol | O(CCOCCO)c1ccccc1 |
n-Hexyl Carbitol | O(CCCCCC)CCOCCO |