If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 2-Dihydroxybenzene | Oc1ccccc1O |
1, 2-Dihydroxybenzene-3,5-disulfonic acid disodium salt | S(=O)(=O)(O)c1cc(cc(O)c1O)S(=O)(=O)O |
1, 4-Dihydroxybenzene | Oc1ccc(O)cc1 |
1,2-Dimethyl-3, 5-dihydroxybenzene | Cc1c(C)cc(O)cc1O |
1,3-Dihydroxybenzene diacetate | O(C(C)=O)c1cccc(c1)OC(C)=O |
1,3-Dihydroxybenzene | Oc1cccc(O)c1 |
1_2-Dimethyl-3__5-dihydroxybenzene | Cc1c(C)cc(O)cc1O |
1_3-Dihydroxybenzene_diacetate | O(C(C)=O)c1cccc(c1)OC(C)=O |
2,5-Dichloro-1,4-dihydroxybenzene | Clc1cc(O)c(Cl)cc1O |
2-Chloro-1,4-dihydroxybenzene | Clc1cc(O)ccc1O |
2_5-Dichloro-1_4-dihydroxybenzene | Clc1cc(O)c(Cl)cc1O |
3-Methyl-1, 2-dihydroxybenzene | Oc1c(C)cccc1O |
4,6-Dichloro-1,3-dihydroxybenzene | Clc1cc(Cl)c(O)cc1O |
4-(2'-Carboxyvinyl)-1,2-dihydroxybenzene | C(=CC(=O)O)c1ccc(O)c(O)c1 |
4-(2-Carboxyethenyl)-1, 2-dihydroxybenzene | C(=CC(=O)O)c1ccc(O)c(O)c1 |
4-Carboxy-1,2-dihydroxybenzene | C(=O)(O)c1ccc(O)c(O)c1 |
4-Carboxy-1_2-dihydroxybenzene | C(=O)(O)c1ccc(O)c(O)c1 |
4-Chloro-1,3-dihydroxybenzene | Oc1cc(O)ccc1Cl |
4-Chloro-1_3-dihydroxybenzene | Oc1cc(O)ccc1Cl |
4-Formyl-1, 2-dihydroxybenzene | C(=O)c1ccc(O)c(O)c1 |
4-Formyl-1__2-dihydroxybenzene | C(=O)c1ccc(O)c(O)c1 |
4-Hexyl-1,3-dihydroxybenzene | C(CCCCC)c1ccc(O)cc1O |
4-Methyl-1, 2-dihydroxybenzene | Oc1cc(C)ccc1O |
4-Methyl-1__2-dihydroxybenzene | Oc1cc(C)ccc1O |
4-tert-Butyl-1,2-dihydroxybenzene | C(C)(C)(C)c1ccc(O)c(O)c1 |
4_6-Dichloro-1_3-dihydroxybenzene | Clc1cc(Cl)c(O)cc1O |
Dihydroxybenzene diacetate | O(C(C)=O)c1cccc(c1)OC(C)=O |
Dihydroxybenzene | Oc1ccc(O)cc1 |
Disodium 1,2-dihydroxybenzene-3, 5-disulfonate | S(=O)(=O)(O)c1cc(cc(O)c1O)S(=O)(=O)O |
Disodium 4,5-dihydroxybenzene-1,3-disulfonate | S(=O)(=O)(O)c1cc(cc(O)c1O)S(=O)(=O)O |
m-Dihydroxybenzene | Oc1cccc(O)c1 |
o-Dihydroxybenzene | Oc1ccccc1O |
p-Dihydroxybenzene | Oc1ccc(O)cc1 |