If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(E)-2-Heptene | C(CCC)C=CC |
(E)-3-Heptene | C(CCC)=CCC |
(Z)-3-Heptene | C(CCC)=CCC |
1,1-Diphenyl-1-heptene | C(=CCCCCC)(c1ccccc1)c2ccccc2 |
1,4,5,6,7, 7-Hexachlorobicyclo(2.2.1)heptene-2,3-dicarboximide | ClC12C(Cl)=C(Cl)C(Cl)(C3C(=O)NC(=O)C13)C2(Cl)Cl |
1,7-Diphenyl-4-(3-phenylpropyl)-3-heptene | C(CCCc1ccccc1)(CCCc2ccccc2)=CCCc3ccccc3 |
1-Heptene oxide | C(CCCC)C1CO1 |
1-Heptene | C(CCC)CC=C |
1-Heptene, 1, 1-diphenyl- | C(=CCCCCC)(c1ccccc1)c2ccccc2 |
1-Heptene, 2-methyl- | C(CCCC)C(C)=C |
1-Heptene, 5-methyl- | C(C)(CC)CCC=C |
1-Heptene__2-methyl- | C(CCCC)C(C)=C |
1-Heptene__5-methyl- | C(C)(CC)CCC=C |
1-n-Heptene | C(CCC)CC=C |
2,2,3,5,5,6,6-Heptamethyl-3-heptene | C(C)(C)(C=C(C)C(C)(C)C)C(C)(C)C |
2,6, 6-Trimethylbicyclo(3.1.1)-2-heptene | CC1(C)C2CC=C(C)C1C2 |
2-Heptene, (E)- | C(CCC)C=CC |
2-Heptene, 1-ethoxy-, (Z)- | C(CCCC)=CCOCC |
2-Heptene, 2-methyl- | C(CCCC)=C(C)C |
2-Heptene, trans- | C(CCC)C=CC |
2-Heptene__1-ethoxy-__(Z)- | C(CCCC)=CCOCC |
2-Heptene__2-methyl- | C(CCCC)=C(C)C |
2-Methyl-1-heptene | C(CCCC)C(C)=C |
2-Methyl-2-heptene | C(CCCC)=C(C)C |
2-Methyl-trans-3-heptene | C(=CCCC)C(C)C |
2-Methylbicyclo(2.2.1)heptene | CC1=CC2CCC1C2 |
3-Heptene, (E)- | C(CCC)=CCC |
3-Heptene, (Z)- | C(CCC)=CCC |
3-Heptene, 2,2,3,5,5,6, 6-heptamethyl- | C(C)(C)(C=C(C)C(C)(C)C)C(C)(C)C |
3-Heptene, 2-methyl-, (E)- | C(=CCCC)C(C)C |
3-Heptene, 4-methyl- | C(C)(CCC)=CCC |
3-Heptene, 6-methyl-, (E)- | C(C=CCC)C(C)C |
3-Heptene__(Z)- | C(CCC)=CCC |
3-Heptene__2-methyl-__(E)- | C(=CCCC)C(C)C |
3-Heptene__2_2_3_5_5_6__6-heptamethyl- | C(C)(C)(C=C(C)C(C)(C)C)C(C)(C)C |
3-Heptene__4-methyl- | C(C)(CCC)=CCC |
3-Heptene__6-methyl-__(E)- | C(C=CCC)C(C)C |
3-Oxiranyl-7-oxabicyclo(4.1.0)heptene | C12OC1CCC(C2)C3CO3 |
4-Methyl-3-heptene | C(C)(CCC)=CCC |
5-Hydroxymethyl-5-methylbicyclo(2.2.1)heptene-2 | C(O)C1(C)CC2C=CC1C2 |
5-Methyl-1-heptene | C(C)(CC)CCC=C |
6, 6-Dimethylbicyclo(3.1.1)-2-heptene | CC1(C)C2CC=CC1C2 |
6, 6-Dimethylbicyclo(3.1.1)-2-heptene-2-ethyl acetate | C(COC(C)=O)C1=CCC2CC1C2(C)C |
6-Methyl-5-heptene-2-one | C(C=C(C)C)CC(C)=O |
Benzene, 1,1'-(4-(3-phenylpropyl)-3-heptene-1,7-diyl)bis- | C(CCCc1ccccc1)(CCCc2ccccc2)=CCCc3ccccc3 |
Benzene__1_1'-(4-(3-phenylpropyl)-3-heptene-1_7-diyl)bis- | C(CCCc1ccccc1)(CCCc2ccccc2)=CCCc3ccccc3 |
Bicyclo(2.2.1)heptene | C12CCC(C1)C=C2 |
Bicyclo(2.2.1)heptene-2-dicarboxylic acid, 2-ethylhexylimide | O=C1N(CC(CC)CCCC)C(=O)C2C3C=CC(C3)C12 |
Dimethyl cis-bicyclo(2,2,1)-5-heptene-2, 3-dicarboxylate | C(=O)(OC)C1C2C=CC(C2)C1C(=O)OC |
Dimethyl cis-bicyclo(2.2.1)-5-heptene-2, 3-dicarboxylate | C(=O)(OC)C1C2C=CC(C2)C1C(=O)OC |
Heptene 1,2-oxide | C(CCCC)C1CO1 |
N-(2-Ethylhexyl)bicyclo(2.2.1)-5-heptene-2,3-dicarboximide | O=C1N(CC(CC)CCCC)C(=O)C2C3C=CC(C3)C12 |
N-Octylbicyclo(2.2.1)-5-heptene-2,3-dicarboximide | O=C1N(CC(CC)CCCC)C(=O)C2C3C=CC(C3)C12 |
cis-3-Heptene | C(CCC)=CCC |
cis-Bicyclo(2,2,1)-heptene-2,3-dicarboxylic acid, methyl ester | C(=O)(OC)C1C2C=CC(C2)C1C(=O)OC |
trans-2-Heptene | C(CCC)C=CC |
trans-3-Heptene | C(CCC)=CCC |