If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
WLN: 1MVOR B1 EK1&1&1 &Q &I | O(C(=O)NC)c1cc(ccc1C)N(C)(C)C |
WLN: 1MVOR C1 E1 | O(C(=O)NC)c1cc(C)cc(C)c1 |
WLN: 1MVOR C1 | O(C(=O)NC)c1cccc(C)c1 |
WLN: 1MVOR DK1&1&1 &Q &I | N(C)(C)(C)c1ccc(cc1)OC(=O)NC |
WLN: 1MVOR | O(C(=O)NC)c1ccccc1 |
WLN: 1X1&1&MVOR CMVN1&1 | N(C(=O)N(C)C)c1cccc(c1)OC(=O)NC(C)(C)C |
WLN: 1Y1&1MVOR CMVO1 | O(C(=O)NCC(C)C)c1cccc(c1)NC(=O)OC |
WLN: 2MVOR CMVO1 | O(C(=O)NCC)c1cccc(c1)NC(=O)OC |
WLN: 4MVOR CMVO1 | O(C(=O)NCCCC)c1cccc(c1)NC(=O)OC |
WLN: IR CI EI BOVM1U1MVOR BI DI FI | O(C(=O)NC=CNC(=O)Oc1c(I)cc(I)cc1I)c2c(I)cc(I)cc2I |