If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Formylbenzoic acid | C(=O)c1ccccc1C(=O)O |
4-Formylbenzoic acid | C(=O)(O)c1ccc(C=O)cc1 |
5,6-Dimethoxy-2-formylbenzoic acid | C(=O)(O)c1c(C=O)ccc(OC)c1OC |
o-Formylbenzoic acid | C(=O)c1ccccc1C(=O)O |
p-Formylbenzoic acid methyl ester | C(=O)(OC)c1ccc(C=O)cc1 |
p-Formylbenzoic acid | C(=O)(O)c1ccc(C=O)cc1 |