If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
((4-Chloro-o-tolyl)oxy)butyric acid | O(CCCC(=O)O)c1ccc(Cl)cc1C |
(2, 4-Dichlorophenoxy)butyric acid | O(CCCC(=O)O)c1ccc(Cl)cc1Cl |
(2-Methyl-4-chlorophenoxy)butyric acid | O(CCCC(=O)O)c1ccc(Cl)cc1C |
(4-Chloro-2-methylphenoxy)butyric acid | O(CCCC(=O)O)c1ccc(Cl)cc1C |
1-Butyric acid | C(CC)C(=O)O |
1H-Indole-3-butyric acid | C(CCC(=O)O)C1=CNc2ccccc12 |
2,4,5-T Butyric acid | O(CCCC(=O)O)c1cc(Cl)c(Cl)cc1Cl |
2,4-D Butyric | O(CCCC(=O)O)c1ccc(Cl)cc1Cl |
2,4-D butyric acid | O(CCCC(=O)O)c1ccc(Cl)cc1Cl |
2-(3-Amino-2,4,6-triiodobenzyl)butyric acid | C(C(CC)C(=O)O)c1c(I)cc(I)c(N)c1I |
2-(4-Biphenyl)butyric acid | C(CC)(C(=O)O)c1ccc(cc1)c2ccccc2 |
2-(4-Biphenylyl)butyric acid | C(CC)(C(=O)O)c1ccc(cc1)c2ccccc2 |
2-(p-Biphenylyl)butyric acid | C(CC)(C(=O)O)c1ccc(cc1)c2ccccc2 |
2-Amino-4-(ethylthio)butyric acid | C(N)(CCSCC)C(=O)O |
2-Amino-4-(methylthio)butyric acid | C(N)(CCSC)C(=O)O |
3-Indolyl-GAMMA_-butyric acid | C(CCC(=O)O)C1=CNc2ccccc12 |
4(p-Bis(BETA_-chloroethyl)aminophenyl)butyric acid | N(CCCl)(CCCl)c1ccc(cc1)CCCC(=O)O |
4-((4-Chloro-o-tolyl)oxy)butyric acid | O(CCCC(=O)O)c1ccc(Cl)cc1C |
4-(2, 4-Dichlorophenoxy)butyric acid | O(CCCC(=O)O)c1ccc(Cl)cc1Cl |
4-(2,4,5-Trichlorophenoxy)butyric acid | O(CCCC(=O)O)c1cc(Cl)c(Cl)cc1Cl |
4-(2-Methyl-4-chlorophenoxy)butyric acid | O(CCCC(=O)O)c1ccc(Cl)cc1C |
4-(4-Chloro-2-methylphenoxy)butyric acid | O(CCCC(=O)O)c1ccc(Cl)cc1C |
4-(4-Chloro-m-tolyloxy)-butyric acid | O(CCCC(=O)O)c1ccc(Cl)c(C)c1 |
4-(4-Chlorophenoxy)butyric acid | O(CCCC(=O)O)c1ccc(Cl)cc1 |
4-(Indol-3-yl)butyric acid | C(CCC(=O)O)C1=CNc2ccccc12 |
4-(p-(Bis(2-chloroethyl)amino)phenyl)butyric acid | N(CCCl)(CCCl)c1ccc(cc1)CCCC(=O)O |
4-(p-Bis(BETA_-chloroethyl)aminophenyl)butyric acid | N(CCCl)(CCCl)c1ccc(cc1)CCCC(=O)O |
A-AMINO BUTYRIC ACID | C(CCN)C(=O)O |
ALPHA_-(4-Biphenylyl)butyric acid | C(CC)(C(=O)O)c1ccc(cc1)c2ccccc2 |
ALPHA_-(4-Diphenylyl)butyric acid | C(CC)(C(=O)O)c1ccc(cc1)c2ccccc2 |
ALPHA_-(4-Hydroxybenzyl)butyric acid | C(c1ccc(O)cc1)C(CC)C(=O)O |
ALPHA_-(p-Xenyl)butyric acid | C(CC)(C(=O)O)c1ccc(cc1)c2ccccc2 |
ALPHA_-Amino-BETA_-phenyl butyric acid | C(C)(c1ccccc1)C(N)C(=O)O |
ALPHA_-Amino-GAMMA_-((p-(dichloroethyl)amino)phenyl)butyric acid | N(CCCl)(CCCl)c1ccc(cc1)CCC(N)C(=O)O |
ALPHA_-Amino-GAMMA_-((p-(dichloroethyl)amino)phenyl)butyric_acid | N(CCCl)(CCCl)c1ccc(cc1)CCC(N)C(=O)O |
ALPHA_-Hydroxy-n-butyric acid | C(O)(CC)C(=O)O |
ALPHA_-Hydroxy-n-butyric_acid | C(O)(CC)C(=O)O |
ALPHA_-Oxo-n-butyric acid | C(=O)(CC)C(=O)O |
ALPHA_-Oxo-n-butyric_acid | C(=O)(CC)C(=O)O |
ALPHA_-Phenyl butyric acid | C(CC)(C(=O)O)c1ccccc1 |
BETA_-Hydroxy-n-butyric acid | C(C(C)O)C(=O)O |
BETA_-Hydroxy-n-butyric_acid | C(C(C)O)C(=O)O |
BUTYRIC ACID | C(CC)C(=O)O |
Butyric acid amidine | C(CC)C(=N)N |
Butyric acid lactone | O=C1CCCO1 |
Butyric acid | C(CC)C(=O)O |
Butyric acid, (bicyclohexyl)-4-yl ester | O(C(=O)CCC)C1CCC(CC1)C2CCCCC2 |
Butyric acid, 1, 5-dimethyl-1-vinyl-4-hexenyl ester | C(C)(C=C)(CCC=C(C)C)OC(=O)CCC |
Butyric acid, 1-naphthyl ester | O(C(=O)CCC)c1cccc2ccccc12 |
Butyric acid, 2, 3-dibromo-, ethyl ester | C(Br)(C(Br)C)C(=O)OCC |
Butyric acid, 2, 4-dinitrophenyl ester | [N+](=O)([O-])c1cc(ccc1OC(=O)CCC)[N+](=O)[O-] |
Butyric acid, 2,2-dimethyl- | C(C)(C)(CC)C(=O)O |
Butyric acid, 2,2-diphenyl-4-mercapto- | C(CCS)(C(=O)O)(c1ccccc1)c2ccccc2 |
Butyric acid, 2,3,4,6-tetrachlorophenyl ester | O(C(=O)CCC)c1c(Cl)cc(Cl)c(Cl)c1Cl |
Butyric acid, 2-(4-biphenylyl)- | C(CC)(C(=O)O)c1ccc(cc1)c2ccccc2 |
Butyric acid, 2-(dimethylamino)ethyl ester | C(=O)(CCC)OCCN(C)C |
Butyric acid, 2-amino-, DL- | C(N)(CC)C(=O)O |
Butyric acid, 2-amino-, L- | C(N)(CC)C(=O)O |
Butyric acid, 2-amino-2-methyl- | C(C)(N)(CC)C(=O)O |
Butyric acid, 2-amino-4-(12-methyl-7-benz(a)anthrylmethyl)thio- | Cc1c2ccccc2c(CSCCC(N)C(=O)O)c3ccc4ccccc4c13 |
Butyric acid, 2-amino-4-(ethylthio)- | C(N)(CCSCC)C(=O)O |
Butyric acid, 2-amino-4-(ethylthio)-, D- | C(N)(CCSCC)C(=O)O |
Butyric acid, 2-amino-4-(ethylthio)-, DL- | C(N)(CCSCC)C(=O)O |
Butyric acid, 2-amino-4-(ethylthio)-, L- | C(N)(CCSCC)C(=O)O |
Butyric acid, 2-amino-4-(methylsulfinyl)- | C(N)(CCS(C)=O)C(=O)O |
Butyric acid, 2-amino-4-(methylsulfonyl)-, DL- | C(CS(C)(=O)=O)C(N)C(=O)O |
Butyric acid, 2-amino-4-(methylthio)- | C(N)(CCSC)C(=O)O |
Butyric acid, 2-amino-4-(p-(bis(2-chloroethyl)amino)phenyl)- | N(CCCl)(CCCl)c1ccc(cc1)CCC(N)C(=O)O |
Butyric acid, 2-amino-4-hydroxy-, DL- | C(N)(CCO)C(=O)O |
Butyric acid, 2-amino-4-hydroxy-, L- | C(N)(CCO)C(=O)O |
Butyric acid, 2-amino-4-mercapto- | C(N)(CCS)C(=O)O |
Butyric acid, 2-amino-4-mercapto-, DL- | C(N)(CCS)C(=O)O |
Butyric acid, 2-amino-4-mercapto-, L- | C(N)(CCS)C(=O)O |
Butyric acid, 2-amino-4-methoxy- | C(N)(CCOC)C(=O)O |
Butyric acid, 2-bornyl ester | CC12CCC(CC1OC(=O)CCC)C2(C)C |
Butyric acid, 2-bromo- | C(Br)(CC)C(=O)O |
Butyric acid, 2-bromo-, ethyl ester | C(=O)(OCC)C(Br)CC |
Butyric acid, 2-bromo-3-methyl- | C(Br)(C(C)C)C(=O)O |
Butyric acid, 2-bromo-3-methyl-, ethyl ester | C(Br)(C(C)C)C(=O)OCC |
Butyric acid, 2-cyano-3-methyl-, ethyl ester | C(C#N)(C(C)C)C(=O)OCC |
Butyric acid, 2-ethyl- | C(CC)(CC)C(=O)O |
Butyric acid, 2-ethyl-, allyl ester | C(CC)(CC)C(=O)OCC=C |
Butyric acid, 2-ethyl-, diester with triethylene glycol | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
Butyric acid, 2-ethyl-, methyl ester | C(CC)(CC)C(=O)OC |
Butyric acid, 2-fluoro- | C(F)(CC)C(=O)O |
Butyric acid, 2-fluoro-3-methyl- | C(F)(C(C)C)C(=O)O |
Butyric acid, 2-hydrazino- | C(CC)(NN)C(=O)O |
Butyric acid, 2-hydroxy- | C(O)(CC)C(=O)O |
Butyric acid, 2-hydroxy-4-(methylthio)-, calcium salt (2:1) | C(O)(CCSC)C(=O)O |
Butyric acid, 2-methyl- | C(C)(CC)C(=O)O |
Butyric acid, 2-methyl-, ethyl ester | C(=O)(OCC)C(C)CC |
Butyric acid, 2-methylallyl ester | C(=O)(CCC)OCC(C)=C |
Butyric acid, 2-oxo- | C(=O)(CC)C(=O)O |
Butyric acid, 2-phenoxyethyl ester | O(CCOC(=O)CCC)c1ccccc1 |
Butyric acid, 2-phenyl- | C(CC)(C(=O)O)c1ccccc1 |
Butyric acid, 2-phenyl-, 2-(diethylamino)ethyl ester, citrate (1:1) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O.CCN(CC)CCOC(=O)C(CC)c1ccccc1 |
Butyric acid, 2-phenyl-, ethyl ester | C(CC)(C(=O)OCC)c1ccccc1 |
Butyric acid, 2-phosphono-, triethyl ester | P(=O)(OCC)(OCC)C(CC)C(=O)OCC |
Butyric acid, 3, 3-dimethyl-2-oxo- | C(=O)(C(=O)O)C(C)(C)C |
Butyric acid, 3,3-dimethyl- | C(C(=O)O)C(C)(C)C |
Butyric acid, 3,7-dimethyl-2,6-octadienyl ester, (E)- | C(C)(CCC=C(C)C)=CCOC(=O)CCC |
Butyric acid, 3,7-dimethyl-6-octenyl ester | C(C)(CCC=C(C)C)CCOC(=O)CCC |
Butyric acid, 3-amino-, (.+-.)- | C(C(C)N)C(=O)O |
Butyric acid, 3-amino-, DL- | C(C(C)N)C(=O)O |
Butyric acid, 3-bromo-, ethyl ester | C(C(Br)C)C(=O)OCC |
Butyric acid, 3-chloro- | C(C(C)Cl)C(=O)O |
Butyric acid, 3-cyano-3-hydroxy-, ethyl ester | C(C)(O)(C#N)CC(=O)OCC |
Butyric acid, 3-hydroxy- | C(C(C)O)C(=O)O |
Butyric acid, 3-hydroxy-, ethyl ester | C(C(C)O)C(=O)OCC |
Butyric acid, 3-methoxy- | C(C)(OC)CC(=O)O |
Butyric acid, 3-methyl- | C(C(C)C)C(=O)O |
Butyric acid, 3-methyl-, allyl ester | C(C(C)C)C(=O)OCC=C |
Butyric acid, 3-methyl-, ethyl ester | C(C(C)C)C(=O)OCC |
Butyric acid, 3-phenylpropyl ester | C(CCOC(=O)CCC)c1ccccc1 |
Butyric acid, 4, 4'-dithiobis(2-amino- | C(CSSCCC(N)C(=O)O)C(N)C(=O)O |
Butyric acid, 4,4'-(thioureylene)di- | N(CCCC(=O)O)C(=S)NCCCC(=O)O |
Butyric acid, 4,4'-dithiobis(2-amino-, DL- | C(CSSCCC(N)C(=O)O)C(N)C(=O)O |
Butyric acid, 4,4,4-trinitro- | C(CCC(=O)O)([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
Butyric acid, 4-((4-chloro-o-tolyl)oxy)- | O(CCCC(=O)O)c1ccc(Cl)cc1C |
Butyric acid, 4-(2,4, 5-trichlorophenoxy)- | O(CCCC(=O)O)c1cc(Cl)c(Cl)cc1Cl |
Butyric acid, 4-(2,4-dichlorophenoxy)- | O(CCCC(=O)O)c1ccc(Cl)cc1Cl |
Butyric acid, 4-(2,5-xylyl)- | C(CCC(=O)O)c1cc(C)ccc1C |
Butyric acid, 4-(4-chloro-m-tolyloxy)- | O(CCCC(=O)O)c1ccc(Cl)c(C)c1 |
Butyric acid, 4-(dimethylamino)-, ethyl ester | C(=O)(OCC)CCCN(C)C |
Butyric acid, 4-(dimethylamino)-3-hydroxy- | C(C(=O)O)C(O)CN(C)C |
Butyric acid, 4-(indolyl)- | C(CCC(=O)O)C1=CNc2ccccc12 |
Butyric acid, 4-(p-(3,3-dimethyl-1-triazeno)phenyl)-, ethyl ester | N(=NN(C)C)c1ccc(cc1)CCCC(=O)OCC |
Butyric acid, 4-(p-(3,3-dimethyl-1-triazeno)phenyl)-, hydrazide | N(=NN(C)C)c1ccc(cc1)CCCC(=O)NN |
Butyric acid, 4-(p-(bis(2-chloroethyl)amino)phenyl)- | N(CCCl)(CCCl)c1ccc(cc1)CCCC(=O)O |
Butyric acid, 4-(p-bis(2-chloroethyl)aminophenyl)- | N(CCCl)(CCCl)c1ccc(cc1)CCCC(=O)O |
Butyric acid, 4-(p-chlorophenoxy)- | O(CCCC(=O)O)c1ccc(Cl)cc1 |
Butyric acid, 4-(p-trifluoroacetamidophenyl)-, methyl ester | N(c1ccc(cc1)CCCC(=O)OC)C(=O)C(F)(F)F |
Butyric acid, 4-acetamido- | C(CNC(C)=O)CC(=O)O |
Butyric acid, 4-amino- | C(CCN)C(=O)O |
Butyric acid, 4-amino-, ethyl ester, hydrochloride | C(=O)(OCC)CCCN |
Butyric acid, 4-amino-3-hydroxy- | C(O)(CN)CC(=O)O |
Butyric acid, 4-bromo- | C(CCBr)C(=O)O |
Butyric acid, 4-chloro- | C(CCCl)C(=O)O |
Butyric acid, 4-chloro-, ethyl ester | C(=O)(OCC)CCCCl |
Butyric acid, 4-chloro-, methyl ester | C(=O)(OC)CCCCl |
Butyric acid, 4-cyano-2,2-dimethyl- | C(C)(C)(CCC#N)C(=O)O |
Butyric acid, 4-cyclohexylcyclohexyl ester | O(C(=O)CCC)C1CCC(CC1)C2CCCCC2 |
Butyric acid, 4-guanidino-, monohydrochloride | C(CNC(=N)N)CC(=O)O |
Butyric acid, 4-hydroxy-, GAMMA_-lactone | O=C1CCCO1 |
Butyric acid, 4-hydroxy-, monosodium salt | C(CCO)C(=O)O |
Butyric acid, 4-hydroxy-, sodium salt | C(CCO)C(=O)O |
Butyric acid, 4-nitro-, methyl ester | C(=O)(OC)CCC[N+](=O)[O-] |
Butyric acid, 4-phenoxy- | O(CCCC(=O)O)c1ccccc1 |
Butyric acid, 4-phenyl- | C(CCC(=O)O)c1ccccc1 |
Butyric acid, 4-phenyl-, ethyl ester | C(CCC(=O)OCC)c1ccccc1 |
Butyric acid, 4-phenyl-, methyl ester | C(CCC(=O)OC)c1ccccc1 |
Butyric acid, 4-phthalimido- | O=C1N(CCCC(=O)O)C(=O)c2ccccc12 |
Butyric acid, ALPHA_-bromo- | C(Br)(CC)C(=O)O |
Butyric acid, BETA_-amino-BETA_-ureido-, ethyl ester | C(C)(N)(NC(N)=O)CC(=O)OCC |
Butyric acid, DL-2-amino-4-(ethylthio)- | C(N)(CCSCC)C(=O)O |
Butyric acid, allyl ester | C(=O)(CCC)OCC=C |
Butyric acid, benzyl ester | C(OC(=O)CCC)c1ccccc1 |
Butyric acid, butyl ester | O(CCCC)C(=O)CCC |
Butyric acid, cinnamyl ester | C(=CCOC(=O)CCC)c1ccccc1 |
Butyric acid, cyclohexyl ester | O(C(=O)CCC)C1CCCCC1 |
Butyric acid, decyl ester | C(=O)(CCC)OCCCCCCCCCC |
Butyric acid, dimethylaminoethyl ester | C(=O)(CCC)OCCN(C)C |
Butyric acid, ester with 7-hydroxy-4-methylcoumarin | CC1=CC(=O)Oc2cc(ccc12)OC(=O)CCC |
Butyric acid, ester with butyl lactate | C(C)(OC(=O)CCC)C(=O)OCCCC |
Butyric acid, ethyl ester | C(=O)(CCC)OCC |
Butyric acid, furfuryl ester | C(OC(=O)CCC)C1=CC=CO1 |
Butyric acid, heptafluoro- | C(F)(F)(C(F)(F)F)C(F)(F)C(=O)O |
Butyric acid, heptafluoro-, ethyl ester | C(F)(F)(C(=O)OCC)C(F)(F)C(F)(F)F |
Butyric acid, heptafluoro-, silver(1+) salt | C(F)(F)(C(F)(F)F)C(F)(F)C(=O)O |
Butyric acid, heptafluoro-, sodium salt | C(F)(F)(C(F)(F)F)C(F)(F)C(=O)O |
Butyric acid, isobutyl ester | C(=O)(CCC)OCC(C)C |
Butyric acid, isopentyl ester | C(=O)(CCC)OCCC(C)C |
Butyric acid, linalyl ester | C(C)(C=C)(CCC=C(C)C)OC(=O)CCC |
Butyric acid, m-tolyl ester | O(C(=O)CCC)c1cccc(C)c1 |
Butyric acid, methyl ester | C(=O)(OC)CCC |
Butyric acid, nickel(II) salt | C(CC)C(=O)O |
Butyric acid, octyl ester | O(CCCCCCCC)C(=O)CCC |
Butyric acid, p-bromophenyl ester | O(C(=O)CCC)c1ccc(Br)cc1 |
Butyric acid, p-chlorophenyl ester | O(C(=O)CCC)c1ccc(Cl)cc1 |
Butyric acid, p-methoxybenzyl ester | C(OC(=O)CCC)c1ccc(OC)cc1 |
Butyric acid, p-nitrophenyl ester | O(C(=O)CCC)c1ccc(cc1)[N+](=O)[O-] |
Butyric acid, p-tolyl ester | O(C(=O)CCC)c1ccc(C)cc1 |
Butyric acid, pentyl ester | C(=O)(CCC)OCCCCC |
Butyric acid, phenethyl ester | C(COC(=O)CCC)c1ccccc1 |
Butyric acid, phenylmercury deriv. | OC(=O)CCC.c1ccccc1 |
Butyric acid, sodium salt | C(CC)C(=O)O |
Butyric acid, thio-, S-tert-butyl ester | C(=O)(CCC)SC(C)(C)C |
Butyric acid, vinyl ester | C(=O)(CCC)OC=C |
Butyric alcohol | C(CC)CO |
Butyric aldehyde | C(CC)C=O |
Butyric ester | C(=O)(CCC)OCC |
Butyric ether | C(=O)(CCC)OCC |
Butyric_acid__2-amino-4-(12-methyl-7-benz(a)anthrylmethyl)thio- | Cc1c2ccccc2c(CSCCC(N)C(=O)O)c3ccc4ccccc4c13 |
Butyric_acid__2-amino-4-(ethylthio)-__D- | C(N)(CCSCC)C(=O)O |
Butyric_acid__2-amino-4-(ethylthio)-__DL- | C(N)(CCSCC)C(=O)O |
Butyric_acid__2-amino-4-hydroxy-__DL- | C(N)(CCO)C(=O)O |
Butyric_acid__2-amino-4-mercapto-__DL- | C(N)(CCS)C(=O)O |
Butyric_acid__2-amino-4-methoxy- | C(N)(CCOC)C(=O)O |
Butyric_acid__2-hydrazino- | C(CC)(NN)C(=O)O |
Butyric_acid__2_3_4_6-tetrachlorophenyl_ester | O(C(=O)CCC)c1c(Cl)cc(Cl)c(Cl)c1Cl |
Butyric_acid__4-(p-(3_3-dimethyl-1-triazeno)phenyl)-__ethyl_ester | N(=NN(C)C)c1ccc(cc1)CCCC(=O)OCC |
Butyric_acid__4-(p-(3_3-dimethyl-1-triazeno)phenyl)-__hydrazide | N(=NN(C)C)c1ccc(cc1)CCCC(=O)NN |
Butyric_acid__4-cyano-2_2-dimethyl- | C(C)(C)(CCC#N)C(=O)O |
Butyric_acid__4-cyclohexylcyclohexyl_ester | O(C(=O)CCC)C1CCC(CC1)C2CCCCC2 |
Butyric_acid__4-phenyl-__ethyl_ester | C(CCC(=O)OCC)c1ccccc1 |
Butyric_acid__4-phenyl-__methyl_ester | C(CCC(=O)OC)c1ccccc1 |
Butyric_acid__ALPHA_-bromo- | C(Br)(CC)C(=O)O |
Butyric_acid__phenylmercury_deriv. | OC(=O)CCC.c1ccccc1 |
D-2-Amino-4-(ethylthio)butyric acid | C(N)(CCSCC)C(=O)O |
DL-2-Amino-4-(ethylthio)butyric acid | C(N)(CCSCC)C(=O)O |
DL-2-Amino-4-(methylthio)butyric acid | C(N)(CCSC)C(=O)O |
DL-2-Amino-n-butyric acid | C(N)(CC)C(=O)O |
DL-ALPHA_-Amino-n-butyric acid (BETA_-form) | C(N)(CC)C(=O)O |
DL-ALPHA_-Amino-n-butyric acid | C(N)(CC)C(=O)O |
DL-ALPHA_-Amino-n-butyric_acid_(BETA_-form) | C(N)(CC)C(=O)O |
Fluorene-2-butyric acid | C(CCC(=O)O)c1ccc2c(c1)Cc3ccccc23 |
Fluorene-2-butyric_acid | C(CCC(=O)O)c1ccc2c(c1)Cc3ccccc23 |
GAMMA_-(2,4,5-Trichlorophenoxy)butyric acid | O(CCCC(=O)O)c1cc(Cl)c(Cl)cc1Cl |
GAMMA_-(2,4-Dichlorophenoxy)butyric acid | O(CCCC(=O)O)c1ccc(Cl)cc1Cl |
GAMMA_-(2,5-Dimethylphenyl)-n-butyric acid | C(CCC(=O)O)c1cc(C)ccc1C |
GAMMA_-(2-Methyl-4-chlorophenoxy)butyric acid | O(CCCC(=O)O)c1ccc(Cl)cc1C |
GAMMA_-(2-Naphthyl)butyric acid | C(CCC(=O)O)c1ccc2ccccc2c1 |
GAMMA_-(2-Naphthyl)butyric_acid | C(CCC(=O)O)c1ccc2ccccc2c1 |
GAMMA_-(2_4-Dichlorophenoxy)butyric_acid | O(CCCC(=O)O)c1ccc(Cl)cc1Cl |
GAMMA_-(2_4_5-Trichlorophenoxy)butyric_acid | O(CCCC(=O)O)c1cc(Cl)c(Cl)cc1Cl |
GAMMA_-(2_5-Dimethylphenyl)-n-butyric_acid | C(CCC(=O)O)c1cc(C)ccc1C |
GAMMA_-(3-Indolyl)butyric acid | C(CCC(=O)O)C1=CNc2ccccc12 |
GAMMA_-(3-Pyrenyl)butyric acid | C(CCC(=O)O)c1ccc2ccc3cccc4C=Cc1c2c34 |
GAMMA_-(3-Pyrenyl)butyric_acid | C(CCC(=O)O)c1ccc2ccc3cccc4C=Cc1c2c34 |
GAMMA_-(4-Chloro-2-methylphenoxy)butyric acid | O(CCCC(=O)O)c1ccc(Cl)cc1C |
GAMMA_-(4-Chlorophenoxy)butyric acid | O(CCCC(=O)O)c1ccc(Cl)cc1 |
GAMMA_-(4-Chlorophenoxy)butyric_acid | O(CCCC(=O)O)c1ccc(Cl)cc1 |
GAMMA_-(Indol-3-yl)butyric acid | C(CCC(=O)O)C1=CNc2ccccc12 |
GAMMA_-(Indol-3-yl)butyric_acid | C(CCC(=O)O)C1=CNc2ccccc12 |
GAMMA_-(Indole-3)-butyric acid | C(CCC(=O)O)C1=CNc2ccccc12 |
GAMMA_-(p-Di(2-chloroethyl)aminophenyl)butyric acid | N(CCCl)(CCCl)c1ccc(cc1)CCCC(=O)O |
GAMMA_-(p-bis(2-chloroethyl)aminophenyl)butyric acid | N(CCCl)(CCCl)c1ccc(cc1)CCCC(=O)O |
GAMMA_-Amino-N-butyric acid | C(CCN)C(=O)O |
GAMMA_-Indole-3-butyric acid | C(CCC(=O)O)C1=CNc2ccccc12 |
INDOLE-3-BUTYRIC ACID | C(CCC(=O)O)C1=CNc2ccccc12 |
Indol-3,4'-yl butyric acid | C(CCC(=O)O)C1=CNc2ccccc12 |
Indole-3-butyric acid | C(CCC(=O)O)C1=CNc2ccccc12 |
Indole-3-butyric acid, methyl ester | C(CCC(=O)OC)C1=CNc2ccccc12 |
Indolyl-3-butyric acid | C(CCC(=O)O)C1=CNc2ccccc12 |
L-ALPHA_-Amino-n-butyric acid | C(N)(CC)C(=O)O |
MCP-Butyric | O(CCCC(=O)O)c1ccc(Cl)cc1C |
Pyrene-3-butyric acid | C(CCC(=O)O)c1ccc2ccc3cccc4C=Cc1c2c34 |
Theophylline-8-butyric acid | O=C1N(C)C(=O)N(C)C2=C1N=C(CCCC(=O)O)N2 |
n-Butyric acid | C(CC)C(=O)O |
p-(N, N-Di-2-chloroethyl)aminophenyl butyric acid | N(CCCl)(CCCl)c1ccc(cc1)CCCC(=O)O |
p-N, N-Di-(BETA_-chloroethyl)aminophenyl butyric acid | N(CCCl)(CCCl)c1ccc(cc1)CCCC(=O)O |
p-N__N-Di-(BETA_-chloroethyl)aminophenyl_butyric_acid | N(CCCl)(CCCl)c1ccc(cc1)CCCC(=O)O |