If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-epi-Gibberellin A1 | C(=O)(CC#N)OC(C)(C)C |
Gibberellin A3 | C(=O)(O)C1C2C3(C=CC(O)C2(C)C(=O)O3)C4CCC5(O)CC14CC5=C |
Gibberellin X | C(=O)(O)C1C2C3(C=CC(O)C2(C)C(=O)O3)C4CCC5(O)CC14CC5=C |
Gibberellin | C(=O)(O)C1C2C3(C=CC(O)C2(C)C(=O)O3)C4CCC5(O)CC14CC5=C |