If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(1-Indolyl)triphenylplumbane | [Pb](c1ccccc1)(c2ccccc2)(c3ccccc3)N4C=Cc5ccccc45 |
2-(3-Indolyl)ethanol | C(CO)C1=CNc2ccccc12 |
2-(3-Indolyl)ethyldimethylamine | C(CN(C)C)C1=CNc2ccccc12 |
3-(3-Indolyl)propanoic acid | C(CC(=O)O)C1=CNc2ccccc12 |
3-(3-Indolyl)propionic acid | C(CC(=O)O)C1=CNc2ccccc12 |
3-Indolyl-GAMMA_-butyric acid | C(CCC(=O)O)C1=CNc2ccccc12 |
5'-Deoxy-5'-(1-indolyl)uridine | C(N1C=Cc2ccccc12)C3OC(C(O)C3O)N4C=CC(=O)NC4=O |
Acetic acid, 3-indolyl ester | O(C(C)=O)C1=CNc2ccccc12 |
Acetic acid, indolyl- | C(C(=O)O)C1=CNc2ccccc12 |
Acetonitrile, 3-indolyl- | C(C#N)C1=CNc2ccccc12 |
Acetonitrile__3-indolyl- | C(C#N)C1=CNc2ccccc12 |
BETA_-(3-Indolyl)propionic acid | C(CC(=O)O)C1=CNc2ccccc12 |
BETA_-(3-Indolyl)propionic_acid | C(CC(=O)O)C1=CNc2ccccc12 |
Butyric acid, 4-(indolyl)- | C(CCC(=O)O)C1=CNc2ccccc12 |
Ethanol, 3-indolyl- | C(CO)C1=CNc2ccccc12 |
GAMMA_-(3-Indolyl)butyric acid | C(CCC(=O)O)C1=CNc2ccccc12 |
Indolyl diacetyl riboside | O(C(C)=O)C1C(OC(C)=O)C(CO)OC1N2C=Cc3ccccc23 |
Indolyl-3-acetic acid | C(C(=O)O)C1=CNc2ccccc12 |
Indolyl-3-butyric acid | C(CCC(=O)O)C1=CNc2ccccc12 |
Methanethiol, N-(3-(3-indolyl)propyl)amidino-, hydrogen thiosulfate | C(CCNC(=N)CSS(=O)(=O)O)C1=CNc2ccccc12 |
Methyl BETA_-(3-indolyl)-propionate | C(CC(=O)OC)C1=CNc2ccccc12 |
Plumbane, (1-indolyl)triphenyl- | [Pb](c1ccccc1)(c2ccccc2)(c3ccccc3)N4C=Cc5ccccc45 |
Propionic acid, 3-(3-indolyl)-, methyl ester | C(CC(=O)OC)C1=CNc2ccccc12 |
Propionic_acid__3-(3-indolyl)-__methyl_ester | C(CC(=O)OC)C1=CNc2ccccc12 |
S-((N-(3-(3-Indolyl)propyl)amidino)methyl) hydrogen thiosulfate | C(CCNC(=N)CSS(=O)(=O)O)C1=CNc2ccccc12 |