If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1,3-Diallyl-2-thiourea | C(=S)(NCC=C)NCC=C |
1-Aziridinepropionamide, N,N-diallyl- | N(CC=C)(CC=C)C(=O)CCN1CC1 |
4-Cyclohexene-1,2-dicarboxylic acid, diallyl ester | C(=O)(OCC=C)C1CC=CCC1C(=O)OCC=C |
5, 5-Diallyl-1,3-dimethylbarbituric acid | C(C=C)C1(CC=C)C(=O)N(C)C(=O)N(C)C1=O |
Acetic acid, oxydi-, diallyl ester | C(=O)(OCC=C)COCC(=O)OCC=C |
Acetic acid, thiodi-, diallyl ester | C(=O)(OCC=C)CSCC(=O)OCC=C |
Adipic acid, diallyl ester | C(=O)(OCC=C)CCCCC(=O)OCC=C |
Aniline, N,N-diallyl- | N(CC=C)(CC=C)c1ccccc1 |
Barbituric acid, 5,5-diallyl- | C(C=C)C1(CC=C)C(=O)NC(=O)NC1=O |
Barbituric acid, 5,5-diallyl-1,3-dimethyl- | C(C=C)C1(CC=C)C(=O)N(C)C(=O)N(C)C1=O |
Bisphenol A diallyl ether | C(C)(C)(c1ccc(OCC=C)cc1)c2ccc(OCC=C)cc2 |
Carbonic acid, diallyl ester | C(=O)(OCC=C)OCC=C |
Carbonic acid, oxydiethylene diallyl ester | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Catechol diallyl ether | O(CC=C)c1ccccc1OCC=C |
Chlorendic acid, diallyl ester | ClC12C(Cl)=C(Cl)C(Cl)(C(C(=O)OCC=C)C1C(=O)OCC=C)C2(Cl)Cl |
Cyanamide, diallyl- | N(C#N)(CC=C)CC=C |
Cyclohexane-1,2-dicarboxylic acid, diallyl ester, (E)- | C(=O)(OCC=C)C1CCCCC1C(=O)OCC=C |
DIALLYL DISULFIDE | S(CC=C)SCC=C |
DIALLYL SULFIDE | S(CC=C)CC=C |
Diallyl 4-cyclohexene-1,2-dicarboxylate | C(=O)(OCC=C)C1CC=CCC1C(=O)OCC=C |
Diallyl adipate | C(=O)(OCC=C)CCCCC(=O)OCC=C |
Diallyl carbonate | C(=O)(OCC=C)OCC=C |
Diallyl chlorendate | ClC12C(Cl)=C(Cl)C(Cl)(C(C(=O)OCC=C)C1C(=O)OCC=C)C2(Cl)Cl |
Diallyl diglycoate | C(=O)(OCC=C)COCC(=O)OCC=C |
Diallyl diglycol carbonate | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Diallyl diglycolate | C(=O)(OCC=C)COCC(=O)OCC=C |
Diallyl disulfide | S(CC=C)SCC=C |
Diallyl disulphide | S(CC=C)SCC=C |
Diallyl ether | O(CC=C)CC=C |
Diallyl fumarate | C(=O)(OCC=C)C=CC(=O)OCC=C |
Diallyl isophthalate | C(=O)(OCC=C)c1cccc(c1)C(=O)OCC=C |
Diallyl itaconate | C(=C)(CC(=O)OCC=C)C(=O)OCC=C |
Diallyl maleate | C(=O)(OCC=C)C=CC(=O)OCC=C |
Diallyl methyl carbinol | C(C)(O)(CC=C)CC=C |
Diallyl monosulfide | S(CC=C)CC=C |
Diallyl oxalate | C(=O)(OCC=C)C(=O)OCC=C |
Diallyl phthalate | C(=O)(OCC=C)c1ccccc1C(=O)OCC=C |
Diallyl sebacate | C(CCCCCCCC(=O)OCC=C)C(=O)OCC=C |
Diallyl succinate | C(=O)(OCC=C)CCC(=O)OCC=C |
Diallyl sulfide | S(CC=C)CC=C |
Diallyl terephthalate | C(=O)(OCC=C)c1ccc(cc1)C(=O)OCC=C |
Diallyl terethiolate | C(=O)(OCC=C)c1ccc(cc1)C(=O)OCC=C |
Diallyl thioather | S(CC=C)CC=C |
Diallyl thioether | S(CC=C)CC=C |
Diallyl | C(C=C)CC=C |
Diethylene glycol diallyl dicarbonate | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Diglycolic acid, diallyl ester | C(=O)(OCC=C)COCC(=O)OCC=C |
Dimethylsulfide-ALPHA_,ALPHA_'-dicarboxylic acid, diallyl ester | C(=O)(OCC=C)CSCC(=O)OCC=C |
Dimethylsulfide-ALPHA__ALPHA_'-dicarboxylic_acid__diallyl_ester | C(=O)(OCC=C)CSCC(=O)OCC=C |
Ether, diallyl | O(CC=C)CC=C |
Fumaric acid, diallyl ester | C(=O)(OCC=C)C=CC(=O)OCC=C |
Glyoxal, bis(diallyl acetal) | C(OCC=C)(OCC=C)C(OCC=C)OCC=C |
Heptanedioic acid, 4,4-dicyano-, diallyl ester | C(C#N)(C#N)(CCC(=O)OCC=C)CCC(=O)OCC=C |
Isophthalic acid, diallyl ester | C(=O)(OCC=C)c1cccc(c1)C(=O)OCC=C |
Maleic acid, diallyl ester | C(=O)(OCC=C)C=CC(=O)OCC=C |
Malonic acid, diallyl-, diethyl ester | C(CC=C)(CC=C)(C(=O)OCC)C(=O)OCC |
Melamine, N2,N2-diallyl- | N(CC=C)(CC=C)c1nc(N)nc(N)n1 |
Oxalic acid, diallyl ester | C(=O)(OCC=C)C(=O)OCC=C |
Phthalic acid, diallyl ester | C(=O)(OCC=C)c1ccccc1C(=O)OCC=C |
Pyrocatechol diallyl ether | O(CC=C)c1ccccc1OCC=C |
Sebacic acid, diallyl ester | C(CCCCCCCC(=O)OCC=C)C(=O)OCC=C |
Succinic acid, diallyl ester | C(=O)(OCC=C)CCC(=O)OCC=C |
Succinic acid, methylene-, diallyl ester | C(=C)(CC(=O)OCC=C)C(=O)OCC=C |
Terephthalic acid, diallyl ester | C(=O)(OCC=C)c1ccc(cc1)C(=O)OCC=C |
Urea, 1, 3-diallyl- | C(=O)(NCC=C)NCC=C |
Urea, 1,3-diallyl-2-thio- | C(=S)(NCC=C)NCC=C |
o-Phthalic acid, diallyl ester | C(=O)(OCC=C)c1ccccc1C(=O)OCC=C |