If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-(4-Aminophenyl)-6-methylbenzothiazole | Nc1ccc(cc1)C2=Nc3ccc(C)cc3S2 |
2-(p-Aminophenyl)-6-methylbenzothiazole | Nc1ccc(cc1)C2=Nc3ccc(C)cc3S2 |
2-Amino-4-methylbenzothiazole | Cc1cccc2SC(=N)Nc12 |
2-Amino-5-methylbenzothiazole | N=C1Sc2ccc(C)cc2N1 |
2-Amino-6-methylbenzothiazole | N=C1Nc2ccc(C)cc2S1 |
2-Methylbenzothiazole | CC1=Nc2ccccc2S1 |
3-Methylbenzothiazole-2-thione | CN1C(=S)Sc2ccccc12 |
5-Chloro-2-methylbenzothiazole | CC1=Nc2cc(Cl)ccc2S1 |
6-Ethoxy-2-methylbenzothiazole | CC1=Nc2ccc(OCC)cc2S1 |
6-Methoxy-2-methylbenzothiazole | CC1=Nc2ccc(OC)cc2S1 |
6-Nitro-2-methylbenzothiazole | [N+](=O)([O-])c1ccc2N=C(C)Sc2c1 |