If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Benzeneazo-2-naphthol | N(=Nc1ccccc1)c2c(O)ccc3ccccc23 |
1-Benzeneazo-2-naphthylamine | N(=Nc1ccccc1)c2c(N)ccc3ccccc23 |
1-Benzeneazo-BETA_-naphthylamine | N(=Nc1ccccc1)c2c(N)ccc3ccccc23 |
4-Benzeneazo-1-naphthylamine | N(=Nc1ccccc1)c2ccc(N)c3ccccc23 |
Benzeneazo-BETA_-naphthol | N(=Nc1ccccc1)c2c(O)ccc3ccccc23 |
p-(Benzeneazo)phenol | N(=Nc1ccccc1)c2ccc(O)cc2 |