Alphabetical Indicies

If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.

If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.

Select from

2-Amino-3-methoxybenzoic acid C(=O)(O)c1cccc(OC)c1N
2-Hydroxy-3-methoxybenzoic acid C(=O)(O)c1cccc(OC)c1O
2-Hydroxy-5-methoxybenzoic acid C(=O)(O)c1cc(OC)ccc1O
2-Methoxybenzoic acid O(C)c1ccccc1C(=O)O
2-Methoxybenzoic acid, methyl ester C(=O)(OC)c1ccccc1OC
3-Methoxybenzoic acid methyl ester C(=O)(OC)c1cccc(OC)c1
3-Methoxybenzoic acid C(=O)(O)c1cccc(OC)c1
3-Nitro-4-methoxybenzoic acid [N+](=O)([O-])c1cc(ccc1OC)C(=O)O
4-Hydroxy-3-methoxybenzoic acid ethyl ester C(=O)(OCC)c1ccc(O)c(OC)c1
4-Hydroxy-3-methoxybenzoic acid methyl ester C(=O)(OC)c1ccc(O)c(OC)c1
4-Hydroxy-3-methoxybenzoic acid O(C)c1cc(ccc1O)C(=O)O
4-Methoxybenzoic acid chloride C(Cl)(=O)c1ccc(OC)cc1
4-Methoxybenzoic acid hydrazide C(=O)(NN)c1ccc(OC)cc1
4-Methoxybenzoic acid methyl ester C(=O)(OC)c1ccc(OC)cc1
4-Methoxybenzoic acid C(=O)(O)c1ccc(OC)cc1
m-Methoxybenzoic acid methyl ester C(=O)(OC)c1cccc(OC)c1
m-Methoxybenzoic acid C(=O)(O)c1cccc(OC)c1
o-Methoxybenzoic acid hydrazide C(=O)(NN)c1ccccc1OC
o-Methoxybenzoic acid methyl ester C(=O)(OC)c1ccccc1OC
o-Methoxybenzoic acid O(C)c1ccccc1C(=O)O
p-Methoxybenzoic acid chloride C(Cl)(=O)c1ccc(OC)cc1
p-Methoxybenzoic acid hydrazide C(=O)(NN)c1ccc(OC)cc1
p-Methoxybenzoic acid methyl ester C(=O)(OC)c1ccc(OC)cc1
p-Methoxybenzoic acid C(=O)(O)c1ccc(OC)cc1
p-Methoxybenzoic_acid_chloride C(Cl)(=O)c1ccc(OC)cc1


The Random Factory - 2001