If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
.DELTA.4-Pentenoic acid | C(CC=C)C(=O)O |
.DELTA.4-Pentenoic_acid | C(CC=C)C(=O)O |
2,2, 4-Trimethyl-3-hydroxy-3-pentenoic acid BETA_ lactone | C(C)(C)=C1OC(=O)C1(C)C |
2-Pentenoic acid | C(=CCC)C(=O)O |
2-Pentenoic acid, 2,3,5,5,5-pentachloro-4-oxo- | C(Cl)(=C(Cl)C(=O)O)C(=O)C(Cl)(Cl)Cl |
2-Pentenoic acid, 2-ethyl-, (E)- | C(CC)(=CCC)C(=O)O |
2-Pentenoic acid, 4-hydroxy-, GAMMA_-lactone | CC1C=CC(=O)O1 |
2-Pentenoic_acid | C(=CCC)C(=O)O |
2-Pentenoic_acid__2-ethyl-__(E)- | C(CC)(=CCC)C(=O)O |
2-Pentenoic_acid__2_3_5_5_5-pentachloro-4-oxo- | C(Cl)(=C(Cl)C(=O)O)C(=O)C(Cl)(Cl)Cl |
2_2__4-Trimethyl-3-hydroxy-3-pentenoic_acid_BETA__lactone | C(C)(C)=C1OC(=O)C1(C)C |
3-Hydroxy-2,2,4-trimethyl-3-pentenoic acid, BETA_-lactone | C(C)(C)=C1OC(=O)C1(C)C |
3-Pentenoic acid, 4-hydroxy-, GAMMA_-lactone | CC1=CCC(=O)O1 |
4-Hydroxy-2-pentenoic acid GAMMA_-lactone | CC1C=CC(=O)O1 |
4-Hydroxy-3-pentenoic acid GAMMA_-lactone | CC1=CCC(=O)O1 |
4-Pentenoic acid | C(CC=C)C(=O)O |
4-Pentenoic acid, 1,1-dimethylethyl ester | O(C(=O)CCC=C)C(C)(C)C |
4-Pentenoic acid, 2-acetyl-, ethyl ester | C(CC=C)(C(C)=O)C(=O)OCC |
4-Pentenoic acid, 2-methylene-, methyl ester | C(=C)(CC=C)C(=O)OC |
4-Pentenoic_acid__1_1-dimethylethyl_ester | O(C(=O)CCC=C)C(C)(C)C |
4-Pentenoic_acid__2-acetyl-__ethyl_ester | C(CC=C)(C(C)=O)C(=O)OCC |
4-Pentenoic_acid__2-methylene-__methyl_ester | C(=C)(CC=C)C(=O)OC |