If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1,4-Butanediol divinyl ether | C(COC=C)CCOC=C |
2,18-Porphinedipropionic acid, 3,8,13, 17-tetramethyl-7,12-divinyl- | C(CC(=O)O)C1=C2NC(C=C3N=C(C=C4NC(=CC5=NC(=C2)C(CCC(=O)O)=C5C)C(C)=C4C=C)C(C)=C3C=C)=C1C |
2,4,8,10-Tetraoxaspiro(5.5)undecane, 3, 9-divinyl- | C(=C)C1OCC2(CO1)COC(C=C)OC2 |
3,9-Divinyl-2,4,8, 10-tetraoxaspiro(5.5)undecane | C(=C)C1OCC2(CO1)COC(C=C)OC2 |
Butanediol divinyl ether | C(COC=C)CCOC=C |
Diethylene glycol divinyl ether | O(CCOC=C)CCOC=C |
Divinyl ether- maleic anhydride copolymer | O=C1C=CC(=O)O1.C=COC=C |
Divinyl ether- maleic anhydride copolymers | O=C1C=CC(=O)O1.C=COC=C |
Divinyl ether- maleic anhydride cyclic copolymer | O=C1C=CC(=O)O1.C=COC=C |
Divinyl ether- maleic anhydride cyclopolymer | O=C1C=CC(=O)O1.C=COC=C |
Divinyl ether- maleic anhydride polymer | O=C1C=CC(=O)O1.C=COC=C |
Divinyl sulfone | S(=O)(=O)(C=C)C=C |
Ethylene glycol divinyl ether | C(OC=C)COC=C |
Sulfone, divinyl- | S(=O)(=O)(C=C)C=C |