If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Bromo-N,N-bis(2-chloroethyl)-3-thenylamine hydrochloride | C(N(CCCl)CCCl)C1=C(Br)SC=C1 |
2-Thenylamine, N,N-dimethyl- | C(N(C)C)C1=CC=CS1 |
2-Thenylamine__N_N-dimethyl- | C(N(C)C)C1=CC=CS1 |
3-Thenylamine, 2-bromo-N,N-bis(2-chloroethyl)-, hydrochloride | C(N(CCCl)CCCl)C1=C(Br)SC=C1 |
3-Thenylamine__2-bromo-N_N-bis(2-chloroethyl)-__hydrochloride | C(N(CCCl)CCCl)C1=C(Br)SC=C1 |
Di-2-Thenylamine | C(NCC1=CC=CS1)C2=CC=CS2 |