If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-(2-Methyl-3-chloroanilino)nicotinic acid | N(c1cccc(Cl)c1C)c2ncccc2C(=O)O |
2-(3-Chloro-2-methylanilino)nicotinic acid | N(c1cccc(Cl)c1C)c2ncccc2C(=O)O |
2-(3-Chloro-o-toluidino)nicotinic acid | N(c1cccc(Cl)c1C)c2ncccc2C(=O)O |
Methiodide of nicotinic acid methyl ester | C(=O)(OC)c1cccn(C)c1 |
NICOTINIC ACID, HYDROCHLORIDE | C(=O)(O)c1cccnc1 |
Nicotinic acid 1-oxide | C(=O)(O)C1=CN(=O)CC=C1 |
Nicotinic acid N'-isopropyl hydrazide | C(=O)(NNC(C)C)c1cccnc1 |
Nicotinic acid N-oxide | C(=O)(O)C1=CN(=O)CC=C1 |
Nicotinic acid amide | C(N)(=O)c1cccnc1 |
Nicotinic acid butyl ester | C(=O)(OCCCC)c1cccnc1 |
Nicotinic acid diethylamide | C(=O)(N(CC)CC)c1cccnc1 |
Nicotinic acid ethyl ester | C(=O)(OCC)c1cccnc1 |
Nicotinic acid hydrazide | C(=O)(NN)c1cccnc1 |
Nicotinic acid isopropylhydrazide | C(=O)(NNC(C)C)c1cccnc1 |
Nicotinic acid methyl ester | C(=O)(OC)c1cccnc1 |
Nicotinic acid methylamide | C(=O)(NC)c1cccnc1 |
Nicotinic acid monoethylamide | C(=O)(NCC)c1cccnc1 |
Nicotinic acid nitrile | C(#N)c1cccnc1 |
Nicotinic acid oxide | C(=O)(O)C1=CN(=O)CC=C1 |
Nicotinic acid sodium salt | C(=O)(O)c1cccnc1 |
Nicotinic acid | C(=O)(O)c1cccnc1 |
Nicotinic acid, (p-(bis(2-chloroethyl)amino)benzylidene)hydrazide | N(CCCl)(CCCl)c1ccc(cc1)C=NNC(=O)c2cccnc2 |
Nicotinic acid, 1,2,5, 6-tetrahydro-1-methyl- | C(=O)(O)C1=CCCN(C)C1 |
Nicotinic acid, 1,2,5,6-tetrahydro-1-methyl-, methyl ester | C(=O)(OC)C1=CCCN(C)C1 |
Nicotinic acid, 1,2-dihydro-4,6-dimethyl-2-oxo- | C(=O)(O)c1c(C)cc(C)nc1O |
Nicotinic acid, 1,6-dihydro-6-oxo- | C(=O)(O)c1ccc(O)nc1 |
Nicotinic acid, 1-oxide | C(=O)(O)C1=CN(=O)CC=C1 |
Nicotinic acid, 1-oxide, N-oxide | C(=O)(O)C1=CN(=O)CC=C1 |
Nicotinic acid, 2-(3-chloro-o-toluidino)- | N(c1cccc(Cl)c1C)c2ncccc2C(=O)O |
Nicotinic acid, 2-(diethylamino)ethyl ester, citrate (1:1) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O.CCN(CC)CCOC(=O)c1cccnc1 |
Nicotinic acid, 2-amino- | C(=O)(O)c1cccnc1N |
Nicotinic acid, 2-chloro- | C(=O)(O)c1cccnc1Cl |
Nicotinic acid, 2-isopropylhydrazide | C(=O)(NNC(C)C)c1cccnc1 |
Nicotinic acid, 4,6-dihydroxy- | C(=O)(O)c1cnc(O)cc1O |
Nicotinic acid, 4-amino-2,6-dihydroxy-, ethyl ester | C(=O)(OCC)c1c(N)cc(O)nc1O |
Nicotinic acid, 6,6'-dithiodi- | C(=O)(O)c1ccc(nc1)SSc2ccc(cn2)C(=O)O |
Nicotinic acid, 6-amino- | C(=O)(O)c1ccc(N)nc1 |
Nicotinic acid, 6-amino-, hydrochloride | C(=O)(O)c1ccc(N)nc1 |
Nicotinic acid, butyl ester | C(=O)(OCCCC)c1cccnc1 |
Nicotinic acid, ethyl ester | C(=O)(OCC)c1cccnc1 |
Nicotinic acid, hexyl ester | C(=O)(OCCCCCC)c1cccnc1 |
Nicotinic acid, hydrazide | C(=O)(NN)c1cccnc1 |
Nicotinic acid, hydrochloride | C(=O)(O)c1cccnc1 |
Nicotinic acid, isopropyl ester | C(=O)(OC(C)C)c1cccnc1 |
Nicotinic acid, methyl ester | C(=O)(OC)c1cccnc1 |
Nicotinic acid, phenyl ester | C(=O)(Oc1ccccc1)c2cccnc2 |
Nicotinic acid, propyl ester | C(=O)(OCCC)c1cccnc1 |
Nicotinic acid, sodium salt | C(=O)(O)c1cccnc1 |
Nicotinic acid-benzyl chloride quat | C(c1ccccc1)n2cccc(c2)C(=O)O |
Nicotinic alcohol | C(O)c1cccnc1 |
Nicotinic aldehyde | C(=O)c1cccnc1 |
Nicotinic amide | C(N)(=O)c1cccnc1 |
Nicotinic anhydride | C(=O)(OC(=O)c1cccnc1)c2cccnc2 |
Nicotinic hydrazide | C(=O)(NN)c1cccnc1 |
Nicotinic_acid__(p-(bis(2-chloroethyl)amino)benzylidene)hydrazide | N(CCCl)(CCCl)c1ccc(cc1)C=NNC(=O)c2cccnc2 |
Nicotinic_acid__4-amino-2_6-dihydroxy-__ethyl_ester | C(=O)(OCC)c1c(N)cc(O)nc1O |
Nicotinic_acid_nitrile | C(#N)c1cccnc1 |
Nicotinic_anhydride | C(=O)(OC(=O)c1cccnc1)c2cccnc2 |