If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Fenanthren Blue BC | O=C1c2ccccc2C(=O)c3cc(Cl)c4Nc5c(Nc4c13)c(Cl)cc6C(=O)c7ccccc7C(=O)c56 |
Fenanthren Blue BD | O=C1c2ccccc2C(=O)c3cc(Cl)c4Nc5c(Nc4c13)c(Cl)cc6C(=O)c7ccccc7C(=O)c56 |
Fenanthren Blue RS | O=C1c2ccccc2C(=O)c3ccc4Nc5c(ccc6C(=O)c7ccccc7C(=O)c56)Nc4c13 |
Fenanthren Dark Blue BO | O=C1c2ccccc2c3ccc4c5ccc6c7ccccc7C(=O)c8ccc(c9ccc1c3c49)c5c68 |
Fenanthren Golden Orange G | O=C1c2ccccc2C3=Cc4ccc5C(=O)c6ccccc6c7cc8ccc1c3c8c4c57 |
Fenanthren Golden Yellow GK | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Fenanthren Golden Yellow RK | C(=O)(c1ccccc1)c2ccc3c4ccccc4C(=O)c5cccc2c35 |
Fenanthren Olive R | O=C1c2ccccc2C(=O)c3c(NC(=O)c4ccccc4)cc5c6cc(NC(=O)c7ccccc7)c8C(=O)c9ccccc9C(=O)c8c6Nc5c13 |
Fenanthren Red F2B | Nc1c(ccc2C(=O)c3ccccc3C(=O)c12)C4=Nc5cc6C(=O)c7ccccc7C(=O)c6cc5O4 |