If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 1-Dichloro-1-propene | C(Cl)(Cl)=CC |
1, 2-Diphenyl-1-propene | C(C)(=Cc1ccccc1)c2ccccc2 |
1,1, 2-Trichlorotrifluoro-1-propene | C(Cl)(=C(Cl)Cl)C(F)(F)F |
1,1, 3-Tricyano-2-amino-1-propene | C(C#N)(C#N)=C(N)CC#N |
1,1,1-Trichloro-2-propene oxide | C(Cl)(Cl)(Cl)C1CO1 |
1,1-Diethoxy-2-propene | C(C=C)(OCC)OCC |
1,1-Diphenyl-1-propene | C(=CC)(c1ccccc1)c2ccccc2 |
1,2,3-Trichloro-1-propene | C(Cl)(CCl)=CCl |
1,2-Dibromo-2-propene | C(Br)(=C)CBr |
1,3,3-Triethoxy-1-propene | C(OCC)(OCC)C=COCC |
1,3-Dichloro-1-propene | C(CCl)=CCl |
1,3-Dichloro-2-propene | C(CCl)=CCl |
1-(3, 4-Dimethoxyphenyl)-1-propene | O(C)c1cc(C=CC)ccc1OC |
1-(3, 4-Dimethoxyphenyl)-2-propene | O(C)c1cc(CC=C)ccc1OC |
1-Bromo-2-methyl-1-propene | C(C)(C)=CBr |
1-Bromo-2-propene | C(Br)C=C |
1-Chloro-1-propene | C(C)=CCl |
1-Chloro-2-propene | C(=C)CCl |
1-Cyclohexyl-2-propene | C(C=C)C1CCCCC1 |
1-Ethoxy-1-propene | C(=CC)OCC |
1-Phenyl-1-propene | C(=CC)c1ccccc1 |
1-Phenyl-1-propene, cis- | C(=CC)c1ccccc1 |
1-Phenyl-1-propene, trans- | C(=CC)c1ccccc1 |
1-Phenyl-2-nitro-1-propene | C(=C(C)[N+](=O)[O-])c1ccccc1 |
1-Phenyl-2-propene | C(C=C)c1ccccc1 |
1-Phenyl-3-chloro-1-propene | C(=CCCl)c1ccccc1 |
1-Propene, 1,1, 2-trichloro-3,3,3-trifluoro- | C(Cl)(=C(Cl)Cl)C(F)(F)F |
1-Propene, 1,1,2,3,3,3-hexachloro- | C(Cl)(=C(Cl)Cl)C(Cl)(Cl)Cl |
1-Propene, 1,1,2,3-tetrachloro-3,3-difluoro- | C(Cl)(=C(Cl)Cl)C(Cl)(F)F |
1-Propene, 1,1-dichloro- | C(Cl)(Cl)=CC |
1-Propene, 1,2, 3-trichloro- | C(Cl)(CCl)=CCl |
1-Propene, 1,2-diphenyl- | C(C)(=Cc1ccccc1)c2ccccc2 |
1-Propene, 1,3,3-triethoxy- | C(OCC)(OCC)C=COCC |
1-Propene, 1,3-dichloro- | C(CCl)=CCl |
1-Propene, 1-(3,4-dimethoxyphenyl)- | O(C)c1cc(C=CC)ccc1OC |
1-Propene, 1-(4-methoxyphenyl)- | C(=CC)c1ccc(OC)cc1 |
1-Propene, 1-bromo-2-methyl- | C(C)(C)=CBr |
1-Propene, 1-chloro- | C(C)=CCl |
1-Propene, 1-ethoxy- | C(=CC)OCC |
1-Propene, 1-phenyl- | C(=CC)c1ccccc1 |
1-Propene, 2, 3-dichloro- | C(=C)(Cl)CCl |
1-Propene, 2,3-dibromo- | C(Br)(=C)CBr |
1-Propene, 2-bromo- | C(Br)(C)=C |
1-Propene, 2-methyl-1-phenyl- | C(=C(C)C)c1ccccc1 |
1-Propene, 2-phenyl- | C(C)(=C)c1ccccc1 |
1-Propene, 3, 3'-((2-methylpropylidene)bis(oxy))bis(2-methyl- | C(OCC(C)=C)(OCC(C)=C)C(C)C |
1-Propene, 3, 3'-thiobis- | S(CC=C)CC=C |
1-Propene, 3,3', 3''-(methylidynetris(oxy))tris- | C(OCC=C)(OCC=C)OCC=C |
1-Propene, 3,3'-oxybis(2-chloro- | O(CC(=C)Cl)CC(=C)Cl |
1-Propene, 3,3'-oxybis- | O(CC=C)CC=C |
1-Propene, 3,3-diethoxy- | C(C=C)(OCC)OCC |
1-Propene, 3,3-dimethoxy- | C(C=C)(OC)OC |
1-Propene, 3-(ethenyloxy)- | C(C=C)OC=C |
1-Propene, 3-(methylsulfonyl)- | C(C=C)S(C)(=O)=O |
1-Propene, 3-(propylthio)- | S(CCC)CC=C |
1-Propene, 3-bromo- | C(Br)C=C |
1-Propene, 3-chloro- | C(=C)CCl |
1-Propene, 3-chloro-1-phenyl- | C(=CCCl)c1ccccc1 |
1-Propene, 3-chloro-2-(chloromethyl)- | C(=C)(CCl)CCl |
1-Propene, 3-chloro-2-methyl- | C(C)(=C)CCl |
1-Propene, 3-cyclohexyl- | C(C=C)C1CCCCC1 |
1-Propene, 3-cyclopentyl- | C(C=C)C1CCCC1 |
1-Propene, 3-iodo- | C(=C)CI |
1-Propene, 3-isocyanato- | C(C=C)N=C=O |
1-Propene, 3-isothiocyanato- | C(C=C)N=C=S |
1-Propene, 3-phenyl- | C(C=C)c1ccccc1 |
1-Propene, 3-propoxy- | O(CCC)CC=C |
1-Propene-1,1,3-tricarbonitrile, 2-amino- | C(C#N)(C#N)=C(N)CC#N |
1-Propene-1,1-diol, 2-chloro-, diacetate | C(OC(C)=O)(OC(C)=O)C(=C)Cl |
1-Propene-1,2, 3-tricarboxylic acid | C(CC(=O)O)(=CC(=O)O)C(=O)O |
1-Propene-1,2, 3-tricarboxylic acid, (E)- | C(CC(=O)O)(=CC(=O)O)C(=O)O |
1-Propene-1,2,3-tricarboxylic acid, (Z)- | C(CC(=O)O)(=CC(=O)O)C(=O)O |
1-Propene-1,2,3-tricarboxylic acid, cis- | C(CC(=O)O)(=CC(=O)O)C(=O)O |
1-Propene-1,2,3-tricarboxylic acid, cyclic 1, 2-anhydride | C(C(=O)O)C1=CC(=O)OC1=O |
1-Propene-1,2,3-tricarboxylic acid, triallyl ester | C(CC(=O)OCC=C)(=CC(=O)OCC=C)C(=O)OCC=C |
1-Propene-1,2,3-tricarboxylic acid, tributyl ester | C(CC(=O)OCCCC)(=CC(=O)OCCCC)C(=O)OCCCC |
1-Propene-1,2,3-tricarboxylic acid, trimethyl ester | C(CC(=O)OC)(=CC(=O)OC)C(=O)OC |
1-Propene-1,3-diol, diacetate | C(C=COC(C)=O)OC(C)=O |
1-Propene-1,3-dione, 3-phenyl-, 1-(dimethyl mercaptole) | C(=O)(C=C(SC)SC)c1ccccc1 |
1-Propene-1,trans-2,3-tricarboxylic acid | C(CC(=O)O)(=CC(=O)O)C(=O)O |
1-Propene-1_1-diol__2-chloro-__diacetate | C(OC(C)=O)(OC(C)=O)C(=C)Cl |
1-Propene-1_2_3-tricarboxylic_acid__(Z)- | C(CC(=O)O)(=CC(=O)O)C(=O)O |
1-Propene-1_2_3-tricarboxylic_acid__cyclic_1__2-anhydride | C(C(=O)O)C1=CC(=O)OC1=O |
1-Propene-1_2_3-tricarboxylic_acid__triallyl_ester | C(CC(=O)OCC=C)(=CC(=O)OCC=C)C(=O)OCC=C |
1-Propene-1_2_3-tricarboxylic_acid__tributyl_ester | C(CC(=O)OCCCC)(=CC(=O)OCCCC)C(=O)OCCCC |
1-Propene-1_2_3-tricarboxylic_acid__trimethyl_ester | C(CC(=O)OC)(=CC(=O)OC)C(=O)OC |
1-Propene-1_2__3-tricarboxylic_acid | C(CC(=O)O)(=CC(=O)O)C(=O)O |
1-Propene-1_2__3-tricarboxylic_acid__(E)- | C(CC(=O)O)(=CC(=O)O)C(=O)O |
1-Propene-1_3-diol__diacetate | C(C=COC(C)=O)OC(C)=O |
1-Propene-1_3-dione__3-phenyl-__1-(dimethyl_mercaptole) | C(=O)(C=C(SC)SC)c1ccccc1 |
1-Propene__1-chloro- | C(C)=CCl |
1-Propene__1_1-dichloro- | C(Cl)(Cl)=CC |
1-Propene__1_1_2_3-tetrachloro-3_3-difluoro- | C(Cl)(=C(Cl)Cl)C(Cl)(F)F |
1-Propene__1_1_2_3_3_3-hexachloro- | C(Cl)(=C(Cl)Cl)C(Cl)(Cl)Cl |
1-Propene__1_1__2-trichloro-3_3_3-trifluoro- | C(Cl)(=C(Cl)Cl)C(F)(F)F |
1-Propene__1_2__3-trichloro- | C(Cl)(CCl)=CCl |
1-Propene__2__3-dichloro- | C(=C)(Cl)CCl |
1-Propene__3-(ethenyloxy)- | C(C=C)OC=C |
1-Propene__3-(methylsulfonyl)- | C(C=C)S(C)(=O)=O |
1-Propene__3-(propylthio)- | S(CCC)CC=C |
1-Propene__3-bromo- | C(Br)C=C |
1-Propene__3-chloro-2-(chloromethyl)- | C(=C)(CCl)CCl |
1-Propene__3-iodo- | C(=C)CI |
1-Propene__3-propoxy- | O(CCC)CC=C |
1-Propene__3_3'-oxybis(2-chloro- | O(CC(=C)Cl)CC(=C)Cl |
1-Propene__3_3'-oxybis- | O(CC=C)CC=C |
1-Propene__3_3'__3''-(methylidynetris(oxy))tris- | C(OCC=C)(OCC=C)OCC=C |
1-Propene__3_3-dimethoxy- | C(C=C)(OC)OC |
1-Propene__3__3'-((2-methylpropylidene)bis(oxy))bis(2-methyl- | C(OCC(C)=C)(OCC(C)=C)C(C)C |
1-Propene__3__3'-thiobis- | S(CC=C)CC=C |
1-Veratryl-1-propene | O(C)c1cc(C=CC)ccc1OC |
2,3-Dibromo-1-propene | C(Br)(=C)CBr |
2,3-Dichloro-1-propene | C(=C)(Cl)CCl |
2-(4-Fluorophenyl)propene | C(C)(=C)c1ccc(F)cc1 |
2-(4-Isopropylphenyl)-1-propene | C(C)(C)c1ccc(cc1)C(C)=C |
2-(p-Isopropylphenyl)propene | C(C)(C)c1ccc(cc1)C(C)=C |
2-(p-Methoxyphenyl)propene | C(C)(=C)c1ccc(OC)cc1 |
2-Amino-1-propene-1,1,3-tricarbonitrile | C(C#N)(C#N)=C(N)CC#N |
2-Bromo-1-propene | C(Br)(C)=C |
2-Cyano-1-propene | C(C)(=C)C#N |
2-Cyclopropyl-1-propene | C(C)(=C)C1CC1 |
2-Methyl-1-phenyl-1-propene | C(=C(C)C)c1ccccc1 |
2-Methyl-1-propene oxide | CC1(C)CO1 |
2-Methyl-2-propene-1-sulfonic acid, sodium salt | C(C(C)=C)S(=O)(=O)O |
2-Nitro-1-phenyl-1-propene | C(=C(C)[N+](=O)[O-])c1ccccc1 |
2-Phenyl-1-propene | C(C)(=C)c1ccccc1 |
2-Propene(dithioic) acid, 3-hydroxy-3-phenyl- | C(O)(=CC(=S)S)c1ccccc1 |
2-Propene(dithioic) acid, 3-hydroxy-3-phenyl-, methyl ester | C(O)(=CC(=S)SC)c1ccccc1 |
2-Propene(dithioic)_acid__3-hydroxy-3-phenyl- | C(O)(=CC(=S)S)c1ccccc1 |
2-Propene(dithioic)_acid__3-hydroxy-3-phenyl-__methyl_ester | C(O)(=CC(=S)SC)c1ccccc1 |
2-Propene-1,1-diol, 2-chloro-, diacetate | C(OC(C)=O)(OC(C)=O)C(=C)Cl |
2-Propene-1,1-diol, 2-methyl-, diacetate | C(OC(C)=O)(OC(C)=O)C(C)=C |
2-Propene-1,1-diol, diacetate | C(C=C)(OC(C)=O)OC(C)=O |
2-Propene-1,2-dicarboxylic acid | C(=C)(CC(=O)O)C(=O)O |
2-Propene-1,2-dicarboxylic acid, 3-phenyl- | C(CC(=O)O)(=Cc1ccccc1)C(=O)O |
2-Propene-1-sulfonic acid, 2-methyl-, sodium salt | C(C(C)=C)S(=O)(=O)O |
2-Propene-1-sulfonic acid, sodium salt | C(C=C)S(=O)(=O)O |
2-Propene-1-sulfonic_acid__2-methyl-__sodium_salt | C(C(C)=C)S(=O)(=O)O |
2-Propene-1-sulfonic_acid__sodium_salt | C(C=C)S(=O)(=O)O |
2-Propene-1-thiol | C(=C)CS |
2-Propene-1-thiol, 2-chloro-, diethyldithiocarbamate | N(CC)(CC)C(=S)SCC(=C)Cl |
2-Propene-1_2-dicarboxylic_acid | C(=C)(CC(=O)O)C(=O)O |
2-Propene-1_2-dicarboxylic_acid__3-phenyl- | C(CC(=O)O)(=Cc1ccccc1)C(=O)O |
3,3'-Oxybis(1-propene) | O(CC=C)CC=C |
3-(p-Methoxyphenyl)propene | C(C=C)c1ccc(OC)cc1 |
3-Amino-1-propene | C(=C)CN |
3-Bromo-1-propene | C(Br)C=C |
3-Chloro-1-propene | C(=C)CCl |
3-Chloro-2-(chloromethyl)propene | C(=C)(CCl)CCl |
3-Chloro-2-methyl-1-propene | C(C)(=C)CCl |
3-Cyano-1-propene | C(C=C)C#N |
3-Cyclohexyl-1-propene | C(C=C)C1CCCCC1 |
3-Cyclopentyl-1-propene | C(C=C)C1CCCC1 |
3-Iodo-1-propene | C(=C)CI |
3-Isocyanato-1-propene | C(C=C)N=C=O |
3-Phenyl-1-propene | C(C=C)c1ccccc1 |
Acetic acid, 2-methyl-2-propene-1,1-diol diester | C(OC(C)=O)(OC(C)=O)C(C)=C |
Acetic_acid__2-methyl-2-propene-1_1-diol_diester | C(OC(C)=O)(OC(C)=O)C(C)=C |
Benzene, 1,1'-(1,3,3-trimethyl-1-propene-1,3-diyl)bis- | C(C)(C)(C=C(C)c1ccccc1)c2ccccc2 |
Benzene, 1,1'-(1-propene-1,3-diyl)bis- | C(C=Cc1ccccc1)c2ccccc2 |
Benzene__1_1'-(1-propene-1_3-diyl)bis- | C(C=Cc1ccccc1)c2ccccc2 |
Benzene__1_1'-(1_3_3-trimethyl-1-propene-1_3-diyl)bis- | C(C)(C)(C=C(C)c1ccccc1)c2ccccc2 |
PROPENE-1,1,3-TRICARBONITRILE, 2-AMINO | C(C#N)(C#N)=C(N)CC#N |
Propene acid | C(=O)(O)C=C |
Propene chlorohydrin | C(C)(O)CCl |
Propene sulfide | CC1CS1 |
Propene, 1, 3-diphenyl- | C(C=Cc1ccccc1)c2ccccc2 |
Propene, 1,1,2,3-tetrabromo- | C(Br)(CBr)=C(Br)Br |
Propene, 1,1,2-trichloro-3,3,3-trifluoro- | C(Cl)(=C(Cl)Cl)C(F)(F)F |
Propene, 1,1-dichloro- | C(Cl)(Cl)=CC |
Propene, 1,1-diphenyl- | C(=CC)(c1ccccc1)c2ccccc2 |
Propene, 1,2,3-trichloro- | C(Cl)(CCl)=CCl |
Propene, 1,3, 3-triethoxy- | C(OCC)(OCC)C=COCC |
Propene, 1,3-dichloro- | C(CCl)=CCl |
Propene, 1-(p-methoxyphenyl)- | C(=CC)c1ccc(OC)cc1 |
Propene, 1-bromo-2-methyl- | C(C)(C)=CBr |
Propene, 1-chloro- | C(C)=CCl |
Propene, 2,3-dibromo- | C(Br)(=C)CBr |
Propene, 2,3-dichloro- | C(=C)(Cl)CCl |
Propene, 2-bromo- | C(Br)(C)=C |
Propene, 2-cyclopropyl- | C(C)(=C)C1CC1 |
Propene, 2-methyl-1,1-diphenyl- | C(=C(C)C)(c1ccccc1)c2ccccc2 |
Propene, 2-methyl-1-phenyl- | C(=C(C)C)c1ccccc1 |
Propene, 3-(dimethylamino)-1,1-diphenyl-, hydrochloride | C(=CCN(C)C)(c1ccccc1)c2ccccc2 |
Propene, 3-bromo- | C(Br)C=C |
Propene, 3-chloro- | C(=C)CCl |
Propene, 3-chloro-1-phenyl- | C(=CCCl)c1ccccc1 |
Propene, 3-chloro-2-(chloromethyl)- | C(=C)(CCl)CCl |
Propene, 3-chloro-2-methyl- | C(C)(=C)CCl |
Propene, 3-iodo- | C(=C)CI |
Propene, 3-iodo-, compd. with hexamethylenetetramine (1:1) | C(C=C)N12CN3CN(C1)CN(C2)C3 |
Propene, 3-isocyanato- | C(C=C)N=C=O |
Propene, 3-isothiocyanato- | C(C=C)N=C=S |
Propene, hexachloro- | C(Cl)(=C(Cl)Cl)C(Cl)(Cl)Cl |
Propene-3-nitrile | C(C=C)C#N |
Propene__1_1_2_3-tetrabromo- | C(Br)(CBr)=C(Br)Br |
Sodium 2-propene-1-sulfonate | C(C=C)S(=O)(=O)O |
cis-1-Phenyl-1-propene | C(=CC)c1ccccc1 |
trans-1, 2-Diphenyl-1-propene | C(C)(=Cc1ccccc1)c2ccccc2 |
trans-1-(p-Methoxyphenyl)propene | C(=CC)c1ccc(OC)cc1 |
trans-1-Phenyl-1-propene | C(=CC)c1ccccc1 |
trans-1-Propene-1,2-dicarboxylic acid | C(C)(=CC(=O)O)C(=O)O |
trans-1-Propene-1_2-dicarboxylic_acid | C(C)(=CC(=O)O)C(=O)O |