If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Coumaric acid | C(=CC(=O)O)c1ccc(O)cc1 |
Hydro-p-coumaric acid | C(CC(=O)O)c1ccc(O)cc1 |
O-Acetyl-o-coumaric acid | O(C(C)=O)c1ccccc1C=CC(=O)O |
Para-Coumaric acid | C(=CC(=O)O)c1ccc(O)cc1 |
p-Coumaric acid | C(=CC(=O)O)c1ccc(O)cc1 |
trans-o-Coumaric acid | C(=CC(=O)O)c1ccccc1O |