If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-(2-Allyl-6-methoxyphenoxy)triethylamine hydrochloride | O(CCN(CC)CC)c1c(OC)cccc1CC=C |
2-(2-Biphenylyloxy)triethylamine hydrochloride | O(CCN(CC)CC)c1ccccc1c2ccccc2 |
Borane, complex with triethylamine(1:1) | N(B)(CC)(CC)CC |
Triethylamine base borane adduct | N(B)(CC)(CC)CC |
Triethylamine borane | N(B)(CC)(CC)CC |
Triethylamine compound with borane (1:1) | N(B)(CC)(CC)CC |
Triethylamine hydrochloride | N(CC)(CC)CC |
Triethylamine monohydrochloride | N(CC)(CC)CC |
Triethylamine, 1,1'-dimethyl- | N(CC)(C(C)C)C(C)C |
Triethylamine, 2''-chloro-1,1'-dimethyl-, hydrochloride | N(CCCl)(C(C)C)C(C)C |
Triethylamine, 2',2''-dichloro-1,1-dimethyl- | N(CCCl)(CCCl)C(C)(C)C |
Triethylamine, 2, 2'-dichloro-2''-phenyl- | C(CN(CCCl)CCCl)c1ccccc1 |
Triethylamine, 2,2'''-dithiobis- | N(CC)(CC)CCSSCCN(CC)CC |
Triethylamine, 2,2', 2''-trichloro-, hydrochloride | N(CCCl)(CCCl)CCCl |
Triethylamine, 2,2',2''-trichloro- | N(CCCl)(CCCl)CCCl |
Triethylamine, 2,2',2''-trihydroxy- | N(CCO)(CCO)CCO |
Triethylamine, 2,2'-bis(diphenylphosphino)- | P(CCN(CC)CCP(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Triethylamine, 2-(2-allyl-6-methoxyphenoxy)- | O(CCN(CC)CC)c1c(OC)cccc1CC=C |
Triethylamine, 2-(2-allyl-6-methoxyphenoxy)-, hydrochloride | O(CCN(CC)CC)c1c(OC)cccc1CC=C |
Triethylamine, 2-(2-biphenylyloxy)-, hydrochloride | O(CCN(CC)CC)c1ccccc1c2ccccc2 |
Triethylamine, 2-(diphenylmethoxy)-, hydrochloride | C(OCCN(CC)CC)(c1ccccc1)c2ccccc2 |
Triethylamine, 2-(o-methoxyphenoxy)-, hydrochloride | O(CCN(CC)CC)c1ccccc1OC |
Triethylamine, 2-(p-(2-chloro-1,2-diphenylvinyl)phenoxy)-, citrate | C(O)(CC(=O)O)(CC(=O)O)C(=O)O.CCN(CC)CCOc1ccc(cc1)C(c2ccccc2)=C(Cl)c3ccccc3 |
Triethylamine, 2-chloro-, hydrochloride | N(CC)(CC)CCCl |
Triethylamine, 2-chloro-1', 1''-dimethyl- | N(CCCl)(C(C)C)C(C)C |
Triethylamine, 2-mercapto- | N(CC)(CC)CCS |
Triethylamine, compd. with borane (1:1) | N(B)(CC)(CC)CC |
Triethylamine, complex with borane (1:1) | N(B)(CC)(CC)CC |
Triethylamine, hydrochloride | N(CC)(CC)CC |
Triethylamine-borane 1 to 1 complex | N(B)(CC)(CC)CC |
Triethylamine-borane | N(B)(CC)(CC)CC |
Triethylamine__2-(o-methoxyphenoxy)-__hydrochloride | O(CCN(CC)CC)c1ccccc1OC |
Triethylamine__2_2'-bis(diphenylphosphino)- | P(CCN(CC)CCP(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Triethylamine__2_2'_2''-trihydroxy- | N(CCO)(CCO)CCO |