If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
N, N'-Bis(2-ethyleniminoethyl)oxalic acid amide | C(CNC(=O)C(=O)NCCN1CC1)N2CC2 |
OXALIC ACID | C(=O)(O)C(=O)O |
Oxalic acid bis(cyclohexylidene hydrazide) | N(NC(=O)C(=O)NN=C1CCCCC1)=C2CCCCC2 |
Oxalic acid bis(cyclohexylidenehydrazide) | N(NC(=O)C(=O)NN=C1CCCCC1)=C2CCCCC2 |
Oxalic acid bisamidrazone | C(=N)(NN)C(=N)NN |
Oxalic acid bishydrazide | C(=O)(NN)C(=O)NN |
Oxalic acid cobalt(2+) salt (1:1) | C(=O)(O)C(=O)O |
Oxalic acid compd. with urea (1:2) | C(N)(N)=O.O=C(O)C(=O)O |
Oxalic acid copper(2+) salt (1:1) | C(=O)(O)C(=O)O |
Oxalic acid diamide | C(N)(=O)C(N)=O |
Oxalic acid dibenzyl ester | C(OC(=O)C(=O)OCc1ccccc1)c2ccccc2 |
Oxalic acid dihydrazide | C(=O)(NN)C(=O)NN |
Oxalic acid dihydrazone | C(=O)(NN)C(=O)NN |
Oxalic acid dimethyl ester | C(=O)(OC)C(=O)OC |
Oxalic acid hydrazide | C(=O)(NN)C(=O)NN |
Oxalic acid monoamide | C(N)(=O)C(=O)O |
Oxalic acid monoethyl ester chloride | C(=O)(OCC)C(Cl)=O |
Oxalic acid | C(=O)(O)C(=O)O |
Oxalic acid, 1, 2-dithio-, S,S-bis(2-chloroethyl) ester | C(=O)(SCCCl)C(=O)SCCCl |
Oxalic acid, bis(((2-hydroxy-1-naphthyl)methylene)hydrazide) | C(=NNC(=O)C(=O)NN=Cc1c(O)ccc2ccccc12)c3c(O)ccc4ccccc34 |
Oxalic acid, bis(benzylidenehydrazide) | C(=NNC(=O)C(=O)NN=Cc1ccccc1)c2ccccc2 |
Oxalic acid, bis(cyclohexylidenehydrazide) | N(NC(=O)C(=O)NN=C1CCCCC1)=C2CCCCC2 |
Oxalic acid, cadmium salt (1:1) | C(=O)(O)C(=O)O |
Oxalic acid, cobalt(2+) salt (1:1) | C(=O)(O)C(=O)O |
Oxalic acid, copper(2+) salt (1:1) | C(=O)(O)C(=O)O |
Oxalic acid, diallyl ester | C(=O)(OCC=C)C(=O)OCC=C |
Oxalic acid, dibenzyl ester | C(OC(=O)C(=O)OCc1ccccc1)c2ccccc2 |
Oxalic acid, dibutyl ester | C(=O)(OCCCC)C(=O)OCCCC |
Oxalic acid, diethyl ester | C(=O)(OCC)C(=O)OCC |
Oxalic acid, dihydrazide (VAN8CI) | C(=O)(NN)C(=O)NN |
Oxalic acid, dilithium salt | C(=O)(O)C(=O)O |
Oxalic acid, dimethyl ester | C(=O)(OC)C(=O)OC |
Oxalic acid, diphenyl ester | O(C(=O)C(=O)Oc1ccccc1)c2ccccc2 |
Oxalic acid, disodium salt | C(=O)(O)C(=O)O |
Oxalic acid, dithiolbis(2-chloroethyl) ester | C(=O)(SCCCl)C(=O)SCCCl |
Oxalic acid, iron(3+) potassium salt (3:1:3) | O=C1O[Fe]234(OC1=O)OC(=O)C(=O)O2.O=C(O3)C(=O)O4 |
Oxalic acid, magnesium salt (1:1) | C(=O)(O)C(=O)O |
Oxalic acid, monoethyl ester amide | C(=O)(OCC)C(N)=O |
Oxalic acid, monoethyl ester, potassium salt | C(=O)(OCC)C(=O)O |
Oxalic acid, monostrontium salt | C(=O)(O)C(=O)O |
Oxalic acid, strontium salt (1:1) | C(=O)(O)C(=O)O |
Oxalic acid, thorium(4+ ) salt (2:1) | O=C1O[Th]2(OC1=O)OC(=O)C(=O)O2 |
Oxalic acid, zinc salt (1:1) | C(=O)(O)C(=O)O |
Oxalic dihydrazide | C(=O)(NN)C(=O)NN |
Oxalic hydrazide | C(=O)(NN)C(=O)NN |
Oxalic_acid__1__2-dithio-__S_S-bis(2-chloroethyl)_ester | C(=O)(SCCCl)C(=O)SCCCl |
Oxalic_acid__bis(((2-hydroxy-1-naphthyl)methylene)hydrazide) | C(=NNC(=O)C(=O)NN=Cc1c(O)ccc2ccccc12)c3c(O)ccc4ccccc34 |
Oxalic_acid__dihydrazide_(VAN8CI) | C(=O)(NN)C(=O)NN |
Oxalic_acid_compd._with_urea_(1:2) | C(N)(N)=O.O=C(O)C(=O)O |