If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Aminopurine riboside | OC1C(O)C(CO)OC1N2C=Nc3cnc(N)nc23 |
2-Aminopurine | Nc1ncc2NC=Nc2n1 |
2-Aminopurine-6(1H)-thione | Sc1nc(N)nc2NC=Nc12 |
2-Aminopurine-6-thiol | Sc1nc(N)nc2NC=Nc12 |
2-Fluoro-6-aminopurine | Nc1nc(F)nc2NC=Nc12 |
2-Mercapto-6-aminopurine | Nc1nc(S)nc2NC=Nc12 |
2-Methyl-6-aminopurine | Nc1nc(C)nc2NC=Nc12 |
6-(N-Hydroxyl)aminopurine | N(O)c1ncnc2NC=Nc12 |
6-Aminopurine | Nc1ncnc2NC=Nc12 |
6-Chloro-2-aminopurine | Clc1nc(N)nc2NC=Nc12 |
6-Mercapto-2-aminopurine | Sc1nc(N)nc2NC=Nc12 |
9-D-Psicofuranosyl-6-aminopurine | C(O)C1(OC(CO)C(O)C1O)N2C=Nc3c(N)ncnc23 |
N6-(.DELTA.2-Isopentenyl)aminopurine | N(CC=C(C)C)c1ncnc2NC=Nc12 |