If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(3-p-Fluorobenzoylpropyl)-4-p-chlorophenyl-4-hydroxypiperidine | OC1(CCN(CCCC(=O)c2ccc(F)cc2)CC1)c3ccc(Cl)cc3 |
1-Methyl-3-hydroxypiperidine | OC1CCCN(C)C1 |
1-Methyl-4-hydroxypiperidine | OC1CCN(C)CC1 |
2,2,6,6-Tetramethyl-4-hydroxypiperidine 1-oxide | ON1C(C)(C)CC(O)CC1(C)C |
2,2,6,6-Tetramethyl-4-hydroxypiperidine | CC1(C)CC(O)CC(C)(C)N1 |
3-Hydroxypiperidine | OC1CCCNC1 |
4-(4-Chlorophenyl)-4-hydroxypiperidine | OC1(CCNCC1)c2ccc(Cl)cc2 |
4-(p-Chlorophenyl)-4-hydroxypiperidine | OC1(CCNCC1)c2ccc(Cl)cc2 |
N-Methyl-3-hydroxypiperidine | OC1CCCN(C)C1 |
N-Methyl-4-hydroxypiperidine | OC1CCN(C)CC1 |