If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,5-Dicyclohexyl-3-(3'-cyclopentylpropyl)pentane | C(CCCC1CCCC1)(CCC2CCCCC2)CCC3CCCCC3 |
1,5-Dicyclopentyl-3-(2-cyclopentylethyl)pentane | C(CCC1CCCC1)(CCC2CCCC2)CCC3CCCC3 |
1,5-Diphenyl-3-(3-cyclopentylpropyl)pentane | C(CCCC1CCCC1)(CCc2ccccc2)CCc3ccccc3 |
1-(4-Pyridyl)pentane | C(CCCC)c1ccncc1 |
1-Phenyl-n-pentane | C(CCCC)c1ccccc1 |
2, 2-Di(carbamoyloxymethyl)pentane | C(C)(CCC)(COC(N)=O)COC(N)=O |
3-(2-Pyridyl)pentane | C(CC)(CC)c1ccccn1 |
3-Aza-1, 2-(dicarbethoxy)pentane-5-thiol hydrochloride | C(NCCS)(CC(=O)OCC)C(=O)OCC |
ALPHA_,.omega.-Bis(trimethylammonium)pentane dibromide | C(CCCCN(C)(C)C)N(C)(C)C |
Methyl pentane(DOT) | C(CC)C(C)C |
Methyl_pentane(DOT) | C(CC)C(C)C |
Pentane | C(CC)CC |
Pentane, 1, 5-dibromo- | C(CCBr)CCBr |
Pentane, 1,1'-oxybis- | O(CCCCC)CCCCC |
Pentane, 1,1'-sulfonylbis- | C(CCCC)S(=O)(=O)CCCCC |
Pentane, 1,1,1,5-tetrachloro- | C(CCCCl)C(Cl)(Cl)Cl |
Pentane, 1,1,1-trifluoro- | C(CCC)C(F)(F)F |
Pentane, 1,1,5,5-tetramethoxy- | C(OC)(OC)CCCC(OC)OC |
Pentane, 1,2-epoxy- | C(CC)C1CO1 |
Pentane, 1,2-epoxy-2,4,4-trimethyl- | C(C(C)(C)C)C1(C)CO1 |
Pentane, 1,2-epoxy-4-methyl- | C(C(C)C)C1CO1 |
Pentane, 1,2:4,5-diepoxy- | C(C1CO1)C2CO2 |
Pentane, 1,4-dibromo- | C(CCBr)C(Br)C |
Pentane, 1,4-dichloro- | C(CCCl)C(C)Cl |
Pentane, 1,5-bis(methylthio)- | C(CCSC)CCSC |
Pentane, 1,5-dichloro- | C(CCCl)CCCl |
Pentane, 1,5-dichloro-3,3-dimethoxy- | C(OC)(OC)(CCCl)CCCl |
Pentane, 1,5-dicyclohexyl-3-(2-cyclohexylethyl)- | C(CCC1CCCCC1)(CCC2CCCCC2)CCC3CCCCC3 |
Pentane, 1,5-diiodo- | C(CCI)CCI |
Pentane, 1,5-dimethoxy- | C(CCOC)CCOC |
Pentane, 1-(methylthio)- | C(CCC)CSC |
Pentane, 1-bromo- | C(CBr)CCC |
Pentane, 1-bromo-4-methyl- | C(CCBr)C(C)C |
Pentane, 1-bromo-5-chloro- | C(CCBr)CCCl |
Pentane, 1-chloro- | C(CC)CCCl |
Pentane, 1-cyclopentyl- | C(CCCC)C1CCCC1 |
Pentane, 1-ethoxy- | C(CCC)COCC |
Pentane, 1-iodo- | C(CC)CCI |
Pentane, 1-nitro- | C(CCCC)[N+](=O)[O-] |
Pentane, 1-phenyl- | C(CCCC)c1ccccc1 |
Pentane, 2,2,3,3-tetramethyl- | C(C)(C)(CC)C(C)(C)C |
Pentane, 2,2,3-trimethyl- | C(C)(CC)C(C)(C)C |
Pentane, 2,2,4,4-tetramethyl- | C(C(C)(C)C)C(C)(C)C |
Pentane, 2,2,4-trimethyl- | C(C(C)C)C(C)(C)C |
Pentane, 2,2,4-trimethyl-4-nitro- | C(C(C)(C)C)C(C)(C)[N+](=O)[O-] |
Pentane, 2,3,3,4-tetramethyl- | C(C)(C)(C(C)C)C(C)C |
Pentane, 2,3,3-trimethyl- | C(C)(C)(CC)C(C)C |
Pentane, 2,3,4-trimethyl- | C(C)(C(C)C)C(C)C |
Pentane, 2,3-dibromo- | C(Br)(CC)C(Br)C |
Pentane, 2,3-dimethyl- | C(C)(CC)C(C)C |
Pentane, 2,4-dimethyl- | C(C(C)C)C(C)C |
Pentane, 2-bromo- | C(CC)C(Br)C |
Pentane, 2-chloro- | C(CC)C(C)Cl |
Pentane, 2-cyclopropyl- | C(C)(CCC)C1CC1 |
Pentane, 2-iodo- | C(CC)C(C)I |
Pentane, 2-isocyano-2,4,4-trimethyl- | C(C(C)(C)C)C(C)(C)N#C |
Pentane, 2-methyl- | C(CC)C(C)C |
Pentane, 3,3-diethyl- | C(CC)(CC)(CC)CC |
Pentane, 3,3-dimethyl- | C(C)(C)(CC)CC |
Pentane, 3-ethyl- | C(CC)(CC)CC |
Pentane, 3-ethyl-2,4-dimethyl- | C(CC)(C(C)C)C(C)C |
Pentane, 3-ethyl-2-methyl- | C(CC)(CC)C(C)C |
Pentane, 3-ethyl-3-methyl- | C(C)(CC)(CC)CC |
Pentane, 3-methyl- | C(C)(CC)CC |
Pentane, 3-methylene- | C(=C)(CC)CC |
Pentane-1,5-diol | C(CCO)CCO |
Pentane-2,4-dione | C(C(C)=O)C(C)=O |
Pentane__1-(methylthio)- | C(CCC)CSC |
Pentane__1-bromo- | C(CBr)CCC |
Pentane__1-bromo-4-methyl- | C(CCBr)C(C)C |
Pentane__1-bromo-5-chloro- | C(CCBr)CCCl |
Pentane__1-chloro- | C(CC)CCCl |
Pentane__1-iodo- | C(CC)CCI |
Pentane__1-nitro- | C(CCCC)[N+](=O)[O-] |
Pentane__1-phenyl- | C(CCCC)c1ccccc1 |
Pentane__1_1'-oxybis- | O(CCCCC)CCCCC |
Pentane__1_1'-sulfonylbis- | C(CCCC)S(=O)(=O)CCCCC |
Pentane__1_1_1-trifluoro- | C(CCC)C(F)(F)F |
Pentane__1_1_1_5-tetrachloro- | C(CCCCl)C(Cl)(Cl)Cl |
Pentane__1_2-epoxy-4-methyl- | C(C(C)C)C1CO1 |
Pentane__1_4-dibromo- | C(CCBr)C(Br)C |
Pentane__1_4-dichloro- | C(CCCl)C(C)Cl |
Pentane__1_5-bis(methylthio)- | C(CCSC)CCSC |
Pentane__1_5-dichloro-3_3-dimethoxy- | C(OC)(OC)(CCCl)CCCl |
Pentane__1_5-dicyclohexyl-3-(2-cyclohexylethyl)- | C(CCC1CCCCC1)(CCC2CCCCC2)CCC3CCCCC3 |
Pentane__1_5-dimethoxy- | C(CCOC)CCOC |
Pentane__2-bromo- | C(CC)C(Br)C |
Pentane__2-cyclopropyl- | C(C)(CCC)C1CC1 |
Pentane__2-iodo- | C(CC)C(C)I |
Pentane__2_2_3-trimethyl- | C(C)(CC)C(C)(C)C |
Pentane__2_2_3_3-tetramethyl- | C(C)(C)(CC)C(C)(C)C |
Pentane__2_2_4-trimethyl- | C(C(C)C)C(C)(C)C |
Pentane__2_2_4-trimethyl-4-nitro- | C(C(C)(C)C)C(C)(C)[N+](=O)[O-] |
Pentane__2_2_4_4-tetramethyl- | C(C(C)(C)C)C(C)(C)C |
Pentane__2_3-dibromo- | C(Br)(CC)C(Br)C |
Pentane__2_3-dimethyl- | C(C)(CC)C(C)C |
Pentane__2_3_3-trimethyl- | C(C)(C)(CC)C(C)C |
Pentane__2_3_3_4-tetramethyl- | C(C)(C)(C(C)C)C(C)C |
Pentane__2_3_4-trimethyl- | C(C)(C(C)C)C(C)C |
Pentane__2_4-dimethyl- | C(C(C)C)C(C)C |
Pentane__3-ethyl- | C(CC)(CC)CC |
Pentane__3-ethyl-2-methyl- | C(CC)(CC)C(C)C |
Pentane__3-ethyl-2_4-dimethyl- | C(CC)(C(C)C)C(C)C |
Pentane__3-ethyl-3-methyl- | C(C)(CC)(CC)CC |
Pentane__3-methyl- | C(C)(CC)CC |
Pentane__3-methylene- | C(=C)(CC)CC |
Pentane__3_3-diethyl- | C(CC)(CC)(CC)CC |
Pentane__3_3-dimethyl- | C(C)(C)(CC)CC |
n-Pentane | C(CC)CC |