If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Hydroxy-2-methylpropiophenone | C(=O)(c1ccccc1)C(C)(C)O |
2-Methylpropiophenone | C(=O)(C(C)C)c1ccccc1 |
3', 4'-Dihydroxy-2-methylpropiophenone | C(=O)(C(C)C)c1ccc(O)c(O)c1 |
3', 4'-Dihydroxy-ALPHA_-methylpropiophenone | C(=O)(C(C)C)c1ccc(O)c(O)c1 |
3-(Dimethylamino)-2-methylpropiophenone | C(=O)(C(C)CN(C)C)c1ccccc1 |
4'-Methoxy-2-methylpropiophenone | C(=O)(C(C)C)c1ccc(OC)cc1 |
ALPHA_-Methylpropiophenone | C(=O)(C(C)C)c1ccccc1 |