If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Shell 1001 | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
Shell 345 | C(C=C)(OC(C)=O)OC(C)=O |
Shell 40 | O(CC(=O)OCCCC)c1ccc(Cl)cc1Cl |
Shell 52-RL-71 | ClC12C(Cl)=C(Cl)C(Cl)(C3C4OC(C5OC45)C13)C2(Cl)Cl |
Shell Lac | C(=O)(O)c1c(C(=O)O)c(O)cc2C(=O)c3c(O)c(CC)c(C(C)=O)c(O)c3C(=O)c12 |
Shell SD 2218 | P(=O)(OCC)(OCC)OC1=CCCCC1 |
Shell SD 345 | C(C=C)(OC(C)=O)OC(C)=O |
Shell SD-8591 | O=C1NC=CN1 |
Shell Unkrauttod A | C(=C)CO |
Shell sd-5532 | ClC12C(Cl)=C(Cl)C(Cl)(C3C(Cl)C(Cl)CC13)C2(Cl)Cl |