If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
9-(5-O-Phosphono-BETA_-D-arabinofuranosyl)-9H-purin-6-amine | OC1C(O)C(COP(=O)(O)O)OC1N2C=Nc3c(N)ncnc23 |
9H-Purin-6-amine, 9-(5-O-phosphono-BETA_-D-arabinofuranosyl)- | OC1C(O)C(COP(=O)(O)O)OC1N2C=Nc3c(N)ncnc23 |
Acetic acid, phosphono- | C(C(=O)O)P(=O)(O)O |
Acetic acid, phosphono-, P,P-disodium salt, hydrate | C(C(=O)O)P(=O)(O)O |
Acetic acid, phosphono-, disodium salt | C(C(=O)O)P(=O)(O)O |
Acetic acid, phosphono-, triethyl ester | P(=O)(OCC)(OCC)CC(=O)OCC |
Acetic_acid__phosphono- | C(C(=O)O)P(=O)(O)O |
Acetic_acid__phosphono-__P_P-disodium_salt__hydrate | C(C(=O)O)P(=O)(O)O |
Alanine, 3-phosphono- | C(N)(CP(=O)(O)O)C(=O)O |
Alanine__3-phosphono- | C(N)(CP(=O)(O)O)C(=O)O |
BETA_-Alanine, 3-phosphono- | C(N)(CC(=O)O)P(=O)(O)O |
Butanoic acid, 2-amino-4-phosphono- | C(CP(=O)(O)O)C(N)C(=O)O |
Butanoic_acid__2-amino-4-phosphono- | C(CP(=O)(O)O)C(N)C(=O)O |
Butyric acid, 2-phosphono-, triethyl ester | P(=O)(OCC)(OCC)C(CC)C(=O)OCC |
Cinnamic acid, 3,4-dimethoxy-ALPHA_-phosphono-, triethyl ester | C(=Cc1ccc(OC)c(OC)c1)(C(=O)OCC)P(=O)(OCC)OCC |
Cinnamic_acid__3_4-dimethoxy-ALPHA_-phosphono-__triethyl_ester | C(=Cc1ccc(OC)c(OC)c1)(C(=O)OCC)P(=O)(OCC)OCC |
Formic acid, phosphono-, triethyl ester | P(=O)(OCC)(OCC)C(=O)OCC |
L-(N5-Phosphono)methionine-S-sulfoximinyl-L-alanyl-L-alanine | S(C)(=O)(CCC(N)C(=O)NC(C)C(=O)NC(C)C(=O)O)=NP(=O)(O)O |
PHOSPHONO-METHIONINE-S-SULFOXIMINYL-L-ALANYL-ALANINE | S(C)(=O)(CCC(N)C(=O)NC(C)C(=O)NC(C)C(=O)O)=NP(=O)(O)O |
Propanoic acid, 3-amino-3-phosphono- | C(N)(CC(=O)O)P(=O)(O)O |
Propanoic_acid__3-amino-3-phosphono- | C(N)(CC(=O)O)P(=O)(O)O |