If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Methyl-2-aminoethanol | C(C)(O)CN |
2(3H)-Benzothiazolethione, compd. with 2-aminoethanol (1:1) | S=C1Nc2ccccc2S1.NCCO |
2(3H)-Benzothiazolethione__compd._with_2-aminoethanol_(1:1) | S=C1Nc2ccccc2S1.NCCO |
2-Aminoethanol hydrochloride | C(N)CO |
BETA_-(2-Hydroxy-3-naphthoyl)aminoethanol | C(=O)(NCCO)c1cc2ccccc2cc1O |
BETA_-Aminoethanol hydrochloride | C(N)CO |
BETA_-Aminoethanol_hydrochloride | C(N)CO |
N,N-Diethyl-2-aminoethanol | N(CC)(CC)CCO |
N,N-Dimethyl-2-aminoethanol | C(CO)N(C)C |
N-(3, 4-Dichlorobenzylidene)-2-aminoethanol | C(=NCCO)c1ccc(Cl)c(Cl)c1 |
N-Acetyl-2-aminoethanol | N(CCO)C(C)=O |
N-Chloroacetyl-2-aminoethanol | C(=O)(CCl)NCCO |
N-Methyl-2-aminoethanol | C(CO)NC |
N-Thenylidene-2-aminoethanol | C(=NCCO)C1=CC=CS1 |