If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1-Naphthyl isocyanate | N(=C=O)c1cccc2ccccc12 |
1-Propyl isocyanate | C(CC)N=C=O |
2,5-Dichlorophenyl isocyanate | N(=C=O)c1cc(Cl)ccc1Cl |
2,5-Dimethylphenyl isocyanate | N(=C=O)c1cc(C)ccc1C |
2-Chloroethyl isocyanate | C(CCl)N=C=O |
2-Chlorophenyl isocyanate | N(=C=O)c1ccccc1Cl |
2-Ethoxyphenyl isocyanate | N(=C=O)c1ccccc1OCC |
2-Naphthyl isocyanate | N(=C=O)c1ccc2ccccc2c1 |
2-Nitrophenyl isocyanate | [N+](=O)([O-])c1ccccc1N=C=O |
3,3'-Dimethoxy-4,4'-biphenylylene isocyanate | O(C)c1cc(ccc1N=C=O)c2ccc(N=C=O)c(OC)c2 |
3,3'-Dimethoxy-4,4'-diphenylyl isocyanate | O(C)c1cc(ccc1N=C=O)c2ccc(N=C=O)c(OC)c2 |
3,3'-Dimethyl-4,4'-biphenylene isocyanate | Cc1cc(ccc1N=C=O)c2ccc(N=C=O)c(C)c2 |
3,4-Dichlorophenyl isocyanate | N(=C=O)c1ccc(Cl)c(Cl)c1 |
3-Chlorophenyl isocyanate | N(=C=O)c1cccc(Cl)c1 |
3-Nitrophenyl isocyanate | N(=C=O)c1cccc(c1)[N+](=O)[O-] |
4,4'-Methylenebis(phenyl isocyanate) | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
4,4'-Methylenedi(phenylene isocyanate) | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
4-Bromophenyl isocyanate | N(=C=O)c1ccc(Br)cc1 |
4-Chlorophenyl isocyanate | N(=C=O)c1ccc(Cl)cc1 |
4-Methoxyphenyl isocyanate | N(=C=O)c1ccc(OC)cc1 |
4-Methyl-m-phenylene isocyanate | N(=C=O)c1cc(N=C=O)ccc1C |
4-Nitrophenyl isocyanate | [N+](=O)([O-])c1ccc(N=C=O)cc1 |
ALPHA_-Naphthyl isocyanate | N(=C=O)c1cccc2ccccc12 |
Allyl isocyanate | C(C=C)N=C=O |
BETA_-Naphthyl isocyanate | N(=C=O)c1ccc2ccccc2c1 |
Benzoyl isocyanate | C(=O)(N=C=O)c1ccccc1 |
Benzoyl_isocyanate | C(=O)(N=C=O)c1ccccc1 |
Carbethoxymethyl isocyanate | C(=O)(OCC)CN=C=O |
Cyclohexyl isocyanate | N(=C=O)C1CCCCC1 |
Di-isocyanate de toluylene (FRENCH) | N(=C=O)c1cc(N=C=O)ccc1C |
Ethoxycarbonylmethyl isocyanate | C(=O)(OCC)CN=C=O |
Ethyl isocyanate | N(CC)=C=O |
Isocyanate de methyle (FRENCH) | C(=O)=NC |
Isocyanate_de_methyle_(FRENCH) | C(=O)=NC |
Methyl isocyanate trimer | O=C1N(C)C(=O)N(C)C(=O)N1C |
Methyl isocyanate | C(=O)=NC |
Methylbisphenyl isocyanate | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
Methylene bisphenyl isocyanate | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
Methylenebis(4, 4'-phenyl isocyanate) | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
Methylenebis(4-phenyl isocyanate) | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
Methylenebis(4-phenylene isocyanate) | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
Methylenebis(p-phenyl isocyanate) | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
Methylenebis(p-phenylene isocyanate) | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
Methylenedi(p-phenyl isocyanate) | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
Methylenedi(p-phenylene isocyanate) | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
Octadecyl isocyanate | C(CCCCCCCCCC)CCCCCCCN=C=O |
Phenyl isocyanate dimer | O=C1N(C(=O)N1c2ccccc2)c3ccccc3 |
Phenyl isocyanate trimer | O=C1N(C(=O)N(C(=O)N1c2ccccc2)c3ccccc3)c4ccccc4 |
Phenyl isocyanate | N(=C=O)c1ccccc1 |
Potassium isocyanate | C(#N)O |
Propyl isocyanate | C(CC)N=C=O |
Sodium isocyanate | C(#N)O |
Stearyl isocyanate | C(CCCCCCCCCC)CCCCCCCN=C=O |
m-Chlorophenyl isocyanate | N(=C=O)c1cccc(Cl)c1 |
m-Fluorosulfonylphenyl isocyanate | S(F)(=O)(=O)c1cccc(N=C=O)c1 |
m-Nitrophenyl isocyanate | N(=C=O)c1cccc(c1)[N+](=O)[O-] |
m-Phenylene isocyanate | N(=C=O)c1cccc(N=C=O)c1 |
m-Propyl isocyanate | C(CC)N=C=O |
n-Octadecyl isocyanate | C(CCCCCCCCCC)CCCCCCCN=C=O |
o-Chlorophenyl isocyanate | N(=C=O)c1ccccc1Cl |
o-Ethoxyphenyl isocyanate | N(=C=O)c1ccccc1OCC |
o-Nitrophenyl isocyanate | [N+](=O)([O-])c1ccccc1N=C=O |
p,p'-Methylenebis(phenyl isocyanate) | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
p-Anisyl isocyanate | N(=C=O)c1ccc(OC)cc1 |
p-Bromophenyl isocyanate | N(=C=O)c1ccc(Br)cc1 |
p-Chlorophenyl isocyanate | N(=C=O)c1ccc(Cl)cc1 |
p-Methoxyphenyl isocyanate | N(=C=O)c1ccc(OC)cc1 |
p-Nitrophenyl isocyanate | [N+](=O)([O-])c1ccc(N=C=O)cc1 |
p-Phenylene isocyanate | N(=C=O)c1ccc(N=C=O)cc1 |
para-Chlorophenyl isocyanate | N(=C=O)c1ccc(Cl)cc1 |