If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Bromo-ethyl-butyryl-urea | C(Br)(CC)(CC)C(=O)NC(N)=O |
Anthranilic acid, N-butyryl- | N(C(=O)CCC)c1ccccc1C(=O)O |
Anthraquinone, 1-butyryl-2,4,5-trihydroxy-7-methoxy- | C(=O)(CCC)c1c(O)cc(O)c2C(=O)c3c(O)cc(OC)cc3C(=O)c12 |
Aziridine, 1-butyryl- | C(=O)(CCC)N1CC1 |
Aziridine, 1-n-butyryl | C(=O)(CCC)N1CC1 |
Butyryl 4-methylumbelliferone | CC1=CC(=O)Oc2cc(ccc12)OC(=O)CCC |
Butyryl chloride, 2-ethyl- | C(CC)(CC)C(Cl)=O |
Butyryl lactone | O=C1CCCO1 |
Hydrazine, 1-butyryl-2-picolinoyl- | C(=O)(NNC(=O)CCC)c1ccccn1 |
Hydrazine__1-butyryl-2-picolinoyl- | C(=O)(NNC(=O)CCC)c1ccccn1 |
N-Butyryl-p-aminophenol | N(C(=O)CCC)c1ccc(O)cc1 |
Piperidine, 1-butyryl- | C(=O)(CCC)N1CCCCC1 |
Pyrrolidine, 1-butyryl- | C(=O)(CCC)N1CCCC1 |