If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(-)-Thyroxine | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
L-Thyroxine monosodium salt | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
L-Thyroxine sodium salt | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
L-Thyroxine sodium | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
L-Thyroxine | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
Monosodium thyroxine | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
Ro-thyroxine | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
Sodium L-thyroxine | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
Sodium thyroxine | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
Thyroxine (VAN) | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
Thyroxine iodine | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
Thyroxine sodium salt | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
Thyroxine sodium | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
Thyroxine, L- | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
Thyroxine, monosodium salt, L- | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
d-Thyroxine | O(c1cc(I)c(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |