If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
5-N-Methylphenazonium methosulfate | S(=O)(=O)(O)OC.Cn1c2ccccc2nc3ccccc13 |
9-Azido-10-methylacridinium methosulfate | S(=O)(=O)(O)OC.N=N=Nc1c2ccccc2n(C)c3ccccc13 |
Diphemanil methosulfate | S(=O)(=O)(O)OC.CN1(C)CCC(CC1)=C(c2ccccc2)c3ccccc3 |
Dodecyltrimethylammonium methosulfate | S(=O)(=O)(O)OC.CCCCCCCCCCCCN(C)(C)C |
Hexocyclium methosulfate | S(=O)(=O)(O)OC.CN1(C)CCN(CC1)CC(O)(C2CCCCC2)c3ccccc3 |
N-Methylphenazinium methosulfate | S(=O)(=O)(O)OC.Cn1c2ccccc2nc3ccccc13 |
N-Methylphenazonium methosulfate | S(=O)(=O)(O)OC.Cn1c2ccccc2nc3ccccc13 |
Neostigmine methosulfate | S(=O)(=O)(O)OC.CN(C)C(=O)Oc1cccc(c1)N(C)(C)C |
Phenazine methosulfate | S(=O)(=O)(O)OC.Cn1c2ccccc2nc3ccccc13 |
Trimethyldodecylammonium methosulfate | S(=O)(=O)(O)OC.CCCCCCCCCCCCN(C)(C)C |