If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
6-12-Insect Repellent | C(CC)(CO)C(O)CCC |
Compound 6-12, insect repellent | C(CC)(CO)C(O)CCC |
DMF, insect repellent | C(=O)(OC)c1ccccc1C(=O)OC |
Experimental Tick Repellent 3 | C(=O)(OCCCC)CCCCC(=O)OCCCC |
Experimental Tick Repellent 3PS | C(=O)(OCCCC)CCCCC(=O)OCCCC |
Experimental_Tick_Repellent_3PS | C(=O)(OCCCC)CCCCC(=O)OCCCC |
Insect repellent 448 | OC1CCCCC1c2ccccc2 |
MGK Repellent 11 | C(=O)C12CC=CCC1C3CC=CCC3O2 |
MGK Repellent 326 (VAN) | C(=O)(OCCC)c1ccc(nc1)C(=O)OCCC |
MGK Repellent 874 | C(CCCCC)CCSCCO |
MGK Repellent II | C(=O)C12CC=CCC1C3CC=CCC3O2 |
MGK repellent 264 | O=C1N(CC(CC)CCCC)C(=O)C2C3C=CC(C3)C12 |
MGK repellent 326 | C(=O)(OCCC)c1ccc(nc1)C(=O)OCCC |
MGK repellent R-11 | C(=O)C12CC=CCC1C3CC=CCC3O2 |
Mgk Repellent 326 | C(=O)(OCCC)c1ccc(nc1)C(=O)OCCC |
Mgk dog & cat repellent | C(CCCCCC)CCC(C)=O |
Mgk_dog_&_cat_repellent | C(CCCCCC)CCC(C)=O |
R 11 (insect repellent) | C(=O)C12CC=CCC1C3CC=CCC3O2 |
R 2 (insect repellent) | C(=O)(N(CC)CC)c1ccccc1 |
R-55 Repellent | S(SC(C)(C)C)C(=S)N(C)C |
Repellent 50/181 | C(=O)(NCCCl)C(Cl)(Cl)Cl |
Repellent 612 | C(CC)(CO)C(O)CCC |