If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-(Pentylamino)ethanol 4-aminobenzoate (ester) hydrochloride | C(=O)(OCCNCCCCC)c1ccc(N)cc1 |
2-(Pentylamino)ethanol | C(CCCC)NCCO |
8-(2-(3-Pentylamino)ethylamino)-6-methoxyquinoline dihydrobromide | N(CCNC(CC)CC)c1cc(OC)cc2cccnc12 |
9,10-Anthracenedione, 1,4-bis(pentylamino)- | N(CCCCC)c1ccc(NCCCCC)c2C(=O)c3ccccc3C(=O)c12 |
9_10-Anthracenedione__1_4-bis(pentylamino)- | N(CCCCC)c1ccc(NCCCCC)c2C(=O)c3ccccc3C(=O)c12 |
Anthraquinone, 1,4-bis(pentylamino)- | N(CCCCC)c1ccc(NCCCCC)c2C(=O)c3ccccc3C(=O)c12 |
Benzoic acid, p-amino-, 2-(pentylamino)ethyl ester | C(=O)(OCCNCCCCC)c1ccc(N)cc1 |
Benzoic_acid__p-amino-__2-(pentylamino)ethyl_ester | C(=O)(OCCNCCCCC)c1ccc(N)cc1 |
Ethanol, 2-(pentylamino)- | C(CCCC)NCCO |
Ethanol, 2-(pentylamino)-, 4-aminobenzoate (ester) | C(=O)(OCCNCCCCC)c1ccc(N)cc1 |
Ethanol, 2-(pentylamino)-, p-aminobenzoate (ester) | C(=O)(OCCNCCCCC)c1ccc(N)cc1 |
Ethanol__2-(pentylamino)- | C(CCCC)NCCO |
p-Aminobenzoic acid 2-(n-pentylamino)ethyl ester | C(=O)(OCCNCCCCC)c1ccc(N)cc1 |