If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Aziridinecarboxamide, N,N'-1,5-naphthalenediylbis(2-methyl)- | N(C(=O)N1CC1C)c2cccc3c2cccc3NC(=O)N4CC4C |
1-Aziridinecarboxamide__N_N'-1_5-naphthalenediylbis(2-methyl)- | N(C(=O)N1CC1C)c2cccc3c2cccc3NC(=O)N4CC4C |
Methanone, 1,8-naphthalenediylbis(phenyl- | C(=O)(c1ccccc1)c2cccc3cccc(C(=O)c4ccccc4)c23 |
Methanone__1_8-naphthalenediylbis(phenyl- | C(=O)(c1ccccc1)c2cccc3cccc(C(=O)c4ccccc4)c23 |
Urea, N,N''-1,5-naphthalenediylbis(N', N'-dimethyl- | N(C(=O)N(C)C)c1cccc2c1cccc2NC(=O)N(C)C |
Urea__N_N''-1_5-naphthalenediylbis(N'__N'-dimethyl- | N(C(=O)N(C)C)c1cccc2c1cccc2NC(=O)N(C)C |