If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Chlorosulfonyl-5-(dimethylamino)naphthalene | S(Cl)(=O)(=O)c1cccc2c1cccc2N(C)C |
2-Chloro-5-(chlorosulfonyl)benzoic acid | C(=O)(O)c1cc(ccc1Cl)S(Cl)(=O)=O |
3-(Chlorosulfonyl)benzoic acid | S(Cl)(=O)(=O)c1cccc(c1)C(=O)O |
4'-(Chlorosulfonyl)acetanilide | S(Cl)(=O)(=O)c1ccc(cc1)NC(C)=O |
8-Chlorosulfonyl-1-benzazine | S(Cl)(=O)(=O)c1cccc2cccnc12 |
Benzenesulfonyl fluoride, 3-(chlorosulfonyl)- | S(Cl)(=O)(=O)c1cccc(c1)S(F)(=O)=O |
Benzoic acid, 2-chloro-5-(chlorosulfonyl)- | C(=O)(O)c1cc(ccc1Cl)S(Cl)(=O)=O |
Benzoic acid, 3-(chlorosulfonyl)- | S(Cl)(=O)(=O)c1cccc(c1)C(=O)O |
Benzoic acid, 4-(chlorosulfonyl)- | S(Cl)(=O)(=O)c1ccc(cc1)C(=O)O |
Benzoic acid, m-(chlorosulfonyl)- | S(Cl)(=O)(=O)c1cccc(c1)C(=O)O |
Benzoic acid, p-(chlorosulfonyl)- | S(Cl)(=O)(=O)c1ccc(cc1)C(=O)O |
Benzoic_acid__2-chloro-5-(chlorosulfonyl)- | C(=O)(O)c1cc(ccc1Cl)S(Cl)(=O)=O |
Benzoic_acid__m-(chlorosulfonyl)- | S(Cl)(=O)(=O)c1cccc(c1)C(=O)O |