If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
3-Bromo-4-methyl-carbostyril | Cc1c(Br)c(O)nc2ccccc12 |
Carbostyril (VAN8CI) | Oc1ccc2ccccc2n1 |
Carbostyril 165 | Cc1cc(O)nc2cc(ccc12)N(C)C |
Carbostyril, 1,3-dimethyl-4-ethyl- | C(C)C1=C(C)C(=O)N(C)c2ccccc12 |
Carbostyril, 1-hydroxy- | ON1C(=O)C=Cc2ccccc12 |
Carbostyril, 1-methyl- | CN1C(=O)C=Cc2ccccc12 |
Carbostyril, 3,4-dihydro- (VAN8CI) | O=C1CCc2ccccc2N1 |
Carbostyril, 3,4-dimethyl- (VAN) | Cc1c(C)c(O)nc2ccccc12 |
Carbostyril, 3-bromo-4-methyl- | Cc1c(Br)c(O)nc2ccccc12 |
Carbostyril, 4-ethyl-1, 3-dimethyl- | C(C)C1=C(C)C(=O)N(C)c2ccccc12 |
Carbostyril, 4-hydroxy- | Oc1cc(O)nc2ccccc12 |
Carbostyril, 4-hydroxy-, monosodium salt | Oc1cc(O)nc2ccccc12 |
Carbostyril, 4-hydroxy-1,3-dimethyl- | OC1=C(C)C(=O)N(C)c2ccccc12 |
Carbostyril, 4-hydroxy-1-methyl- | CN1C(=O)C=C(O)c2ccccc12 |
Carbostyril, 4-methyl- (VAN8CI) | Cc1cc(O)nc2ccccc12 |
Carbostyril, 7-(dimethylamino)-4-methyl- | Cc1cc(O)nc2cc(ccc12)N(C)C |
Carbostyril, 7-chloro-4-methyl- | Cc1cc(O)nc2cc(Cl)ccc12 |
Carbostyril, 8-hydroxy- | Oc1cccc2ccc(O)nc12 |
Carbostyril, thio- (VAN8CI) | Sc1ccc2ccccc2n1 |
Carbostyril__3_4-dihydro-_(VAN8CI) | O=C1CCc2ccccc2N1 |
Carbostyril__4-hydroxy-__monosodium_salt | Oc1cc(O)nc2ccccc12 |
Carbostyril__4-methyl-_(VAN8CI) | Cc1cc(O)nc2ccccc12 |
Carbostyril__7-chloro-4-methyl- | Cc1cc(O)nc2cc(Cl)ccc12 |
Carbostyril__thio-_(VAN8CI) | Sc1ccc2ccccc2n1 |