If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1-Methyl-6-(1-methylallyl)-2,5-dithiobiurea | N(C(C)C=C)C(=S)NNC(=S)NC |
1-Methyl-6-(1-methylallyl)dithiobiurea | N(C(C)C=C)C(=S)NNC(=S)NC |
1-Methylallyl chloride | C(C)(Cl)C=C |
17ALPHA_-(2-Methylallyl)-19-nortestosterone | CC12CCC3C4CCC(=O)C=C4CCC3C1CCC2(O)CC(C)=C |
2-Methylallyl alcohol | C(C)(=C)CO |
2-Methylallyl chloride | C(C)(=C)CCl |
2-Methylallyl phenyl ether | O(CC(C)=C)c1ccccc1 |
3-Methylallyl alcohol | C(=CC)CO |
6-Amino-3-methyl-1-(2-methylallyl)-2,4(1H,3H)-pyrimidinedione | C(C(C)=C)N1C(N)=CC(=O)N(C)C1=O |
6-Amino-3-methyl-1-(2-methylallyl)uracil | C(C(C)=C)N1C(N)=CC(=O)N(C)C1=O |
ALPHA_-Ethyl-GAMMA_-methylallyl alcohol | C(O)(CC)C=CC |
ALPHA_-Ethyl-GAMMA_-methylallyl_alcohol | C(O)(CC)C=CC |
ALPHA_-Methylallyl chloride | C(C)(Cl)C=C |
BETA_-Methylallyl chloride | C(C)(=C)CCl |
Barbituric acid, 5-(2-methylallyl)-5-propyl-2-thio- | C(C(C)=C)C1(CCC)C(=O)NC(=S)NC1=O |
Barbituric acid, 5-ethyl-5-(2-methylallyl)-2-thio- | C(C(C)=C)C1(CC)C(=O)NC(=S)NC1=O |
Biurea, 1-methyl-6-(1-methylallyl)-2, 5-dithio- | N(C(C)C=C)C(=S)NNC(=S)NC |
Butyric acid, 2-methylallyl ester | C(=O)(CCC)OCC(C)=C |
Carbamic acid, 2-methylallyl ester | C(OC(N)=O)C(C)=C |
Estr-4-en-3-one, 17BETA_-hydroxy-17-(2-methylallyl)- | CC12CCC3C4CCC(=O)C=C4CCC3C1CCC2(O)CC(C)=C |
Ether, 2-methylallyl phenyl | O(CC(C)=C)c1ccccc1 |
Isobutyraldehyde, bis(2-methylallyl)acetal | C(OCC(C)=C)(OCC(C)=C)C(C)C |
Methylallyl chloride | C(C)(=C)CCl |
N-((1-Methylallyl)thiocarbamoyl)-N'-(methylthiocarbamoyl)hydrazine | N(C(C)C=C)C(=S)NNC(=S)NC |
Uracil, 6-amino-3-methyl-1-(2-methylallyl)- | C(C(C)=C)N1C(N)=CC(=O)N(C)C1=O |