If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(E)-1,1'-(1, 2-Diethyl-1,2-ethene-diyl)bis(4-methoxybenzene) | C(CC)(c1ccc(OC)cc1)=C(CC)c2ccc(OC)cc2 |
(E)-1_1'-(1__2-Diethyl-1_2-ethene-diyl)bis(4-methoxybenzene) | C(CC)(c1ccc(OC)cc1)=C(CC)c2ccc(OC)cc2 |
1, 1-Bis((p-dimethylamino)phenyl)ethene | C(=C)(c1ccc(cc1)N(C)C)c2ccc(cc2)N(C)C |
1, 1-Bis(p-chlorophenyl)ethene | C(=C)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
1, 1-Dichloro-2-(o-chlorophenyl)-2-(p-chlorophenyl)ethene | C(=C(Cl)Cl)(c1ccc(Cl)cc1)c2ccccc2Cl |
1,1-Dichloro-2, 2-bis(4-methoxyphenyl) ethene | C(=C(Cl)Cl)(c1ccc(OC)cc1)c2ccc(OC)cc2 |
1,1-Dichloro-2, 2-bis(p-chlorophenyl)ethene | C(=C(Cl)Cl)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
2, 5-Furandione, polymer with 1,1'-oxybis(ethene) (MF2) | O=C1C=CC(=O)O1.C=COC=C |
2, 5-Furandione, polymer with 1,1'-oxybis(ethene) | O=C1C=CC(=O)O1.C=COC=C |
2,5-Furandione, polymer with 1,1'-oxybis(ethene) | O=C1C=CC(=O)O1.C=COC=C |
2_5-Furandione__polymer_with_1_1'-oxybis(ethene) | O=C1C=CC(=O)O1.C=COC=C |
2__5-Furandione__polymer_with_1_1'-oxybis(ethene) | O=C1C=CC(=O)O1.C=COC=C |
2__5-Furandione__polymer_with_1_1'-oxybis(ethene)_(MF2) | O=C1C=CC(=O)O1.C=COC=C |
Ethene, (2-chloroethoxy)- | C(CCl)OC=C |
Ethene, (2-methoxyethoxy)- | C(COC)OC=C |
Ethene, (ethylthio)- | S(CC)C=C |
Ethene, (methylsulfonyl)- | S(C)(=O)(=O)C=C |
Ethene, 1, 2-dichloro-, (E)- | C(Cl)=CCl |
Ethene, 1,1'-(1, 2-ethanediylbis(oxy))bis- | C(OC=C)COC=C |
Ethene, 1,1'-(oxybis(2,1-ethanediyloxy))bis- | O(CCOC=C)CCOC=C |
Ethene, 1,1'-sulfonylbis- | S(=O)(=O)(C=C)C=C |
Ethene, 1,2-bis(ethylsulfonyl)- | S(=O)(=O)(CC)C=CS(=O)(=O)CC |
Ethene, 1,2-dibromo- | C(Br)=CBr |
Ethene, 1,2-dichloro-, (Z)- | C(Cl)=CCl |
Ethene, chlorohydrin | C(Cl)CO |
Ethene, ethoxy | O(CC)C=C |
Ethene, ethoxy- | O(CC)C=C |
Ethene, methoxy-, homopolymer | C(=C)OC |
Ethene, methoxy-, polymer with (Z)-2-butenedioic acid | C(=CC(=O)O)C(=O)O.C=COC |
Ethene, methoxy-, polymer with 2,5-furandione | O=C1C=CC(=O)O1.C=COC |
Ethene, tetrabromo- | C(Br)(Br)=C(Br)Br |
Ethene, tetrachloro- | C(Cl)(Cl)=C(Cl)Cl |
Ethene, tetracyano- | C(C#N)(C#N)=C(C#N)C#N |
Ethene, tetraiodo- | C(I)(I)=C(I)I |
Ethene, tribromo- | C(Br)(Br)=CBr |
Ethene__(methylsulfonyl)- | S(C)(=O)(=O)C=C |
Ethene__1_1'-(1__2-ethanediylbis(oxy))bis- | C(OC=C)COC=C |
Ethene__1_1'-(oxybis(2_1-ethanediyloxy))bis- | O(CCOC=C)CCOC=C |
Ethene__1_1'-sulfonylbis- | S(=O)(=O)(C=C)C=C |
Ethene__methoxy-__polymer_with_(Z)-2-butenedioic_acid | C(=CC(=O)O)C(=O)O.C=COC |
trans-1, 2-Bis(propylsulfonyl)ethene | S(=O)(=O)(CCC)C=CS(=O)(=O)CCC |