If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Indanone | O=C1CCc2ccccc12 |
1-Indanone, 2-diazo- | O=C1C(=N=N)Cc2ccccc12 |
1-Indanone, 3,3-dimethyl- | CC1(C)CC(=O)c2ccccc12 |
1-Indanone, 3-methyl- | CC1CC(=O)c2ccccc12 |
1-Indanone, 3-phenyl- | O=C1CC(c2ccccc2)c3ccccc13 |
1-Indanone, 4,7-dimethyl- | Cc1ccc(C)c2C(=O)CCc12 |
2,3-Diphenyl-1-indanone | O=C1c2ccccc2C(c3ccccc3)=C1c4ccccc4 |
2-(1-Indanylidene)-1-indanone | O=C1c2ccccc2CC1=C3CCc4ccccc34 |
2-(4-(Dimethylamino)benzylidene)-1-indanone | O=C1C(=Cc2ccc(cc2)N(C)C)Cc3ccccc13 |
2-(Aminomethylene)-1-indanone | O=C1C(=CN)Cc2ccccc12 |
2-Indanone oxime | N(O)=C1Cc2ccccc2C1 |
2-Indanone, oxime | N(O)=C1Cc2ccccc2C1 |
3,3-Dimethyl-1-indanone | CC1(C)CC(=O)c2ccccc12 |
3-Methyl-1-indanone | CC1CC(=O)c2ccccc12 |
3-Phenyl-1-indanone | O=C1CC(c2ccccc2)c3ccccc13 |
4,7-Dimethyl-1-indanone | Cc1ccc(C)c2C(=O)CCc12 |
4-Chloro-7-methyl-1-indanone | Clc1ccc(C)c2C(=O)CCc12 |
7-Chloro-4-methyl-1-indanone | Cc1ccc(Cl)c2C(=O)CCc12 |
ALPHA_-Indanone | O=C1CCc2ccccc12 |
Indanone (VAN) | O=C1CCc2ccccc12 |