If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Phenylphenacyl bromide | C(=O)(CBr)c1ccc(cc1)c2ccccc2 |
Benzoic acid, p-((ALPHA_-ethoxy-p-phenylphenacyl)amino)- | C(=O)(c1ccc(cc1)c2ccccc2)C(OCC)Nc3ccc(cc3)C(=O)O |
p-((ALPHA_-Ethoxy-p-phenylphenacyl)amino)benzoic acid | C(=O)(c1ccc(cc1)c2ccccc2)C(OCC)Nc3ccc(cc3)C(=O)O |
p-Phenylphenacyl benzoate | C(=O)(COC(=O)c1ccccc1)c2ccc(cc2)c3ccccc3 |
p-Phenylphenacyl bromide | C(=O)(CBr)c1ccc(cc1)c2ccccc2 |
p-Phenylphenacyl chloride | C(=O)(CCl)c1ccc(cc1)c2ccccc2 |