If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Naphthyl chloroformate | O(C(Cl)=O)c1cccc2ccccc12 |
2,2, 2-Trichloroethyl chloroformate | C(OC(Cl)=O)C(Cl)(Cl)Cl |
2-Methylpropyl chloroformate | C(OC(Cl)=O)C(C)C |
ALPHA_-Naphthyl chloroformate | O(C(Cl)=O)c1cccc2ccccc12 |
Adamantyl chloroformate | C(Cl)(=O)C12CC3CC(C1)CC(C2)C3 |
Amyl chloroformate | C(CCCC)OC(Cl)=O |
Benzyl chloroformate | C(OC(Cl)=O)c1ccccc1 |
Butyl chloroformate | O(CCCC)C(Cl)=O |
Cetyl chloroformate | C(CCCCCCCCCCC)CCCCOC(Cl)=O |
Cholesterol chloroformate | CC12CCC(OC(Cl)=O)CC2=CCC3C1CCC4(C)C(CCC34)C(C)CCCC(C)C |
Cholesterol, chloroformate | CC12CCC(OC(Cl)=O)CC2=CCC3C1CCC4(C)C(CCC34)C(C)CCCC(C)C |
Cholesteryl chloroformate | CC12CCC(OC(Cl)=O)CC2=CCC3C1CCC4(C)C(CCC34)C(C)CCCC(C)C |
Diethylene glycol bis(chloroformate) | C(COCCOC(Cl)=O)OC(Cl)=O |
Diethylene glycol chloroformate | C(COCCOC(Cl)=O)OC(Cl)=O |
Hexadecyl chloroformate | C(CCCCCCCCCCC)CCCCOC(Cl)=O |
Isobutyl chloroformate | C(OC(Cl)=O)C(C)C |
Oxydiethylene bis(chloroformate) | C(COCCOC(Cl)=O)OC(Cl)=O |
Oxydiethylene chloroformate | C(COCCOC(Cl)=O)OC(Cl)=O |
Pentyl chloroformate | C(CCCC)OC(Cl)=O |
Phenyl chloroformate | O(C(Cl)=O)c1ccccc1 |
Trichloroethyl chloroformate | C(OC(Cl)=O)C(Cl)(Cl)Cl |