If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Aldehyde C-12, lauric | C(CCCCCC)CCCCC=O |
Aldehyde_C-12__lauric | C(CCCCCC)CCCCC=O |
C-12 Aldehyde, lauric | C(CCCCCC)CCCCC=O |
Diethylene glycol lauric acid monoester | C(=O)(OCCOCCO)CCCCCCCCCCC |
LAURIC ACID | C(CCCCCCCC)CCC(=O)O |
LAURIC ALDEHYDE | C(CCCCCC)CCCCC=O |
Lauric 3-dimethylaminopropylamide | C(=O)(CCCCCCCCCCC)NCCCN(C)C |
Lauric acid glycidyl ester | C(OC(=O)CCCCCCCCCCC)C1CO1 |
Lauric acid hydrazide | C(CCCCCCCC)CCC(=O)NN |
Lauric acid monoglyceride | C(CCCCCCCC)CCC(=O)O.OCC(O)CO |
Lauric acid nitrile | C(CCCCCC)CCCCC#N |
Lauric acid triglyceride | C(COC(=O)CCCCCCCCCCC)(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC |
Lauric acid triglycerin ester | C(COC(=O)CCCCCCCCCCC)(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC |
Lauric acid | C(CCCCCCCC)CCC(=O)O |
Lauric acid, 2,3-epoxypropyl ester | C(OC(=O)CCCCCCCCCCC)C1CO1 |
Lauric acid, 2-(2-hydroxyethoxy)ethyl ester | C(=O)(OCCOCCO)CCCCCCCCCCC |
Lauric acid, 2-(p-tert-pentylphenoxy)ethyl ester | O(CCOC(=O)CCCCCCCCCCC)c1ccc(cc1)C(C)(C)CC |
Lauric acid, 2-butoxyethyl ester | C(CCCCCCCCCC)C(=O)OCCOCCCC |
Lauric acid, 2-ethoxyethyl ester | C(=O)(OCCOCC)CCCCCCCCCCC |
Lauric acid, 2-naphthyl ester | O(C(=O)CCCCCCCCCCC)c1ccc2ccccc2c1 |
Lauric acid, 2-thiocyanatoethyl ester | C(=O)(OCCSC#N)CCCCCCCCCCC |
Lauric acid, 3-hydroxypropyl ester | C(=O)(OCCCO)CCCCCCCCCCC |
Lauric acid, benzyl ester | C(OC(=O)CCCCCCCCCCC)c1ccccc1 |
Lauric acid, butyl ester | C(=O)(OCCCC)CCCCCCCCCCC |
Lauric acid, dibutylstannylene deriv. | [Sn](CCCC)(CCCC)(OC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC |
Lauric acid, dibutylstannylene salt | [Sn](CCCC)(CCCC)(OC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC |
Lauric acid, dibutyltin deriv. | [Sn](CCCC)(CCCC)(OC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC |
Lauric acid, dodecyl ester | C(=O)(CCCCCCCCCCC)OCCCCCCCCCCCC |
Lauric acid, ester with nonaethylene glycol | C(=O)(CCCCCCCCCCC)OCCOCCOCCOCCOCCOCCOCCOCCOCCO |
Lauric acid, ethyl ester | C(=O)(OCC)CCCCCCCCCCC |
Lauric acid, ethylene ester | C(=O)(CCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCC |
Lauric acid, hydrazide | C(CCCCCCCC)CCC(=O)NN |
Lauric acid, isopentyl ester | C(=O)(CCCCCCCCCCC)OCCC(C)C |
Lauric acid, methyl ester | C(CCCCCCCC)CCC(=O)OC |
Lauric acid, p-hydroxyphenyl ester | O(C(=O)CCCCCCCCCCC)c1ccc(O)cc1 |
Lauric acid, pentyl ester | C(=O)(OCCCCC)CCCCCCCCCCC |
Lauric acid, tert-butyl ester | C(=O)(CCCCCCCCCCC)OC(C)(C)C |
Lauric acid, vinyl ester | C(=O)(OC=C)CCCCCCCCCCC |
Lauric alcohol | C(CCCCCC)CCCCCO |
Lauric aldehyde | C(CCCCCC)CCCCC=O |
Lauric amide | C(CCCCCCCC)CCC(N)=O |
Lauric nitrile | C(CCCCCC)CCCCC#N |
Lauric_acid__p-hydroxyphenyl_ester | O(C(=O)CCCCCCCCCCC)c1ccc(O)cc1 |
Lauric_acid_nitrile | C(CCCCCC)CCCCC#N |