If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Nitroso-2-nitroamino-2-imidazoline | N(N(O)O)C1=NCCN1N=O |
Acetic acid, (amino(nitroamino)methylene)hydrazide | C(=N)(NNC(C)=O)NN(O)O |
Acetic_acid__(amino(nitroamino)methylene)hydrazide | C(=N)(NNC(C)=O)NN(O)O |
Hydrazinecarboxamide, 2-(imino(nitroamino)methyl)- | C(=N)(NNC(N)=O)NN(O)O |
Hydrazinecarboxamide__2-(imino(nitroamino)methyl)- | C(=N)(NNC(N)=O)NN(O)O |
L-Ornithine, N5-(imino(nitroamino)methyl)- | N(CCCC(N)C(=O)O)C(=N)NN(O)O |
L-Ornithine__N5-(imino(nitroamino)methyl)- | N(CCCC(N)C(=O)O)C(=N)NN(O)O |