If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Bornyl 3-methylbutyrate | CC12CCC(CC1OC(=O)CC(C)C)C2(C)C |
2-Methylpropyl 3-methylbutyrate | C(=O)(OCC(C)C)CC(C)C |
3-Methylbutyl 3-methylbutyrate | C(=O)(OCCC(C)C)CC(C)C |
3-Methylbutyrate | C(C(C)C)C(=O)O |
Benzyl 3-methylbutyrate | C(OC(=O)CC(C)C)c1ccccc1 |
Butyl 3-methylbutyrate | O(CCCC)C(=O)CC(C)C |
Ethyl 2-bromo-3-methylbutyrate | C(Br)(C(C)C)C(=O)OCC |
Ethyl 2-methylbutyrate | C(=O)(OCC)C(C)CC |
Ethyl 3-methylbutyrate | C(C(C)C)C(=O)OCC |
Ethyl ALPHA_-methylbutyrate | C(=O)(OCC)C(C)CC |
Isopentyl 3-methylbutyrate | C(=O)(OCCC(C)C)CC(C)C |
Pentyl 3-methylbutyrate | O(CCCCC)C(=O)CC(C)C |