If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1-Anilino-9,10-dihydro-9, 10-dioxo-2-anthroic acid | N(c1ccccc1)c2c(ccc3C(=O)c4ccccc4C(=O)c23)C(=O)O |
1-Anthroic acid, 9,10-dihydro-9,10-dioxo- | O=C1c2ccccc2C(=O)c3cccc(C(=O)O)c13 |
2-Anthroic acid | C(=O)(O)c1ccc2cc3ccccc3cc2c1 |
2-Anthroic acid, 1-amino-4-bromo-9,10-dihydro-9, 10-dioxo- | O=C1c2ccccc2C(=O)c3c(Br)cc(C(=O)O)c(N)c13 |
2-Anthroic acid, 1-amino-9,10-dihydro-9,10-dioxo- | O=C1c2ccccc2C(=O)c3ccc(C(=O)O)c(N)c13 |
2-Anthroic acid, 1-anilino-9,10-dihydro-9,10-dioxo- | N(c1ccccc1)c2c(ccc3C(=O)c4ccccc4C(=O)c23)C(=O)O |
2-Anthroic acid, 1-chloro-9,10-dihydro-9,10-dioxo- | O=C1c2ccccc2C(=O)c3ccc(C(=O)O)c(Cl)c13 |
2-Anthroic acid, 3-hydroxy- | C(=O)(O)c1cc2cc3ccccc3cc2cc1O |
2-Anthroic acid, 9,10-dihydro-1-nitro-9,10-dioxo- | [N+](=O)([O-])c1c(ccc2C(=O)c3ccccc3C(=O)c12)C(=O)O |
2-Anthroic acid, 9,10-dihydro-4,5-dihydroxy-9, 10-dioxo- | O=C1c2c(O)cccc2C(=O)c3cc(cc(O)c13)C(=O)O |
2-Anthroic acid, 9,10-dihydro-9, 10-dioxo- | O=C1c2ccccc2C(=O)c3ccc(cc13)C(=O)O |
9, 10-Dihydro-1-nitro-9,10-dioxo-2-anthroic acid | [N+](=O)([O-])c1c(ccc2C(=O)c3ccccc3C(=O)c12)C(=O)O |
9-Anthroic acid | C(=O)(O)c1c2ccccc2cc3ccccc13 |
9-Anthroic acid, methyl ester | C(=O)(OC)c1c2ccccc2cc3ccccc13 |