If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(-)-Argemonine | CN1C2Cc3cc(OC)c(OC)cc3C1Cc4cc(OC)c(OC)cc24 |
ARGEMONINE (PROTOPINE | CN1CCc2cc3OCOc3cc2C(=O)Cc4ccc5OCOc5c4C1 |
ARGEMONINE | CN1CCc2cc3OCOc3cc2C(=O)Cc4ccc5OCOc5c4C1 |
Argemonine, (+)- | CN1C2Cc3cc(OC)c(OC)cc3C1Cc4cc(OC)c(OC)cc24 |
Argemonine, (-)- | CN1C2Cc3cc(OC)c(OC)cc3C1Cc4cc(OC)c(OC)cc24 |
Argemonine, (.+-.) | CN1C2Cc3cc(OC)c(OC)cc3C1Cc4cc(OC)c(OC)cc24 |
Argemonine, (.+-.)- | CN1C2Cc3cc(OC)c(OC)cc3C1Cc4cc(OC)c(OC)cc24 |
Argemonine, O2,O9-didemethyl- | CN1C2Cc3cc(O)c(OC)cc3C1Cc4cc(OC)c(O)cc24 |
Argemonine, O2-demethyl- | CN1C2Cc3cc(OC)c(OC)cc3C1Cc4cc(OC)c(O)cc24 |
Argemonine__(+)- | CN1C2Cc3cc(OC)c(OC)cc3C1Cc4cc(OC)c(OC)cc24 |
Argemonine__(.+-.)- | CN1C2Cc3cc(OC)c(OC)cc3C1Cc4cc(OC)c(OC)cc24 |
Argemonine__O2-demethyl- | CN1C2Cc3cc(OC)c(OC)cc3C1Cc4cc(OC)c(O)cc24 |
Argemonine__O2_O9-didemethyl- | CN1C2Cc3cc(O)c(OC)cc3C1Cc4cc(OC)c(O)cc24 |