If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Aizen Cathilon Grey BLH | N(CC)(CC)c1ccc2nc3ccc(N=Nc4ccc(O)cc4)cc3n(c5ccccc5)c2c1 |
Aizen Cathilon Orange RH | C(=CC1=N(C)c2ccccc2C1(C)C)C3=C(N(C)c4ccccc34)c5ccccc5 |
Aizen Cathilon Orange RL | C(=CC1=N(C)c2ccccc2C1(C)C)C3=C(N(C)c4ccccc34)c5ccccc5 |
Aizen Cathilon Pink FG | CC1(C)C(C=Cc2ccc(cc2)N(C)CCCl)=N(C)c3ccccc13 |
Aizen Cathilon Pink FGH | CC1(C)C(C=Cc2ccc(cc2)N(C)CCCl)=N(C)c3ccccc13 |
Aizen Cathilon Red 6B | CC1(C)C(C=Cc2ccc(cc2C)N(CC)CCCl)=N(C)c3ccccc13 |
Aizen Cathilon Red 6BH | CC1(C)C(C=Cc2ccc(cc2C)N(CC)CCCl)=N(C)c3ccccc13 |
Aizen Cathilon Yellow 3GH | CC1(C)C(C=CNc2ccc(OC)cc2OC)=N(C)c3ccccc13 |
Aizen Cathilon Yellow 3GL | CC1(C)C(C=CNc2ccc(OC)cc2OC)=N(C)c3ccccc13 |
Aizen Cathilon Yellow 3GLH | CC1(C)C(C=CNc2ccc(OC)cc2OC)=N(C)c3ccccc13 |
Cathilon Pink FGH | CC1(C)C(C=Cc2ccc(cc2)N(C)CCCl)=N(C)c3ccccc13 |