If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Acetate Turquoise Blue B | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Acilan Turquoise Blue AE | C(c1ccc(cc1)N(CC)Cc2cccc(c2)S(=O)(=O)O)(=C3C=CC(C=C3)=N(CC)Cc4cccc(c4)S(=O)(=O)O)c5ccccc5S(=O)(=O)O |
Alizarine Turquoise B | N(c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12)c4ccc(C)cc4S(=O)(=O)O |
Alizarine Turquoise Blue B | N(c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12)c4ccc(C)cc4S(=O)(=O)O |
Cibacet Turquoise Blue 2G | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Cibacet Turquoise Blue 4G | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Cibacet Turquoise Blue G | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Fenacet Fast Turquoise B | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Indanthren Turquoise Blue 3GK | O=C1c2ccccc2C(=O)c3c(N)cc4C(=O)c5cc(Cl)cc(Cl)c5Nc4c13 |
Methylene Turquoise JSA Extra | C(c1ccc(cc1)N(C)C)(=C2C=CC(C=C2)=N(C)C)c3ccccc3Cl |
Miketon Fast Turquoise Blue G | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Palanthrene Turquoise Blue 3GK | O=C1c2ccccc2C(=O)c3c(N)cc4C(=O)c5cc(Cl)cc(Cl)c5Nc4c13 |
Setacyl Turquoise Blue 2G | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Setacyl Turquoise Blue 4G | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Setacyl Turquoise Blue G | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Setacyl Turquoise Blue GD | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Terasil Turquoise Blue G | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |