If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Diacelliton Fast Blue Green B | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Diacelliton Fast Blue R | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Diacelliton Fast Brilliant Blue B | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Diacelliton Fast Brilliant Blue BF | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Diacelliton Fast Pink B | O=C1c2ccccc2C(=O)c3c(O)ccc(N)c13 |
Diacelliton Fast Pink R | O=C1c2ccccc2C(=O)c3cccc(NC)c13 |
Diacelliton Fast Violet 5R | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Diacelliton Fast Violet B | O=C1c2c(N)ccc(N)c2C(=O)c3cccc([N+](=O)[O-])c13 |
Diacelliton Fast Yellow YLP | N(c1ccccc1)c2ccc(cc2[N+](=O)[O-])S(=O)(=O)Nc3ccccc3 |
Diacelliton Scarlet B | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Diacelliton fast grey G | O(C)c1cc(ccc1N)c2ccc(N)c(OC)c2 |