If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(2,4,6-Trichlorophenyl)-3-(4-nitroanilino)-2-pyrazolin-5-one | Clc1cc(Cl)cc(Cl)c1N2N=C(CC2=O)Nc3ccc(cc3)[N+](=O)[O-] |
1-(2,4,6-Trichlorophenyl)-3-p-nitroanilino-2-pyrazolin-5-one | Clc1cc(Cl)cc(Cl)c1N2N=C(CC2=O)Nc3ccc(cc3)[N+](=O)[O-] |
2-Pyrazolin-5-one, 3-(p-nitroanilino)-1-(2,4,6-trichlorophenyl)- | Clc1cc(Cl)cc(Cl)c1N2N=C(CC2=O)Nc3ccc(cc3)[N+](=O)[O-] |
Ethanol, 2-(o-nitroanilino)- | N(CCO)c1ccccc1[N+](=O)[O-] |