If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Methyl glutaraldehyde | C(C)(CC=O)CC=O |
Glutaraldehyde bis(sodium bisulfite) | C(O)(CCCC(O)S(=O)(=O)O)S(=O)(=O)O |
Glutaraldehyde bisulfite | C(O)(CCCC(O)S(=O)(=O)O)S(=O)(=O)O |
Glutaraldehyde | C(CC=O)CC=O |
Glutaraldehyde, 3-methyl- | C(C)(CC=O)CC=O |
Glutaraldehyde, bis(4-methyl-3-thiosemicarbazone) | C(=S)(NC)NN=CCCCC=NNC(=S)NC |
Glutaraldehyde, bis(dimethyl acetal) | C(OC)(OC)CCCC(OC)OC |
Glutaraldehyde-sodium bisulfite | C(O)(CCCC(O)S(=O)(=O)O)S(=O)(=O)O |
Glutaraldehyde__3-methyl- | C(C)(CC=O)CC=O |
Glutaraldehyde__bis(4-methyl-3-thiosemicarbazone) | C(=S)(NC)NN=CCCCC=NNC(=S)NC |
Glutaraldehyde__bis(dimethyl_acetal) | C(OC)(OC)CCCC(OC)OC |