If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(4-(4-Sulfanilyl)phenyl)urea | S(=O)(=O)(c1ccc(N)cc1)c2ccc(cc2)NC(N)=O |
1-Sulfanilyl-2-thiourea | S(=O)(=O)(NC(N)=S)c1ccc(N)cc1 |
4-(N-Sulfanilyl)phenylurea | S(=O)(=O)(c1ccc(N)cc1)c2ccc(cc2)NC(N)=O |
Acetamide, N-sulfanilyl- | S(=O)(=O)(NC(C)=O)c1ccc(N)cc1 |
Benzamide, N-sulfanilyl- | S(=O)(=O)(NC(=O)c1ccccc1)c2ccc(N)cc2 |
Benzamide, p-isopropoxy-N-sulfanilyl- | S(=O)(=O)(NC(=O)c1ccc(cc1)OC(C)C)c2ccc(N)cc2 |
Guanidine, sulfanilyl- | S(=O)(=O)(NC(=N)N)c1ccc(N)cc1 |
N-Sulfanilyl-N'-butylurea | S(=O)(=O)(NC(=O)NCCCC)c1ccc(N)cc1 |
N-Sulfanilyl-l-ethylcytosine | S(=O)(=O)(NC1=NC(=O)N(CC)C=C1)c2ccc(N)cc2 |
Sulfanilyl chloride, N-acetyl- | S(Cl)(=O)(=O)c1ccc(cc1)NC(C)=O |
Sulfanilyl fluoride | S(F)(=O)(=O)c1ccc(N)cc1 |
Sulfanilyl fluoride, N-acetyl- | S(F)(=O)(=O)c1ccc(cc1)NC(C)=O |
Thiazole, 2-amino-5-sulfanilyl- | S(=O)(=O)(c1ccc(N)cc1)C2=CNC(=N)S2 |
Urea, 1-butyl-3-sulfanilyl- | S(=O)(=O)(NC(=O)NCCCC)c1ccc(N)cc1 |
Urea, 1-sulfanilyl-2-thio- | S(=O)(=O)(NC(N)=S)c1ccc(N)cc1 |
Urea, sulfanilyl- | S(=O)(=O)(NC(N)=O)c1ccc(N)cc1 |
n(sup 1)-Sulfanilyl-n(sup 2)-butylcarbamide | S(=O)(=O)(NC(=O)NCCCC)c1ccc(N)cc1 |
n(sup 1)-Sulfanilyl-n(sup 2)-butylurea | S(=O)(=O)(NC(=O)NCCCC)c1ccc(N)cc1 |
p-Sulfanilyl fluoride | S(F)(=O)(=O)c1ccc(N)cc1 |