If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Butyn-3-ol | C(C)(O)C#C |
1-Butyn-4-ol | C(C#C)CO |
2-Butyn-1-ol | C(#CC)CO |
2-Butyn-1-ol, 4-chloro-, m-chlorocarbanilate | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
2-Butyn-1-one, 1-phenyl- | C(=O)(C#CC)c1ccccc1 |
2-Butyn-1-one__1-phenyl- | C(=O)(C#CC)c1ccccc1 |
2-Methyl-3-butyn-2-ol | C(C)(C)(O)C#C |
3-Butyn-1-ol | C(C#C)CO |
3-Butyn-2-ol | C(C)(O)C#C |
3-Butyn-2-ol, 2-methyl- | C(C)(C)(O)C#C |
3-Butyn-2-ol, 2-methyl-, acetate | O(C(C)=O)C(C)(C)C#C |
3-Butyn-2-ol, 2-methyl-, phenylcarbamate | N(C(=O)OC(C)(C)C#C)c1ccccc1 |
3-Butyn-2-ol, 2-methyl-4-(6-methyl-3-pyridinyl)- | C(#CC(C)(C)O)c1ccc(C)nc1 |
3-Butyn-2-ol, 2-methyl-4-(6-methyl-3-pyridyl)- | C(#CC(C)(C)O)c1ccc(C)nc1 |
3-Butyn-2-ol, 2-phenyl- | C(C)(O)(C#C)c1ccccc1 |
3-Butyn-2-ol__2-methyl-4-(6-methyl-3-pyridinyl)- | C(#CC(C)(C)O)c1ccc(C)nc1 |
3-Butyn-2-ol__2-methyl-__acetate | O(C(C)=O)C(C)(C)C#C |
3-Methyl-1-butyn-3-ol | C(C)(C)(O)C#C |