If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Nitrophenyl galactoside | O(c1ccc(cc1)[N+](=O)[O-])C2OC(CO)C(O)C(O)C2O |
ALPHA_-Methyl-D-galactoside | C(O)C1OC(OC)C(O)C(O)C1O |
Methyl ALPHA_-D-galactoside | C(O)C1OC(OC)C(O)C(O)C1O |
Methyl BETA_-galactoside (VAN) | C(O)C1OC(OC)C(O)C(O)C1O |
Methyl galactoside | C(O)C1OC(OC)C(O)C(O)C1O |
Methyl-BETA_-galactoside | C(O)C1OC(OC)C(O)C(O)C1O |
o-Nitrophenyl BETA_-D-galactoside (VAN) | O(C1OC(CO)C(O)C(O)C1O)c2ccccc2[N+](=O)[O-] |
o-Nitrophenyl BETA_-galactoside | O(C1OC(CO)C(O)C(O)C1O)c2ccccc2[N+](=O)[O-] |
p-Nitrophenol galactoside | O(c1ccc(cc1)[N+](=O)[O-])C2OC(CO)C(O)C(O)C2O |
p-Nitrophenyl ALPHA_-D-galactoside | O(c1ccc(cc1)[N+](=O)[O-])C2OC(CO)C(O)C(O)C2O |
p-Nitrophenyl ALPHA_-galactoside | O(c1ccc(cc1)[N+](=O)[O-])C2OC(CO)C(O)C(O)C2O |
p-Nitrophenyl BETA_-D-galactoside (VAN) | O(c1ccc(cc1)[N+](=O)[O-])C2OC(CO)C(O)C(O)C2O |
p-Nitrophenyl-BETA_-galactoside | O(c1ccc(cc1)[N+](=O)[O-])C2OC(CO)C(O)C(O)C2O |