If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Nitro-p-anisic acid | [N+](=O)([O-])c1cc(ccc1OC)C(=O)O |
4-Anisic acid | C(=O)(O)c1ccc(OC)cc1 |
ANISIC ACID, PARA | C(=O)(O)c1ccc(OC)cc1 |
Anisic acid, pentyl ester | C(=O)(OCCCCC)c1ccc(OC)cc1 |
Anisic alcohol | C(O)c1ccc(OC)cc1 |
Anisic aldehyde | C(=O)c1ccc(OC)cc1 |
m-Anisic acid | C(=O)(O)c1cccc(OC)c1 |
m-Anisic acid, (1-naphthoyl)hydrazide | C(=O)(NNC(=O)c1cccc(OC)c1)c2cccc3ccccc23 |
m-Anisic acid, 2-amino- | C(=O)(O)c1cccc(OC)c1N |
m-Anisic acid, 2-hydroxy- | C(=O)(O)c1cccc(OC)c1O |
m-Anisic acid, 2-nitro- | [N+](=O)([O-])c1c(OC)cccc1C(=O)O |
m-Anisic acid, 4-hydroxy- | O(C)c1cc(ccc1O)C(=O)O |
m-Anisic acid, 4-hydroxy-, ethyl ester | C(=O)(OCC)c1ccc(O)c(OC)c1 |
m-Anisic acid, 6-hydroxy- | C(=O)(O)c1cc(OC)ccc1O |
m-Anisic acid, methyl ester | C(=O)(OC)c1cccc(OC)c1 |
o-Anisic acid | O(C)c1ccccc1C(=O)O |
o-Anisic acid, 5,6-diformyl-3-methyl- | C(=O)(O)c1c(OC)c(C)cc(C=O)c1C=O |
o-Anisic acid, 5-(fluorosulfonyl)- | C(=O)(O)c1cc(ccc1OC)S(F)(=O)=O |
o-Anisic acid, ALPHA_-carboxy- | O(CC(=O)O)c1ccccc1C(=O)O |
o-Anisic acid, hydrazide | C(=O)(NN)c1ccccc1OC |
o-Anisic acid, methyl ester | C(=O)(OC)c1ccccc1OC |
p-Anisic acid | C(=O)(O)c1ccc(OC)cc1 |
p-Anisic acid, 3-(bis(2-chloroethyl)amino)- | N(CCCl)(CCCl)c1cc(ccc1OC)C(=O)O |
p-Anisic acid, 3-nitro- | [N+](=O)([O-])c1cc(ccc1OC)C(=O)O |
p-Anisic acid, ethyl ester | C(=O)(OCC)c1ccc(OC)cc1 |
p-Anisic acid, hydrazide | C(=O)(NN)c1ccc(OC)cc1 |
p-Anisic acid, methyl ester | C(=O)(OC)c1ccc(OC)cc1 |
p-Anisic acid, methylenehydrazide | C(=O)(NN=C)c1ccc(OC)cc1 |
p-Anisic acid, propyl ester | C(=O)(OCCC)c1ccc(OC)cc1 |
p-Anisic aldehyde | C(=O)c1ccc(OC)cc1 |
p-Anisic anhydride | C(=O)(OC(=O)c1ccc(OC)cc1)c2ccc(OC)cc2 |
p-Anisic_anhydride | C(=O)(OC(=O)c1ccc(OC)cc1)c2ccc(OC)cc2 |