If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
D-(+)-Turanose (VAN) | O(C1OC(CO)C(O)C(O)C1O)C(C(=O)CO)C(O)C(O)CO |
D-Turanose | O(C1OC(CO)C(O)C(O)C1O)C(C(=O)CO)C(O)C(O)CO |
TURANOSE | O(C1OC(CO)C(O)C(O)C1O)C(C(=O)CO)C(O)C(O)CO |
Turanose (VAN8CI) | O(C1OC(CO)C(O)C(O)C1O)C(C(=O)CO)C(O)C(O)CO |
Turanose phenylosazone | O(C1OC(CO)C(O)C(O)C1O)C(C(O)CO)C(O)C(C=NNc2ccccc2)=NNc3ccccc3 |
Turanose | O(C1OC(CO)C(O)C(O)C1O)C2C(O)C(O)COC2(O)CO |