If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-Butenedioic acid (E)- | C(=CC(=O)O)C(=O)O |
2-Butenedioic acid (E)-, bis(1-methylethyl) ester | C(=O)(C=CC(=O)OC(C)C)OC(C)C |
2-Butenedioic acid (E)-, bis(2-methylpropyl) ester | C(=O)(OCC(C)C)C=CC(=O)OCC(C)C |
2-Butenedioic acid (E)-, bis(phenylmethyl) ester | C(OC(=O)C=CC(=O)OCc1ccccc1)c2ccccc2 |
2-Butenedioic acid (E)-, di-2-propenyl ester | C(=O)(OCC=C)C=CC(=O)OCC=C |
2-Butenedioic acid (E)-, dibutyl ester | C(=O)(OCCCC)C=CC(=O)OCCCC |
2-Butenedioic acid (E)-, diethyl ester | C(=O)(OCC)C=CC(=O)OCC |
2-Butenedioic acid (E)-, dihydrazide | C(=O)(NN)C=CC(=O)NN |
2-Butenedioic acid (E)-, dimethyl ester | C(=O)(OC)C=CC(=O)OC |
2-Butenedioic acid (E)-, monoethyl ester | C(=O)(OCC)C=CC(=O)O |
2-Butenedioic acid (E)-, monoethyl ester, manganese(2+) salt | C(=O)(OCC)C=CC(=O)O |
2-Butenedioic acid (E)-, monomethyl ester | C(=O)(OC)C=CC(=O)O |
2-Butenedioic acid (Z), monoethyl ester | C(=O)(OCC)C=CC(=O)O |
2-Butenedioic acid (Z)- | C(=CC(=O)O)C(=O)O |
2-Butenedioic acid (Z)-, bis(2-phenoxyethyl) ester | O(CCOC(=O)C=CC(=O)OCCOc1ccccc1)c2ccccc2 |
2-Butenedioic acid (Z)-, bis(cyclohexyl) ester | O(C(=O)C=CC(=O)OC1CCCCC1)C2CCCCC2 |
2-Butenedioic acid (Z)-, di-2-propenyl ester | C(=O)(OCC=C)C=CC(=O)OCC=C |
2-Butenedioic acid (Z)-, di-2-propynyl ester | C(=O)(OCC#C)C=CC(=O)OCC#C |
2-Butenedioic acid (Z)-, dibutyl ester | C(=O)(OCCCC)C=CC(=O)OCCCC |
2-Butenedioic acid (Z)-, dicyclohexyl ester | O(C(=O)C=CC(=O)OC1CCCCC1)C2CCCCC2 |
2-Butenedioic acid (Z)-, didodecyl ester | C(=O)(OCCCCCCCCCCCC)C=CC(=O)OCCCCCCCCCCCC |
2-Butenedioic acid (Z)-, diethyl ester | C(=O)(OCC)C=CC(=O)OCC |
2-Butenedioic acid (Z)-, dimethyl ester | C(=O)(OC)C=CC(=O)OC |
2-Butenedioic acid (Z)-, dipropyl ester | C(=O)(OCCC)C=CC(=O)OCCC |
2-Butenedioic acid (Z)-, mono(2,2-dimethylhydrazide) | C(=O)(C=CC(=O)O)NN(C)C |
2-Butenedioic acid (Z)-, monoethyl ester | C(=O)(OCC)C=CC(=O)O |
2-Butenedioic acid (Z)-, monomethyl ester | C(=O)(OC)C=CC(=O)O |
2-Butenedioic acid (Z)-, polymer with methoxyethene | C(=CC(=O)O)C(=O)O.C=COC |
2-Butenedioic acid, (E)- | C(=CC(=O)O)C(=O)O |
2-Butenedioic acid, (Z)- | C(=CC(=O)O)C(=O)O |
2-Butenedioic acid, 2, 3-dibromo-, (Z)- | C(Br)(C(=O)O)=C(Br)C(=O)O |
2-Butenedioic acid, 2,3-dihydroxy-, (E)- | C(O)(C(=O)O)=C(O)C(=O)O |
2-Butenedioic acid, 2,3-dihydroxy-, (Z)- | C(O)(C(=O)O)=C(O)C(=O)O |
2-Butenedioic acid, 2-bromo-3-methyl-, dimethyl ester, (Z)- | C(Br)(C(=O)OC)=C(C)C(=O)OC |
2-Butenedioic acid, 2-chloro-, (Z)- | C(Cl)(=CC(=O)O)C(=O)O |
2-Butenedioic acid, 2-chloro-, diethyl ester, (Z)- | C(C(=O)OCC)=C(Cl)C(=O)OCC |
2-Butenedioic acid, 2-iodo-, dibutyl ester, (Z)- | C(I)(=CC(=O)OCCCC)C(=O)OCCCC |
2-Butenedioic acid, 2-methyl-, (E)- | C(C)(=CC(=O)O)C(=O)O |
2-Butenedioic acid, 2-methyl-, (Z)- | C(C)(=CC(=O)O)C(=O)O |
2-Butenedioic acid, 2-methyl-, cyclic hydrazide, (Z)- | Cc1cc(O)nnc1O |
2-Butenedioic acid, 2-methyl-, dimethyl ester (Z)- | C(C)(=CC(=O)OC)C(=O)OC |
2-Butenedioic acid, 2-methyl-, dimethyl ester, (E)- | C(C)(=CC(=O)OC)C(=O)OC |
2-Butenedioic acid, 2-methyl-, dimethyl ester, (Z)- | C(C)(=CC(=O)OC)C(=O)OC |
2-Butenedioic acid, dibutyl ester | C(=O)(OCCCC)C=CC(=O)OCCCC |
2-Butenedioic acid, diethyl ester, (E)- | C(=O)(OCC)C=CC(=O)OCC |
2-Butenedioic acid, dimethyl ester, (E)- | C(=O)(OC)C=CC(=O)OC |
2-Butenedioic acid, dimethyl ester, (Z)- | C(=O)(OC)C=CC(=O)OC |
2-Butenedioic acid, monomethyl ester | C(=O)(OC)C=CC(=O)O |
2-Butenedioic_acid_(E)-__bis(1-methylethyl)_ester | C(=O)(C=CC(=O)OC(C)C)OC(C)C |
2-Butenedioic_acid_(E)-__bis(2-methylpropyl)_ester | C(=O)(OCC(C)C)C=CC(=O)OCC(C)C |
2-Butenedioic_acid_(E)-__bis(phenylmethyl)_ester | C(OC(=O)C=CC(=O)OCc1ccccc1)c2ccccc2 |
2-Butenedioic_acid_(E)-__di-2-propenyl_ester | C(=O)(OCC=C)C=CC(=O)OCC=C |
2-Butenedioic_acid_(E)-__dibutyl_ester | C(=O)(OCCCC)C=CC(=O)OCCCC |
2-Butenedioic_acid_(E)-__dihydrazide | C(=O)(NN)C=CC(=O)NN |
2-Butenedioic_acid_(E)-__monoethyl_ester | C(=O)(OCC)C=CC(=O)O |
2-Butenedioic_acid_(E)-__monoethyl_ester__manganese(2+)_salt | C(=O)(OCC)C=CC(=O)O |
2-Butenedioic_acid_(E)-__monomethyl_ester | C(=O)(OC)C=CC(=O)O |
2-Butenedioic_acid_(Z)-__bis(2-phenoxyethyl)_ester | O(CCOC(=O)C=CC(=O)OCCOc1ccccc1)c2ccccc2 |
2-Butenedioic_acid_(Z)-__bis(cyclohexyl)_ester | O(C(=O)C=CC(=O)OC1CCCCC1)C2CCCCC2 |
2-Butenedioic_acid_(Z)-__di-2-propenyl_ester | C(=O)(OCC=C)C=CC(=O)OCC=C |
2-Butenedioic_acid_(Z)-__di-2-propynyl_ester | C(=O)(OCC#C)C=CC(=O)OCC#C |
2-Butenedioic_acid_(Z)-__dibutyl_ester | C(=O)(OCCCC)C=CC(=O)OCCCC |
2-Butenedioic_acid_(Z)-__didodecyl_ester | C(=O)(OCCCCCCCCCCCC)C=CC(=O)OCCCCCCCCCCCC |
2-Butenedioic_acid_(Z)-__diethyl_ester | C(=O)(OCC)C=CC(=O)OCC |
2-Butenedioic_acid_(Z)-__dipropyl_ester | C(=O)(OCCC)C=CC(=O)OCCC |
2-Butenedioic_acid_(Z)-__mono(2_2-dimethylhydrazide) | C(=O)(C=CC(=O)O)NN(C)C |
2-Butenedioic_acid_(Z)-__monoethyl_ester | C(=O)(OCC)C=CC(=O)O |
2-Butenedioic_acid_(Z)-__monomethyl_ester | C(=O)(OC)C=CC(=O)O |
2-Butenedioic_acid__2-bromo-3-methyl-__dimethyl_ester__(Z)- | C(Br)(C(=O)OC)=C(C)C(=O)OC |
2-Butenedioic_acid__2-chloro-__(Z)- | C(Cl)(=CC(=O)O)C(=O)O |
2-Butenedioic_acid__2-chloro-__diethyl_ester__(Z)- | C(C(=O)OCC)=C(Cl)C(=O)OCC |
2-Butenedioic_acid__2-iodo-__dibutyl_ester__(Z)- | C(I)(=CC(=O)OCCCC)C(=O)OCCCC |
2-Butenedioic_acid__2-methyl-__(Z)- | C(C)(=CC(=O)O)C(=O)O |
2-Butenedioic_acid__2-methyl-__cyclic_hydrazide__(Z)- | Cc1cc(O)nnc1O |
2-Butenedioic_acid__2-methyl-__dimethyl_ester__(E)- | C(C)(=CC(=O)OC)C(=O)OC |
2-Butenedioic_acid__2-methyl-__dimethyl_ester__(Z)- | C(C)(=CC(=O)OC)C(=O)OC |
2-Butenedioic_acid__2_3-dihydroxy-__(E)- | C(O)(C(=O)O)=C(O)C(=O)O |
2-Butenedioic_acid__2_3-dihydroxy-__(Z)- | C(O)(C(=O)O)=C(O)C(=O)O |
2-Butenedioic_acid__2__3-dibromo-__(Z)- | C(Br)(C(=O)O)=C(Br)C(=O)O |
2-Butenedioic_acid__diethyl_ester__(E)- | C(=O)(OCC)C=CC(=O)OCC |
2-Butenedioic_acid__dimethyl_ester__(Z)- | C(=O)(OC)C=CC(=O)OC |
Butenedioic acid, (E)- | C(=CC(=O)O)C(=O)O |
Butenedioic acid, (Z)- | C(=CC(=O)O)C(=O)O |
Butenedioic acid, methyl-, (E)- | C(C)(=CC(=O)O)C(=O)O |
Ethene, methoxy-, polymer with (Z)-2-butenedioic acid | C(=CC(=O)O)C(=O)O.C=COC |
Ethene__methoxy-__polymer_with_(Z)-2-butenedioic_acid | C(=CC(=O)O)C(=O)O.C=COC |
cis-2-Methyl-2-butenedioic acid, dimethyl ester | C(C)(=CC(=O)OC)C(=O)OC |
cis-Butenedioic acid | C(=CC(=O)O)C(=O)O |
cis-Butenedioic anhydride | O=C1C=CC(=O)O1 |
cis-Butenedioic_anhydride | O=C1C=CC(=O)O1 |
trans-2-Methyl-2-butenedioic acid | C(C)(=CC(=O)O)C(=O)O |
trans-Butenedioic acid dimethyl ester | C(=O)(OC)C=CC(=O)OC |
trans-Butenedioic acid | C(=CC(=O)O)C(=O)O |