If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Phenylpropyl crotonate | C(CCOC(=O)C=CC)c1ccccc1 |
Allyl crotonate | C(=O)(C=CC)OCC=C |
Benzyl crotonate | C(OC(=O)C=CC)c1ccccc1 |
Dimethyl phosphate of methyl 3-hydroxy-cis-crotonate | P(=O)(OC)(OC)OC(C)=CC(=O)OC |
Ethyl 3-(methylamino)crotonate | C(=C(C)NC)C(=O)OCC |
Ethyl 3-(p-chloroanilino)-crotonate | N(C(C)=CC(=O)OCC)c1ccc(Cl)cc1 |
Ethyl 3-(phenylamino)crotonate | N(C(C)=CC(=O)OCC)c1ccccc1 |
Ethyl BETA_-(methylamino)crotonate | C(=C(C)NC)C(=O)OCC |
Ethyl crotonate | C(=O)(C=CC)OCC |
Hexyl crotonate | C(=O)(C=CC)OCCCCCC |
Methyl 3-(dimethoxyphosphinyloxy)crotonate | P(=O)(OC)(OC)OC(C)=CC(=O)OC |
Methyl crotonate | C(=O)(OC)C=CC |
Methyl-3-(N-pyrrolidinyl)crotonate | C(C)(=CC(=O)OC)N1CCCC1 |
Propyl crotonate | C(=O)(C=CC)OCCC |
Trichothec-9-en-8-one, 12,13-epoxy-4-hydroxy-, crotonate | C1(=O)CC2(C)C(C=C1C)OC3CC(OC(=O)C=CC)C2(C)C34CO4 |
Vinyl crotonate | C(=O)(C=CC)OC=C |