If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
6-Hydroxy-2-methylaminopurine | Oc1nc(NC)nc2NC=Nc12 |
6-Methylaminopurine D-riboside | OC1C(O)C(CO)OC1N2C=Nc3c(NC)ncnc23 |
6-Methylaminopurine ribonucleoside | OC1C(O)C(CO)OC1N2C=Nc3c(NC)ncnc23 |
6-Methylaminopurine riboside | OC1C(O)C(CO)OC1N2C=Nc3c(NC)ncnc23 |
6-Methylaminopurine_ribonucleoside | OC1C(O)C(CO)OC1N2C=Nc3c(NC)ncnc23 |
7-Methyl-6-methylaminopurine | N(C)c1ncnc2N=CN(C)c12 |