If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Nitrobenzoic acid dimethylamide | C(=O)(N(C)C)c1ccc(cc1)[N+](=O)[O-] |
5-Amino-1-(bis(dimethylamide)phosphoryl)-3-phenyl-1,2,4-triazole | P(=O)(N(C)C)(N(C)C)N1N=C(NC1=N)c2ccccc2 |
Acetic acid, dimethylamide | C(C)(=O)N(C)C |
Benzenesulfonic dimethylamide | S(=O)(=O)(N(C)C)c1ccccc1 |
Chloroformic acid dimethylamide | C(Cl)(=O)N(C)C |
Diazenedicarboxylic acid bis(N,N-dimethylamide) | C(=O)(N=NC(=O)N(C)C)N(C)C |
Diazenedicarboxylic_acid_bis(N_N-dimethylamide) | C(=O)(N=NC(=O)N(C)C)N(C)C |
Dichlorophosphoric dimethylamide | P(Cl)(Cl)(=O)N(C)C |
Dimethylamide acetate | C(C)(=O)N(C)C |
Lauryl N, N-dimethylamide | C(CCCCCCCCC)CC(=O)N(C)C |
Phenylacetic acid N,N-dimethylamide | C(C(=O)N(C)C)c1ccccc1 |
Phenylacetic_acid_N_N-dimethylamide | C(C(=O)N(C)C)c1ccccc1 |
Phosphoric tris(dimethylamide) | P(=O)(N(C)C)(N(C)C)N(C)C |