If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
6-Benzylamino-9BETA_-D-ribofuranosylpurine | OC1C(O)C(CO)OC1N2C=Nc3c(ncnc23)NCc4ccccc4 |
6-Benzylamino-9BETA_-ribofuranosylpurine, D- | OC1C(O)C(CO)OC1N2C=Nc3c(ncnc23)NCc4ccccc4 |
6-Benzylamino-9BETA_-ribofuranosylpurine__D- | OC1C(O)C(CO)OC1N2C=Nc3c(ncnc23)NCc4ccccc4 |
6-Hydroxyamino-9-BETA_-D-ribofuranosylpurine | OC1C(O)C(CO)OC1N2C=Nc3c(NO)ncnc23 |
6-Methyl-9BETA_-D-ribofuranosylpurine | OC1C(O)C(CO)OC1N2C=Nc3c(C)ncnc23 |
6-N-((3-Methyl-2-butenyl)amino)-9BETA_-D-ribofuranosylpurine | OC1C(O)C(CO)OC1N2C=Nc3c(NCC=C(C)C)ncnc23 |
9-BETA_-Ribofuranosylpurine | OC1C(O)C(CO)OC1N2C=Nc3cncnc23 |