If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
D-glycero-D-gulo-Heptatole | C(O)(C(O)C(O)CO)C(O)C(O)CO |
D-glycero-D-gulo-Heptitol | C(O)(C(O)C(O)CO)C(O)C(O)CO |
D-glycero-D-gulo-Heptonic acid, GAMMA_-lactone | C(O)(C(O)CO)C1OC(=O)C(O)C1O |
D-glycero-D-gulo-Heptonic acid, calcium salt (2:1) | C(O)(C(O)C(O)CO)C(O)C(O)C(=O)O |
D-glycero-D-gulo-Heptonic acid, calcium salt | C(O)(C(O)C(O)CO)C(O)C(O)C(=O)O |
D-glycero-D-gulo-Heptonic_acid__GAMMA_-lactone | C(O)(C(O)CO)C1OC(=O)C(O)C1O |
D-glycero-D-gulo-Heptonic_acid__calcium_salt_(2:1) | C(O)(C(O)C(O)CO)C(O)C(O)C(=O)O |
D-glycero-D-gulo-Heptose | C(O)(C(O)C(O)CO)C(O)C(O)C=O |
glycero-gulo-Heptitol, meso- | C(O)(C(O)C(O)CO)C(O)C(O)CO |
glycero-gulo-Heptitol__meso- | C(O)(C(O)C(O)CO)C(O)C(O)CO |
meso-glycero-gulo-Heptitol | C(O)(C(O)C(O)CO)C(O)C(O)CO |