If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
ALPHA_, ALPHA_-Diphenylacetic acid | C(C(=O)O)(c1ccccc1)c2ccccc2 |
ALPHA_-Hydroxy-2,2-diphenylacetic acid | C(O)(C(=O)O)(c1ccccc1)c2ccccc2 |
Diphenylacetic acid 2-(diethylamino)ethyl ester hydrochloride | C(C(=O)OCCN(CC)CC)(c1ccccc1)c2ccccc2 |
Diphenylacetic acid 2-(diethylamino)ethyl ester methyl bromide | C(C(=O)OCCN(C)(CC)CC)(c1ccccc1)c2ccccc2 |
Diphenylacetic acid 2-(dimethylamino)ethyl ester hydrochloride | C(C(=O)OCCN(C)C)(c1ccccc1)c2ccccc2 |
Diphenylacetic acid amide | C(C(N)=O)(c1ccccc1)c2ccccc2 |
Diphenylacetic acid anhydride | C(C(=O)OC(=O)C(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Diphenylacetic acid chloride | C(C(Cl)=O)(c1ccccc1)c2ccccc2 |
Diphenylacetic acid | C(C(=O)O)(c1ccccc1)c2ccccc2 |
Diphenylacetic acid, 1-ethyl-3-piperidyl ester, hydrochloride | C(C(=O)OC1CCCN(CC)C1)(c2ccccc2)c3ccccc3 |
Diphenylacetic acid, ethyl ester | C(C(=O)OCC)(c1ccccc1)c2ccccc2 |
Diphenylacetic acid, methyl ester | C(C(=O)OC)(c1ccccc1)c2ccccc2 |
Diphenylacetic anhydride | C(C(=O)OC(=O)C(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |