If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Methylpurine-6-thione | S=C1N(C)C=NC2=C1N=CN2 |
2,6-Dichloro-7-methylpurine | Clc1nc(Cl)nc2N=CN(C)c12 |
2-Amino-6-methylpurine | Cc1nc(N)nc2NC=Nc12 |
6-Amino-7-methylpurine | Nc1ncnc2N=CN(C)c12 |
6-Amino-9-methylpurine | Nc1ncnc2N(C)C=Nc12 |
6-Chloro-7-methylpurine | Clc1ncnc2N=CN(C)c12 |
6-Chloro-9-methylpurine | Clc1ncnc2N(C)C=Nc12 |
6-Ethylmercapto-7-methylpurine | S(CC)c1ncnc2N=CN(C)c12 |
6-Mercapto-7-methylpurine | Sc1ncnc2N=CN(C)c12 |
6-Mercapto-9-methylpurine | Sc1ncnc2N(C)C=Nc12 |
6-Methylpurine ribonucleoside | OC1C(O)C(CO)OC1N2C=Nc3c(C)ncnc23 |
6-Methylpurine | Cc1ncnc2NC=Nc12 |
7-Methylpurine-6-thiol | Sc1ncnc2N=CN(C)c12 |
7-Methylpurine-6-thione | Sc1ncnc2N=CN(C)c12 |
8-Methylpurine | CC1=Nc2cncnc2N1 |