If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Java Unichrome Brown EB | N(=Nc1cc(N=Nc2cc(ccc2O)[N+](=O)[O-])c(N)cc1N)c3cccc4c3cccc4S(=O)(=O)O |
Java Unichrome Orange E | N(=Nc1ccc(cc1)N=Nc2ccc(cc2)S(=O)(=O)O)c3ccc(O)c(c3)C(=O)O |
Java Unichrome Red 5G | O=C1C(N=Nc2cc(Cl)cc(c2O)S(=O)(=O)O)C(C)=NN1c3ccccc3 |
Java Unichrome Red B | N(=NC1C(C)=NN(C1=O)c2ccccc2)c3c(O)cc(c4ccccc34)S(=O)(=O)O |
Java Unichrome Red G | O=C1C(N=Nc2cc(Cl)cc(c2O)S(=O)(=O)O)C(C)=NN1c3ccccc3 |
Java Unichrome Yellow OB | S(=O)(=O)(O)c1ccc2cc(N=Nc3ccc(O)c(c3)C(=O)O)ccc2c1 |