If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Hexanaminium, N,N,N-trihexyl-, benzoate | N(CCCCCC)(CCCCCC)(CCCCCC)CCCCCC.O=C(O)c1ccccc1 |
1-Hexanaminium, N,N,N-trihexyl-, iodide | N(CCCCCC)(CCCCCC)(CCCCCC)CCCCCC |
1-Hexanaminium__N_N_N-trihexyl-__benzoate | N(CCCCCC)(CCCCCC)(CCCCCC)CCCCCC.O=C(O)c1ccccc1 |
1-Hexanaminium__N_N_N-trihexyl-__iodide | N(CCCCCC)(CCCCCC)(CCCCCC)CCCCCC |
Boric acid (H3BO3), trihexyl ester | B(OCCCCCC)(OCCCCCC)OCCCCCC |
Boric acid, trihexyl ester | B(OCCCCCC)(OCCCCCC)OCCCCCC |
Boric_acid_(H3BO3)__trihexyl_ester | B(OCCCCCC)(OCCCCCC)OCCCCCC |
Germanium, trihexyl- acetate | [Ge](CCCCCC)(CCCCCC)(CCCCCC)OC(C)=O |
Germanium__trihexyl-_acetate | [Ge](CCCCCC)(CCCCCC)(CCCCCC)OC(C)=O |
Phosphine oxide, trihexyl- | P(=O)(CCCCCC)(CCCCCC)CCCCCC |
Phosphine_oxide__trihexyl- | P(=O)(CCCCCC)(CCCCCC)CCCCCC |
Phosphorous acid, trihexyl ester | P(OCCCCCC)(OCCCCCC)OCCCCCC |
Phosphorous_acid__trihexyl_ester | P(OCCCCCC)(OCCCCCC)OCCCCCC |
Silane, trihexyl- | [Si](CCCCCC)(CCCCCC)CCCCCC |
Silane__trihexyl- | [Si](CCCCCC)(CCCCCC)CCCCCC |
Trihexyl borate | B(OCCCCCC)(OCCCCCC)OCCCCCC |
Trihexyl phosphite | P(OCCCCCC)(OCCCCCC)OCCCCCC |