If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Isoxazolecarboxylic acid, 5-methyl-, 2-benzylhydrazide | C(=O)(NNCc1ccccc1)C2=NOC(C)=C2 |
5-Methyl-3-isoxazolecarboxylic acid 2-benzylhydrazide | C(=O)(NNCc1ccccc1)C2=NOC(C)=C2 |
Benzoic acid, 2-benzylhydrazide | C(=O)(NNCc1ccccc1)c2ccccc2 |
Picolinic acid, 2-benzylhydrazide | C(=O)(NNCc1ccccc1)c2ccccn2 |
Ribonic acid, 2-benzylhydrazide, D- | C(NNC(=O)C(O)C(O)C(O)CO)c1ccccc1 |