If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Indoleacetic acid | C(C(=O)O)C1=CNc2ccccc12 |
3-Indoleacetic acid, 4, 7-dimethyl- | C(C(=O)O)C1=CNc2c(C)ccc(C)c12 |
3-Indoleacetic acid, 5,7-dimethyl- | C(C(=O)O)C1=CNc2c(C)cc(C)cc12 |
4,7-Dimethyl-3-indoleacetic acid | C(C(=O)O)C1=CNc2c(C)ccc(C)c12 |
5,7-Dimethyl-3-indoleacetic acid | C(C(=O)O)C1=CNc2c(C)cc(C)cc12 |
BETA_-Indoleacetic acid | C(C(=O)O)C1=CNc2ccccc12 |
Indoleacetic acid (VAN) | C(C(=O)O)C1=CNc2ccccc12 |
Indoleacetic acid, 5-hydroxy- | C(C(=O)O)C1=CNc2ccc(O)cc12 |