If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Naphthalenesulfonic acid, 6,8-dianilino- | N(c1ccccc1)c2cc(Nc3ccccc3)cc4cccc(c24)S(=O)(=O)O |
2, 5-Dianilino-1,4-benzoquinone | N(c1ccccc1)C2=CC(=O)C(=CC2=O)Nc3ccccc3 |
2,5-Dianilino-3,6-dichloroquinone | N(c1ccccc1)C2=C(Cl)C(=O)C(Nc3ccccc3)=C(Cl)C2=O |
2,5-Dianilino-p-benzoquinone | N(c1ccccc1)C2=CC(=O)C(=CC2=O)Nc3ccccc3 |
6, 8-Dianilino-1-naphthalenesulfonic acid | N(c1ccccc1)c2cc(Nc3ccccc3)cc4cccc(c24)S(=O)(=O)O |
Mercury, dianilino- | Nc1ccccc1 |
Urea, 1, 3-dianilino-2-thio- | N(NC(=S)NNc1ccccc1)c2ccccc2 |
p-Benzoquinone, 2,5-dianilino- | N(c1ccccc1)C2=CC(=O)C(=CC2=O)Nc3ccccc3 |
p-Benzoquinone, 2,5-dianilino-3,6-dichloro- | N(c1ccccc1)C2=C(Cl)C(=O)C(Nc3ccccc3)=C(Cl)C2=O |