If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Animal galactose factor | C(=O)(O)c1cc(O)nc(O)n1 |
Anti-Chromotrichia factor | C(=O)(O)c1ccc(N)cc1 |
Anti-Chromotrichia_factor | C(=O)(O)c1ccc(N)cc1 |
BS factor | Cc1nc(C)c(C)nc1C |
Calcium citrovorum factor | C(=O)N1C(CNc2ccc(cc2)C(=O)NC(CCC(=O)O)C(=O)O)CNc3nc(N)nc(O)c13 |
Chromotrichia factor | C(=O)(O)c1ccc(N)cc1 |
Dormin (abscission factor) | C(=CC(C)=CC(=O)O)C1(O)C(C)=CC(=O)CC1(C)C |
Factor S (vitamin) | C(CCCC(=O)O)C1SCC2NC(=O)NC12 |
Factor S | C(CCCC(=O)O)C1SCC2NC(=O)NC12 |
Factor Streptococcus lactis R | Oc1nc(N)nc2ncc(CN(C=O)c3ccc(cc3)C(=O)O)nc12 |
Factor pp | C(N)(=O)c1cccnc1 |
Lard Factor | C(=CC(C)=CC=CC(C)=CCO)C1=C(C)CCCC1(C)C |
Liver Lactobacillus casei factor | Oc1nc(N)nc2ncc(CNc3ccc(cc3)C(=O)NC(CCC(=O)O)C(=O)O)nc12 |
Mauve factor | C(C)C1=C(C)NC=C1C |
Nebramycin factor 6 | O(C1OC(CO)C(O)C(N)C1O)C2C(N)CC(N)C(OC3OC(CN)C(O)CC3N)C2O |
P.P. factor-pellagra preventive factor | C(=O)(O)c1cccnc1 |
P.P._factor-pellagra_preventive_factor | C(=O)(O)c1cccnc1 |
PP Factor | C(=O)(O)c1cccnc1 |
Pellagra preventive factor | C(=O)(O)c1cccnc1 |
S.L.R. Factor | Oc1nc(N)nc2ncc(CN(C=O)c3ccc(cc3)C(=O)O)nc12 |
Streptococcus lactis R factor | Oc1nc(N)nc2ncc(CN(C=O)c3ccc(cc3)C(=O)O)nc12 |
Trichochromogenic factor | C(=O)(O)c1ccc(N)cc1 |
Virginiamycin Factor M1 | O=C1C2=COC(CC(=O)CC(O)C=C(C)C=CCNC(=O)C=CC(C)C(OC(=O)C3=CCCN13)C(C)C)=N2 |
Whey factor | C(=O)(O)c1cc(O)nc(O)n1 |