If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
OBABERINE | O(C)c1c(OC)cc2CCN(C)C3Cc4ccc(cc4)Oc5cc(ccc5OC)CC6N(C)CCc7cc(OC)c(Oc1c23)cc67 |
OBACUNOIC ACID | CC12C(=O)CC(C(C)(C)O)C(C)(C=CC(=O)O)C2CCC3(C)C(OC(=O)C4OC134)C5=COC=C5 |
Obacunoic_acid | CC12C(=O)CC(C(C)(C)O)C(C)(C=CC(=O)O)C2CCC3(C)C(OC(=O)C4OC134)C5=COC=C5 |
Obamegin | C1CN(C)C2Cc3ccc(O)c(Oc4ccc(cc4)CC5N(C)CCc6cc(OC)c(Oc7c(O)c(OC)cc1c27)cc56)c3 |
(+)-Obamegine | C1CN(C)C2Cc3ccc(O)c(Oc4ccc(cc4)CC5N(C)CCc6cc(OC)c(Oc7c(O)c(OC)cc1c27)cc56)c3 |
Obedrin-LA | C(C(C)NC)c1ccccc1 |
Obepin | C(=O)c1ccc(OC)cc1 |
Obesedrin | C(C(C)N)c1ccccc1.O=S(=O)(O)O |
Obesin | C(C(C)NC)C1CCCCC1 |
Obesine | C(C(C)NC)C1CCCCC1 |
Obesonil | C(C(C)N)c1ccccc1.O=S(=O)(O)O |
Obestat | C(O)(C(C)N)c1ccccc1 |
Oblevil | C(C)(O)(CC)C#C |
oblivon | A sub-index is available for oblivon... |
WLN: T8OBOBOTJ BOX3 & 1 & 1 DOX3 & 1 & 1 F1 F1 H1 | O(B1OC(C)CC(C)(C)O1)C(C)(C)CC(C)OB2OC(C)CC(C)(C)O2 |
WLN: T6OBOTJ BR D1& E3 E1 | C(CC)C1(C)COB(OC1)c2ccc(C)cc2 |
OBOVATOL | O(c1ccc(CC=C)cc1)c2cc(CC=C)cc(O)c2O |
WLN: 1Y1&OBOY1&1&OY1&1 | B(OC(C)C)(OC(C)C)OC(C)C |
WLN: Z1Y1&OBOY1Z1&OY1Z1 | CC1OB2OC(C)CN(C1)CC(C)O2 |
Obracin | O(C1OC(CO)C(O)C(N)C1O)C2C(N)CC(N)C(OC3OC(CN)C(O)CC3N)C2O |
OBSH | S(=O)(=O)(NN)c1ccc(cc1)Oc2ccc(cc2)S(=O)(=O)NN |
Pyrdone (obsolete) | O=C1N(CC(CC)CCCC)C(=O)C2C3C=CC(C3)C12 |
OBTUSAFURAN JURD 2130 | CC1c2cc(O)c(OC)cc2OC1c3ccccc3 |
OBTUSAFURAN_JURD_2130 | CC1c2cc(O)c(OC)cc2OC1c3ccccc3 |
obtusaquinone | A sub-index is available for obtusaquinone... |
Obtusastyrene | C(C=Cc1ccccc1)c2ccc(O)cc2 |
OBTUSIQUINONE DERIV JURD 2280 | C(C=Cc1ccccc1)c2cc(cc(c2O)C(C)(C)C)C(C)(C)C |
OBTUSIQUINONE DERIV JURD 2335 | C(c1ccc(OC)cc1)c2cc3OCOc3cc2OC |
OBTUSIQUINONE_DERIV_JURD_2280 | C(C=Cc1ccccc1)c2cc(cc(c2O)C(C)(C)C)C(C)(C)C |
OBTUSIQUINONE_DERIV_JURD_2335 | C(c1ccc(OC)cc1)c2cc3OCOc3cc2OC |