If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Pivaloyl-indaan-1,3-dion (DUTCH) | C(=O)(C1C(=O)c2ccccc2C1=O)C(C)(C)C |
2-Pivaloyl-indan-1,3-dion (GERMAN) | C(=O)(C1C(=O)c2ccccc2C1=O)C(C)(C)C |
6ALPHA_-Methyl-4-pregnene-3,20-dion-17ALPHA_-ol acetate | O(C(C)=O)C1(CCC2C3CC(C)C4=CC(=O)CCC4(C)C3CCC12C)C(C)=O |
Dion 6692 (VAN) | Brc1c(Br)c(Br)c(Br)c2C(=O)OC(=O)c12 |