If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Hydroxyethylpiperazine | C(CO)N1CCNCC1 |
Hydroxyethylpiperazine | C(CO)N1CCNCC1 |
N-2-Hydroxyethylpiperazine N',2'-ethanesulfonic acid | C(CS(=O)(=O)O)N1CCN(CCO)CC1 |
N-2-Hydroxyethylpiperazine-N'-ethanesulfonate | C(CS(=O)(=O)O)N1CCN(CCO)CC1 |
N-2-Hydroxyethylpiperazine-N'-ethanesulfonic acid | C(CS(=O)(=O)O)N1CCN(CCO)CC1 |
N-2-Hydroxyethylpiperazine-N-ethane sulfonic acid | C(CS(=O)(=O)O)N1CCN(CCO)CC1 |
N-2-Hydroxyethylpiperazine_N'_2'-ethanesulfonic_acid | C(CS(=O)(=O)O)N1CCN(CCO)CC1 |