If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Acetylaniline | C(C)(=O)c1ccccc1N |
2-Methoxy-5-acetylaniline | C(C)(=O)c1ccc(OC)c(N)c1 |
3-Acetylaniline | C(C)(=O)c1cccc(N)c1 |
3-Amino-N-acetylaniline | N(C(C)=O)c1cccc(N)c1 |
3-Nitro-N-acetylaniline | N(C(C)=O)c1cccc(c1)[N+](=O)[O-] |
4-Acetylaniline | C(C)(=O)c1ccc(N)cc1 |
Acetylaniline | N(C(C)=O)c1ccccc1 |
N-Acetylaniline | N(C(C)=O)c1ccccc1 |
m-Acetylaniline | C(C)(=O)c1cccc(N)c1 |
p-Acetylaniline | C(C)(=O)c1ccc(N)cc1 |