If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Methyl-5-bromouracil | BrC1=CN(C)C(=O)NC1=O |
5-Bromouracil deoxyriboside | O=C1NC(=O)C(Br)=CN1C2CC(O)C(CO)O2 |
5-Bromouracil ribonucleoside | OC1C(O)C(CO)OC1N2C=C(Br)C(=O)NC2=O |
5-Bromouracil | Oc1nc(O)ncc1Br |
5-Bromouracil-2-deoxyriboside | O=C1NC(=O)C(Br)=CN1C2CC(O)C(CO)O2 |
5-Bromouracil_ribonucleoside | OC1C(O)C(CO)OC1N2C=C(Br)C(=O)NC2=O |
Bromouracil deoxyriboside | O=C1NC(=O)C(Br)=CN1C2CC(O)C(CO)O2 |
Bromouracil | Oc1nc(O)ncc1Br |