If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Phenylethyl anthranilate | C(=O)(OCCc1ccccc1)c2ccccc2N |
3, 7-Dimethyl-1,6-octadien-3-yl, anthranilate | C(C)(C=C)(CCC=C(C)C)OC(=O)c1ccccc1N |
3-Phenyl-2-propen-1-yl anthranilate | C(=O)(OCC=Cc1ccccc1)c2ccccc2N |
3-Phenyl-2-propenyl anthranilate | C(=O)(OCC=Cc1ccccc1)c2ccccc2N |
ALPHA_-Amylcinnamaldehyde, methyl anthranilate Schiff base | N(=CC(CCCCC)=Cc1ccccc1)c2ccccc2C(=O)OC |
ALPHA_-Amylcinnamylidene methyl anthranilate | N(=CC(CCCCC)=Cc1ccccc1)c2ccccc2C(=O)OC |
Allyl anthranilate | C(=O)(OCC=C)c1ccccc1N |
Amyl cinnamylidene methyl anthranilate | N(=CC(CCCCC)=Cc1ccccc1)c2ccccc2C(=O)OC |
Benzylcarbinyl anthranilate | C(=O)(OCCc1ccccc1)c2ccccc2N |
Butyl anthranilate | C(=O)(OCCCC)c1ccccc1N |
Cinnamyl alcohol, anthranilate | C(=O)(OCC=Cc1ccccc1)c2ccccc2N |
Cinnamyl anthranilate | C(=O)(OCC=Cc1ccccc1)c2ccccc2N |
Cupric anthranilate | O=C1O[Cu]2(OC(=O)c3ccccc3N2)Nc4ccccc14 |
Dimethyl anthranilate | C(=O)(OC)c1ccccc1NC |
Ethyl anthranilate | C(=O)(OCC)c1ccccc1N |
Hydroxycitronellylidene methyl anthranilate | C(=O)(OC)c1ccccc1N=CCC(C)CCCC(C)(C)O |
Linalyl anthranilate | C(C)(C=C)(CCC=C(C)C)OC(=O)c1ccccc1N |
Methyl N-(2-amyl-3-phenylpropenylidene)anthranilate | N(=CC(CCCCC)=Cc1ccccc1)c2ccccc2C(=O)OC |
Methyl N-(BETA_-pentylcinnamylidene)anthranilate | N(=CC(CCCCC)=Cc1ccccc1)c2ccccc2C(=O)OC |
Methyl N-methyl-o-anthranilate | C(=O)(OC)c1ccccc1NC |
Methyl anthranilate | C(=O)(OC)c1ccccc1N |
N-Methyl methyl anthranilate | C(=O)(OC)c1ccccc1NC |
Phenethyl anthranilate | C(=O)(OCCc1ccccc1)c2ccccc2N |
Phenylethyl anthranilate | C(=O)(OCCc1ccccc1)c2ccccc2N |
n-Hexyl anthranilate | C(=O)(OCCCCCC)c1ccccc1N |