If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Methylfuroxan-4-(N, N-dimethylcarboxamide) | C(=O)(N(C)C)C1=NON(=O)=C1C |
3-Methylfuroxan-4-(N__N-dimethylcarboxamide) | C(=O)(N(C)C)C1=NON(=O)=C1C |
4-Methylfurazan-3-(N, N-dimethylcarboxamide) | C(=O)(N(C)C)C1=NON=C1C |
4-Methylfurazan-3-(N__N-dimethylcarboxamide) | C(=O)(N(C)C)C1=NON=C1C |
4-Methylfuroxan-3-(N, N-dimethylcarboxamide) | C(=O)(N(C)C)C1=[N+](=O)[O-]N=C1C |
4-Methylfuroxan-3-(N__N-dimethylcarboxamide) | C(=O)(N(C)C)C1=[N+](=O)[O-]N=C1C |