If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(+)-3, 4-Dihydroxyphenylalanine | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
(.+-.)-3, 4-Dihydroxyphenylalanine | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
3', 4'-Dihydroxyphenylalanine | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
3, 4-Dihydroxyphenylalanine (VAN) | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
ALPHA_-Methyl-L-3,4-dihydroxyphenylalanine | C(c1ccc(O)c(O)c1)C(C)(N)C(=O)O |
D-3, 4-Dihydroxyphenylalanine | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
D-B-3,4-Dihydroxyphenylalanine | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
DIHYDROXYPHENYLALANINE | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
DL-Dihydroxyphenylalanine | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
L-Dihydroxyphenylalanine | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |