If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2,3-Benzofuran | c12C=COc1cccc2 |
2-(4-Pyridyl)benzofuran | C1(=Cc2ccccc2O1)c3ccncc3 |
2-Ethyl-3-(4-hydroxybenzoyl)benzofuran | C(=O)(c1ccc(O)cc1)C2=C(CC)Oc3ccccc23 |
2-Ethyl-3-(p-hydroxybenzoyl)benzofuran | C(=O)(c1ccc(O)cc1)C2=C(CC)Oc3ccccc23 |
2_3-Benzofuran | c12C=COc1cccc2 |
BENZOFURAN DERIV (HERZ) | O(C)c1c(O)c(cc2CC(Oc12)C(C)=C)C(C)=O |
BENZOFURAN_DERIV_(HERZ) | O(C)c1c(O)c(cc2CC(Oc12)C(C)=C)C(C)=O |
Benzofuran | c12C=COc1cccc2 |
Benzofuran, (2-ethyl-3-(4'-hydroxybenzoyl)) | C(=O)(c1ccc(O)cc1)C2=C(CC)Oc3ccccc23 |
Benzofuran, 2,3-dihydro-2-methyl- | CC1Cc2ccccc2O1 |
Benzofuran, 2,5-diacetyl- | C(C)(=O)C1=Cc2cc(ccc2O1)C(C)=O |
Benzofuran, 4,5,6, 7-tetrahydro-3,6-dimethyl- | CC1=COC2=C1CCC(C)C2 |
Benzofuran, 5-methoxy- | O(C)c1ccc2OC=Cc2c1 |
Benzofuran-3(2H)-one | O=C1COc2ccccc12 |
Benzofuran__2_3-dihydro-2-methyl- | CC1Cc2ccccc2O1 |
Benzofuran__4_5_6__7-tetrahydro-3_6-dimethyl- | CC1=COC2=C1CCC(C)C2 |
Benzofuran__5-methoxy- | O(C)c1ccc2OC=Cc2c1 |
Oxepino(2,3-b)benzofuran, 2,9-bis(1,1-dimethylethyl)-4,7-diethoxy- | C(C)(C)(C)c1cc(OCC)cc2c1OC3=C2C=C(OCC)C=C(O3)C(C)(C)C |
Oxepino(2_3-b)benzofuran__2_9-bis(1_1-dimethylethyl)-4_7-diethoxy- | C(C)(C)(C)c1cc(OCC)cc2c1OC3=C2C=C(OCC)C=C(O3)C(C)(C)C |