If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Aza-2-cycloheptanone | O=C1CCCCCN1 |
10,11-Dihydrodibenzo(a,d)cycloheptanone | O=C1c2ccccc2CCc3ccccc13 |
Cycloheptanone (2,4-dinitrophenyl)hydrazone | N(N=C1CCCCCC1)c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
Cycloheptanone | O=C1CCCCCC1 |
Cycloheptanone, (2, 4-dinitrophenyl)hydrazone | N(N=C1CCCCCC1)c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
Cycloheptanone, 4-methyl- | CC1CCCC(=O)CC1 |
Cycloheptanone, oxime | N(O)=C1CCCCCC1 |
Cycloheptanone__(2__4-dinitrophenyl)hydrazone | N(N=C1CCCCCC1)c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
Cycloheptanone__4-methyl- | CC1CCCC(=O)CC1 |
Cycloheptanone__oxime | N(O)=C1CCCCCC1 |