If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Acetoxybenzoic acid | C(=O)(O)c1ccccc1OC(C)=O |
4-Acetoxybenzoic acid | O(C(C)=O)c1ccc(cc1)C(=O)O |
5-Iodo-2-acetoxybenzoic acid | O(C(C)=O)c1ccc(I)cc1C(=O)O |
o-Acetoxybenzoic acid | C(=O)(O)c1ccccc1OC(C)=O |
p-Acetoxybenzoic acid | O(C(C)=O)c1ccc(cc1)C(=O)O |