If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-Butenedioic acid (E)-, monoethyl ester | C(=O)(OCC)C=CC(=O)O |
2-Butenedioic acid (E)-, monoethyl ester, manganese(2+) salt | C(=O)(OCC)C=CC(=O)O |
2-Butenedioic acid (Z), monoethyl ester | C(=O)(OCC)C=CC(=O)O |
2-Butenedioic acid (Z)-, monoethyl ester | C(=O)(OCC)C=CC(=O)O |
2-Butenedioic_acid_(E)-__monoethyl_ester | C(=O)(OCC)C=CC(=O)O |
2-Butenedioic_acid_(E)-__monoethyl_ester__manganese(2+)_salt | C(=O)(OCC)C=CC(=O)O |
2-Butenedioic_acid_(Z)-__monoethyl_ester | C(=O)(OCC)C=CC(=O)O |
Adipic acid, monoethyl ester | C(CCCC(=O)O)C(=O)OCC |
Bis(diethyleneglycol) monoethyl ether phthalate | C(=O)(OCCOCCOCC)c1ccccc1C(=O)OCCOCCOCC |
Butylene glycol monoethyl ether | C(CCO)COCC |
Butylene_glycol_monoethyl_ether | C(CCO)COCC |
Carbonotrithioic acid, monoethyl ester, potassium salt | S(CC)C(=S)S |
Carbonotrithioic_acid__monoethyl_ester__potassium_salt | S(CC)C(=S)S |
Catechol monoethyl ether | O(CC)c1ccccc1O |
Catechol_monoethyl_ether | O(CC)c1ccccc1O |
Decanedioic acid, monoethyl ester | C(CCCCCC(=O)O)CCC(=O)OCC |
Decanedioic_acid__monoethyl_ester | C(CCCCCC(=O)O)CCC(=O)OCC |
Diethylene glycol monoethyl ether acetate | C(OCCOCC)COC(C)=O |
Diethylene glycol monoethyl ether | C(COCC)OCCO |
Diethylene_glycol_monoethyl_ether_acetate | C(OCCOCC)COC(C)=O |
Diglycol monoethyl ether acetate | C(OCCOCC)COC(C)=O |
Diglycol monoethyl ether | C(COCC)OCCO |
Ethanedioic acid, monoethyl ester, potassium salt | C(=O)(OCC)C(=O)O |
Ethanedioic_acid__monoethyl_ester__potassium_salt | C(=O)(OCC)C(=O)O |
Ethanol, 2,2'-oxybis-, monoethyl ether | C(COCC)OCCO |
Ethanol__2_2'-oxybis-__monoethyl_ether | C(COCC)OCCO |
Ethylene diglycol monoethyl ether | C(COCC)OCCO |
Ethylene glycol monoethyl ether acetate | C(COCC)OC(C)=O |
Ethylene glycol monoethyl ether acrylate | C(=O)(C=C)OCCOCC |
Ethylene glycol monoethyl ether propenoate | C(=O)(C=C)OCCOCC |
Ethylene glycol monoethyl ether | C(CO)OCC |
Ethylene_glycol_monoethyl_ether_propenoate | C(=O)(C=C)OCCOCC |
Glycerol ALPHA_-monoethyl ether | C(O)(CO)COCC |
Glycerol_ALPHA_-monoethyl_ether | C(O)(CO)COCC |
Glycol monoethyl ether acetate | C(COCC)OC(C)=O |
Glycol monoethyl ether | C(CO)OCC |
Hexanedioic acid, monoethyl ester | C(CCCC(=O)O)C(=O)OCC |
Hexanedioic_acid__monoethyl_ester | C(CCCC(=O)O)C(=O)OCC |
Hydroquinone monoethyl ether | O(CC)c1ccc(O)cc1 |
Hydroquinone_monoethyl_ether | O(CC)c1ccc(O)cc1 |
Maleic acid, monoethyl ester | C(=O)(OCC)C=CC(=O)O |
Malonic acid, (2-phenylacetamido)-, monoethyl ester, sodium salt | C(C(=O)NC(C(=O)O)C(=O)OCC)c1ccccc1 |
Monoethyl adipate | C(CCCC(=O)O)C(=O)OCC |
Monoethyl ether of diethylene glycol | C(COCC)OCCO |
Monoethyl maleate | C(=O)(OCC)C=CC(=O)O |
Monoethyl oxaloyl chloride | C(=O)(OCC)C(Cl)=O |
Monoethyl sebacate | C(CCCCCC(=O)O)CCC(=O)OCC |
Oxalic acid monoethyl ester chloride | C(=O)(OCC)C(Cl)=O |
Oxalic acid, monoethyl ester amide | C(=O)(OCC)C(N)=O |
Oxalic acid, monoethyl ester, potassium salt | C(=O)(OCC)C(=O)O |
Phosphonic acid, ethyl-, monoethyl ester, vanadium(3+) salt | P(=O)(O)(CC)OCC |
Phosphonic_acid__ethyl-__monoethyl_ester__vanadium(3+)_salt | P(=O)(O)(CC)OCC |
Phthalic acid, tetrachloro-, monoethyl ester | C(=O)(OCC)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O |
Propylene glycol BETA_-monoethyl ether | C(CCO)OCC |
Propylene glycol monoethyl ether, BETA_ | C(CCO)OCC |
Propylene_glycol_monoethyl_ether__BETA_ | C(CCO)OCC |
Resorcinol monoethyl ether | O(CC)c1cccc(O)c1 |
Resorcinol_monoethyl_ether | O(CC)c1cccc(O)c1 |
Sebacic acid, monoethyl ester | C(CCCCCC(=O)O)CCC(=O)OCC |