If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
5-Benzyl L-glutamate polymer | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
5-Benzyl L-glutamate | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
ALPHA_-Monosodium glutamate | C(N)(CCC(=O)O)C(=O)O |
ALPHA_-Poly(GAMMA_-benzyl-L-glutamate) | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
Arginine glutamate(USAN) | C(N)(CCC(=O)O)C(=O)O.N=C(N)NCCCC(N)C(=O)O |
Arginine, glutamate, L- | C(N)(CCC(=O)O)C(=O)O.N=C(N)NCCCC(N)C(=O)O |
Diethyl L-glutamate hydrochloride | C(CC(=O)OCC)C(N)C(=O)OCC |
Diethyl N-(4-(methylamino)benzoyl)-L-glutamate | C(CCC(=O)OCC)(NC(=O)c1ccc(NC)cc1)C(=O)OCC |
Diethyl N-(p-N-methylaminobenzoyl)glutamate | C(CCC(=O)OCC)(NC(=O)c1ccc(NC)cc1)C(=O)OCC |
Diethyl glutamate hydrochloride | C(CC(=O)OCC)C(N)C(=O)OCC |
Ethyl glutamate | C(CC(N)C(=O)O)C(=O)OCC |
GAMMA_-Benzyl L-glutamate homopolymer | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
GAMMA_-Benzyl L-glutamate polymer | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
GAMMA_-Benzyl L-glutamate | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
GAMMA_-Ethyl L-glutamate | C(CC(N)C(=O)O)C(=O)OCC |
L-(+)-Sodium glutamate | C(N)(CCC(=O)O)C(=O)O |
L-Arginine L-glutamate (1:1) | C(N)(CCC(=O)O)C(=O)O.N=C(N)NCCCC(N)C(=O)O |
L-Arginine glutamate | C(N)(CCC(=O)O)C(=O)O.N=C(N)NCCCC(N)C(=O)O |
L-Glutamate-GAMMA_-ethyl ester | C(CC(N)C(=O)O)C(=O)OCC |
L-Glutamate-GAMMA_-hydrazide | C(CC(=O)NN)C(N)C(=O)O |
L-Lysine L-glutamate | C(N)(CCC(=O)O)C(=O)O.NCCCCC(N)C(=O)O |
Lysine glutamate | C(N)(CCC(=O)O)C(=O)O.NCCCCC(N)C(=O)O |
Monosodium L-glutamate | C(N)(CCC(=O)O)C(=O)O |
Monosodium glutamate | C(N)(CCC(=O)O)C(=O)O |
Poly(5-benzyl L-glutamate) | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
Poly(GAMMA_-(phenylmethyl) L-glutamate) | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
Poly(GAMMA_-benzyl L-glutamate) | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
Poly(GAMMA_-benzyl glutamate) (VAN) | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
Sodium L-glutamate (VAN) | C(N)(CCC(=O)O)C(=O)O |
Sodium glutamate (VAN) | C(N)(CCC(=O)O)C(=O)O |
Sodium hydrogen glutamate | C(N)(CCC(=O)O)C(=O)O |