If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Antipyrine | CN1C(C)=CC(=O)N1c2ccccc2 |
4-((3-Methyl-2-phenylmorpholino)methyl)antipyrine | O=C1C(CN2CCOC(C2C)c3ccccc3)=C(C)N(C)N1c4ccccc4 |
4-(Benzylideneamino)antipyrine | O=C1C(N=Cc2ccccc2)=C(C)N(C)N1c3ccccc3 |
4-(Dimethylamino)antipyrine | O=C1C(N(C)C)=C(C)N(C)N1c2ccccc2 |
Antipyrine | CN1C(C)=CC(=O)N1c2ccccc2 |
Antipyrine, 4,4'-methylenedi- | O=C1C(CC2=C(C)N(C)N(C2=O)c3ccccc3)=C(C)N(C)N1c4ccccc4 |
Antipyrine, 4-((3-methyl-2-phenylmorpholino)methyl)- | O=C1C(CN2CCOC(C2C)c3ccccc3)=C(C)N(C)N1c4ccccc4 |
Antipyrine, 4-(benzylideneamino)- | O=C1C(N=Cc2ccccc2)=C(C)N(C)N1c3ccccc3 |
Antipyrine, 4-(dimethylamino)- | O=C1C(N(C)C)=C(C)N(C)N1c2ccccc2 |
Antipyrine, 4-acetamido- | O=C1C(NC(C)=O)=C(C)N(C)N1c2ccccc2 |
Antipyrine, 4-amino- | O=C1C(N)=C(C)N(C)N1c2ccccc2 |
Antipyrine, 4-amino-, monohydrochloride | O=C1C(N)=C(C)N(C)N1c2ccccc2 |
Antipyrine, 4-bromo- | O=C1C(Br)=C(C)N(C)N1c2ccccc2 |
Antipyrine, 4-formyl- | O=C1C(C=O)=C(C)N(C)N1c2ccccc2 |
Antipyrine, 4-nitroso- | O=C1C(N=O)=C(C)N(C)N1c2ccccc2 |
BETA_-Antipyrine | CN1C(C)=CC(=O)N1c2ccccc2 |
Methoxy-4-antipyrine | O=C1C(OC)=C(C)N(C)N1c2ccccc2 |