If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Biphenylol acetate | O(C(C)=O)c1ccccc1c2ccccc2 |
2-Biphenylol sodium salt | Oc1ccccc1c2ccccc2 |
2-Biphenylol | Oc1ccccc1c2ccccc2 |
2-Biphenylol, 3, 5-dichloro- | Oc1c(Cl)cc(Cl)cc1c2ccccc2 |
2-Biphenylol, 3,5-dinitro- | Oc1c(cc(cc1c2ccccc2)[N+](=O)[O-])[N+](=O)[O-] |
2-Biphenylol, 3-chloro- | Oc1c(Cl)cccc1c2ccccc2 |
2-Biphenylol, 5-chloro- | Oc1ccc(Cl)cc1c2ccccc2 |
2-Biphenylol, 5-tert-butyl- | Oc1ccc(cc1c2ccccc2)C(C)(C)C |
2-Biphenylol, acetate | O(C(C)=O)c1ccccc1c2ccccc2 |
2-Biphenylol, phosphate (3:1) | O(c1ccccc1c2ccccc2)P(=O)(Oc3ccccc3c4ccccc4)Oc5ccccc5c6ccccc6 |
2-Biphenylol, sodium salt | Oc1ccccc1c2ccccc2 |
3, 5-Dichloro-2-biphenylol | Oc1c(Cl)cc(Cl)cc1c2ccccc2 |
3,5-Dinitro-2-biphenylol | Oc1c(cc(cc1c2ccccc2)[N+](=O)[O-])[N+](=O)[O-] |
3-Biphenylol | Oc1cccc(c1)c2ccccc2 |
3-Chloro-2-biphenylol | Oc1c(Cl)cccc1c2ccccc2 |
3-Chloro-4-biphenylol | Clc1cc(ccc1O)c2ccccc2 |
4-Biphenylol | Oc1ccc(cc1)c2ccccc2 |
4-Biphenylol, 3-amino- | Nc1cc(ccc1O)c2ccccc2 |
4-Biphenylol, 3-chloro- | Clc1cc(ccc1O)c2ccccc2 |
4-Biphenylol, acetate | O(C(C)=O)c1ccc(cc1)c2ccccc2 |
5-Chloro-2-biphenylol | Oc1ccc(Cl)cc1c2ccccc2 |
o-Biphenylol | Oc1ccccc1c2ccccc2 |
p-Biphenylol | Oc1ccc(cc1)c2ccccc2 |