If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
7-Deaza-7-cyanoadenosine | OC1C(O)C(CO)OC1N2C=C(C#N)c3c(N)ncnc23 |
Adenosine, 3-deaza- | OC1C(O)C(CO)OC1N2C=Nc3c(N)nccc23 |
Adenosine, 7-deaza- | OC1C(O)C(CO)OC1N2C=Cc3c(N)ncnc23 |
Deaza-Ado | OC1C(O)C(CO)OC1N2C=Nc3c(N)nccc23 |
Nebularine, 7-deaza- | OC1C(O)C(CO)OC1N2C=Cc3cncnc23 |