If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Bis(glycinato)copper | O=C1CN[Cu]2(O1)NCC(=O)O2 |
Bis(glycinato)copper(2+) | O=C1CN[Cu]2(O1)NCC(=O)O2 |
Bis(glycinato)copper(II) | O=C1CN[Cu]2(O1)NCC(=O)O2 |
Copper, bis(glycinato(1-))- | O=C1CN[Cu]2(O1)NCC(=O)O2 |
Copper, bis(glycinato)- | O=C1CN[Cu]2(O1)NCC(=O)O2 |
Copper, bis(glycinato-N,O)- | O=C1CN[Cu]2(O1)NCC(=O)O2 |
Nickel, bis(glycinato-N,O)- | O=C1CN[Ni]2(O1)NCC(=O)O2 |
Nickel__bis(glycinato-N_O)- | O=C1CN[Ni]2(O1)NCC(=O)O2 |
Platinate(1-), dichloro(glycinato-N,O)-, potassium, (SP-4-3)- | Cl[Pt]1(Cl)NCC(=O)O1 |
Platinate(1-)__dichloro(glycinato-N_O)-__potassium__(SP-4-3)- | Cl[Pt]1(Cl)NCC(=O)O1 |
Platinate(2-), dichlorobis(glycinato-N)-, dihydrogen, (SP-4-2)- | [Pt](Cl)(Cl)(NCC(=O)O)NCC(=O)O |
Platinate(2-)__dichlorobis(glycinato-N)-__dihydrogen__(SP-4-2)- | [Pt](Cl)(Cl)(NCC(=O)O)NCC(=O)O |
Platinum, bis(glycinato)-, trans- | O=C1CN[Pt]2(O1)NCC(=O)O2 |
Platinum, bis(glycinato-N,O)-, (SP-4-1)- | O=C1CN[Pt]2(O1)NCC(=O)O2 |
Platinum, bis(glycinato-N,O)-, (SP-4-2)- | O=C1CN[Pt]2(O1)NCC(=O)O2 |
Platinum__bis(glycinato-N_O)-__(SP-4-1)- | O=C1CN[Pt]2(O1)NCC(=O)O2 |
Platinum__bis(glycinato-N_O)-__(SP-4-2)- | O=C1CN[Pt]2(O1)NCC(=O)O2 |
cis-Bis(glycinato)platinum(II) | O=C1CN[Pt]2(O1)NCC(=O)O2 |
trans-Bis(glycinato)platinum | O=C1CN[Pt]2(O1)NCC(=O)O2 |