If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Adenosine 5'-(trihydrogen pyrophosphate), monosodium salt | OC1C(O)C(COP(=O)(O)OP(=O)(O)O)OC1N2C=Nc3c(N)ncnc23 |
Adenosine_5'-(trihydrogen_pyrophosphate)__monosodium_salt | OC1C(O)C(COP(=O)(O)OP(=O)(O)O)OC1N2C=Nc3c(N)ncnc23 |
Anhydrous tetrasodium pyrophosphate | O(P(=O)(O)O)P(=O)(O)O |
Butyl pyrophosphate | P(=O)(OCCCC)(OCCCC)OP(=O)(OCCCC)OCCCC |
Butyl_pyrophosphate | P(=O)(OCCCC)(OCCCC)OP(=O)(OCCCC)OCCCC |
Choline cytidine 5'-pyrophosphate (ester) | OC1C(O)C(COP(=O)(O)OP(=O)(O)OCCN(C)(C)C)OC1N2C=CC(=N)NC2=O |
Choline cytidine 5'-pyrophosphate ester | OC1C(O)C(COP(=O)(O)OP(=O)(O)OCCN(C)(C)C)OC1N2C=CC(=N)NC2=O |
Choline, ester with cytidine 5'-pyrophosphate | OC1C(O)C(COP(=O)(O)OP(=O)(O)OCCN(C)(C)C)OC1N2C=CC(=N)NC2=O |
Cytidine 5'-(cholinyl pyrophosphate) | OC1C(O)C(COP(=O)(O)OP(=O)(O)OCCN(C)(C)C)OC1N2C=CC(=N)NC2=O |
Cytidine, 5'-pyrophosphate, ester with choline | OC1C(O)C(COP(=O)(O)OP(=O)(O)OCCN(C)(C)C)OC1N2C=CC(=N)NC2=O |
Dimethyl acid pyrophosphate | O(P(=O)(O)OC)P(=O)(O)OC |
Ethyl pyrophosphate (Et4P2O7) | O(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
Ethyl pyrophosphate | P(=O)(O)(OCC)OP(=O)(O)OCC |
Ethyl pyrophosphate, tetra- | O(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
Ethyl_pyrophosphate | P(=O)(O)(OCC)OP(=O)(O)OCC |
Octamethyl tetramido pyrophosphate | P(=O)(OP(=O)(N(C)C)N(C)C)(N(C)C)N(C)C |
Pyrophosphate de tetraethyle(FRENCH) | O(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
Pyrophosphate sodium salt | O(P(=O)(O)O)P(=O)(O)O |
Sodium pyrophosphate (Na4(P2O7)) | O(P(=O)(O)O)P(=O)(O)O |
Sodium pyrophosphate (Na4P2O7) | O(P(=O)(O)O)P(=O)(O)O |
Sodium pyrophosphate(USAN) | O(P(=O)(O)O)P(=O)(O)O |
Sodium pyrophosphate, Na4P2O7 | O(P(=O)(O)O)P(=O)(O)O |
Tetraethyl dithio pyrophosphate, liquid (DOT) | O(P(=S)(OCC)OCC)P(=S)(OCC)OCC |
Tetraethyl pyrophosphate mixture, dry (DOT) | O(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
Tetraethyl pyrophosphate mixture, liquid (DOT) | O(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
Tetraethyl pyrophosphate | O(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
Tetraethyl pyrophosphate, liquid(DOT) | O(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
Tetrasodium pyrophosphate | O(P(=O)(O)O)P(=O)(O)O |
Tetrasodium pyrophosphate, anhydrous | O(P(=O)(O)O)P(=O)(O)O |