If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
WLN: T5N CSJ BMSWR DMVR BVQ | C(=O)(Nc1ccc(cc1)S(=O)(=O)NC2=NC=CS2)c3ccccc3C(=O)O |
WLN: T5N CSJ BMSWR DZ | S(=O)(=O)(NC1=NC=CS1)c2ccc(N)cc2 |
WLN: T6N CNJ BMSWR CZ& EG | S(=O)(=O)(Nc1ncc(Cl)cn1)c2cccc(N)c2 |
WLN: T6N CNJ BMSWR DZ &-NA- | S(=O)(=O)(Nc1ncccn1)c2ccc(N)cc2 |
WLN: T6N CNJ BMSWR DZ | S(=O)(=O)(Nc1ncccn1)c2ccc(N)cc2 |
WLN: T6N CNJ BMSWR DZ& D1 F1 | S(=O)(=O)(Nc1nc(C)cc(C)n1)c2ccc(N)cc2 |
WLN: T6N CNJ BMSWR DZ& DO1 FO1 | N(c1nc(OC)cc(OC)n1)S(=O)(=O)c2ccc(N)cc2 |
WLN: T6NJ BMSWR DZ | S(=O)(=O)(Nc1ccccn1)c2ccc(N)cc2 |