If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(-)-Malic acid | C(O)(CC(=O)O)C(=O)O |
(S)-Malic acid | C(O)(CC(=O)O)C(=O)O |
.+-.-Malic acid | C(O)(CC(=O)O)C(=O)O |
L-(-)-Malic acid | C(O)(CC(=O)O)C(=O)O |
L-Malic acid | C(O)(CC(=O)O)C(=O)O |
MALIC ACID, (L) | C(O)(CC(=O)O)C(=O)O |
MALIC ACID,(DL) | C(O)(CC(=O)O)C(=O)O |
Malic acid, 2-thio- | C(S)(CC(=O)O)C(=O)O |
Malic acid, 3-amino- | C(N)(C(=O)O)C(O)C(=O)O |
Malic acid, 3-hydroxy- | C(O)(C(=O)O)C(O)C(=O)O |
Malic acid, DL- | C(O)(CC(=O)O)C(=O)O |
Malic acid, L- | C(O)(CC(=O)O)C(=O)O |
Malic acid, dibutyl ester | C(O)(CC(=O)OCCCC)C(=O)OCCCC |
Malic acid, dibutyl ester, (.+-.)- | C(O)(CC(=O)OCCCC)C(=O)OCCCC |
Malic acid, dimethyl ester | C(O)(CC(=O)OC)C(=O)OC |
S-(-)-Malic acid | C(O)(CC(=O)O)C(=O)O |
dl-Malic acid | C(O)(CC(=O)O)C(=O)O |