If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Methyl-5-phenyltetrazole | CN1N=NN=C1c2ccccc2 |
1-Phenyltetrazole-5-thiol | S=C1N=NNN1c2ccccc2 |
1-Phenyltetrazole-thiol | S=C1N=NNN1c2ccccc2 |
2-Methyl-5-phenyltetrazole | CN1N=NC(=N1)c2ccccc2 |
5-(Ethyl(benzylamino))-1-phenyltetrazole | N(CC)(Cc1ccccc1)C2=NN=NN2c3ccccc3 |
5-Amino-1-phenyltetrazole | N=C1N=NNN1c2ccccc2 |
5-Ethylamino-1-phenyltetrazole | N(CC)C1=NN=NN1c2ccccc2 |
5-Mercapto-1-phenyltetrazole | S=C1N=NNN1c2ccccc2 |
5-Phenyltetrazole (VAN) | C1(=NN=NN1)c2ccccc2 |