If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Piperazinecarboxamide | C(N)(=O)N1CCNCC1 |
1-Piperazinecarboxamide, N,N-diethyl-4-methyl-, citrate (1:1) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O.CCN(CC)C(=O)N1CCN(C)CC1 |
1-Piperazinecarboxamide, N,N-diethyl-4-methyl-, hydrochloride | C(=O)(N(CC)CC)N1CCN(C)CC1 |
1-Piperazinecarboxamide, N,N-diethyl-4-methyl-, monohydrochloride | C(=O)(N(CC)CC)N1CCN(C)CC1 |
1-Piperazinecarboxamide__N_N-diethyl-4-methyl-__monohydrochloride | C(=O)(N(CC)CC)N1CCN(C)CC1 |
N, N-Diethyl-4-methyl-1-piperazinecarboxamide dihydrogen citrate | C(O)(CC(=O)O)(CC(=O)O)C(=O)O.CCN(CC)C(=O)N1CCN(C)CC1 |
N,N-Diethyl-4-methyl-1-piperazinecarboxamide citrate | C(O)(CC(=O)O)(CC(=O)O)C(=O)O.CCN(CC)C(=O)N1CCN(C)CC1 |