If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(+)-Pantothenic acid, calcium salt | C(O)(C(=O)NCCC(=O)O)C(C)(C)CO |
PANTOTHENIC ACID | C(O)(C(=O)NCCC(=O)O)C(C)(C)CO |
Pantothenic acid calcium salt | C(O)(C(=O)NCCC(=O)O)C(C)(C)CO |
Pantothenic acid, calcium salt (2:1), ( +)- | C(O)(C(=O)NCCC(=O)O)C(C)(C)CO |
Pantothenic acid, calcium salt (2:1), D- | C(O)(C(=O)NCCC(=O)O)C(C)(C)CO |
Pantothenic acid, calcium salt | C(O)(C(=O)NCCC(=O)O)C(C)(C)CO |
Pantothenic acid, calcium salt, (+)- | C(O)(C(=O)NCCC(=O)O)C(C)(C)CO |
Pantothenic acid, calcium salt, D-, compd. with calcium chloride | C(O)(C(=O)NCCC(=O)O)C(C)(C)CO |