If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(+)-Catechin | OC1Cc2c(O)cc(O)cc2OC1c3ccc(O)c(O)c3 |
CATECHIN, ALPHA | OC1Cc2c(O)cc(O)cc2OC1c3ccc(O)c(O)c3 |
CATECHIN, D | OC1Cc2c(O)cc(O)cc2OC1c3ccc(O)c(O)c3 |
CATECHIN__ALPHA | OC1Cc2c(O)cc(O)cc2OC1c3ccc(O)c(O)c3 |
Catechin (VAN) | Oc1ccccc1O |
Catechin (flavan) (VAN) | OC1Cc2c(O)cc(O)cc2OC1c3ccc(O)c(O)c3 |
Catechin (phenol) | Oc1ccccc1O |
d-Catechin | OC1Cc2c(O)cc(O)cc2OC1c3ccc(O)c(O)c3 |