If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-Propynoic acid | C(=O)(O)C#C |
2-Propynoic acid, 2-(4-chlorophenyl)- | C(#CC(=O)O)c1ccc(Cl)cc1 |
2-Propynoic acid, 2-propenyl ester | C(=O)(C#C)OCC=C |
2-Propynoic acid, 3-(2-chlorophenyl)- | C(#CC(=O)O)c1ccccc1Cl |
2-Propynoic acid, 3-(2-nitrophenyl)- | C(#CC(=O)O)c1ccccc1[N+](=O)[O-] |
2-Propynoic acid, 3-(3-chlorophenyl)- | C(#CC(=O)O)c1cccc(Cl)c1 |
2-Propynoic acid, 3-bromo-, methyl ester | C(=O)(OC)C#CBr |
2-Propynoic acid, 3-phenyl- | C(#CC(=O)O)c1ccccc1 |
2-Propynoic acid, 3-phenyl-, ethyl ester | C(#CC(=O)OCC)c1ccccc1 |
2-Propynoic acid, compd. with phenylmethyl carbamimidothioate (1:1) | C(=O)(O)C#C.N=C(N)SCc1ccccc1 |
2-Propynoic acid, ethyl ester | C(=O)(C#C)OCC |
2-Propynoic acid, methyl ester | C(=O)(C#C)OC |
2-Propynoic_acid__2-(4-chlorophenyl)- | C(#CC(=O)O)c1ccc(Cl)cc1 |
2-Propynoic_acid__3-(2-chlorophenyl)- | C(#CC(=O)O)c1ccccc1Cl |
2-Propynoic_acid__3-(2-nitrophenyl)- | C(#CC(=O)O)c1ccccc1[N+](=O)[O-] |
2-Propynoic_acid__3-(3-chlorophenyl)- | C(#CC(=O)O)c1cccc(Cl)c1 |
2-Propynoic_acid__3-bromo-__methyl_ester | C(=O)(OC)C#CBr |
2-Propynoic_acid__compd._with_phenylmethyl_carbamimidothioate_(1:1) | C(=O)(O)C#C.N=C(N)SCc1ccccc1 |
2-Propynoic_acid__ethyl_ester | C(=O)(C#C)OCC |
2-Propynoic_acid__methyl_ester | C(=O)(C#C)OC |
Propynoic acid | C(=O)(O)C#C |