If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Daito Grounder BG | C(=O)(Nc1cc(OC)ccc1OC)c2cc3ccccc3cc2O |
Daito Grounder BS | C(=O)(Nc1cccc(c1)[N+](=O)[O-])c2cc3ccccc3cc2O |
Daito Grounder D | C(=O)(Nc1ccccc1C)c2cc3ccccc3cc2O |
Daito Grounder E | C(=O)(Nc1ccc(Cl)cc1)c2cc3ccccc3cc2O |
Daito Grounder G | Cc1cc(ccc1NC(=O)CC(C)=O)c2ccc(NC(=O)CC(C)=O)c(C)c2 |
Daito Grounder ITR | C(=O)(Nc1cc(Cl)c(OC)cc1OC)c2cc3ccccc3cc2O |
Daito Grounder L4G | N(C(=O)CC(C)=O)C1=Nc2ccc(OCC)cc2S1 |
Daito Grounder OL | C(=O)(Nc1ccccc1OC)c2cc3ccccc3cc2O |
Daito Grounder RL | C(=O)(Nc1ccc(OC)cc1)c2cc3ccccc3cc2O |
Daito Grounder TR | C(=O)(Nc1ccc(Cl)cc1C)c2cc3ccccc3cc2O |
Daito Grounder phenyl | C(=O)(Nc1ccccc1OCC)c2cc3ccccc3cc2O |
Kiwa Grounder G | Cc1cc(ccc1NC(=O)CC(C)=O)c2ccc(NC(=O)CC(C)=O)c(C)c2 |