If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Cinnamoyl-1,2,3, 4-tetrahydroquinoline | C(=O)(C=Cc1ccccc1)N2CCCc3ccccc23 |
Cinnamoyl chloride | C(=CC(Cl)=O)c1ccccc1 |
Hydroxylamine, N-cinnamoyl- | C(=CC(=O)NO)c1ccccc1 |
Imidazole, 1-cinnamoyl-, (E)- | C(=O)(C=Cc1ccccc1)N2C=CN=C2 |
Imidazole, 1-cinnamoyl-, trans- | C(=O)(C=Cc1ccccc1)N2C=CN=C2 |
Morpholine, 4-cinnamoyl- | C(=O)(C=Cc1ccccc1)N2CCOCC2 |
Piperidine, 1-(3,4-(methylenedioxy)cinnamoyl)- | C(=CC(=O)N1CCCCC1)c2ccc3OCOc3c2 |
Piperidine, 1-cinnamoyl- | C(=O)(C=Cc1ccccc1)N2CCCCC2 |
Quinoline, 1, 2,3,4-tetrahydro-1-cinnamoyl- | C(=O)(C=Cc1ccccc1)N2CCCc3ccccc23 |
Quinoline, 1-cinnamoyl-1,2,3,4-tetrahydro- | C(=O)(C=Cc1ccccc1)N2CCCc3ccccc23 |