If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3H-Phenothiazine-3-one, 2-amino-, monochloride (8CI 9CI) | NC1=CC2=Nc3ccccc3SC2=CC1=O |
Arginine monochloride | C(CCNC(=N)N)C(N)C(=O)O |
Cesium monochloride | Cl[Cs] |
Diphenylphosphoric acid monochloride | O(c1ccccc1)P(Cl)(=O)Oc2ccccc2 |
Phenol, p-(2-aminoethyl)-, monochloride | C(CN)c1ccc(O)cc1 |
Potassium monochloride | Cl[K] |
Rubidium monochloride | Cl[Rb] |
Sodium monochloride | Cl[Na] |
Thallium monochloride | Cl[Tl] |
Triethylene glycol monochloride | C(OCCCl)COCCO |
Trimellitic anhydride monochloride | O=C1OC(=O)c2ccc(cc12)C(Cl)=O |
Tris(triphenylphosphine)rhodium monochloride | [Rh](Cl)(P(c1ccccc1)(c2ccccc2)c3ccccc3)(P(c4ccccc4)(c5ccccc5)c6ccccc6)P(c7ccccc7)(c8ccccc8)c9ccccc9 |
Tyramine monochloride | C(CN)c1ccc(O)cc1 |