If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Methyl-3-(2,5-dimethylbenzoyl)propanoic acid | C(=O)(CC(C)C(=O)O)c1cc(C)ccc1C |
BETA_-(2,5-Dimethylbenzoyl)propionic acid | C(=O)(CCC(=O)O)c1cc(C)ccc1C |
Propionic acid, 3-(2, 5-dimethylbenzoyl)- | C(=O)(CCC(=O)O)c1cc(C)ccc1C |
Propionic acid, 3-(2,5-dimethylbenzoyl)-2-methyl- | C(=O)(CC(C)C(=O)O)c1cc(C)ccc1C |
Propionic_acid__3-(2_5-dimethylbenzoyl)-2-methyl- | C(=O)(CC(C)C(=O)O)c1cc(C)ccc1C |