If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(2,4,6-Tribromophenyl)-3,3-dimethyltriazene | N(=NN(C)C)c1c(Br)cc(Br)cc1Br |
1-Triazene, 3, 3-dimethyl-1-(2,4,6-tribromophenyl)- | N(=NN(C)C)c1c(Br)cc(Br)cc1Br |
1-Triazene__3__3-dimethyl-1-(2_4_6-tribromophenyl)- | N(=NN(C)C)c1c(Br)cc(Br)cc1Br |
3,3-Dimethyl-1-(2,4, 6-tribromophenyl)triazene | N(=NN(C)C)c1c(Br)cc(Br)cc1Br |
Allyl 2,4,6-tribromophenyl ether | O(CC=C)c1c(Br)cc(Br)cc1Br |
Ether, allyl 2,4, 6-tribromophenyl | O(CC=C)c1c(Br)cc(Br)cc1Br |
Methyl 2,4,6-tribromophenyl ether | O(C)c1c(Br)cc(Br)cc1Br |