If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-(Methylthio)-4-pyrimidone | S(C)c1nccc(O)n1 |
2-Amino-4-pyrimidone | Oc1ccnc(N)n1 |
2-Mercapto-4-pyrimidone | Oc1ccnc(S)n1 |
2-Mercapto-6-methyl-4-pyrimidone | Cc1cc(O)nc(S)n1 |
2-Mercapto-6-propyl-4-pyrimidone | C(CC)c1cc(O)nc(S)n1 |
Pyrimidone Medi-pets | C(C)C1(C(=O)NCNC1=O)c2ccccc2 |