If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,4-Tetramethylene glycol | C(CO)CCO |
1-Butanesulfonic acid, 3-methyl-, tetramethylene ester | S(=O)(=O)(OCCCCOS(=O)(=O)CCC(C)C)CCC(C)C |
1-Tetramethylene-3-p-tolylsulfonylurea | S(=O)(=O)(NC(=O)N1CCCC1)c2ccc(C)cc2 |
1_4-Tetramethylene_glycol | C(CO)CCO |
2,3-Tetramethylene-1H-indole | C12CCCCC2Nc3c1cccc3 |
3,3'-Tetramethylene glutaric acid | C(C(=O)O)C1(CCCC1)CC(=O)O |
3_3'-Tetramethylene_glutaric_acid | C(C(=O)O)C1(CCCC1)CC(=O)O |
Cyclic tetramethylene sulfone | O=S1(=O)CCCC1 |
Formaldehyde, cyclic tetramethylene acetal | C1CCOCOC1 |
Formaldehyde__cyclic_tetramethylene_acetal | C1CCOCOC1 |
Methanesulfonic acid, chloro-, tetramethylene ester | S(=O)(=O)(CCl)OCCCCOS(=O)(=O)CCl |
Methanesulfonic acid, tetramethylene ester | O(CCCCOS(C)(=O)=O)S(C)(=O)=O |
Methanesulfonic_acid__chloro-__tetramethylene_ester | S(=O)(=O)(CCl)OCCCCOS(=O)(=O)CCl |
Octanoic acid, tetramethylene ester | O(CCCCOC(=O)CCCCCCC)C(=O)CCCCCCC |
Phosphonic acid, (dichloromethyl)-, cyclic tetramethylene ester | C(Cl)(Cl)P1(=O)OCCCCO1 |
Phosphonic_acid__(dichloromethyl)-__cyclic_tetramethylene_ester | C(Cl)(Cl)P1(=O)OCCCCO1 |
Pseudourea, 2, 2'-tetramethylene(dithio-, dihydrobromide | C(CCCSC(=N)N)SC(=N)N |
Tetramethylene Blue | N(C)(C)c1ccc2nc3ccc(cc3sc2c1)N(C)C |
Tetramethylene acetate | C(CCCOC(C)=O)OC(C)=O |
Tetramethylene bis(methanesulfonate) | O(CCCCOS(C)(=O)=O)S(C)(=O)=O |
Tetramethylene chlorobromide | C(CBr)CCCl |
Tetramethylene chlorohydrin | C(CCl)CCO |
Tetramethylene cyanide | C(CC#N)CCC#N |
Tetramethylene diacetate | C(CCCOC(C)=O)OC(C)=O |
Tetramethylene dibromide | C(CBr)CCBr |
Tetramethylene dicyanide | C(CC#N)CCC#N |
Tetramethylene diiodide | C(CI)CCI |
Tetramethylene dimethane sulfonate | O(CCCCOS(C)(=O)=O)S(C)(=O)=O |
Tetramethylene disulfide | C1CCSSC1 |
Tetramethylene formal | C1CCOCOC1 |
Tetramethylene glycol diglycidyl ether | C(OCCCCOCC1CO1)C2CO2 |
Tetramethylene glycol | C(CO)CCO |
Tetramethylene oxide | C1CCOC1 |
Tetramethylene phosphate | O=P1(O)OCCCCO1 |
Tetramethylene phosphoric acid | O=P1(O)OCCCCO1 |
Tetramethylene sulfide | C1CCSC1 |
Tetramethylene sulfone | O=S1(=O)CCCC1 |
Tetramethylene sulfone, 2,3-epoxy- | O=S1(=O)CC2OC2C1 |
Tetramethylene sulfoxide | O=S1CCCC1 |
Tetramethylene-bismaleimide | C(CCCN1C(=O)C=CC1=O)N2C(=O)C=CC2=O |
Tetramethylene_chlorobromide | C(CBr)CCCl |
Tetramethylene_chlorohydrin | C(CCl)CCO |
Tetramethylene_dibromide | C(CBr)CCBr |
Tetramethylene_diiodide | C(CI)CCI |
Tetramethylene_disulfide | C1CCSSC1 |
Tetramethylene_sulfide | C1CCSC1 |