If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
WLN: OCNR B1 D1R C1 DNCO | C(c1ccc(N=C=O)c(C)c1)c2ccc(N=C=O)c(C)c2 |
WLN: OCNR B1 DR C1 DNCO | Cc1cc(ccc1N=C=O)c2ccc(N=C=O)c(C)c2 |
WLN: OCNR B1 ENCO | N(=C=O)c1cc(N=C=O)ccc1C |
WLN: OCNR BO1 DR CO1 DNCO | O(C)c1cc(ccc1N=C=O)c2ccc(N=C=O)c(OC)c2 |
WLN: OCNR CG | N(=C=O)c1cccc(Cl)c1 |
WLN: OCNR D1R DNCO | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
WLN: OCNR DG | N(=C=O)c1ccc(Cl)cc1 |
WLN: OCNR | N(=C=O)c1ccccc1 |