If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 2-Butene oxide (VAN) | C(C)C1CO1 |
1, 4-Bis(bromoacetoxy)-2-butene | C(=O)(CBr)OCC=CCOC(=O)CBr |
1, 4-Diphenyl-2-butene-1,4-dione | C(=O)(C=CC(=O)c1ccccc1)c2ccccc2 |
1,1-Dimethyl-2-butene | C(=CC)C(C)C |
1,2-Epoxy-3-butene | C(=C)C1CO1 |
1,2-Oxido-3-butene | C(=C)C1CO1 |
1,3-Dichloro-2-butene | C(CCl)=C(C)Cl |
1,4-Dibromo-2-butene | C(CBr)=CCBr |
1,4-Dichloro-2-butene | C(CCl)=CCCl |
1,4-Dicyano-2-butene | C(CC#N)=CCC#N |
1,4-Diethoxy-2-butene | C(COCC)=CCOCC |
1,4-Dihydroxy-2-butene | C(CO)=CCO |
1-(1-Pyrrolidinyl)-1-butene | C(=CCC)N1CCCC1 |
1-Bromo-2-butene | C(CBr)=CC |
1-Butene , 2-nitro-1-phenyl- | C(c1ccccc1)=C(CC)[N+](=O)[O-] |
1-Butene oxide | C(C)C1CO1 |
1-Butene, 2,3,3-trimethyl- | C(C)(C)(C)C(C)=C |
1-Butene, 2,3-dimethyl- | C(C)(C)C(C)=C |
1-Butene, 2-cyclopropyl- | C(=C)(CC)C1CC1 |
1-Butene, 2-cyclopropyl-3-methyl- | C(=C)(C(C)C)C1CC1 |
1-Butene, 2-ethyl- | C(=C)(CC)CC |
1-Butene, 2-ethyl-3-methyl- | C(=C)(CC)C(C)C |
1-Butene, 2-methyl- | C(C)(=C)CC |
1-Butene, 2-methyl-4-phenyl- | C(CC(C)=C)c1ccccc1 |
1-Butene, 3,3-dimethyl- | C(C)(C)(C)C=C |
1-Butene, 3,4-epoxy- | C(=C)C1CO1 |
1-Butene, 3-chloro- | C(C)(Cl)C=C |
1-Butene, 3-methyl-3-phenyl- | C(C)(C)(C=C)c1ccccc1 |
1-Butene, 4,4, 4-triphenyl- | C(CC=C)(c1ccccc1)(c2ccccc2)c3ccccc3 |
1-Butene, 4-bromo-3-chloro-3,4,4-trifluoro- | C(Cl)(F)(C=C)C(Br)(F)F |
1-Butene, 4-phenyl- | C(CC=C)c1ccccc1 |
1-Butene-4-nitrile | C(C=C)C#N |
1-Butene__2-cyclopropyl-3-methyl- | C(=C)(C(C)C)C1CC1 |
1-Butene__2-ethyl-3-methyl- | C(=C)(CC)C(C)C |
1-Butene__2-methyl- | C(C)(=C)CC |
1-Butene__2_3-dimethyl- | C(C)(C)C(C)=C |
1-Butene__2_3_3-trimethyl- | C(C)(C)(C)C(C)=C |
1-Butene__3_3-dimethyl- | C(C)(C)(C)C=C |
1-Butene__4-bromo-3-chloro-3_4_4-trifluoro- | C(Cl)(F)(C=C)C(Br)(F)F |
1-Ethyleneimino-2-hydroxy-3-butene | C(C(O)C=C)N1CC1 |
1-Phenyl-2-butene | C(C=CC)c1ccccc1 |
1-Phenyl-3-butene | C(CC=C)c1ccccc1 |
1-Pyrrolidino-1-butene | C(=CCC)N1CCCC1 |
1_1-Dimethyl-2-butene | C(=CC)C(C)C |
1_4-Dihydroxy-2-butene | C(CO)=CCO |
1__2-Butene_oxide_(VAN) | C(C)C1CO1 |
2, 2-Dimethyl-3-butene | C(C)(C)(C)C=C |
2, 3-Dimethyl-2-Butene | C(C)(C)=C(C)C |
2, 3-Dimethyl-2-butene oxide | CC1(C)OC1(C)C |
2,3, 3-Trimethyl-1-butene | C(C)(C)(C)C(C)=C |
2,3-Dimethyl-1-butene | C(C)(C)C(C)=C |
2,3-Dimethyl-2-butene | C(C)(C)=C(C)C |
2,3:4, 5-Bis(2-butene-1,4-diyl)tetrahydrofurfural | C(=O)C12CC=CCC1C3CC=CCC3O2 |
2-Butene, 1, 3-dichloro- | C(CCl)=C(C)Cl |
2-Butene, 1,4-dibromo- | C(CBr)=CCBr |
2-Butene, 1,4-dichloro- | C(CCl)=CCCl |
2-Butene, 1,4-diethoxy- | C(COCC)=CCOCC |
2-Butene, 1-bromo- | C(CBr)=CC |
2-Butene, 1-phenyl- | C(C=CC)c1ccccc1 |
2-Butene, 2, 3-dimethyl- | C(C)(C)=C(C)C |
2-Butene, 2-cyclopropyl- | C(C)(=CC)C1CC1 |
2-Butene, 2-methyl- | C(C)(C)=CC |
2-Butene-1, 4-dione, 1,4-diphenyl-, (Z)- | C(=O)(C=CC(=O)c1ccccc1)c2ccccc2 |
2-Butene-1,4-diamine, N, N'-dimethyl- | C(CNC)=CCNC |
2-Butene-1,4-diamine, N,N,N',N'-tetraethyl-, (E)- | N(CC)(CC)CC=CCN(CC)CC |
2-Butene-1,4-diol | C(CO)=CCO |
2-Butene-1,4-diol, 2,3-dibromo- | C(Br)(CO)=C(Br)CO |
2-Butene-1,4-dione, 1, 4-bis(4-chlorophenyl)-, (Z)- | C(=O)(C=CC(=O)c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
2-Butene-1,4-dione, 1, 4-bis(4-methylphenyl)-3-(4-morpholinyl)- | C(=CC(=O)c1ccc(C)cc1)(C(=O)c2ccc(C)cc2)N3CCOCC3 |
2-Butene-1,4-dione, 1, 4-bis(p-chlorophenyl)-, (Z)- | C(=O)(C=CC(=O)c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
2-Butene-1,4-dione, 1,2,3,4-tetraphenyl- | C(C(=O)c1ccccc1)(c2ccccc2)=C(C(=O)c3ccccc3)c4ccccc4 |
2-Butene-1,4-dione, 1,4-diphenyl- | C(=O)(C=CC(=O)c1ccccc1)c2ccccc2 |
2-Butene-1,4-dione, 1,4-diphenyl-, (E)- | C(=O)(C=CC(=O)c1ccccc1)c2ccccc2 |
2-Butene-1,4-dione, 1,4-diphenyl-2-(phenylamino)- | C(=CC(=O)c1ccccc1)(Nc2ccccc2)C(=O)c3ccccc3 |
2-Butene-1,4-dione, 2-anilino-1,4-diphenyl- | C(=CC(=O)c1ccccc1)(Nc2ccccc2)C(=O)c3ccccc3 |
2-Butene-1_4-diamine__N_N_N'_N'-tetraethyl-__(E)- | N(CC)(CC)CC=CCN(CC)CC |
2-Butene-1_4-diamine__N__N'-dimethyl- | C(CNC)=CCNC |
2-Butene-1_4-diol__2_3-dibromo- | C(Br)(CO)=C(Br)CO |
2-Butene-1_4-dione__1_2_3_4-tetraphenyl- | C(C(=O)c1ccccc1)(c2ccccc2)=C(C(=O)c3ccccc3)c4ccccc4 |
2-Butene-1_4-dione__1_4-diphenyl- | C(=O)(C=CC(=O)c1ccccc1)c2ccccc2 |
2-Butene-1_4-dione__1_4-diphenyl-2-(phenylamino)- | C(=CC(=O)c1ccccc1)(Nc2ccccc2)C(=O)c3ccccc3 |
2-Butene-1_4-dione__1_4-diphenyl-__(E)- | C(=O)(C=CC(=O)c1ccccc1)c2ccccc2 |
2-Butene-1_4-dione__1__4-bis(4-methylphenyl)-3-(4-morpholinyl)- | C(=CC(=O)c1ccc(C)cc1)(C(=O)c2ccc(C)cc2)N3CCOCC3 |
2-Butene-1_4-dione__1__4-bis(p-chlorophenyl)-__(Z)- | C(=O)(C=CC(=O)c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
2-Butene-1__4-dione__1_4-diphenyl-__(Z)- | C(=O)(C=CC(=O)c1ccccc1)c2ccccc2 |
2-Butene__1-bromo- | C(CBr)=CC |
2-Butene__1_4-dibromo- | C(CBr)=CCBr |
2-Butene__1_4-dichloro- | C(CCl)=CCCl |
2-Butene__1_4-diethoxy- | C(COCC)=CCOCC |
2-Butene__1__3-dichloro- | C(CCl)=C(C)Cl |
2-Carbomethoxy-2-butene, (E)- | C(C)(=CC)C(=O)OC |
2-Ethyl-1-butene | C(=C)(CC)CC |
2-Furancarboxaldehyde, 2,3:4,5-bis(2-butene-1,4-diyl)tetrahydro- | C(=O)C12CC=CCC1C3CC=CCC3O2 |
2-Furancarboxaldehyde__2_3:4_5-bis(2-butene-1_4-diyl)tetrahydro- | C(=O)C12CC=CCC1C3CC=CCC3O2 |
2-Methyl-1-butene | C(C)(=C)CC |
2-Methyl-2-butene | C(C)(C)=CC |
2-Methyl-4-phenyl-1-butene | C(CC(C)=C)c1ccccc1 |
3, 4-Epoxy-1-butene | C(=C)C1CO1 |
3,3-Dimethyl-1-butene | C(C)(C)(C)C=C |
3-Butene-1,1-dicarboxylic acid | C(CC=C)(C(=O)O)C(=O)O |
3-Butene-2-ol | C(C)(O)C=C |
3-Butene-2-one ethylene acetal | C(=C)C1(C)OCCO1 |
3-Butene-2-one | C(C)(=O)C=C |
3-Butene-2-one, 4-(2-furanyl)- | C(=CC(C)=O)C1=CC=CO1 |
3-Butene-2-one__4-(2-furanyl)- | C(=CC(C)=O)C1=CC=CO1 |
3-Chloro-1-butene | C(C)(Cl)C=C |
3-Hydroxy-1-butene | C(C)(O)C=C |
3-Methyl-2-butene | C(C)(C)=CC |
3-Methyl-2-ethyl-1-butene | C(=C)(CC)C(C)C |
3-Methyl-3-phenyl-1-butene | C(C)(C)(C=C)c1ccccc1 |
4-(5-Nitro-2-furyl)-3-butene-2-one | C(=CC(C)=O)C1=CC=C(O1)[N+](=O)[O-] |
4-Aziridinyl-3-hydroxy-1,2-butene | C(C(O)C=C)N1CC1 |
4-Phenyl-1-butene | C(CC=C)c1ccccc1 |
4-Phenyl-2-butene | C(C=CC)c1ccccc1 |
Acetic acid, bromo-, 2-butene-1,4-diyl ester | C(=O)(CBr)OCC=CCOC(=O)CBr |
Acetic_acid__bromo-__2-butene-1_4-diyl_ester | C(=O)(CBr)OCC=CCOC(=O)CBr |
BUTENE, (S)-1-CYANO-2-HYDROXY-3- | C(O)(C=C)CC#N |
BUTENE__(S)-1-CYANO-2-HYDROXY-3- | C(O)(C=C)CC#N |
Carbamimidothioic acid, 2-butene-1,4-diyl ester, dihydrochloride | C(C=CCSC(=N)N)SC(=N)N |
Carbamimidothioic_acid__2-butene-1_4-diyl_ester__dihydrochloride | C(C=CCSC(=N)N)SC(=N)N |
Methyl butene (DOT) | C(C)(C)=CC |
N,N'-Dimethyl-2-butene-1,4-diamine | C(CNC)=CCNC |
n-Butene-1,2-oxide | C(C)C1CO1 |
trans-1,4-Diphenyl-2-butene-1, 4-dione | C(=O)(C=CC(=O)c1ccccc1)c2ccccc2 |