If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Iodobenzoyl chloride | C(Cl)(=O)c1ccc(I)cc1 |
Glycine, N-(2-iodobenzoyl)-, monosodium salt | C(=O)(NCC(=O)O)c1ccccc1I |
Glycine__N-(2-iodobenzoyl)-__monosodium_salt | C(=O)(NCC(=O)O)c1ccccc1I |
Stannane, ((2-iodobenzoyl)oxy)tripropyl- | [Sn](CCC)(CCC)(CCC)OC(=O)c1ccccc1I |
Stannane__((2-iodobenzoyl)oxy)tripropyl- | [Sn](CCC)(CCC)(CCC)OC(=O)c1ccccc1I |
p-Iodobenzoyl chloride | C(Cl)(=O)c1ccc(I)cc1 |