If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(Ethoxycarbonyl)-4-piperidone | C(=O)(OCC)N1CCC(=O)CC1 |
1-Benzoyl-4-piperidone | C(=O)(c1ccccc1)N2CCC(=O)CC2 |
1-Benzyl-4-piperidone | C(c1ccccc1)N2CCC(=O)CC2 |
1-Carbethoxy-4-piperidone | C(=O)(OCC)N1CCC(=O)CC1 |
1-Methyl-2-piperidone | O=C1CCCCN1C |
1-Methyl-4-piperidone | O=C1CCN(C)CC1 |
2,2,6,6-Tetramethyl-4-piperidone | CC1(C)CC(=O)CC(C)(C)N1 |
2-Piperidone | O=C1CCCCN1 |
2-Piperidone, 1-methyl- | O=C1CCCCN1C |
2-Piperidone, 6-thioxo- | O=C1CCCC(=S)N1 |
4-Piperidone, 1-benzoyl- | C(=O)(c1ccccc1)N2CCC(=O)CC2 |
4-Piperidone, 1-benzyl- | C(c1ccccc1)N2CCC(=O)CC2 |
4-Piperidone, 1-hydroxy-2,2,6,6-tetramethyl- | ON1C(C)(C)CC(=O)CC1(C)C |
4-Piperidone, 1-methyl- | O=C1CCN(C)CC1 |
4-Piperidone, 2,2,6, 6-tetramethyl- | CC1(C)CC(=O)CC(C)(C)N1 |
ALPHA_-Piperidone | O=C1CCCCN1 |
N-Benzoyl-4-piperidone | C(=O)(c1ccccc1)N2CCC(=O)CC2 |
N-Benzyl-4-piperidone | C(c1ccccc1)N2CCC(=O)CC2 |
N-Methyl-2-piperidone | O=C1CCCCN1C |
N-Methyl-4-piperidone methodide | CN1(C)CCC(=O)CC1 |
N-Methyl-4-piperidone | O=C1CCN(C)CC1 |
PIPERIDONE,2- | O=C1CCCCN1 |