If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Naphthanil AS | C(=O)(Nc1ccccc1)c2cc3ccccc3cc2O |
Naphthanil AS-D | C(=O)(Nc1ccccc1C)c2cc3ccccc3cc2O |
Naphthanil BS | C(=O)(Nc1cccc(c1)[N+](=O)[O-])c2cc3ccccc3cc2O |
Naphthanil Blue B Base | O(C)c1cc(ccc1N)c2ccc(N)c(OC)c2 |
Naphthanil Bordeaux GP Base | [N+](=O)([O-])c1cc(OC)ccc1N |
Naphthanil Diazo Bordeaux GP | [N+](=O)([O-])c1cc(OC)ccc1N |
Naphthanil G | Cc1cc(ccc1NC(=O)CC(C)=O)c2ccc(NC(=O)CC(C)=O)c(C)c2 |
Naphthanil OL | C(=O)(Nc1ccccc1OC)c2cc3ccccc3cc2O |
Naphthanil OP | C(=O)(Nc1ccccc1OCC)c2cc3ccccc3cc2O |
Naphthanil RL | C(=O)(Nc1ccc(OC)cc1)c2cc3ccccc3cc2O |
Naphthanil Red 3G Base | [N+](=O)([O-])c1cc(Cl)ccc1N |
Naphthanil Red B Base | O(C)c1cc(ccc1N)[N+](=O)[O-] |
Naphthanil Red G Base | [N+](=O)([O-])c1cc(C)ccc1N |
Naphthanil SW | C(=O)(Nc1ccc2ccccc2c1)c3cc4ccccc4cc3O |
Naphthanil Scarlet 2G Base | Nc1cc(Cl)ccc1Cl |
Naphthanil Scarlet G Base | [N+](=O)([O-])c1ccc(C)c(N)c1 |