If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Hexanamide | C(CCCC)C(N)=O |
Hexanamide, 2-ethyl-N-(2-hydroxypropyl)- | C(CC)(CCCC)C(=O)NCC(C)O |
Hexanamide, 6-(acetylamino)-N,N-dimethyl- | C(CCCCNC(C)=O)C(=O)N(C)C |
Hexanamide, 6-(acetylamino)-N-methyl- | C(=O)(NC)CCCCCNC(C)=O |
Hexanamide, N,N-dibutyl- | N(CCCC)(CCCC)C(=O)CCCCC |
Hexanamide, N,N-diethyl- | N(CC)(CC)C(=O)CCCCC |
Hexanamide, N-(2-chloro-2-propenyl)-N-phenyl- | N(CC(=C)Cl)(C(=O)CCCCC)c1ccccc1 |
Hexanamide, N-(3-hydroxyphenyl)- | N(C(=O)CCCCC)c1cccc(O)c1 |
Hexanamide, N-(3-hydroxyphenyl)-2-methyl- | N(C(=O)C(C)CCCC)c1cccc(O)c1 |
Hexanamide, N-butyl-2-ethyl- | C(CC)(CCCC)C(=O)NCCCC |
Hexanamide, N-phenyl- | N(C(=O)CCCCC)c1ccccc1 |
Hexanamide__2-ethyl-N-(2-hydroxypropyl)- | C(CC)(CCCC)C(=O)NCC(C)O |
Hexanamide__6-(acetylamino)-N-methyl- | C(=O)(NC)CCCCCNC(C)=O |
Hexanamide__6-(acetylamino)-N_N-dimethyl- | C(CCCCNC(C)=O)C(=O)N(C)C |
Hexanamide__N-(2-chloro-2-propenyl)-N-phenyl- | N(CC(=C)Cl)(C(=O)CCCCC)c1ccccc1 |
Hexanamide__N-(3-hydroxyphenyl)- | N(C(=O)CCCCC)c1cccc(O)c1 |
Hexanamide__N-(3-hydroxyphenyl)-2-methyl- | N(C(=O)C(C)CCCC)c1cccc(O)c1 |
Hexanamide__N-butyl-2-ethyl- | C(CC)(CCCC)C(=O)NCCCC |
Hexanamide__N-phenyl- | N(C(=O)CCCCC)c1ccccc1 |
Hexanamide__N_N-dibutyl- | N(CCCC)(CCCC)C(=O)CCCCC |
n-Hexanamide | C(CCCC)C(N)=O |