If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Nyanthrene Blue BFP | O=C1c2ccccc2C(=O)c3cc(Cl)c4Nc5c(Nc4c13)c(Cl)cc6C(=O)c7ccccc7C(=O)c56 |
Nyanthrene Golden Orange G | O=C1c2ccccc2C3=Cc4ccc5C(=O)c6ccccc6c7cc8ccc1c3c8c4c57 |
Nyanthrene Golden Yellow GK | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Nyanthrene Golden Yellow | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Nyanthrene Navy Blue BR | O=C1c2ccccc2c3ccc4c5ccc6c7ccccc7C(=O)c8ccc(c9ccc1c3c49)c5c68 |
Nyanthrene Olive R | O=C1c2ccccc2C(=O)c3c(NC(=O)c4ccccc4)cc5c6cc(NC(=O)c7ccccc7)c8C(=O)c9ccccc9C(=O)c8c6Nc5c13 |
Nyanthrene Red FBB | Nc1c(ccc2C(=O)c3ccccc3C(=O)c12)C4=Nc5cc6C(=O)c7ccccc7C(=O)c6cc5O4 |
Nyanthrene Yellow AR | N(C(=O)c1ccccc1)c2cccc3C(=O)c4c(cccc4C(=O)c23)NC(=O)c5ccccc5 |