If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Pyridylcarbinol acetate (ester) | C(OC(C)=O)c1ccccn1 |
3-Pyridylcarbinol bitartrate | C(O)(C(=O)O)C(O)C(=O)O.OCc1cccnc1 |
3-Pyridylcarbinol | C(O)c1cccnc1 |
4-Pyridylcarbinol acetate (ester) | C(OC(C)=O)c1ccncc1 |
4-Pyridylcarbinol | C(O)c1ccncc1 |
BETA_-Pyridylcarbinol tartrate | C(O)(C(=O)O)C(O)C(=O)O.OCc1cccnc1 |
BETA_-Pyridylcarbinol | C(O)c1cccnc1 |