If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3, 5-Diacetamido-2,4,6-triiodobenzoic acid, sodium salt | N(C(C)=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I |
3,5-Diacetamido-2,4,6-triiodobenzoic acid | N(C(C)=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I |
4,4'-Diacetamido-3,3'-dinitrophenyl ether | [N+](=O)([O-])c1cc(ccc1NC(C)=O)Oc2ccc(NC(C)=O)c(c2)[N+](=O)[O-] |
Benzoic acid, 3, 5-diacetamido-2,4,6-triiodo- | N(C(C)=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I |
Benzoic acid, 3,5-diacetamido-2,4, 6-triiodo-, sodium salt | N(C(C)=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I |
Benzoic acid, 3,5-diacetamido-2,4,6-triiodo-, monosodium salt | N(C(C)=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I |
Phenazinium, 3, 7-diacetamido-5-phenyl chloride | N(C(C)=O)c1ccc2nc3ccc(NC(C)=O)cc3n(c4ccccc4)c2c1 |
Sodium 3,5-diacetamido-2,4,6-triiodobenzoate | N(C(C)=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I |