If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1-Benzoyl-4-piperidinone | C(=O)(c1ccccc1)N2CCC(=O)CC2 |
1-Benzyl-4-piperidinone | C(c1ccccc1)N2CCC(=O)CC2 |
1-Ethoxycarbonyl-4-piperidinone | C(=O)(OCC)N1CCC(=O)CC1 |
1-Methyl-2-piperidinone | O=C1CCCCN1C |
1-Methyl-4-piperidinone | O=C1CCN(C)CC1 |
2,2,6, 6-Tetramethyl-4-piperidinone | CC1(C)CC(=O)CC(C)(C)N1 |
2-Piperidinone | O=C1CCCCN1 |
2-Piperidinone, 1-methyl- | O=C1CCCCN1C |
2-Piperidinone, 6-thioxo- | O=C1CCCC(=S)N1 |
2-Piperidinone__6-thioxo- | O=C1CCCC(=S)N1 |
4-Piperidinone, 1-(phenylmethyl)- | C(c1ccccc1)N2CCC(=O)CC2 |
4-Piperidinone, 1-benzoyl- | C(=O)(c1ccccc1)N2CCC(=O)CC2 |
4-Piperidinone, 1-hydroxy-2,2,6,6-tetramethyl- | ON1C(C)(C)CC(=O)CC1(C)C |
4-Piperidinone, 1-methyl- | O=C1CCN(C)CC1 |
4-Piperidinone, 2,2,6,6-tetramethyl- | CC1(C)CC(=O)CC(C)(C)N1 |
4-Piperidinone, 2,2,6,6-tetramethyl-1-nitroso- | CC1(C)CC(=O)CC(C)(C)N1N=O |
4-Piperidinone__1-(phenylmethyl)- | C(c1ccccc1)N2CCC(=O)CC2 |
4-Piperidinone__1-benzoyl- | C(=O)(c1ccccc1)N2CCC(=O)CC2 |
4-Piperidinone__1-hydroxy-2_2_6_6-tetramethyl- | ON1C(C)(C)CC(=O)CC1(C)C |
4-Piperidinone__1-methyl- | O=C1CCN(C)CC1 |
4-Piperidinone__2_2_6_6-tetramethyl- | CC1(C)CC(=O)CC(C)(C)N1 |
4-Piperidinone__2_2_6_6-tetramethyl-1-nitroso- | CC1(C)CC(=O)CC(C)(C)N1N=O |
N-Benzyl-4-piperidinone | C(c1ccccc1)N2CCC(=O)CC2 |
N-Ethoxycarbonyl-4-piperidinone | C(=O)(OCC)N1CCC(=O)CC1 |
N-Methyl-2-piperidinone | O=C1CCCCN1C |
N-Methyl-4-piperidinone | O=C1CCN(C)CC1 |