If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 1'-Thiodi-BETA_-naphthol | S(c1c(O)ccc2ccccc12)c3c(O)ccc4ccccc34 |
2-Naphthol, 1,1'-thiodi- | S(c1c(O)ccc2ccccc12)c3c(O)ccc4ccccc34 |
2-Propanol, 1,1'-thiodi- | S(CC(C)O)CC(C)O |
4,4'-Thiodi(2-butanone) | C(SCCC(C)=O)CC(C)=O |
Acetic acid, thiodi- | S(CC(=O)O)CC(=O)O |
Acetic acid, thiodi-, diallyl ester | C(=O)(OCC=C)CSCC(=O)OCC=C |
Alanine, 3, 3'-thiodi- | C(N)(CSCC(N)C(=O)O)C(=O)O |
Alanine, 3,3'-thiodi-, L- | C(N)(CSCC(N)C(=O)O)C(=O)O |
Aniline, 4, 4'-thiodi- | S(c1ccc(N)cc1)c2ccc(N)cc2 |
Ethanethiol, 2,2'-thiodi- | S(CCS)CCS |
Ethanol, 2,2'-thiodi- | S(CCO)CCO |
Ethanol, 2,2'-thiodi-, diacetate | C(CSCCOC(C)=O)OC(C)=O |
Metanilic acid, 6,6'-thiodi- | S(=O)(=O)(O)c1cc(N)ccc1Sc2ccc(N)cc2S(=O)(=O)O |
Phenol, 2,2'-thiodi- | S(c1ccccc1O)c2ccccc2O |
Phenol, 4,4'-thiodi- | S(c1ccc(O)cc1)c2ccc(O)cc2 |
Piperidine, 1,1'-thiodi- | S(N1CCCCC1)N2CCCCC2 |
Propionic acid, 2, 2'-thiodi-, dihydrazide | C(C)(SC(C)C(=O)NN)C(=O)NN |
Propionic acid, 3, 3'-thiodi-, didodecyl ester | C(=O)(OCCCCCCCCCCCC)CCSCCC(=O)OCCCCCCCCCCCC |
Propionic acid, 3,3'-thiodi- | C(SCCC(=O)O)CC(=O)O |
Propionic acid, 3,3'-thiodi-, dibutyl ester | C(CSCCC(=O)OCCCC)C(=O)OCCCC |
Propionic acid, 3,3'-thiodi-, diethyl ester | C(=O)(OCC)CCSCCC(=O)OCC |
Propionic acid, 3,3'-thiodi-, dimethyl ester | C(CSCCC(=O)OC)C(=O)OC |
Propionic acid, 3,3'-thiodi-, dioctadecyl ester | C(SCCC(=O)OCCCCCCCCCCCCCCCCCC)CC(=O)OCCCCCCCCCCCCCCCCCC |
Propionitrile, 3,3'-thiodi- | S(CCC#N)CCC#N |
Purine, 6,6'-thiodi-, dihydrate | S(c1ncnc2NC=Nc12)c3ncnc4NC=Nc34 |
Purine__6_6'-thiodi-__dihydrate | S(c1ncnc2NC=Nc12)c3ncnc4NC=Nc34 |
Resorcinol, 4,4'-thiodi- | S(c1ccc(O)cc1O)c2ccc(O)cc2O |
Succinic acid, thiodi-, tetrabutyl ester | C(CC(=O)OCCCC)(SC(CC(=O)OCCCC)C(=O)OCCCC)C(=O)OCCCC |
Thiodi-p-phenylenediamine | S(c1ccc(N)cc1)c2ccc(N)cc2 |
Valeric acid, 5,5'-thiodi- | C(CCSCCCCC(=O)O)CC(=O)O |