If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Phenylcinnamic acid | C(=Cc1ccccc1)(C(=O)O)c2ccccc2 |
ALPHA_-Cyano-BETA_-phenylcinnamic acid, ethyl ester | C(c1ccccc1)(c2ccccc2)=C(C#N)C(=O)OCC |
ALPHA_-Phenylcinnamic acid (cis-form) | C(=Cc1ccccc1)(C(=O)O)c2ccccc2 |
ALPHA_-Phenylcinnamic acid (trans-form). | C(=Cc1ccccc1)(C(=O)O)c2ccccc2 |
ALPHA_-Phenylcinnamic acid | C(=Cc1ccccc1)(C(=O)O)c2ccccc2 |
cis-ALPHA_-Phenylcinnamic acid | C(=Cc1ccccc1)(C(=O)O)c2ccccc2 |
trans-ALPHA_-Phenylcinnamic acid | C(=Cc1ccccc1)(C(=O)O)c2ccccc2 |