If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(2-Furyl)acrylic acid | C(=CC(=O)O)C1=CC=CO1 |
3, 4-Methylenedioxybenzene-3-acrylic acid | C(=CC(=O)O)c1ccc2OCOc2c1 |
3-(2-Furyl)acrylic acid | C(=CC(=O)O)C1=CC=CO1 |
3-(2-Thienyl)acrylic acid | C(=CC(=O)O)C1=CC=CS1 |
3-(4-Hydroxy-3-methoxyphenyl)acrylic acid | C(=CC(=O)O)c1ccc(O)c(OC)c1 |
3-(4-Nitrophenyl)acrylic acid | [N+](=O)([O-])c1ccc(cc1)C=CC(=O)O |
3-(p-Chlorophenyl)acrylic acid | C(=CC(=O)O)c1ccc(Cl)cc1 |
ACRYLIC ACID | C(=O)(O)C=C |
ALPHA_-Methyl acrylic amide | C(C)(=C)C(N)=O |
ALPHA_-Methyl_acrylic_amide | C(C)(=C)C(N)=O |
ALPHA_-Phenyl acrylic acid | C(=C)(C(=O)O)c1ccccc1 |
Acrolein, acrylic acid polymer | C(=C)C=O.C=CC(=O)O |
Acrylamide-acrylic acid copolymer | C(=O)(O)C=C.C=CC(N)=O |
Acrylamide-acrylic acid polymer | C(=O)(O)C=C.C=CC(N)=O |
Acrylamide-acrylic acid resin | C(=O)(O)C=C.C=CC(N)=O |
Acrylamide-acrylic resin | C(=O)(O)C=C.C=CC(N)=O |
Acrylic acid BETA_-chloroethyl ester | C(=O)(C=C)OCCCl |
Acrylic acid butyl ester | C(=O)(C=C)OCCCC |
Acrylic acid chloride | C(Cl)(=O)C=C |
Acrylic acid ethyl ester | C(=O)(C=C)OCC |
Acrylic acid homopolymer | C(=O)(O)C=C |
Acrylic acid methyl ester | C(=O)(C=C)OC |
Acrylic acid resin | C(=O)(O)C=C |
Acrylic acid | C(=O)(O)C=C |
Acrylic acid, 2,2,2-trifluoroethyl ester | O(CC(F)(F)F)C(=O)C=C |
Acrylic acid, 2,2-dimethyl-1,3-propanediol diester | C(OC(=O)C=C)C(C)(C)COC(=O)C=C |
Acrylic acid, 2,2-dimethyltrimethylene ester | C(OC(=O)C=C)C(C)(C)COC(=O)C=C |
Acrylic acid, 2,2-dinitropropyl ester | C(C)(COC(=O)C=C)([N+](=O)[O-])[N+](=O)[O-] |
Acrylic acid, 2,3-dichloro- | C(Cl)(=CCl)C(=O)O |
Acrylic acid, 2,3-dichloro-3-formyl- | C(Cl)(C(=O)O)=C(Cl)C=O |
Acrylic acid, 2,3-diphenyl- | C(=Cc1ccccc1)(C(=O)O)c2ccccc2 |
Acrylic acid, 2,3-diphenyl-, (E)- | C(=Cc1ccccc1)(C(=O)O)c2ccccc2 |
Acrylic acid, 2,3-diphenyl-, (Z)- | C(=Cc1ccccc1)(C(=O)O)c2ccccc2 |
Acrylic acid, 2,3-epoxypropyl ester | C(OC(=O)C=C)C1CO1 |
Acrylic acid, 2-(diethylamino)ethyl ester | N(CC)(CC)CCOC(=O)C=C |
Acrylic acid, 2-(dimethylamino)ethyl ester | C(=O)(C=C)OCCN(C)C |
Acrylic acid, 2-acetamido- | C(=C)(NC(C)=O)C(=O)O |
Acrylic acid, 2-bromoethyl ester | C(=O)(C=C)OCCBr |
Acrylic acid, 2-butoxyethoxy ester | C(OCCCC)COC(=O)C=C |
Acrylic acid, 2-butoxyethyl ester | C(OCCCC)COC(=O)C=C |
Acrylic acid, 2-chloro-, ethyl ester | C(=O)(C=C)OCCCl |
Acrylic acid, 2-chloro-, methyl ester | C(=O)(OC)C(=C)Cl |
Acrylic acid, 2-chloroethyl ester | C(=O)(C=C)OCCCl |
Acrylic acid, 2-cyano-3,3-diphenyl-, ethyl ester | C(c1ccccc1)(c2ccccc2)=C(C#N)C(=O)OCC |
Acrylic acid, 2-cyano-3-(4-(diethylamino)phenyl)-, ethyl ester | N(CC)(CC)c1ccc(cc1)C=C(C#N)C(=O)OCC |
Acrylic acid, 2-cyano-3-ethoxy- | C(C#N)(=COCC)C(=O)O |
Acrylic acid, 2-cyano-3-ethoxy-, ethyl ester | C(C#N)(=COCC)C(=O)OCC |
Acrylic acid, 2-cyanoethyl ester | C(=O)(C=C)OCCC#N |
Acrylic acid, 2-ethoxyethanol ester | C(=O)(C=C)OCCOCC |
Acrylic acid, 2-ethoxyethyl ester | C(=O)(C=C)OCCOCC |
Acrylic acid, 2-ethylbutyl ester | C(CC)(CC)COC(=O)C=C |
Acrylic acid, 2-ethylhexyl ester | C(CC)(CCCC)COC(=O)C=C |
Acrylic acid, 2-methoxyethoxy ester | C(=O)(C=C)OCCOC |
Acrylic acid, 2-methoxyethyl ester | C(=O)(C=C)OCCOC |
Acrylic acid, 2-methyl- | C(C)(=C)C(=O)O |
Acrylic acid, 2-methyl-, dodecyl ester | C(CCCCCCCCCCC)OC(=O)C(C)=C |
Acrylic acid, 2-methyl-, isopropyl ester | C(=O)(OC(C)C)C(C)=C |
Acrylic acid, 2-phenyl- | C(=C)(C(=O)O)c1ccccc1 |
Acrylic acid, 3-(1-hydroxy-N-phenylformimidoyl)-, cyclic anhydride | N(c1ccccc1)=C2C=CC(=O)O2 |
Acrylic acid, 3-(2-(methyl-aci-nitro)acetamido)-, (E)- | C(=O)(NC=CC(=O)O)C=N(O)OC |
Acrylic acid, 3-(4-pyridyl)-, methyl ester | C(=CC(=O)OC)c1ccncc1 |
Acrylic acid, 3-(5-nitro-2-furyl)-, ethyl ester | C(=CC(=O)OCC)C1=CC=C(O1)[N+](=O)[O-] |
Acrylic acid, 3-(o-nitrophenyl)-2-phenyl- | C(c1ccccc1[N+](=O)[O-])=C(C(=O)O)c2ccccc2 |
Acrylic acid, 3-benzoyl- | C(=O)(C=CC(=O)O)c1ccccc1 |
Acrylic acid, 3-bromo-, (E)- | C(=CBr)C(=O)O |
Acrylic acid, 3-bromo-, trans- | C(=CBr)C(=O)O |
Acrylic acid, 3-carbamoyl-, (Z)- | C(=CC(=O)O)C(N)=O |
Acrylic acid, 3-chloro-, (E)- | C(=CCl)C(=O)O |
Acrylic acid, 3-chloro-, (Z)- | C(=CCl)C(=O)O |
Acrylic acid, 3-chloro-, trans- | C(=CCl)C(=O)O |
Acrylic acid, 3-chloroallyl ester | C(=O)(C=C)OCC=CCl |
Acrylic acid, 3-ethoxy-, ethyl ester | C(=COCC)C(=O)OCC |
Acrylic acid, 3-furfuryl | C(C=CC(=O)O)C1=CC=CO1 |
Acrylic acid, 3-methyl- | C(=CC)C(=O)O |
Acrylic acid, 3-p-anisoyl-3-bromo-, (E)- | C(=O)(C(Br)=CC(=O)O)c1ccc(OC)cc1 |
Acrylic acid, 3-p-anisoyl-3-bromo-, sodium salt | C(=O)(C(Br)=CC(=O)O)c1ccc(OC)cc1 |
Acrylic acid, ALPHA_-BETA_-dichloro- | C(Cl)(=CCl)C(=O)O |
Acrylic acid, BETA_-2-furyl- | C(=CC(=O)O)C1=CC=CO1 |
Acrylic acid, BETA_-2-thienyl- | C(=CC(=O)O)C1=CC=CS1 |
Acrylic acid, N,N-(diethylamino)ethyl ester | N(CC)(CC)CCOC(=O)C=C |
Acrylic acid, allyl ester | C(=O)(C=C)OCC=C |
Acrylic acid, benzyl ester | C(OC(=O)C=C)c1ccccc1 |
Acrylic acid, butoxyethyl ester | C(OCCCC)COC(=O)C=C |
Acrylic acid, butyl ester | C(=O)(C=C)OCCCC |
Acrylic acid, calcium salt | C(=O)(O)C=C |
Acrylic acid, cyclohexyl ester | O(C(=O)C=C)C1CCCCC1 |
Acrylic acid, decyl ester | C(CCCCCCCC)COC(=O)C=C |
Acrylic acid, diester with ethylene glycol | O(CCOC(=O)C=C)C(=O)C=C |
Acrylic acid, dodecyl ester | C(CCCCCCCCCC)COC(=O)C=C |
Acrylic acid, ester with hydracrylonitrile | C(=O)(C=C)OCCC#N |
Acrylic acid, ethyl ester (inhibited) | C(=O)(C=C)OCC |
Acrylic acid, ethyl ester | C(=O)(C=C)OCC |
Acrylic acid, ethylene ester | O(CCOC(=O)C=C)C(=O)C=C |
Acrylic acid, ethylene glycol diester | O(CCOC(=O)C=C)C(=O)C=C |
Acrylic acid, glacial | C(=O)(O)C=C |
Acrylic acid, heptyl ester | C(CCCCC)COC(=O)C=C |
Acrylic acid, hexadecyl ester | C(CCCCCCCCCCCC)CCCOC(=O)C=C |
Acrylic acid, hexyl ester | C(CCCCC)OC(=O)C=C |
Acrylic acid, isobutyl ester | C(=O)(C=C)OCC(C)C |
Acrylic acid, isopropyl ester | C(=O)(C=C)OC(C)C |
Acrylic acid, methyl ester | C(=O)(C=C)OC |
Acrylic acid, n-butyl ester | C(=O)(C=C)OCCCC |
Acrylic acid, octyl ester | O(CCCCCCCC)C(=O)C=C |
Acrylic acid, pentyl ester | C(=O)(C=C)OCCCCC |
Acrylic acid, perchloro-, sodium salt | C(Cl)(=C(Cl)Cl)C(=O)O |
Acrylic acid, polymer with acrylamide | C(=O)(O)C=C.C=CC(N)=O |
Acrylic acid, polymer | C(=O)(O)C=C |
Acrylic acid, polymers | C(=O)(O)C=C |
Acrylic acid, propyl ester | C(=O)(C=C)OCCC |
Acrylic acid, sec-butyl ester | O(C(C)CC)C(=O)C=C |
Acrylic acid, tert-butyl ester | O(C(=O)C=C)C(C)(C)C |
Acrylic acid, tetrahydrofurfuryl ester | C(OC(=O)C=C)C1CCCO1 |
Acrylic acid, tridecyl ester | C(CCCCCCCCCCC)COC(=O)C=C |
Acrylic acid, vinyl ester | C(=O)(C=C)OC=C |
Acrylic acid-acrylamide copolymer | C(=O)(O)C=C.C=CC(N)=O |
Acrylic acid-acrylamide polymer | C(=O)(O)C=C.C=CC(N)=O |
Acrylic aldehyde | C(=C)C=O |
Acrylic amide | C(N)(=O)C=C |
Acrylic anhydride | O(C(=O)C=C)C(=O)C=C |
Acrylic polymer | C(=O)(O)C=C |
Acrylic polymers | C(=O)(O)C=C |
Acrylic resin | C(=O)(O)C=C |
Acrylic_acid__3-(1-hydroxy-N-phenylformimidoyl)-__cyclic_anhydride | N(c1ccccc1)=C2C=CC(=O)O2 |
Acrylic_acid__3-(4-pyridyl)-__methyl_ester | C(=CC(=O)OC)c1ccncc1 |
Acrylic_acid__3-(o-nitrophenyl)-2-phenyl- | C(c1ccccc1[N+](=O)[O-])=C(C(=O)O)c2ccccc2 |
Acrylic_acid__ALPHA_-BETA_-dichloro- | C(Cl)(=CCl)C(=O)O |
Acrylic_acid__diester_with_ethylene_glycol | O(CCOC(=O)C=C)C(=O)C=C |
Acrylic_acid__ester_with_hydracrylonitrile | C(=O)(C=C)OCCC#N |
Acrylic_acid__ethyl_ester_(inhibited) | C(=O)(C=C)OCC |
Acrylic_acid_chloride | C(Cl)(=O)C=C |
Acrylic_anhydride | O(C(=O)C=C)C(=O)C=C |
Atactic poly(acrylic acid) | C(=O)(O)C=C |
BETA_-(2-Furyl)acrylic acid | C(=CC(=O)O)C1=CC=CO1 |
BETA_-(4-Hydroxyphenyl)acrylic acid | C(=CC(=O)O)c1ccc(O)cc1 |
Choline, ester with imidazole-4(or 5)-acrylic acid | C(=CC(=O)OCCN(C)(C)C)C1=CNC=N1 |
Imidazole-4-acrylic acid | C(=CC(=O)O)C1=CNC=N1 |
Indole-3-acrylic acid | C(=CC(=O)O)C1=CNc2ccccc12 |
Indole-3BETA_-acrylic acid | C(=CC(=O)O)C1=CNc2ccccc12 |
K 4 (acrylic polymer) | C(N)(=O)C=C |
Poly(acrylic acid-acrylamide) | C(=O)(O)C=C.C=CC(N)=O |
Polymerized acrylic acid | C(=O)(O)C=C |
Succinic acid, methylene-, polymer with acrylic acid | C(=C)(CC(=O)O)C(=O)O.C=CC(=O)O |
Succinic_acid__methylene-__polymer_with_acrylic_acid | C(=C)(CC(=O)O)C(=O)O.C=CC(=O)O |