If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(-)-ALPHA_-(1-Methylaminoethyl)benzyl alcohol | C(O)(C(C)NC)c1ccccc1 |
1-ALPHA_-(1-Methylaminoethyl)-benzyl alcohol | C(O)(C(C)NC)c1ccccc1 |
4-(2-Methylaminoethyl)pyrocatechol hydrochloride | C(CNC)c1ccc(O)c(O)c1 |
5, 6-Dibromo-3-(2-methylaminoethyl)indole | C(CNC)C1=CNc2cc(Br)c(Br)cc12 |
Benzyl alcohol, ALPHA_-(1-methylaminoethyl)- | C(O)(C(C)NC)c1ccccc1 |
INDOLE, 5,6-DIBROMO-3-(2-METHYLAMINOETHYL)- | C(CNC)C1=CNc2cc(Br)c(Br)cc12 |
INDOLE__5_6-DIBROMO-3-(2-METHYLAMINOETHYL)- | C(CNC)C1=CNc2cc(Br)c(Br)cc12 |
Pyridine, 2-(2-methylaminoethyl)- | C(CNC)c1ccccn1 |
l-ALPHA_-(1-Methylaminoethyl)benzyl alcohol | C(O)(C(C)NC)c1ccccc1 |