If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Ethyleneimino-2-hydroxy-3-butene | C(C(O)C=C)N1CC1 |
2, 5-Bis(ethyleneimino)-1,4-benzoquinone | O=C1C=C(C(=O)C=C1N2CC2)N3CC3 |
2, 5-Di(ethyleneimino)-1,4-benzoquinone | O=C1C=C(C(=O)C=C1N2CC2)N3CC3 |
2,3, 5-Tris(ethyleneimino)benzoquinone | O=C1C(=CC(=O)C(N2CC2)=C1N3CC3)N4CC4 |
2,4, 6-Tri(ethyleneimino)-s-triazine | c1(nc(nc(n1)N2CC2)N3CC3)N4CC4 |
2,4, 6-Tris(ethyleneimino)-s-triazine | c1(nc(nc(n1)N2CC2)N3CC3)N4CC4 |
2,4,6-Tri(ethyleneimino)-1,3, 5-triazine | c1(nc(nc(n1)N2CC2)N3CC3)N4CC4 |
3,6-Bis(BETA_-methoxyethoxy)-2, 5-bis(ethyleneimino)-p-benzoquinone | O(CCOC)C1=C(C(=O)C(OCCOC)=C(C1=O)N2CC2)N3CC3 |
Tri(ethyleneimino)thiophosphoramide | P(=S)(N1CC1)(N2CC2)N3CC3 |
Tris(ethyleneimino)benzoquinone | O=C1C(=CC(=O)C(N2CC2)=C1N3CC3)N4CC4 |
Tris(ethyleneimino)triazine | c1(nc(nc(n1)N2CC2)N3CC3)N4CC4 |