If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Chloropropionyl chloride | C(CCl)C(Cl)=O |
BETA_-Chloropropionyl chloride | C(CCl)C(Cl)=O |
Chloropropionyl chloride | C(CCl)C(Cl)=O |
N,N'-Bis(3-chloropropionyl)piperazine | C(=O)(CCCl)N1CCN(CC1)C(=O)CCCl |
N,N-Bis(2-chloropropionyl)piperazine | C(=O)(C(C)Cl)N1CCN(CC1)C(=O)C(C)Cl |
N-(3-Chloropropionyl)benzylamine | C(NC(=O)CCCl)c1ccccc1 |
Piperazine, 1, 4-bis(2-chloropropionyl)- | C(=O)(C(C)Cl)N1CCN(CC1)C(=O)C(C)Cl |
Piperazine, 1, 4-bis(3-chloropropionyl)- | C(=O)(CCCl)N1CCN(CC1)C(=O)CCCl |
Quinoxaline, 1,4-bis(3-chloropropionyl)-1,2,3,4-tetrahydro- | C(=O)(CCCl)N1CCN(C(=O)CCCl)c2ccccc12 |
Quinoxaline__1_4-bis(3-chloropropionyl)-1_2_3_4-tetrahydro- | C(=O)(CCCl)N1CCN(C(=O)CCCl)c2ccccc12 |