If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1,3-Propanediol formal | C1COCOC1 |
1,4-Butanediol formal | C1CCOCOC1 |
1_3-Propanediol_formal | C1COCOC1 |
Bis(2, 2-dinitropropyl)formal | C(C)(COCOCC(C)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
Bis(2,2-dinitro-2-fluoroethyl)formal | C(F)(COCOCC(F)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
Bis(2,2-dinitropropyl) formal | C(C)(COCOCC(C)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
Bis(2-chloroethyl) formal | C(OCCCl)OCCCl |
Bis(2-fluoro-2, 2-dinitroethyl)formal | C(F)(COCOCC(F)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
Bis(BETA_-chloroethyl) formal | C(OCCCl)OCCCl |
Bis(butoxyethoxyethyl)formal | C(OCCOCCOCCCC)OCCOCCOCCCC |
Bis(butylcarbitol)formal | C(OCCOCCOCCCC)OCCOCCOCCCC |
Bis(dinitropropyl) formal | C(C)(COCOCC(C)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
Butyl formal | C(CC)CC=O |
Butylcarbitol formal | C(OCCOCCOCCCC)OCCOCCOCCCC |
Di(2-chloroethyl)formal | C(OCCCl)OCCCl |
Di(Butylcarbitol)formal | C(OCCOCCOCCCC)OCCOCCOCCCC |
Di-2-chloroethyl formal | C(OCCCl)OCCCl |
Di-n-butyl formal | C(OCCCC)OCCCC |
Di-n-propyl formal | C(OCCC)OCCC |
Dibutoxyethoxyethyl formal | C(OCCOCCOCCCC)OCCOCCOCCCC |
Dibutyl formal | C(OCCCC)OCCCC |
Dibutylcarbitol formal | C(OCCOCCOCCCC)OCCOCCOCCCC |
Dichloroethyl formal | C(OCCCl)OCCCl |
Diethylene glycol monomethyl ether formal | C(OCCOCCOC)OCCOCCOC |
Diethylene_glycol_monomethyl_ether_formal | C(OCCOCCOC)OCCOCCOC |
Ethylene glycol monomethyl ether formal | C(OCCOC)OCCOC |
Ethylene_glycol_monomethyl_ether_formal | C(OCCOC)OCCOC |
Formal Blue G | Oc1c(N=Nc2ccc(cc2OC)c3ccc(N=Nc4ccc5c(c(N)ccc5S(=O)(=O)O)c4O)c(OC)c3)ccc6c1c(N)ccc6S(=O)(=O)O |
Formal Fast Black 2B | Nc1c(N=Nc2ccc(cc2)N=Nc3ccc(N)cc3N)c(cc4cc(c(N=Nc5ccc(cc5)N=Nc6ccc(N)cc6N)c(O)c14)S(=O)(=O)O)S(=O)(=O)O |
Formal | C(CC(=O)OCC)(SP(=S)(OC)OC)C(=O)OCC |
Glycerol formal | C(O)C1COCO1 |
Tetramethylene formal | C1CCOCOC1 |