If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Carbamoyloxy-1-(2-propynyl)cyclohexane | O(C(N)=O)C1(CC#C)CCCCC1 |
1-Carbamoyloxy-2-hydroxy-3-(o-methylphenoxy)propane | O(CC(O)COC(N)=O)c1ccccc1C |
1-Carbamoyloxy-3-phenylpropane | C(CCOC(N)=O)c1ccccc1 |
3'-(1, 1-(Dimethylethyl)carbamoyloxy)-2-methylpropionanilide | N(C(=O)C(C)C)c1cccc(c1)OC(=O)NC(C)(C)C |
3'-(2,2-(Dimethylethyl)carbamoyloxy)propionanilide | O(C(=O)NC(C)(C)C)c1cccc(c1)NC(=O)CC |