If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
BASF 220F | C(CCCCCCCCCCCC)N1CC(C)OC(C)C1 |
BASF 238 | C1COCCN1 |
BASF Brilliant Indigo 4B | O=C1c2cc(Br)cc(Br)c2NC1=C3Nc4c(Br)cc(Br)cc4C3=O |
BASF Brilliant Indigo 4BC | O=C1c2cc(Br)cc(Br)c2NC1=C3Nc4c(Br)cc(Br)cc4C3=O |
BASF URSOL 3GA | Nc1ccccc1O |
BASF Ursol D | Nc1ccc(N)cc1 |
BASF Ursol P Base | Nc1ccc(O)cc1 |
Basf Ursol ERN | Oc1cccc2ccccc12 |
Basf ursol eg | Nc1cccc(O)c1 |
Indigo Pure BASF Powder K | O=C1c2ccccc2NC1=C3Nc4ccccc4C3=O |
Indigo Pure BASF | O=C1c2ccccc2NC1=C3Nc4ccccc4C3=O |
Metam-fluid basf | C(=S)(S)NC |