If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-(p-Tolylthio)propionic acid | S(CCC(=O)O)c1ccc(C)cc1 |
ALPHA_-(o-Tolylthio)acetamide | S(CC(N)=O)c1ccccc1C |
ALPHA_-(p-Tolylthio)-p-toluidine | C(Sc1ccc(C)cc1)c2ccc(N)cc2 |
Acetamide, 2-(o-tolylthio)- | S(CC(N)=O)c1ccccc1C |
Acetic acid, (m-tolylthio)- | S(CC(=O)O)c1cccc(C)c1 |
Acetic_acid__(m-tolylthio)- | S(CC(=O)O)c1cccc(C)c1 |
Cinnamamide, ALPHA_-(p-tolylthio)- | C(=Cc1ccccc1)(Sc2ccc(C)cc2)C(N)=O |
p-Toluidine, ALPHA_-(p-tolylthio)- | C(Sc1ccc(C)cc1)c2ccc(N)cc2 |