If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Eastman 11219 | C(C)N1C(=CC=CC=CC2=N(CC)c3ccccc3O2)Oc4ccccc14 |
Eastman 1334 | C(C=Cc1ccn(CC)c2ccccc12)=C3C=CN(CC)c4ccccc34 |
Eastman 1361 | C(C)n1c(C=Cc2ccc(cc2)N(C)C)ccc3ccccc13 |
Eastman 7663 | C(C)N1C(=CC=CC=CC2=N(CC)c3ccccc3S2)Sc4ccccc14 |
Eastman 7851 | C(C)N1C(C=Cc2ccccc12)=Cc3ccc4ccccc4n3CC |
Eastman Blue BNN | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Eastman Blue GBN | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Eastman Inhibitor HPT | P(=O)(N(C)C)(N(C)C)N(C)C |
Eastman Inhibitor RMB | C(=O)(Oc1cccc(O)c1)c2ccccc2 |
Eastman Polyester Pink R-LSH | N(c1cc(OC)c(N)c2C(=O)c3ccccc3C(=O)c12)S(=O)(=O)c4ccc(C)cc4 |
Eastman Polyester Pink RL | N(c1cc(OC)c(N)c2C(=O)c3ccccc3C(=O)c12)S(=O)(=O)c4ccc(C)cc4 |
Eastman inhibitor DHPB | C(=O)(c1ccccc1)c2ccc(O)cc2O |
Eastman-4770 | S(=O)(=O)(Nc1ccccc1)c2ccc(N)cc2 |