If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
8-Cinnamyl-theophylline | O=C1N(C)C(=O)N(C)C2=C1N=C(CC=Cc3ccccc3)N2 |
Acetic acid, cinnamyl ester | C(=CCOC(C)=O)c1ccccc1 |
Anthranilic acid, cinnamyl ester | C(=O)(OCC=Cc1ccccc1)c2ccccc2N |
Benzoic acid, cinnamyl ester | C(=O)(OCC=Cc1ccccc1)c2ccccc2 |
Butyric acid, cinnamyl ester | C(=CCOC(=O)CCC)c1ccccc1 |
Cinnamic acid, cinnamyl ester | C(=CC(=O)OCC=Cc1ccccc1)c2ccccc2 |
Cinnamyl 2-aminobenzoate | C(=O)(OCC=Cc1ccccc1)c2ccccc2N |
Cinnamyl acetate | C(=CCOC(C)=O)c1ccccc1 |
Cinnamyl alcohol | C(=CCO)c1ccccc1 |
Cinnamyl alcohol, ALPHA_,ALPHA_-diphenyl- | C(O)(C=Cc1ccccc1)(c2ccccc2)c3ccccc3 |
Cinnamyl alcohol, acetate | C(=CCOC(C)=O)c1ccccc1 |
Cinnamyl alcohol, anthranilate | C(=O)(OCC=Cc1ccccc1)c2ccccc2N |
Cinnamyl alcohol, benzoate | C(=O)(OCC=Cc1ccccc1)c2ccccc2 |
Cinnamyl alcohol, cinnamate | C(=CC(=O)OCC=Cc1ccccc1)c2ccccc2 |
Cinnamyl alcohol, formate | C(=CCOC=O)c1ccccc1 |
Cinnamyl alcohol, propionate | C(=CCOC(=O)CC)c1ccccc1 |
Cinnamyl anthranilate | C(=O)(OCC=Cc1ccccc1)c2ccccc2N |
Cinnamyl benzoate | C(=O)(OCC=Cc1ccccc1)c2ccccc2 |
Cinnamyl butyrate | C(=CCOC(=O)CCC)c1ccccc1 |
Cinnamyl chloride | C(=CCCl)c1ccccc1 |
Cinnamyl cinnamate | C(=CC(=O)OCC=Cc1ccccc1)c2ccccc2 |
Cinnamyl eugenol | O(C(=O)C=Cc1ccccc1)c2ccc(CC=C)cc2OC |
Cinnamyl formate | C(=CCOC=O)c1ccccc1 |
Cinnamyl isobutyrate | C(=CCOC(=O)C(C)C)c1ccccc1 |
Cinnamyl isovalerate | C(=CCOC(=O)CC(C)C)c1ccccc1 |
Cinnamyl methanoate | C(=CCOC=O)c1ccccc1 |
Cinnamyl nitrile | C(=CC#N)c1ccccc1 |
Cinnamyl o-aminobenzoate | C(=O)(OCC=Cc1ccccc1)c2ccccc2N |
Cinnamyl phenyl ether | C(=CCOc1ccccc1)c2ccccc2 |
Cinnamyl propionate | C(=CCOC(=O)CC)c1ccccc1 |
Cinnamyl_phenyl_ether | C(=CCOc1ccccc1)c2ccccc2 |
Formic acid, cinnamyl ester | C(=CCOC=O)c1ccccc1 |
Isobutyric acid, cinnamyl ester | C(=CCOC(=O)C(C)C)c1ccccc1 |
Isovaleric acid, cinnamyl ester | C(=CCOC(=O)CC(C)C)c1ccccc1 |
Piperazine, 1-cinnamyl-4-(diphenylmethyl)-, (E)- | C(c1ccccc1)(c2ccccc2)N3CCN(CC3)CC=Cc4ccccc4 |
Propionic acid, cinnamyl ester | C(=CCOC(=O)CC)c1ccccc1 |
Theophylline, 8-cinnamyl- | O=C1N(C)C(=O)N(C)C2=C1N=C(CC=Cc3ccccc3)N2 |