If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(+-)-ALPHA_-Ethyl-4-biphenylacetic acid | C(CC)(C(=O)O)c1ccc(cc1)c2ccccc2 |
2-Biphenylacetic acid | C(C(=O)O)c1ccccc1c2ccccc2 |
4-Biphenylacetic acid | C(C(=O)O)c1ccc(cc1)c2ccccc2 |
4-Biphenylacetic acid, ALPHA_-ethyl- | C(CC)(C(=O)O)c1ccc(cc1)c2ccccc2 |
ALPHA_-Ethyl-4-biphenylacetic acid | C(CC)(C(=O)O)c1ccc(cc1)c2ccccc2 |
p-Biphenylacetic acid | C(C(=O)O)c1ccc(cc1)c2ccccc2 |