If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
5-Fluorouracil 2'-deoxyriboside | O=C1NC(=O)C(F)=CN1C2CC(O)C(CO)O2 |
5-Fluorouracil arabinoside | OC1C(O)C(CO)OC1N2C=C(F)C(=O)NC2=O |
5-Fluorouracil deoxyriboside | O=C1NC(=O)C(F)=CN1C2CC(O)C(CO)O2 |
5-Fluorouracil | Oc1nc(O)ncc1F |
5-Fluorouracil_arabinoside | OC1C(O)C(CO)OC1N2C=C(F)C(=O)NC2=O |
Fluorouracil(USAN) | Oc1nc(O)ncc1F |