If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 2-Benzenedicarboxylic acid, dipentyl ester | C(=O)(OCCCCC)c1ccccc1C(=O)OCCCCC |
1-Pentanamine, N,N-dipentyl- | N(CCCCC)(CCCCC)CCCCC |
1-Pentanamine__N_N-dipentyl- | N(CCCCC)(CCCCC)CCCCC |
1__2-Benzenedicarboxylic_acid__dipentyl_ester | C(=O)(OCCCCC)c1ccccc1C(=O)OCCCCC |
Acetamide, N,N-dipentyl- | N(CCCCC)(CCCCC)C(C)=O |
Acetamide__N_N-dipentyl- | N(CCCCC)(CCCCC)C(C)=O |
Butanamide, N,N-dipentyl- | N(CCCCC)(CCCCC)C(=O)CCC |
Butanamide__N_N-dipentyl- | N(CCCCC)(CCCCC)C(=O)CCC |
Butanedioic acid, dipentyl ester | C(=O)(OCCCCC)CCC(=O)OCCCCC |
Butanedioic_acid__dipentyl_ester | C(=O)(OCCCCC)CCC(=O)OCCCCC |
Butyramide, N,N-dipentyl- | N(CCCCC)(CCCCC)C(=O)CCC |
Carbonic acid, dipentyl ester | O(CCCCC)C(=O)OCCCCC |
Carbonic_acid__dipentyl_ester | O(CCCCC)C(=O)OCCCCC |
Dipentyl ether | O(CCCCC)CCCCC |
Dipentyl phthalate | C(=O)(OCCCCC)c1ccccc1C(=O)OCCCCC |
Dipentyl sulfone | C(CCCC)S(=O)(=O)CCCCC |
Formamide, N,N-dipentyl- | N(C=O)(CCCCC)CCCCC |
Formamide__N_N-dipentyl- | N(C=O)(CCCCC)CCCCC |
Hexadecane, 6,11-dipentyl- | C(CCCCC)(CCCCC)CCCCC(CCCCC)CCCCC |
Hexadecane__6_11-dipentyl- | C(CCCCC)(CCCCC)CCCCC(CCCCC)CCCCC |
Phthalic acid, dipentyl ester | C(=O)(OCCCCC)c1ccccc1C(=O)OCCCCC |
Propionitrile, 2, 2-dipentyl- | C(C)(C#N)(CCCCC)CCCCC |
Succinic acid, dipentyl ester | C(=O)(OCCCCC)CCC(=O)OCCCCC |
Tin, dipentyl-, oxide | C(CCCC)[Sn](=O)CCCCC |