If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Aminofluorene | Nc1ccc2c(c1)Cc3ccccc23 |
9-Aminofluorene hydrochloride | NC1c2ccccc2c3ccccc13 |
N, N-Dimethyl-2-aminofluorene | N(C)(C)c1ccc2c(c1)Cc3ccccc23 |
N,N-Diacetyl-2-aminofluorene | N(C(C)=O)(C(C)=O)c1ccc2c(c1)Cc3ccccc23 |
N-Acetyl-2-aminofluorene | N(C(C)=O)c1ccc2c(c1)Cc3ccccc23 |
N-Acetyl-3-aminofluorene | N(C(C)=O)c1ccc2Cc3ccccc3c2c1 |