If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Isopropylbenzaldehyde thiosemicarbazone | C(=NNC(N)=S)c1ccc(cc1)C(C)C |
4-Isopropylbenzaldehyde | C(C)(C)c1ccc(C=O)cc1 |
p-Isopropylbenzaldehyde 3-thiosemicarbazone | C(=NNC(N)=S)c1ccc(cc1)C(C)C |
p-Isopropylbenzaldehyde thiosemicarbazone | C(=NNC(N)=S)c1ccc(cc1)C(C)C |
p-Isopropylbenzaldehyde | C(C)(C)c1ccc(C=O)cc1 |