If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Buten-3-ynyl methyl ether | C(C#C)=COC |
4,4-Dimethylpent-2-ynyl chloride | C(#CCCl)C(C)(C)C |
4-Chlorobut-2-ynyl 3-chlorophenylcarbamate | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
Ether, 1-buten-3-ynyl methyl | C(C#C)=COC |
Ether__1-buten-3-ynyl_methyl | C(C#C)=COC |