If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-(2-Furyl)acrylophenone | C(=O)(C=CC1=CC=CO1)c2ccccc2 |
Acrylophenone | C(=O)(C=C)c1ccccc1 |
Acrylophenone, 3,3-diphenyl- | C(=CC(=O)c1ccccc1)(c2ccccc2)c3ccccc3 |
Acrylophenone, 3-(2-furyl)- | C(=O)(C=CC1=CC=CO1)c2ccccc2 |
Acrylophenone, 3-phenyl- | C(=O)(C=Cc1ccccc1)c2ccccc2 |