If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
9-(BETA_-D-Xylofuranosyl)guanine | Oc1nc(N)nc2c1N=CN2C3OC(CO)C(O)C3O |
BETA_-D-Ribofuranoside, guanine-9 | Oc1nc(N)nc2c1N=CN2C3OC(CO)C(O)C3O |
GUANINE-9:BETA-D-RIBOFURANOSIDE | Oc1nc(N)nc2c1N=CN2C3OC(CO)C(O)C3O |
Guanine 3-N-oxide | O=n1c(N)nc(O)c2NC=Nc12 |
Guanine deoxy nucleoside | Oc1nc(N)nc2c1N=CN2C3CC(O)C(CO)O3 |
Guanine deoxyriboside | Oc1nc(N)nc2c1N=CN2C3CC(O)C(CO)O3 |
Guanine hydrochloride | Oc1nc(N)nc2NC=Nc12 |
Guanine riboside | Oc1nc(N)nc2c1N=CN2C3OC(CO)C(O)C3O |
Guanine, 1-methyl- | O=C1N(C)C(=N)NC2=C1N=CN2 |
Guanine, 3-methyl- (VAN8CI) | CN1C(=N)NC(=O)C2=C1N=CN2 |
Guanine, 3-oxide | O=n1c(N)nc(O)c2NC=Nc12 |
Guanine, 7-methyl- (VAN8CI) | Oc1nc(N)nc2N=CN(C)c12 |
Guanine, 7-oxide | Oc1nc(N)nc2NCN(=O)c12 |
Guanine, 8-methyl- (VAN8CI) | Oc1nc(N)nc2NC(C)=Nc12 |
Guanine, 9-(2-deoxy-BETA_-D-erythro-pentofuranosyl)- | Oc1nc(N)nc2c1N=CN2C3CC(O)C(CO)O3 |
Guanine, 9-BETA_-D-ribofuranosyl- (VAN) | Oc1nc(N)nc2c1N=CN2C3OC(CO)C(O)C3O |
Guanine, 9-BETA_-D-xylofuranosyl- | Oc1nc(N)nc2c1N=CN2C3OC(CO)C(O)C3O |
Guanine, 9-ethyl- | C(C)N1C=Nc2c(O)nc(N)nc12 |
Guanine, N,N-dimethyl- (VAN8CI) | Oc1nc(nc2NC=Nc12)N(C)C |
Guanine, N-7-oxide | Oc1nc(N)nc2NCN(=O)c12 |
Guanine, N-methyl- (VAN) | Oc1nc(NC)nc2NC=Nc12 |
Guanine, hydrochloride | Oc1nc(N)nc2NC=Nc12 |
Guanine, monohydrochloride | Oc1nc(N)nc2NC=Nc12 |
Guanine, thio- (VAN) | Sc1nc(N)nc2NC=Nc12 |
Guanine__N-7-oxide | Oc1nc(N)nc2NCN(=O)c12 |
Ribofuranoside, guanine-9, BETA_-D- | Oc1nc(N)nc2c1N=CN2C3OC(CO)C(O)C3O |