If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2,4-Dinitro carbanilic acid ethyl ester | [N+](=O)([O-])c1cc(ccc1NC(=O)OCC)[N+](=O)[O-] |
Carbanilic acid, 1,1-dimethyl-2-propynyl ester | N(C(=O)OC(C)(C)C#C)c1ccccc1 |
Carbanilic acid, 1-carboxyethyl ester | N(C(=O)OC(C)C(=O)O)c1ccccc1 |
Carbanilic acid, 1-ethynylcyclohexyl ester | O(C(=O)Nc1ccccc1)C2(C#C)CCCCC2 |
Carbanilic acid, 2,4-dichloro-, ethyl ester | N(C(=O)OCC)c1ccc(Cl)cc1Cl |
Carbanilic acid, 2,4-dinitro-, ethyl ester | [N+](=O)([O-])c1cc(ccc1NC(=O)OCC)[N+](=O)[O-] |
Carbanilic acid, 2,5-dichloro-, ethyl ester | N(C(=O)OCC)c1cc(Cl)ccc1Cl |
Carbanilic acid, 2-((1-methylbutyl)amino)ethyl ester, hydrochloride | N(C(=O)OCCNC(C)CCC)c1ccccc1 |
Carbanilic acid, 2-(cyclohexylamino)ethyl ester, hydrochloride | N(C(=O)OCCNC1CCCCC1)c2ccccc2 |
Carbanilic acid, 2-(sec-butylamino)ethyl ester, hydrochloride | N(C(=O)OCCNC(C)CC)c1ccccc1 |
Carbanilic acid, 3,4-dichloro-, ethyl ester | N(C(=O)OCC)c1ccc(Cl)c(Cl)c1 |
Carbanilic acid, 5-chloro-2-methyl-, 2-chloroethyl ester | N(C(=O)OCCCl)c1cc(Cl)ccc1C |
Carbanilic acid, 5-chloro-2-methyl-, 2-propynyl ester | N(C(=O)OCC#C)c1cc(Cl)ccc1C |
Carbanilic acid, N,m-dimethylthio-, O-2-naphthyl ester | O(C(=S)N(C)c1cccc(C)c1)c2ccc3ccccc3c2 |
Carbanilic acid, N-ethyl-, ethyl ester | N(CC)(C(=O)OCC)c1ccccc1 |
Carbanilic acid, N-methyl-, ethyl ester | N(C)(C(=O)OCC)c1ccccc1 |
Carbanilic acid, N-methyl-, isopropyl ester | N(C)(C(=O)OC(C)C)c1ccccc1 |
Carbanilic acid, butyl ester | N(C(=O)OCCCC)c1ccccc1 |
Carbanilic acid, dithio-, methyl ester | N(C(=S)SC)c1ccccc1 |
Carbanilic acid, dithio-, monoammonium salt | N(C(=S)S)c1ccccc1 |
Carbanilic acid, dithio-m-hydroxy-, S-methyl ester, methylcarbamate | N(C(=S)SC)c1cccc(c1)OC(=O)NC |
Carbanilic acid, ethyl ester | N(C(=O)OCC)c1ccccc1 |
Carbanilic acid, isopropyl ester | N(C(=O)OC(C)C)c1ccccc1 |
Carbanilic acid, m,N-dimethylthio-, O-2-naphthyl ester | O(C(=S)N(C)c1cccc(C)c1)c2ccc3ccccc3c2 |
Carbanilic acid, m-chloro-, 2-chloroethyl ester | N(C(=O)OCCCl)c1cccc(Cl)c1 |
Carbanilic acid, m-chloro-, 4-chloro-2-butynyl ester | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
Carbanilic acid, m-chloro-, allyl ester | N(C(=O)OCC=C)c1cccc(Cl)c1 |
Carbanilic acid, m-chloro-, ethyl ester | N(C(=O)OCC)c1cccc(Cl)c1 |
Carbanilic acid, m-chloro-, isopropyl ester | N(C(=O)OC(C)C)c1cccc(Cl)c1 |
Carbanilic acid, m-chloro-, sec-butyl ester | N(C(=O)OC(C)CC)c1cccc(Cl)c1 |
Carbanilic acid, m-hydroxy-, 2-methoxyethyl ester, methylcarbamate | N(C(=O)OCCOC)c1cccc(c1)OC(=O)NC |
Carbanilic acid, m-hydroxy-, 2-propynyl ester, methylcarbamate | N(C(=O)OCC#C)c1cccc(c1)OC(=O)NC |
Carbanilic acid, m-hydroxy-, allyl ester | N(C(=O)OCC=C)c1cccc(O)c1 |
Carbanilic acid, m-hydroxy-, cyclohexyl ester | N(C(=O)OC1CCCCC1)c2cccc(O)c2 |
Carbanilic acid, m-hydroxy-, ethyl ester | N(C(=O)OCC)c1cccc(O)c1 |
Carbanilic acid, m-hydroxy-, isopentyl ester | N(C(=O)OCCC(C)C)c1cccc(O)c1 |
Carbanilic acid, m-hydroxy-, isopropyl ester, methylcarbamate | N(C(=O)OC(C)C)c1cccc(c1)OC(=O)NC |
Carbanilic acid, m-hydroxy-, methyl ester, 2-isobutylcarbamate | O(C(=O)NCC(C)C)c1cccc(c1)NC(=O)OC |
Carbanilic acid, m-hydroxy-, methyl ester, butylcarbamate | O(C(=O)NCCCC)c1cccc(c1)NC(=O)OC |
Carbanilic acid, m-hydroxy-, methyl ester, ethylcarbamate (ester) | O(C(=O)NCC)c1cccc(c1)NC(=O)OC |
Carbanilic acid, m-hydroxy-, methyl ester, ethylcarbamate | O(C(=O)NCC)c1cccc(c1)NC(=O)OC |
Carbanilic acid, m-hydroxy-, propyl ester | N(C(=O)OCCC)c1cccc(O)c1 |
Carbanilic acid, methyl ester | N(C(=O)OC)c1ccccc1 |
Carbanilic acid, o-hydroxy-, methyl ester, methylcarbamate | N(C(=O)OC)c1ccccc1OC(=O)NC |
Carbanilic acid, o-nitro-, ethyl ester | N(C(=O)OCC)c1ccccc1[N+](=O)[O-] |
Carbanilic acid, o-nitro-, methyl ester | [N+](=O)([O-])c1ccccc1NC(=O)OC |
Carbanilic acid, p-(benzyloxy)-, p-nitrophenyl ester | O(Cc1ccccc1)c2ccc(cc2)NC(=O)Oc3ccc(cc3)[N+](=O)[O-] |
Carbanilic acid, p-benzyloxy-, (p-nitrophenyl) ester | O(Cc1ccccc1)c2ccc(cc2)NC(=O)Oc3ccc(cc3)[N+](=O)[O-] |
Carbanilic acid, p-chloro-, 2,2,2-trichloroacetimidoylamino ester | N(C(=O)ONC(=N)C(Cl)(Cl)Cl)c1ccc(Cl)cc1 |
Carbanilic acid, p-chloro-, 2-butynylene ester | N(C(=O)OCC#CCOC(=O)Nc1ccc(Cl)cc1)c2ccc(Cl)cc2 |
Carbanilic acid, p-chloro-, 3,4,6-trichloro-2-nitrophenyl ester | O(C(=O)Nc1ccc(Cl)cc1)c2c(Cl)cc(Cl)c(Cl)c2[N+](=O)[O-] |
Carbanilic acid, p-chloro-, ethyl ester | N(C(=O)OCC)c1ccc(Cl)cc1 |
Carbanilic acid, p-chloro-, isopropyl ester | N(C(=O)OC(C)C)c1ccc(Cl)cc1 |
Carbanilic acid, p-chlorodithio-, ester with ethyl mercaptoacetate | N(C(=S)SCC(=O)OCC)c1ccc(Cl)cc1 |
Carbanilic acid, p-chlorodithio-, ethyl ester | N(C(=S)SCC)c1ccc(Cl)cc1 |
Carbanilic acid, p-chlorodithio-, methyl ester | N(C(=S)SC)c1ccc(Cl)cc1 |
Carbanilic acid, p-ethoxy-, isopropyl ester | N(C(=O)OC(C)C)c1ccc(OCC)cc1 |
Carbanilic acid, p-hydroxy-, (p-aminophenyl) ester | N(C(=O)Oc1ccc(N)cc1)c2ccc(O)cc2 |
Carbanilic acid, p-hydroxy-, p-aminophenyl ester | N(C(=O)Oc1ccc(N)cc1)c2ccc(O)cc2 |
Carbanilic acid, p-nitro-, ethyl ester | N(C(=O)OCC)c1ccc(cc1)[N+](=O)[O-] |
Carbanilic acid, phenyl ester | N(C(=O)Oc1ccccc1)c2ccccc2 |
Carbanilic acid, propyl ester | N(C(=O)OCCC)c1ccccc1 |
Carbanilic acid, thio-, O-methyl ester | N(C(=S)OC)c1ccccc1 |
Carbanilic acid, thio-, o-ethyl ester | N(C(=S)OCC)c1ccccc1 |
Carbanilic acid, thiol-, p-chlorophenyl ester | S(C(=O)Nc1ccccc1)c2ccc(Cl)cc2 |
Carbanilic acid, thiono-, ethyl ester | N(C(=S)OCC)c1ccccc1 |
Carbanilic_acid__1-ethynylcyclohexyl_ester | O(C(=O)Nc1ccccc1)C2(C#C)CCCCC2 |
Carbanilic_acid__m-hydroxy-__cyclohexyl_ester | N(C(=O)OC1CCCCC1)c2cccc(O)c2 |
Carbanilic_acid__m-hydroxy-__methyl_ester__ethylcarbamate_(ester) | O(C(=O)NCC)c1cccc(c1)NC(=O)OC |
Carbanilic_acid__p-(benzyloxy)-__p-nitrophenyl_ester | O(Cc1ccccc1)c2ccc(cc2)NC(=O)Oc3ccc(cc3)[N+](=O)[O-] |
Carbanilic_acid__p-chloro-__3_4_6-trichloro-2-nitrophenyl_ester | O(C(=O)Nc1ccc(Cl)cc1)c2c(Cl)cc(Cl)c(Cl)c2[N+](=O)[O-] |
Carbanilic_acid__p-hydroxy-__(p-aminophenyl)_ester | N(C(=O)Oc1ccc(N)cc1)c2ccc(O)cc2 |
Carbanilic_acid__thiol-__p-chlorophenyl_ester | S(C(=O)Nc1ccccc1)c2ccc(Cl)cc2 |
Isopropyl carbanilic acid ester | N(C(=O)OC(C)C)c1ccccc1 |