If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
N-Phenylcarbamic acid cyclopentyl ester | N(C(=O)OC1CCCC1)c2ccccc2 |
N-Phenylcarbamic acid, isopropyl ester | N(C(=O)OC(C)C)c1ccccc1 |
Phenylcarbamic acid 1,1-dimethyl-2-propynyl ester | N(C(=O)OC(C)(C)C#C)c1ccccc1 |
Phenylcarbamic acid carboxyethyl ester | N(C(=O)OC(C)C(=O)O)c1ccccc1 |
Phenylcarbamic acid,1-methylethyl ester | N(C(=O)OC(C)C)c1ccccc1 |
Phenylcarbamic_acid_1_1-dimethyl-2-propynyl_ester | N(C(=O)OC(C)(C)C#C)c1ccccc1 |