If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Acetic acid, glacial | C(C)(=O)O |
Acrylic acid, glacial | C(=O)(O)C=C |
Glacial acetic acid | C(C)(=O)O |
Brilliant Glacier Blue | C(c1ccc(NCC)c(C)c1)(=C2C=CC(=NCC)C(C)=C2)c3ccccc3Cl |
GLADIOLIC ACID | C(=O)(O)c1c(OC)c(C)cc(C=O)c1C=O |
Glandubolin | CC12CCC3c4ccc(O)cc4CCC3C1CCC2=O |
Glanducorpin | CC12CCC(=O)C=C2CCC3C1CCC4(C)C(CCC34)C(C)=O |
GLANDULIFEROL | CC1(C)C(Br)CC=C(C)C12CCC(C)(O)C(Cl)C2 |
Glarubin | CC12C(O)C(O)C=C(C)C2CC3OC(=O)C(OC(=O)C(C)(O)CC)C4C(C)C(O)C5(O)OCC34C15 |
Leucena glauca ALPHA_-amino acid | C(C(N)C(=O)O)N1C=CC(=O)C(O)=C1 |
Glaucarubin | CC12C(O)C(O)C=C(C)C2CC3OC(=O)C(OC(=O)C(C)(O)CC)C4C(C)C(O)C5(O)OCC34C15 |
GLAUCARUBINE | CC12C(O)C(O)C=C(C)C2CC3OC(=O)C(OC(=O)C(C)(O)CC)C4C(C)C(O)C5(O)OCC34C15 |
GLAUCARUBINE, 2'-ACETYL | CC12C(O)C(O)C=C(C)C2CC3OC(=O)C(OC(=O)C(C)(CC)OC(C)=O)C4C(C)C(O)C5(O)OCC34C15 |
Glaucarubine-2'-acetate | CC12C(O)C(O)C=C(C)C2CC3OC(=O)C(OC(=O)C(C)(CC)OC(C)=O)C4C(C)C(O)C5(O)OCC34C15 |
glaucarubinone | A sub-index is available for glaucarubinone... |
GLAUCARUBOL | CC12C(O)C(O)C=C(C)C2CC3OC(=O)C(O)C4C(C)C(O)C5(O)OCC34C15 |
Glaucarubol pentaacetate | C(OC(C)=O)C12C3OC(=O)C(OC(C)=O)C2C(C)C(OC(C)=O)C(=O)C1C4(C)C(C3)C(C)=CC(OC(C)=O)C4OC(C)=O |
Glaucarubol | CC12C(O)C(O)C=C(C)C2CC3OC(=O)C(O)C4C(C)C(O)C5(O)OCC34C15 |
Glaucarubol_pentaacetate | C(OC(C)=O)C12C3OC(=O)C(OC(C)=O)C2C(C)C(OC(C)=O)C(=O)C1C4(C)C(C3)C(C)=CC(OC(C)=O)C4OC(C)=O |
GLAUCARUBOLINE,13-DEHYDRO- | CC12C(O)C(=O)C=C(C)C2CC3OC(=O)C(O)C4C(=C)C(O)C5(O)OCC34C15 |
glaucarubolone | A sub-index is available for glaucarubolone... |
(+)-Glaucine | O(C)c1c(OC)cc2CCN(C)C3Cc4cc(OC)c(OC)cc4c1c23 |
GLAUCINE,(D) | O(C)c1c(OC)cc2CCN(C)C3Cc4cc(OC)c(OC)cc4c1c23 |
Glaucine | O(C)c1c(OC)cc2CCN(C)C3Cc4cc(OC)c(OC)cc4c1c23 |
S-(+)-Glaucine | O(C)c1c(OC)cc2CCN(C)C3Cc4cc(OC)c(OC)cc4c1c23 |
d-Glaucine | O(C)c1c(OC)cc2CCN(C)C3Cc4cc(OC)c(OC)cc4c1c23 |
Glaucosan | C(O)(CNC)c1ccc(O)c(O)c1 |
Glaucotensil | S(N)(=O)(=O)C1=Nc2ccc(OCC)cc2S1 |
Glaumeba | CC12C(O)C(O)C=C(C)C2CC3OC(=O)C(OC(=O)C(C)(O)CC)C4C(C)C(O)C5(O)OCC34C15 |
Glaupax | S(N)(=O)(=O)C1=NN=C(S1)NC(C)=O |
Glaurin | C(=O)(OCCOCCO)CCCCCCCCCCC |
Glauvent | O(C)c1c(OC)cc2CCN(C)C3Cc4cc(OC)c(OC)cc4c1c23 |
Glavaspidic acid | C(c1c(O)c(C)c(O)c(C(=O)CCC)c1O)C2=C(O)C(C)(C)C(O)=C(C(=O)CCC)C2=O |
Glazamine M | N(CO)c1nc(NCO)nc(NCO)n1 |
Glazd penta | Clc1c(Cl)c(Cl)c(O)c(Cl)c1Cl |
(.+-.)-Glaziovine | Oc1c(OC)cc2CCN(C)C3CC4(C=CC(=O)C=C4)c1c23 |
GLAZIOVINE | Oc1c(OC)cc2CCN(C)C3CC4(C=CC(=O)C=C4)c1c23 |
Glaziovine (VAN8CI) | Oc1c(OC)cc2CCN(C)C3CC4(C=CC(=O)C=C4)c1c23 |
Glaziovine, (.+-.)- | Oc1c(OC)cc2CCN(C)C3CC4(C=CC(=O)C=C4)c1c23 |
Glaziovine, L- | Oc1c(OC)cc2CCN(C)C3CC4(C=CC(=O)C=C4)c1c23 |
Glcylalanine | N(C(=O)CN)C(C)C(=O)O |
GLECHOMAFURAN | CC12OC1CCC3(C)OC3CC4=C(OC=C4C)C2 |
Glianimon | O=C1Nc2ccccc2N1C3CCN(CCCC(=O)c4ccc(F)cc4)CC3 |
Guiacol-gliceriletere monocarbammato | O(CC(O)COC(N)=O)c1ccccc1OC |
Gliciclamide | S(=O)(=O)(NC(=O)NC1CCCCC1)c2ccc(C)cc2 |
Allil-glicidil-etere(ITALIAN) | C(OCC=C)C1CO1 |
Glicoamin | C(=O)(O)CN |
(3,4-Methylenedioxy-6-propylbenzyl) (butyl) diethylene glicol ether | C(OCCOCCOCCCC)c1cc2OCOc2cc1CCC |
Glicol monocloridrina(ITALIAN) | C(Cl)CO |
Glicosil | S(=O)(=O)(NC(=O)NC1CCCCC1)c2ccc(C)cc2 |
Glimid | C(C)C1(CCC(=O)NC1=O)c2ccccc2 |
Gliodin | C(CCCCCCCCCCCCCCCC)C1=NCCN1 |
Glipasol | N(C1=NN=C(S1)C(C)(C)C)S(=O)(=O)c2ccc(N)cc2 |
Glisema | S(=O)(=O)(NC(=O)NCCC)c1ccc(Cl)cc1 |
Glitsin | N(CC(=O)O)c1ccc(O)cc1 |
Globenicol | C(O)(c1ccc(cc1)[N+](=O)[O-])C(CO)NC(=O)C(Cl)Cl |
Globentyl | C(=O)(O)c1ccccc1OC(C)=O |
Globoid | C(=O)(O)c1ccccc1OC(C)=O |
Globulariacitrin | c1cc(cc(O)c1O)C2=C(OC3OC(COC4OC(C)C(O)C(O)C4O)C(O)C(O)C3O)C(=O)c5c(O)cc(O)cc5O2 |
Globularicitrin | c1cc(cc(O)c1O)C2=C(OC3OC(COC4OC(C)C(O)C(O)C4O)C(O)C(O)C3O)C(=O)c5c(O)cc(O)cc5O2 |
Globulin, immune human serum | C(CCN)C(=O)O |
Globulin__immune_human_serum | C(CCN)C(=O)O |
Globulol | CC1(C)C2CCC(C)(O)C3CCC(C)C3C12 |
Glomerulin | O=S1(=O)NCNc2cc(c(cc12)S(N)(=O)=O)C(F)(F)F |
Gloriosine | O(C)c1c(OC)c(OC)cc2CCC(NC=O)C3=CC(=O)C(OC)=CC=C3c12 |
Glorous | C(O)(c1ccc(cc1)[N+](=O)[O-])C(CO)NC(=O)C(Cl)Cl |
Glosso-Sterandryl | CC12CCC(=O)C=C2CCC3C1CCC4(C)C3CCC4(C)O |
Gloxazon | C(C=NNC(N)=S)(=NNC(N)=S)C(C)OCC |
Gloxazone(USAN) | C(C=NNC(N)=S)(=NNC(N)=S)C(C)OCC |
Irgalite Blue GLSM | [Cu]123N4C5=C6C=CC=CC6=C4N=C7N2=C(N=C8N1C(=NC9=N3C(=N5)c%10ccccc9%10)c%11ccccc8%11)c%12ccccc7%12 |
D-Glucamine | C(O)(C(O)CI)C(O)C(O)CI |
N-Methyl-D-glucamine | C(O)(C(O)CNC)C(O)C(O)CO |
D-Glucaramide | C(O)(C(O)C(N)=O)C(O)C(O)C(N)=O |
Calcium D-glucarate | C(O)(C(O)C(=O)O)C(O)C(O)C(=O)O |
Copper glucarate, Cu(O8C6H8) | C(O)(C(O)C(=O)O)C(O)C(O)C(=O)O |
Copper_glucarate__Cu(O8C6H8) | C(O)(C(O)C(=O)O)C(O)C(O)C(=O)O |
glucaric | A sub-index is available for glucaric... |
Glucazide | C(O)(C=NNC(=O)c1ccncc1)C2OC(=O)C(O)C2O |
Calcium gluceptate | C(O)(C(O)C(O)CO)C(O)C(O)C(=O)O |
Glucid | O=S1(=O)NC(=O)c2ccccc12 |
Glucidoral | S(=O)(=O)(NC(=O)NCCCC)c1ccc(N)cc1 |
glucitol | A sub-index is available for glucitol... |
gluco | A sub-index is available for gluco... |
D-Glucoanilide, p-sulfamoyl- | N(C(=O)C(O)C(O)C(O)C(O)CO)c1ccc(cc1)S(N)(=O)=O |
D-Glucoascorbic acid | C(O)(C(O)CO)C1OC(=O)C(O)=C1O |
GLUCOASCORBIC ACID (L), HYDRATE | C(O)(C(O)CO)C1OC(=O)C(O)=C1O |
GLUCOASCORBIC_ACID_(L)__HYDRATE | C(O)(C(O)CO)C1OC(=O)C(O)=C1O |
Glucoascorbic acid, D- | C(O)(C(O)CO)C1OC(=O)C(O)=C1O |
Glucocaffeic acid | O(c1ccc(C=CC(=O)O)cc1O)C2OC(CO)C(O)C(O)C2O |
Glucocaffeic_acid | O(c1ccc(C=CC(=O)O)cc1O)C2OC(CO)C(O)C(O)C2O |
GLUCOCAPPARIN, POTASSIUM SALT | S(C(C)=NOS(=O)(=O)O)C1OC(CO)C(O)C(O)C1O |
GLUCOCAPPARIN__POTASSIUM_SALT | S(C(C)=NOS(=O)(=O)O)C1OC(CO)C(O)C(O)C1O |
Glucochloralose | OC1C(OC2OC(OC12)C(Cl)(Cl)Cl)C(O)CO |
Glucodigin | OC12CCC(C3=CC(=O)OC3)C2(C)CCC4C1CCC5CC(CCC45C)OC6CC(O)C(OC7CC(O)C(OC8CC(O)C(O)C(C)O8)C(C)O7)C(C)O6 |
Glucoenergan | N(CC)C1C2CCC(C2)C1c3ccccc3 |
Glucofren | S(=O)(=O)(NC(=O)NCCCC)c1ccc(N)cc1 |
glucofuranose | A sub-index is available for glucofuranose... |
D-Glucofuranuronic acid, GAMMA_-lactone | C(O)(C=O)C1OC(=O)C(O)C1O |
Glucofuranuronic acid, GAMMA_-lactone, D- | C(O)(C=O)C1OC(=O)C(O)C1O |
Glucofuranuronic_acid__GAMMA_-lactone__D- | C(O)(C=O)C1OC(=O)C(O)C1O |
ALPHA_-Glucoheptitol | C(O)(C(O)C(O)CO)C(O)C(O)CO |
Calcium glucoheptonate | C(O)(C(O)C(O)CO)C(O)C(O)C(=O)O |
Calcium-ALPHA_-D-glucoheptonate | C(O)(C(O)C(O)CO)C(O)C(O)C(=O)O |
Glucoheptonic acid, calcium salt (2:1) | C(O)(C(O)C(O)CO)C(O)C(O)C(=O)O |
Calcium glucoheptonoate | C(O)(C(O)C(O)CO)C(O)C(O)C(=O)O |
3-keto-D-Glucoheptonofuranolactone | C(O)(C(O)CO)C1OC(=O)C(O)=C1O |
Glucolin | C(O)(C(O)CO)C(O)C(O)C=O |
D-Gluconamide, N-(4-(aminosulfonyl)phenyl)- | N(C(=O)C(O)C(O)C(O)C(O)CO)c1ccc(cc1)S(N)(=O)=O |
D-Gluconamide__N-(4-(aminosulfonyl)phenyl)- | N(C(=O)C(O)C(O)C(O)C(O)CO)c1ccc(cc1)S(N)(=O)=O |
m-AMSA gluconate salt | C(O)(C(O)C(=O)O)C(O)C(O)CO.COc1cc(ccc1Nc2c3ccccc3nc4ccccc24)NS(C)(=O)=O |
gluconato | A sub-index is available for gluconato... |
gluconic | A sub-index is available for gluconic... |
Glucoproscillaridin A | OC12CCC(C3=COC(=O)C=C3)C2(C)CCC4C1CCC5=CC(CCC45C)OC6OC(C)C(O)C(OC7OC(CO)C(O)C(O)C7O)C6O |
Glucoproscillaridin_A | OC12CCC(C3=COC(=O)C=C3)C2(C)CCC4C1CCC5=CC(CCC45C)OC6OC(C)C(O)C(OC7OC(CO)C(O)C(O)C7O)C6O |
glucopyranose | A sub-index is available for glucopyranose... |
glucopyranoside | A sub-index is available for glucopyranoside... |
glucopyranosiduronic | A sub-index is available for glucopyranosiduronic... |
glucopyranosyl | A sub-index is available for glucopyranosyl... |
glucopyranosylamine | A sub-index is available for glucopyranosylamine... |
glucopyranosyloxy | A sub-index is available for glucopyranosyloxy... |
Tetra-O-acetyl-BETA_-d-Glucopyranosylsulfenamido benzene | O(C(C)=O)C1C(OC(C)=O)C(COC(C)=O)OC(SNc2ccccc2)C1OC(C)=O |
glucopyranuronic | A sub-index is available for glucopyranuronic... |
glucopyranuronosyl | A sub-index is available for glucopyranuronosyl... |
D-Glucosaccharinic acid | C(C)(O)(C(=O)O)C(O)C(O)CO |
D-Glucosaccharinic_acid | C(C)(O)(C(=O)O)C(O)C(O)CO |
Glucosaccharonic acid | C(O)(CO)C1OC(=O)C(O)=C1O |
glucosamine | A sub-index is available for glucosamine... |
Glucosaminic acid | C(O)(C(N)C(=O)O)C(O)C(O)CO |
d-Glucosaminic acid | C(O)(C(N)C(=O)O)C(O)C(O)CO |
D-Glucosazone | C(C=NNc1ccccc1)(=NNc2ccccc2)C(O)C(O)C(O)CO |
glucose | A sub-index is available for glucose... |
Podophyllotoxin-benziliden-glucosid (GERMAN) | O=C1OCC2C1C(c3cc(OC)c(OC)c(OC)c3)c4cc5OCOc5cc4C2OC6OC7COC(OC7C(O)C6O)c8ccccc8 |
glucoside | A sub-index is available for glucoside... |
(ALPHA_-D-Glucosido)-BETA_-D-fructofuranoside | O(C1OC(CO)C(O)C(O)C1O)C2(CO)OC(CO)C(O)C2O |
Glucosoxime | C(O)(C(O)C=NO)C(O)C(O)CO |
glucosulfone | A sub-index is available for glucosulfone... |
7-Glucosyl quercetin | O=C1C(O)=C(Oc2cc(cc(O)c12)OC3OC(CO)C(O)C(O)C3O)c4ccc(O)c(O)c4 |
7-O-(BETA_-D-Glucosyl)apigenin | O=C1C=C(Oc2cc(cc(O)c12)OC3OC(CO)C(O)C(O)C3O)c4ccc(O)cc4 |
ANTHRONE, 10-GLUCOSYL-1,8-DIHYDROXY-3-(HYDROXYMETHYL) | OC1C(O)C(O)C(CO)OC1C2c3cccc(O)c3C(=O)c4c(O)cc(CO)cc24 |
ANTHRONE__10-GLUCOSYL-1_8-DIHYDROXY-3-(HYDROXYMETHYL) | OC1C(O)C(O)C(CO)OC1C2c3cccc(O)c3C(=O)c4c(O)cc(CO)cc24 |
Glucosyl-7-quercetin | O=C1C(O)=C(Oc2cc(cc(O)c12)OC3OC(CO)C(O)C(O)C3O)c4ccc(O)c(O)c4 |
2-10-Di(demethoxy)-2-glucosyloxy-10-methylthiocolchicine | O(C)c1c(OC)c(cc2CCC(NC(C)=O)C3=CC(=O)C(SC)=CC=C3c12)OC4OC(CO)C(O)C(O)C4O |
BETA_-D-glucosyloxyazoxymethane | O(CN=N(C)O)C1OC(CO)C(O)C(O)C1O |
Glucoxy | C(O)(C=O)C1OC(=O)C(O)C1O |
Glucurolactone | C(O)(C=O)C1OC(=O)C(O)C1O |
Glucuron | C(O)(C=O)C1OC(=O)C(O)C1O |
TRIMETREXATE GLUCURONATE | Cc1c(CNc2cc(OC)c(OC)c(OC)c2)ccc3nc(N)nc(N)c13.O=CC(O)C(O)C(O)C(O)C(=O)O |
Cyclohexanemethanamine, 2-amino-, platinum glucuronatecomplex | C(O)(C(O)C(O)C=O)C1O[Pt]2(NCC3CCCCC3N2)OC1=O |
glucuronato | A sub-index is available for glucuronato... |
Glucurone | C(O)(C=O)C1OC(=O)C(O)C1O |
glucuronic | A sub-index is available for glucuronic... |
8-Quinolinyl glucuronide | O(C1OC(C(=O)O)C(O)C(O)C1O)c2cccc3cccnc23 |
Etiocholanolone glucuronide | CC12CCC(OC3OC(C(=O)O)C(O)C(O)C3O)CC2CCC4C1CCC5(C)C(=O)CCC45 |
Etiocholanolone_glucuronide | CC12CCC(OC3OC(C(=O)O)C(O)C(O)C3O)CC2CCC4C1CCC5(C)C(=O)CCC45 |
D-Glucurono-3,6-lactone | C(O)(C=O)C1OC(=O)C(O)C1O |
D-Glucurono-6,3-lactone | C(O)(C=O)C1OC(=O)C(O)C1O |
D-Glucurono-GAMMA_-lactone | C(O)(C=O)C1OC(=O)C(O)C1O |
D-Glucuronolactone isonicotinoylhydrazone | C(O)(C=NNC(=O)c1ccncc1)C2OC(=O)C(O)C2O |
D-Glucuronolactone isonicotinyl hydrazone | C(O)(C=NNC(=O)c1ccncc1)C2OC(=O)C(O)C2O |
D-Glucuronolactone | C(O)(C=O)C1OC(=O)C(O)C1O |
Glucuronolactone (VAN) | C(O)(C=O)C1OC(=O)C(O)C1O |
Glucuronosan | C(O)(C=O)C1OC(=O)C(O)C1O |
l-Mandelonitrile-BETA_-glucuronoside | O(C(C#N)c1ccccc1)C2OC(C(=O)O)C(O)C(O)C2O |
Seriplas Glue Green BW | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Glukresin | O(CC(O)CO)c1ccccc1C |
Glumin | C(N)(CCC(N)=O)C(=O)O |
Glupan | O=C1c2ccccc2C(=O)N1C3CCC(=O)NC3=O |
Glupax | S(N)(=O)(=O)C1=NN=C(S1)NC(C)=O |
Gluronazid | C(O)(C=NNC(=O)c1ccncc1)C2OC(=O)C(O)C2O |
Gluronsan | C(O)(C=O)C1OC(=O)C(O)C1O |
Glusate | C(N)(CCC(=O)O)C(=O)O |
Glusatin | C(N)(CCC(=O)O)C(=O)O |
Gluside | O=S1(=O)NC(=O)c2ccccc12 |
gluta | A sub-index is available for gluta... |
Glutacid | C(N)(CCC(=O)O)C(=O)O |
GLUTACOMMIDE, 3-ACETYL-4-ISOVALERYL | C(=O)(CC(C)C)C1C(=O)NC(=O)C=C1C(C)=O |
GLUTACOMMIDE__3-ACETYL-4-ISOVALERYL | C(=O)(CC(C)C)C1C(=O)NC(=O)C=C1C(C)=O |
Glutaconaldehyde dianil chloride | N(C=CC=CC=Nc1ccccc1)c2ccccc2 |
Glutaconaldehyde dianil monohydrochloride | N(C=CC=CC=Nc1ccccc1)c2ccccc2 |
Glutaconaldehyde dianilide hydrochloride | N(C=CC=CC=Nc1ccccc1)c2ccccc2 |
Glutaconaldehydedianil hydrochloride | N(C=CC=CC=Nc1ccccc1)c2ccccc2 |
Diethyl glutaconate | C(=O)(OCC)CC=CC(=O)OCC |
Dimethyl glutaconate | C(C=CC(=O)OC)C(=O)OC |
Glutaconic acid, 3-carboxy- | C(CC(=O)O)(=CC(=O)O)C(=O)O |
Glutaconic acid, diethyl ester | C(=O)(OCC)CC=CC(=O)OCC |
Glutaconic acid, dimethyl ester | C(C=CC(=O)OC)C(=O)OC |
Glutacyl | C(N)(CCC(=O)O)C(=O)O |
glutamate | A sub-index is available for glutamate... |
glutamic | A sub-index is available for glutamic... |
GLUTAMICINE | C(=O)(CC(C)C)C1C(=O)NC(=O)C=C1C(C)=O |
Glutamicol | C(N)(CCC(=O)O)C(=O)O |
L-Glutamid | C(N)(CCC(N)=O)C(=O)O |
L-Glutamide | C(N)(CCC(N)=O)C(=O)O |
Glutamidex | C(N)(CCC(=O)O)C(=O)O |
Glutamidin | C(N)(CCC(=O)O)C(=O)O |
Zinc, bis(L-glutaminato-N(2),O(1))- | C(CC(N)=O)C1N[Zn]2(OC1=O)OC(=O)C(CCC(N)=O)N2 |
Zinc, bis(L-glutaminato-N2, O1)- | C(CC(N)=O)C1N[Zn]2(OC1=O)OC(=O)C(CCC(N)=O)N2 |
Zinc__bis(L-glutaminato-N(2)_O(1))- | C(CC(N)=O)C1N[Zn]2(OC1=O)OC(=O)C(CCC(N)=O)N2 |
glutamine | A sub-index is available for glutamine... |
Glutaminic acid (VAN) | C(N)(CCC(=O)O)C(=O)O |
L-Glutaminic acid | C(N)(CCC(=O)O)C(=O)O |
Glutaminol | C(N)(CCC(=O)O)C(=O)O |
N-Phthalyl-glutaminsaeure-imid (GERMAN) | O=C1c2ccccc2C(=O)N1C3CCC(=O)NC3=O |
Glutammato monosodico(ITALIAN) | C(N)(CCC(=O)O)C(=O)O |
glutamyl | A sub-index is available for glutamyl... |
L-GAMMA_-Glutamylhydrazide | C(CC(=O)NN)C(N)C(=O)O |
ALPHA_-Glutamylvaline | C(NC(=O)C(N)CCC(=O)O)(C(C)C)C(=O)O |
Glutamylvaline | C(NC(=O)C(N)CCC(=O)O)(C(C)C)C(=O)O |
Glutan H-C-L | C(N)(CCC(=O)O)C(=O)O |
Glutan HCl | C(N)(CCC(=O)O)C(=O)O |
Glutan Hydrochloric | C(N)(CCC(=O)O)C(=O)O |
Glutan hydrochloride | C(N)(CCC(=O)O)C(=O)O |
Glutanon | O=C1c2ccccc2C(=O)N1C3CCC(=O)NC3=O |
Glutaral(USAN) | C(CC=O)CC=O |
Glutaraldehyd(CZECH) | C(CC=O)CC=O |
glutaraldehyde | A sub-index is available for glutaraldehyde... |
glutaramic | A sub-index is available for glutaramic... |
ALPHA_,GAMMA_-dicyano-BETA_-methyl glutaramide | C(C#N)(C(N)=O)C(C)C(C#N)C(N)=O |
ALPHA__GAMMA_-dicyano-BETA_-methyl_glutaramide | C(C#N)(C(N)=O)C(C)C(C#N)C(N)=O |
Glutaramide | C(CC(N)=O)CC(N)=O |
Glutaramide, 2, 4-dicyano-3-methyl- | C(C#N)(C(N)=O)C(C)C(C#N)C(N)=O |
glutaranilic | A sub-index is available for glutaranilic... |
Glutaranilide | N(C(=O)CCCC(=O)Nc1ccccc1)c2ccccc2 |
glutarate | A sub-index is available for glutarate... |
Glutardialdehyde tetramethyl acetal | C(OC)(OC)CCCC(OC)OC |
Glutardialdehyde | C(CC=O)CC=O |
Glutargin | C(N)(CCC(=O)O)C(=O)O.N=C(N)NCCCC(N)C(=O)O |
glutaric | A sub-index is available for glutaric... |
glutarimide | A sub-index is available for glutarimide... |
Glutarodiamide | C(CC(N)=O)CC(N)=O |
Glutarodinitrile | C(CC#N)CC#N |
Glutarol | C(CC=O)CC=O |
Glutaronitrile | C(CC#N)CC#N |
Glutaroyl chloride | C(CC(Cl)=O)CC(Cl)=O |
Glutaryl chloride | C(CC(Cl)=O)CC(Cl)=O |
Glutaryl chloride, hexafluoro- | C(F)(F)(C(F)(F)C(Cl)=O)C(F)(F)C(Cl)=O |
Glutaryl dichloride | C(CC(Cl)=O)CC(Cl)=O |
Glutasin | C(N)(CCC(=O)O)C(=O)O |
Glutathimid | C(C)C1(CCC(=O)NC1=O)c2ccccc2 |
Glutathion | C(CS)(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O |
glutathione | A sub-index is available for glutathione... |
Glutatiol | C(CS)(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O |
Glutatione | C(CS)(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O |
Glutaton | C(N)(CCC(=O)O)C(=O)O |
Glutavene | C(N)(CCC(=O)O)C(=O)O |
Glutepar | C(N)(CCC(=O)O)C(=O)O.N=C(N)NCCCC(N)C(=O)O |
Glutethimid | C(C)C1(CCC(=O)NC1=O)c2ccccc2 |
Glutethimide | C(C)C1(CCC(=O)NC1=O)c2ccccc2 |
Glutetimid | C(C)C1(CCC(=O)NC1=O)c2ccccc2 |
Glutetimide | C(C)C1(CCC(=O)NC1=O)c2ccccc2 |
Gluthetimide | C(C)C1(CCC(=O)NC1=O)c2ccccc2 |
Glutide | C(CS)(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O |
Glutinal | C(CS)(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O |
Glutosalyl | C(=O)(O)c1ccccc1O |
Glybrom | N(CCN(C)C)(Cc1ccc(OC)cc1)c2ccccn2.BrC3=NC4=C(N3)N(C)C(=O)N(C)C4=O |
Glybutamide | S(=O)(=O)(NC(=O)NCCCC)c1ccc(N)cc1 |
Glybuthiazol | N(C1=NN=C(S1)C(C)(C)C)S(=O)(=O)c2ccc(N)cc2 |
Glybuthiazole | N(C1=NN=C(S1)C(C)(C)C)S(=O)(=O)c2ccc(N)cc2 |
DL-GLYC | C(O)(CO)C=O |
Solu-Glyc | CC12CC(O)C3C(CCC4=CC(=O)CCC34C)C1CCC2(O)C(=O)COC(=O)CCC(=O)O |
Glycarsamide | [As](=O)(O)(O)c1ccc(cc1)NC(=O)CO |
D-(+)-Glyceraldehyde | C(O)(CO)C=O |
D-Glyceraldehyde | C(O)(CO)C=O |
GLYCERALDEHYDE | C(O)(CO)C=O |
Glyceraldehyde, D- | C(O)(CO)C=O |
Lead glycerate | C(O)(CO)C(=O)O |
Lead_glycerate | C(O)(CO)C(=O)O |
Di(glycerato)(1,2-diaminocyclohexane)platinum(II) | O(C(=O)C(O)CO)[Pt]1(OC(=O)C(O)CO)NC2CCCCC2N1 |
Platinum(II), (cyclohexane-1,2-diammine)di(glycerato)- | O(C(=O)C(O)CO)[Pt]1(OC(=O)C(O)CO)NC2CCCCC2N1 |
DL-Glyceric acid | C(O)(CO)C(=O)O |
GLYCERIC ACID, (D) | C(O)(CO)C(=O)O |
Glyceric acid, DL- | C(O)(CO)C(=O)O |
Glyceric aldehyde | C(O)(CO)C=O |
1,3-Distearin glyceride | C(OC(=O)CCCCCCCCCCCCCCCCC)C(O)COC(=O)CCCCCCCCCCCCCCCCC |
Tricapric glyceride | C(COC(=O)CCCCCCCCC)(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC |
Tricaprylic glyceride | C(COC(=O)CCCCCCC)(COC(=O)CCCCCCC)OC(=O)CCCCCCC |
glycerin | A sub-index is available for glycerin... |
glycerinaether | A sub-index is available for glycerinaether... |
Glycerinaldehyde | C(O)(CO)C=O |
glycerine | A sub-index is available for glycerine... |
Glycerinformal | C(O)(CO)C=O |
Glycerinisopropylidene ether | C(O)C1COC(C)(C)O1 |
Glyceritol | C(O)(CO)CO |
glycero | A sub-index is available for glycero... |
glycerol | A sub-index is available for glycerol... |
Glycerolacetone | C(O)C1COC(C)(C)O1 |
1-Glycerophosphate | C(OP(=O)(O)O)C(O)CO |
3-Glycerophosphate | C(OP(=O)(O)O)C(O)CO |
ALPHA_-Glycerophosphate | C(OP(=O)(O)O)C(O)CO |
GLYCEROPHOSPHATE | C(OP(=O)(O)O)C(O)CO |
1-Glycerophosphoric acid | C(OP(=O)(O)O)C(O)CO |
ALPHA_-Glycerophosphoric acid | C(OP(=O)(O)O)C(O)CO |
Glycerophosphoric acid | C(OP(=O)(O)O)C(O)CO |
Glycerose | C(O)(CO)C=O |
glyceryl | A sub-index is available for glyceryl... |
Glycerylguaiacolate carbamate | O(CC(O)COC(N)=O)c1ccccc1OC |
Glycerylguajacol-Carbamat | O(CC(O)COC(N)=O)c1ccccc1OC |
glycidaether | A sub-index is available for glycidaether... |
Glycidal | C(=O)C1CO1 |
Glycidaldehyde | C(=O)C1CO1 |
Ethyl(methylphenyl)glycidate | CC1(OC1C(=O)OCC)c2ccccc2 |
Glycide | C(O)C1CO1 |
Glycidic acid, 3-phenyl-, ethyl ester | C(=O)(OCC)C1OC1c2ccccc2 |
Glycidic acid, 3-phenyl-, ethyl ester, trans- | C(=O)(OCC)C1OC1c2ccccc2 |
Glycidic acid, 3-sec-butyl-3-methyl-, methyl ester | C(C)(CC)C1(C)OC1C(=O)OC |
glycidol | A sub-index is available for glycidol... |
(3-Glycidoxypropyl)trimethoxysilane | [Si](OC)(OC)(OC)CCCOCC1CO1 |
(GAMMA_-Glycidoxypropyl)methyldiethoxysilane | [Si](C)(OCC)(OCC)CCCOCC1CO1 |
(GAMMA_-Glycidoxypropyl)trimethoxysilane | [Si](OC)(OC)(OC)CCCOCC1CO1 |
Bis(3-glycidoxypropyl)tetramethyldisiloxane | [Si](C)(C)(CCCOCC1CO1)O[Si](C)(C)CCCOCC2CO2 |
GAMMA_-((Glycidoxypropyl)trimethoxy)silane | [Si](OC)(OC)(OC)CCCOCC1CO1 |
ALPHA_-Glycidoxypropyltrimethoxysilane | [Si](OC)(OC)(OC)CCCOCC1CO1 |
GAMMA_-Glycidoxypropyltrimethoxysilane | [Si](OC)(OC)(OC)CCCOCC1CO1 |
Glycidoxypropyltrimethoxysilane | [Si](OC)(OC)(OC)CCCOCC1CO1 |
glycidyl | A sub-index is available for glycidyl... |
glycidyldiethylamine | A sub-index is available for glycidyldiethylamine... |
Oxyde d'allyle et de glycidyle(FRENCH) | C(OCC=C)C1CO1 |
Oxyde_d'allyle_et_de_glycidyle(FRENCH) | C(OCC=C)C1CO1 |
Dian-bis-glycidylether (CZECH) | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
Fenyl-glycidylether(CZECH) | O(CC1CO1)c2ccccc2 |
Glycidylnitrophenyl ether | [N+](=O)([O-])c1ccc(cc1)OCC2CO2 |
glycidyloxy | A sub-index is available for glycidyloxy... |
2, 2-Bis(4'-glycidyloxyphenyl)propane | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
2, 2-Bis(4-glycidyloxyphenyl)propane | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
2, 2-Bis(p-glycidyloxyphenyl)propane | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
Bis(4-glycidyloxyphenyl)dimethylmethane | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
Glycidyloxypropyltrimethoxysilane | [Si](OC)(OC)(OC)CCCOCC1CO1 |
Glycidylphosphonic acid diethyl ester | P(=O)(OCC)(OCC)CC1CO1 |
N-Glycidylphthalimide | O=C1c2ccccc2C(=O)N1CC3CO3 |
Glycidyltrimethylammonium chloride | C(C1CO1)N(C)(C)C |
Glycin | N(CC(=O)O)c1ccc(O)cc1 |
Glycinaldehyde diethyl acetal | C(CN)(OCC)OCC |
glycinamide | A sub-index is available for glycinamide... |
Glycinamidehydrochloride | C(N)(=O)CN |
Glycinanilide | N(C(=O)CN)c1ccccc1 |
Aphidicolin glycinate | CC12CCC(O)C(C)(CO)C2CCC3CC4CC13CCC4(O)COC(=O)CN |
Copper glycinate | O=C1CN[Cu]2(O1)NCC(=O)O2 |
Cupric glycinate | O=C1CN[Cu]2(O1)NCC(=O)O2 |
Ethyl glycinate hydrochloride | C(=O)(CN)OCC |
Nickel bis(glycinate) | O=C1CN[Ni]2(O1)NCC(=O)O2 |
glycinato | A sub-index is available for glycinato... |
glycine | A sub-index is available for glycine... |
Glycineamide hydrochloride | C(N)(=O)CN |
glycinonitrile | A sub-index is available for glycinonitrile... |
Glycirenan | C(O)(CNC)c1ccc(O)c(O)c1 |
Glyco stearin | C(=O)(OCCOCCO)CCCCCCCCCCCCCCCCC |
GLYCOALDEHYDE | C(O)C=O |
Glycobiarsol | [As](=O)(O)(O[Bi]=O)c1ccc(cc1)NC(=O)CO |
Sodium glycocholate | OC1CC2CC(O)CCC2(C)C3CC(O)C4(C)C(CCC4C13)C(C)CCC(=O)NCC(=O)O |
Glycocoll betaine | C(C(=O)O)N(C)(C)C |
Glycocoll | C(=O)(O)CN |
Glycocollanilide | N(C(=O)CN)c1ccccc1 |
Glycocollbetaine hydrochloride | C(C(=O)O)N(C)(C)C |
GLYCOCYAMINE | C(NC(=N)N)C(=O)O |
glycol | A sub-index is available for glycol... |
Glycolaldehyde diethyl acetal | C(CO)(OCC)OCC |
Glycolaldehyde | C(O)C=O |
Glycolaldehyde, diethyl acetal | C(CO)(OCC)OCC |
Glycolaldehyde__diethyl_acetal | C(CO)(OCC)OCC |
glycolamide | A sub-index is available for glycolamide... |
Glycolamidine hydrochloride | C(=N)(N)CO |
Glycolan Yellow BEL | CC1=NN(c2ccc(cc2C)S(=O)(=O)O)C3=O[Cr]4(O)OC(=O)c5ccc(cc5N4=NC13)S(=O)(=O)O |
Glycolanilide | N(C(=O)CO)c1ccccc1 |
glycolate | A sub-index is available for glycolate... |
Glycoleucine | C(N)(CCCC)C(=O)O |
glycolic | A sub-index is available for glycolic... |
Ethylene glycolide, (2, 3-epoxy-2-methylpropyl) ether | C(OCCOCC1(C)CO1)C2(C)CO2 |
Glycolide | O=C1COC(=O)CO1 |
Glycolixir | C(=O)(O)CN |
Ethyl 4, 4'-dichlorodiphenyl glycollate | C(O)(C(=O)OCC)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
Ethyl 4,4'-dichlorophenyl glycollate | C(O)(C(=O)OCC)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
Glycollic acid | C(=O)(O)CO |
o-((Carboxyphenyl)thio)glycollic acid | S(CC(=O)O)c1ccccc1C(=O)O |
Glycollide | O=C1COC(=O)CO1 |
Glycolmethyl ether | C(CO)OC |
Glycolmonochloorhydrine(DUTCH) | C(Cl)CO |
glycolonitrile | A sub-index is available for glycolonitrile... |
p-Glycolophenetidide | N(C(C)=O)c1ccc(OCC)cc1O |
Glycolophenone | C(=O)(CO)c1ccccc1 |
Arsanilic acid, N-glycoloyl- | [As](=O)(O)(O)c1ccc(cc1)NC(=O)CO |
Arsanilic acid, N-glycoloyl-, bismuth deriv | [As](=O)(O)(O[Bi]=O)c1ccc(cc1)NC(=O)CO |
p-Glycoloylaminobenzenearsonic acid | [As](=O)(O)(O)c1ccc(cc1)NC(=O)CO |
p-Glycoloylaminophenylarsinic acid | [As](=O)(O)(O)c1ccc(cc1)NC(=O)CO |
p-Glycoloylaminophenylarsonic acid | [As](=O)(O)(O)c1ccc(cc1)NC(=O)CO |
Bismuth, (hydrogen N-glycoloylarsanilato)oxo- | [As](=O)(O)(O[Bi]=O)c1ccc(cc1)NC(=O)CO |
N-Glycoloylarsanilic acid | [As](=O)(O)(O)c1ccc(cc1)NC(=O)CO |
Daunomycin, glycoloylhydrazone, monohydrochloride, monohydrate | Oc1c2CC(O)(CC(OC3CC(N)C(O)C(C)O3)c2c(O)c4C(=O)c5c(OC)cccc5C(=O)c14)C(C)=NNC(=O)CO |
Diethylene glycolphenyl ether | O(CCOCCO)c1ccccc1 |
glycols | A sub-index is available for glycols... |
Glycolsulfite | O=S1OCCO1 |
Glycoluric acid | C(NC(N)=O)C(=O)O |
glycoluril | A sub-index is available for glycoluril... |
Bismuth glycolyl arsanilate | [As](=O)(O)(O[Bi]=O)c1ccc(cc1)NC(=O)CO |
p-Glycolylaminobenzenearsonic acid | [As](=O)(O)(O)c1ccc(cc1)NC(=O)CO |
p-Glycolylaminophenylarsinic acid | [As](=O)(O)(O)c1ccc(cc1)NC(=O)CO |
Bismuth p-glycolylaminophenylarsonate | [As](=O)(O)(O[Bi]=O)c1ccc(cc1)NC(=O)CO |
Bismuth p-glycolylarsanilate | [As](=O)(O)(O[Bi]=O)c1ccc(cc1)NC(=O)CO |
Bismuthoxy-p-N-glycolylarsanilate | [As](=O)(O)(O[Bi]=O)c1ccc(cc1)NC(=O)CO |
Bismuthyl N-glycolylarsanilate | [As](=O)(O)(O[Bi]=O)c1ccc(cc1)NC(=O)CO |
N-Glycolylarsanilic acid | [As](=O)(O)(O)c1ccc(cc1)NC(=O)CO |
Glycolylurea | O=C1CNC(=O)N1 |
Glycomonochlorhydrin | C(Cl)CO |
glycon | A sub-index is available for glycon... |
Glyconiazide | C(O)(C=NNC(=O)c1ccncc1)C2OC(=O)C(O)C2O |
Glyconitrile | C(#N)CO |
Glyconon | S(=O)(=O)(NC(=O)NCCCC)c1ccc(C)cc1 |
APIGENIN, 7-B-D-GLYCOPYRANOSIDE | O=C1C=C(Oc2cc(cc(O)c12)OC3OC(CO)C(O)C(O)C3O)c4ccc(O)cc4 |
Glycopyrrolate(USAN) | C(O)(C(=O)OC1CCN(C)(C)C1)(C2CCCC2)c3ccccc3 |
Glycopyrronium bromide | C(O)(C(=O)OC1CCN(C)(C)C1)(C2CCCC2)c3ccccc3 |
Glycorine | O=C1N=CN(C)c2ccccc12 |
glycoside | A sub-index is available for glycoside... |
Glycosin | CN1C(=NC(=O)c2ccccc12)Cc3ccccc3 |
Glycosine | CN1C(=NC(=O)c2ccccc12)Cc3ccccc3 |
Glycosmicine | CN1C(=O)NC(=O)c2ccccc12 |
Glycosthene | C(=O)(O)CN |
Glycotuss | O(CC(O)CO)c1ccccc1OC |
Glycozoline | O(C)c1ccc2Nc3ccc(C)cc3c2c1 |
Glycurone | C(O)(C=O)C1OC(=O)C(O)C1O |
Glycyclamid | S(=O)(=O)(NC(=O)NC1CCCCC1)c2ccc(C)cc2 |
Glycyclamide | S(=O)(=O)(NC(=O)NC1CCCCC1)c2ccc(C)cc2 |
N-Diazoacetyl glycyclhydrazide | N(CC(=O)NN)C(=O)C=N=N |
glycyl | A sub-index is available for glycyl... |
Glycylalanine | N(C(=O)CN)C(C)C(=O)O |
N-Glycylaniline | N(C(=O)CN)c1ccccc1 |
Glycylbetaine | C(C(=O)O)N(C)(C)C |
Ethyl glycylglycinate hydrochloride | C(NC(=O)CN)C(=O)OCC |
glycylglycine | A sub-index is available for glycylglycine... |
Cyclic(glycylglycyl) | O=C1CNC(=O)CN1 |
Cyclo(glycylglycyl) | O=C1CNC(=O)CN1 |
Glycine, N-(N-glycylglycyl)- | C(=O)(NCC(=O)O)CNC(=O)CN |
Glycine__N-(N-glycylglycyl)- | C(=O)(NCC(=O)O)CNC(=O)CN |
N-(N-Glycylglycyl)glycine | C(=O)(NCC(=O)O)CNC(=O)CN |
Glycylglycylglycine | C(=O)(NCC(=O)O)CNC(=O)CN |
Glycylleucine | C(CC(C)C)(NC(=O)CN)C(=O)O |
Glycylproline | C(=O)(CN)N1CCCC1C(=O)O |
Glycylvaline | C(NC(=O)CN)(C(C)C)C(=O)O |
Glycyron | CC12CCC3C(C)(C)C(CCC3(C)C1C(=O)C=C4C5CC(C)(CCC5(C)CCC24C)C(=O)O)OC6OC(C(=O)O)C(O)C(O)C6OC7OC(C(=O)O)C(O)C(O)C7O |
18BETA_-Glycyrrhetic acid | CC12CCC3C(C)(C)C(O)CCC3(C)C1C(=O)C=C4C5CC(C)(CCC5(C)CCC24C)C(=O)O |
BETA_-Glycyrrhetic acid | CC12CCC3C(C)(C)C(O)CCC3(C)C1C(=O)C=C4C5CC(C)(CCC5(C)CCC24C)C(=O)O |
Glycyrrhetic acid | CC12CCC3C(C)(C)C(O)CCC3(C)C1C(=O)C=C4C5CC(C)(CCC5(C)CCC24C)C(=O)O |
Glycyrrhetin | CC12CCC3C(C)(C)C(O)CCC3(C)C1C(=O)C=C4C5CC(C)(CCC5(C)CCC24C)C(=O)O |
glycyrrhetinic | A sub-index is available for glycyrrhetinic... |
Monoammonium glycyrrhizate | CC12CCC3C(C)(C)C(CCC3(C)C1C(=O)C=C4C5CC(C)(CCC5(C)CCC24C)C(=O)O)OC6OC(C(=O)O)C(O)C(O)C6OC7OC(C(=O)O)C(O)C(O)C7O |
glycyrrhizic | A sub-index is available for glycyrrhizic... |
Glycyrrhizin | CC12CCC3C(C)(C)C(CCC3(C)C1C(=O)C=C4C5CC(C)(CCC5(C)CCC24C)C(=O)O)OC6OC(C(=O)O)C(O)C(O)C6OC7OC(C(=O)O)C(O)C(O)C7O |
Ammonium glycyrrhizinate | CC12CCC3C(C)(C)C(CCC3(C)C1C(=O)C=C4C5CC(C)(CCC5(C)CCC24C)C(=O)O)OC6OC(C(=O)O)C(O)C(O)C6OC7OC(C(=O)O)C(O)C(O)C7O |
glycyrrhizinic | A sub-index is available for glycyrrhizinic... |
18BETA_-Glycyrrhtinic acid | CC12CCC3C(C)(C)C(O)CCC3(C)C1C(=O)C=C4C5CC(C)(CCC5(C)CCC24C)C(=O)O |
Glycyrrizin | CC12CCC3C(C)(C)C(CCC3(C)C1C(=O)C=C4C5CC(C)(CCC5(C)CCC24C)C(=O)O)OC6OC(C(=O)O)C(O)C(O)C6OC7OC(C(=O)O)C(O)C(O)C7O |
Glyfyllin | C(C(O)CO)N1C=NC2=C1C(=O)N(C)C(=O)N2C |
Glyhexamide(USAN) | S(=O)(=O)(NC(=O)NC1CCCCC1)c2ccc3CCCc3c2 |
Glyketal | C(CCCC)C1(C)OCC(CO)O1 |
Glykocyamin | C(NC(=N)N)C(=O)O |
Glykresin | O(CC(O)CO)c1ccccc1C |
glyme | A sub-index is available for glyme... |
Glyo-I | O(C(=O)c1c(C)cc(O)cc1O)c2cc(CO)c(CO)c(O)c2CC=C(C)C |
Glyodex 37-22 | S(N1C(=O)C2CC=CCC2C1=O)C(Cl)(Cl)Cl |
Glyotol | O(CC(O)CO)c1ccccc1C |
glyoxal | A sub-index is available for glyoxal... |
GLYOXALASE I | O(C(=O)c1c(C)cc(O)cc1O)c2cc(CO)c(CO)c(O)c2CC=C(C)C |
MS-3 (GLYOXALASE INHIBITOR) | O(C(=O)c1c(C)cc(O)cc1O)c2cc(CO)c(CO)c(O)c2CC=C(C)C |
MS-3_(GLYOXALASE_INHIBITOR) | O(C(=O)c1c(C)cc(O)cc1O)c2cc(CO)c(CO)c(O)c2CC=C(C)C |
Butyl glyoxalate | C(=O)(C=O)OCCCC |
Diurea glyoxalate | O=C1NC2NC(=O)NC2N1 |
Glyoxalbiuret | O=C1NC2NC(=O)NC2N1 |
Glyoxaldiureine | O=C1NC2NC(=O)NC2N1 |
Glyoxaldiurene | O=C1NC2NC(=O)NC2N1 |
Glyoxalic acid | C(=O)(O)C=O |
1-Hydroxyethyl-2-heptadecyl glyoxalidine | C(CCCCCCCCCCCCCCCC)C1=NCCN1CCO |
Glyoxalin | C1=CNC=N1 |
Glyoxaline | C1=CNC=N1 |
Glyoxaline-5-alanine | C(C(N)C(=O)O)C1=CNC=N1 |
Glyoxalinedicarboxylic acid | C(=O)(O)C1=C(NC=N1)C(=O)O |
Glyoxalmonourein | OC1NC(=O)NC1O |
Glyoxalmonoureine | OC1NC(=O)NC1O |
Glyoxalurea | OC1NC(=O)NC1O |
Glyoxanilide oxime | N(C(=O)C=NO)c1ccccc1 |
Glyoxide | C(CCCCCCCCCCCCCCCC)C1=NCCN1 |
Bis(glyoximato)nickel | ON1=CC=N(O)[Ni]12N(O)=CC=N2O |
glyoxime | A sub-index is available for glyoxime... |
Indole-3-glyoxylamide | C(=O)(C(N)=O)C1=CNc2ccccc12 |
Glyoxylanilide 2-oxime | N(C(=O)C=NO)c1ccccc1 |
Glyoxylanilide oxime | N(C(=O)C=NO)c1ccccc1 |
Glyoxylanilide, 2-oxime | N(C(=O)C=NO)c1ccccc1 |
p-Glyoxylanisidide, 2-oxime | N(C(=O)C=NO)c1ccc(OC)cc1 |
Butyl glyoxylate | C(=O)(C=O)OCCCC |
Glyoxyldiureid | N(C(N)=O)C1NC(=O)NC1=O |
Glyoxyldiureide | N(C(N)=O)C1NC(=O)NC1=O |
glyoxylic | A sub-index is available for glyoxylic... |
Glyoxylidenebis(2-hydroxyaniline) | N(=CC=Nc1ccccc1O)c2ccccc2O |
Glyoxylonitrile, phenyl- | C(=O)(C#N)c1ccccc1 |
p-Glyoxylophenetidide | N(C(=O)C=O)c1ccc(OCC)cc1 |
Indole-3-glyoxyloyl chloride | C(=O)(C(Cl)=O)C1=CNc2ccccc12 |
Indole-3-glyoxyloyl_chloride | C(=O)(C(Cl)=O)C1=CNc2ccccc12 |
Glyparamide(USAN) | N(C(=O)NS(=O)(=O)c1ccc(Cl)cc1)c2ccc(cc2)N(C)C |
Glypasol | N(C1=NN=C(S1)C(C)(C)C)S(=O)(=O)c2ccc(N)cc2 |
Glyped | C(COC(C)=O)(COC(C)=O)OC(C)=O |
Glypesin | C(C(CC)CCCC)N1CN(CC(CC)CCCC)CC(C)(N)C1 |
Glyphenarsine | [As](=O)(O)(O)c1ccc(cc1)NCC(N)=O |
Glyphosate | C(NCC(=O)O)P(=O)(O)O |
Glyphosate, isopropylamine salt | C(NCC(=O)O)P(=O)(O)O |
Glyphosate__isopropylamine_salt | C(NCC(=O)O)P(=O)(O)O |
Isopropylamine glyphosate | C(NCC(=O)O)P(=O)(O)O |
Glyphosphate | C(NCC(=O)O)P(=O)(O)O |
Glyphyllin | C(C(O)CO)N1C=NC2=C1C(=O)N(C)C(=O)N2C |
Glyphylline | C(C(O)CO)N1C=NC2=C1C(=O)N(C)C(=O)N2C |
Glypinamide | S(=O)(=O)(NC(=O)NN1CCCCCC1)c2ccc(Cl)cc2 |
Glyrol | C(O)(CO)CO |
Glysal | C(=O)(OCCO)c1ccccc1O |
Glysanin | C(O)(CO)CO |
N,N-Bis(carboxymethyl)glysine | N(CC(=O)O)(CC(=O)O)CC(=O)O |
Glysobuzol | S(=O)(=O)(NC1=NN=C(CC(C)C)S1)c2ccc(OC)cc2 |
Glysobuzole | S(=O)(=O)(NC1=NN=C(CC(C)C)S1)c2ccc(OC)cc2 |
Glysoletten | C(C)C1(C(=O)NC(=O)NC1=O)c2ccccc2 |
Glytac | C(=O)(OCCOC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Glytol | O(CC(O)CO)c1ccccc1C |