If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Propanamine, N-(1-methylethyl)-, nitrite | N(C(C)C)C(C)C.O=NO |
2-Propanamine__N-(1-methylethyl)-__nitrite | N(C(C)C)C(C)C.O=NO |
3-Methylbutanol nitrite | C(CON=O)C(C)C |
3-Methylbutyl nitrite | C(CON=O)C(C)C |
Amyl nitrite (VAN) | C(CON=O)C(C)C |
Benzyl nitrite | C(ON=O)c1ccccc1 |
Benzyl_nitrite | C(ON=O)c1ccccc1 |
Butyl nitrite | C(CCC)ON=O |
Diisopropylamine, nitrite | N(C(C)C)C(C)C.O=NO |
Diisopropylammonium nitrite | N(C(C)C)C(C)C.O=NO |
Isoamyl nitrite | C(CON=O)C(C)C |
Isopentyl alcohol, nitrite | C(CON=O)C(C)C |
Isopentyl nitrite | C(CON=O)C(C)C |
Nitrite de sodium (FRENCH) | [N+](=O)[O-] |
Nitrite | [N+](=O)([O-])c1cc(ccc1SC#N)[N+](=O)[O-] |
Nitrite_de_sodium_(FRENCH) | [N+](=O)[O-] |
Platinum ammine nitrite | [Pt](N)(N)([N+](=O)[O-])[N+](=O)[O-] |
Potassium nickel nitrite | [Ni]([N+](=O)[O-])([N+](=O)[O-])([N+](=O)[O-])([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
Sodium nitrite(DOT) | [N+](=O)[O-] |
n-Butyl nitrite | C(CCC)ON=O |
tert-Pentyl nitrite | C(C)(C)(CC)ON=O |
tert-Pentyl_nitrite | C(C)(C)(CC)ON=O |