If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1-(2-Pyridylazo)resorcinol | N(=Nc1ccccn1)c2ccc(O)cc2O |
2, 4-Dinitroso-m-resorcinol | N(=O)c1c(O)ccc(N=O)c1O |
4,4'-Thiobis(resorcinol) | S(c1ccc(O)cc1O)c2ccc(O)cc2O |
4-(1-Hexyl)resorcinol | C(CCCCC)c1ccc(O)cc1O |
4-(2-Pyridlyazo)resorcinol | N(=Nc1ccccn1)c2ccc(O)cc2O |
4-(2-Pyridylazo)-2-resorcinol | N(=Nc1ccccn1)c2ccc(O)cc2O |
4-(2-Pyridylazo)resorcinol disodium salt | N(=Nc1ccccn1)c2ccc(O)cc2O |
4-(2-Pyridylazo)resorcinol | N(=Nc1ccccn1)c2ccc(O)cc2O |
4-(Phenylazo)resorcinol | N(=Nc1ccccc1)c2ccc(O)cc2O |
4-(p-Nitrophenylazo)resorcinol | N(=Nc1ccc(O)cc1O)c2ccc(cc2)[N+](=O)[O-] |
4-Benzoyl Resorcinol | C(=O)(c1ccccc1)c2ccc(O)cc2O |
ALPHA_-Resorcinol carboxylic acid methyl ester | C(=O)(OC)c1cc(O)cc(O)c1 |
ALPHA_-Resorcinol | Oc1cccc(O)c1 |
ALPHA_-Resorcinol_carboxylic_acid_methyl_ester | C(=O)(OC)c1cc(O)cc(O)c1 |
Diglycidyl ether of resorcinol | O(CC1CO1)c2cccc(c2)OCC3CO3 |
Diglycidyl resorcinol ether | O(CC1CO1)c2cccc(c2)OCC3CO3 |
RESORCINOL, 5-PENTADECYL | C(CCCCCCCCCCCCCC)c1cc(O)cc(O)c1 |
Resorcinol Yellow A | N(=Nc1ccc(O)cc1O)c2ccc(cc2)S(=O)(=O)O |
Resorcinol bis(2,3-epoxypropyl) ether | O(CC1CO1)c2cccc(c2)OCC3CO3 |
Resorcinol bis(BETA_-hydroxyethyl) ether | O(CCO)c1cccc(OCCO)c1 |
Resorcinol diacetate | O(C(C)=O)c1cccc(c1)OC(C)=O |
Resorcinol dibenzoate | C(=O)(Oc1cccc(c1)OC(=O)c2ccccc2)c3ccccc3 |
Resorcinol diglycidyl ether | O(CC1CO1)c2cccc(c2)OCC3CO3 |
Resorcinol dimethyl ether | O(C)c1cccc(OC)c1 |
Resorcinol glycidyl ether | O(CC1CO1)c2cccc(c2)OCC3CO3 |
Resorcinol methyl ether | O(C)c1cccc(O)c1 |
Resorcinol monoacetate | O(C(C)=O)c1cccc(O)c1 |
Resorcinol monobenzoate | C(=O)(Oc1cccc(O)c1)c2ccccc2 |
Resorcinol monoethyl ether | O(CC)c1cccc(O)c1 |
Resorcinol monomethyl ether | O(C)c1cccc(O)c1 |
Resorcinol yellow | N(=Nc1ccc(O)cc1O)c2ccc(cc2)S(=O)(=O)O |
Resorcinol | Oc1cccc(O)c1 |
Resorcinol, 2,4,6-tribromo- | Oc1c(Br)cc(Br)c(O)c1Br |
Resorcinol, 2,4,6-trichloro- | Oc1c(Cl)cc(Cl)c(O)c1Cl |
Resorcinol, 2,4,6-trinitro- | [N+](=O)([O-])c1c(O)c(cc([N+](=O)[O-])c1O)[N+](=O)[O-] |
Resorcinol, 2,4-dinitro- | [N+](=O)([O-])c1c(O)ccc([N+](=O)[O-])c1O |
Resorcinol, 2,4-dinitroso- | N(=O)c1c(O)ccc(N=O)c1O |
Resorcinol, 2-acetyl- | C(C)(=O)c1c(O)cccc1O |
Resorcinol, 2-amino-, hydrochloride | Nc1c(O)cccc1O |
Resorcinol, 2-mercapto-, cyclic 0, S-carbonate | Oc1cccc2OC(=O)Sc12 |
Resorcinol, 2-mercapto-, cyclic thiocarbonate | Oc1cccc2OC(=O)Sc12 |
Resorcinol, 2-methyl- | Cc1c(O)cccc1O |
Resorcinol, 2-nitro- | [N+](=O)([O-])c1c(O)cccc1O |
Resorcinol, 4,4'-thiodi- | S(c1ccc(O)cc1O)c2ccc(O)cc2O |
Resorcinol, 4,5-dimethyl- | Cc1c(C)cc(O)cc1O |
Resorcinol, 4,6-dichloro- | Clc1cc(Cl)c(O)cc1O |
Resorcinol, 4-((bis(2-chloropropyl)amino)methyl)-6-chloro- | C(N(CC(C)Cl)CC(C)Cl)c1cc(Cl)c(O)cc1O |
Resorcinol, 4-((p-nitrophenyl)azo)- | N(=Nc1ccc(O)cc1O)c2ccc(cc2)[N+](=O)[O-] |
Resorcinol, 4-(2-pyridylazo)- | N(=Nc1ccccn1)c2ccc(O)cc2O |
Resorcinol, 4-(phenylazo)- | N(=Nc1ccccc1)c2ccc(O)cc2O |
Resorcinol, 4-acetyl- | C(C)(=O)c1ccc(O)cc1O |
Resorcinol, 4-chloro- | Oc1cc(O)ccc1Cl |
Resorcinol, 4-ethyl- | C(C)c1ccc(O)cc1O |
Resorcinol, 4-hexyl- | C(CCCCC)c1ccc(O)cc1O |
Resorcinol, 5-methyl- | Cc1cc(O)cc(O)c1 |
Resorcinol, 5-pentadecyl- | C(CCCCCCCCCCCCCC)c1cc(O)cc(O)c1 |
Resorcinol, diacetate | O(C(C)=O)c1cccc(c1)OC(C)=O |
Resorcinol, dibenzoate | C(=O)(Oc1cccc(c1)OC(=O)c2ccccc2)c3ccccc3 |
Resorcinol, dihydro- | O=C1CCCC(=O)C1 |
Resorcinol, monoacetate | O(C(C)=O)c1cccc(O)c1 |
Resorcinol, monobenzoate | C(=O)(Oc1cccc(O)c1)c2ccccc2 |
Resorcinol, pentadecyl- | C(CCCCCCCCCCCCCC)c1cc(O)cc(O)c1 |
Resorcinol_dimethyl_ether | O(C)c1cccc(OC)c1 |
Resorcinol_monoethyl_ether | O(CC)c1cccc(O)c1 |
Resorcinol_monomethyl_ether | O(C)c1cccc(O)c1 |