If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
((Methylimino)diethylene)bis(ethyldimethylammonium) bromide | C(CN(C)CCN(C)(C)CC)N(C)(C)CC |
(3,4-Methylenedioxy-6-propylbenzyl) (butyl) diethylene glicol ether | C(OCCOCCOCCCC)c1cc2OCOc2cc1CCC |
1, 4-Diethylene dioxide | C1COCCO1 |
1,4-Bis(N,N'-diethylene phosphamide)piperazine | P(=O)(N1CC1)(N2CC2)N3CCN(CC3)P(=O)(N4CC4)N5CC5 |
1__4-Diethylene_dioxide | C1COCCO1 |
6-Propylpiperonyl butyl diethylene glycol ether | C(OCCOCCOCCCC)c1cc2OCOc2cc1CCC |
Acetic acid, iodo-, (methylimino)diethylene ester, hydriodide | C(COC(=O)CI)N(C)CCOC(=O)CI |
Ammonium, ((methylimino)diethylene)bis(ethyldimethyl-, dibromide | C(CN(C)CCN(C)(C)CC)N(C)(C)CC |
Ammonium,((methylimino)diethylene)bis(ethyldimethyl-, dibromide | C(CN(C)CCN(C)(C)CC)N(C)(C)CC |
Benzenesulfonic acid, ((phenyleneimino)diethylene) ester | N(CCOS(=O)(=O)c1ccccc1)(CCOS(=O)(=O)c2ccccc2)c3ccccc3 |
Benzenesulfonic_acid__((phenyleneimino)diethylene)_ester | N(CCOS(=O)(=O)c1ccccc1)(CCOS(=O)(=O)c2ccccc2)c3ccccc3 |
Butoxy diethylene glycol | C(COCCO)OCCCC |
Butyl diethylene glycol acetate | C(OCCOCCCC)COC(C)=O |
Carbonic acid, allyl ester, diester with diethylene glycol | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Carbonic acid, phenyl ester, diester with diethylene glycol | O(C(=O)OCCOCCOC(=O)Oc1ccccc1)c2ccccc2 |
Carbonic_acid__phenyl_ester__diester_with_diethylene_glycol | O(C(=O)OCCOCCOC(=O)Oc1ccccc1)c2ccccc2 |
Diethylene Glycol Monophenyl Ether | O(CCOCCO)c1ccccc1 |
Diethylene dioxide | C1COCCO1 |
Diethylene ether | C1COCCO1 |
Diethylene glycol amine | O(CCN)CCO |
Diethylene glycol benzoate | C(=O)(OCCOCCO)c1ccccc1 |
Diethylene glycol bis(2-chloroethyl) ether | O(CCOCCCl)CCOCCCl |
Diethylene glycol bis(allyl carbonate) | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Diethylene glycol bis(allylcarbonate) | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Diethylene glycol bis(butyl carbonate) | O(CCOCCOC(=O)OCCCC)C(=O)OCCCC |
Diethylene glycol bis(chloroformate) | C(COCCOC(Cl)=O)OC(Cl)=O |
Diethylene glycol bis(phenyl carbonate) | O(C(=O)OCCOCCOC(=O)Oc1ccccc1)c2ccccc2 |
Diethylene glycol bis-glycidyl ether | C(OCCOCCOCC1CO1)C2CO2 |
Diethylene glycol butyl ether acetate | C(OCCOCCCC)COC(C)=O |
Diethylene glycol butyl ether | C(COCCO)OCCCC |
Diethylene glycol chloroformate | C(COCCOC(Cl)=O)OC(Cl)=O |
Diethylene glycol diallyl dicarbonate | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Diethylene glycol dicarbamate | C(COCCOC(N)=O)OC(N)=O |
Diethylene glycol diglycidyl ether | C(OCCOCCOCC1CO1)C2CO2 |
Diethylene glycol dimethyl ether | O(CCOC)CCOC |
Diethylene glycol dipropionate | C(=O)(CC)OCCOCCOC(=O)CC |
Diethylene glycol divinyl ether | O(CCOC=C)CCOC=C |
Diethylene glycol ethyl ether acetate | C(OCCOCC)COC(C)=O |
Diethylene glycol ethyl ether | C(COCC)OCCO |
Diethylene glycol hexyl ether | O(CCCCCC)CCOCCO |
Diethylene glycol laurate | C(=O)(OCCOCCO)CCCCCCCCCCC |
Diethylene glycol lauric acid monoester | C(=O)(OCCOCCO)CCCCCCCCCCC |
Diethylene glycol methyl ether | C(COC)OCCO |
Diethylene glycol mono(n-hexyl) ether | O(CCCCCC)CCOCCO |
Diethylene glycol monoamine | O(CCN)CCO |
Diethylene glycol monobenzoate | C(=O)(OCCOCCO)c1ccccc1 |
Diethylene glycol monobutyl ether acetate | C(OCCOCCCC)COC(C)=O |
Diethylene glycol monobutyl ether | C(COCCO)OCCCC |
Diethylene glycol monoethyl ether acetate | C(OCCOCC)COC(C)=O |
Diethylene glycol monoethyl ether | C(COCC)OCCO |
Diethylene glycol monohexyl ether | O(CCCCCC)CCOCCO |
Diethylene glycol monolaurate | C(=O)(OCCOCCO)CCCCCCCCCCC |
Diethylene glycol monomethyl ether formal | C(OCCOCCOC)OCCOCCOC |
Diethylene glycol monomethyl ether | C(COC)OCCO |
Diethylene glycol monophenyl ether | O(CCOCCO)c1ccccc1 |
Diethylene glycol monostearate | C(=O)(OCCOCCO)CCCCCCCCCCCCCCCCC |
Diethylene glycol monovinyl ether | C(COC=C)OCCO |
Diethylene glycol n-butyl ether | C(COCCO)OCCCC |
Diethylene glycol n-hexyl ether | O(CCCCCC)CCOCCO |
Diethylene glycol sesquilaurate | C(=O)(OCCOCCO)CCCCCCCCCCC |
Diethylene glycol sesquistearate | C(=O)(OCCOCCO)CCCCCCCCCCCCCCCCC |
Diethylene glycol stearate | C(=O)(OCCOCCO)CCCCCCCCCCCCCCCCC |
Diethylene glycol | O(CCO)CCO |
Diethylene glycol, diacetate | C(COCCOC(C)=O)OC(C)=O |
Diethylene glycol, dipropionate | C(=O)(CC)OCCOCCOC(=O)CC |
Diethylene glycol, dithiocyanate | O(CCSC#N)CCSC#N |
Diethylene glycol, monobenzoate | C(=O)(OCCOCCO)c1ccccc1 |
Diethylene glycol, monoester with stearic acid | C(=O)(OCCOCCO)CCCCCCCCCCCCCCCCC |
Diethylene glycolphenyl ether | O(CCOCCO)c1ccccc1 |
Diethylene gylcol monobutyl ether | C(COCCO)OCCCC |
Diethylene imidoxide | C1COCCN1 |
Diethylene oxide | C1COCCO1 |
Diethylene oximide | C1COCCN1 |
Diethylene_glycol_bis(2-chloroethyl)_ether | O(CCOCCCl)CCOCCCl |
Diethylene_glycol_mono(n-hexyl)_ether | O(CCCCCC)CCOCCO |
Diethylene_glycol_monobutyl_ether_acetate | C(OCCOCCCC)COC(C)=O |
Diethylene_glycol_monoethyl_ether_acetate | C(OCCOCC)COC(C)=O |
Diethylene_glycol_monomethyl_ether_formal | C(OCCOCCOC)OCCOCCOC |
Diethylene_glycol_monophenyl_ether | O(CCOCCO)c1ccccc1 |
Ethyl diethylene glycol | C(COCC)OCCO |
Monoethyl ether of diethylene glycol | C(COCC)OCCO |
N, N'-Diethylene-N''-(3-oxapentamethylene)phosphoramide | P(=O)(N1CC1)(N2CC2)N3CCOCC3 |
N, N'-Diethylene-N''-(3-oxapentamethylene)thiophosphoramide | P(=S)(N1CC1)(N2CC2)N3CCOCC3 |
N-Hexamethylene N',N''-diethylene thiophosphoramide | P(=S)(N1CC1)(N2CC2)N3CCCCCC3 |
N__N'-Diethylene-N''-(3-oxapentamethylene)phosphoramide | P(=O)(N1CC1)(N2CC2)N3CCOCC3 |
N__N'-Diethylene-N''-(3-oxapentamethylene)thiophosphoramide | P(=S)(N1CC1)(N2CC2)N3CCOCC3 |
O-Butyl diethylene glycol | C(COCCO)OCCCC |
Phosphoramide, N, N'-diethylene-N''-phenyl- | P(=O)(Nc1ccccc1)(N2CC2)N3CC3 |
Phosphoric acid, 1, 4-dioxyphenyl-O,O-bis-, diethylene diamide | P(=O)(Oc1ccc(cc1)OP(=O)(N2CC2)N3CC3)(N4CC4)N5CC5 |
Phosphoric triamide, N, N'-diethylene-N''-phenyl- | P(=O)(Nc1ccccc1)(N2CC2)N3CC3 |
Phosphorotrithious acid, ethylene cyclic diethylene ester | S(CCSP1SCCS1)P2SCCS2 |