If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Methoxy strychnine | O=C1CC2OCC=C3CN4CCC56C4CC3C2C5N1c7ccc(OC)cc67 |
STRYCHNINE | O=C1CC2OCC=C3CN4CCC56c7ccccc7N1C5C2C3CC46 |
STRYCHNINE, N-OXIDE | O=N12CCC34c5ccccc5N6C(=O)CC7OCC=C(C2)C(CC13)C7C46 |
Strychnine N-oxide | O=N12CCC34c5ccccc5N6C(=O)CC7OCC=C(C2)C(CC13)C7C46 |
Strychnine N6-oxide | O=N12CCC34c5ccccc5N6C(=O)CC7OCC=C(C2)C(CC13)C7C46 |
Strychnine | O=C1CC2OCC=C3CN4CCC56c7ccccc7N1C5C2C3CC46 |
Strychnine, 18-oxo- | O=C1CC23c4ccccc4N5C(=O)CC6OCC=C7CN1C3CC7C6C25 |
Strychnine, 19-oxide | O=N12CCC34c5ccccc5N6C(=O)CC7OCC=C(C2)C(CC13)C7C46 |
Strychnine, 2-methoxy- | O=C1CC2OCC=C3CN4CCC56C4CC3C2C5N1c7ccc(OC)cc67 |
Strychnine, N-oxide | O=N12CCC34c5ccccc5N6C(=O)CC7OCC=C(C2)C(CC13)C7C46 |
Strychnine, Nb-oxide | O=N12CCC34c5ccccc5N6C(=O)CC7OCC=C(C2)C(CC13)C7C46 |
Strychnine__18-oxo- | O=C1CC23c4ccccc4N5C(=O)CC6OCC=C7CN1C3CC7C6C25 |