If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Diphenylmethoxytropane mesylate | S(C)(=O)(=O)O.CN1C2CCC1CC(C2)OC(c3ccccc3)c4ccccc4 |
Antazoline mesylate | S(C)(=O)(=O)O.c1ccc(cc1)CN(CC2=NCCN2)c3ccccc3 |
Benzotropine mesylate | S(C)(=O)(=O)O.CN1C2CCC1CC(C2)OC(c3ccccc3)c4ccccc4 |
Benztropine mesylate | S(C)(=O)(=O)O.CN1C2CCC1CC(C2)OC(c3ccccc3)c4ccccc4 |
Butyl mesylate | O(CCCC)S(C)(=O)=O |
Cogentin Mesylate | S(C)(=O)(=O)O.CN1C2CCC1CC(C2)OC(c3ccccc3)c4ccccc4 |
Ethyl mesylate | O(CC)S(C)(=O)=O |
Hycanthone mesylate | S(C)(=O)(=O)O.CCN(CC)CCNc1ccc(CO)c2Sc3ccccc3C(=O)c12 |
Methyl mesylate | S(C)(=O)(=O)OC |
Pergolide mesylate | S(C)(=O)(=O)O.CSCC1CN(CCC)C2CC3=CNc4cccc(C2C1)c34 |