If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
VANILLIC ACID | O(C)c1cc(ccc1O)C(=O)O |
Vanillic acid N,N-diethylamide | C(=O)(N(CC)CC)c1ccc(O)c(OC)c1 |
Vanillic acid diethylamide | C(=O)(N(CC)CC)c1ccc(O)c(OC)c1 |
Vanillic acid methyl ester | C(=O)(OC)c1ccc(O)c(OC)c1 |
Vanillic acid | O(C)c1cc(ccc1O)C(=O)O |
Vanillic acid, ethyl ester | C(=O)(OCC)c1ccc(O)c(OC)c1 |
Vanillic acid, methyl ester | C(=O)(OC)c1ccc(O)c(OC)c1 |
Vanillic aldehyde | O(C)c1cc(C=O)ccc1O |
o-Vanillic acid | C(=O)(O)c1cccc(OC)c1O |