If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Ethanedioic acid | C(=O)(O)C(=O)O |
Ethanedioic acid, bis((phenylmethylene)hydrazide) | C(=NNC(=O)C(=O)NN=Cc1ccccc1)c2ccccc2 |
Ethanedioic acid, bis(3-methylbutyl) ester | C(=O)(OCCC(C)C)C(=O)OCCC(C)C |
Ethanedioic acid, bis(cyclohexylidenehydrazide) | N(NC(=O)C(=O)NN=C1CCCCC1)=C2CCCCC2 |
Ethanedioic acid, bis(phenylmethyl) ester | C(OC(=O)C(=O)OCc1ccccc1)c2ccccc2 |
Ethanedioic acid, cadmium salt (1:1) | C(=O)(O)C(=O)O |
Ethanedioic acid, cobalt(2+) salt (1:1) | C(=O)(O)C(=O)O |
Ethanedioic acid, copper(2+ ) salt (1:1) | C(=O)(O)C(=O)O |
Ethanedioic acid, di-2-propenyl ester | C(=O)(OCC=C)C(=O)OCC=C |
Ethanedioic acid, dibutyl ester | C(=O)(OCCCC)C(=O)OCCCC |
Ethanedioic acid, dicyclohexyl ester | O(C(=O)C(=O)OC1CCCCC1)C2CCCCC2 |
Ethanedioic acid, diethyl ester | C(=O)(OCC)C(=O)OCC |
Ethanedioic acid, dihydrazide | C(=O)(NN)C(=O)NN |
Ethanedioic acid, dilithium salt | C(=O)(O)C(=O)O |
Ethanedioic acid, dimethyl ester | C(=O)(OC)C(=O)OC |
Ethanedioic acid, diphenyl ester | O(C(=O)C(=O)Oc1ccccc1)c2ccccc2 |
Ethanedioic acid, disodium salt | C(=O)(O)C(=O)O |
Ethanedioic acid, magnesium salt (1:1) | C(=O)(O)C(=O)O |
Ethanedioic acid, monoethyl ester, potassium salt | C(=O)(OCC)C(=O)O |
Ethanedioic acid, scandium(3+) salt (3:2) | C(=O)(O)C(=O)O |
Ethanedioic acid, strontium salt (1:1) | C(=O)(O)C(=O)O |
Ethanedioic acid, thorium(4+) salt (2:1) | O=C1O[Th]2(OC1=O)OC(=O)C(=O)O2 |
Ethanedioic acid, uranium(4+) salt (2:1) | C(=O)(O)C(=O)O |
Ethanedioic acid, zinc salt (1:1) | C(=O)(O)C(=O)O |
Ethanedioic_acid__bis((phenylmethylene)hydrazide) | C(=NNC(=O)C(=O)NN=Cc1ccccc1)c2ccccc2 |
Ethanedioic_acid__bis(3-methylbutyl)_ester | C(=O)(OCCC(C)C)C(=O)OCCC(C)C |
Ethanedioic_acid__bis(cyclohexylidenehydrazide) | N(NC(=O)C(=O)NN=C1CCCCC1)=C2CCCCC2 |
Ethanedioic_acid__bis(phenylmethyl)_ester | C(OC(=O)C(=O)OCc1ccccc1)c2ccccc2 |
Ethanedioic_acid__cadmium_salt_(1:1) | C(=O)(O)C(=O)O |
Ethanedioic_acid__cobalt(2+)_salt_(1:1) | C(=O)(O)C(=O)O |
Ethanedioic_acid__copper(2+_)_salt_(1:1) | C(=O)(O)C(=O)O |
Ethanedioic_acid__di-2-propenyl_ester | C(=O)(OCC=C)C(=O)OCC=C |
Ethanedioic_acid__dibutyl_ester | C(=O)(OCCCC)C(=O)OCCCC |
Ethanedioic_acid__dicyclohexyl_ester | O(C(=O)C(=O)OC1CCCCC1)C2CCCCC2 |
Ethanedioic_acid__diethyl_ester | C(=O)(OCC)C(=O)OCC |
Ethanedioic_acid__dilithium_salt | C(=O)(O)C(=O)O |
Ethanedioic_acid__dimethyl_ester | C(=O)(OC)C(=O)OC |
Ethanedioic_acid__diphenyl_ester | O(C(=O)C(=O)Oc1ccccc1)c2ccccc2 |
Ethanedioic_acid__disodium_salt | C(=O)(O)C(=O)O |
Ethanedioic_acid__magnesium_salt_(1:1) | C(=O)(O)C(=O)O |
Ethanedioic_acid__monoethyl_ester__potassium_salt | C(=O)(OCC)C(=O)O |
Ethanedioic_acid__scandium(3+)_salt_(3:2) | C(=O)(O)C(=O)O |
Ethanedioic_acid__strontium_salt_(1:1) | C(=O)(O)C(=O)O |
Ethanedioic_acid__thorium(4+)_salt_(2:1) | O=C1O[Th]2(OC1=O)OC(=O)C(=O)O2 |
Ethanedioic_acid__uranium(4+)_salt_(2:1) | C(=O)(O)C(=O)O |
Ethanedioic_acid__zinc_salt_(1:1) | C(=O)(O)C(=O)O |