If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,2-Dithiane | C1CCSSC1 |
1,3-Dithiane | C1CSCSC1 |
1,3-Dithiane, 2-(4-nitrophenyl)- | [N+](=O)([O-])c1ccc(cc1)C2SCCCS2 |
1,3-Dithiane, 2-methyl- | CC1SCCCS1 |
1,3-Dithiane, 2-phenyl- | c1(ccccc1)C2SCCCS2 |
1,3-Dithiane, 4-methyl- | CC1CCSCS1 |
1,3-Dithiane, urea deriv. | N(C(=O)N(N=O)CCCl)C1CS(=O)(=O)C(C)S(=O)(=O)C1 |
1,3-Dithiane-2-thione | S=C1SCCCS1 |
1,4-Dithiane | C1CSCCS1 |
1,4-Dithiane, 1,4-dioxide | O=S1CCS(=O)CC1 |
1,4-Dithiane-2,5-diol, 2,5-dimethyl- | CC1(O)CSC(C)(O)CS1 |
1_3-Dithiane | C1CSCSC1 |
1_3-Dithiane__2-(4-nitrophenyl)- | [N+](=O)([O-])c1ccc(cc1)C2SCCCS2 |
1_3-Dithiane__2-methyl- | CC1SCCCS1 |
1_3-Dithiane__2-phenyl- | c1(ccccc1)C2SCCCS2 |
1_3-Dithiane__4-methyl- | CC1CCSCS1 |
1_4-Dithiane__1_4-dioxide | O=S1CCS(=O)CC1 |
2,5-Dimethyl-2, 5-dihydroxy-1,4-dithiane | CC1(O)CSC(C)(O)CS1 |
2-Methyl-1,3-dithiane | CC1SCCCS1 |
2-Phenyl-1,3-dithiane | c1(ccccc1)C2SCCCS2 |
2_5-Dimethyl-2__5-dihydroxy-1_4-dithiane | CC1(O)CSC(C)(O)CS1 |
4-Methyl-1,3-dithiane | CC1CCSCS1 |
PODOPHYLLOTOXIN, DEGRADED DITHIANE DERIV | C(OCC1OC(=O)CC1C2(SCCCS2)c3cc(OC)c(OC)c(OC)c3)(c4ccccc4)(c5ccccc5)c6ccccc6 |
PODOPHYLLOTOXIN__DEGRADED_DITHIANE_DERIV | C(OCC1OC(=O)CC1C2(SCCCS2)c3cc(OC)c(OC)c(OC)c3)(c4ccccc4)(c5ccccc5)c6ccccc6 |
m-Dithiane | C1CSCSC1 |
m-Dithiane, 2-(p-nitrophenyl)- | [N+](=O)([O-])c1ccc(cc1)C2SCCCS2 |
m-Dithiane, 2-methyl- | CC1SCCCS1 |
m-Dithiane, 2-phenyl- | c1(ccccc1)C2SCCCS2 |
m-Dithiane-2-thione | S=C1SCCCS1 |
o-Dithiane | C1CCSSC1 |
p-Dithiane | C1CSCCS1 |