If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Decanoic acid amide | C(CCCCCC)CCC(N)=O |
Decanoic acid methyl ester | C(CCCCCCCC)C(=O)OC |
Decanoic acid | C(CCCCCC)CCC(=O)O |
Decanoic acid, (2,4-hexadienyl) ester | C(=O)(OCC=CC=CC)CCCCCCCCC |
Decanoic acid, 1,2, 3-propanetriyl ester | C(COC(=O)CCCCCCCCC)(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC |
Decanoic acid, 2,4-hexadienyl ester | C(=O)(OCC=CC=CC)CCCCCCCCC |
Decanoic acid, 2-bromo- | C(CCCCCCC)C(Br)C(=O)O |
Decanoic acid, 2-hydroxy- | C(CCCCCCC)C(O)C(=O)O |
Decanoic acid, 4-hydroxy-, GAMMA_-lactone | C(CCCCC)C1CCC(=O)O1 |
Decanoic acid, 4-hydroxy-4-methyl-, GAMMA_-lactone | C(CCCCC)C1(C)CCC(=O)O1 |
Decanoic acid, 9-oxo-, methyl ester | C(=O)(OC)CCCCCCCC(C)=O |
Decanoic acid, GAMMA_-lactone | C(CCCCC)C1CCC(=O)O1 |
Decanoic acid, ethenyl ester | C(CCCCCCCC)C(=O)OC=C |
Decanoic acid, ethyl ester | C(CCCCCCCC)C(=O)OCC |
Decanoic acid, lead(2+) salt | C(CCCCCC)CCC(=O)O |
Decanoic acid, methyl ester | C(CCCCCCCC)C(=O)OC |
Decanoic acid, vinyl ester | C(CCCCCCCC)C(=O)OC=C |
Decanoic_acid__(2_4-hexadienyl)_ester | C(=O)(OCC=CC=CC)CCCCCCCCC |
Decanoic_acid__1_2__3-propanetriyl_ester | C(COC(=O)CCCCCCCCC)(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC |
Decanoic_acid__2-bromo- | C(CCCCCCC)C(Br)C(=O)O |
Decanoic_acid__4-hydroxy-4-methyl-__GAMMA_-lactone | C(CCCCC)C1(C)CCC(=O)O1 |
Decanoic_acid__4-hydroxy-__GAMMA_-lactone | C(CCCCC)C1CCC(=O)O1 |
Decanoic_acid__9-oxo-__methyl_ester | C(=O)(OC)CCCCCCCC(C)=O |
Decanoic_acid__ethenyl_ester | C(CCCCCCCC)C(=O)OC=C |
Decanoic_acid__ethyl_ester | C(CCCCCCCC)C(=O)OCC |
Decanoic_acid__lead(2+)_salt | C(CCCCCC)CCC(=O)O |
Decanoic_acid__methyl_ester | C(CCCCCCCC)C(=O)OC |
Decanoic_acid_amide | C(CCCCCC)CCC(N)=O |
n-Decanoic acid | C(CCCCCC)CCC(=O)O |