If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(-)-Tropate(ester) | CN1(C)C2CC(OC(=O)C(CO)c3ccccc3)CC1C4OC24 |
1ALPHA_H,5ALPHA_H-Tropan-3ALPHA_-ol (.+-.)-tropate (ester), 8-oxide | CN1(=O)C2CCC1CC(OC(=O)C(CO)c3ccccc3)C2 |
8-Azabicyclo(3.2.1)octan-3ALPHA_-ol, 8-methyl-, 8-oxide, tropate | CN1(=O)C2CCC1CC(OC(=O)C(CO)c3ccccc3)C2 |
Aminoxytropine tropate | CN1(=O)C2CCC1CC(OC(=O)C(CO)c3ccccc3)C2 |
Epoxytropine tropate methylbromide | CN1(C)C2CC(OC(=O)C(CO)c3ccccc3)CC1C4OC24 |