If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
6-Monopalmitoyl-L-ascorbate | C(O)(COC(=O)CCCCCCCCCCCCCCC)C1OC(=O)C(O)=C1O |
Cetyl ascorbate | C(O)(COC(=O)CCCCCCCCCCCCCCC)C1OC(=O)C(O)=C1O |
Ferrous ascorbate | C(O)(CO)C1OC(=O)C(O)=C1O |
Iron(II) ascorbate | C(O)(CO)C1OC(=O)C(O)=C1O |
Niacinamide ascorbate | C(N)(=O)c1cccnc1.OCC(O)C2OC(=O)C(O)=C2O |
Nicotinamide ascorbate (VAN) | C(N)(=O)c1cccnc1.OCC(O)C2OC(=O)C(O)=C2O |
Technetium-99 labeled ferrous ascorbate | C(O)(CO)C1OC(=O)C(O)=C1O |