If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Chloroquine (VAN) | N(C(C)CCCN(CC)CC)c1ccnc2cc(Cl)ccc12 |
Chloroquine diphosphate | P(=O)(O)(O)O.CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 |
Chloroquine mustard pamoate | C(c1c(O)c(cc2ccccc12)C(=O)O)c3c(O)c(cc4ccccc34)C(=O)O.ClCCN(CCCl)CCCC(C)Nc5ccnc6cc(Cl)ccc56 |
Chloroquine mustard | N(C(C)CCCN(CCCl)CCCl)c1ccnc2cc(Cl)ccc12 |
Chloroquine mustard, pamoate | C(c1c(O)c(cc2ccccc12)C(=O)O)c3c(O)c(cc4ccccc34)C(=O)O.ClCCN(CCCl)CCCC(C)Nc5ccnc6cc(Cl)ccc56 |
Chloroquine phosphate | P(=O)(O)(O)O.CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 |
Chloroquine sulfate | N(C(C)CCCN(CC)CC)c1ccnc2cc(Cl)ccc12.O=S(=O)(O)O |
Chloroquine-ethyl phenyl mustard | N(CCc1ccc(cc1)N(CCCl)CCCl)c2ccnc3cc(Cl)ccc23 |