If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Miketon Brilliant Blue B | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Miketon Fast Blue B | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Miketon Fast Blue | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Miketon Fast Pink FF 3B | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Miketon Fast Pink FF3B | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Miketon Fast Pink RL | O=C1c2ccccc2C(=O)c3c(O)cc(OC)c(N)c13 |
Miketon Fast Red Violet R | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Miketon Fast Scarlet B | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Miketon Fast Turquoise Blue G | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Miketon Fast Violet B | O=C1c2c(N)ccc(N)c2C(=O)c3cccc([N+](=O)[O-])c13 |
Miketon Fast Yellow YL | N(c1ccccc1)c2ccc(cc2[N+](=O)[O-])S(=O)(=O)Nc3ccccc3 |
Miketon Polyester Pink RL | O=C1c2ccccc2C(=O)c3c(O)cc(OC)c(N)c13 |
Miketon Polyester Yellow 5R | N(=Nc1ccc(cc1)N=Nc2ccccc2)c3ccc(O)c(C)c3 |
Miketon Polyester Yellow YL | N(c1ccccc1)c2ccc(cc2[N+](=O)[O-])S(=O)(=O)Nc3ccccc3 |