If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(5-(3,4-Methylenedioxyphenyl)-1-oxo-2, 4-pentadienyl)piperidine | C(=CC=CC(=O)N1CCCCC1)c2ccc3OCOc3c2 |
1-Methyl-2-(3, 4-methylenedioxyphenyl)ethyl octyl sulfoxide | C(C(C)S(=O)CCCCCCCC)c1ccc2OCOc2c1 |
2-(3,4-Methylenedioxyphenyl)ethylamine hydrochloride | C(CN)c1ccc2OCOc2c1 |
2-Methyl-3-(3, 4-methylenedioxyphenyl)-2-propenal | C(=C(C)C=O)c1ccc2OCOc2c1 |
2-Methyl-3-(3__4-methylenedioxyphenyl)-2-propenal | C(=C(C)C=O)c1ccc2OCOc2c1 |
3-(3, 4-Methylenedioxyphenyl)propionic acid | C(CC(=O)O)c1ccc2OCOc2c1 |
3-(3,4-Methylenedioxyphenyl)propenoic acid | C(=CC(=O)O)c1ccc2OCOc2c1 |
3-(3__4-Methylenedioxyphenyl)propionic_acid | C(CC(=O)O)c1ccc2OCOc2c1 |
Benzoxazole, 2-(3, 4-methylenedioxyphenyl)- | C1(=Nc2ccccc2O1)c3ccc4OCOc4c3 |
Benzoxazole__2-(3__4-methylenedioxyphenyl)- | C1(=Nc2ccccc2O1)c3ccc4OCOc4c3 |