If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(1, 1'-Bicyclohexyl)-2-ol, triester with boric acid (H3BO3) | O(B(OC1CCCCC1C2CCCCC2)OC3CCCCC3C4CCCCC4)C5CCCCC5C6CCCCC6 |
(1__1'-Bicyclohexyl)-2-ol__triester_with_boric_acid_(H3BO3) | O(B(OC1CCCCC1C2CCCCC2)OC3CCCCC3C4CCCCC4)C5CCCCC5C6CCCCC6 |
(Bicyclohexyl)-2-ol, triester with boric acid (H3BO3) | O(B(OC1CCCCC1C2CCCCC2)OC3CCCCC3C4CCCCC4)C5CCCCC5C6CCCCC6 |
12-Hydroxyoctadecanoic acid, triester with glycerol | C(COC(=O)CCCCCCCCCCC(O)CCCCCC)(COC(=O)CCCCCCCCCCC(O)CCCCCC)OC(=O)CCCCCCCCCCC(O)CCCCCC |
2-Octanol, triester with boric acid (H3BO3) | B(OC(C)CCCCCC)(OC(C)CCCCCC)OC(C)CCCCCC |
2-Octanol__triester_with_boric_acid_(H3BO3) | B(OC(C)CCCCCC)(OC(C)CCCCCC)OC(C)CCCCCC |
2-Pentanol, 4-methyl-, triester with boric acid (H3BO3) | B(OC(C)CC(C)C)(OC(C)CC(C)C)OC(C)CC(C)C |
2-Pentanol, 4-methyl-, triester with boric acid | B(OC(C)CC(C)C)(OC(C)CC(C)C)OC(C)CC(C)C |
2-Pentanol__4-methyl-__triester_with_boric_acid_(H3BO3) | B(OC(C)CC(C)C)(OC(C)CC(C)C)OC(C)CC(C)C |
Acetic acid, iodo-, triester with glycerol | C(COC(=O)CI)(COC(=O)CI)OC(=O)CI |
Ethanol, 2-(dimethylamino)-, triester with boric acid (H3BO3) | B(OCCN(C)C)(OCCN(C)C)OCCN(C)C |
Ethanol__2-(dimethylamino)-__triester_with_boric_acid_(H3BO3) | B(OCCN(C)C)(OCCN(C)C)OCCN(C)C |
Methacrylic acid, triester with glycerol | C(COC(=O)C(C)=C)(COC(=O)C(C)=C)OC(=O)C(C)=C |
Octadecanoic acid, 12-hydroxy-, triester with glycerol | C(COC(=O)CCCCCCCCCCC(O)CCCCCC)(COC(=O)CCCCCCCCCCC(O)CCCCCC)OC(=O)CCCCCCCCCCC(O)CCCCCC |