If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Ethyl formic ester | O(CC)C=O |
FORMIC ACID, K SALT | C(=O)O |
FORMIC ACID, NA SALT | C(=O)O |
Formic Black C | Nc1c(N=Nc2ccc(cc2)c3ccc(N=Nc4ccc(N)cc4N)cc3)c(cc5cc(c(N=Nc6ccccc6)c(O)c15)S(=O)(=O)O)S(=O)(=O)O |
Formic Black CW | Nc1c(N=Nc2ccc(cc2)c3ccc(N=Nc4ccc(N)cc4N)cc3)c(cc5cc(c(N=Nc6ccccc6)c(O)c15)S(=O)(=O)O)S(=O)(=O)O |
Formic Black EA | Nc1c(N=Nc2ccc(cc2)c3ccc(N=Nc4ccc(N)cc4N)cc3)c(cc5cc(c(N=Nc6ccccc6)c(O)c15)S(=O)(=O)O)S(=O)(=O)O |
Formic Black MTG | Nc1c(N=Nc2ccc(cc2)c3ccc(N=Nc4ccc(N)cc4N)cc3)c(cc5cc(c(N=Nc6ccccc6)c(O)c15)S(=O)(=O)O)S(=O)(=O)O |
Formic Black MTR | Nc1c(N=Nc2ccc(cc2)c3ccc(N=Nc4cc(C)c(N)cc4N)cc3)c(cc5cc(c(N=Nc6ccccc6)c(O)c15)S(=O)(=O)O)S(=O)(=O)O |
Formic Black TG | Nc1c(N=Nc2ccc(cc2)c3ccc(N=Nc4ccc(N)cc4N)cc3)c(cc5cc(c(N=Nc6ccccc6)c(O)c15)S(=O)(=O)O)S(=O)(=O)O |
Formic acid 2-(4-(5-nitro-2-furyl)-2-thiazolyl)hydrazide | [N+](=O)([O-])C1=CC=C(O1)C2=CSC(NNC=O)=N2 |
Formic acid cobalt(2+) salt | C(=O)O |
Formic acid copper(2+) salt | C(=O)O |
Formic acid magnesium salt | C(=O)O |
Formic acid potassium salt | C(=O)O |
Formic acid, (aminocarbonyl)- | C(N)(=O)C(=O)O |
Formic acid, (phenylazo)thio-, 2-phenylhydrazide | N(NC(=S)N=Nc1ccccc1)c2ccccc2 |
Formic acid, 1-methylhydrazide | N(C)(N)C=O |
Formic acid, 1-methylpropyl ester | C(C)(CC)OC=O |
Formic acid, 2-(4-(5-nitro-2-furyl)-2-thiazolyl)hydrazide | [N+](=O)([O-])C1=CC=C(O1)C2=CSC(NNC=O)=N2 |
Formic acid, 2-(4-(5-nitro-2-furyl)-2-thiazolylhydrazide | [N+](=O)([O-])C1=CC=C(O1)C2=CSC(NNC=O)=N2 |
Formic acid, 2-(p-nitrophenyl)hydrazide | [N+](=O)([O-])c1ccc(NNC=O)cc1 |
Formic acid, 2-ethylidene-1-methylhydrazide | N(C)(C=O)N=CC |
Formic acid, 2-methylpropyl ester | C(OC=O)C(C)C |
Formic acid, 2-phenylethyl ester | C(COC=O)c1ccccc1 |
Formic acid, 2-phenylhydrazide | N(NC=O)c1ccccc1 |
Formic acid, 2-propenyl ester | C(C=C)OC=O |
Formic acid, 3,7-dimethyl-2,6-octadienyl ester, (E)- | C(C)(=CCOC=O)CCC=C(C)C |
Formic acid, 3,7-dimethyl-6-octen-1-yl ester | C(C)(CCOC=O)CCC=C(C)C |
Formic acid, 4-nitrophenyl ester | [N+](=O)([O-])c1ccc(OC=O)cc1 |
Formic acid, K salt | C(=O)O |
Formic acid, allyl ester | C(C=C)OC=O |
Formic acid, azido-, tert-butyl ester | C(=O)(N=N=N)OC(C)(C)C |
Formic acid, azodi-, diethyl ester | C(=O)(OCC)N=NC(=O)OCC |
Formic acid, azodi-, diphenyl ester | O(C(=O)N=NC(=O)Oc1ccccc1)c2ccccc2 |
Formic acid, benzoyl- | C(=O)(C(=O)O)c1ccccc1 |
Formic acid, benzyl ester | C(OC=O)c1ccccc1 |
Formic acid, butyl ester | C(CCC)OC=O |
Formic acid, cadmium salt | C(=O)O |
Formic acid, carbamoyl- | C(N)(=O)C(=O)O |
Formic acid, chloro-, 1-naphthyl ester | O(C(Cl)=O)c1cccc2ccccc12 |
Formic acid, chloro-, 2,2,2-trichloroethyl ester | C(OC(Cl)=O)C(Cl)(Cl)Cl |
Formic acid, chloro-, benzyl ester | C(OC(Cl)=O)c1ccccc1 |
Formic acid, chloro-, butyl ester | O(CCCC)C(Cl)=O |
Formic acid, chloro-, isobutyl ester | C(OC(Cl)=O)C(C)C |
Formic acid, chloro-, oxydiethylene ester | C(COCCOC(Cl)=O)OC(Cl)=O |
Formic acid, chloro-, pentyl ester | C(CCCC)OC(Cl)=O |
Formic acid, chloro-, phenyl ester | O(C(Cl)=O)c1ccccc1 |
Formic acid, chlorothio-, O-phenyl ester | O(C(Cl)=S)c1ccccc1 |
Formic acid, chlorothio-, S-propyl ester | S(CCC)C(Cl)=O |
Formic acid, chromium(3+) salt | C(=O)O |
Formic acid, cinnamyl ester | C(=CCOC=O)c1ccccc1 |
Formic acid, citronellyl ester | C(C)(CCOC=O)CCC=C(C)C |
Formic acid, cobalt(2+) salt | C(=O)O |
Formic acid, compd. with N,N-dimethylmethanamine (1:1) | C(=O)O.CN(C)C |
Formic acid, copper(2+) salt (1:1) | C(=O)O |
Formic acid, copper(2+) salt | C(=O)O |
Formic acid, cyano-, ethyl ester | C(=O)(C#N)OCC |
Formic acid, cyclohexyl ester | O(C=O)C1CCCCC1 |
Formic acid, decyl ester | C(CCCCCC)CCCOC=O |
Formic acid, dithiobis(thio-, O,O-dibutyl ester | C(=S)(OCCCC)SSC(=S)OCCCC |
Formic acid, dithiobis(thio-, O,O-diethyl ester | C(=S)(OCC)SSC(=S)OCC |
Formic acid, dithiobis(thio-, O,O-diisopropyl ester | C(=S)(SSC(=S)OC(C)C)OC(C)C |
Formic acid, ethenyl ester | O(C=C)C=O |
Formic acid, ethyl ester | O(CC)C=O |
Formic acid, ethylene ester | C(OC=O)COC=O |
Formic acid, ethylidenemethylhydrazide | N(C)(C=O)N=CC |
Formic acid, formyl- | C(=O)(O)C=O |
Formic acid, geraniol ester | C(C)(=CCOC=O)CCC=C(C)C |
Formic acid, hexyl ester | C(CCCC)COC=O |
Formic acid, hydrazide | C(=O)NN |
Formic acid, hydrazodi- | N(C=O)NC=O |
Formic acid, isobutyl ester | C(OC=O)C(C)C |
Formic acid, isopentyl ester | C(COC=O)C(C)C |
Formic acid, lead(2+) salt | C(=O)O |
Formic acid, magnesium salt | C(=O)O |
Formic acid, methylhydrazide | N(C)(N)C=O |
Formic acid, nonyl ester | C(CCCCC)CCCOC=O |
Formic acid, octyl ester | C(CCCCC)CCOC=O |
Formic acid, p-nitrophenyl ester | [N+](=O)([O-])c1ccc(OC=O)cc1 |
Formic acid, pentyl ester | C(CCC)COC=O |
Formic acid, phenethyl ester | C(COC=O)c1ccccc1 |
Formic acid, phenylmethyl ester | C(OC=O)c1ccccc1 |
Formic acid, phosphono-, triethyl ester | P(=O)(OCC)(OCC)C(=O)OCC |
Formic acid, potassium salt | C(=O)O |
Formic acid, propionyl- | C(=O)(CC)C(=O)O |
Formic acid, sec-butyl ester | C(C)(CC)OC=O |
Formic acid, sodium salt | C(=O)O |
Formic acid, tetrathiobis(thio-, O,O-diethyl ester | C(=S)(OCC)SSSSC(=S)OCC |
Formic acid, thallium(1+) salt | C(=O)O |
Formic acid, trithiobis(thio-, O,O-diethyl ester | C(=S)(OCC)SSSC(=S)OCC |
Formic acid, vinyl ester | O(C=C)C=O |
Formic aldehyde | C=O |
Formic hydrazide | C(=O)NN |
Formic_acid__(aminocarbonyl)- | C(N)(=O)C(=O)O |
Formic_acid__1-methylpropyl_ester | C(C)(CC)OC=O |
Formic_acid__2-ethylidene-1-methylhydrazide | N(C)(C=O)N=CC |
Formic_acid__2-methylpropyl_ester | C(OC=O)C(C)C |
Formic_acid__2-phenylethyl_ester | C(COC=O)c1ccccc1 |
Formic_acid__2-propenyl_ester | C(C=C)OC=O |
Formic_acid__3_7-dimethyl-2_6-octadienyl_ester__(E)- | C(C)(=CCOC=O)CCC=C(C)C |
Formic_acid__3_7-dimethyl-6-octen-1-yl_ester | C(C)(CCOC=O)CCC=C(C)C |
Formic_acid__butyl_ester | C(CCC)OC=O |
Formic_acid__chromium(3+)_salt | C(=O)O |
Formic_acid__cobalt(2+)_salt | C(=O)O |
Formic_acid__compd._with_N_N-dimethylmethanamine_(1:1) | C(=O)O.CN(C)C |
Formic_acid__copper(2+)_salt_(1:1) | C(=O)O |
Formic_acid__cyclohexyl_ester | O(C=O)C1CCCCC1 |
Formic_acid__decyl_ester | C(CCCCCC)CCCOC=O |
Formic_acid__ethenyl_ester | O(C=C)C=O |
Formic_acid__ethylene_ester | C(OC=O)COC=O |
Formic_acid__hexyl_ester | C(CCCC)COC=O |
Formic_acid__lead(2+)_salt | C(=O)O |
Formic_acid__magnesium_salt | C(=O)O |
Formic_acid__nonyl_ester | C(CCCCC)CCCOC=O |
Formic_acid__octyl_ester | C(CCCCC)CCOC=O |
Formic_acid__p-nitrophenyl_ester | [N+](=O)([O-])c1ccc(OC=O)cc1 |
Formic_acid__pentyl_ester | C(CCC)COC=O |
Formic_acid__phenylmethyl_ester | C(OC=O)c1ccccc1 |
Formic_acid__potassium_salt | C(=O)O |
Formic_acid__sodium_salt | C(=O)O |
Formic_acid__thallium(1+)_salt | C(=O)O |