If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Cyclohexyl-2-(cyclohexylmethyl)pentadecane | C(CCCCCCCCCCCCC)(CC1CCCCC1)CC2CCCCC2 |
Pentadecane | C(CCCCCCC)CCCCCCC |
Pentadecane, 1-bromo- | C(CCCCCCBr)CCCCCCCC |
Pentadecane, 1-phenyl- | C(CCCCCCCCCCCCCC)c1ccccc1 |
Pentadecane, 2,6,10, 14-tetramethyl- | C(C)(CCCC(C)C)CCCC(C)CCCC(C)C |
Pentadecane, 2-methyl- | C(CCCCCCCC)CCCCC(C)C |
Pentadecane, 6-methyl- | C(CCCCCCCC)C(C)CCCCC |
Pentadecane, 8-hexyl- | C(CCCCCC)(CCCCCCC)CCCCCCC |
Pentadecane__1-bromo- | C(CCCCCCBr)CCCCCCCC |
Pentadecane__1-phenyl- | C(CCCCCCCCCCCCCC)c1ccccc1 |
Pentadecane__2-methyl- | C(CCCCCCCC)CCCCC(C)C |
Pentadecane__2_6_10__14-tetramethyl- | C(C)(CCCC(C)C)CCCC(C)CCCC(C)C |
Pentadecane__6-methyl- | C(CCCCCCCC)C(C)CCCCC |
Pentadecane__8-hexyl- | C(CCCCCC)(CCCCCCC)CCCCCCC |
n-Pentadecane | C(CCCCCCC)CCCCCCC |