If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Polyethylene glycol 400 monoester of ricinoleic acid | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Polyethylene glycol, ester with ricinoleic acid | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Polyethylene glycol-ricinoleic acid monoester | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
RICINOLEIC ACID | C(O)(CCCCCC)CC=CCCCCCCCC(=O)O |
Ricinoleic acid methyl ester | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OC |
Ricinoleic acid | C(O)(CCCCCC)CC=CCCCCCCCC(=O)O |
Ricinoleic acid, 2-hydroxyethyl ester | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Ricinoleic acid, 2-methoxyethyl ester | C(C=CCCCCCCCC(=O)OCCOC)C(O)CCCCCC |
Ricinoleic acid, 2-methoxyethyl ester, acetate | C(CCCCCC)(CC=CCCCCCCCC(=O)OCCOC)OC(C)=O |
Ricinoleic acid, acetyl methoxyglycol deriv. | C(CCCCCC)(CC=CCCCCCCCC(=O)OCCOC)OC(C)=O |
Ricinoleic acid, barium salt (2:1) | C(O)(CCCCCC)CC=CCCCCCCCC(=O)O |
Ricinoleic acid, barium salt | C(O)(CCCCCC)CC=CCCCCCCCC(=O)O |
Ricinoleic acid, butyl ester, acetate | C(CCCCCC)(CC=CCCCCCCCC(=O)OCCCC)OC(C)=O |
Ricinoleic acid, methyl ester | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OC |
Ricinoleic acid, methyl ester, acetate | C(CCCCCC)(CC=CCCCCCCCC(=O)OC)OC(C)=O |
Ricinoleic acid, monoester with polyethylene glycol | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Ricinoleic acid, monosodium salt, (+)- | C(O)(CCCCCC)CC=CCCCCCCCC(=O)O |
Ricinoleic acid, sodium salt | C(O)(CCCCCC)CC=CCCCCCCCC(=O)O |