If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Carbamothioic acid, (2-hydroxyethyl)-, GAMMA_-lactone | S=C1NCCO1 |
Carbamothioic acid, (2-mercatophenyl)-, GAMMA_-lactone | O=C1Nc2ccccc2S1 |
Carbamothioic acid, 2-propenyl-, O-ethyl ester | C(=S)(OCC)NCC=C |
Carbamothioic acid, O-ethyl ester | O(CC)C(N)=S |
Carbamothioic acid, O-phenyl ester | O(C(N)=S)c1ccccc1 |
Carbamothioic acid, S-(3-chloropropyl) ester | S(CCCCl)C(N)=O |
Carbamothioic acid, diethyl-, sodium salt | N(CC)(CC)C(=O)S |
Carbamothioic acid, dipropyl-, S-ethyl ester | N(CCC)(CCC)C(=O)SCC |
Carbamothioic acid, heptyl-, O-ethyl ester | C(=S)(OCC)NCCCCCCC |
Carbamothioic acid, methyl(3-methylphenyl)-, O-2-naphthalenyl ester | O(C(=S)N(C)c1cccc(C)c1)c2ccc3ccccc3c2 |
Carbamothioic acid, phenyl-, O-ethyl ester | N(C(=S)OCC)c1ccccc1 |
Carbamothioic acid, phenyl-, O-methyl ester | N(C(=S)OC)c1ccccc1 |
Carbamothioic acid, phenyl-, S-phenyl ester | N(C(=O)Sc1ccccc1)c2ccccc2 |
Carbamothioic_acid__(2-hydroxyethyl)-__GAMMA_-lactone | S=C1NCCO1 |
Carbamothioic_acid__(2-mercatophenyl)-__GAMMA_-lactone | O=C1Nc2ccccc2S1 |
Carbamothioic_acid__2-propenyl-__O-ethyl_ester | C(=S)(OCC)NCC=C |
Carbamothioic_acid__diethyl-__sodium_salt | N(CC)(CC)C(=O)S |
Carbamothioic_acid__dipropyl-__S-ethyl_ester | N(CCC)(CCC)C(=O)SCC |
Carbamothioic_acid__methyl(3-methylphenyl)-__O-2-naphthalenyl_ester | O(C(=S)N(C)c1cccc(C)c1)c2ccc3ccccc3c2 |
Carbamothioic_acid__phenyl-__O-ethyl_ester | N(C(=S)OCC)c1ccccc1 |
Carbamothioic_acid__phenyl-__O-methyl_ester | N(C(=S)OC)c1ccccc1 |
Carbamothioic_acid__phenyl-__S-phenyl_ester | N(C(=O)Sc1ccccc1)c2ccccc2 |