If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-(2,5-Xylyloxy)ethanol | O(CCO)c1cc(C)ccc1C |
2-(4-Chloro-3, 5-xylyloxy)ethanol | O(CCO)c1cc(C)c(Cl)c(C)c1 |
2-Oxazolidinone, 5-((3, 5-xylyloxy)methyl)- | C(Oc1cc(C)cc(C)c1)C2CNC(=O)O2 |
4-(4-Chloro-3,5-xylyloxy)ethanol | O(CCO)c1cc(C)c(Cl)c(C)c1 |
5-((3, 5-Xylyloxy)methyl)-2-oxazolidinone | C(Oc1cc(C)cc(C)c1)C2CNC(=O)O2 |
Acetic acid, (2,6-xylyloxy)- | O(CC(=O)O)c1c(C)cccc1C |
Ethanol, 2-(2, 5-xylyloxy)- | O(CCO)c1cc(C)ccc1C |