If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
D-Iditol | C(O)(C(O)CO)C(O)C(O)CO |
Iditol, 1,4:3,6-dianhydro-2,5-bis-O-(2,3-epoxypropyl)-, L- | O(CC1CO1)C2COC3C2OCC3OCC4CO4 |
Iditol, D- | C(O)(C(O)CO)C(O)C(O)CO |
Iditol__1_4:3_6-dianhydro-2_5-bis-O-(2_3-epoxypropyl)-__L- | O(CC1CO1)C2COC3C2OCC3OCC4CO4 |
Iditol__D- | C(O)(C(O)CO)C(O)C(O)CO |
L-Iditol, 1,4:3,6-dianhydro-2,5-bis-O-(2,3-epoxypropyl)- | O(CC1CO1)C2COC3C2OCC3OCC4CO4 |