If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
A-H Injection | C(CC(=O)O)C(=O)O.CN(C)CCOC(C)(c1ccccc1)c2ccccn2 |
D-P-A Injection | C(O)(C(=O)NCCCO)C(C)(C)CO |
Femestrone injection | CC12CCC3c4ccc(O)cc4CCC3C1CCC2=O |
Malogen, aquaspension injection | CC12CCC(=O)C=C2CCC3C1CCC4(C)C(O)CCC34 |
Prednisolone sodium succinate, injection | CC12CC(O)C3C(CCC4=CC(=O)C=CC34C)C1CCC2(O)C(=O)COC(=O)CCC(=O)O |
Sodium glucosulfone, injection | C(Nc1ccc(cc1)S(=O)(=O)c2ccc(cc2)NC(C(O)C(O)C(O)C(O)CO)S(=O)(=O)O)(C(O)C(O)C(O)C(O)CO)S(=O)(=O)O |
Sodium lactate, injection | C(C)(O)C(=O)O |
Sulfamerazine sodium, injection | S(=O)(=O)(Nc1nccc(C)n1)c2ccc(N)cc2 |
Syntostigmin (injection) | S(=O)(=O)(O)OC.CN(C)C(=O)Oc1cccc(c1)N(C)(C)C |
Vinbarbital sodium, injection | C(C)(=CCC)C1(CC)C(=O)NC(=O)NC1=O |