If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
9-Octadecenamide, (Z)- | C(CC=CCCCCCCCC)CCCCCC(N)=O |
9-Octadecenamide, N,N'-1,2-ethanediylbis-, (Z,Z)- | N(CCNC(=O)CCCCCCCC=CCCCCCCCC)C(=O)CCCCCCCC=CCCCCCCCC |
9-Octadecenamide, N,N-dimethyl-, (Z)- | C(CCCCC=CCCCCCCCC)CCC(=O)N(C)C |
9-Octadecenamide, N-(2-(diethylamino)ethyl)-, (Z)- | C(CNC(=O)CCCCCCCC=CCCCCCCCC)N(CC)CC |
9-Octadecenamide, N-(3-(dimethylamino)propyl)-, (Z)- | C(CCCCCCC=CCCCCCCCC)C(=O)NCCCN(C)C |
9-Octadecenamide, N-octadecyl-, (Z)- | N(CCCCCCCCCCCCCCCCCC)C(=O)CCCCCCCC=CCCCCCCCC |
9-Octadecenamide__(Z)- | C(CC=CCCCCCCCC)CCCCCC(N)=O |
9-Octadecenamide__N-(2-(diethylamino)ethyl)-__(Z)- | C(CNC(=O)CCCCCCCC=CCCCCCCCC)N(CC)CC |
9-Octadecenamide__N-octadecyl-__(Z)- | N(CCCCCCCCCCCCCCCCCC)C(=O)CCCCCCCC=CCCCCCCCC |
9-Octadecenamide__N_N-dimethyl-__(Z)- | C(CCCCC=CCCCCCCCC)CCC(=O)N(C)C |
N, N-Dimethyl-cis-9-octadecenamide | C(CCCCC=CCCCCCCCC)CCC(=O)N(C)C |