If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 6-Octadien-3-ol, 3,7-dimethyl-, formate | C(C)(C=C)(OC=O)CCC=C(C)C |
1-Butanol, 3-methyl-, formate | C(COC=O)C(C)C |
1-Butanol__3-methyl-__formate | C(COC=O)C(C)C |
1-Octadecanol, formate | C(CCCCCCCCCC)CCCCCCCOC=O |
1-Octadecanol__formate | C(CCCCCCCCCC)CCCCCCCOC=O |
1-Propanol, 2, 2-dimethyl-, formate | C(OC=O)C(C)(C)C |
1-Propanol, 3-(3-phenoxypropoxy)-, formate | O(CCCOCCCOC=O)c1ccccc1 |
1-Propanol, 3-phenyl-, formate | C(CCOC=O)c1ccccc1 |
1-Propanol__2__2-dimethyl-__formate | C(OC=O)C(C)(C)C |
1-Propanol__3-(3-phenoxypropoxy)-__formate | O(CCCOCCCOC=O)c1ccccc1 |
1-Propanol__3-phenyl-__formate | C(CCOC=O)c1ccccc1 |
1-Tetradecanol, formate | C(CCCCCCCC)CCCCCOC=O |
1-Tetradecanol__formate | C(CCCCCCCC)CCCCCOC=O |
1-Undecanol, formate | C(CCCCCC)CCCCOC=O |
1-Undecanol__formate | C(CCCCCC)CCCCOC=O |
1__6-Octadien-3-ol__3_7-dimethyl-__formate | C(C)(C=C)(OC=O)CCC=C(C)C |
2, 6-Dimethyl-2-octen-8-yl formate | C(C)(CCOC=O)CCC=C(C)C |
2, 6-Octadien-1-ol, 3,7-dimethyl-, formate, (E)- | C(C)(=CCOC=O)CCC=C(C)C |
2-Hydroxyethyl formate | C(CO)OC=O |
2-Methylpropyl formate | C(OC=O)C(C)C |
2-Phenethyl formate | C(COC=O)c1ccccc1 |
2-Phenylethyl formate | C(COC=O)c1ccccc1 |
2-Propen-1-ol, 3-phenyl-, formate | C(=CCOC=O)c1ccccc1 |
2-Propen-1-ol__3-phenyl-__formate | C(=CCOC=O)c1ccccc1 |
3,7-Dimethyl-6-octen-1-yl formate | C(C)(CCOC=O)CCC=C(C)C |
3-Methylbutyl formate | C(COC=O)C(C)C |
3-Phenyl-1-propyl formate | C(CCOC=O)c1ccccc1 |
3-Phenyl-2-propen-1-yl formate | C(=CCOC=O)c1ccccc1 |
3-Phenylpropyl formate | C(CCOC=O)c1ccccc1 |
4-(1,1-Dimethylethyl)cyclohexyl formate | C(C)(C)(C)C1CCC(OC=O)CC1 |
4-Methoxybenzyl formate | C(OC=O)c1ccc(OC)cc1 |
4-Nitrophenyl formate | [N+](=O)([O-])c1ccc(OC=O)cc1 |
6-Octen-1-ol, 3,7-dimethyl-, formate | C(C)(CCOC=O)CCC=C(C)C |
9-BETA_-D-Arabinofuranosyladenine 5'-formate | OC1C(O)C(COC=O)OC1N2C=Nc3c(N)ncnc23 |
9BETA_-D-Arabinofuranoxyladenine 5'-formate | OC1C(O)C(COC=O)OC1N2C=Nc3c(N)ncnc23 |
ALPHA_-Methylbenzyl formate | C(C)(OC=O)c1ccccc1 |
Allyl formate | C(C=C)OC=O |
Ammonium, tetramethyl-, formate | C(=O)O.CN(C)(C)C |
Amyl formate | C(CCC)COC=O |
Anisyl alcohol, formate | C(OC=O)c1ccc(OC)cc1 |
Anisyl formate | C(OC=O)c1ccc(OC)cc1 |
Arabinosyladenine 5'-O-formate ester | OC1C(O)C(COC=O)OC1N2C=Nc3c(N)ncnc23 |
BETA_-Phenethyl formate | C(COC=O)c1ccccc1 |
BETA_-Phenylethyl formate | C(COC=O)c1ccccc1 |
Benzeneethanol, formate | C(COC=O)c1ccccc1 |
Benzenemethanol, 4-methoxy-, formate | C(OC=O)c1ccc(OC)cc1 |
Benzenemethanol, ALPHA_-methyl-, formate | C(C)(OC=O)c1ccccc1 |
Benzenemethanol__4-methoxy-__formate | C(OC=O)c1ccc(OC)cc1 |
Benzenemethanol__ALPHA_-methyl-__formate | C(C)(OC=O)c1ccccc1 |
Benzenepropanol, formate | C(CCOC=O)c1ccccc1 |
Benzyl alcohol, ALPHA_-methyl-, formate | C(C)(OC=O)c1ccccc1 |
Benzyl alcohol, formate | C(OC=O)c1ccccc1 |
Benzyl alcohol, p-methoxy-, formate | C(OC=O)c1ccc(OC)cc1 |
Benzyl formate | C(OC=O)c1ccccc1 |
Benzylcarbinyl formate | C(COC=O)c1ccccc1 |
Butyl formate | C(CCC)OC=O |
Cadmium formate Cd(O2CH)2 | C(=O)O |
Cadmium formate | C(=O)O |
Cadmium_formate_Cd(O2CH)2 | C(=O)O |
Chromic formate | C(=O)O |
Chromium formate Cr(O2CH)3 | C(=O)O |
Cinnamyl alcohol, formate | C(=CCOC=O)c1ccccc1 |
Cinnamyl formate | C(=CCOC=O)c1ccccc1 |
Citronellyl formate | C(C)(CCOC=O)CCC=C(C)C |
Cobalt formate (VAN) | C(=O)O |
Cobalt formate, Co(O2CH)2 | C(=O)O |
Cobaltous formate | C(=O)O |
Copper formate (VAN) | C(=O)O |
Cupric formate | C(=O)O |
Cyclohexanol, 4-(1,1-dimethylethyl)-, formate | C(C)(C)(C)C1CCC(OC=O)CC1 |
Cyclohexanol__4-(1_1-dimethylethyl)-__formate | C(C)(C)(C)C1CCC(OC=O)CC1 |
Cyclohexyl formate | O(C=O)C1CCCCC1 |
Decyl formate | C(CCCCCC)CCCOC=O |
Ethyl formate | O(CC)C=O |
Ethyl formate(ortho) | C(OCC)(OCC)OCC |
Ethyl xanthogen ethyl formate | C(=O)(OCC)SC(=S)OCC |
Ethylene formate | C(OC=O)COC=O |
GAMMA_-Phenylallyl formate | C(=CCOC=O)c1ccccc1 |
Geraniol formate | C(C)(=CCOC=O)CCC=C(C)C |
Geranyl formate | C(C)(=CCOC=O)CCC=C(C)C |
Hexyl formate | C(CCCC)COC=O |
Hydrocinnamyl formate | C(CCOC=O)c1ccccc1 |
Isoamyl formate | C(COC=O)C(C)C |
Isobutyl formate | C(OC=O)C(C)C |
Isopentyl alcohol, formate | C(COC=O)C(C)C |
Isopentyl formate | C(COC=O)C(C)C |
LINOLOOL, FORMATE | C(C)(C=C)(OC=O)CCC=C(C)C |
Lead formate (Pb(HCO2)2) | C(=O)O |
Lead formate (VAN) | C(=O)O |
Lead formate Pb(O2CH)2 | C(=O)O |
Lead(2+) formate | C(=O)O |
Linalool, formate | C(C)(C=C)(OC=O)CCC=C(C)C |
Linalyl formate | C(C)(C=C)(OC=O)CCC=C(C)C |
Magnesium formate | C(=O)O |
Methanaminium, N,N,N-trimethyl-, formate | C(=O)O.CN(C)(C)C |
Methanaminium__N_N_N-trimethyl-__formate | C(=O)O.CN(C)(C)C |
Neopentyl formate | C(OC=O)C(C)(C)C |
Octyl alcohol, formate | C(CCCCC)CCOC=O |
Octyl formate | C(CCCCC)CCOC=O |
Pentyl formate | C(CCC)COC=O |
Phenethyl alcohol, formate | C(COC=O)c1ccccc1 |
Phenethyl formate | C(COC=O)c1ccccc1 |
Phenylethyl formate | C(COC=O)c1ccccc1 |
Phenylpropyl formate | C(CCOC=O)c1ccccc1 |
Potassium formate | C(=O)O |
Sodium formate | C(=O)O |
Sodium formate, refined | C(=O)O |
Styralyl formate | C(C)(OC=O)c1ccccc1 |
Tetramethylammonium formate | C(=O)O.CN(C)(C)C |
Tetryl formate | C(OC=O)C(C)C |
Thallium formate TlO2CH | C(=O)O |
Thallium(I) formate | C(=O)O |
Thallous formate | C(=O)O |
Vinyl formate | O(C=C)C=O |
n-Amyl formate | C(CCC)COC=O |
n-Butyl formate | C(CCC)OC=O |
n-Hexyl formate | C(CCCC)COC=O |
n-Octyl formate | C(CCCCC)CCOC=O |
n-Pentyl formate | C(CCC)COC=O |
p-Methoxybenzyl alcohol, formate | C(OC=O)c1ccc(OC)cc1 |
p-Methoxybenzyl formate | C(OC=O)c1ccc(OC)cc1 |
p-Nitrophenyl formate | [N+](=O)([O-])c1ccc(OC=O)cc1 |
p-t-Butylcyclohexyl formate | C(C)(C)(C)C1CCC(OC=O)CC1 |
sec-Butyl formate | C(C)(CC)OC=O |
sec-Butyl xanthogen ethyl formate | S(C(=O)OCC)C(=S)OC(C)CC |
trans-3, 7-Dimethyl-2,6-octadien-1-yl formate | C(C)(=CCOC=O)CCC=C(C)C |
trans-3,7-Dimethyl-2,6-octadien-1-ol formate | C(C)(=CCOC=O)CCC=C(C)C |