If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Duranol Blue Green B | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Duranol Blue PP | N(C(C)C)c1ccc(NC(C)C)c2C(=O)c3ccccc3C(=O)c12 |
Duranol Brilliant Blue B | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Duranol Brilliant Blue BN | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Duranol Brilliant Blue CB | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Duranol Brilliant Blue G | O=C1c2ccccc2C(=O)c3c(NC)ccc(NC)c13 |
Duranol Brilliant Blue Violet BR | O=C1c2c(N)ccc(N)c2C(=O)c3cccc([N+](=O)[O-])c13 |
Duranol Brilliant Violet BR | O=C1c2c(N)ccc(N)c2C(=O)c3cccc([N+](=O)[O-])c13 |
Duranol Brilliant Violet TG | N(c1ccc(C)cc1)c2ccc(O)c3C(=O)c4ccccc4C(=O)c23 |
Duranol Orange G | O=C1c2ccccc2C(=O)c3ccc(C)c(N)c13 |
Duranol Printing Blue B | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Duranol Printing Blue Green B | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Duranol Red 2B | O=C1c2ccccc2C(=O)c3c(O)ccc(N)c13 |
Duranol Red GN | O=C1c2ccccc2C(=O)c3cccc(NC)c13 |
Duranol Red X 3B | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Duranol Red X3B | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Duranol Violet 2R | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Duranol Violet 2R, 1,4-diamino- | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |