If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 2-Benzenedicarboxylic acid, monobutyl ester | C(=O)(OCCCC)c1ccccc1C(=O)O |
1,2-Propylene glycol 1-monobutyl ether | O(CCCC)CC(C)O |
1_2-Propylene_glycol_1-monobutyl_ether | O(CCCC)CC(C)O |
1__2-Benzenedicarboxylic_acid__monobutyl_ester | C(=O)(OCCCC)c1ccccc1C(=O)O |
Adipic acid, bis(ethylene glycol monobutyl ether) ester | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Adipic_acid__bis(ethylene_glycol_monobutyl_ether)_ester | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Bis(ethylene glycol monobutyl ether) adipate | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Di(ethylene glycol monobutyl ether) phthalate | C(=O)(OCCOCCOCCCC)c1ccccc1C(=O)OCCOCCOCCCC |
Dibutyltin bis(monobutyl maleate) | [Sn](CCCC)(CCCC)(OC(=O)C=CC(=O)OCCCC)OC(=O)C=CC(=O)OCCCC |
Diethylene glycol monobutyl ether acetate | C(OCCOCCCC)COC(C)=O |
Diethylene glycol monobutyl ether | C(COCCO)OCCCC |
Diethylene gylcol monobutyl ether | C(COCCO)OCCCC |
Diethylene_glycol_monobutyl_ether_acetate | C(OCCOCCCC)COC(C)=O |
Diglycol monobutyl ether acetate | C(OCCOCCCC)COC(C)=O |
Diglycol monobutyl ether | C(COCCO)OCCCC |
Ethanol, 2, 2'-oxybis-, monobutyl ether | C(COCCO)OCCCC |
Ethanol__2__2'-oxybis-__monobutyl_ether | C(COCCO)OCCCC |
Ethylene glycol monobutyl ether laurate | C(CCCCCCCCCC)C(=O)OCCOCCCC |
Ethylene glycol monobutyl ether | C(CCC)OCCO |
Ethylene_glycol_monobutyl_ether_laurate | C(CCCCCCCCCC)C(=O)OCCOCCCC |
Glycol monobutyl ether | C(CCC)OCCO |
Monobutyl ether of ethylene glycol | C(CCC)OCCO |
Monobutyl glycol ether | C(CCC)OCCO |
Monobutyl phosphate | O(CCCC)P(=O)(O)O |
Monobutyl phthalate | C(=O)(OCCCC)c1ccccc1C(=O)O |
Monobutyl tetrachlorophthalate | C(=O)(OCCCC)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O |
Monobutyl | O=C1C(CCCC)C(=O)NN1c2ccccc2 |
Monobutyl_ether_of_ethylene_glycol | C(CCC)OCCO |
Phosphonic acid, butyl-, monobutyl ester, vanadium(3+) salt | O(CCCC)P(=O)(O)CCCC |
Phosphonic_acid__butyl-__monobutyl_ester__vanadium(3+)_salt | O(CCCC)P(=O)(O)CCCC |
Phosphoric acid, monobutyl ester | O(CCCC)P(=O)(O)O |
Phosphoric_acid__monobutyl_ester | O(CCCC)P(=O)(O)O |
Phthalic acid, monobutyl ester | C(=O)(OCCCC)c1ccccc1C(=O)O |
Phthalic acid, monobutyl ester, copper(2+) salt | C(=O)(OCCCC)c1ccccc1C(=O)O |
Phthalic acid, monobutyl ester, copper(II) salt | C(=O)(OCCCC)c1ccccc1C(=O)O |
Phthalic acid, tetrachloro-, monobutyl ester | C(=O)(OCCCC)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O |
Phthalic_acid__monobutyl_ester__copper(II)_salt | C(=O)(OCCCC)c1ccccc1C(=O)O |
Propylene glycol monobutyl ether | O(CCCC)CC(C)O |
Tetrachlorophthalic acid monobutyl ester | C(=O)(OCCCC)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O |
Triethylene glycol monobutyl ether | C(COCCCC)OCCOCCO |
Triethyleneglycol monobutyl ether | C(COCCCC)OCCOCCO |
Triglycol monobutyl ether | C(COCCCC)OCCOCCO |