If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
L-Buthionine sulfoximine | S(=N)(=O)(CCCC)CCC(N)C(=O)O |
Sulfoximine, N-(4-bromophenyl)-S,S-dimethyl- | N(c1ccc(Br)cc1)=S(C)(C)=O |
Sulfoximine, N-(4-chlorophenyl)-S,S-dimethyl- | N(c1ccc(Cl)cc1)=S(C)(C)=O |
Sulfoximine, N-(4-cyanophenyl)-S,S-dimethyl- | N(c1ccc(C#N)cc1)=S(C)(C)=O |
Sulfoximine, S,S-dimethyl-N-(4-methylphenyl)- | N(c1ccc(C)cc1)=S(C)(C)=O |
Sulfoximine, S-methyl-S-phenyl- | S(C)(=N)(=O)c1ccccc1 |
Sulfoximine__N-(4-bromophenyl)-S_S-dimethyl- | N(c1ccc(Br)cc1)=S(C)(C)=O |
Sulfoximine__N-(4-chlorophenyl)-S_S-dimethyl- | N(c1ccc(Cl)cc1)=S(C)(C)=O |
Sulfoximine__N-(4-cyanophenyl)-S_S-dimethyl- | N(c1ccc(C#N)cc1)=S(C)(C)=O |
Sulfoximine__S-methyl-S-phenyl- | S(C)(=N)(=O)c1ccccc1 |
Sulfoximine__S_S-dimethyl-N-(4-methylphenyl)- | N(c1ccc(C)cc1)=S(C)(C)=O |