If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Aminoanisole | O(C)c1ccccc1N |
2-Chloro-4-aminoanisole | O(C)c1ccc(N)cc1Cl |
2-Methoxy-4-aminoanisole | O(C)c1ccc(N)cc1OC |
3-Aminoanisole | O(C)c1cccc(N)c1 |
3-Nitro-4-aminoanisole | [N+](=O)([O-])c1cc(OC)ccc1N |
4-Aminoanisole | O(C)c1ccc(N)cc1 |
4-Methyl-2-aminoanisole | O(C)c1ccc(C)cc1N |
m-Aminoanisole | O(C)c1cccc(N)c1 |
o-Aminoanisole | O(C)c1ccccc1N |
p-Aminoanisole | O(C)c1ccc(N)cc1 |