If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Crotyl bromide | C(CBr)=CC |
CROTYL ALCOHOL | C(=CC)CO |
Crotyl alcohol (VAN) | C(=CC)CO |
Crotyl bromide | C(CBr)=CC |
Ethyl(crotyl)barbiturate | C(C=CC)C1(CC)C(=O)NC(=O)NC1=O |
Ethyl-crotyl-barbiturate | C(C=CC)C1(CC)C(=O)NC(=O)NC1=O |