If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Pyrrolidinyloxy, 3-(aminocarbonyl)-2,2,5,5-tetramethyl- | ON1C(C)(C)CC(C(N)=O)C1(C)C |
1-Pyrrolidinyloxy, 3-carbamoyl-2,2,5,5-tetramethyl- | ON1C(C)(C)CC(C(N)=O)C1(C)C |
1-Pyrrolidinyloxy, 3-carboxy-2,2,5,5-tetramethyl- | ON1C(C)(C)CC(C(=O)O)C1(C)C |
1-Pyrrolidinyloxy__3-(aminocarbonyl)-2_2_5_5-tetramethyl- | ON1C(C)(C)CC(C(N)=O)C1(C)C |
1-Pyrrolidinyloxy__3-carboxy-2_2_5_5-tetramethyl- | ON1C(C)(C)CC(C(=O)O)C1(C)C |
2,2,5, 5-Tetramethyl-3-carbamoyl-1-pyrrolidinyloxy | ON1C(C)(C)CC(C(N)=O)C1(C)C |