If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(+)-Prostaglandin A2 | C(C=CCCCC(=O)O)C1C(=O)C=CC1C=CC(O)CCCCC |
(-)-Prostaglandin E1 | C(CCCCCC(=O)O)C1C(=O)CC(O)C1C=CC(O)CCCCC |
(-)-Prostaglandin E2 | C(C=CCCCC(=O)O)C1C(=O)CC(O)C1C=CC(O)CCCCC |
(15S)-Prostaglandin A2 | C(C=CCCCC(=O)O)C1C(=O)C=CC1C=CC(O)CCCCC |
(15S)-Prostaglandin E2 | C(C=CCCCC(=O)O)C1C(=O)CC(O)C1C=CC(O)CCCCC |
Prostaglandin A2 | C(C=CCCCC(=O)O)C1C(=O)C=CC1C=CC(O)CCCCC |
Prostaglandin E(2) | C(C=CCCCC(=O)O)C1C(=O)CC(O)C1C=CC(O)CCCCC |
Prostaglandin E1 | C(CCCCCC(=O)O)C1C(=O)CC(O)C1C=CC(O)CCCCC |
Prostaglandin E2 | C(C=CCCCC(=O)O)C1C(=O)CC(O)C1C=CC(O)CCCCC |
Prostaglandin E2ALPHA_ | C(C=CCCCC(=O)O)C1C(=O)CC(O)C1C=CC(O)CCCCC |
Prostaglandin F2ALPHA_ THAM | C(N)(CO)(CO)CO.CCCCCC(O)C=CC1C(O)CC(O)C1CC=CCCCC(=O)O |
Prostaglandin | C(=CC(CCCCC)OC(C)=O)C1C=CC(=O)C1CC=CCCCC(=O)OC |
l-Prostaglandin E1 | C(CCCCCC(=O)O)C1C(=O)CC(O)C1C=CC(O)CCCCC |