If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Hydroxybenzonitrile | C(#N)c1ccccc1O |
3-Bromo-5-tert-butyl-4-hydroxybenzonitrile | C(C)(C)(C)c1cc(C#N)cc(Br)c1O |
3-Hydroxybenzonitrile | C(#N)c1cccc(O)c1 |
4-Hydroxybenzonitrile | C(#N)c1ccc(O)cc1 |
m-Hydroxybenzonitrile | C(#N)c1cccc(O)c1 |
o-Hydroxybenzonitrile | C(#N)c1ccccc1O |
p-Hydroxybenzonitrile | C(#N)c1ccc(O)cc1 |