If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Hydroxy-5-phenylaniline | Nc1cc(ccc1O)c2ccccc2 |
2-Nitro-4-phenylaniline | [N+](=O)([O-])c1cc(ccc1N)c2ccccc2 |
2-Phenylaniline | Nc1ccccc1c2ccccc2 |
4-Nitroso-N-phenylaniline | N(c1ccccc1)c2ccc(N=O)cc2 |
4-Phenylaniline | Nc1ccc(cc1)c2ccccc2 |
N-Methyl-N-phenylaniline | N(C)(c1ccccc1)c2ccccc2 |
N-Nitroso-N-phenylaniline | N(N=O)(c1ccccc1)c2ccccc2 |
N-Phenylaniline | N(c1ccccc1)c2ccccc2 |
Phenylaniline | N(c1ccccc1)c2ccccc2 |
o-Nitro-N-phenylaniline | N(c1ccccc1)c2ccccc2[N+](=O)[O-] |
o-Phenylaniline | Nc1ccccc1c2ccccc2 |
p'-Chloro-p-phenylaniline | Clc1ccc(cc1)c2ccc(N)cc2 |
p-Nitroso-N-phenylaniline | N(c1ccccc1)c2ccc(N=O)cc2 |
p-Phenylaniline | Nc1ccc(cc1)c2ccccc2 |