If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Sulfurous acid, bis(phenylmethyl) ester | C(OS(=O)OCc1ccccc1)c2ccccc2 |
Sulfurous acid, cyclic ester with 1,2-propanediol | CC1COS(=O)O1 |
Sulfurous acid, cyclic ester with ethylene glycol | O=S1OCCO1 |
Sulfurous acid, cyclic propylene ester | CC1COS(=O)O1 |
Sulfurous acid, dibenzyl ester | C(OS(=O)OCc1ccccc1)c2ccccc2 |
Sulfurous acid, dibutyl ester | O(CCCC)S(=O)OCCCC |
Sulfurous acid, diethyl ester | S(=O)(OCC)OCC |
Sulfurous acid, dimethyl ester | S(=O)(OC)OC |
Sulfurous acid, monosodium salt | S(=O)(O)O |
Sulfurous imide, phenyl- | N(=S=O)c1ccccc1 |
Sulfurous_acid__bis(phenylmethyl)_ester | C(OS(=O)OCc1ccccc1)c2ccccc2 |
Sulfurous_acid__cyclic_ester_with_1_2-propanediol | CC1COS(=O)O1 |
Sulfurous_acid__cyclic_ester_with_ethylene_glycol | O=S1OCCO1 |
Sulfurous_acid__dibutyl_ester | O(CCCC)S(=O)OCCCC |
Sulfurous_acid__diethyl_ester | S(=O)(OCC)OCC |
Sulfurous_acid__dimethyl_ester | S(=O)(OC)OC |