If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,2, 3-Propanetricarboxylic acid, 2-hydroxy-, lead(2+) salt (2:3) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |
1_2__3-Propanetricarboxylic_acid__2-hydroxy-__lead(2+)_salt_(2:3) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |
6H-Purine-6-thione, 1,7-dihydro-, lead complex | [Pb]123S=C4N=CNC5=C4N1=CN5.S3=C6N=CNC7=C6N2=CN7 |
Acetic acid lead(2+) salt | C(C)(=O)O |
Acetic acid, lead salt | C(C)(=O)O |
Acetic acid, lead(2 +) salt | C(C)(=O)O |
Acetic acid, lead(2+) salt (8CI 9CI) | C(C)(=O)O |
Acetic_acid__lead(2+)_salt_(8CI_9CI) | C(C)(=O)O |
Benzoic acid, lead(2+) salt | C(=O)(O)c1ccccc1 |
Benzoic_acid__lead(2+)_salt | C(=O)(O)c1ccccc1 |
Bis(diethyldithiocarbamato)lead(II) | N(CC)(CC)C1=S[Pb]2(S1)SC(=S2)N(CC)CC |
Bis(methylthio)lead | CS |
Butanedioic acid, 2,3-dihydroxy- (R-(R*,R*))-, lead(2+) salt (1:1) | C(O)(C(=O)O)C(O)C(=O)O |
Butanedioic_acid__2_3-dihydroxy-_(R-(R*_R*))-__lead(2+)_salt_(1:1) | C(O)(C(=O)O)C(O)C(=O)O |
Citric acid, lead(2+) salt (2:3) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |
Decanoic acid, lead(2+) salt | C(CCCCCC)CCC(=O)O |
Decanoic_acid__lead(2+)_salt | C(CCCCCC)CCC(=O)O |
Dibasic lead acetate | C(C)(=O)O |
Formic acid, lead(2+) salt | C(=O)O |
Formic_acid__lead(2+)_salt | C(=O)O |
Lead acetate (ACN) | C(C)(=O)O |
Lead acetate (Pb(Ac)2) | C(C)(=O)O |
Lead acetate (Pb(O2C2H3)2) | C(C)(=O)O |
Lead acetate (Pb(OAc)2) | C(C)(=O)O |
Lead benzoate, Pb(OBz)2 | C(=O)(O)c1ccccc1 |
Lead bis(N, N-diethyldithiocarbamate) | N(CC)(CC)C1=S[Pb]2(S1)SC(=S2)N(CC)CC |
Lead caprate | C(CCCCCC)CCC(=O)O |
Lead citrate (Pb3(C6H5O7)2) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |
Lead citrate (VAN) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |
Lead diacetate | C(C)(=O)O |
Lead dibasic acetate | C(C)(=O)O |
Lead diethyl dithiocarbamate | N(CC)(CC)C1=S[Pb]2(S1)SC(=S2)N(CC)CC |
Lead diformate | C(=O)O |
Lead formate (Pb(HCO2)2) | C(=O)O |
Lead formate (VAN) | C(=O)O |
Lead formate Pb(O2CH)2 | C(=O)O |
Lead glycerate | C(O)(CO)C(=O)O |
Lead monooxide | O=[Pb] |
Lead monoxide | O=[Pb] |
Lead oxide (PbO) | O=[Pb] |
Lead oxide (VAN) | O=[Pb] |
Lead oxide yellow | O=[Pb] |
Lead oxide, (PbO) | O=[Pb] |
Lead oxide, PbO | O=[Pb] |
Lead protoxide | O=[Pb] |
Lead tartrate (PbC4H4O6) | C(O)(C(=O)O)C(O)C(=O)O |
Lead tartrate (VAN) | C(O)(C(=O)O)C(O)C(=O)O |
Lead tetraethyl | [Pb](CC)(CC)(CC)CC |
Lead(2+) acetate | C(C)(=O)O |
Lead(2+) formate | C(=O)O |
Lead(2+) oxide | O=[Pb] |
Lead(II) acetate | C(C)(=O)O |
Lead(II) methylthiolate | CS |
Lead(II) oxide | O=[Pb] |
Lead(II) tartrate (1:1) | C(O)(C(=O)O)C(O)C(=O)O |
Lead, bis(1,7-dihydro-6H-purine-6-thionato-N7,S6)-, (T-4)- | [Pb]123S=C4N=CNC5=C4N1=CN5.S3=C6N=CNC7=C6N2=CN7 |
Lead, bis(1,9-dihydro-6H-purine-6-thionato-N7,S6)-, (T-4)- | [Pb]123S=C4N=CNC5=C4N1=CN5.S3=C6N=CNC7=C6N2=CN7 |
Lead, bis(8-quinolinolato-N1,O8)-, (T-4)- | [Pb]123Oc4cccc5cccn1c45.O3c6cccc7cccn2c67 |
Lead, bis(diethylcarbamodithioato-S,S')- | N(CC)(CC)C1=S[Pb]2(S1)SC(=S2)N(CC)CC |
Lead, bis(diethyldithiocarbamato)- | N(CC)(CC)C1=S[Pb]2(S1)SC(=S2)N(CC)CC |
Lead, chlorotrimethyl- | [Pb](C)(C)(C)Cl |
Lead, hexaphenyldi- | [Pb](c1ccccc1)(c2ccccc2)(c3ccccc3)[Pb](c4ccccc4)(c5ccccc5)c6ccccc6 |
Lead, tetraethyl- | [Pb](CC)(CC)(CC)CC |
Lead, tributyl-, chloride | [Pb](Cl)(CCCC)(CCCC)CCCC |
Lead, triethyl-, chloride | [Pb](Cl)(CC)(CC)CC |
Lead, trimethyl-, chloride | [Pb](C)(C)(C)Cl |
Lead, triphenyl- S-thioacetate | [Pb](SC(C)=O)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Lead, tripropyl-, chloride | [Pb](Cl)(CCC)(CCC)CCC |
Lead__bis(1_7-dihydro-6H-purine-6-thionato-N7_S6)-__(T-4)- | [Pb]123S=C4N=CNC5=C4N1=CN5.S3=C6N=CNC7=C6N2=CN7 |
Lead__bis(8-quinolinolato-N1_O8)-__(T-4)- | [Pb]123Oc4cccc5cccn1c45.O3c6cccc7cccn2c67 |
Lead__bis(diethylcarbamodithioato-S_S')- | N(CC)(CC)C1=S[Pb]2(S1)SC(=S2)N(CC)CC |
Lead__tributyl-__chloride | [Pb](Cl)(CCCC)(CCCC)CCCC |
Lead__triethyl-__chloride | [Pb](Cl)(CC)(CC)CC |
Lead__trimethyl-__chloride | [Pb](C)(C)(C)Cl |
Lead__triphenyl-_S-thioacetate | [Pb](SC(C)=O)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Lead__tripropyl-__chloride | [Pb](Cl)(CCC)(CCC)CCC |
Lead_glycerate | C(O)(CO)C(=O)O |
Methanethiol, lead(2+) salt | CS |
Methanethiol__lead(2+)_salt | CS |
Normal lead acetate | C(C)(=O)O |
Octanoic acid, lead(2+) salt | C(CCCCC)CC(=O)O |
Octanoic_acid__lead(2+)_salt | C(CCCCC)CC(=O)O |
Sugar of lead | C(C)(=O)O |
Tartaric acid, lead(2+) salt (1:1) | C(O)(C(=O)O)C(O)C(=O)O |
Tetra(methylethyl)lead | [Pb](CC)(CC)(CC)CC |
Tetraethyl lead, liquid (DOT) | [Pb](CC)(CC)(CC)CC |
Tetraethyl_lead__liquid_(DOT) | [Pb](CC)(CC)(CC)CC |
Texaco lead appreciator | O(C(C)=O)C(C)(C)C |
Tri-n-propyl lead chloride | [Pb](Cl)(CCC)(CCC)CCC |
Triethyl lead p-aminobenzoate | [Pb](CC)(CC)(CC)OC(=O)c1ccc(N)cc1 |
Trimethyl lead chloride | [Pb](C)(C)(C)Cl |
Tripropyl lead chloride | [Pb](Cl)(CCC)(CCC)CCC |
Xanthic acid, isopropyl-, lead(II) salt | O(C(C)C)C(=S)S |
Xanthic_acid__isopropyl-__lead(II)_salt | O(C(C)C)C(=S)S |
Yellow lead ocher | O=[Pb] |