If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,4-Hexadiene, (Z)- | C(C=C)C=CC |
1,5-Hexadiene diepoxide | C(CC1CO1)C2CO2 |
1,5-Hexadiene | C(C=C)CC=C |
1,5-Hexadiene, 2,5-dimethyl- | C(CC(C)=C)C(C)=C |
1,5-Hexadiene, 2-methyl- | C(CC=C)C(C)=C |
1,5-Hexadiene, 3-methyl- | C(C)(C=C)CC=C |
1,5-Hexadiene,3,4-dihydroxy- | C(O)(C=C)C(O)C=C |
1,5-Hexadiene-3,4-diol | C(O)(C=C)C(O)C=C |
1,5-Hexadiene-3,4-diol, 1,6-diphenyl- | C(=CC(O)C(O)C=Cc1ccccc1)c2ccccc2 |
1,5-Hexadiene-3,4-diol, 2,5-dimethyl- | C(O)(C(C)=C)C(O)C(C)=C |
1_4-Hexadiene__(Z)- | C(C=C)C=CC |
1_5-Hexadiene-3_4-diol__1_6-diphenyl- | C(=CC(O)C(O)C=Cc1ccccc1)c2ccccc2 |
1_5-Hexadiene-3_4-diol__2_5-dimethyl- | C(O)(C(C)=C)C(O)C(C)=C |
1_5-Hexadiene_3_4-dihydroxy- | C(O)(C=C)C(O)C=C |
1_5-Hexadiene__2-methyl- | C(CC=C)C(C)=C |
1_5-Hexadiene__2_5-dimethyl- | C(CC(C)=C)C(C)=C |
1_5-Hexadiene__3-methyl- | C(C)(C=C)CC=C |
2,4-Hexadiene | C(=CC)C=CC |
2,4-Hexadiene, 2, 5-dimethyl- | C(C=C(C)C)=C(C)C |
2,4-Hexadiene, 3, 4-bis(4-hydroxyphenyl)- | C(=CC)(c1ccc(O)cc1)C(=CC)c2ccc(O)cc2 |
2,5-Dimethyl-1,5-hexadiene | C(CC(C)=C)C(C)=C |
2,5-Dimethyl-2,4-hexadiene | C(C=C(C)C)=C(C)C |
2-Methyl-1,5-hexadiene | C(CC=C)C(C)=C |
2_4-Hexadiene | C(=CC)C=CC |
2_4-Hexadiene__2__5-dimethyl- | C(C=C(C)C)=C(C)C |
3,4-Bis(p-acetoxyphenyl)-2,4-hexadiene | C(=CC)(c1ccc(cc1)OC(C)=O)C(=CC)c2ccc(cc2)OC(C)=O |
3,4-Bis(p-hydroxyphenyl)-2,4-hexadiene | C(=CC)(c1ccc(O)cc1)C(=CC)c2ccc(O)cc2 |
3,4-Dihydroxy-1,5-hexadiene | C(O)(C=C)C(O)C=C |
ALPHA_,.omega.-Hexadiene | C(C=C)CC=C |
ALPHA__.omega.-Hexadiene | C(C=C)CC=C |
Hexadiene (DOT) | C(C=C)CC=C |