If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Aziridinecarboxamide, N,N'-1,10-decanediylbis- | C(=O)(NCCCCCCCCCCNC(=O)N1CC1)N2CC2 |
1-Aziridinecarboxamide__N_N'-1_10-decanediylbis- | C(=O)(NCCCCCCCCCCNC(=O)N1CC1)N2CC2 |
Ethanol, 2,2'-(1, 10-decanediylbis(thio))bis- | C(CCCCSCCO)CCCCCSCCO |
Ethanol__2_2'-(1__10-decanediylbis(thio))bis- | C(CCCCSCCO)CCCCCSCCO |
Guanidine, N,N'''-1,10-decanediylbis-, dihydrochloride | C(CCCCCCCCCNC(=N)N)NC(=N)N |
Guanidine__N_N'''-1_10-decanediylbis-__dihydrochloride | C(CCCCCCCCCNC(=N)N)NC(=N)N |