If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 6-Octadiene, 7-methyl-3-methylene- | C(=C)(C=C)CCC=C(C)C |
1, 7-Octadiene | C(CC=C)CCC=C |
1,6-Octadiene, 5,7-dimethyl- | C(=C(C)C)C(C)CCC=C |
1_6-Octadiene__5_7-dimethyl- | C(=C(C)C)C(C)CCC=C |
1__6-Octadiene__7-methyl-3-methylene- | C(=C)(C=C)CCC=C(C)C |
2,6-Dimethyl-2, 7-octadiene-6-ol | C(C)(O)(C=C)CCC=C(C)C |
2,6-Octadiene | C(C=CC)CC=CC |
2,6-Octadiene-4,5-diol | C(O)(C=CC)C(O)C=CC |
2-Methyl-6-methylene-2,7-octadiene | C(=C)(C=C)CCC=C(C)C |
2_6-Octadiene | C(C=CC)CC=CC |
2_6-Octadiene-4_5-diol | C(O)(C=CC)C(O)C=CC |
3,5-Octadiene, 2,2,4,5,7,7-hexamethyl-, (E,Z)- | C(=C(C)C(C)=CC(C)(C)C)C(C)(C)C |
3,5-Octadiene, 2,7-dimethyl-, (E,Z)- | C(C=CC(C)C)=CC(C)C |
3,5-Octadiene, 4,5-diethyl-, (E,Z)- | C(CC)(=CCC)C(CC)=CCC |
3-Methylene-7-methyl-1, 6-octadiene | C(=C)(C=C)CCC=C(C)C |
3_5-Octadiene__2_2_4_5_7_7-hexamethyl-__(E_Z)- | C(=C(C)C(C)=CC(C)(C)C)C(C)(C)C |
3_5-Octadiene__2_7-dimethyl-__(E_Z)- | C(C=CC(C)C)=CC(C)C |
7-Methyl-3-methylene-1,6-octadiene | C(=C)(C=C)CCC=C(C)C |
ALPHA_,.omega.-Octadiene | C(CC=C)CCC=C |
ALPHA__.omega.-Octadiene | C(CC=C)CCC=C |
Dibenzobicyclo(2.2.2)octadiene | C12CCC(c3c1cccc3)c4c2cccc4 |
cis,trans-4,5-Diethyl-3,5-octadiene | C(CC)(=CCC)C(CC)=CCC |
cis_trans-4_5-Diethyl-3_5-octadiene | C(CC)(=CCC)C(CC)=CCC |