If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2, 2'-Biphenylylene oxide | c12ccccc2Oc3c1cccc3 |
2,2'-Biphenylylene sulfide | c12ccccc2Sc3c1cccc3 |
3, 3'-Dimethyl-4,4'-biphenylylene diisocyanate | Cc1cc(ccc1N=C=O)c2ccc(N=C=O)c(C)c2 |
3,3'-Dimethoxy-4,4'-biphenylylene isocyanate | O(C)c1cc(ccc1N=C=O)c2ccc(N=C=O)c(OC)c2 |
Hydrazine, 1, 1'-(4,4'-biphenylylene)di-, dihydrochloride | N(N)c1ccc(cc1)c2ccc(NN)cc2 |
Hydrazine, 1,1'-(biphenylylene)di-, dihydrochloride | N(N)c1ccc(cc1)c2ccc(NN)cc2 |
Hydrazine__1__1'-(4_4'-biphenylylene)di-__dihydrochloride | N(N)c1ccc(cc1)c2ccc(NN)cc2 |
Isocyanic acid 3,3'-dimethoxy-4, 4'-biphenylylene ester | O(C)c1cc(ccc1N=C=O)c2ccc(N=C=O)c(OC)c2 |
Isocyanic acid, 3,3'-dimethoxy-4, 4'-biphenylylene ester | O(C)c1cc(ccc1N=C=O)c2ccc(N=C=O)c(OC)c2 |
Isocyanic acid, 3,3'-dimethyl-4, 4'-biphenylylene ester | Cc1cc(ccc1N=C=O)c2ccc(N=C=O)c(C)c2 |
Isocyanic_acid__3_3'-dimethoxy-4__4'-biphenylylene_ester | O(C)c1cc(ccc1N=C=O)c2ccc(N=C=O)c(OC)c2 |
Isocyanic_acid__3_3'-dimethyl-4__4'-biphenylylene_ester | Cc1cc(ccc1N=C=O)c2ccc(N=C=O)c(C)c2 |
Triazene, 1,1'-(4,4'-biphenylylene)bis(3,3-dimethyl- | N(=NN(C)C)c1ccc(cc1)c2ccc(N=NN(C)C)cc2 |