If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(-)-Rotenone | O=C1c2ccc3OC(Cc3c2OC4COc5cc(OC)c(OC)cc5C14)C(C)=C |
5'BETA_-Rotenone | O=C1c2ccc3OC(Cc3c2OC4COc5cc(OC)c(OC)cc5C14)C(C)=C |
ROTENONE | O=C1c2ccc3OC(Cc3c2OC4COc5cc(OC)c(OC)cc5C14)C(C)=C |
ROTENONE, DIHYDRO-DIHYDROXY- | O=C1c2ccc3OC(Cc3c2OC4COc5cc(OC)c(OC)cc5C14)C(C)(O)CO |
Rotenone | O=C1c2ccc3OC(Cc3c2OC4COc5cc(OC)c(OC)cc5C14)C(C)=C |
Rotenone, 6', 7'-dihydro-6',7'-dihydroxy- | O=C1c2ccc3OC(Cc3c2OC4COc5cc(OC)c(OC)cc5C14)C(C)(O)CO |
Rotenone, dihydro- (VAN) | O=C1c2ccc3OC(Cc3c2OC4COc5cc(OC)c(OC)cc5C14)C(C)C |