If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Amino-4-chlorodiphenyl ether | O(c1ccccc1)c2ccc(Cl)cc2N |
2-Chlorodiphenyl ether | O(c1ccccc1)c2ccccc2Cl |
2-Chlorodiphenyl | Clc1ccccc1c2ccccc2 |
4-Amino-4'-chlorodiphenyl ether | O(c1ccc(Cl)cc1)c2ccc(N)cc2 |
4-Amino-4'-chlorodiphenyl | Clc1ccc(cc1)c2ccc(N)cc2 |
4-Chlorodiphenyl ether | O(c1ccccc1)c2ccc(Cl)cc2 |
4-Chlorodiphenyl sulfide | S(c1ccccc1)c2ccc(Cl)cc2 |
4-Chlorodiphenyl sulfone | S(=O)(=O)(c1ccccc1)c2ccc(Cl)cc2 |
4-Chlorodiphenyl | Clc1ccc(cc1)c2ccccc2 |
Acetyl chloride, chlorodiphenyl- | C(Cl)(C(Cl)=O)(c1ccccc1)c2ccccc2 |
Methane, chlorodiphenyl- | C(Cl)(c1ccccc1)c2ccccc2 |
Phosphine oxide, chlorodiphenyl- | P(Cl)(=O)(c1ccccc1)c2ccccc2 |
Phosphine, chlorodiphenyl- | P(Cl)(c1ccccc1)c2ccccc2 |
Phosphine_oxide__chlorodiphenyl- | P(Cl)(=O)(c1ccccc1)c2ccccc2 |
Stannane, methylenebis(chlorodiphenyl- | [Sn](Cl)(C[Sn](Cl)(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Stannane__methylenebis(chlorodiphenyl- | [Sn](Cl)(C[Sn](Cl)(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Tin, chlorodiphenyl(8-quinolinolato-N,O)- | Cl[Sn]1(Oc2cccc3cccn1c23)(c4ccccc4)c5ccccc5 |
Tin__chlorodiphenyl(8-quinolinolato-N_O)- | Cl[Sn]1(Oc2cccc3cccn1c23)(c4ccccc4)c5ccccc5 |
o-Chlorodiphenyl | Clc1ccccc1c2ccccc2 |
p-Chlorodiphenyl oxide | O(c1ccccc1)c2ccc(Cl)cc2 |
p-Chlorodiphenyl sulfide | S(c1ccccc1)c2ccc(Cl)cc2 |
p-Chlorodiphenyl | Clc1ccc(cc1)c2ccccc2 |