If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Nitro-p-phenetidine | [N+](=O)([O-])c1cc(OCC)ccc1N |
Aceto-4-phenetidine | N(C(C)=O)c1ccc(OCC)cc1 |
N, N-Diethyl-3-phenetidine | N(CC)(CC)c1cccc(OCC)c1 |
N, N-Diethyl-m-phenetidine | N(CC)(CC)c1cccc(OCC)c1 |
N-Acetyl-p-phenetidine | N(C(C)=O)c1ccc(OCC)cc1 |
N-Lactyl-p-phenetidine | N(C(=O)C(C)O)c1ccc(OCC)cc1 |
m-Phenetidine | O(CC)c1cccc(N)c1 |
m-Phenetidine, N,N-diethyl- | N(CC)(CC)c1cccc(OCC)c1 |
o-Phenetidine | O(CC)c1ccccc1N |
o-Phenetidine, 5-methyl- | O(CC)c1ccc(C)cc1N |
p-Phenetidine | O(CC)c1ccc(N)cc1 |
p-Phenetidine, 2-nitro- | [N+](=O)([O-])c1cc(OCC)ccc1N |
p-Phenetidine, N-acetyl- | N(C(C)=O)c1ccc(OCC)cc1 |
p-Phenetidine, N-chloroacetyl- | N(C(=O)CCl)c1ccc(OCC)cc1 |