If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-Methylene-N-(m-tolyl)succinimide | O=C1CC(=C)C(=O)N1c2cccc(C)c2 |
ALPHA_-Chloro-N-(p-methoxyphenyl)succinimide | O=C1CC(Cl)C(=O)N1c2ccc(OC)cc2 |
Mercuric succinimide | O=C1CCC(=O)N1 |
N-(2-Chloroethyl)succinimide | C(CCl)N1C(=O)CCC1=O |
N-(Hydroxymethyl)succinimide | C(O)N1C(=O)CCC1=O |
N-(Trichloromethylthio)succinimide | S(N1C(=O)CCC1=O)C(Cl)(Cl)Cl |
N-(p-Chlorophenyl)succinimide | O=C1CCC(=O)N1c2ccc(Cl)cc2 |
Succinimide , N-(hydroxymethyl)- | C(O)N1C(=O)CCC1=O |
Succinimide monoxime | N(O)C1=NC(=O)CC1 |
Succinimide | O=C1CCC(=O)N1 |
Succinimide, 2,2,3,3-tetramethyl- | CC1(C)C(=O)NC(=O)C1(C)C |
Succinimide, 2-ethyl-2-methyl- | C(C)C1(C)CC(=O)NC1=O |
Succinimide, 2-methylene-N-(m-tolyl)- | O=C1CC(=C)C(=O)N1c2cccc(C)c2 |
Succinimide, 2-phthalimido- | O=C1c2ccccc2C(=O)N1C3CC(=O)NC3=O |
Succinimide, 3-chloro-N-(p-methoxyphenyl)- | O=C1CC(Cl)C(=O)N1c2ccc(OC)cc2 |
Succinimide, 3-ethyl-2-methyl-2-phenyl- | CC1(C(=O)NC(=O)C1CC)c2ccccc2 |
Succinimide, N-(hydroxymethyl)- | C(O)N1C(=O)CCC1=O |
Succinimide, N-(p-chlorophenyl)- | O=C1CCC(=O)N1c2ccc(Cl)cc2 |
Succinimide, N-(p-methoxyphenyl)-2-thio- | O=C1CCC(=S)N1c2ccc(OC)cc2 |
Succinimide, N-(p-methoxyphenyl)thio- | O=C1CCC(=S)N1c2ccc(OC)cc2 |
Succinimide, N-(trichloromethylthio)- | S(N1C(=O)CCC1=O)C(Cl)(Cl)Cl |
Succinimide, N-bromo- | BrN1C(=O)CCC1=O |
Succinimide, N-butyl- | C(CCC)N1C(=O)CCC1=O |
Succinimide, N-chloro- | ClN1C(=O)CCC1=O |
Succinimide, N-ethyl- | C(C)N1C(=O)CCC1=O |
Succinimide, N-hydroxy- | ON1C(=O)CCC1=O |
Succinimide, N-methyl- | CN1C(=O)CCC1=O |
Succinimide, N-nitro- | [N+](=O)([O-])N1C(=O)CCC1=O |
Succinimide, N-p-anisyl-2-methylene- | O=C1CC(=C)C(=O)N1c2ccc(OC)cc2 |
Succinimide, N-pentyl- | C(CCCC)N1C(=O)CCC1=O |
Succinimide, N-phenyl- | O=C1CCC(=O)N1c2ccccc2 |
Succinimide, N-phenyl-2-thio- | O=C1CCC(=S)N1c2ccccc2 |
Succinimide, N-phenylthio- | O=C1CCC(=S)N1c2ccccc2 |
Succinimide, N-propyl- | C(CC)N1C(=O)CCC1=O |
Succinimide, mercury(2+) salt | O=C1CCC(=O)N1 |
Succinimide, monooxime | N(O)C1=NC(=O)CC1 |
Succinimide-Sauba | O=C1CCC(=O)N1 |
Succinimide__N-nitro- | [N+](=O)([O-])N1C(=O)CCC1=O |