If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
WLN: QR DG CXFFF | C(F)(F)(F)c1cc(O)ccc1Cl |
WLN: QVR BMR CXFFF | N(c1cccc(c1)C(F)(F)F)c2ccccc2C(=O)O |
WLN: T56 BM DNJ CXFFF G1 H1 | C(F)(F)(F)C1=Nc2cc(C)c(C)cc2N1 |
WLN: T5MYOTJ BUS D1OR CXFFF | O(CC1CNC(=S)O1)c2cccc(c2)C(F)(F)F |
WLN: T5NTJ A2OYR&R CXFFF &QV1U1VQ -T | C(=CC(=O)O)C(=O)O.FC(F)(F)c1cccc(c1)C(OCCN2CCCC2)c3ccccc3 |
WLN: T6NTJ A3VR DF& DQ DR CXFFF | OC1(CCN(CCCC(=O)c2ccc(F)cc2)CC1)c3cccc(c3)C(F)(F)F |
WLN: WNR CXFFF | C(F)(F)(F)c1cccc(c1)[N+](=O)[O-] |
WLN: ZR CXFFF | C(F)(F)(F)c1ccc(N)cc1 |