If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Chlorobenzaldehyde | C(=O)c1ccccc1Cl |
2-Hydroxy-5-chlorobenzaldehyde | C(=O)c1cc(Cl)ccc1O |
3-Chlorobenzaldehyde | C(=O)c1cccc(Cl)c1 |
3-Nitro-6-chlorobenzaldehyde | C(=O)c1cc(ccc1Cl)[N+](=O)[O-] |
4-Chlorobenzaldehyde diethyl acetal | C(OCC)(OCC)c1ccc(Cl)cc1 |
4-Chlorobenzaldehyde oxime | C(=NO)c1ccc(Cl)cc1 |
4-Chlorobenzaldehyde | C(=O)c1ccc(Cl)cc1 |
ALPHA_-Chlorobenzaldehyde phenylhydrazone | C(Cl)(=NNc1ccccc1)c2ccccc2 |
m-Chlorobenzaldehyde | C(=O)c1cccc(Cl)c1 |
meta-Chlorobenzaldehyde | C(=O)c1cccc(Cl)c1 |
o-Chlorobenzaldehyde (1,3,7-trimethylxanthinyl)hydrazone | CN1C(=O)N(C)C(=O)C2=C1N=C(NN=Cc3ccccc3Cl)N2C |
o-Chlorobenzaldehyde oxime | C(=NO)c1ccccc1Cl |
o-Chlorobenzaldehyde | C(=O)c1ccccc1Cl |
o-Chlorobenzaldehyde-8-caffeine-hydrazone | CN1C(=O)N(C)C(=O)C2=C1N=C(NN=Cc3ccccc3Cl)N2C |
p-Chlorobenzaldehyde diethyl acetal | C(OCC)(OCC)c1ccc(Cl)cc1 |
p-Chlorobenzaldehyde o-carbamoyloxime | C(=NOC(N)=O)c1ccc(Cl)cc1 |
p-Chlorobenzaldehyde oxime | C(=NO)c1ccc(Cl)cc1 |
p-Chlorobenzaldehyde | C(=O)c1ccc(Cl)cc1 |