If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(p-Hydroxyphenyl)pyruvic acid | C(C(=O)C(=O)O)c1ccc(O)cc1 |
Indole-3-pyruvic acid | C(C(=O)C(=O)O)C1=CNc2ccccc12 |
PYRUVIC ACID | C(C)(=O)C(=O)O |
Pyruvic acid nitrile | C(C)(=O)C#N |
Pyruvic acid | C(C)(=O)C(=O)O |
Pyruvic acid, (4-hydroxy-3-methoxyphenyl)-, 2-oxime | C(c1ccc(O)c(OC)c1)C(=NO)C(=O)O |
Pyruvic acid, (4-hydroxy-3-methoxyphenyl)-, oxime | C(c1ccc(O)c(OC)c1)C(=NO)C(=O)O |
Pyruvic acid, (4-hydroxy-3-methoxyphenyl)-2-thio- | C(C(=S)C(=O)O)c1ccc(O)c(OC)c1 |
Pyruvic acid, (o-nitrophenyl)- | [N+](=O)([O-])c1ccccc1CC(=O)C(=O)O |
Pyruvic acid, (p-((2-chloroethyl)(2-fluoroethyl)amino)phenyl)- | N(CCCl)(CCF)c1ccc(cc1)C=C(O)C(=O)O |
Pyruvic acid, (p-(bis(2-chloroethyl)amino)phenyl)- | N(CCCl)(CCCl)c1ccc(cc1)CC(=O)C(=O)O |
Pyruvic acid, (p-hydroxyphenyl)- | C(C(=O)C(=O)O)c1ccc(O)cc1 |
Pyruvic acid, 3-fluoro | C(=O)(CF)C(=O)O |
Pyruvic acid, bromo- | C(=O)(CBr)C(=O)O |
Pyruvic acid, bromo-, ethyl ester | C(=O)(OCC)C(=O)CBr |
Pyruvic acid, cyanophenyl-, ethyl ester | C(C#N)(C(=O)C(=O)OCC)c1ccccc1 |
Pyruvic acid, ethyl ester | C(=O)(OCC)C(C)=O |
Pyruvic acid, ethyl ester, azine with 1,4-dimethoxy-2-butanone | C(COC)(CCOC)=NN=C(C)C(=O)OCC |
Pyruvic acid, fluoro- | C(=O)(CF)C(=O)O |
Pyruvic acid, methyl ester | C(=O)(OC)C(C)=O |
Pyruvic acid, methyl- | C(=O)(CC)C(=O)O |
Pyruvic acid, trimethyl- | C(=O)(C(=O)O)C(C)(C)C |
Pyruvic aldehyde | CC(=O)C=O |
Pyruvic_acid__(4-hydroxy-3-methoxyphenyl)-__2-oxime | C(c1ccc(O)c(OC)c1)C(=NO)C(=O)O |
Pyruvic_acid__(p-((2-chloroethyl)(2-fluoroethyl)amino)phenyl)- | N(CCCl)(CCF)c1ccc(cc1)C=C(O)C(=O)O |
Pyruvic_acid__(p-(bis(2-chloroethyl)amino)phenyl)- | N(CCCl)(CCCl)c1ccc(cc1)CC(=O)C(=O)O |
Pyruvic_acid__ethyl_ester__azine_with_1_4-dimethoxy-2-butanone | C(COC)(CCOC)=NN=C(C)C(=O)OCC |