If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Isocyanic acid 3,3'-dimethoxy-4, 4'-biphenylene ester | O(C)c1cc(ccc1N=C=O)c2ccc(N=C=O)c(OC)c2 |
Isocyanic acid 3,3'-dimethoxy-4, 4'-biphenylylene ester | O(C)c1cc(ccc1N=C=O)c2ccc(N=C=O)c(OC)c2 |
Isocyanic acid dimer | N(C=O)C(N)=O |
Isocyanic acid ethyl ester | N(CC)=C=O |
Isocyanic acid, 1,5-naphthylene ester | N(=C=O)c1cccc2c(N=C=O)cccc12 |
Isocyanic acid, 1-naphthyl ester | N(=C=O)c1cccc2ccccc12 |
Isocyanic acid, 2, 5-dichlorophenyl ester | N(=C=O)c1cc(Cl)ccc1Cl |
Isocyanic acid, 2-chloroethyl ester | C(CCl)N=C=O |
Isocyanic acid, 3, 4-dichlorophenyl ester | N(=C=O)c1ccc(Cl)c(Cl)c1 |
Isocyanic acid, 3,3'-dimethoxy-4, 4'-biphenylene ester | O(C)c1cc(ccc1N=C=O)c2ccc(N=C=O)c(OC)c2 |
Isocyanic acid, 3,3'-dimethoxy-4, 4'-biphenylylene ester | O(C)c1cc(ccc1N=C=O)c2ccc(N=C=O)c(OC)c2 |
Isocyanic acid, 3,3'-dimethyl-4, 4'-biphenylene ester | Cc1cc(ccc1N=C=O)c2ccc(N=C=O)c(C)c2 |
Isocyanic acid, 3,3'-dimethyl-4, 4'-biphenylylene ester | Cc1cc(ccc1N=C=O)c2ccc(N=C=O)c(C)c2 |
Isocyanic acid, 4-methyl-m-phenylene ester | N(=C=O)c1cc(N=C=O)ccc1C |
Isocyanic acid, allyl ester | C(C=C)N=C=O |
Isocyanic acid, cyclohexyl ester | N(=C=O)C1CCCCC1 |
Isocyanic acid, diester with 1,6-hexanediol | C(CCN=C=O)CCCN=C=O |
Isocyanic acid, ester with O, O'-dimethoxybiphenyl | O(C)c1cc(ccc1N=C=O)c2ccc(N=C=O)c(OC)c2 |
Isocyanic acid, ester with di-o-toluenemethane | C(c1ccc(N=C=O)c(C)c1)c2ccc(N=C=O)c(C)c2 |
Isocyanic acid, ester with diphenylmethane | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
Isocyanic acid, ethyl ester | N(CC)=C=O |
Isocyanic acid, hexamethylene ester | C(CCN=C=O)CCCN=C=O |
Isocyanic acid, m-(fluorosulfonyl)phenyl ester | S(F)(=O)(=O)c1cccc(N=C=O)c1 |
Isocyanic acid, m-chlorophenyl ester | N(=C=O)c1cccc(Cl)c1 |
Isocyanic acid, m-nitrophenyl ester | N(=C=O)c1cccc(c1)[N+](=O)[O-] |
Isocyanic acid, m-phenylene ester | N(=C=O)c1cccc(N=C=O)c1 |
Isocyanic acid, methyl ester | C(=O)=NC |
Isocyanic acid, methylenebis(2-methyl-p-phenylene) ester | C(c1ccc(N=C=O)c(C)c1)c2ccc(N=C=O)c(C)c2 |
Isocyanic acid, methylenedi-p-phenylene ester | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
Isocyanic acid, methylphenylene ester | N(=C=O)c1cc(N=C=O)ccc1C |
Isocyanic acid, o-chlorophenyl ester | N(=C=O)c1ccccc1Cl |
Isocyanic acid, o-ethoxyphenyl ester | N(=C=O)c1ccccc1OCC |
Isocyanic acid, o-nitrophenyl ester | [N+](=O)([O-])c1ccccc1N=C=O |
Isocyanic acid, octadecyl ester | C(CCCCCCCCCC)CCCCCCCN=C=O |
Isocyanic acid, p-(phenylazo)phenyl ester | N(=Nc1ccccc1)c2ccc(N=C=O)cc2 |
Isocyanic acid, p-bromophenyl ester | N(=C=O)c1ccc(Br)cc1 |
Isocyanic acid, p-chlorophenyl ester | N(=C=O)c1ccc(Cl)cc1 |
Isocyanic acid, p-methoxyphenyl ester | N(=C=O)c1ccc(OC)cc1 |
Isocyanic acid, p-nitrophenyl ester | [N+](=O)([O-])c1ccc(N=C=O)cc1 |
Isocyanic acid, p-phenylene ester | N(=C=O)c1ccc(N=C=O)cc1 |
Isocyanic acid, phenyl ester | N(=C=O)c1ccccc1 |
Isocyanic acid, potassium salt | C(#N)O |
Isocyanic acid, propyl ester | C(CC)N=C=O |
Isocyanic_acid__1-naphthyl_ester | N(=C=O)c1cccc2ccccc12 |
Isocyanic_acid__1_5-naphthylene_ester | N(=C=O)c1cccc2c(N=C=O)cccc12 |
Isocyanic_acid__2-chloroethyl_ester | C(CCl)N=C=O |
Isocyanic_acid__2__5-dichlorophenyl_ester | N(=C=O)c1cc(Cl)ccc1Cl |
Isocyanic_acid__3_3'-dimethoxy-4__4'-biphenylylene_ester | O(C)c1cc(ccc1N=C=O)c2ccc(N=C=O)c(OC)c2 |
Isocyanic_acid__3_3'-dimethyl-4__4'-biphenylylene_ester | Cc1cc(ccc1N=C=O)c2ccc(N=C=O)c(C)c2 |
Isocyanic_acid__3__4-dichlorophenyl_ester | N(=C=O)c1ccc(Cl)c(Cl)c1 |
Isocyanic_acid__4-methyl-m-phenylene_ester | N(=C=O)c1cc(N=C=O)ccc1C |
Isocyanic_acid__allyl_ester | C(C=C)N=C=O |
Isocyanic_acid__cyclohexyl_ester | N(=C=O)C1CCCCC1 |
Isocyanic_acid__diester_with_1_6-hexanediol | C(CCN=C=O)CCCN=C=O |
Isocyanic_acid__ethyl_ester | N(CC)=C=O |
Isocyanic_acid__m-(fluorosulfonyl)phenyl_ester | S(F)(=O)(=O)c1cccc(N=C=O)c1 |
Isocyanic_acid__m-chlorophenyl_ester | N(=C=O)c1cccc(Cl)c1 |
Isocyanic_acid__m-nitrophenyl_ester | N(=C=O)c1cccc(c1)[N+](=O)[O-] |
Isocyanic_acid__m-phenylene_ester | N(=C=O)c1cccc(N=C=O)c1 |
Isocyanic_acid__methylenebis(2-methyl-p-phenylene)_ester | C(c1ccc(N=C=O)c(C)c1)c2ccc(N=C=O)c(C)c2 |
Isocyanic_acid__methylenedi-p-phenylene_ester | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
Isocyanic_acid__o-chlorophenyl_ester | N(=C=O)c1ccccc1Cl |
Isocyanic_acid__o-ethoxyphenyl_ester | N(=C=O)c1ccccc1OCC |
Isocyanic_acid__o-nitrophenyl_ester | [N+](=O)([O-])c1ccccc1N=C=O |
Isocyanic_acid__octadecyl_ester | C(CCCCCCCCCC)CCCCCCCN=C=O |
Isocyanic_acid__p-(phenylazo)phenyl_ester | N(=Nc1ccccc1)c2ccc(N=C=O)cc2 |
Isocyanic_acid__p-bromophenyl_ester | N(=C=O)c1ccc(Br)cc1 |
Isocyanic_acid__p-chlorophenyl_ester | N(=C=O)c1ccc(Cl)cc1 |
Isocyanic_acid__p-methoxyphenyl_ester | N(=C=O)c1ccc(OC)cc1 |
Isocyanic_acid__p-nitrophenyl_ester | [N+](=O)([O-])c1ccc(N=C=O)cc1 |
Isocyanic_acid__p-phenylene_ester | N(=C=O)c1ccc(N=C=O)cc1 |
Isocyanic_acid__phenyl_ester | N(=C=O)c1ccccc1 |
Isocyanic_acid__propyl_ester | C(CC)N=C=O |