If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Quinolinemethanol | C(O)c1ccc2ccccc2n1 |
2-Quinolinemethanol, 4-nitro-, 1-oxide | [N+](=O)([O-])c1cc(CO)n(=O)c2ccccc12 |
2-Quinolinemethanol__4-nitro-__1-oxide | [N+](=O)([O-])c1cc(CO)n(=O)c2ccccc12 |
4-Quinolinemethanol | C(O)c1ccnc2ccccc12 |
7-Quinolinemethanol | C(O)c1ccc2cccnc2c1 |
7-Quinolinemethanol, 8-hydroxy-5-methyl- | Oc1c(CO)cc(C)c2cccnc12 |
7-Quinolinemethanol__8-hydroxy-5-methyl- | Oc1c(CO)cc(C)c2cccnc12 |
8-Hydroxy-5-methyl-7-quinolinemethanol | Oc1c(CO)cc(C)c2cccnc12 |