If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Carbamic acid, dimethyldithio- sodium salt | C(=S)(S)N(C)C |
Carbamic acid, dimethyldithio-, (dimethylamino)methyl ester | C(=S)(SCN(C)C)N(C)C |
Carbamic acid, dimethyldithio-, 2,4-dinitrophenyl ester | [N+](=O)([O-])c1cc(ccc1SC(=S)N(C)C)[N+](=O)[O-] |
Carbamic acid, dimethyldithio-, 2-benzothiazolyl ester | S(C(=S)N(C)C)C1=Nc2ccccc2S1 |
Carbamic acid, dimethyldithio-, anhydrosulfide | C(=S)(SC(=S)N(C)C)N(C)C |
Carbamic acid, dimethyldithio-, bismuth salt | N(C)(C)C1=S[Bi]234(S1)SC(=S2)N(C)C.CN(C)C(S3)=S4 |
Carbamic acid, dimethyldithio-, bismuth(3+) salt | N(C)(C)C1=S[Bi]234(S1)SC(=S2)N(C)C.CN(C)C(S3)=S4 |
Carbamic acid, dimethyldithio-, compd. with dimethylamine (1:1) | N(C)C.S=C(S)N(C)C |
Carbamic acid, dimethyldithio-, dimethylamine salt (1:1) | N(C)C.S=C(S)N(C)C |
Carbamic acid, dimethyldithio-, manganese(2+) salt | N(C)(C)C1=S[Mn]2(S1)SC(=S2)N(C)C |
Carbamic acid, dimethyldithio-, methyl ester | C(=S)(SC)N(C)C |
Carbamic acid, dimethyldithio-, methylene ester | C(=S)(SCSC(=S)N(C)C)N(C)C |
Carbamic acid, dimethyldithio-, piperidinomethyl ester | C(SC(=S)N(C)C)N1CCCCC1 |
Carbamic acid, dimethyldithio-, sodium salt | C(=S)(S)N(C)C |
Carbamic acid, dimethyldithio-, zinc salt (2:1) | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Carbamic_acid__dimethyldithio-__piperidinomethyl_ester | C(SC(=S)N(C)C)N1CCCCC1 |
N, N-(Dimethyldithio)carbamic acid (dimethylamino)methyl ester | C(=S)(SCN(C)C)N(C)C |
Oxamide, N,N'-dimethyldithio- | C(=S)(NC)C(=S)NC |