If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
WLN: T5NNVJ A1 BR& DMVH E1 | O=C1C(NC=O)=C(C)N(C)N1c2ccccc2 |
WLN: T5NNVJ A1 BR& DMYUS&MR& E1 | O=C1C(NC(=S)Nc2ccccc2)=C(C)N(C)N1c3ccccc3 |
WLN: T5NNVJ A1 BR& DN1&1 E1 | O=C1C(N(C)C)=C(C)N(C)N1c2ccccc2 |
WLN: T5NNVJ A1 BR& E1 | CN1C(C)=CC(=O)N1c2ccccc2 |
WLN: T6N DOTJ B1 CR& A1- DT5NNVJ A1 BR E1 | O=C1C(CN2CCOC(C2C)c3ccccc3)=C(C)N(C)N1c4ccccc4 |
WLN: T6NNVJ BR& DG EG | O=C1C(Cl)=C(Cl)C=NN1c2ccccc2 |