If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Unox 201 | C(=O)(OCC1CC2OC2CC1C)C3CC4OC4CC3C |
Unox 207 | C12C3OC3CC2C4CC1C5OC45 |
Unox 207X | C12C3OC3CC2C4CC1C5OC45 |
Unox 269 | CC12CCC(CC1O2)C3(C)CO3 |
Unox 4206 | C12OC1CCC(C2)C3CO3 |
Unox Epoxide 201 | C(=O)(OCC1CC2OC2CC1C)C3CC4OC4CC3C |
Unox Epoxide 206 | C12OC1CCC(C2)C3CO3 |
Unox Epoxide 269 | CC12CCC(CC1O2)C3(C)CO3 |
Unox epoxide 206 | C12OC1CCC(C2)C3CO3 |
Unox epoxide 207 | C12C3OC3CC2C4CC1C5OC45 |