If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(1, 1'-Bicyclohexyl)-2-ol, triester with boric acid (H3BO3) | O(B(OC1CCCCC1C2CCCCC2)OC3CCCCC3C4CCCCC4)C5CCCCC5C6CCCCC6 |
(1,1'-Bicyclohexyl)-2-amine | NC1CCCCC1C2CCCCC2 |
(1,1'-Bicyclohexyl)-2-ol | OC1CCCCC1C2CCCCC2 |
(1,1'-Bicyclohexyl)-2-one | O=C1CCCCC1C2CCCCC2 |
(1,1'-Bicyclohexyl)-4-ol | OC1CCC(CC1)C2CCCCC2 |
(1,1'-Bicyclohexyl)-4-one | O=C1CCC(CC1)C2CCCCC2 |
(1_1'-Bicyclohexyl)-2-amine | NC1CCCCC1C2CCCCC2 |
(1_1'-Bicyclohexyl)-4-ol | OC1CCC(CC1)C2CCCCC2 |
(1_1'-Bicyclohexyl)-4-one | O=C1CCC(CC1)C2CCCCC2 |
(1__1'-Bicyclohexyl)-2-ol__triester_with_boric_acid_(H3BO3) | O(B(OC1CCCCC1C2CCCCC2)OC3CCCCC3C4CCCCC4)C5CCCCC5C6CCCCC6 |
(Bicyclohexyl)-2-amine | NC1CCCCC1C2CCCCC2 |
(Bicyclohexyl)-2-ol | OC1CCCCC1C2CCCCC2 |
(Bicyclohexyl)-2-ol, triester with boric acid (H3BO3) | O(B(OC1CCCCC1C2CCCCC2)OC3CCCCC3C4CCCCC4)C5CCCCC5C6CCCCC6 |
(Bicyclohexyl)-4-amine | NC1CCC(CC1)C2CCCCC2 |
(Bicyclohexyl)-4-ol | OC1CCC(CC1)C2CCCCC2 |
1,1'-Bicyclohexyl | C1(CCCCC1)C2CCCCC2 |
1,1'-Bicyclohexyl, 2-(1-methylethyl)- | C(C)(C)C1CCCCC1C2CCCCC2 |
1,1'-Bicyclohexyl, 2-methyl- | CC1CCCCC1C2CCCCC2 |
1-(o-Bicyclohexyl)-2-thio-4,4,6-trimethyl dihydropyrimidine | CC1=CC(C)(C)NC(=S)N1C2CCCCC2C3CCCCC3 |
1_1'-Bicyclohexyl__2-(1-methylethyl)- | C(C)(C)C1CCCCC1C2CCCCC2 |
1_1'-Bicyclohexyl__2-methyl- | CC1CCCCC1C2CCCCC2 |
Bicyclohexyl | C1(CCCCC1)C2CCCCC2 |
Butyric acid, (bicyclohexyl)-4-yl ester | O(C(=O)CCC)C1CCC(CC1)C2CCCCC2 |