If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,2,3-Propanetricarboxylic acid, 2-hydroxy-, indium(3+) salt (3:1) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |
1_2_3-Propanetricarboxylic_acid__2-hydroxy-__indium(3+)_salt_(3:1) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |
Acetic acid, indium(3+) salt | C(C)(=O)O |
Acetic_acid__indium(3+)_salt | C(C)(=O)O |
Indium acetate | C(C)(=O)O |
Indium acetylacetonate | CC1=O[In]234(O=C(C)C1)O=C(C)CC(C)=O2.CC(CC(C)=O4)=O3 |
Indium citrate | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |
Indium hydroxide (In(OH)3) | [In](O)(O)O |
Indium hydroxide (VAN) | [In](O)(O)O |
Indium nitrate (In(NO3)3) | N(O)(O)O |
Indium nitrate | N(O)(O)O |
Indium nitrate, In(NO3)2 | N(O)(O)O |
Indium sulfate (In2(SO4)3) | S(=O)(=O)(O)O |
Indium sulfate (VAN) | S(=O)(=O)(O)O |
Indium sulfate, In2(SO4)3 | S(=O)(=O)(O)O |
Indium triacetate | C(C)(=O)O |
Indium trihydroxide | [In](O)(O)O |
Indium trinitrate | N(O)(O)O |
Indium tris(acetylacetonate) | CC1=O[In]234(O=C(C)C1)O=C(C)CC(C)=O2.CC(CC(C)=O4)=O3 |
Indium(3+) sulfate | S(=O)(=O)(O)O |
Indium, tris(2,4-pentanedionato)- | CC1=O[In]234(O=C(C)C1)O=C(C)CC(C)=O2.CC(CC(C)=O4)=O3 |
Indium, tris(2,4-pentanedionato-O,O')-, (OC-6-11)- | CC1=O[In]234(O=C(C)C1)O=C(C)CC(C)=O2.CC(CC(C)=O4)=O3 |
Indium, tris(acetylacetonato)- | CC1=O[In]234(O=C(C)C1)O=C(C)CC(C)=O2.CC(CC(C)=O4)=O3 |
Indium__tris(2_4-pentanedionato-O_O')-__(OC-6-11)- | CC1=O[In]234(O=C(C)C1)O=C(C)CC(C)=O2.CC(CC(C)=O4)=O3 |
Indium_hydroxide_(In(OH)3) | [In](O)(O)O |
Indium_nitrate__In(NO3)2 | N(O)(O)O |
Nitric acid, indium(3+) salt | N(O)(O)O |
Nitric_acid__indium(3+)_salt | N(O)(O)O |
Sulfuric acid, indium salt | S(=O)(=O)(O)O |
Sulfuric acid, indium(3+) salt (3:2) | S(=O)(=O)(O)O |
Sulfuric_acid__indium(3+)_salt_(3:2) | S(=O)(=O)(O)O |
Tris(2,4-pentanedionato)indium | CC1=O[In]234(O=C(C)C1)O=C(C)CC(C)=O2.CC(CC(C)=O4)=O3 |
Tris(acetylacetonato)indium | CC1=O[In]234(O=C(C)C1)O=C(C)CC(C)=O2.CC(CC(C)=O4)=O3 |
Tris(acetylacetonato)indium(III) | CC1=O[In]234(O=C(C)C1)O=C(C)CC(C)=O2.CC(CC(C)=O4)=O3 |