If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Ethylpyridine 1-oxide | C(C)c1ccccn1=O |
2-Ethylpyridine N-oxide | C(C)c1ccccn1=O |
2-Ethylpyridine | C(C)c1ccccn1 |
2-Methyl-5-ethylpyridine | C(C)c1ccc(C)nc1 |
2-Vinyl-5-ethylpyridine | C(C)c1ccc(C=C)nc1 |
4-Ethylpyridine | C(C)c1ccncc1 |
4-Methyl-3-ethylpyridine | C(C)c1cnccc1C |
6-Methyl-3-ethylpyridine | C(C)c1ccc(C)nc1 |
ALPHA_-Ethylpyridine | C(C)c1ccccn1 |
BETA_-Trichlorosilyl-2-ethylpyridine | C(C[Si](Cl)(Cl)Cl)c1ccccn1 |
Copper, dichlorobis(4-ethylpyridine)- | [Cu](Cl)(Cl)(n1ccc(CC)cc1)n2ccc(CC)cc2 |
Copper__dichlorobis(4-ethylpyridine)- | [Cu](Cl)(Cl)(n1ccc(CC)cc1)n2ccc(CC)cc2 |
GAMMA_-Ethylpyridine | C(C)c1ccncc1 |