If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1-Propene, 3-isocyanato- | C(C=C)N=C=O |
3-Isocyanato-1-propene | C(C=C)N=C=O |
Acetic acid, isocyanato-, butyl ester | O(CCCC)C(=O)CN=C=O |
Acetic acid, isocyanato-, ethyl ester | C(=O)(OCC)CN=C=O |
Acetic_acid__isocyanato-__butyl_ester | O(CCCC)C(=O)CN=C=O |
Acetic_acid__isocyanato-__ethyl_ester | C(=O)(OCC)CN=C=O |
Benzene, 1,1'-methylenebis(4-isocyanato- | C(c1ccc(N=C=O)cc1)c2ccc(N=C=O)cc2 |
Benzene, 1,1'-methylenebis(4-isocyanato-3-methyl- | C(c1ccc(N=C=O)c(C)c1)c2ccc(N=C=O)c(C)c2 |
Benzene, 1,2-dichloro-4-isocyanato- | N(=C=O)c1ccc(Cl)c(Cl)c1 |
Benzene, 1,4-dichloro-2-isocyanato- | N(=C=O)c1cc(Cl)ccc1Cl |
Benzene, 1-bromo-4-isocyanato- | N(=C=O)c1ccc(Br)cc1 |
Benzene, 1-chloro-2-isocyanato- | N(=C=O)c1ccccc1Cl |
Benzene, 1-chloro-3-isocyanato- | N(=C=O)c1cccc(Cl)c1 |
Benzene, 1-chloro-4-isocyanato- | N(=C=O)c1ccc(Cl)cc1 |
Benzene, 1-ethoxy-2-isocyanato- | N(=C=O)c1ccccc1OCC |
Benzene, 1-isocyanato-2-nitro- | [N+](=O)([O-])c1ccccc1N=C=O |
Benzene, 1-isocyanato-3-nitro- | N(=C=O)c1cccc(c1)[N+](=O)[O-] |
Benzene, 1-isocyanato-4-methoxy- | N(=C=O)c1ccc(OC)cc1 |
Benzene, 1-isocyanato-4-nitro- | [N+](=O)([O-])c1ccc(N=C=O)cc1 |
Benzene, 2-isocyanato-1,3-dimethyl- | N(=C=O)c1c(C)cccc1C |
Benzene, 2-isocyanato-1,4-dimethyl- | N(=C=O)c1cc(C)ccc1C |
Benzene, 2-isocyanato-1-methyl-4-nitro- | N(=C=O)c1cc(ccc1C)[N+](=O)[O-] |
Benzene, 4-isocyanato-1-methyl-2-nitro- | [N+](=O)([O-])c1cc(N=C=O)ccc1C |
Benzene, isocyanato- | N(=C=O)c1ccccc1 |
Benzene__2-isocyanato-1-methyl-4-nitro- | N(=C=O)c1cc(ccc1C)[N+](=O)[O-] |
Benzene__2-isocyanato-1_3-dimethyl- | N(=C=O)c1c(C)cccc1C |
Benzene__2-isocyanato-1_4-dimethyl- | N(=C=O)c1cc(C)ccc1C |
Benzene__4-isocyanato-1-methyl-2-nitro- | [N+](=O)([O-])c1cc(N=C=O)ccc1C |
Benzenesulfonyl fluoride, 3-isocyanato- | S(F)(=O)(=O)c1cccc(N=C=O)c1 |
Cyclohexane, isocyanato- | N(=C=O)C1CCCCC1 |
Ethane, 1-chloro-2-isocyanato- | C(CCl)N=C=O |
Ethane, isocyanato- | N(CC)=C=O |
Methane, isocyanato- | C(=O)=NC |
Naphthalene, 1-isocyanato- | N(=C=O)c1cccc2ccccc12 |
Naphthalene, 2-isocyanato- | N(=C=O)c1ccc2ccccc2c1 |
Naphthalene__2-isocyanato- | N(=C=O)c1ccc2ccccc2c1 |
Octadecane, 1-isocyanato- | C(CCCCCCCCCC)CCCCCCCN=C=O |
Propane, 1-isocyanato- | C(CC)N=C=O |
Propene, 3-isocyanato- | C(C=C)N=C=O |
Toluene, 5,5'-methylenebis(2-isocyanato- | C(c1ccc(N=C=O)c(C)c1)c2ccc(N=C=O)c(C)c2 |