If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Nitrophenyl trifluoroacetate | O(c1ccc(cc1)[N+](=O)[O-])C(=O)C(F)(F)F |
Allyl trifluoroacetate | C(=O)(OCC=C)C(F)(F)F |
Ammonium trifluoroacetate | C(F)(F)(F)C(=O)O |
Butyl trifluoroacetate | C(=O)(OCCCC)C(F)(F)F |
Cholest-5-en-3-ol (3BETA_)-, trifluoroacetate | CC12CCC(OC(=O)C(F)(F)F)CC2=CCC3C1CCC4(C)C(CCC34)C(C)CCCC(C)C |
Cholest-5-en-3-ol_(3BETA_)-__trifluoroacetate | CC12CCC(OC(=O)C(F)(F)F)CC2=CCC3C1CCC4(C)C(CCC34)C(C)CCCC(C)C |
Cholesterol O-trifluoroacetate | CC12CCC(OC(=O)C(F)(F)F)CC2=CCC3C1CCC4(C)C(CCC34)C(C)CCCC(C)C |
Cholesterol, trifluoroacetate | CC12CCC(OC(=O)C(F)(F)F)CC2=CCC3C1CCC4(C)C(CCC34)C(C)CCCC(C)C |
Ethyl trifluoroacetate | C(=O)(OCC)C(F)(F)F |
Silver mono(trifluoroacetate) | C(F)(F)(F)C(=O)O |
Silver trifluoroacetate | C(F)(F)(F)C(=O)O |
Silver(1+) trifluoroacetate | C(F)(F)(F)C(=O)O |
Sodium trifluoroacetate | C(F)(F)(F)C(=O)O |
Trifluoroacetate sodium | C(F)(F)(F)C(=O)O |
p-Nitrophenyl trifluoroacetate | O(c1ccc(cc1)[N+](=O)[O-])C(=O)C(F)(F)F |