If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Benzylamine, N,N-dimethyl-, compd. with borane (1:1) | C(c1ccccc1)N(B)(C)C |
Borane, (bis(2-chloroethyl)amino)bis(o-hydroxyphenoxy)- | B(Oc1ccccc1O)(Oc2ccccc2O)N(CCCl)CCCl |
Borane, compd. with N, N-dimethylmethanamine (1:1) | BN(C)(C)C |
Borane, compd. with dimethylamine (1:1) | BN(C)C |
Borane, compd. with morpholine | BN1CCOCC1 |
Borane, compd. with pyridine | Bn1ccccc1 |
Borane, compd. with trimethylamine (1:1) | BN(C)(C)C |
Borane, complex with triethylamine(1:1) | N(B)(CC)(CC)CC |
Borane, dichlorophenyl- | B(Cl)(Cl)c1ccccc1 |
Borane, tributoxy- | B(OCCCC)(OCCCC)OCCCC |
Borane, triethoxy- | B(OCC)(OCC)OCC |
Borane, trifluoro-, monoammoniate | B(F)(F)(F)N |
Borane, trimesityl- | B(c1c(C)cc(C)cc1C)(c2c(C)cc(C)cc2C)c3c(C)cc(C)cc3C |
Borane, tris(2,4,6-trimethylphenyl)- | B(c1c(C)cc(C)cc1C)(c2c(C)cc(C)cc2C)c3c(C)cc(C)cc3C |
Borane, tris(bis(2-chloroethyl)amino)- | B(N(CCCl)CCCl)(N(CCCl)CCCl)N(CCCl)CCCl |
Borane, tris(decyloxy)- | B(OCCCCCCCCCC)(OCCCCCCCCCC)OCCCCCCCCCC |
Borane__compd._with_N__N-dimethylmethanamine_(1:1) | BN(C)(C)C |
Borane__dichlorophenyl- | B(Cl)(Cl)c1ccccc1 |
Borane__trifluoro-__monoammoniate | B(F)(F)(F)N |
Borane__tris(2_4_6-trimethylphenyl)- | B(c1c(C)cc(C)cc1C)(c2c(C)cc(C)cc2C)c3c(C)cc(C)cc3C |
Dimethylamine borane | BN(C)C |
Dimethylamine compound with borane (1:1) | BN(C)C |
Dimethylamine, compd. with borane (1:1) | BN(C)C |
Ethylenediamine, compd. with borane (1:2) | N(B)CCNB |
Hexamethylenetetramine, compd. with borane (1:1) | BN12CN3CN(C1)CN(C2)C3 |
Morpholine, compd. with borane (1:1) | BN1CCOCC1 |
Pyridine borane | Bn1ccccc1 |
Pyridine, compd. with borane (1:1) | Bn1ccccc1 |
Pyridine-borane | Bn1ccccc1 |
Triethylamine base borane adduct | N(B)(CC)(CC)CC |
Triethylamine borane | N(B)(CC)(CC)CC |
Triethylamine compound with borane (1:1) | N(B)(CC)(CC)CC |
Triethylamine, compd. with borane (1:1) | N(B)(CC)(CC)CC |
Triethylamine, complex with borane (1:1) | N(B)(CC)(CC)CC |
Triethylamine-borane 1 to 1 complex | N(B)(CC)(CC)CC |
Triethylamine-borane | N(B)(CC)(CC)CC |
Trimethylamine borane | BN(C)(C)C |
Trimethylamine, compd. with borane (1:1) | BN(C)(C)C |
Tris(allyloxy)borane | B(OCC=C)(OCC=C)OCC=C |
Tris(butoxy)borane | B(OCCCC)(OCCCC)OCCCC |
Tris(decyloxy)borane | B(OCCCCCCCCCC)(OCCCCCCCCCC)OCCCCCCCCCC |
Tris(propoxy)borane | B(OCCC)(OCCC)OCCC |
Tris(tert-butyloxy)borane | O(B(OC(C)(C)C)OC(C)(C)C)C(C)(C)C |
tert-Butylamine borane | N(B)C(C)(C)C |
tert-Butylamine, compd. with borane (1:1) | N(B)C(C)(C)C |
tert-Butylamine-borane (1:1) | N(B)C(C)(C)C |