If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(2-Piperidyl)-ethyleneglycol | C(O)(CO)C1CCCCN1 |
Di(ethyleneglycol) ethyl ether phthalate | C(=O)(OCCOCCOCC)c1ccccc1C(=O)OCCOCCOCC |
Ethyleneglycol dibenzenesulfonate | S(=O)(=O)(OCCOS(=O)(=O)c1ccccc1)c2ccccc2 |
Ethyleneglycol monobenzoate | C(=O)(OCCO)c1ccccc1 |
Ethyleneglycol monophenyl ether propionate | O(CCOC(=O)CC)c1ccccc1 |
Ethyleneglycol_monophenyl_ether_propionate | O(CCOC(=O)CC)c1ccccc1 |
Phenylacetaldehyde ethyleneglycol acetal | C(c1ccccc1)C2OCCO2 |
Phenylacetaldehyde_ethyleneglycol_acetal | C(c1ccccc1)C2OCCO2 |
Poly(ethyleneglycol) 6000 | C(O)CO |