If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 6-Bis(2-hydroxyethyl)hexane | C(CCCCO)CCCCCO |
1, 6-Bis(5-(p-chlorophenyl)biguandino)hexane diacetate | C(C)(=O)O.Clc1ccc(cc1)NC(=N)NC(=N)NCCCCCCNC(=N)NC(=N)Nc2ccc(Cl)cc2 |
1, 6-Bis(p-chlorophenylbiguanido)hexane diacetate | C(C)(=O)O.Clc1ccc(cc1)NC(=N)NC(=N)NCCCCCCNC(=N)NC(=N)Nc2ccc(Cl)cc2 |
1, 6-Diamino-n-hexane | C(CCN)CCCN |
1,1,6,6-(Tetracyclohexyl)hexane | C(CCCCC(C1CCCCC1)C2CCCCC2)(C3CCCCC3)C4CCCCC4 |
1,6-Bis(9 fluorenyldimethyl-ammonium)hexane bromide | N(C)(C)(CCCCCCN(C)(C)C1c2ccccc2c3ccccc13)C4c5ccccc5c6ccccc46 |
1,6-Dibromo-n-hexane | C(CCBr)CCCBr |
1__6-Bis(2-hydroxyethyl)hexane | C(CCCCO)CCCCCO |
2,5-Dimethyl-2, 5-bis(tert-butyldioxy)hexane | C(C)(C)(OOC(C)(C)C)CCC(C)(C)OOC(C)(C)C |
2,5-Dimethyl-2, 5-bis(tert-butylhydroperoxy)hexane | C(C)(C)(OOC(C)(C)C)CCC(C)(C)OOC(C)(C)C |
2,5-Dimethyl-2, 5-bis(tert-butylperoxy)hexane | C(C)(C)(OOC(C)(C)C)CCC(C)(C)OOC(C)(C)C |
2,5-Dimethyl-2, 5-di(tert-butylperoxy)hexane | C(C)(C)(OOC(C)(C)C)CCC(C)(C)OOC(C)(C)C |
3, 4-Di(p-methoxyphenyl)hexane | C(CC)(c1ccc(OC)cc1)C(CC)c2ccc(OC)cc2 |
3,3'-Oxydi-6-oxabicyclo(3.1.0)hexane | O(C1CCC2OC12)C3CCC4OC34 |
3,4-Bis(p-hydroxyphenyl)hexane | C(CC)(c1ccc(O)cc1)C(CC)c2ccc(O)cc2 |
3,6-Dioxabicyclo(3.1.0)hexane | C12OC1COC2 |
3_6-Dioxabicyclo(3.1.0)hexane | C12OC1COC2 |
6-Oxa-3-thiabicyclo(3.1.0)hexane 3,3-dioxide | O=S1(=O)CC2OC2C1 |
6-Oxa-3-thiabicyclo(3.1.0)hexane, 3,3-dioxide | O=S1(=O)CC2OC2C1 |
6-Oxa-3-thiabicyclo(3.1.0)hexane__3_3-dioxide | O=S1(=O)CC2OC2C1 |
6-Oxabicyclo(3.1.0)hexane | C12OC1CCC2 |
6-Oxabicyclo(3.1.0)hexane, 2,2'-oxybis- | O(C1CCC2OC12)C3CCC4OC34 |
6-Oxabicyclo(3.1.0)hexane__2_2'-oxybis- | O(C1CCC2OC12)C3CCC4OC34 |
6-Thiabicyclo(3.1.0)hexane | C12SC1CCC2 |
ALPHA_, .omega.-Bis(trimethyl ammonium)hexane dibromide | C(CCCCCN(C)(C)C)N(C)(C)C |
ALPHA_,.omega.-Bis(trimethylammonium)hexane dichloride | C(CCCCCN(C)(C)C)N(C)(C)C |
Bicyclo(3.1.0)hexane, 4-methylene-1-(1-methylethyl)- | C(C)(C)C12CCC(=C)C1C2 |
Bicyclo(3.1.0)hexane-6-methanol | C(O)C1C2CCCC12 |
Bicyclo(3.1.0)hexane__4-methylene-1-(1-methylethyl)- | C(C)(C)C12CCC(=C)C1C2 |
GAMMA_, DELTA_-Di(p-hydroxyphenyl)hexane | C(CC)(c1ccc(O)cc1)C(CC)c2ccc(O)cc2 |
GAMMA_,DELTA_-Di(p-hydroxyphenyl)-hexane | C(CC)(c1ccc(O)cc1)C(CC)c2ccc(O)cc2 |
Hexane 1,6-diisocyanate | C(CCN=C=O)CCCN=C=O |
Hexane | C(CC)CCC |
Hexane, 1, 1'-(ethylidenebis(oxy))bis- | C(C)(OCCCCCC)OCCCCCC |
Hexane, 1,1'-oxybis- | O(CCCCCC)CCCCCC |
Hexane, 1,1'-selenobis- | [Se](CCCCCC)CCCCCC |
Hexane, 1,1'-thiobis- | S(CCCCCC)CCCCCC |
Hexane, 1,1,6,6-tetraphenyl- | C(CCCCC(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Hexane, 1,2-epoxy- | C(CCC)C1CO1 |
Hexane, 1,2:5,6-diepoxy- | C(CC1CO1)C2CO2 |
Hexane, 1,3-epoxy- | C(CC)C1CCO1 |
Hexane, 1,6-bis(methylthio)- | C(CCSC)CCCSC |
Hexane, 1,6-dibromo- | C(CCBr)CCCBr |
Hexane, 1,6-dichloro- | C(CCCl)CCCCl |
Hexane, 1,6-diisocyanato- | C(CCN=C=O)CCCN=C=O |
Hexane, 1,6-diphenyl- | C(CCCCCc1ccccc1)c2ccccc2 |
Hexane, 1-(ethenyloxy)- | C(CCCC)COC=C |
Hexane, 1-(propylthio)- | C(CCCC)CSCCC |
Hexane, 1-bromo- | C(CCBr)CCC |
Hexane, 1-bromo-6-chloro- | C(CCBr)CCCCl |
Hexane, 1-cyclohexyl- | C(CCCCC)C1CCCCC1 |
Hexane, 1-iodo- | C(CCC)CCI |
Hexane, 1-isocyano- | C(CCC)CCN#C |
Hexane, 1-phenyl- | C(CCCCC)c1ccccc1 |
Hexane, 2, 5-diphenyl- | C(C)(CCC(C)c1ccccc1)c2ccccc2 |
Hexane, 2,2,5-trimethyl- | C(CC(C)C)C(C)(C)C |
Hexane, 2,2-dimethyl- | C(CCC)C(C)(C)C |
Hexane, 2,3-dimethyl- | C(C)(CCC)C(C)C |
Hexane, 2,4-dimethyl- | C(C)(CC)CC(C)C |
Hexane, 2,5-dichloro-2,5-dimethyl- | C(CC(C)(C)Cl)C(C)(C)Cl |
Hexane, 2,5-dimethyl- | C(CC(C)C)C(C)C |
Hexane, 2,5-dimethyl-2,5-di(tert-butylperoxy)- | C(C)(C)(OOC(C)(C)C)CCC(C)(C)OOC(C)(C)C |
Hexane, 2-methyl- | C(CCC)C(C)C |
Hexane, 3, 4-bis(p-methoxyphenyl)- | C(CC)(c1ccc(OC)cc1)C(CC)c2ccc(OC)cc2 |
Hexane, 3,3-dimethyl- | C(C)(C)(CC)CCC |
Hexane, 3,4-bis(4-hydroxyphenyl)- | C(CC)(c1ccc(O)cc1)C(CC)c2ccc(O)cc2 |
Hexane, 3,4-bis(4-methoxyphenyl)- | C(CC)(c1ccc(OC)cc1)C(CC)c2ccc(OC)cc2 |
Hexane, 3,4-bis(p-hydroxyphenyl)- | C(CC)(c1ccc(O)cc1)C(CC)c2ccc(O)cc2 |
Hexane, 3,4-dimethyl- | C(C)(CC)C(C)CC |
Hexane, 3-ethyl- | C(CC)(CC)CCC |
Hexane, 3-methyl- | C(C)(CC)CCC |
Hexane-1,2,6-triol | C(O)(CO)CCCCO |
Hexane__1-(ethenyloxy)- | C(CCCC)COC=C |
Hexane__1-(propylthio)- | C(CCCC)CSCCC |
Hexane__1-bromo- | C(CCBr)CCC |
Hexane__1-bromo-6-chloro- | C(CCBr)CCCCl |
Hexane__1-iodo- | C(CCC)CCI |
Hexane__1-isocyano- | C(CCC)CCN#C |
Hexane__1-phenyl- | C(CCCCC)c1ccccc1 |
Hexane__1_1'-oxybis- | O(CCCCCC)CCCCCC |
Hexane__1_1'-selenobis- | [Se](CCCCCC)CCCCCC |
Hexane__1_1'-thiobis- | S(CCCCCC)CCCCCC |
Hexane__1_2-epoxy- | C(CCC)C1CO1 |
Hexane__1_3-epoxy- | C(CC)C1CCO1 |
Hexane__1_6-bis(methylthio)- | C(CCSC)CCCSC |
Hexane__1_6-dichloro- | C(CCCl)CCCCl |
Hexane__1__1'-(ethylidenebis(oxy))bis- | C(C)(OCCCCCC)OCCCCCC |
Hexane__2-methyl- | C(CCC)C(C)C |
Hexane__2_2-dimethyl- | C(CCC)C(C)(C)C |
Hexane__2_2_5-trimethyl- | C(CC(C)C)C(C)(C)C |
Hexane__2_3-dimethyl- | C(C)(CCC)C(C)C |
Hexane__2_4-dimethyl- | C(C)(CC)CC(C)C |
Hexane__2_5-dichloro-2_5-dimethyl- | C(CC(C)(C)Cl)C(C)(C)Cl |
Hexane__2_5-dimethyl- | C(CC(C)C)C(C)C |
Hexane__3-ethyl- | C(CC)(CC)CCC |
Hexane__3-methyl- | C(C)(CC)CCC |
Hexane__3_3-dimethyl- | C(C)(C)(CC)CCC |
Hexane__3_4-dimethyl- | C(C)(CC)C(C)CC |
meso-3, 4-Bis(p-hydroxyphenyl)-n-hexane | C(CC)(c1ccc(O)cc1)C(CC)c2ccc(O)cc2 |
meso-3, 4-Di(p-hydroxyphenyl)-n-hexane | C(CC)(c1ccc(O)cc1)C(CC)c2ccc(O)cc2 |
n-Hexane | C(CC)CCC |