If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 2-Epoxy-1,2,3,4-tetrahydronaphthalene | C12OC2CCc3c1cccc3 |
1,1,4,4-tetramethyl-6-ethyl-7-acetyl-1,2,3, 4-tetrahydronaphthalene | CC1(C)CCC(C)(C)c2cc(CC)c(cc12)C(C)=O |
1,2,3, 4-Tetrahydronaphthalene 1,2-epoxide | C12OC2CCc3c1cccc3 |
1,2,3, 4-Tetrahydronaphthalene | c12CCCCc1cccc2 |
1,2,3, 4-Tetrahydronaphthalene-1,2-oxide | C12OC2CCc3c1cccc3 |
1-Amino-5,6,7, 8-tetrahydronaphthalene | Nc1cccc2CCCCc12 |
1-Amino-5_6_7__8-tetrahydronaphthalene | Nc1cccc2CCCCc12 |
2,5,8-Trimethyl-1,2,3, 4-tetrahydronaphthalene | Cc1ccc(C)c2CCC(C)Cc12 |
2-Methyl-(1,2,3, 4-tetrahydronaphthalene) | CC1CCc2ccccc2C1 |
5, 7-Dimethyl-(1,2,3,4-tetrahydronaphthalene) | Cc1cc(C)cc2CCCCc12 |
5-Amino-1,2,3, 4-tetrahydronaphthalene | Nc1cccc2CCCCc12 |
6-Methoxy-1,2,3, 4-tetrahydronaphthalene | O(C)c1ccc2CCCCc2c1 |
6-Methyl-(1,2, 3,4-tetrahydronaphthalene) | Cc1ccc2CCCCc2c1 |
6-Methyl-1,2,3, 4-tetrahydronaphthalene | Cc1ccc2CCCCc2c1 |
6-n-Butyl-(1,2, 3,4-tetrahydronaphthalene) | C(CCC)c1ccc2CCCCc2c1 |
6-n-Butyl-(1_2__3_4-tetrahydronaphthalene) | C(CCC)c1ccc2CCCCc2c1 |
6-tert-Butyl-(1,2,3,4-tetrahydronaphthalene) | C(C)(C)(C)c1ccc2CCCCc2c1 |
Tetrahydronaphthalene | c12CCCCc1cccc2 |