If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Methoxy-4-propylphenol | O(C)c1cc(CCC)ccc1O |
2-Propylphenol | C(CC)c1ccccc1O |
2-n-Propylphenol | C(CC)c1ccccc1O |
3-Propylphenol | C(CC)c1cccc(O)c1 |
3-n-Propylphenol | C(CC)c1cccc(O)c1 |
4-Propylphenol | C(CC)c1ccc(O)cc1 |
4-n-Propylphenol | C(CC)c1ccc(O)cc1 |
Dinitro-iso-propylphenol | C(C)(C)c1cc(cc([N+](=O)[O-])c1O)[N+](=O)[O-] |
m-Propylphenol | C(CC)c1cccc(O)c1 |
o-Propylphenol | C(CC)c1ccccc1O |
p-Propylphenol | C(CC)c1ccc(O)cc1 |