If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Quinoxalinol | Oc1cnc2ccccc2n1 |
2-Quinoxalinol, 3-(trichloromethyl)- | C(Cl)(Cl)(Cl)c1nc2ccccc2nc1O |
2-Quinoxalinol, 3-methyl- | Cc1nc2ccccc2nc1O |
3-(Trichloromethyl)-2-quinoxalinol | C(Cl)(Cl)(Cl)c1nc2ccccc2nc1O |
6-Quinoxalinol | Oc1ccc2nccnc2c1 |