If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Oxazolidinethione | S=C1NCCO1 |
2-Oxazolidinethione, 4, 4-dimethyl- | CC1(C)COC(=S)N1 |
2-Oxazolidinethione, 4-ethyl- | C(C)C1COC(=S)N1 |
2-Oxazolidinethione, 5-((3-(trifluoromethyl)phenoxy)methyl)- | O(CC1CNC(=S)O1)c2cccc(c2)C(F)(F)F |
2-Oxazolidinethione, 5-methyl-3-((5-nitro-2-furfurylidene)amino)- | N(=CC1=CC=C(O1)[N+](=O)[O-])N2CC(C)OC2=S |
2-Oxazolidinethione, 5-methyl-3-((5-nitrofurfurylidene)amino)- | N(=CC1=CC=C(O1)[N+](=O)[O-])N2CC(C)OC2=S |
2-Oxazolidinethione__4-ethyl- | C(C)C1COC(=S)N1 |
2-Oxazolidinethione__5-methyl-3-((5-nitro-2-furfurylidene)amino)- | N(=CC1=CC=C(O1)[N+](=O)[O-])N2CC(C)OC2=S |
4-Ethyl-2-oxazolidinethione | C(C)C1COC(=S)N1 |