If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Ahcovat Printing Blue 2BD | O=C1c2cc(Br)cc(Br)c2NC1=C3Nc4c(Br)cc(Br)cc4C3=O |
Ahcovat Printing Golden Yellow GK | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Ahcovat Printing Golden Yellow | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Ahcovat Printing Orange R | O=C1c2ccc(OCC)cc2SC1=C3Sc4cc(OCC)ccc4C3=O |
Alizarine Fast Printing Green G | N(c1ccc(Nc2ccc(C)cc2S(=O)(=O)O)c3C(=O)c4ccccc4C(=O)c13)c5ccc(C)cc5S(=O)(=O)O |
Anthracene Printing Brown | O=C1c2ccccc2C(=O)c3cc(O)c(O)c(O)c13 |
Calcoloid Printing Orange RE | O=C1c2ccc(OCC)cc2SC1=C3Sc4cc(OCC)ccc4C3=O |
Calcoloid Printing Orange RYW | O=C1c2ccc(OCC)cc2SC1=C3Sc4cc(OCC)ccc4C3=O |
Caledon Printing Blue RN | O=C1c2ccccc2C(=O)c3ccc4Nc5c(ccc6C(=O)c7ccccc7C(=O)c56)Nc4c13 |
Caledon Printing Blue XRN | O=C1c2ccccc2C(=O)c3ccc4Nc5c(ccc6C(=O)c7ccccc7C(=O)c56)Nc4c13 |
Caledon Printing Dark Blue BM | O=C1c2ccccc2c3ccc4c5ccc6c7ccccc7C(=O)c8ccc(c9ccc1c3c49)c5c68 |
Caledon Printing Orange G | O=C1c2ccccc2C3=Cc4ccc5C(=O)c6ccccc6c7cc8ccc1c3c8c4c57 |
Caledon Printing Red 3B | Nc1c(ccc2C(=O)c3ccccc3C(=O)c12)C4=Nc5cc6C(=O)c7ccccc7C(=O)c6cc5O4 |
Caledon Printing Yellow GK | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Caledon Printing Yellow GN | O=C1c2ccccc2C3=Nc4ccc5C(=O)c6ccccc6c7nc8ccc1c3c8c4c57 |
Caledon Printing Yellow | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Carbanthrene Printing Dark Blue DR | O=C1c2ccccc2c3ccc4c5ccc6c7ccccc7C(=O)c8ccc(c9ccc1c3c49)c5c68 |
Carbanthrene Printing FBB | Nc1c(ccc2C(=O)c3ccccc3C(=O)c12)C4=Nc5cc6C(=O)c7ccccc7C(=O)c6cc5O4 |
Carbanthrene Printing Golden Orange G | O=C1c2ccccc2C3=Cc4ccc5C(=O)c6ccccc6c7cc8ccc1c3c8c4c57 |
Carbanthrene Printing Violet 2R | O=C1c2ccccc2c3ccc4c5ccc6C(=O)c7ccccc7c8ccc(c9ccc1c3c49)c5c68 |
Carbanthrene Printing Yellow G | O=C1c2ccccc2C3=Nc4ccc5C(=O)c6ccccc6c7nc8ccc1c3c8c4c57 |
Carbanthrene_Printing_Golden_Orange_G | O=C1c2ccccc2C3=Cc4ccc5C(=O)c6ccccc6c7cc8ccc1c3c8c4c57 |
Chrome Printing Black M | S(=O)(=O)(O)c1cc(O)c(N=Nc2c(O)ccc3ccccc23)c4ccc(cc14)[N+](=O)[O-] |
Dispersol Printing Yellow A | [N+](=O)([O-])c1cc(ccc1Nc2ccc(O)cc2)[N+](=O)[O-] |
Duranol Printing Blue B | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Duranol Printing Blue Green B | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Durindone Printing Blue 4BC | O=C1c2cc(Br)cc(Br)c2NC1=C3Nc4c(Br)cc(Br)cc4C3=O |
Durindone Printing Orange R | O=C1c2ccc(OCC)cc2SC1=C3Sc4cc(OCC)ccc4C3=O |
Durindone Printing Red 3B | O=C1c2cc(Cl)cc(C)c2SC1=C3Sc4c(C)cc(Cl)cc4C3=O |
Indanthren Printing Blue FRS | O=C1c2ccccc2C(=O)c3ccc4Nc5c(ccc6C(=O)c7ccccc7C(=O)c56)Nc4c13 |
Indanthren Printing Blue KRS | O=C1c2ccccc2C(=O)c3ccc4Nc5c(ccc6C(=O)c7ccccc7C(=O)c56)Nc4c13 |
Indanthren Printing Red Violet RH | O=C1c2cc(Cl)cc(C)c2SC1=C3Sc4c(C)cc(Cl)cc4C3=O |
Indanthren Printing Yellow GOK | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Indanthren Printing Yellow | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Palanthrene Printing Blue KRS | O=C1c2ccccc2C(=O)c3ccc4Nc5c(ccc6C(=O)c7ccccc7C(=O)c56)Nc4c13 |
Paradone Printing Blue FRS | O=C1c2ccccc2C(=O)c3ccc4Nc5c(ccc6C(=O)c7ccccc7C(=O)c56)Nc4c13 |
Sandothrene Printing Yellow NH | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Sandothrene Printing Yellow | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Vat Printing Orange R | O=C1c2ccc(OCC)cc2SC1=C3Sc4cc(OCC)ccc4C3=O |
Vat Printing Red Violet RH | O=C1c2cc(Cl)cc(C)c2SC1=C3Sc4c(C)cc(Cl)cc4C3=O |