If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-tert-Butylcyclohexyl acetate | C(C)(C)(C)C1CCC(CC1)OC(C)=O |
Acetic acid, (4-tert-butylcyclohexyl) ester | C(C)(C)(C)C1CCC(CC1)OC(C)=O |
Urea, 3-(3-tert-butylcyclohexyl)-1-(2-chloroethyl)-1-nitroso- | C(C)(C)(C)C1CCCC(C1)NC(=O)N(N=O)CCCl |
Urea__3-(3-tert-butylcyclohexyl)-1-(2-chloroethyl)-1-nitroso- | C(C)(C)(C)C1CCCC(C1)NC(=O)N(N=O)CCCl |
p-t-Butylcyclohexyl caproate | O(C(=O)CCCCC)C1CCC(CC1)C(C)(C)C |
p-t-Butylcyclohexyl formate | C(C)(C)(C)C1CCC(OC=O)CC1 |
p-tert-Butylcyclohexyl acetate | C(C)(C)(C)C1CCC(CC1)OC(C)=O |