If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(+-)-Hexestrol | C(CC)(c1ccc(O)cc1)C(CC)c2ccc(O)cc2 |
(.+-.)-Hexestrol | C(CC)(c1ccc(O)cc1)C(CC)c2ccc(O)cc2 |
DL-Hexestrol | C(CC)(c1ccc(O)cc1)C(CC)c2ccc(O)cc2 |
Hexestrol (VAN) | C(CC)(c1ccc(O)cc1)C(CC)c2ccc(O)cc2 |
Hexestrol dimethyl ether | C(CC)(c1ccc(OC)cc1)C(CC)c2ccc(OC)cc2 |
Hexestrol, dimethyl ether | C(CC)(c1ccc(OC)cc1)C(CC)c2ccc(OC)cc2 |
Hexestrol, methyl ether | C(CC)(c1ccc(OC)cc1)C(CC)c2ccc(O)cc2 |
Hexestrol, monomethyl ether | C(CC)(c1ccc(OC)cc1)C(CC)c2ccc(O)cc2 |
meso-Hexestrol | C(CC)(c1ccc(O)cc1)C(CC)c2ccc(O)cc2 |