If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Butyn-1-ol, 4-chloro-, m-chlorocarbanilate | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
2-Butynyl 4-chloro-m-chlorocarbanilate | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
2-Nitro-3,4,6-trichlorophenol p-chlorocarbanilate | O(C(=O)Nc1ccc(Cl)cc1)c2c(Cl)cc(Cl)c(Cl)c2[N+](=O)[O-] |
3,4, 6-Trichloro-2-nitrophenyl-p-chlorocarbanilate | O(C(=O)Nc1ccc(Cl)cc1)c2c(Cl)cc(Cl)c(Cl)c2[N+](=O)[O-] |
4-Chloro-2-butynyl 3-chlorocarbanilate | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
4-Chloro-2-butynyl m-chlorocarbanilate | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
4-Chloro-2-butynylm-chlorocarbanilate | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
Isopropyl 3-chlorocarbanilate | N(C(=O)OC(C)C)c1cccc(Cl)c1 |
Isopropyl m-chlorocarbanilate | N(C(=O)OC(C)C)c1cccc(Cl)c1 |
Phenol, 2-nitro-3,4,6-trichloro-, p-chlorocarbanilate | O(C(=O)Nc1ccc(Cl)cc1)c2c(Cl)cc(Cl)c(Cl)c2[N+](=O)[O-] |