If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Iodophenol | Ic1ccccc1O |
4-Iodophenol | Ic1ccc(O)cc1 |
Iodophenol blue | O=S1(=O)OC(c2cc(I)c(O)c(I)c2)(c3cc(I)c(O)c(I)c3)c4ccccc14 |
Iodophenol_blue | O=S1(=O)OC(c2cc(I)c(O)c(I)c2)(c3cc(I)c(O)c(I)c3)c4ccccc14 |
o-Iodophenol | Ic1ccccc1O |
p-Iodophenol | Ic1ccc(O)cc1 |