If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Aminohippuric acid | C(=O)(NCC(=O)O)c1ccc(N)cc1 |
Aminohippuric acid | C(=O)(NCC(=O)O)c1ccc(N)cc1 |
p-Aminohippuric acid | C(=O)(NCC(=O)O)c1ccc(N)cc1 |