If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1-(Methylbutyl)malonic acid diethyl ester | C(C(C)CCC)(C(=O)OCC)C(=O)OCC |
1-Methylbutyl malonic ester | C(C(C)CCC)(C(=O)OCC)C(=O)OCC |
2-Acetamido-2-(7-amino-3-indolylmethyl)malonic acid diethyl ester | C(NC(C)=O)(CC1=CNc2c(N)cccc12)(C(=O)OCC)C(=O)OCC |
MALONIC ACID | C(C(=O)O)C(=O)O |
MALONIC ACID, HYDROXY- | C(O)(C(=O)O)C(=O)O |
Malonic acid chloride | C(C(Cl)=O)C(Cl)=O |
Malonic acid diamide | C(C(N)=O)C(N)=O |
Malonic acid dianilide | N(C(=O)CC(=O)Nc1ccccc1)c2ccccc2 |
Malonic acid dichloride | C(C(Cl)=O)C(Cl)=O |
Malonic acid dinitrile | C(C#N)C#N |
Malonic acid diphenylamide | N(C(=O)CC(=O)Nc1ccccc1)c2ccccc2 |
Malonic acid hydrazide | C(C(=O)NN)C(=O)NN |
Malonic acid | C(C(=O)O)C(=O)O |
Malonic acid, (1-ethoxyethylidene)-, diethyl ester | C(=C(C)OCC)(C(=O)OCC)C(=O)OCC |
Malonic acid, (1-methylbutyl)-, diethyl ester | C(C(C)CCC)(C(=O)OCC)C(=O)OCC |
Malonic acid, (2-phenylacetamido)-, monoethyl ester, sodium salt | C(C(=O)NC(C(=O)O)C(=O)OCC)c1ccccc1 |
Malonic acid, (2-propynyl)-, diethyl ester | C(CC#C)(C(=O)OCC)C(=O)OCC |
Malonic acid, (ethoxymethylene)-, diethyl ester | C(=COCC)(C(=O)OCC)C(=O)OCC |
Malonic acid, (o-chlorobenzylidene)-, diethyl ester | C(=Cc1ccccc1Cl)(C(=O)OCC)C(=O)OCC |
Malonic acid, (p-methoxybenzylidene)-, dimethyl ester | C(=Cc1ccc(OC)cc1)(C(=O)OC)C(=O)OC |
Malonic acid, 2-(2-propynyl)-, diethyl ester | C(CC#C)(C(=O)OCC)C(=O)OCC |
Malonic acid, 2-benzyl- | C(Cc1ccccc1)(C(=O)O)C(=O)O |
Malonic acid, 2-benzyl-, diethyl ester | C(Cc1ccccc1)(C(=O)OCC)C(=O)OCC |
Malonic acid, acetamido(7-amino-3-indolylmethyl)-, diethyl ester | C(NC(C)=O)(CC1=CNc2c(N)cccc12)(C(=O)OCC)C(=O)OCC |
Malonic acid, acetamido-, diethyl ester | C(NC(C)=O)(C(=O)OCC)C(=O)OCC |
Malonic acid, acetyl-, diethyl ester | C(C(C)=O)(C(=O)OCC)C(=O)OCC |
Malonic acid, allyl- | C(CC=C)(C(=O)O)C(=O)O |
Malonic acid, allyl-, diethyl ester | C(CC=C)(C(=O)OCC)C(=O)OCC |
Malonic acid, amino- | C(N)(C(=O)O)C(=O)O |
Malonic acid, benzamido-, diethyl ester | C(NC(=O)c1ccccc1)(C(=O)OCC)C(=O)OCC |
Malonic acid, benzyl- | C(Cc1ccccc1)(C(=O)O)C(=O)O |
Malonic acid, benzyl-, diethyl ester | C(Cc1ccccc1)(C(=O)OCC)C(=O)OCC |
Malonic acid, benzylidene- | C(=Cc1ccccc1)(C(=O)O)C(=O)O |
Malonic acid, benzylidene-, diethyl ester | C(=Cc1ccccc1)(C(=O)OCC)C(=O)OCC |
Malonic acid, benzylidene-, dimethyl ester | C(=Cc1ccccc1)(C(=O)OC)C(=O)OC |
Malonic acid, bromo-, diethyl ester | C(Br)(C(=O)OCC)C(=O)OCC |
Malonic acid, butyl- | C(CCCC)(C(=O)O)C(=O)O |
Malonic acid, butyl-, diethyl ester | C(CCCC)(C(=O)OCC)C(=O)OCC |
Malonic acid, butylmethyl-, diethyl ester | C(C)(CCCC)(C(=O)OCC)C(=O)OCC |
Malonic acid, chloro-, diethyl ester | C(Cl)(C(=O)OCC)C(=O)OCC |
Malonic acid, cinnamylidene- | C(=CC=C(C(=O)O)C(=O)O)c1ccccc1 |
Malonic acid, cyclic isopropylidene ester | CC1(C)OC(=O)CC(=O)O1 |
Malonic acid, diallyl-, diethyl ester | C(CC=C)(CC=C)(C(=O)OCC)C(=O)OCC |
Malonic acid, diazo-, dimethyl ester (VAN8CI) | C(=N=N)(C(=O)OC)C(=O)OC |
Malonic acid, dibromo-, diethyl ester | C(Br)(Br)(C(=O)OCC)C(=O)OCC |
Malonic acid, dibutyl ester | C(C(=O)OCCCC)C(=O)OCCCC |
Malonic acid, dibutyl-, diethyl ester | C(CCCC)(CCCC)(C(=O)OCC)C(=O)OCC |
Malonic acid, diethyl ester | C(=O)(OCC)CC(=O)OCC |
Malonic acid, diethyl- | C(CC)(CC)(C(=O)O)C(=O)O |
Malonic acid, diethyl-, diethyl ester | C(CC)(CC)(C(=O)OCC)C(=O)OCC |
Malonic acid, dihydrazide | C(C(=O)NN)C(=O)NN |
Malonic acid, dimethyl- | C(C)(C)(C(=O)O)C(=O)O |
Malonic acid, dimethyl-, diethyl ester | C(C)(C)(C(=O)OCC)C(=O)OCC |
Malonic acid, dipropyl- | C(CCC)(CCC)(C(=O)O)C(=O)O |
Malonic acid, dipropyl-, diethyl ester | C(CCC)(CCC)(C(=O)OCC)C(=O)OCC |
Malonic acid, dodecyl- | C(CCCCCCCCCCCC)(C(=O)O)C(=O)O |
Malonic acid, ethyl ester nitrile | C(=O)(CC#N)OCC |
Malonic acid, ethyl(1-methylbutyl)-, diethyl ester | C(CC)(C(C)CCC)(C(=O)OCC)C(=O)OCC |
Malonic acid, ethyl- | C(CC)(C(=O)O)C(=O)O |
Malonic acid, ethyl-, diethyl ester | C(CC)(C(=O)OCC)C(=O)OCC |
Malonic acid, ethylisopentyl-, diethyl ester | C(CC)(CCC(C)C)(C(=O)OCC)C(=O)OCC |
Malonic acid, ethylmethyl- | C(C)(CC)(C(=O)O)C(=O)O |
Malonic acid, ethylphenyl-, diethyl ester | C(CC)(C(=O)OCC)(C(=O)OCC)c1ccccc1 |
Malonic acid, formamido-, diethyl ester | C(NC=O)(C(=O)OCC)C(=O)OCC |
Malonic acid, formamido-, dimethyl ester | C(NC=O)(C(=O)OC)C(=O)OC |
Malonic acid, furfurylidene- | C(=CC1=CC=CO1)(C(=O)O)C(=O)O |
Malonic acid, furfurylidene-, diethyl ester | C(=CC1=CC=CO1)(C(=O)OCC)C(=O)OCC |
Malonic acid, heptyl- | C(CCCCCCC)(C(=O)O)C(=O)O |
Malonic acid, hexadecyl- | C(CCCCCCCCCCCCCCCC)(C(=O)O)C(=O)O |
Malonic acid, hexyl- | C(CCCCCC)(C(=O)O)C(=O)O |
Malonic acid, hexyl-, diethyl ester | C(CCCCCC)(C(=O)OCC)C(=O)OCC |
Malonic acid, isobutyl-, diethyl ester | C(CC(C)C)(C(=O)OCC)C(=O)OCC |
Malonic acid, isopropyl- | C(C(C)C)(C(=O)O)C(=O)O |
Malonic acid, isopropyl-, diethyl ester | C(C(C)C)(C(=O)OCC)C(=O)OCC |
Malonic acid, isopropylidene-, diethyl ester | C(=C(C)C)(C(=O)OCC)C(=O)OCC |
Malonic acid, methyl- | C(C)(C(=O)O)C(=O)O |
Malonic acid, methyl-, diethyl ester | C(C)(C(=O)OCC)C(=O)OCC |
Malonic acid, methyl-, dimethyl ester | C(C)(C(=O)OC)C(=O)OC |
Malonic acid, octadecyl- | C(CCCCCCCCCCCCCCCCCC)(C(=O)O)C(=O)O |
Malonic acid, octyl-, diethyl ester | C(CCCCCCCC)(C(=O)OCC)C(=O)OCC |
Malonic acid, oxo-, diethyl ester, dimethylhydrazone | C(=NN(C)C)(C(=O)OCC)C(=O)OCC |
Malonic acid, pentyl- | C(CCCCC)(C(=O)O)C(=O)O |
Malonic acid, phenyl- | C(C(=O)O)(C(=O)O)c1ccccc1 |
Malonic acid, phenyl-, diethyl ester | C(C(=O)OCC)(C(=O)OCC)c1ccccc1 |
Malonic acid, propionyl-, diethyl ester | C(C(=O)CC)(C(=O)OCC)C(=O)OCC |
Malonic acid, propyl-, diethyl ester | C(CCC)(C(=O)OCC)C(=O)OCC |
Malonic acid, salicylidene-, DELTA_-lactone | C(=O)(O)C1=Cc2ccccc2OC1=O |
Malonic acid, sec-butyl-, diethyl ester | C(C(C)CC)(C(=O)OCC)C(=O)OCC |
Malonic acid, sec-butylethyl-, diethyl ester | C(CC)(C(C)CC)(C(=O)OCC)C(=O)OCC |
Malonic acid, tetradecyl- | C(CCCCCCCCCCCCCC)(C(=O)O)C(=O)O |
Malonic acid, thallium salt (1:2) | C(C(=O)O)C(=O)O |
Malonic acid, undecyl- | C(CCCCCCCCCCC)(C(=O)O)C(=O)O |
Malonic dianilide | N(C(=O)CC(=O)Nc1ccccc1)c2ccccc2 |
Malonic dihydrazide | C(C(=O)NN)C(=O)NN |
Malonic dinitrile | C(C#N)C#N |
Malonic ester | C(=O)(OCC)CC(=O)OCC |
Malonic mononitrile | C(C#N)C(=O)O |
Malonic_acid__butylmethyl-__diethyl_ester | C(C)(CCCC)(C(=O)OCC)C(=O)OCC |
Malonic_acid__cyclic_isopropylidene_ester | CC1(C)OC(=O)CC(=O)O1 |
Malonic_acid__diazo-__dimethyl_ester_(VAN8CI) | C(=N=N)(C(=O)OC)C(=O)OC |
Malonic_acid__ethyl_ester_nitrile | C(=O)(CC#N)OCC |
Malonic_acid__salicylidene-__DELTA_-lactone | C(=O)(O)C1=Cc2ccccc2OC1=O |
Malonic_acid_dichloride | C(C(Cl)=O)C(Cl)=O |