If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Anthranilic acid, linalyl ester | C(C)(C=C)(CCC=C(C)C)OC(=O)c1ccccc1N |
Benzoic acid, linalyl ester | C(C)(C=C)(CCC=C(C)C)OC(=O)c1ccccc1 |
Butyric acid, linalyl ester | C(C)(C=C)(CCC=C(C)C)OC(=O)CCC |
Cinnamic acid, linalyl ester | C(C)(C=C)(CCC=C(C)C)OC(=O)C=Cc1ccccc1 |
Linalyl acetate | C(C)(C=C)(CCC=C(C)C)OC(C)=O |
Linalyl alcohol | C(C)(O)(C=C)CCC=C(C)C |
Linalyl anthranilate | C(C)(C=C)(CCC=C(C)C)OC(=O)c1ccccc1N |
Linalyl benzoate | C(C)(C=C)(CCC=C(C)C)OC(=O)c1ccccc1 |
Linalyl butyrate | C(C)(C=C)(CCC=C(C)C)OC(=O)CCC |
Linalyl cinnamate | C(C)(C=C)(CCC=C(C)C)OC(=O)C=Cc1ccccc1 |
Linalyl formate | C(C)(C=C)(OC=O)CCC=C(C)C |
Linalyl isobutyrate | C(C)(C=C)(CCC=C(C)C)OC(=O)C(C)C |
Linalyl phenylacetate | C(C)(C=C)(CCC=C(C)C)OC(=O)Cc1ccccc1 |
Linalyl propionate | C(C)(C=C)(CCC=C(C)C)OC(=O)CC |
Linalyl, neryl, geranyl acetates, mixture | C(C)(CCC=C(C)C)=CCOC(C)=O |