If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Hydroxy-GABA | C(O)(CN)CC(=O)O |
GABA | C(CCN)C(=O)O |
DL-Gabaculine | C(=O)(O)C1=CC=CC(N)C1 |
GABACULINE, D.L- | C(=O)(O)C1=CC=CC(N)C1 |
GABACULINE__D.L- | C(=O)(O)C1=CC=CC(N)C1 |
Gabail | C(=O)(O)c1cc(O)ccc1O |
Gaballon | C(CCN)C(=O)O |
Gabbropas | C(=O)(O)c1ccc(N)cc1O |
Gabilin | N(C)(C)c1ccc2nc3cc(C)c(N)cc3sc2c1 |
Gabimex | C(O)(CN)CC(=O)O |
GABOB | C(O)(CN)CC(=O)O |
Gabobe | C(O)(CN)CC(=O)O |
Gabomade | C(O)(CN)CC(=O)O |
Gaboril | C(O)(CN)CC(=O)O |
Gallium bromide (GaBr3) (8CI 9CI) | [Ga](Br)(Br)Br |
Gallium bromide, GaBr3 | [Ga](Br)(Br)Br |
Gallium_bromide_(GaBr3)_(8CI_9CI) | [Ga](Br)(Br)Br |
GABUNAMINE | C(=O)(OC)C12CC3CC(CC)C2N(CCC4=C1Nc5cc(OC)c(cc45)C6CC7C(=CC)CNC(CC8=C6Nc9ccccc89)C7C(=O)OC)C3 |
gacl | A sub-index is available for gacl... |
GADENINE | OC12CC3C(OC)CC(O)(C2C3OC(=O)c4ccccc4)C5(O)C(OC)C6C7(C)CCC(O)C16C5N(CC)C7 |
GADESINE | OC12C(OC)C3C4(C)CCC5OC4N(CC)C1C35C6CC7C(O)C6C2(O)CC7OC |
Gadexyl | C(C)(CCC)(COC(N)=O)COC(N)=O |
gadolinium | A sub-index is available for gadolinium... |
Gestageno Gador | CC12CCC3C(CCC4=CC(=O)CCC34C)C1CCC2(O)C(C)=O |
gafanol | A sub-index is available for gafanol... |
Gafcol EB | C(CCC)OCCO |
Gagexyl | C(C)(CCC)(COC(N)=O)COC(N)=O |
Gaiamar | O(CC(O)CO)c1ccccc1OC |
GAILLARDIN | O(C(C)=O)C1CC(C)(O)C2CC3C(=C)C(=O)OC3C=C(C)C12 |
Gainex | C1(=Nc2ccccc2N1)c3ccccc3 |
Galactaric acid | C(O)(C(O)C(=O)O)C(O)C(O)C(=O)O |
Galactaric acid, D- | C(O)(C(O)C(=O)O)C(O)C(O)C(=O)O |
galactitol | A sub-index is available for galactitol... |
galacto | A sub-index is available for galacto... |
GALACTOFLAVINE | C(C(O)C(O)C(O)C(O)CO)N1c2cc(C)c(C)cc2N=C3C(=O)NC(=O)N=C13 |
D-Galactonic acid, GAMMA_-lactone | C(O)(CO)C1OC(=O)C(O)C1O |
Galactonic acid, GAMMA_-lactone, D- | C(O)(CO)C1OC(=O)C(O)C1O |
Galactonic_acid__GAMMA_-lactone__D- | C(O)(CO)C1OC(=O)C(O)C1O |
Galactonitrile, pentaacetate | C(OC(C)=O)(C(COC(C)=O)OC(C)=O)C(OC(C)=O)C(C#N)OC(C)=O |
Galactonitrile__pentaacetate | C(OC(C)=O)(C(COC(C)=O)OC(C)=O)C(OC(C)=O)C(C#N)OC(C)=O |
D-Galactono-1,4-lactone | C(O)(CO)C1OC(=O)C(O)C1O |
D-Galactono-GAMMA_-lactone | C(O)(CO)C1OC(=O)C(O)C1O |
1,4-D-Galactonolactone | C(O)(CO)C1OC(=O)C(O)C1O |
GAMMA_-D-Galactonolactone | C(O)(CO)C1OC(=O)C(O)C1O |
galactopyranose | A sub-index is available for galactopyranose... |
galactopyranoside | A sub-index is available for galactopyranoside... |
galactopyranosyl | A sub-index is available for galactopyranosyl... |
ALPHA_-D-Galactopyranuronic acid | C(=O)(O)C1OC(O)C(O)C(O)C1O |
D-Galactopyranuronic acid | C(O)(C(O)C(=O)O)C(O)C(O)C=O |
Galactopyranuronic acid, ALPHA_-D- | C(=O)(O)C1OC(O)C(O)C(O)C1O |
Galactopyranuronic acid, D- | C(O)(C(O)C(=O)O)C(O)C(O)C=O |
Galactopyranuronic_acid__D- | C(O)(C(O)C(=O)O)C(O)C(O)C=O |
Galactosaccharic acid | C(O)(C(O)C(=O)O)C(O)C(O)C(=O)O |
galactose | A sub-index is available for galactose... |
galactoside | A sub-index is available for galactoside... |
ALPHA_-D-Galacturonic acid | C(=O)(O)C1OC(O)C(O)C(O)C1O |
D-Galacturonic acid | C(O)(C(O)C(=O)O)C(O)C(O)C=O |
GALACTURONIC ACID, ALPHA,(D) HYDRATE | C(=O)(O)C1OC(O)C(O)C(O)C1O |
GALACTURONIC_ACID__ALPHA_(D)_HYDRATE | C(=O)(O)C1OC(O)C(O)C(O)C1O |
Galacturonic acid, D- | C(O)(C(O)C(=O)O)C(O)C(O)C=O |
BETA_-D-Galaltosamine hydrochloride | C(O)C1OC(O)C(N)C(O)C1O |
GALANGIN | O=C1C(O)=C(Oc2cc(O)cc(O)c12)c3ccccc3 |
Galangin flavanone | O=C1CC(Oc2cc(O)cc(O)c12)c3ccccc3 |
Galangin | O=C1C(O)=C(Oc2cc(O)cc(O)c12)c3ccccc3 |
Galantamin | O(C)c1ccc2CN(C)CCC34C=CC(O)CC4Oc1c23 |
Galantamine | O(C)c1ccc2CN(C)CCC34C=CC(O)CC4Oc1c23 |
GALANTHAMINE | O(C)c1ccc2CN(C)CCC34C=CC(O)CC4Oc1c23 |
Galanthidine | OC1C(O)C=C2CCN3Cc4cc5OCOc5cc4C1C23 |
GALANTHINE | OC1C(OC)C=C2CCN3Cc4cc(OC)c(OC)cc4C1C23 |
Galasan | C(=S)(OCC)SSC(=S)OCC |
Galatone | C(O)(C=NNC(=O)c1ccncc1)C2OC(=O)C(O)C2O |
Galatur | C(CCN(C)C)N1C2=C(CCCCCC2)c3ccccc13 |
Galesan | O(c1cc(C)nc(n1)C(C)C)P(=S)(OCC)OCC |
Galinex | C(C)(O)c1ccc(C)cc1 |
Gallacetophenone | C(C)(=O)c1ccc(O)c(O)c1O |
Gallaflex | O(CCN(CC)(CC)CC)c1c(cccc1OCCN(CC)(CC)CC)OCCN(CC)(CC)CC |
Gallaldehyde 3,5-dimethyl ether | O(C)c1cc(C=O)cc(OC)c1O |
Gallaldehyde | C(=O)c1cc(O)c(O)c(O)c1 |
Gallamide | C(N)(=O)c1cc(O)c(O)c(O)c1 |
Gallamin (VAN) | O(CCN(CC)(CC)CC)c1c(cccc1OCCN(CC)(CC)CC)OCCN(CC)(CC)CC |
Gallamin triethiodide | O(CCN(CC)(CC)CC)c1c(cccc1OCCN(CC)(CC)CC)OCCN(CC)(CC)CC |
gallamine | A sub-index is available for gallamine... |
Gallamone triethiodide | O(CCN(CC)(CC)CC)c1c(cccc1OCCN(CC)(CC)CC)OCCN(CC)(CC)CC |
gallate | A sub-index is available for gallate... |
Gallein | O=C1OC3(c2ccccc12)c4ccc(O)c(O)c4Oc5c(O)c(O)ccc35 |
Gallenperlen | C(O)(CC)c1ccccc1 |
gallic | A sub-index is available for gallic... |
gallium | A sub-index is available for gallium... |
Gallo Sky Blue B | C(N)(=O)c1cc(O)c(O)c2oc3C=C(C=Cc3nc12)N(CC)CC |
Gallo Sky Blue S | C(N)(=O)c1cc(O)c(O)c2oc3C=C(C=Cc3nc12)N(CC)CC |
Galloacetophenone | C(C)(=O)c1ccc(O)c(O)c1O |
Gallobenzophenone | C(=O)(c1ccccc1)c2ccc(O)c(O)c2O |
Gallocyanin | C(=O)(O)c1cc(O)c(O)c2oc3cc(ccc3nc12)N(C)C |
gallocyanine | A sub-index is available for gallocyanine... |
Galloflavin | Oc1c(O)c(O)cc2C(=O)OC3=C(OC(=O)C(O)=C3)c12 |
Gallogen (VAN) | Oc1c(O)cc2C(=O)Oc3c(O)c(O)cc4C(=O)Oc1c2c34 |
Gallogen, astringent | Oc1c(O)cc2C(=O)Oc3c(O)c(O)cc4C(=O)Oc1c2c34 |
Gallopamil hydrochloride | C(C#N)(CCCN(C)CCc1ccc(OC)c(OC)c1)(C(C)C)c2cc(OC)c(OC)c(OC)c2 |
Gallopamil_hydrochloride | C(C#N)(CCCN(C)CCc1ccc(OC)c(OC)c1)(C(C)C)c2cc(OC)c(OC)c(OC)c2 |
Gallotox | OC(C)=O.c1ccccc1 |
m-Galloylgallic acid | O(C(=O)c1cc(O)c(O)c(O)c1)c2cc(cc(O)c2O)C(=O)O |
Galofak | C(=O)(O)C1N2C(=O)C(NC(=O)Cc3ccccc3)C2SC1(C)C |
Galoperidol | OC1(CCN(CCCC(=O)c2ccc(F)cc2)CC1)c3ccc(Cl)cc3 |
Galvanisone | C(CCC(=O)c1ccc(F)cc1)N2CCN(CC2)c3ccccc3 |
Galvinoxyl radical | C(C)(C)(C)C1=CC(=Cc2cc(c(O)c(c2)C(C)(C)C)C(C)(C)C)C=C(C1=O)C(C)(C)C |
Galvinoxyl | C(C)(C)(C)C1=CC(=Cc2cc(c(O)c(c2)C(C)(C)C)C(C)(C)C)C=C(C1=O)C(C)(C)C |
Gamabufagin | CC12CC(O)C3C(CCC4CC(O)CCC34C)C1(O)CCC2C5=COC(=O)C=C5 |
Gamabufogenin | CC12CC(O)C3C(CCC4CC(O)CCC34C)C1(O)CCC2C5=COC(=O)C=C5 |
Gamabufotalin | CC12CC(O)C3C(CCC4CC(O)CCC34C)C1(O)CCC2C5=COC(=O)C=C5 |
Gamaquil | C(CCOC(N)=O)c1ccccc1 |
Gamarex | C(CCN)C(=O)O |
Gamasol 90 | S(C)(C)=O |
Gamastan | C(CCN)C(=O)O |
Gamatran citrate | C(O)(CC(=O)O)(CC(=O)O)C(=O)O.CCN(CCCc1ccccc1)CCCc2ccccc2 |
Gamefar naphthoate | C(c1c(O)c(cc2ccccc12)C(=O)O)c3c(O)c(cc4ccccc34)C(=O)O.CCN(CC)CCCC(C)Nc5cc(OC)cc6cccnc56 |
Gamibetal | C(O)(CN)CC(=O)O |
Gaminal | C(O)(CN)CC(=O)O |
gamma | A sub-index is available for gamma... |
Gammabufotalin | CC12CC(O)C3C(CCC4CC(O)CCC34C)C1(O)CCC2C5=COC(=O)C=C5 |
Gammachlorobutyric acid | C(CCCl)C(=O)O |
Gammacorten | FC12C(O)CC3(C)C(CC(C)C3(O)C(=O)CO)C1CCC4=CC(=O)C=CC24C |
Gammagee | C(CCN)C(=O)O |
Gammalon | C(CCN)C(=O)O |
Gammalone | C(CCN)C(=O)O |
Gammaphos | S(CCNCCCN)P(=O)(O)O |
Gammar | C(CCN)C(=O)O |
Gammasol | C(CCN)C(=O)O |
Gamonil | O(C(=O)NC)c1cccc2ccccc12 |
Gamophen | C(c1c(Cl)c(Cl)cc(Cl)c1O)c2c(Cl)c(Cl)cc(Cl)c2O |
Gamophene | C(c1c(Cl)c(Cl)cc(Cl)c1O)c2c(Cl)c(Cl)cc(Cl)c2O |
Gamulin | C(CCN)C(=O)O |
Ganasag | C(NC(C)=O)C(=O)O.N=C(N)c1ccc(N=NNc2ccc(cc2)C(=N)N)cc1 |
Ganaseg | C(NC(C)=O)C(=O)O.N=C(N)c1ccc(N=NNc2ccc(cc2)C(=N)N)cc1 |
ganex | A sub-index is available for ganex... |
Gangesol | O=S1(=O)NC(Nc2cc(Cl)c(cc12)S(N)(=O)=O)C(Cl)Cl |
Gangliostat | C(CCCCCN(C)(C)C)N(C)(C)C |
Ganidan | S(=O)(=O)(NC(=N)N)c1ccc(N)cc1 |
Ganlion | C(CN(C)CCN(C)(C)CC)N(C)(C)CC |
Ganozan | CC.Cl |
Ganphen | C(C(C)N(C)C)N1c2ccccc2Sc3ccccc13 |
Gansil | S(=O)(=O)(NCl)c1ccc(C)cc1 |
Gantanol | S(=O)(=O)(NC1=NOC(C)=C1)c2ccc(N)cc2 |
component of Azo Gantanol | N(=Nc1ccccc1)c2ccc(N)nc2N |
Gantre M-154 | C(=C)OC |
gantrez | A sub-index is available for gantrez... |
gantrisin | A sub-index is available for gantrisin... |
Gantrisona | S(=O)(=O)(NC1=C(C)C(C)=NO1)c2ccc(N)cc2 |
Gantron S 860 | C(=C)N1CCCC1=O.C=COC(C)=O |
Gantrosan | S(=O)(=O)(NC1=C(C)C(C)=NO1)c2ccc(N)cc2 |
GANU | N(C(=O)N(N=O)CCCl)C1OC(CO)C(O)C(O)C1O |
Isol Benzidine Yellow Gapropyl | Clc1cc(ccc1N=NC(C(C)=O)C(=O)Nc2ccccc2)c3ccc(N=NC(C(C)=O)C(=O)Nc4ccccc4)c(Cl)c3 |
Garantose | O=S1(=O)NC(=O)c2ccccc12 |
Rat-Gard | C(CC(C)=O)(c1ccccc1)C2=C(O)c3ccccc3OC2=O |
Cenol garden dust | O=C1c2ccc3OC(Cc3c2OC4COc5cc(OC)c(OC)cc5C14)C(C)=C |
Garden Tox | O(c1cc(C)nc(n1)C(C)C)P(=S)(OCC)OCC |
Gardenal | C(C)C1(C(=O)NC(=O)NC1=O)c2ccccc2 |
Gardenin A | O(C)c1c(OC)c(OC)c(O)c2C(=O)C=C(Oc12)c3cc(OC)c(OC)c(OC)c3 |
Gardenin | O(C)c1c(OC)c(OC)c(O)c2C(=O)C=C(Oc12)c3cc(OC)c(OC)c(OC)c3 |
Gardeniol II | C(C)(OC(C)=O)c1ccccc1 |
Gardenol | C(C)(OC(C)=O)c1ccccc1 |
GARDENOSIDE | O(C1OC(CO)C(O)C(O)C1O)C2OC=C(C(=O)OC)C3C=CC(O)(CO)C23 |
Gardepanyl | C(C)C1(C(=O)NC(=O)NC1=O)c2ccccc2 |
GARDMULTINE | O(C)c1c(OC)cc(OC)c2N3CC8(OC34OCC5C6CC7N(CC6=CCOC)C5CC47c12)C9CC%10N(CC9=CC)C8CC%10%11C(=O)Nc%12c(OC)cc(OC)c(OC)c%11%12 |
Gardol | C(=O)(CCCCCCCCCCC)N(C)CC(=O)O |
Oil garlic | S(CC=C)CC=C |
garnet | A sub-index is available for garnet... |
Garrathion | P(=S)(OCC)(OCC)SCSc1ccc(Cl)cc1 |
GARRYFOLINE | C1COC2N1CC3(C)CCCC24C3CCC56CC(CCC45)C(=C)C6O |
Gallium selenide (GaSe) | [Ga]=[Se] |
Gallium_selenide_(GaSe) | [Ga]=[Se] |
Du Pont Gasoline Antioxidant No. 22 | N(C(C)CC)c1ccc(cc1)NC(C)CC |
Du Pont Gasoline Antioxidant No. 5 | N(CCCC)c1ccc(O)cc1 |
Du_Pont_Gasoline_Antioxidant_No._5 | N(CCCC)c1ccc(O)cc1 |
Gasstenon | C(=O)(CC)c1c(O)cc(O)cc1O |
Gastracid | N(=Nc1ccccc1)c2ccc(N)nc2N |
Gastrimade | C(O)(C(=O)OCCN(C)(CC)CC)(c1ccccc1)c2ccccc2 |
Gastrinide | O=C1c2ccccc2C(=O)N1C3CCC(=O)NC3=O |
Gastrix | C(O)(C(=O)OCC1=NCCCN1C)(C2CCCCC2)c3ccccc3 |
Gastrodyn | C(O)(C(=O)OC1CCN(C)(C)C1)(C2CCCC2)c3ccccc3 |
Gastrografin | N(C(C)=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I |
Gastrolena | O(C)c1cc2c(ccnc2c3cc(OCC)c(OCC)c(OCC)c3)cc1OC |
Gastron | C(=O)(OCCN(C)(CC)CC)C1c2ccccc2Oc3ccccc13 |
Gastropidil | C(O)(C(=O)OC1CCCN(C)(C)C1)(c2ccccc2)c3ccccc3 |
Gastrosedan | C(=O)(OCCN(C)(CC)CC)C1c2ccccc2Oc3ccccc13 |
Gastuloric | C(N)(CCC(=O)O)C(=O)O |
Gatalone | C(O)(C=NNC(=O)c1ccncc1)C2OC(=O)C(O)C2O |
Gatinon | N(C(=O)NC)C1=Nc2ccccc2S1 |
Gatnon | N(C(=O)NC)C1=Nc2ccccc2S1 |
Gaultheria Oil, artificial | C(=O)(OC)c1ccccc1O |
Gaultheria oil | C(=O)(OC)c1ccccc1O |
Gaultheriaoel | C(=O)(OC)c1ccccc1O |