If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Methylbenzophenone | C(=O)(c1ccccc1)c2ccccc2C |
4'-Methylbenzophenone-2-carboxylic acid | C(=O)(c1ccc(C)cc1)c2ccccc2C(=O)O |
4'-Methylbenzophenone-2-carboxylic_acid | C(=O)(c1ccc(C)cc1)c2ccccc2C(=O)O |
4-Hydroxy-4'-methylbenzophenone | C(=O)(c1ccc(C)cc1)c2ccc(O)cc2 |
4-Methylbenzophenone | C(=O)(c1ccccc1)c2ccc(C)cc2 |
o-Methylbenzophenone | C(=O)(c1ccccc1)c2ccccc2C |
p-Methylbenzophenone | C(=O)(c1ccccc1)c2ccc(C)cc2 |