If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Methyl-2-oxindole | CN1C(=O)Cc2ccccc12 |
2-Oxindole | O=C1Cc2ccccc2N1 |
3, 3-Bis(p-acetoxyphenyl)oxindole | O=C1Nc2ccccc2C1(c3ccc(cc3)OC(C)=O)c4ccc(cc4)OC(C)=O |
3, 3-Bis(p-hydroxyphenyl)oxindole | O=C1Nc2ccccc2C1(c3ccc(O)cc3)c4ccc(O)cc4 |
3,3-Bis(4-hydroxyphenyl)oxindole | O=C1Nc2ccccc2C1(c3ccc(O)cc3)c4ccc(O)cc4 |
3-(Phenylimino)oxindole | N(c1ccccc1)=C2C(=O)Nc3ccccc23 |
3-Oxindole | O=C1CNc2ccccc12 |
Oxindole | O=C1Cc2ccccc2N1 |
Oxindole, 3,3'-bis(p-hydroxyphenyl)-, diacetate | O=C1Nc2ccccc2C1(c3ccc(cc3)OC(C)=O)c4ccc(cc4)OC(C)=O |