If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Aminobiphenyl | Nc1ccccc1c2ccccc2 |
4'-Fluoro-4-aminobiphenyl | Fc1ccc(cc1)c2ccc(N)cc2 |
4-Acetamido-4'-aminobiphenyl | N(C(C)=O)c1ccc(cc1)c2ccc(N)cc2 |
4-Acetylamino-4'-aminobiphenyl | N(C(C)=O)c1ccc(cc1)c2ccc(N)cc2 |
4-Aminobiphenyl | Nc1ccc(cc1)c2ccccc2 |
N, N-Dimethyl-4-aminobiphenyl | N(C)(C)c1ccc(cc1)c2ccccc2 |
N-Acetyl-4-aminobiphenyl | N(C(C)=O)c1ccc(cc1)c2ccccc2 |
o-Aminobiphenyl | Nc1ccccc1c2ccccc2 |
p-Aminobiphenyl | Nc1ccc(cc1)c2ccccc2 |