If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Nitrilo-propionamide | C(C#N)C(N)=O |
Acetophenone, 2-nitrilo-3',4',5'-trimethoxy- | O(C)c1c(OC)cc(cc1OC)C(=O)C#N |
Nitrilo-2,2', 2''-triacetic acid | N(CC(=O)O)(CC(=O)O)CC(=O)O |
Nitrilo-2,2',2''-triethanol | N(CCO)(CCO)CCO |
Propionamide, 3-nitrilo- | C(C#N)C(N)=O |
Trispropionamide, 3,3',3''-nitrilo- | N(CCC(N)=O)(CCC(N)=O)CCC(N)=O |