If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Methyl-2-propyltrimethylene butylcarbamate carbamate | C(C)(CCC)(COC(N)=O)COC(=O)NCCCC |
Carbamic acid 2-methyl-2-propyltrimethylene ester | C(C)(CCC)(COC(N)=O)COC(N)=O |
Carbamic acid, 2-methyl-2-propyltrimethylene ester | C(C)(CCC)(COC(N)=O)COC(N)=O |
Carbamic_acid__2-methyl-2-propyltrimethylene_ester | C(C)(CCC)(COC(N)=O)COC(N)=O |
Carbonic acid, cyclic 2-methyl-2-propyltrimethylene ester | C(CC)C1(C)COC(=O)OC1 |
Carbonic_acid__cyclic_2-methyl-2-propyltrimethylene_ester | C(CC)C1(C)COC(=O)OC1 |
p-Tolueneboronic acid, cyclic 2-methyl-2-propyltrimethylene ester | C(CC)C1(C)COB(OC1)c2ccc(C)cc2 |
p-Tolueneboronic_acid__cyclic_2-methyl-2-propyltrimethylene_ester | C(CC)C1(C)COB(OC1)c2ccc(C)cc2 |