If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Furanmethanol | C(O)C1=CC=CO1 |
2-Furanmethanol, 5-ethenyltetrahydro-ALPHA_,ALPHA_,5-trimethyl- | C(=C)C1(C)CCC(O1)C(C)(C)O |
2-Furanmethanol, 5-nitro- | [N+](=O)([O-])C1=CC=C(CO)O1 |
2-Furanmethanol, ALPHA_-ethyl- | C(O)(CC)C1=CC=CO1 |
2-Furanmethanol, acetate | C(OC(C)=O)C1=CC=CO1 |
2-Furanmethanol, propanoate | C(OC(=O)CC)C1=CC=CO1 |
2-Furanmethanol, tetrahydro- | C(O)C1CCCO1 |
2-Furanmethanol, tetrahydro-, acetate | C(OC(C)=O)C1CCCO1 |
2-Furanmethanol, tetrahydro-, benzoate | C(=O)(OCC1CCCO1)c2ccccc2 |
2-Furanmethanol, tetrahydro-, phosphate (3:1) | P(=O)(OCC1CCCO1)(OCC2CCCO2)OCC3CCCO3 |
2-Furanmethanol__5-ethenyltetrahydro-ALPHA__ALPHA__5-trimethyl- | C(=C)C1(C)CCC(O1)C(C)(C)O |
2-Furanmethanol__tetrahydro-__benzoate | C(=O)(OCC1CCCO1)c2ccccc2 |
ALPHA_-Ethyl-2-furanmethanol | C(O)(CC)C1=CC=CO1 |
Tetrahydro-2-furanmethanol | C(O)C1CCCO1 |