If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Amacel Blue BNN | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Amacel Blue GG | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Amacel Brilliant Blue B | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Amacel Cerise B | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Amacel Developed Navy SD | O(C)c1cc(ccc1N)c2ccc(N)c(OC)c2 |
Amacel Green Blue B | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Amacel Green Blue G | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Amacel Heliotrope R | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Amacel Pink B | O=C1c2ccccc2C(=O)c3c(O)ccc(N)c13 |
Amacel Pure Blue B | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Amacel Scarlet GB | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Amacel Yellow CW | N(c1ccccc1)c2ccc(cc2[N+](=O)[O-])S(=O)(=O)Nc3ccccc3 |
Amacel Yellow RR | [N+](=O)([O-])c1cc(ccc1Nc2ccc(O)cc2)[N+](=O)[O-] |