If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Thiazolidinone, 5-(2-thienylmethylene)-2-thioxo- | C(C1=CC=CS1)=C2SC(=S)NC2=O |
4-Thiazolidinone__5-(2-thienylmethylene)-2-thioxo- | C(C1=CC=CS1)=C2SC(=S)NC2=O |
Benzenamine, 4-iodo-N-(2-thienylmethylene)- | N(=CC1=CC=CS1)c2ccc(I)cc2 |
Benzenamine__4-iodo-N-(2-thienylmethylene)- | N(=CC1=CC=CS1)c2ccc(I)cc2 |
Cyclohexanone, 2,6-bis(2-thienylmethylene)- | C(C1=CC=CS1)=C2CCCC(=CC3=CC=CS3)C2=O |
Cyclohexanone__2_6-bis(2-thienylmethylene)- | C(C1=CC=CS1)=C2CCCC(=CC3=CC=CS3)C2=O |
Ethanol, 2-((2-thienylmethylene)amino)- | C(=NCCO)C1=CC=CS1 |
Hydrazinecarbothioamide, 2-(2-thienylmethylene)- | C(=NNC(N)=S)C1=CC=CS1 |
Hydrazinecarbothioamide__2-(2-thienylmethylene)- | C(=NNC(N)=S)C1=CC=CS1 |