If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Aziridineacetamide, N,N'-1,7-heptanediylbis- | C(C(=O)NCCCCCCCNC(=O)CN1CC1)N2CC2 |
1-Aziridineacetamide__N_N'-1_7-heptanediylbis- | C(C(=O)NCCCCCCCNC(=O)CN1CC1)N2CC2 |
4, 7-Quinolinediamine, N(4),N(4')-1,7-heptanediylbis(2-methyl- | N(CCCCCCCNc1cc(C)nc2cc(N)ccc12)c3cc(C)nc4cc(N)ccc34 |
4, 7-Quinolinediamine, N4,N4'-1,7-heptanediylbis(2-methyl- | N(CCCCCCCNc1cc(C)nc2cc(N)ccc12)c3cc(C)nc4cc(N)ccc34 |
4__7-Quinolinediamine__N(4)_N(4')-1_7-heptanediylbis(2-methyl- | N(CCCCCCCNc1cc(C)nc2cc(N)ccc12)c3cc(C)nc4cc(N)ccc34 |