If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,2-Benzenedicarboxylic acid, 2-ethylhexyl hexyl ester | C(=O)(OCC(CC)CCCC)c1ccccc1C(=O)OCCCCCC |
1,3-Benzenediol, 4-hexyl- | C(CCCCC)c1ccc(O)cc1O |
1,3-Benzenediol, 5-hexyl- | C(CCCCC)c1cc(O)cc(O)c1 |
1,3-Benzodioxole, 2-hexyl-2-methyl- | C(CCCCC)C1(C)Oc2ccccc2O1 |
1,3-Dioxane, 2-hexyl-4-methyl- | C(CCCCC)C1OCCC(C)O1 |
1,3-Dioxolane, 2-hexyl- | C(CCCCC)C1OCCO1 |
1,3-Dioxolane, 2-hexyl-2,4, 5-trimethyl- | C(CCCCC)C1(C)OC(C)C(C)O1 |
1,3-Dioxolane, 2-hexyl-4,5-dimethyl- | C(CCCCC)C1OC(C)C(C)O1 |
1,3-Dioxolane, 2-hexyl-4-methyl- | C(CCCCC)C1OCC(C)O1 |
1,3-Dioxolane, 4, 5-dimethyl-2-hexyl- | C(CCCCC)C1OC(C)C(C)O1 |
1,3-Dioxolane, 4-(chloromethyl)-2-hexyl- | C(CCCCC)C1OCC(CCl)O1 |
1,3-Dioxolane-4-methanol, 2-hexyl-2-methyl- | C(CCCCC)C1(C)OCC(CO)O1 |
1-Hexanamine, N-hexyl- | N(CCCCCC)CCCCCC |
1-Hexanamine, N-hexyl-N-nitroso- | N(N=O)(CCCCCC)CCCCCC |
1-Hexanamine__N-hexyl- | N(CCCCCC)CCCCCC |
1-Hexanamine__N-hexyl-N-nitroso- | N(N=O)(CCCCCC)CCCCCC |
1-Hexyl acetate | C(CCCCC)OC(C)=O |
1-Hexyl alcohol | C(CCC)CCO |
1-Hexyl bromide | C(CCBr)CCC |
1-Hexyl iodide | C(CCC)CCI |
1-Hexyl isobutyrate | O(CCCCCC)C(=O)C(C)C |
1-Hexyl n-valerate | C(=O)(CCCC)OCCCCCC |
1-Hexyl pivalate | C(=O)(OCCCCCC)C(C)(C)C |
1H-Indene, 1-hexyl- | C(CCCCC)C1C=Cc2ccccc12 |
1H-Indene, 2-butyl-1-hexyl- | C(CCCCC)C1C(CCCC)=Cc2ccccc12 |
1H-Indene, 2-butyl-1-hexyl-2,3-dihydro- | C(CCCCC)C1C(CCCC)Cc2ccccc12 |
1H-Indene, 5-butyl-6-hexyl-2,3-dihydro- | C(CCCCC)c1cc2CCCc2cc1CCCC |
1H-Indene__1-hexyl- | C(CCCCC)C1C=Cc2ccccc12 |
1H-Indene__2-butyl-1-hexyl- | C(CCCCC)C1C(CCCC)=Cc2ccccc12 |
1H-Indene__2-butyl-1-hexyl-2_3-dihydro- | C(CCCCC)C1C(CCCC)Cc2ccccc12 |
1H-Indene__5-butyl-6-hexyl-2_3-dihydro- | C(CCCCC)c1cc2CCCc2cc1CCCC |
1H-Purine-2,6-dione, 8-hexyl-3,7-dihydro-1,3-dimethyl- | O=C1N(C)C(=O)N(C)C2=C1N=C(CCCCCC)N2 |
1H-Purine-2_6-dione__8-hexyl-3_7-dihydro-1_3-dimethyl- | O=C1N(C)C(=O)N(C)C2=C1N=C(CCCCCC)N2 |
1_2-Benzenedicarboxylic_acid__2-ethylhexyl_hexyl_ester | C(=O)(OCC(CC)CCCC)c1ccccc1C(=O)OCCCCCC |
1_3-Benzenediol__5-hexyl- | C(CCCCC)c1cc(O)cc(O)c1 |
1_3-Benzodioxole__2-hexyl-2-methyl- | C(CCCCC)C1(C)Oc2ccccc2O1 |
1_3-Dioxolane__2-hexyl-2_4__5-trimethyl- | C(CCCCC)C1(C)OC(C)C(C)O1 |
1_3-Dioxolane__4-(chloromethyl)-2-hexyl- | C(CCCCC)C1OCC(CCl)O1 |
1_3-Dioxolane__4__5-dimethyl-2-hexyl- | C(CCCCC)C1OC(C)C(C)O1 |
2,4,6(1H,3H, 5H)-Pyrimidinetrione, 5-ethyl-5-hexyl- | C(CCCCC)C1(CC)C(=O)NC(=O)NC1=O |
2-Butenoic acid, hexyl ester | C(=O)(C=CC)OCCCCCC |
2-Butenoic_acid__hexyl_ester | C(=O)(C=CC)OCCCCCC |
2-Cyanoethyl hexyl ether | C(CCCCC)OCCC#N |
2-Cyclopenten-1-one, 2-hexyl- | C(CCCCC)C1=CCCC1=O |
2-Ethyl-1-hexyl acetate | C(CC)(CCCC)COC(C)=O |
2-Ethyl-1-hexyl acrylate | C(CC)(CCCC)COC(=O)C=C |
2-Ethyl-1-hexyl methacrylate | C(CC)(CCCC)COC(=O)C(C)=C |
2-Hexyl-1,3-dioxolane | C(CCCCC)C1OCCO1 |
2-Hexyl-2-cyclopenten-1-one | C(CCCCC)C1=CCCC1=O |
2-Hexyl-2-cyclopentenone | C(CCCCC)C1=CCCC1=O |
2-Hexyl-4-methyl-1, 3-dioxane | C(CCCCC)C1OCCC(C)O1 |
2-Hexyl-4-methyl-1,3-dioxolan | C(CCCCC)C1OCC(C)O1 |
2-Propenoic acid, 2-methyl-, hexyl ester | O(CCCCCC)C(=O)C(C)=C |
2-Propenoic acid, hexyl ester | C(CCCCC)OC(=O)C=C |
2-Propenoic_acid__2-methyl-__hexyl_ester | O(CCCCCC)C(=O)C(C)=C |
2-Propenoic_acid__hexyl_ester | C(CCCCC)OC(=O)C=C |
2-n-Butyl-1-n-hexyl-(2,3-dihydroindene) | C(CCCCC)C1C(CCCC)Cc2ccccc12 |
2-n-Butyl-5-n-hexyl-(2, 3-dihydroindene) | C(CCC)C1Cc2ccc(CCCCCC)cc2C1 |
2-n-Butyl-5-n-hexyl-(2__3-dihydroindene) | C(CCC)C1Cc2ccc(CCCCCC)cc2C1 |
2-n-Butyl-5-n-hexyl-(hexahydroindan) | C(CCC)C1CC2CCC(CCCCCC)CC2C1 |
2-n-Hexyl-1,3-dioxolane | C(CCCCC)C1OCCO1 |
2-n-Hexyl-2-cyclopenten-1-one | C(CCCCC)C1=CCCC1=O |
2_4_6(1H_3H__5H)-Pyrimidinetrione__5-ethyl-5-hexyl- | C(CCCCC)C1(CC)C(=O)NC(=O)NC1=O |
3,5-Heptanedione, 4-(6-(2-chloro-4-methoxyphenoxy)hexyl)- | O(CCCCCCC(C(=O)CC)C(=O)CC)c1ccc(OC)cc1Cl |
3-Pyridinecarboxylic acid, hexyl ester | C(=O)(OCCCCCC)c1cccnc1 |
3-Pyridinecarboxylic_acid__hexyl_ester | C(=O)(OCCCCCC)c1cccnc1 |
3_5-Heptanedione__4-(6-(2-chloro-4-methoxyphenoxy)hexyl)- | O(CCCCCCC(C(=O)CC)C(=O)CC)c1ccc(OC)cc1Cl |
4(1H)-Pyrimidinone, 2-amino-5-hexyl-6-methyl- | C(CCCCC)c1c(C)nc(N)nc1O |
4(1H)-Pyrimidinone__2-amino-5-hexyl-6-methyl- | C(CCCCC)c1c(C)nc(N)nc1O |
4-((6-(Diethylamino)hexyl)amino)-6-methoxybenzothiazole oxalate | C(=O)(O)C(=O)O.CCN(CC)CCCCCCNc1cc(OC)cc2SC=Nc12 |
4-(1-Hexyl)resorcinol | C(CCCCC)c1ccc(O)cc1O |
4-(6-(2-Chloro-4-methoxyphenoxy)hexyl)-3,5-heptanedione | O(CCCCCCC(C(=O)CC)C(=O)CC)c1ccc(OC)cc1Cl |
4-Hexyl-1,3-dihydroxybenzene | C(CCCCC)c1ccc(O)cc1O |
4-Hexyl-4-butanolide | C(CCCCC)C1CCC(=O)O1 |
4-Hexyl-GAMMA_-butyrolactone | C(CCCCC)C1CCC(=O)O1 |
4-Imidazolidinone, 5-hexyl-3-phenyl-2-thioxo- | O=C1C(CCCCCC)NC(=S)N1c2ccccc2 |
4-Imidazolidinone__5-hexyl-3-phenyl-2-thioxo- | O=C1C(CCCCCC)NC(=S)N1c2ccccc2 |
4-Methyl-2-hexyl-1,3-dioxane | C(CCCCC)C1OCCC(C)O1 |
4-Pyrimidinol, 2-amino-5-hexyl-6-methyl- | C(CCCCC)c1c(C)nc(N)nc1O |
5-n-Butyl-6-n-hexyl-(2,3-dihydroindene) | C(CCCCC)c1cc2CCCc2cc1CCCC |
ALPHA_-n-Hexyl-BETA_-phenylacrolein | C(=C(C=O)CCCCCC)c1ccccc1 |
Acetamide, N-hexyl- | C(CCCCC)NC(C)=O |
Acetamide__N-hexyl- | C(CCCCC)NC(C)=O |
Acetic acid, hexyl ester | C(CCCCC)OC(C)=O |
Acetic_acid__hexyl_ester | C(CCCCC)OC(C)=O |
Acrylic acid, hexyl ester | C(CCCCC)OC(=O)C=C |
Anthranilic acid, hexyl ester | C(=O)(OCCCCCC)c1ccccc1N |
Aziridine, 1-hexyl- | C(CCCCC)N1CC1 |
Aziridine__1-hexyl- | C(CCCCC)N1CC1 |
Barbituric acid, 5-ethyl-5-hexyl- | C(CCCCC)C1(CC)C(=O)NC(=O)NC1=O |
Benzene, (1 hexyl-1-heptenyl)- | C(CCCCCC)(=CCCCCC)c1ccccc1 |
Benzene, hexyl- | C(CCCCC)c1ccccc1 |
Benzene__(1_hexyl-1-heptenyl)- | C(CCCCCC)(=CCCCCC)c1ccccc1 |
Benzeneacetic acid, ALPHA_-hydroxy-, hexyl ester | C(O)(C(=O)OCCCCCC)c1ccccc1 |
Benzeneacetic acid, hexyl ester | C(C(=O)OCCCCCC)c1ccccc1 |
Benzeneacetic_acid__ALPHA_-hydroxy-__hexyl_ester | C(O)(C(=O)OCCCCCC)c1ccccc1 |
Benzeneacetic_acid__hexyl_ester | C(C(=O)OCCCCCC)c1ccccc1 |
Benzeneethanol, ALPHA_-hexyl- | C(C(O)CCCCCC)c1ccccc1 |
Benzeneethanol__ALPHA_-hexyl- | C(C(O)CCCCCC)c1ccccc1 |
Benzoic acid, 2-amino-, hexyl ester | C(=O)(OCCCCCC)c1ccccc1N |
Benzoic acid, 4-hexyl- | C(=O)(O)c1ccc(CCCCCC)cc1 |
Benzoic acid, p-hexyl- | C(=O)(O)c1ccc(CCCCCC)cc1 |
Benzoic_acid__2-amino-__hexyl_ester | C(=O)(OCCCCCC)c1ccccc1N |
Benzoic_acid__p-hexyl- | C(=O)(O)c1ccc(CCCCCC)cc1 |
Benzothiazole, 4-((6-(diethylamino)hexyl)amino)-6-methoxy-, oxalate | C(=O)(O)C(=O)O.CCN(CC)CCCCCCNc1cc(OC)cc2SC=Nc12 |
Bicyclo(4.3.0)nonane, 8-butyl-3-hexyl- | C(CCC)C1CC2CCC(CCCCCC)CC2C1 |
Bicyclo(4.3.0)nonane__8-butyl-3-hexyl- | C(CCC)C1CC2CCC(CCCCCC)CC2C1 |
Bis(1-hexyl)ether | O(CCCCCC)CCCCCC |
Butanamide, N-hexyl- | C(=O)(CCC)NCCCCCC |
Butanamide__N-hexyl- | C(=O)(CCC)NCCCCCC |
Butyramide, N-hexyl- | C(=O)(CCC)NCCCCCC |
Catechol, methyl hexyl ketal | C(CCCCC)C1(C)Oc2ccccc2O1 |
Cinnamaldehyde, ALPHA_-hexyl- | C(=C(C=O)CCCCCC)c1ccccc1 |
Crotonic acid, hexyl ester | C(=O)(C=CC)OCCCCCC |
Cyclohexanamine, 4-hexyl-, sulfate (2:1) | S(=O)(=O)(O)O.CCCCCCC1CCC(N)CC1 |
Cyclohexanamine__4-hexyl-__sulfate_(2:1) | S(=O)(=O)(O)O.CCCCCCC1CCC(N)CC1 |
Cyclohexane, (6-cyclopentyl-3-(3-cyclopentylpropyl)hexyl)- | C(CCCC1CCCC1)(CCCC2CCCC2)CCC3CCCCC3 |
Cyclohexane, hexyl- | C(CCCCC)C1CCCCC1 |
Cyclohexane, n-hexyl- | C(CCCCC)C1CCCCC1 |
Cyclohexane__(6-cyclopentyl-3-(3-cyclopentylpropyl)hexyl)- | C(CCCC1CCCC1)(CCCC2CCCC2)CCC3CCCCC3 |
Cyclohexane__n-hexyl- | C(CCCCC)C1CCCCC1 |
Di-N-hexyl-diselenide | [Se](CCCCCC)[Se]CCCCCC |
Di-n-hexyl ether | O(CCCCCC)CCCCCC |
Di-n-hexyl phthalate | C(=O)(OCCCCCC)c1ccccc1C(=O)OCCCCCC |
Di-n-hexyl sulfide | S(CCCCCC)CCCCCC |
Diethylene glycol hexyl ether | O(CCCCCC)CCOCCO |
Diethylene glycol mono(n-hexyl) ether | O(CCCCCC)CCOCCO |
Diethylene glycol n-hexyl ether | O(CCCCCC)CCOCCO |
Diethylene_glycol_mono(n-hexyl)_ether | O(CCCCCC)CCOCCO |
Docosane, 7-hexyl- | C(CCCCCC)(CCCCCC)CCCCCCCCCCCCCCC |
Docosane__7-hexyl- | C(CCCCCC)(CCCCCC)CCCCCCCCCCCCCCC |
Eicosane, 7-hexyl- | C(CCCCCC)(CCCCCC)CCCCCCCCCCCCC |
Eicosane__7-hexyl- | C(CCCCCC)(CCCCCC)CCCCCCCCCCCCC |
Ether, hexyl vinyl | C(CCCC)COC=C |
Formamide, N-2-hexyl- | C(C)(NC=O)CCCC |
Formic acid, hexyl ester | C(CCCC)COC=O |
Formic_acid__hexyl_ester | C(CCCC)COC=O |
GAMMA_-Hexyl-GAMMA_-butyrolactone | C(CCCCC)C1CCC(=O)O1 |
GAMMA_-N-Hexyl-GAMMA_-butyrolactone | C(CCCCC)C1CCC(=O)O1 |
Heptadecane, 9-hexyl- | C(CCCCCC)(CCCCCCCC)CCCCCCCC |
Heptadecane__9-hexyl- | C(CCCCCC)(CCCCCCCC)CCCCCCCC |
Hexanoic acid, 2-ethyl-, hexyl ester | C(CC)(CCCC)C(=O)OCCCCCC |
Hexanoic acid, hexyl ester | C(=O)(CCCCC)OCCCCCC |
Hexanoic_acid__2-ethyl-__hexyl_ester | C(CC)(CCCC)C(=O)OCCCCCC |
Hexanoic_acid__hexyl_ester | C(=O)(CCCCC)OCCCCCC |
Hexyl (VAN) | N(c1c(cc(cc1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])c2c(cc(cc2[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
Hexyl (reagent) | N(c1c(cc(cc1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])c2c(cc(cc2[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
Hexyl 2-butenoate | C(=O)(C=CC)OCCCCCC |
Hexyl 2-ethylhexanoate | C(CC)(CCCC)C(=O)OCCCCCC |
Hexyl 2-methyl-2-propenoate | O(CCCCCC)C(=O)C(C)=C |
Hexyl 2-propenoate | C(CCCCC)OC(=O)C=C |
Hexyl acetate | C(CCCCC)OC(C)=O |
Hexyl acrylate | C(CCCCC)OC(=O)C=C |
Hexyl alcohol | C(CCC)CCO |
Hexyl alcohol, acetate | C(CCCCC)OC(C)=O |
Hexyl borate, (C6H13O)3 B | B(OCCCCCC)(OCCCCCC)OCCCCCC |
Hexyl borate, tri- | B(OCCCCCC)(OCCCCCC)OCCCCCC |
Hexyl bromide | C(CCBr)CCC |
Hexyl bromide, 6-chloro- | C(CCBr)CCCCl |
Hexyl caproate | C(=O)(CCCCC)OCCCCCC |
Hexyl carbitol | O(CCCCCC)CCOCCO |
Hexyl cinnamic aldehyde (VAN) | C(=C(C=O)CCCCCC)c1ccccc1 |
Hexyl crotonate | C(=O)(C=CC)OCCCCCC |
Hexyl cyanide | C(CCC)CCC#N |
Hexyl ethanoate | C(CCCCC)OC(C)=O |
Hexyl ether | O(CCCCCC)CCCCCC |
Hexyl formate | C(CCCC)COC=O |
Hexyl hexanoate | C(=O)(CCCCC)OCCCCCC |
Hexyl hexoate | C(=O)(CCCCC)OCCCCCC |
Hexyl hydride | C(CC)CCC |
Hexyl iodide | C(CCC)CCI |
Hexyl isobutyrate | O(CCCCCC)C(=O)C(C)C |
Hexyl isocyanide | C(CCC)CCN#C |
Hexyl isopropyl ketone | C(=O)(CCCCCC)C(C)C |
Hexyl ketone | C(CCCCC)C(=O)CCCCCC |
Hexyl mandelate | C(O)(C(=O)OCCCCCC)c1ccccc1 |
Hexyl methacrylate | O(CCCCCC)C(=O)C(C)=C |
Hexyl methyl ketone | C(CCCC)CC(C)=O |
Hexyl neopentanoate | C(=O)(OCCCCCC)C(C)(C)C |
Hexyl nicotinate | C(=O)(OCCCCCC)c1cccnc1 |
Hexyl orthoborate | B(OCCCCCC)(OCCCCCC)OCCCCCC |
Hexyl pentanoate | C(=O)(CCCC)OCCCCCC |
Hexyl phenylacetate | C(C(=O)OCCCCCC)c1ccccc1 |
Hexyl phosphite ((C6H13O)3P) | P(OCCCCCC)(OCCCCCC)OCCCCCC |
Hexyl phosphite, (C6H13O)3P | P(OCCCCCC)(OCCCCCC)OCCCCCC |
Hexyl pivalate | C(=O)(OCCCCCC)C(C)(C)C |
Hexyl selenide | [Se](CCCCCC)CCCCCC |
Hexyl silicate | [Si](OCCCCCC)(OCCCCCC)(OCCCCCC)OCCCCCC |
Hexyl sulfide | S(CCCCCC)CCCCCC |
Hexyl valerate | C(=O)(CCCC)OCCCCCC |
Hexyl valerianate | C(=O)(CCCC)OCCCCCC |
Hexyl_isopropyl_ketone | C(=O)(CCCCCC)C(C)C |
Hexyl_silicate | [Si](OCCCCCC)(OCCCCCC)(OCCCCCC)OCCCCCC |
Indan, 2-butyl-5-hexyl- | C(CCC)C1Cc2ccc(CCCCCC)cc2C1 |
Isobutyric acid, hexyl ester | O(CCCCCC)C(=O)C(C)C |
Lactic acid, hexyl ester, lactate (ester) | C(C)(OC(=O)C(C)O)C(=O)OCCCCCC |
Malonic acid, hexyl- | C(CCCCCC)(C(=O)O)C(=O)O |
Malonic acid, hexyl-, diethyl ester | C(CCCCCC)(C(=O)OCC)C(=O)OCC |
Mandelic acid, hexyl ester | C(O)(C(=O)OCCCCCC)c1ccccc1 |
Methacrylic acid, hexyl ester | O(CCCCCC)C(=O)C(C)=C |
Methyl hexyl ketone | C(CCCC)CC(C)=O |
Methyl n-hexyl ketone | C(CCCC)CC(C)=O |
Naphthalene, 2-butyl-3-hexyl- | C(CCCCC)c1cc2ccccc2cc1CCCC |
Naphthalene, 7-butyl-1-hexyl-1,2,3,4-tetrahydro- | C(CCCCC)C1CCCc2ccc(CCCC)cc12 |
Naphthalene__7-butyl-1-hexyl-1_2_3_4-tetrahydro- | C(CCCCC)C1CCCc2ccc(CCCC)cc12 |
Nicotinic acid, hexyl ester | C(=O)(OCCCCCC)c1cccnc1 |
Oxirane, hexyl- | C(CCCCC)C1CO1 |
Pentadecane, 8-hexyl- | C(CCCCCC)(CCCCCCC)CCCCCCC |
Pentadecane__8-hexyl- | C(CCCCCC)(CCCCCCC)CCCCCCC |
Pentanoic acid, hexyl ester | C(=O)(CCCC)OCCCCCC |
Pentanoic_acid__hexyl_ester | C(=O)(CCCC)OCCCCCC |
Perylene, 3-hexyl- | C(CCCCC)c1ccc2c3cccc4cccc(c5cccc1c25)c34 |
Perylene__3-hexyl- | C(CCCCC)c1ccc2c3cccc4cccc(c5cccc1c25)c34 |
Phosphinic acid, bis(1-aziridinyl)-, hexyl ester (8CI 9CI) | P(=O)(N(CCCC)CCCC)(N1CC1)N2CC2 |
Phosphinic acid, bis(1-aziridinyl)-, hexyl ester | P(=O)(OCCCCCC)(N1CC1)N2CC2 |
Phosphinic amide, P,P-bis(1-aziridinyl)-N-hexyl- (8CI 9CI) | P(=O)(NCCCCCC)(N1CC1)N2CC2 |
Phosphinic_acid__bis(1-aziridinyl)-__hexyl_ester_(8CI_9CI) | P(=O)(N(CCCC)CCCC)(N1CC1)N2CC2 |
Phosphinic_amide__P_P-bis(1-aziridinyl)-N-hexyl-_(8CI_9CI) | P(=O)(NCCCCCC)(N1CC1)N2CC2 |
Phosphoramidic acid, hexyl-, diethyl ester | P(=O)(OCC)(OCC)NCCCCCC |
Phosphoramidic_acid__hexyl-__diethyl_ester | P(=O)(OCC)(OCC)NCCCCCC |
Pivalic acid, hexyl ester | C(=O)(OCCCCCC)C(C)(C)C |
Propanedioic acid, hexyl- | C(CCCCCC)(C(=O)O)C(=O)O |
Propanedioic acid, hexyl-, diethyl ester | C(CCCCCC)(C(=O)OCC)C(=O)OCC |
Propanedioic_acid__hexyl-__diethyl_ester | C(CCCCCC)(C(=O)OCC)C(=O)OCC |
Propanoic acid, 2,2-dimethyl-, hexyl ester | C(=O)(OCCCCCC)C(C)(C)C |
Propanoic acid, 2-methyl-, hexyl ester | O(CCCCCC)C(=O)C(C)C |
Propanoic_acid__2-methyl-__hexyl_ester | O(CCCCCC)C(=O)C(C)C |
Propanoic_acid__2_2-dimethyl-__hexyl_ester | C(=O)(OCCCCCC)C(C)(C)C |
Resorcinol, 4-hexyl- | C(CCCCC)c1ccc(O)cc1O |
S-Hexyl p-toluenethiosulfonate | S(=O)(=O)(SCCCCCC)c1ccc(C)cc1 |
Silane, hexyl- | C(CCC)CC[Si] |
Silane__hexyl- | C(CCC)CC[Si] |
Sulfide, 2,4-dinitrophenyl hexyl | [N+](=O)([O-])c1cc(ccc1SCCCCCC)[N+](=O)[O-] |
Sulfide__2_4-dinitrophenyl_hexyl | [N+](=O)([O-])c1cc(ccc1SCCCCCC)[N+](=O)[O-] |
Theophylline, 8-hexyl- | O=C1N(C)C(=O)N(C)C2=C1N=C(CCCCCC)N2 |
Thiocyanic acid, hexyl ester | C(CCCC)CSC#N |
Thiocyanic_acid__hexyl_ester | C(CCCC)CSC#N |
Thiourea, N-hexyl-N'-phenyl- | N(C(=S)NCCCCCC)c1ccccc1 |
Tri-n-hexyl borate | B(OCCCCCC)(OCCCCCC)OCCCCCC |
Tridecane, 7-hexyl- | C(CCCCCC)(CCCCCC)CCCCCC |
Tridecane__7-hexyl- | C(CCCCCC)(CCCCCC)CCCCCC |
Urea, 1-hexyl-3-phenyl-2-thio- | N(C(=S)NCCCCCC)c1ccccc1 |
Urea, N-hexyl- | C(CCCCC)NC(N)=O |
Urea, hexyl- | C(CCCCC)NC(N)=O |
Urea__1-hexyl-3-phenyl-2-thio- | N(C(=S)NCCCCCC)c1ccccc1 |
Urea__N-hexyl- | C(CCCCC)NC(N)=O |
Valeric acid, hexyl ester | C(=O)(CCCC)OCCCCCC |
Vinyl hexyl ether | C(CCCC)COC=C |
Xanthine, 1,3-dimethyl-8-hexyl- | O=C1N(C)C(=O)N(C)C2=C1N=C(CCCCCC)N2 |
m-Dioxane, 2-hexyl-2,4-dimethyl- | C(CCCCC)C1(C)OCCC(C)O1 |
m-Dioxane, 2-hexyl-4-methyl- | C(CCCCC)C1OCCC(C)O1 |
m-Dioxane__2-hexyl-2_4-dimethyl- | C(CCCCC)C1(C)OCCC(C)O1 |
n-Hexyl Carbitol | O(CCCCCC)CCOCCO |
n-Hexyl acetate | C(CCCCC)OC(C)=O |
n-Hexyl acrylate | C(CCCCC)OC(=O)C=C |
n-Hexyl alcohol | C(CCC)CCO |
n-Hexyl anthranilate | C(=O)(OCCCCCC)c1ccccc1N |
n-Hexyl bromide | C(CCBr)CCC |
n-Hexyl ethanoate | C(CCCCC)OC(C)=O |
n-Hexyl ether | O(CCCCCC)CCCCCC |
n-Hexyl formate | C(CCCC)COC=O |
n-Hexyl hexanoate | C(=O)(CCCCC)OCCCCCC |
n-Hexyl iodide | C(CCC)CCI |
n-Hexyl isobutyrate | O(CCCCCC)C(=O)C(C)C |
n-Hexyl methanoate | C(CCCC)COC=O |
n-Hexyl methyl ketone | C(CCCC)CC(C)=O |
n-Hexyl o-aminobenzoate | C(=O)(OCCCCCC)c1ccccc1N |
n-Hexyl phenylacetate | C(C(=O)OCCCCCC)c1ccccc1 |
n-Hexyl_alcohol | C(CCC)CCO |
n-Hexyl_methyl_ketone | C(CCCC)CC(C)=O |
p-Toluenesulfonic acid, thio-, S-hexyl ester | S(=O)(=O)(SCCCCCC)c1ccc(C)cc1 |
p-Toluenesulfonic_acid__thio-__S-hexyl_ester | S(=O)(=O)(SCCCCCC)c1ccc(C)cc1 |
sec-Hexyl alcohol | C(CC)(CC)CO |
sec-Hexyl_alcohol | C(CCC)C(C)O |