If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
WLN: WNR DOR BNW BXFFF | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2[N+](=O)[O-])C(F)(F)F |
WLN: WNR DQ BXFFF | C(F)(F)(F)c1cc(O)ccc1[N+](=O)[O-] |
WLN: T6NJ D- AL3TJ BXQR&R &GH | C(O)(c1ccccc1)(c2ccccc2)C3CC3c4ccncc4 |
WLN: T5SJ BXQVO2K2&2&1&- AL5TJ &Q &E | C(O)(C(=O)OCCN(C)(CC)CC)(C1CCCC1)C2=CC=CS2 |
WLN: L E5 B765 A 1B P BXTJ AOV1 DQ EQ F1 F1 GQ JQ J1 OQ O1 | O(C(C)=O)C1C2CCC3C(C)(O)C4CC(O)C(C)(C)C4(O)C(O)CC13CC2(C)O |
WLN: L E5 B765 A 1B P BXTJ AQ DQ EQ F1 F1 GQ JQ J1 OQ O1 | OC1C2CCC3C(C)(O)C4CC(O)C(C)(C)C4(O)C(O)CC13CC2(C)O |