If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Bromo-3,5-resorcylamide | C(N)(=O)c1cc(O)c(Br)c(O)c1 |
ALPHA_-Resorcylamide | C(N)(=O)c1cc(O)cc(O)c1 |
ALPHA_-Resorcylamide, 4-bromo- | C(N)(=O)c1cc(O)c(Br)c(O)c1 |
BETA_-Resorcylamide | C(N)(=O)c1ccc(O)cc1O |
GAMMA_-Resorcylamide | C(N)(=O)c1c(O)cccc1O |