If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Phenylallyl alcohol | C(O)(C=C)c1ccccc1 |
3-Phenylallyl alcohol | C(=CCO)c1ccccc1 |
3-Phenylallyl isovalerate | C(=CCOC(=O)CC(C)C)c1ccccc1 |
ALPHA_-Phenylallyl alcohol | C(O)(C=C)c1ccccc1 |
GAMMA_-Phenylallyl acetate | C(=CCOC(C)=O)c1ccccc1 |
GAMMA_-Phenylallyl alcohol | C(=CCO)c1ccccc1 |
GAMMA_-Phenylallyl formate | C(=CCOC=O)c1ccccc1 |
GAMMA_-Phenylallyl_alcohol | C(=CCO)c1ccccc1 |
Phenylallyl cinnamate | C(=CC(=O)OCC=Cc1ccccc1)c2ccccc2 |
Phenylallyl(dichloro)silane | [Si](Cl)(Cl)(CC=C)c1ccccc1 |