If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(2-Chloroethyl)dimethylamine hydrochloride | C(CCl)N(C)C |
(2-Chloroethyl)dimethylamine monohydrochloride | C(CCl)N(C)C |
(2-Chloropropyl)dimethylamine hydrochloride | C(C(C)Cl)N(C)C |
(2-Chloropropyl)dimethylamine monohydrochloride | C(C(C)Cl)N(C)C |
(2-Hydroxybenzyl)dimethylamine | C(N(C)C)c1ccccc1O |
(2-Hydroxyethyl)dimethylamine | C(CO)N(C)C |
(3-Hydroxyphenyl)dimethylamine | N(C)(C)c1cccc(O)c1 |
(ALPHA_-Methylbenzyl)dimethylamine | C(C)(N(C)C)c1ccccc1 |
(BETA_-Chloroethyl)dimethylamine hydrochloride | C(CCl)N(C)C |
(BETA_-Chloroisopropyl)dimethylamine-hydrochloride | C(C)(CCl)N(C)C |
(Chloroethyl)dimethylamine hydrochloride | C(CCl)N(C)C |
4, 4'-Imidocarbonylbis(N,N-dimethylamine) monohydrochloride | C(=N)(c1ccc(cc1)N(C)C)c2ccc(cc2)N(C)C |
Borane, compd. with dimethylamine (1:1) | BN(C)C |
Carbamic acid, dimethyldithio-, compd. with dimethylamine (1:1) | N(C)C.S=C(S)N(C)C |
Carbamic acid, dimethyldithio-, dimethylamine salt (1:1) | N(C)C.S=C(S)N(C)C |
DIMETHYLAMINE | N(C)C |
Dimethylamine (anhydrous) | N(C)C |
Dimethylamine anhydrous (DOT) | N(C)C |
Dimethylamine aqueous solution(DOT) | N(C)C |
Dimethylamine benzhydryl ester hydrochloride | C(OCCN(C)C)(c1ccccc1)c2ccccc2 |
Dimethylamine borane | BN(C)C |
Dimethylamine compound with borane (1:1) | BN(C)C |
Dimethylamine dimethyldithiocarbamate | N(C)C.S=C(S)N(C)C |
Dimethylamine hydrobromide | N(C)C |
Dimethylamine sulfonate | S(=O)(=O)(O)N(C)C |
Dimethylamine | N(C)C |
Dimethylamine, N,N',N'', N'''-diborane(4)diylidenetetrakis- | B(N(C)C)(N(C)C)B(N(C)C)N(C)C |
Dimethylamine, N,N',N'',N'''-silanetetrayltetrakis- | [Si](N(C)C)(N(C)C)(N(C)C)N(C)C |
Dimethylamine, N-nitro- | N(C)(C)[N+](=O)[O-] |
Dimethylamine, N-nitroso- | N(C)(C)N=O |
Dimethylamine, compd. with borane (1:1) | BN(C)C |
Dimethylamine, hydrobromide | N(C)C |
Dimethylamine__N_N'_N''_N'''-silanetetrayltetrakis- | [Si](N(C)C)(N(C)C)(N(C)C)N(C)C |
Dimethylamine__N_N'_N''__N'''-diborane(4)diylidenetetrakis- | B(N(C)C)(N(C)C)B(N(C)C)N(C)C |
Dimethylamine_aqueous_solution(DOT) | N(C)C |
Dimethyldithiocarbamic acid compd with dimethylamine (1:1) | N(C)C.S=C(S)N(C)C |
Dimethyldithiocarbamic acid compd. with dimethylamine (1:1) | N(C)C.S=C(S)N(C)C |
Dimethyldithiocarbamic acid dimethylamine salt | N(C)C.S=C(S)N(C)C |
Methylenebis(dimethylamine) | C(N(C)C)N(C)C |
Monolauryl dimethylamine | C(CCCCCCCCC)CCN(C)C |
N-(2-Aminoethyl)-N,N-dimethylamine | C(CN)N(C)C |
N-(2-Aminoethyl)-N_N-dimethylamine | C(CN)N(C)C |
N-(2-Hydroxyethyl)dimethylamine | C(CO)N(C)C |
N-(2-Mercaptoethyl)dimethylamine hydrochloride | C(CS)N(C)C |
N-(3,5-Di-tert-butyl-4-hydroxybenzyl)dimethylamine | C(C)(C)(C)c1cc(CN(C)C)cc(c1O)C(C)(C)C |
N-(Cyanomethyl)dimethylamine | C(C#N)N(C)C |
N-Allyl-N,N-dimethylamine | C(C=C)N(C)C |
N-Nitroso-N,N-dimethylamine | N(C)(C)N=O |
Oleamidopropyl Dimethylamine | C(CCCCCCC=CCCCCCCCC)C(=O)NCCCN(C)C |
Stilbenyl-N,N-dimethylamine | C(=Cc1ccccc1)c2ccc(cc2)N(C)C |
o-Phenylenebis(dimethylamine) | N(C)(C)c1ccccc1N(C)C |