If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Mercaptobenzimidazole zinc salt (2:1) | S=C1Nc2ccccc2N1 |
2-Mercaptobenzimidazole zinc salt | S=C1Nc2ccccc2N1 |
2-Mercaptobenzimidazole | S=C1Nc2ccccc2N1 |
5-Amino-2-mercaptobenzimidazole | S=C1Nc2ccc(N)cc2N1 |
5-Chloro-2-mercaptobenzimidazole | S=C1Nc2ccc(Cl)cc2N1 |
5-Nitro-2-mercaptobenzimidazole | [N+](=O)([O-])c1ccc2NC(=S)Nc2c1 |
Mercaptobenzimidazole zinc salt | S=C1Nc2ccccc2N1 |
Mercaptobenzimidazole | S=C1Nc2ccccc2N1 |
S-Methyl-2-mercaptobenzimidazole | S(C)C1=Nc2ccccc2N1 |
Zinc mercaptobenzimidazole | S=C1Nc2ccccc2N1 |