If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1-Octen-3-ol | C(O)(C=C)CCCCC |
1-Octen-3-one, 4-methyl-1-phenyl-, (E)- | C(=CC(=O)C(C)CCCC)c1ccccc1 |
1-Octen-3-one__4-methyl-1-phenyl-__(E)- | C(=CC(=O)C(C)CCCC)c1ccccc1 |
2, 6-Dimethyl-2-octen-8-yl formate | C(C)(CCOC=O)CCC=C(C)C |
2,6-Dimethyl-2-octen-8-ol | C(C)(CCO)CCC=C(C)C |
2,6-Dimethyl-2-octen-8-ol, butyrate | C(C)(CCC=C(C)C)CCOC(=O)CCC |
2,6-Dimethyl-2-octen-8-yl butyrate | C(C)(CCC=C(C)C)CCOC(=O)CCC |
2-Octen-4-ol | C(O)(C=CC)CCCC |
2-Octen-8-ol, 2, 6-dimethyl-, acetate | C(C)(CCC=C(C)C)CCOC(C)=O |
3, 7-Dimethyl-6-octen-1-ol | C(C)(CCO)CCC=C(C)C |
3,6-Dimethyl-6-octen-3-ol | C(CC(C)=CC)C(C)(O)CC |
3,7-Dimethyl-6-octen-1-yl acetate | C(C)(CCC=C(C)C)CCOC(C)=O |
3,7-Dimethyl-6-octen-1-yl formate | C(C)(CCOC=O)CCC=C(C)C |
3-Octen-2-ol, (E)- | C(CCCC)=CC(C)O |
3-Octen-2-ol__(E)- | C(CCCC)=CC(C)O |
3-Octen-5-yne, 2,7-dimethyl-, (E)- | C(C#CC(C)C)=CC(C)C |
3-Octen-5-yne__2_7-dimethyl-__(E)- | C(C#CC(C)C)=CC(C)C |
6-Octen-1-ol, 3,7-dimethyl- | C(C)(CCO)CCC=C(C)C |
6-Octen-1-ol, 3,7-dimethyl-, acetate | C(C)(CCC=C(C)C)CCOC(C)=O |
6-Octen-1-ol, 3,7-dimethyl-, butyrate | C(C)(CCC=C(C)C)CCOC(=O)CCC |
6-Octen-1-ol, 3,7-dimethyl-, formate | C(C)(CCOC=O)CCC=C(C)C |
6-Octen-1-ol__3_7-dimethyl- | C(C)(CCO)CCC=C(C)C |
6-Octen-3-ol, 3,6-dimethyl- | C(CC(C)=CC)C(C)(O)CC |
6-Octen-3-ol__3_6-dimethyl- | C(CC(C)=CC)C(C)(O)CC |
Acetic acid, 3,7-dimethyl-6-octen-1-yl ester | C(C)(CCC=C(C)C)CCOC(C)=O |
Acetic_acid__3_7-dimethyl-6-octen-1-yl_ester | C(C)(CCC=C(C)C)CCOC(C)=O |
Formic acid, 3,7-dimethyl-6-octen-1-yl ester | C(C)(CCOC=O)CCC=C(C)C |
Formic_acid__3_7-dimethyl-6-octen-1-yl_ester | C(C)(CCOC=O)CCC=C(C)C |