If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(2-Aminoethyl)isothiuronium bromide hydrobromide | S(CCN)C(=N)N |
(2-Aminoethyl)isothiuronium dihydrobromide | S(CCN)C(=N)N |
1, 4-Butylene-bis-phenyl isothiuronium dihydrobromide | N(C(=N)SCCCCSC(=N)Nc1ccccc1)c2ccccc2 |
1, 5-Pentamethylenebisphenyl isothiuronium dihydrobromide | N(C(=N)SCCCCCSC(=N)Nc1ccccc1)c2ccccc2 |
1,3-Propylenebisphenyl isothiuronium dihydrobromide | N(C(=N)SCCCSC(=N)Nc1ccccc1)c2ccccc2 |
2-(BETA_-Aminoethyl)isothiuronium bromide hydrobromide | S(CCN)C(=N)N |
Isothiuronium bromide, aminoethyl-, hydrobromide | S(CCN)C(=N)N |
Podophyllotoxin isothiuronium bromide | O=C1OCC2C1C(c3cc(OC)c(OC)c(OC)c3)c4cc5OCOc5cc4C2SC(=N)N |
Podophyllotoxin_isothiuronium_bromide | O=C1OCC2C1C(c3cc(OC)c(OC)c(OC)c3)c4cc5OCOc5cc4C2SC(=N)N |
S-(2-Aminoethyl)isothiuronium bromide hydrobromide | S(CCN)C(=N)N |
S-(BETA_-Aminoethyl)isothiuronium bromide hydrobromide | S(CCN)C(=N)N |
S-(BETA_-Aminoethyl)isothiuronium bromohydrate | S(CCN)C(=N)N |
S-(BETA_-N-Phenylcarboxamidoethyl)isothiuronium bromide | N(C(=O)CCSC(=N)N)c1ccccc1 |