If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Pentanaminium, N,N,N-tripentyl-, chloride | N(CCCCC)(CCCCC)(CCCCC)CCCCC |
1-Pentanaminium__N_N_N-tripentyl-__chloride | N(CCCCC)(CCCCC)(CCCCC)CCCCC |
Boric acid (H3BO3), tripentyl ester | B(OCCCCC)(OCCCCC)OCCCCC |
Boric_acid_(H3BO3)__tripentyl_ester | B(OCCCCC)(OCCCCC)OCCCCC |
Phosphine oxide, tripentyl- | P(=O)(CCCCC)(CCCCC)CCCCC |
Phosphine_oxide__tripentyl- | P(=O)(CCCCC)(CCCCC)CCCCC |
Phosphoric acid, tripentyl ester | P(=O)(OCCCCC)(OCCCCC)OCCCCC |
Phosphoric_acid__tripentyl_ester | P(=O)(OCCCCC)(OCCCCC)OCCCCC |
Tripentyl borate ((C5H11O)3B) | B(OCCCCC)(OCCCCC)OCCCCC |
Tripentyl borate | B(OCCCCC)(OCCCCC)OCCCCC |