If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Benzyl fumarate | C(OC(=O)C=CC(=O)OCc1ccccc1)c2ccccc2 |
Butyl fumarate | C(=O)(OCCCC)C=CC(=O)OCCCC |
Diallyl fumarate | C(=O)(OCC=C)C=CC(=O)OCC=C |
Dibenzyl fumarate | C(OC(=O)C=CC(=O)OCc1ccccc1)c2ccccc2 |
Dibutyl fumarate | C(=O)(OCCCC)C=CC(=O)OCCCC |
Diethyl fumarate | C(=O)(OCC)C=CC(=O)OCC |
Diisobutyl fumarate | C(=O)(OCC(C)C)C=CC(=O)OCC(C)C |
Diisopropyl fumarate | C(=O)(C=CC(=O)OC(C)C)OC(C)C |
Dimethyl fumarate | C(=O)(OC)C=CC(=O)OC |
Ethyl fumarate | C(=O)(OCC)C=CC(=O)OCC |
Methafurylene Fumarate | C(=CC(=O)O)C(=O)O.CN(C)CCN(CC1=CC=CO1)c2ccccn2 |
Methyl fumarate | C(=O)(OC)C=CC(=O)OC |
Monomethyl fumarate | C(=O)(OC)C=CC(=O)O |
Propionitrile, 3-amino-, fumarate (1:1) | C(=CC(=O)O)C(=O)O.NCCC#N |