If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Amino-4-chloroanisole | O(C)c1ccc(Cl)cc1N |
2-Chloroanisole | O(C)c1ccccc1Cl |
2-Nitro-5-chloroanisole | O(C)c1cc(Cl)ccc1[N+](=O)[O-] |
4-Chloroanisole | O(C)c1ccc(Cl)cc1 |
o-Chloroanisole | O(C)c1ccccc1Cl |
p-Chloroanisole | O(C)c1ccc(Cl)cc1 |