If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,3-Benzodioxole, 2-methyl-2-pentyl- | C(CCCC)C1(C)Oc2ccccc2O1 |
1,3-Dioxane, 4,4,6-trimethyl-2-pentyl- | C(CCCC)C1OC(C)CC(C)(C)O1 |
1,3-Dioxane, 4-methyl-2-pentyl- | C(CCCC)C1OCCC(C)O1 |
1,3-Dioxolane, 4-(chloromethyl)-2-methyl-2-pentyl- | C(CCCC)C1(C)OCC(CCl)O1 |
1,3-Dioxolane-4-methanol, 2-methyl-2-pentyl- | C(CCCC)C1(C)OCC(CO)O1 |
1,3-Dioxolane-4-methanol, 2-methyl-2-pentyl-, acetate | C(CCCC)C1(C)OCC(COC(C)=O)O1 |
1-Heptanenitrile, 2-methyl-2-pentyl- | C(C)(C#N)(CCCCC)CCCCC |
1-Heptanenitrile__2-methyl-2-pentyl- | C(C)(C#N)(CCCCC)CCCCC |
1-Pentanamine, N-nitroso-N-pentyl- | N(N=O)(CCCCC)CCCCC |
1-Pentanamine, N-pentyl- | N(CCCCC)CCCCC |
1-Pentanamine__N-nitroso-N-pentyl- | N(N=O)(CCCCC)CCCCC |
1-Pentanamine__N-pentyl- | N(CCCCC)CCCCC |
1-Pentyl acetate | C(CCCC)OC(C)=O |
1-Pentyl alcohol | C(CC)CCO |
1-Pentyl bromide | C(CBr)CCC |
1-Pentyl butyrate | C(=O)(CCC)OCCCCC |
1-Pentyl iodide | C(CC)CCI |
1-Pentyl isovalerate | O(CCCCC)C(=O)CC(C)C |
1-Pentyl n-valerate | O(CCCCC)C(=O)CCCC |
1-Pentyl-3-nitro-1-nitrosoguanidine | N(N=O)(CCCCC)C(=N)NN(O)O |
11-(3'-n-Pentyl)heneicosane | C(CCCCCCCCCC)(CCCCCCCCCC)C(CC)CC |
1H-Imidazole-4-carboxamide, 5-(3-methyl-3-pentyl-1-triazenyl)- | N(=NN(C)CCCCC)C1=C(NC=N1)C(N)=O |
1H-Imidazole-4-carboxamide__5-(3-methyl-3-pentyl-1-triazenyl)- | N(=NN(C)CCCCC)C1=C(NC=N1)C(N)=O |
1H-Pyrazolo(1, 2-a)cinnoline-1,3(2H)-dione, 2-pentyl-6-phenyl- | O=C1C(CCCCC)C(=O)N2C=C(c3ccccc3)c4ccccc4N12 |
1H-Pyrazolo(1__2-a)cinnoline-1_3(2H)-dione__2-pentyl-6-phenyl- | O=C1C(CCCCC)C(=O)N2C=C(c3ccccc3)c4ccccc4N12 |
1H-Pyrazolo(4,3-d)pyrimidin-7-amine, 3-methyl-N-pentyl- | N(CCCCC)c1ncnc2C(C)=NNc12 |
1H-Pyrazolo(4_3-d)pyrimidin-7-amine__3-methyl-N-pentyl- | N(CCCCC)c1ncnc2C(C)=NNc12 |
1_3-Dioxane__4_4_6-trimethyl-2-pentyl- | C(CCCC)C1OC(C)CC(C)(C)O1 |
1_3-Dioxolane-4-methanol__2-methyl-2-pentyl-__acetate | C(CCCC)C1(C)OCC(COC(C)=O)O1 |
1_3-Dioxolane__4-(chloromethyl)-2-methyl-2-pentyl- | C(CCCC)C1(C)OCC(CCl)O1 |
2,4,6(1H,3H, 5H)-Pyrimidinetrione, 5-(1-methylethenyl)-5-pentyl- | C(CCCC)C1(C(C)=C)C(=O)NC(=O)NC1=O |
2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-pentyl- | C(CCCC)C1(CC)C(=O)NC(=O)NC1=O |
2,4-D Pentyl ester | O(CC(=O)OCCCCC)c1ccc(Cl)cc1Cl |
2,4-Dichlorophenoxyacetic acid, amyl(pentyl) ester | O(CC(=O)OCCCCC)c1ccc(Cl)cc1Cl |
2,5-Pyrrolidinedione, 1-pentyl- | C(CCCC)N1C(=O)CCC1=O |
2-(3-Pentyl)isothiazolidine-1,1-dioxide | C(CC)(CC)N1CCCS1(=O)=O |
2-(3-Pentyl)pyridine | C(CC)(CC)c1ccccn1 |
2-Cyclopenten-1-one, 3-methyl-2-pentyl- | C(CCCC)C1=C(C)CCC1=O |
2-Cyclopenten-1-one__3-methyl-2-pentyl- | C(CCCC)C1=C(C)CCC1=O |
2-Methyl-2-pentyl-1,3-dioxolane-4-methanol | C(CCCC)C1(C)OCC(CO)O1 |
2-Pentyl bromide | C(CC)C(Br)C |
2-Pentyl p-toluenesulfonate | S(=O)(=O)(OC(C)CCC)c1ccc(C)cc1 |
2-Pentyl-2-methylheptanonitrile | C(C)(C#N)(CCCCC)CCCCC |
2-Pentyl-6-phenyl-1H-pyrazolo(1,2-a)cinnoline-1,3(2H)-dione | O=C1C(CCCCC)C(=O)N2C=C(c3ccccc3)c4ccccc4N12 |
2-Propenoic acid, 2-methyl-, pentyl ester | C(=O)(OCCCCC)C(C)=C |
2-Propenoic acid, 3-phenyl-, pentyl ester | C(=CC(=O)OCCCCC)c1ccccc1 |
2-Propenoic acid, pentyl ester | C(=O)(C=C)OCCCCC |
2-Propenoic_acid__2-methyl-__pentyl_ester | C(=O)(OCCCCC)C(C)=C |
2-Propenoic_acid__3-phenyl-__pentyl_ester | C(=CC(=O)OCCCCC)c1ccccc1 |
2-Propenoic_acid__pentyl_ester | C(=O)(C=C)OCCCCC |
2-Pyrrolidinecarboxylic acid, 5-oxo-3-pentyl-4-phenyl- | C(CCCC)C1C(NC(=O)C1c2ccccc2)C(=O)O |
2-Pyrrolidinecarboxylic_acid__5-oxo-3-pentyl-4-phenyl- | C(CCCC)C1C(NC(=O)C1c2ccccc2)C(=O)O |
2-tert-Pentyl mercaptan | C(C)(C)(S)CC |
2_4-Dichlorophenoxyacetic_acid__amyl(pentyl)_ester | O(CC(=O)OCCCCC)c1ccc(Cl)cc1Cl |
2_4_6(1H_3H_5H)-Pyrimidinetrione__5-ethyl-5-pentyl- | C(CCCC)C1(CC)C(=O)NC(=O)NC1=O |
2_4_6(1H_3H__5H)-Pyrimidinetrione__5-(1-methylethenyl)-5-pentyl- | C(CCCC)C1(C(C)=C)C(=O)NC(=O)NC1=O |
2_5-Pyrrolidinedione__1-pentyl- | C(CCCC)N1C(=O)CCC1=O |
3-Pentyl acetate | C(CC)(CC)OC(C)=O |
3-Pentyl alcohol | C(O)(CC)CC |
3-Pentyl-3, 5-dinitrobenzoate | C(=O)(OC(CC)CC)c1cc(cc(c1)[N+](=O)[O-])[N+](=O)[O-] |
4-Methyl-2-pentyl acetate | C(C(C)C)C(C)OC(C)=O |
4-Methyl-2-pentyl-1,3-dioxane | C(CCCC)C1OCCC(C)O1 |
5-(sec-Pentyl)barbituric acid | C(C)(CCC)C1C(=O)NC(=O)NC1=O |
5-Aethyl-5-pentyl-(2')-barbitursaeure(GERMAN) | C(CCCC)C1(CC)C(=O)NC(=O)NC1=O |
5-Benzofuranol, 2,3-dihydro-2-(4-morpholinyl)-3-pentyl- | C(CCCC)C1c2cc(O)ccc2OC1N3CCOCC3 |
5-Benzofuranol__2_3-dihydro-2-(4-morpholinyl)-3-pentyl- | C(CCCC)C1c2cc(O)ccc2OC1N3CCOCC3 |
5-Chloro-1-pentyl acetate | C(CCCCCl)OC(C)=O |
5-Ethyl-5-(sec-pentyl)barbituric acid | C(C)(CCC)C1(CC)C(=O)NC(=O)NC1=O |
6,6, 9-Trimethyl-3-pentyl-6H-dibenzo(b,d)pyran-1-ol | Oc1cc(CCCCC)cc2OC(C)(C)c3ccc(C)cc3c12 |
6H-Dibenzo(b, d)pyran-1-ol, 6,6,9-trimethyl-3-pentyl- | Oc1cc(CCCCC)cc2OC(C)(C)c3ccc(C)cc3c12 |
6H-Purine-6-thione, 1,9-dihydro-9-pentyl- | C(CCCC)N1C=Nc2c(S)ncnc12 |
6H-Purine-6-thione__1_9-dihydro-9-pentyl- | C(CCCC)N1C=Nc2c(S)ncnc12 |
9-Octadecenoic acid (Z)-, pentyl ester | C(CCCCCCC=CCCCCCCCC)C(=O)OCCCCC |
9-Octadecenoic acid, pentyl ester, (E)- | C(CCCCCCC=CCCCCCCCC)C(=O)OCCCCC |
9-Octadecenoic_acid_(Z)-__pentyl_ester | C(CCCCCCC=CCCCCCCCC)C(=O)OCCCCC |
9-Octadecenoic_acid__pentyl_ester__(E)- | C(CCCCCCC=CCCCCCCCC)C(=O)OCCCCC |
9H-Purine-6-thiol, 9-pentyl- | C(CCCC)N1C=Nc2c(S)ncnc12 |
Acetamide, N-pentyl-N-phenyl- | N(CCCCC)(C(C)=O)c1ccccc1 |
Acetamide__N-pentyl-N-phenyl- | N(CCCCC)(C(C)=O)c1ccccc1 |
Acetanilide, N-pentyl- | N(CCCCC)(C(C)=O)c1ccccc1 |
Acetic acid, (2, 4,5-trichlorophenoxy)-, pentyl ester | O(CC(=O)OCCCCC)c1cc(Cl)c(Cl)cc1Cl |
Acetic acid, (2,4-dichlorophenoxy)-, pentyl ester | O(CC(=O)OCCCCC)c1ccc(Cl)cc1Cl |
Acetic acid, pentyl ester (mixed isomers) | C(CCCC)OC(C)=O |
Acetic acid, pentyl ester | C(CCCC)OC(C)=O |
Acetic acid, phenyl-, pentyl ester | C(C(=O)OCCCCC)c1ccccc1 |
Acetic acid, thiocyanato-, pentyl ester | O(CCCCC)C(=O)CSC#N |
Acetic_acid__(2__4_5-trichlorophenoxy)-__pentyl_ester | O(CC(=O)OCCCCC)c1cc(Cl)c(Cl)cc1Cl |
Acetic_acid__pentyl_ester_(mixed_isomers) | C(CCCC)OC(C)=O |
Acetic_acid__phenyl-__pentyl_ester | C(C(=O)OCCCCC)c1ccccc1 |
Acetophenone, 4'-pentyl- | C(CCCC)c1ccc(cc1)C(C)=O |
Acrylic acid, pentyl ester | C(=O)(C=C)OCCCCC |
Amyl(pentyl) 2,4-dichlorophenoxyacetate | O(CC(=O)OCCCCC)c1ccc(Cl)cc1Cl |
Anisic acid, pentyl ester | C(=O)(OCCCCC)c1ccc(OC)cc1 |
Barbituric acid, 5-ethyl-5-pentyl- | C(CCCC)C1(CC)C(=O)NC(=O)NC1=O |
Barbituric acid, 5-ethyl-5-sec-pentyl-, sodium salt | C(C)(CCC)C1(CC)C(=O)NC(=O)NC1=O |
Barbituric acid, 5-isopropenyl-5-pentyl- | C(CCCC)C1(C(C)=C)C(=O)NC(=O)NC1=O |
Benzene, pentyl- | C(CCCC)c1ccccc1 |
Benzene, tert-pentyl- | C(C)(C)(CC)c1ccccc1 |
Benzeneacetic acid, pentyl ester | C(C(=O)OCCCCC)c1ccccc1 |
Benzenebutanoic acid, 4-(bis(2-chloroethyl)amino)-, pentyl ester | N(CCCl)(CCCl)c1ccc(cc1)CCCC(=O)OCCCCC |
Benzenebutanoic_acid__4-(bis(2-chloroethyl)amino)-__pentyl_ester | N(CCCl)(CCCl)c1ccc(cc1)CCCC(=O)OCCCCC |
Benzoic acid, 2-hydroxy-, pentyl ester | C(=O)(OCCCCC)c1ccccc1O |
Benzoic acid, 4-methoxy-, pentyl ester | C(=O)(OCCCCC)c1ccc(OC)cc1 |
Benzoic acid, 4-pentyl- | C(CCCC)c1ccc(cc1)C(=O)O |
Benzoic_acid__2-hydroxy-__pentyl_ester | C(=O)(OCCCCC)c1ccccc1O |
Benzoic_acid__4-methoxy-__pentyl_ester | C(=O)(OCCCCC)c1ccc(OC)cc1 |
Benzoic_acid__4-pentyl- | C(CCCC)c1ccc(cc1)C(=O)O |
Boric acid, tri-n-pentyl ester | B(OCCCCC)(OCCCCC)OCCCCC |
Boric acid, tris(4-methyl-2-pentyl) ester | B(OC(C)CC(C)C)(OC(C)CC(C)C)OC(C)CC(C)C |
Butanamide, N-pentyl- | C(=O)(CCC)NCCCCC |
Butanamide, N-pentyl-N-phenyl- | N(CCCCC)(C(=O)CCC)c1ccccc1 |
Butanamide__N-pentyl- | C(=O)(CCC)NCCCCC |
Butanamide__N-pentyl-N-phenyl- | N(CCCCC)(C(=O)CCC)c1ccccc1 |
Butanoic acid, 3-methyl-, pentyl ester | O(CCCCC)C(=O)CC(C)C |
Butanoic acid, pentyl ester | C(=O)(CCC)OCCCCC |
Butanoic_acid__3-methyl-__pentyl_ester | O(CCCCC)C(=O)CC(C)C |
Butanoic_acid__pentyl_ester | C(=O)(CCC)OCCCCC |
Butyramide, N-pentyl- | C(=O)(CCC)NCCCCC |
Butyranilide, N-pentyl- | N(CCCCC)(C(=O)CCC)c1ccccc1 |
Butyric acid, pentyl ester | C(=O)(CCC)OCCCCC |
Carbamic acid, pentyl ester | C(CCCC)OC(N)=O |
Carbamic acid, pentyl-, ethyl ester | C(=O)(OCC)NCCCCC |
Carbamic_acid__pentyl-__ethyl_ester | C(=O)(OCC)NCCCCC |
Carbamic_acid__pentyl_ester | C(CCCC)OC(N)=O |
Carbonic acid, dithio-, O-pentyl ester, potassium salt | C(CCCC)OC(=S)S |
Carbonic_acid__dithio-__O-pentyl_ester__potassium_salt | C(CCCC)OC(=S)S |
Carbonochloridic acid, pentyl ester | C(CCCC)OC(Cl)=O |
Carbonochloridic_acid__pentyl_ester | C(CCCC)OC(Cl)=O |
Carbonodithioic acid, O-pentyl ester, potassium salt | C(CCCC)OC(=S)S |
Cinnamaldehyde, ALPHA_-pentyl- | C(=C(C=O)CCCCC)c1ccccc1 |
Cinnamic acid, pentyl ester | C(=CC(=O)OCCCCC)c1ccccc1 |
Cyclohexane, tert-pentyl- | C(C)(C)(CC)C1CCCCC1 |
Cyclohexanol, 4-pentyl- | C(CCCC)C1CCC(O)CC1 |
Cyclohexanol, 4-tert-pentyl- | C(C)(C)(CC)C1CCC(O)CC1 |
Cyclohexanol__4-pentyl- | C(CCCC)C1CCC(O)CC1 |
Cyclohexanol__4-tert-pentyl- | C(C)(C)(CC)C1CCC(O)CC1 |
Cyclohexanone, 4-tert-pentyl- | C(C)(C)(CC)C1CCC(=O)CC1 |
Cyclopentane, n-pentyl- | C(CCCC)C1CCCC1 |
Cyclopentane, pentyl- | C(CCCC)C1CCCC1 |
Cyclopentane__n-pentyl- | C(CCCC)C1CCCC1 |
Di-n-Pentyl ketone | C(CCCCC)C(=O)CCCC |
Di-n-Pentyl_ketone | C(CCCCC)C(=O)CCCC |
Di-n-pentyl ether | O(CCCCC)CCCCC |
Di-n-pentyl phthalate | C(=O)(OCCCCC)c1ccccc1C(=O)OCCCCC |
Dodecanoic acid, pentyl ester | C(=O)(OCCCCC)CCCCCCCCCCC |
Dodecanoic_acid__pentyl_ester | C(=O)(OCCCCC)CCCCCCCCCCC |
Ethanol, 2-(2-nitro-4-(tert-pentyl)phenoxy)- | O(CCO)c1ccc(cc1[N+](=O)[O-])C(C)(C)CC |
Ether, di-n-pentyl- | O(CCCCC)CCCCC |
Ether, ethyl pentyl | C(CCC)COCC |
Ether__ethyl_pentyl | C(CCC)COCC |
Ethyl n-pentyl ketone | C(=O)(CC)CCCCC |
Ethyl pentyl ether | C(CCC)COCC |
Ethyl pentyl ketone | C(=O)(CC)CCCCC |
Ethyl_n-pentyl_ketone | C(=O)(CC)CCCCC |
Formamide, N-pentyl-N-phenyl- | N(C=O)(CCCCC)c1ccccc1 |
Formamide__N-pentyl-N-phenyl- | N(C=O)(CCCCC)c1ccccc1 |
Formanilide, N-pentyl- | N(C=O)(CCCCC)c1ccccc1 |
Formic acid, chloro-, pentyl ester | C(CCCC)OC(Cl)=O |
Formic acid, pentyl ester | C(CCC)COC=O |
Formic_acid__pentyl_ester | C(CCC)COC=O |
Glycine, N-(1-oxo-5-(1H-purin-6-ylthio)pentyl)-, ethyl ester | S(CCCCC(=O)NCC(=O)OCC)c1ncnc2NC=Nc12 |
Glycine__N-(1-oxo-5-(1H-purin-6-ylthio)pentyl)-__ethyl_ester | S(CCCCC(=O)NCC(=O)OCC)c1ncnc2NC=Nc12 |
Guanidine, 3-nitro-1-nitroso-1-pentyl- | N(N=O)(CCCCC)C(=N)NN(O)O |
Guanidine, N'-nitro-N-nitroso-N-pentyl- | N(N=O)(CCCCC)C(=N)NN(O)O |
Guanidine, N-nitro-N'-pentyl- | N(CCCCC)C(=N)NN(O)O |
Guanidine__N'-nitro-N-nitroso-N-pentyl- | N(N=O)(CCCCC)C(=N)NN(O)O |
Guanidine__N-nitro-N'-pentyl- | N(CCCCC)C(=N)NN(O)O |
Heneicosane, 11-pentyl- | C(CCCCC)(CCCCCCCCCC)CCCCCCCCCC |
Heneicosane__11-pentyl- | C(CCCCC)(CCCCCCCCCC)CCCCCCCCCC |
Heptanenitrile, 2-methyl-2-pentyl- | C(C)(C#N)(CCCCC)CCCCC |
Heptanoic acid, 2-pentyl- | C(CCCCC)(CCCCC)C(=O)O |
Heptanoic acid, pentyl ester | C(CCCCC)C(=O)OCCCCC |
Heptanoic_acid__2-pentyl- | C(CCCCC)(CCCCC)C(=O)O |
Heptanoic_acid__pentyl_ester | C(CCCCC)C(=O)OCCCCC |
Hexanoic acid, pentyl ester | C(=O)(CCCCC)OCCCCC |
Hexanoic_acid__pentyl_ester | C(=O)(CCCCC)OCCCCC |
Hydroquinone, 2, 5-di-tert-pentyl- | C(C)(C)(CC)c1cc(O)c(cc1O)C(C)(C)CC |
Imidazole-4-carboxamide, 5-(3-methyl-3-pentyl-1-triazeno)- | N(=NN(C)CCCCC)C1=C(NC=N1)C(N)=O |
Isopropyl pentyl ketone | C(=O)(CCCCC)C(C)C |
Isopropyl_pentyl_ketone | C(=O)(CCCCC)C(C)C |
Isothiazolidine, 2-(3-pentyl)-, 1,1-dioxide | C(CC)(CC)N1CCCS1(=O)=O |
Isovaleric acid, pentyl ester | O(CCCCC)C(=O)CC(C)C |
Ketone, methyl pentyl | C(CCCC)C(C)=O |
Lactic acid, pentyl ester | C(=O)(OCCCCC)C(C)O |
Lauric acid, pentyl ester | C(=O)(OCCCCC)CCCCCCCCCCC |
Malonic acid, pentyl- | C(CCCCC)(C(=O)O)C(=O)O |
Methacrylic acid, pentyl ester | C(=O)(OCCCCC)C(C)=C |
Methanesulfonic acid, pentyl ester | C(CCCC)OS(C)(=O)=O |
Methanesulfonic_acid__pentyl_ester | C(CCCC)OS(C)(=O)=O |
Methyl n-pentyl ketone | C(CCCC)C(C)=O |
Methyl n-pentyl sulfide | C(CCC)CSC |
Methyl pentyl ketone | C(CCCC)C(C)=O |
Methyl pentyl sulfide | C(CCC)CSC |
Octanoic acid, pentyl ester | C(CCCCCC)C(=O)OCCCCC |
Octanoic_acid__pentyl_ester | C(CCCCCC)C(=O)OCCCCC |
Oleic acid, pentyl ester | C(CCCCCCC=CCCCCCCCC)C(=O)OCCCCC |
Oxirane, pentyl- | C(CCCC)C1CO1 |
Pentanoic acid, pentyl ester | O(CCCCC)C(=O)CCCC |
Pentanoic_acid__pentyl_ester | O(CCCCC)C(=O)CCCC |
Pentyl (2, 4-dichlorophenoxy)acetate | O(CC(=O)OCCCCC)c1ccc(Cl)cc1Cl |
Pentyl 2-methyl-2-propenoate | C(=O)(OCCCCC)C(C)=C |
Pentyl 2-propenoate | C(=O)(C=C)OCCCCC |
Pentyl 3-methylbutyrate | O(CCCCC)C(=O)CC(C)C |
Pentyl acetate | C(CCCC)OC(C)=O |
Pentyl acrylate | C(=O)(C=C)OCCCCC |
Pentyl alcohol | C(CC)CCO |
Pentyl borate, (C5H11O)3 B | B(OCCCCC)(OCCCCC)OCCCCC |
Pentyl borate, (C5H11O)3B | B(OCCCCC)(OCCCCC)OCCCCC |
Pentyl bromide | C(CBr)CCC |
Pentyl butanoate | C(=O)(CCC)OCCCCC |
Pentyl butyrate | C(=O)(CCC)OCCCCC |
Pentyl caproate | C(=O)(CCCCC)OCCCCC |
Pentyl carbamate | C(CCCC)OC(N)=O |
Pentyl chloride | C(CC)CCCl |
Pentyl chloroformate | C(CCCC)OC(Cl)=O |
Pentyl cinnamate | C(=CC(=O)OCCCCC)c1ccccc1 |
Pentyl cyanide | C(CCC)CC#N |
Pentyl dihydrogen phosphate | C(CCCC)OP(=O)(O)O |
Pentyl ether | O(CCCCC)CCCCC |
Pentyl formate | C(CCC)COC=O |
Pentyl hexanoate | C(=O)(CCCCC)OCCCCC |
Pentyl iodide | C(CC)CCI |
Pentyl laurate | C(=O)(OCCCCC)CCCCCCCCCCC |
Pentyl methyl ketone | C(CCCC)C(C)=O |
Pentyl octanoate | C(CCCCCC)C(=O)OCCCCC |
Pentyl pentanoate | O(CCCCC)C(=O)CCCC |
Pentyl phenyl ketone | C(=O)(CCCCC)c1ccccc1 |
Pentyl phenylacetate | C(C(=O)OCCCCC)c1ccccc1 |
Pentyl phosphate, (C5H11O)(OH)2PO | C(CCCC)OP(=O)(O)O |
Pentyl propanate | C(=O)(CC)OCCCCC |
Pentyl propionate | C(=O)(CC)OCCCCC |
Pentyl salicylate | C(=O)(OCCCCC)c1ccccc1O |
Pentyl silicate ((C5H11O)4Si) | [Si](OCCCCC)(OCCCCC)(OCCCCC)OCCCCC |
Pentyl sodium sulfate | C(CCCC)OS(=O)(=O)O |
Pentyl sodium sulphate | C(CCCC)OS(=O)(=O)O |
Pentyl sulfone | C(CCCC)S(=O)(=O)CCCCC |
Pentyl valerate | O(CCCCC)C(=O)CCCC |
Pentyl | C(C)(CCC)C1(CC)C(=O)NC(=O)NC1=O |
Pentyl_phosphate__(C5H11O)(OH)2PO | C(CCCC)OP(=O)(O)O |
Pentylamine, pentyl- | N(CCCCC)CCCCC |
Phenol, 2, 4-di-tert-pentyl- | C(C)(C)(CC)c1cc(ccc1O)C(C)(C)CC |
Phenol, 2-chloro-4-tert-pentyl- | C(C)(C)(CC)c1ccc(O)c(Cl)c1 |
Phenol, 2-pentyl- | C(CCCC)c1ccccc1O |
Phenol, o-pentyl- | C(CCCC)c1ccccc1O |
Phenol, p-(tert-pentyl)- | C(C)(C)(CC)c1ccc(O)cc1 |
Phenol, p-tert-pentyl- | C(C)(C)(CC)c1ccc(O)cc1 |
Phenol__o-pentyl- | C(CCCC)c1ccccc1O |
Potassium pentyl xanthate | C(CCCC)OC(=S)S |
Potassium pentyl xanthogenate | C(CCCC)OC(=S)S |
Propanamide, N-pentyl-N-phenyl- | N(CCCCC)(C(=O)CC)c1ccccc1 |
Propanamide__N-pentyl-N-phenyl- | N(CCCCC)(C(=O)CC)c1ccccc1 |
Propanedioic acid, pentyl- | C(CCCCC)(C(=O)O)C(=O)O |
Propanoic acid, 2-hydroxy-, pentyl ester | C(=O)(OCCCCC)C(C)O |
Propanoic acid, pentyl ester | C(=O)(CC)OCCCCC |
Propanoic_acid__2-hydroxy-__pentyl_ester | C(=O)(OCCCCC)C(C)O |
Propanoic_acid__pentyl_ester | C(=O)(CC)OCCCCC |
Propiolic acid, pentyl ester | C(CCCCC)#CC(=O)O |
Propiolic acid, pentyl- | C(CCCCC)#CC(=O)O |
Propiolic_acid__pentyl_ester | C(CCCCC)#CC(=O)O |
Propionanilide, N-pentyl- | N(CCCCC)(C(=O)CC)c1ccccc1 |
Propionic acid, pentyl ester | C(=O)(CC)OCCCCC |
Pyridine, 2-pentyl- | C(CCCC)c1ccccn1 |
Pyridine, 4-pentyl- | C(CCCC)c1ccncc1 |
Pyridine__2-pentyl- | C(CCCC)c1ccccn1 |
Pyroglutamic acid, 3-pentyl-4-phenyl- | C(CCCC)C1C(NC(=O)C1c2ccccc2)C(=O)O |
Salicylic acid, pentyl ester | C(=O)(OCCCCC)c1ccccc1O |
Sodium pentyl sulfate | C(CCCC)OS(=O)(=O)O |
Succinimide, N-pentyl- | C(CCCC)N1C(=O)CCC1=O |
Sulfide, cyclopentyl pentyl | S(CCCCC)C1CCCC1 |
Sulfide, methyl pentyl | C(CCC)CSC |
Sulfide__cyclopentyl_pentyl | S(CCCCC)C1CCCC1 |
Tertiary pentyl chloride | C(C)(C)(Cl)CC |
Thiazolium, 2-(4-(dimethylamino)phenyl)-3-methyl-4-pentyl-, iodide | CN1=C(SC=C1CCCCC)c2ccc(cc2)N(C)C |
Thiazolium__2-(4-(dimethylamino)phenyl)-3-methyl-4-pentyl-__iodide | CN1=C(SC=C1CCCCC)c2ccc(cc2)N(C)C |
Thiocyanatoacetic acid pentyl ester | O(CCCCC)C(=O)CSC#N |
Thiourea, N-pentyl-N'-phenyl- | N(C(=S)NCCCCC)c1ccccc1 |
Thiourea__N-pentyl-N'-phenyl- | N(C(=S)NCCCCC)c1ccccc1 |
Tri-n-pentyl borate | B(OCCCCC)(OCCCCC)OCCCCC |
Urea, tert-pentyl- | N(C(N)=O)C(C)(C)CC |
Valeric acid, 2-methyl-, pentyl ester | C(=O)(OCCCCC)C(C)CCC |
Valeric acid, pentyl ester | O(CCCCC)C(=O)CCCC |
Valeric_acid__2-methyl-__pentyl_ester | C(=O)(OCCCCC)C(C)CCC |
m-Dioxane, 2,5,5-trimethyl-2-pentyl- | C(CCCC)C1(C)OCC(C)(C)CO1 |
m-Pentyl propiolate | C(CCCCC)#CC(=O)O |
n-Pentyl acetate | C(CCCC)OC(C)=O |
n-Pentyl acrylate | C(=O)(C=C)OCCCCC |
n-Pentyl alcohol | C(CC)CCO |
n-Pentyl bromide | C(CBr)CCC |
n-Pentyl butanoate | C(=O)(CCC)OCCCCC |
n-Pentyl chloride | C(CC)CCCl |
n-Pentyl ethanoate | C(CCCC)OC(C)=O |
n-Pentyl ether | O(CCCCC)CCCCC |
n-Pentyl formate | C(CCC)COC=O |
n-Pentyl iodide | C(CC)CCI |
n-Pentyl methanoate | C(CCC)COC=O |
n-Pentyl methyl ketone | C(CCCC)C(C)=O |
n-Pentyl n-butyrate | C(=O)(CCC)OCCCCC |
n-Pentyl propanoate | C(=O)(CC)OCCCCC |
n-Pentyl propionate | C(=O)(CC)OCCCCC |
n-Pentyl valerate | O(CCCCC)C(=O)CCCC |
p-Benzoquinone, 2,5-di-tert-pentyl- | C(C)(C)(CC)C1=CC(=O)C(=CC1=O)C(C)(C)CC |
p-Toluenesulfonic acid, 2-pentyl ester | S(=O)(=O)(OC(C)CCC)c1ccc(C)cc1 |
p-Toluenesulfonic_acid__2-pentyl_ester | S(=O)(=O)(OC(C)CCC)c1ccc(C)cc1 |
tert-Pentyl alcohol | C(C)(C)(O)CC |
tert-Pentyl bromide | C(Br)(C)(C)CC |
tert-Pentyl chloride | C(C)(C)(Cl)CC |
tert-Pentyl mercaptan | C(C)(C)(S)CC |
tert-Pentyl nitrite | C(C)(C)(CC)ON=O |
tert-Pentyl_nitrite | C(C)(C)(CC)ON=O |