If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Anhydrous citric acid | C(C(=O)O)C(O)(CC(=O)O)C(=O)O |
CITRIC ACID | C(C(=O)O)C(O)(CC(=O)O)C(=O)O |
Citric acid, acetyl triethyl ester | C(OC(C)=O)(CC(=O)OCC)(CC(=O)OCC)C(=O)OCC |
Citric acid, anhydrous | C(C(=O)O)C(O)(CC(=O)O)C(=O)O |
Citric acid, gallium salt (1:1) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |
Citric acid, gallium(II) salt | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |
Citric acid, iron(3+) salt (1:1) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |
Citric acid, lead(2+) salt (2:3) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |
Citric acid, magnesium salt (2:3) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |
Citric acid, nickel(2+) salt (2:3) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |
Citric acid, triallyl ester | C(O)(CC(=O)OCC=C)(CC(=O)OCC=C)C(=O)OCC=C |
Citric acid, tributyl ester | C(O)(CC(=O)OCCCC)(CC(=O)OCCCC)C(=O)OCCCC |
Citric acid, tributyl ester, acetate | C(OC(C)=O)(CC(=O)OCCCC)(CC(=O)OCCCC)C(=O)OCCCC |
Citric acid, triethyl ester | C(O)(CC(=O)OCC)(CC(=O)OCC)C(=O)OCC |
Citric acid, triethyl ester, acetate | C(OC(C)=O)(CC(=O)OCC)(CC(=O)OCC)C(=O)OCC |
Citric acid, trimethyl ester | C(O)(CC(=O)OC)(CC(=O)OC)C(=O)OC |
Citric acid, tris(2-ethylhexyl) ester | C(O)(CC(=O)OCC(CC)CCCC)(CC(=O)OCC(CC)CCCC)C(=O)OCC(CC)CCCC |
Citric_acid__gallium_salt_(1:1) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |