If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,4-Naphthoquinone, 2-hydroxy-3-isopentyl- | O=C1C(CCC(C)C)=C(O)C(=O)c2ccccc12 |
5-Ethyl-5-isopentyl-2-thiobarbituric acid | C(CC(C)C)C1(CC)C(=O)NC(=S)NC1=O |
9H-Purine-6-thiol, 2-amino-9-isopentyl- | C(CC(C)C)N1C=Nc2c(S)nc(N)nc12 |
9H-Purine-6-thiol__2-amino-9-isopentyl- | C(CC(C)C)N1C=Nc2c(S)nc(N)nc12 |
Acetanilide, N-isopentyl- | N(CCC(C)C)(C(C)=O)c1ccccc1 |
Acetic acid, isopentyl ester | C(CC(C)C)OC(C)=O |
Acetic acid, phenyl-, isopentyl ester | C(C(=O)OCCC(C)C)c1ccccc1 |
Barbituric acid, 1,3-dimethyl-5-isopentyl- | C(CC(C)C)C1C(=O)N(C)C(=O)N(C)C1=O |
Barbituric acid, 1-allyl-5-ethyl-5-isopentyl-2-thio-, sodium salt | C(CC(C)C)C1(CC)C(=O)NC(=S)N(CC=C)C1=O |
Barbituric acid, 5-ethyl-5-isopentyl- | C(CC(C)C)C1(CC)C(=O)NC(=O)NC1=O |
Barbituric acid, 5-ethyl-5-isopentyl-1,3-dimethyl- | C(CC(C)C)C1(CC)C(=O)N(C)C(=O)N(C)C1=O |
Barbituric acid, 5-ethyl-5-isopentyl-1-methyl- | C(CC(C)C)C1(CC)C(=O)NC(=O)N(C)C1=O |
Barbituric acid, 5-ethyl-5-isopentyl-1-methyl-2-thio-, sodium salt | C(CC(C)C)C1(CC)C(=O)NC(=S)N(C)C1=O |
Barbituric acid, 5-ethyl-5-isopentyl-1-phenyl- | C(CC(C)C)C1(CC)C(=O)NC(=O)N(C1=O)c2ccccc2 |
Barbituric acid, 5-ethyl-5-isopentyl-2-thio- | C(CC(C)C)C1(CC)C(=O)NC(=S)NC1=O |
Barbituric acid, 5-isopentyl-5-isopropenyl- | C(CC(C)C)C1(C(C)=C)C(=O)NC(=O)NC1=O |
Barbituric acid, 5-isopentyl-5-methyl- | C(CC(C)C)C1(C)C(=O)NC(=O)NC1=O |
Barbituric acid, 5-isopentyl-5-propyl- | C(CC(C)C)C1(CCC)C(=O)NC(=O)NC1=O |
Benzene, isopentyl- | C(CC(C)C)c1ccccc1 |
Benzoic acid, isopentyl ester | C(=O)(OCCC(C)C)c1ccccc1 |
Benzyl isopentyl ether | C(OCCC(C)C)c1ccccc1 |
Butyranilide, N-isopentyl- | N(CCC(C)C)(C(=O)CCC)c1ccccc1 |
Butyric acid, isopentyl ester | C(=O)(CCC)OCCC(C)C |
Carbamic acid, isopentyl-, 2-hydroxyethyl ester | C(=O)(OCCO)NCCC(C)C |
Carbamic_acid__isopentyl-__2-hydroxyethyl_ester | C(=O)(OCCO)NCCC(C)C |
Carbanilic acid, m-hydroxy-, isopentyl ester | N(C(=O)OCCC(C)C)c1cccc(O)c1 |
Ether, benzyl isopentyl | C(OCCC(C)C)c1ccccc1 |
Formanilide, N-isopentyl- | N(C=O)(CCC(C)C)c1ccccc1 |
Formic acid, isopentyl ester | C(COC=O)C(C)C |
Isopentyl 3-methylbutyrate | C(=O)(OCCC(C)C)CC(C)C |
Isopentyl acetate | C(CC(C)C)OC(C)=O |
Isopentyl alcohol | C(CO)C(C)C |
Isopentyl alcohol, O-bis(1-aziridinyl)phosphinothioate | P(=S)(OCCC(C)C)(N1CC1)N2CC2 |
Isopentyl alcohol, acetate | C(CC(C)C)OC(C)=O |
Isopentyl alcohol, benzoate | C(=O)(OCCC(C)C)c1ccccc1 |
Isopentyl alcohol, formate | C(COC=O)C(C)C |
Isopentyl alcohol, nitrite | C(CON=O)C(C)C |
Isopentyl alcohol, propionate | C(=O)(CC)OCCC(C)C |
Isopentyl benzoate | C(=O)(OCCC(C)C)c1ccccc1 |
Isopentyl borate, (C5H11O)3 B | B(OCCC(C)C)(OCCC(C)C)OCCC(C)C |
Isopentyl bromide | C(CBr)C(C)C |
Isopentyl butanoate | C(=O)(CCC)OCCC(C)C |
Isopentyl butyrate | C(=O)(CCC)OCCC(C)C |
Isopentyl chloride | C(CCl)C(C)C |
Isopentyl disulfide | C(SSCCC(C)C)CC(C)C |
Isopentyl ethanoate | C(CC(C)C)OC(C)=O |
Isopentyl ether | C(OCCC(C)C)CC(C)C |
Isopentyl formate | C(COC=O)C(C)C |
Isopentyl isovalerate | C(=O)(OCCC(C)C)CC(C)C |
Isopentyl laurate | C(=O)(CCCCCCCCCCC)OCCC(C)C |
Isopentyl m-hydroxycarbanilate | N(C(=O)OCCC(C)C)c1cccc(O)c1 |
Isopentyl methanoate | C(COC=O)C(C)C |
Isopentyl nitrite | C(CON=O)C(C)C |
Isopentyl phenylacetate | C(C(=O)OCCC(C)C)c1ccccc1 |
Isopentyl propanoate | C(=O)(CC)OCCC(C)C |
Isopentyl propionate | C(=O)(CC)OCCC(C)C |
Isopentyl salicylate | C(=O)(OCCC(C)C)c1ccccc1O |
Isopentyl sulfoxide | S(=O)(CCC(C)C)CCC(C)C |
Isopentyl_borate__(C5H11O)3_B | B(OCCC(C)C)(OCCC(C)C)OCCC(C)C |
Isovaleric acid, isopentyl ester | C(=O)(OCCC(C)C)CC(C)C |
Lauric acid, isopentyl ester | C(=O)(CCCCCCCCCCC)OCCC(C)C |
Mandelic acid, isopentyl ester | C(O)(C(=O)OCCC(C)C)c1ccccc1 |
Nitrous acid, isopentyl ester | C(CON=O)C(C)C |
Phenylacetic acid, isopentyl ester | C(C(=O)OCCC(C)C)c1ccccc1 |
Phosphinothioic acid, bis(1-aziridinyl)-, O-isopentyl ester | P(=S)(OCCC(C)C)(N1CC1)N2CC2 |
Phosphinothioic_acid__bis(1-aziridinyl)-__O-isopentyl_ester | P(=S)(OCCC(C)C)(N1CC1)N2CC2 |
Propionanilide, N-isopentyl- | N(CCC(C)C)(C(=O)CC)c1ccccc1 |
Propionic acid, isopentyl ester | C(=O)(CC)OCCC(C)C |
Salicylic acid, isopentyl ester | C(=O)(OCCC(C)C)c1ccccc1O |
Sulfide, isopentyl methyl | C(CSC)C(C)C |
Theobromine, 1-isopentyl- | O=C1N(CCC(C)C)C(=O)N(C)C2=C1N(C)C=N2 |
m-Hydroxycarbanilic acid isopentyl ester | N(C(=O)OCCC(C)C)c1cccc(O)c1 |