If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
.omega.-Hexanediol | C(CCO)CCCO |
1, 6-Hexanediol | C(CCO)CCCO |
1,2-Hexanediol | C(C(C)O)C(C)(C)O |
1,3-Hexanediol, 2-ethyl- | C(CC)(CO)C(O)CCC |
1,6-Hexanediol, diacetate | C(CCCCCOC(C)=O)OC(C)=O |
2,5-Dimethyl-2,5-hexanediol | C(CC(C)(C)O)C(C)(C)O |
2,5-Hexanediol | C(CC(C)O)C(C)O |
2,5-Hexanediol, 2,5-dimethyl- | C(CC(C)(C)O)C(C)(C)O |
2,5-Hexanediol, dimethanesulfonate (8CI 9CI) | O(C(C)CCC(C)OS(C)(=O)=O)S(C)(=O)=O |
2,5-Hexanediol, dimethanesulfonate | O(C(C)CCC(C)OS(C)(=O)=O)S(C)(=O)=O |
2,5-Hexanediol, dimethanesulfonate, (-)- | O(C(C)CCC(C)OS(C)(=O)=O)S(C)(=O)=O |
2,5-Hexanediol, dimethanesulfonate, (R*, S*)- | O(C(C)CCC(C)OS(C)(=O)=O)S(C)(=O)=O |
2,5-Hexanediol, dimethanesulfonate, (R*,R*)-(-)- | O(C(C)CCC(C)OS(C)(=O)=O)S(C)(=O)=O |
2,5-Hexanediol, dimethanesulfonate, (R*,R*)-(.+-.)- | O(C(C)CCC(C)OS(C)(=O)=O)S(C)(=O)=O |
2,5-Hexanediol, dimethanesulfonate, meso- | O(C(C)CCC(C)OS(C)(=O)=O)S(C)(=O)=O |
2,5-Hexanediol, dimethylsulfonate | O(C(C)CCC(C)OS(C)(=O)=O)S(C)(=O)=O |
2-Ethyl-1,3-hexanediol | C(CC)(CO)C(O)CCC |
2_5-Hexanediol__dimethanesulfonate__(R*_R*)-(.+-.)- | O(C(C)CCC(C)OS(C)(=O)=O)S(C)(=O)=O |
2_5-Hexanediol__dimethanesulfonate__(R*__S*)- | O(C(C)CCC(C)OS(C)(=O)=O)S(C)(=O)=O |
3, 4-Bis(p-hydroxyphenyl)-3,4-hexanediol | C(O)(CC)(c1ccc(O)cc1)C(O)(CC)c2ccc(O)cc2 |
3,4-Dithia-1,6-hexanediol | S(CCO)SCCO |
3,4-Hexanediol, 3, 4-bis(4-hydroxyphenyl)- | C(O)(CC)(c1ccc(O)cc1)C(O)(CC)c2ccc(O)cc2 |
3,4-Hexanediol, 3, 4-bis(p-hydroxyphenyl)- | C(O)(CC)(c1ccc(O)cc1)C(O)(CC)c2ccc(O)cc2 |
3,4-Hexanediol, 3,4-dimethyl- | C(C)(O)(CC)C(C)(O)CC |
3_4-Hexanediol__3_4-dimethyl- | C(C)(O)(CC)C(C)(O)CC |
ALPHA_,.omega.-Hexanediol | C(CCO)CCCO |
ALPHA__.omega.-Hexanediol | C(CCO)CCCO |
Ethyl hexanediol | C(CC)(CO)C(O)CCC |
Isocyanic acid, diester with 1,6-hexanediol | C(CCN=C=O)CCCN=C=O |
Isocyanic_acid__diester_with_1_6-hexanediol | C(CCN=C=O)CCCN=C=O |