If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Aminosalicylic acid | C(=O)(O)c1cccc(N)c1O |
4-Aminosalicylic acid hydrazide | C(=O)(NN)c1ccc(N)cc1O |
4-Aminosalicylic acid | C(=O)(O)c1ccc(N)cc1O |
5-Aminosalicylic acid | C(=O)(O)c1cc(N)ccc1O |
Aminosalicylic acid | C(=O)(O)c1ccc(N)cc1O |
Benzoyl-p-aminosalicylic acid | C(=O)(O)c1ccc(cc1O)NC(=O)c2ccccc2 |
N-Acetyl-5-aminosalicylic acid | N(C(C)=O)c1ccc(O)c(c1)C(=O)O |
N-Acetyl-p-aminosalicylic acid | C(=O)(O)c1ccc(NC(C)=O)cc1O |
N-Benzoyl-p-aminosalicylic acid calcium salt | C(=O)(O)c1ccc(cc1O)NC(=O)c2ccccc2 |
N-Benzoyl-p-aminosalicylic acid sodium salt | C(=O)(O)c1ccc(cc1O)NC(=O)c2ccccc2 |
m-Aminosalicylic acid | C(=O)(O)c1cc(N)ccc1O |
p-Aminosalicylic acid hydrazide | C(=O)(NN)c1ccc(N)cc1O |
p-Aminosalicylic acid hydrochloride | C(=O)(O)c1ccc(N)cc1O |
p-Aminosalicylic acid | C(=O)(O)c1ccc(N)cc1O |
p-Aminosalicylic acid, phenyl ester | C(=O)(Oc1ccccc1)c2ccc(N)cc2O |