If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Biphenylamine | Nc1ccccc1c2ccccc2 |
3-Nitro-4-biphenylamine | [N+](=O)([O-])c1cc(ccc1N)c2ccccc2 |
4'-Fluoro-4-biphenylamine | Fc1ccc(cc1)c2ccc(N)cc2 |
4-Biphenylamine | Nc1ccc(cc1)c2ccccc2 |
4-Biphenylamine, 3-nitro- | [N+](=O)([O-])c1cc(ccc1N)c2ccccc2 |
4-Biphenylamine, 4'-chloro- | Clc1ccc(cc1)c2ccc(N)cc2 |
4-Biphenylamine, 4'-fluoro- | Fc1ccc(cc1)c2ccc(N)cc2 |
4-Biphenylamine, N,N-dimethyl- | N(C)(C)c1ccc(cc1)c2ccccc2 |
Biphenylamine | Nc1ccc(cc1)c2ccccc2 |
o-Biphenylamine | Nc1ccccc1c2ccccc2 |
p-Biphenylamine | Nc1ccc(cc1)c2ccccc2 |