If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1,4-Bis(3-aminopropyl)piperazine adipate (1:1) | C(CCC(=O)O)CC(=O)O.NCCCN1CCN(CCCN)CC1 |
Allyl adipate | C(=O)(OCC=C)CCCCC(=O)OCC=C |
Bis(2-butoxyethyl) adipate | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Bis(2-ethoxyethyl) adipate | C(CCCC(=O)OCCOCC)C(=O)OCCOCC |
Bis(2-ethylhexyl) adipate | C(CC)(CCCC)COC(=O)CCCCC(=O)OCC(CC)CCCC |
Bis(2-methoxyethyl) adipate | C(=O)(OCCOC)CCCCC(=O)OCCOC |
Bis(3-methylbutyl) adipate | O(CCC(C)C)C(=O)CCCCC(=O)OCCC(C)C |
Bis(6-methyl-3-cyclohexenemethyl) adipate | C(OC(=O)CCCCC(=O)OCC1CC=CCC1C)C2CC=CCC2C |
Bis(ethylene glycol monobutyl ether) adipate | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Bis(tetrahydrofurfuryl) adipate | C(OC(=O)CCCCC(=O)OCC1CCCO1)C2CCCO2 |
Bis(tetrahydrofurfuryl)adipate | C(OC(=O)CCCCC(=O)OCC1CCCO1)C2CCCO2 |
Butyl Cellosolve Adipate (BCA) | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Butyl adipate | C(=O)(OCCCC)CCCCC(=O)OCCCC |
Di(2-butoxyethyl) adipate | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Di(2-ethylhexyl) adipate | C(CC)(CCCC)COC(=O)CCCCC(=O)OCC(CC)CCCC |
Di(2-ethylhexyl)adipate | C(CC)(CCCC)COC(=O)CCCCC(=O)OCC(CC)CCCC |
Di(3-methylbutyl)adipate | O(CCC(C)C)C(=O)CCCCC(=O)OCCC(C)C |
Di-n-Decyl adipate | C(=O)(OCCCCCCCCCC)CCCCC(=O)OCCCCCCCCCC |
Di-n-Propyl adipate | C(=O)(OCCC)CCCCC(=O)OCCC |
Di-n-butyl adipate | C(=O)(OCCCC)CCCCC(=O)OCCCC |
Di-n-nonyl adipate | C(CCCC(=O)OCCCCCCCCC)C(=O)OCCCCCCCCC |
Di-n-octyl adipate | C(CCCC(=O)OCCCCCCCC)C(=O)OCCCCCCCC |
Di-sec-butyl adipate | O(C(C)CC)C(=O)CCCCC(=O)OC(C)CC |
Diallyl adipate | C(=O)(OCC=C)CCCCC(=O)OCC=C |
Dibutoxyethyl adipate | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Dibutyl Cellosolve Adipate | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Dibutyl adipate | C(=O)(OCCCC)CCCCC(=O)OCCCC |
Dicyclohexyl adipate | O(C(=O)CCCCC(=O)OC1CCCCC1)C2CCCCC2 |
Didecyl adipate | C(=O)(OCCCCCCCCCC)CCCCC(=O)OCCCCCCCCCC |
Diethyl adipate | C(=O)(OCC)CCCCC(=O)OCC |
Diisoamyl adipate | O(CCC(C)C)C(=O)CCCCC(=O)OCCC(C)C |
Diisobutyl adipate | C(=O)(CCCCC(=O)OCC(C)C)OCC(C)C |
Diisodecyl adipate, adipate | C(CCCC(=O)OCCCCCCCC(C)C)C(=O)OCCCCCCCC(C)C |
Diisopropyl adipate | O(C(C)C)C(=O)CCCCC(=O)OC(C)C |
Dimethyl adipate | C(CCCC(=O)OC)C(=O)OC |
Dinonyl adipate | C(CCCC(=O)OCCCCCCCCC)C(=O)OCCCCCCCCC |
Dioctyl adipate (VAN) | C(CC)(CCCC)COC(=O)CCCCC(=O)OCC(CC)CCCC |
Dioctyl adipate | C(CCCC(=O)OCCCCCCCC)C(=O)OCCCCCCCC |
Dipropyl adipate | C(=O)(OCCC)CCCCC(=O)OCCC |
Ethyl adipate | C(=O)(OCC)CCCCC(=O)OCC |
Ethyl hydrogen adipate | C(CCCC(=O)O)C(=O)OCC |
Isobutyl adipate | C(=O)(CCCCC(=O)OCC(C)C)OCC(C)C |
Isopropyl adipate | O(C(C)C)C(=O)CCCCC(=O)OC(C)C |
Magnesium adipate | C(CCC(=O)O)CC(=O)O |
Methyl adipate (VAN) | C(CCCC(=O)OC)C(=O)OC |
Methyl hydrogen adipate | C(CCCC(=O)O)C(=O)OC |
Monoethyl adipate | C(CCCC(=O)O)C(=O)OCC |
Monomethyl adipate | C(CCCC(=O)O)C(=O)OC |
Octyl adipate (VAN) | C(CC)(CCCC)COC(=O)CCCCC(=O)OCC(CC)CCCC |
Piperazine adipate | C1CNCCN1.O=C(O)CCCCC(=O)O |