If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(p-Hydroxyphenyl)lactic acid | C(C(O)C(=O)O)c1ccc(O)cc1 |
3-(4-Hydroxyphenyl)lactic acid | C(C(O)C(=O)O)c1ccc(O)cc1 |
Acridine, 6,9-diamino-2-ethoxy-, cpd with lactic acid (1:1) | Nc1c2ccc(N)cc2nc3ccc(OCC)cc13.CC(O)C(=O)O |
BETA_-(4-Hydroxyphenyl)lactic acid | C(C(O)C(=O)O)c1ccc(O)cc1 |
BETA_-(p-Hydroxyphenyl)lactic acid | C(C(O)C(=O)O)c1ccc(O)cc1 |
LACTIC ACID(DL) | S(C)(=O)(=O)O |
Lactic acid amide | C(C)(O)C(N)=O |
Lactic acid monosodium salt | C(C)(O)C(=O)O |
Lactic acid silver salt (VAN) | CC1O[Ag]OC1=O |
Lactic acid, (p-hydroxyphenyl)- | C(C(O)C(=O)O)c1ccc(O)cc1 |
Lactic acid, 2-chloroallyl ester | C(=O)(OCC(=C)Cl)C(C)O |
Lactic acid, 2-isopropylhydrazide | C(=O)(NNC(C)C)C(C)O |
Lactic acid, 2-methyl- | C(C)(C)(O)C(=O)O |
Lactic acid, 2-methyl-, L- | C(C)(C)(O)C(=O)O |
Lactic acid, 2-methyl-, ethyl ester | C(=O)(OCC)C(C)(C)O |
Lactic acid, 2-methyl-, methyl ester | C(=O)(OC)C(C)(C)O |
Lactic acid, 3-(p-hydroxyphenyl)- | C(C(O)C(=O)O)c1ccc(O)cc1 |
Lactic acid, 3-phenyl-, DL- | C(C(O)C(=O)O)c1ccccc1 |
Lactic acid, acetate | C(C)(OC(C)=O)C(=O)O |
Lactic acid, butyl ester | C(=O)(OCCCC)C(C)O |
Lactic acid, calcium salt (2:1), L- | C(C)(O)C(=O)O |
Lactic acid, compd. with 6, 9-diamino-2-ethoxyacridine (1:1) | Nc1c2ccc(N)cc2nc3ccc(OCC)cc13.CC(O)C(=O)O |
Lactic acid, copper(2+) salt (2:1) | C(C)(O)C(=O)O |
Lactic acid, dodecyl ester | C(CCCCCCCCCCC)OC(=O)C(C)O |
Lactic acid, ethyl carbonate, ethyl ester | O(C(=O)OCC)C(C)C(=O)OCC |
Lactic acid, ethyl ester | C(=O)(OCC)C(C)O |
Lactic acid, ethyl ester, ethyl carbonate | O(C(=O)OCC)C(C)C(=O)OCC |
Lactic acid, hexyl ester, lactate (ester) | C(C)(OC(=O)C(C)O)C(=O)OCCCCCC |
Lactic acid, methyl ester | C(=O)(OC)C(C)O |
Lactic acid, monosodium salt | C(C)(O)C(=O)O |
Lactic acid, nickel(II) salt | CC1O[Ni]2(OC1=O)OC(C)C(=O)O2 |
Lactic acid, pentyl ester | C(=O)(OCCCCC)C(C)O |
Lactic acid, phenylmercury(II)salt | OC(=O)C(C)O.c1ccccc1 |
Lactic acid, silver(1+ ) salt | CC1O[Ag]OC1=O |
Lactic acid, sodium salt (VAN) | C(C)(O)C(=O)O |
Lactic acid, strontium salt (2:1) | C(C)(O)C(=O)O |
Lactic amide | C(C)(O)C(N)=O |
Lactic_acid__copper(2+)_salt_(2:1) | C(C)(O)C(=O)O |
Methylenesuccinic acid ester with lactic acid allyl ester (1:1) | C(C(=O)OC(C)C(=O)OCC=C)C(=C)C(=O)OC(C)C(=O)OCC=C |
Sodium lactic acid | C(C)(O)C(=O)O |
Succinic acid, methylene-, ester with lactic acid allyl ester (1:1) | C(C(=O)OC(C)C(=O)OCC=C)C(=C)C(=O)OC(C)C(=O)OCC=C |