If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Cilla Blue Extra | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Cilla Fast Blue B | O=C1c2ccccc2C(=O)c3c(NC)ccc(NC)c13 |
Cilla Fast Blue FFR | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Cilla Fast Blue Green B | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Cilla Fast Pink BN | O=C1c2ccccc2C(=O)c3c(O)ccc(N)c13 |
Cilla Fast Pink FF3B | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Cilla Fast Pink RF | O=C1c2ccccc2C(=O)c3c(O)cc(OC)c(N)c13 |
Cilla Fast Red Violet RN | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Cilla Fast Violet B | O=C1c2c(N)ccc(N)c2C(=O)c3cccc([N+](=O)[O-])c13 |
Cilla Fast Yellow 5R | N(=Nc1ccc(cc1)N=Nc2ccccc2)c3ccc(O)c(C)c3 |
Cilla Fast Yellow RR | [N+](=O)([O-])c1cc(ccc1Nc2ccc(O)cc2)[N+](=O)[O-] |
Cilla Orange R | O=C1c2ccccc2C(=O)c3ccc(C)c(N)c13 |
Cilla Scarlet B | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |