If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 2-Propylene glycol monostearate | C(CCCCCCCCCCC)CCCCCC(=O)O.OCC(C)O |
1,1'-Undecanedicarboxylic acid, ester with ethylene glycol | O=C1CCCCCCCCCCCC(=O)OCCO1 |
1,2-Butylene glycol | C(O)(CC)CO |
1,2-Dimethyl-1,2-diphenylethylene glycol | C(C)(O)(c1ccccc1)C(C)(O)c2ccccc2 |
1,2-Diphenylethylene glycol | C(O)(c1ccccc1)C(O)c2ccccc2 |
1,2-Ethylene glycol monosalicylate | C(=O)(OCCO)c1ccccc1O |
1,2-Octylene glycol | C(O)(CO)CCCCCC |
1,2-Propane glycol monobenzoate | C(=O)(OCC(C)O)c1ccccc1 |
1,2-Propylene glycol 1-monobutyl ether | O(CCCC)CC(C)O |
1,2-Propylene glycol diacetate | C(C)(COC(C)=O)OC(C)=O |
1,2-Propylene glycol dinitrate | C(C)(CO[N+](=O)[O-])O[N+](=O)[O-] |
1,2-Propylene glycol sulfite | CC1COS(=O)O1 |
1,2-Propylene glycol | C(C)(O)CO |
1,3-Butylene glycol diacetate | C(C)(CCOC(C)=O)OC(C)=O |
1,3-Butylene glycol | C(CO)C(C)O |
1,3-Propylene glycol diacetate | C(CCOC(C)=O)OC(C)=O |
1,3-Propylene glycol dinitrate | C(CCO[N+](=O)[O-])O[N+](=O)[O-] |
1,3-Propylene glycol | C(CO)CO |
1,4-Butylene glycol diacetate | C(CCCOC(C)=O)OC(C)=O |
1,4-Butylene glycol | C(CO)CCO |
1,4-Tetramethylene glycol | C(CO)CCO |
1,4-Xylylene glycol | C(O)c1ccc(CO)cc1 |
1,5-Pentamethylene glycol | C(CCO)CCO |
1,5-Pentylene glycol | C(CCO)CCO |
1_1'-Undecanedicarboxylic_acid__ester_with_ethylene_glycol | O=C1CCCCCCCCCCCC(=O)OCCO1 |
1_2-Dimethyl-1_2-diphenylethylene_glycol | C(C)(O)(c1ccccc1)C(C)(O)c2ccccc2 |
1_2-Propane_glycol_monobenzoate | C(=O)(OCC(C)O)c1ccccc1 |
1_2-Propylene_glycol_1-monobutyl_ether | O(CCCC)CC(C)O |
1_3-Butylene_glycol_diacetate | C(C)(CCOC(C)=O)OC(C)=O |
1_3-Propylene_glycol_diacetate | C(CCOC(C)=O)OC(C)=O |
1_3-Propylene_glycol_dinitrate | C(CCO[N+](=O)[O-])O[N+](=O)[O-] |
1_4-Butylene_glycol_diacetate | C(CCCOC(C)=O)OC(C)=O |
1_4-Tetramethylene_glycol | C(CO)CCO |
2,4-Amylene glycol | C(C(C)O)C(C)O |
2-Ethyl-1,3-hexylene glycol | C(CC)(CO)C(O)CCC |
2-Ethylbutyric acid, diester with triethylene glycol | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
2-Ethylbutyric acid, triethylene glycol diester | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
3,3, 5-Trimethylcyclohexyl dipropylene glycol | O(C(C)COCC(C)O)C1CC(C)CC(C)(C)C1 |
6-Propylpiperonyl butyl diethylene glycol ether | C(OCCOCCOCCCC)c1cc2OCOc2cc1CCC |
ALPHA_,ALPHA_,ALPHA_'-Trimethyltrimethylene glycol | C(C(C)O)C(C)(C)O |
ALPHA_-Butylene glycol | C(O)(CC)CO |
ALPHA_-Butylene_glycol | C(O)(CC)CO |
ALPHA_-Propylene glycol diacetate | C(C)(COC(C)=O)OC(C)=O |
ALPHA_-Propylene glycol monomethyl ether | C(OC)C(C)O |
ALPHA_-Propylene glycol | C(C)(O)CO |
ALPHA_-Propylene_glycol | C(C)(O)CO |
ALPHA_-Propylene_glycol_diacetate | C(C)(COC(C)=O)OC(C)=O |
ALPHA_-Propylene_glycol_monomethyl_ether | C(OC)C(C)O |
ALPHA__ALPHA__ALPHA_'-Trimethyltrimethylene_glycol | C(C(C)O)C(C)(C)O |
Acetate de l'ether monoethylique de l'ethylene-glycol(FRENCH) | C(COCC)OC(C)=O |
Acetate_de_l'ether_monoethylique_de_l'ethylene-glycol(FRENCH) | C(COCC)OC(C)=O |
Acetic acid, bromo-, diester with ethylene glycol | O(CCOC(=O)CBr)C(=O)CBr |
Acetic acid, hexylene glycol | C(C(C)OC(C)=O)C(C)(C)OC(C)=O |
Acetic acid, iodo-, diester with ethylene glycol | O(CCOC(=O)CI)C(=O)CI |
Acetic acid, triethylene glycol diester | C(COCCOCCOC(C)=O)OC(C)=O |
Acetic_acid__bromo-__diester_with_ethylene_glycol | O(CCOC(=O)CBr)C(=O)CBr |
Acetic_acid__iodo-__diester_with_ethylene_glycol | O(CCOC(=O)CI)C(=O)CI |
Acrylic acid, diester with ethylene glycol | O(CCOC(=O)C=C)C(=O)C=C |
Acrylic acid, ethylene glycol diester | O(CCOC(=O)C=C)C(=O)C=C |
Acrylic_acid__diester_with_ethylene_glycol | O(CCOC(=O)C=C)C(=O)C=C |
Adipic acid, bis(ethylene glycol monobutyl ether) ester | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Adipic_acid__bis(ethylene_glycol_monobutyl_ether)_ester | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Allyl glycol | O(CC=C)CCO |
Amylene glycol | C(C)(CO)CCO |
BETA_-Butylene glycol | C(CO)C(C)O |
BETA_-Propylene glycol | C(CO)CO |
Bis(ethylene glycol monobutyl ether) adipate | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Butoxy diethylene glycol | C(COCCO)OCCCC |
Butoxydiethylene glycol | C(COCCO)OCCCC |
Butoxytriethylene glycol | C(COCCCC)OCCOCCO |
Butyl diethylene glycol acetate | C(OCCOCCCC)COC(C)=O |
Butyl glycol phthalate | C(=O)(OCCOCCCC)c1ccccc1C(=O)OCCOCCCC |
Butyl glycol | C(CCC)OCCO |
Butylene glycol diacetate | C(CCCOC(C)=O)OC(C)=O |
Butylene glycol ethyl ether | C(CCO)COCC |
Butylene glycol methyl ether | C(CCO)COC |
Butylene glycol monoethyl ether | C(CCO)COCC |
Butylene glycol monomethyl ether | C(CCO)COC |
Butylene_glycol_monoethyl_ether | C(CCO)COCC |
Butylene_glycol_monomethyl_ether | C(CCO)COC |
Butyraldehyde-1,3-butylene glycol acetal | C(CC)C1OCCC(C)O1 |
Butyraldehyde-1_3-butylene_glycol_acetal | C(CC)C1OCCC(C)O1 |
Butyric acid, 2-ethyl-, diester with triethylene glycol | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
Carbonic acid, allyl ester, diester with diethylene glycol | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Carbonic acid, phenyl ester, diester with diethylene glycol | O(C(=O)OCCOCCOC(=O)Oc1ccccc1)c2ccccc2 |
Carbonic_acid__phenyl_ester__diester_with_diethylene_glycol | O(C(=O)OCCOCCOC(=O)Oc1ccccc1)c2ccccc2 |
Cinnamaldehyde ethylene glycol acetal | C(=CC1OCCO1)c2ccccc2 |
Cinnamaldehyde-1,3-butylene glycol acetal | C(=Cc1ccccc1)C2OCCC(C)O2 |
Cyclohexanone styrene glycol ketal | C123CCCCC1.O3CC(O2)c4ccccc4 |
Decamethylene glycol | C(CCCCO)CCCCCO |
Decanal, propylene glycol acetal | C(CCCCCCCC)C1OCC(C)O1 |
Decanal__propylene_glycol_acetal | C(CCCCCCCC)C1OCC(C)O1 |
Di(ethylene glycol monobutyl ether) phthalate | C(=O)(OCCOCCOCCCC)c1ccccc1C(=O)OCCOCCOCCCC |
Diacetylene glycol | C(#CCO)C#CCO |
Dibenzoyl ethylene glycol | C(=O)(OCCOC(=O)c1ccccc1)c2ccccc2 |
Dibromoneopentyl glycol | C(CBr)(CBr)(CO)CO |
Diethylene Glycol Monophenyl Ether | O(CCOCCO)c1ccccc1 |
Diethylene glycol amine | O(CCN)CCO |
Diethylene glycol benzoate | C(=O)(OCCOCCO)c1ccccc1 |
Diethylene glycol bis(2-chloroethyl) ether | O(CCOCCCl)CCOCCCl |
Diethylene glycol bis(allyl carbonate) | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Diethylene glycol bis(allylcarbonate) | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Diethylene glycol bis(butyl carbonate) | O(CCOCCOC(=O)OCCCC)C(=O)OCCCC |
Diethylene glycol bis(chloroformate) | C(COCCOC(Cl)=O)OC(Cl)=O |
Diethylene glycol bis(phenyl carbonate) | O(C(=O)OCCOCCOC(=O)Oc1ccccc1)c2ccccc2 |
Diethylene glycol bis-glycidyl ether | C(OCCOCCOCC1CO1)C2CO2 |
Diethylene glycol butyl ether acetate | C(OCCOCCCC)COC(C)=O |
Diethylene glycol butyl ether | C(COCCO)OCCCC |
Diethylene glycol chloroformate | C(COCCOC(Cl)=O)OC(Cl)=O |
Diethylene glycol diallyl dicarbonate | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Diethylene glycol dicarbamate | C(COCCOC(N)=O)OC(N)=O |
Diethylene glycol diglycidyl ether | C(OCCOCCOCC1CO1)C2CO2 |
Diethylene glycol dimethyl ether | O(CCOC)CCOC |
Diethylene glycol dipropionate | C(=O)(CC)OCCOCCOC(=O)CC |
Diethylene glycol divinyl ether | O(CCOC=C)CCOC=C |
Diethylene glycol ethyl ether acetate | C(OCCOCC)COC(C)=O |
Diethylene glycol ethyl ether | C(COCC)OCCO |
Diethylene glycol hexyl ether | O(CCCCCC)CCOCCO |
Diethylene glycol laurate | C(=O)(OCCOCCO)CCCCCCCCCCC |
Diethylene glycol lauric acid monoester | C(=O)(OCCOCCO)CCCCCCCCCCC |
Diethylene glycol methyl ether | C(COC)OCCO |
Diethylene glycol mono(n-hexyl) ether | O(CCCCCC)CCOCCO |
Diethylene glycol monoamine | O(CCN)CCO |
Diethylene glycol monobenzoate | C(=O)(OCCOCCO)c1ccccc1 |
Diethylene glycol monobutyl ether acetate | C(OCCOCCCC)COC(C)=O |
Diethylene glycol monobutyl ether | C(COCCO)OCCCC |
Diethylene glycol monoethyl ether acetate | C(OCCOCC)COC(C)=O |
Diethylene glycol monoethyl ether | C(COCC)OCCO |
Diethylene glycol monohexyl ether | O(CCCCCC)CCOCCO |
Diethylene glycol monolaurate | C(=O)(OCCOCCO)CCCCCCCCCCC |
Diethylene glycol monomethyl ether formal | C(OCCOCCOC)OCCOCCOC |
Diethylene glycol monomethyl ether | C(COC)OCCO |
Diethylene glycol monophenyl ether | O(CCOCCO)c1ccccc1 |
Diethylene glycol monostearate | C(=O)(OCCOCCO)CCCCCCCCCCCCCCCCC |
Diethylene glycol monovinyl ether | C(COC=C)OCCO |
Diethylene glycol n-butyl ether | C(COCCO)OCCCC |
Diethylene glycol n-hexyl ether | O(CCCCCC)CCOCCO |
Diethylene glycol sesquilaurate | C(=O)(OCCOCCO)CCCCCCCCCCC |
Diethylene glycol sesquistearate | C(=O)(OCCOCCO)CCCCCCCCCCCCCCCCC |
Diethylene glycol stearate | C(=O)(OCCOCCO)CCCCCCCCCCCCCCCCC |
Diethylene glycol | O(CCO)CCO |
Diethylene glycol, diacetate | C(COCCOC(C)=O)OC(C)=O |
Diethylene glycol, dipropionate | C(=O)(CC)OCCOCCOC(=O)CC |
Diethylene glycol, dithiocyanate | O(CCSC#N)CCSC#N |
Diethylene glycol, monobenzoate | C(=O)(OCCOCCO)c1ccccc1 |
Diethylene glycol, monoester with stearic acid | C(=O)(OCCOCCO)CCCCCCCCCCCCCCCCC |
Diethylene_glycol_bis(2-chloroethyl)_ether | O(CCOCCCl)CCOCCCl |
Diethylene_glycol_mono(n-hexyl)_ether | O(CCCCCC)CCOCCO |
Diethylene_glycol_monobutyl_ether_acetate | C(OCCOCCCC)COC(C)=O |
Diethylene_glycol_monoethyl_ether_acetate | C(OCCOCC)COC(C)=O |
Diethylene_glycol_monomethyl_ether_formal | C(OCCOCCOC)OCCOCCOC |
Diethylene_glycol_monophenyl_ether | O(CCOCCO)c1ccccc1 |
Diglycidylethylene glycol | C(OCCOCC1CO1)C2CO2 |
Diglycidyltriethylene glycol | C(OCCOCCOCCOCC1CO1)C2CO2 |
Dimethoxytetraethylene glycol | O(CCOCCOC)CCOCCOC |
Dimethyltrimethylene glycol | C(C)(C)(CO)CO |
Dipropylene glycol | O(CC(C)O)CC(C)O |
Dipropylene glycol, 3,3,5-trimethylcyclohexyl ester | O(C(C)COCC(C)O)C1CC(C)CC(C)(C)C1 |
Ether monoethylique de l'ethylene-glycol(FRENCH) | C(CO)OCC |
Ether monomethylique de l'ethylene-glycol(FRENCH) | C(CO)OC |
Ether_monoethylique_de_l'ethylene-glycol(FRENCH) | C(CO)OCC |
Ether_monomethylique_de_l'ethylene-glycol(FRENCH) | C(CO)OC |
Ethoxylated hydantoin glycol dicocoate | C(Br)(CBr)CO |
Ethoxylated_hydantoin_glycol_dicocoate | C(Br)(CBr)CO |
Ethyl diethylene glycol | C(COCC)OCCO |
Ethyl glycol acetate | C(COCC)OC(C)=O |
Ethyl glycol | C(CO)OCC |
Ethyl hexylene glycol | C(CC)(CO)C(O)CCC |
Ethylene glycol acetal of heptaldehyde | C(CCCCC)C1OCCO1 |
Ethylene glycol acetate | C(COC(C)=O)OC(C)=O |
Ethylene glycol bis(2,3-epoxy-2-methylpropyl) ether | C(OCCOCC1(C)CO1)C2(C)CO2 |
Ethylene glycol bis(2,3-epoxypropyl) ether | C(OCCOCC1CO1)C2CO2 |
Ethylene glycol bis(2-cyanoethyl) ether | C(OCCC#N)COCCC#N |
Ethylene glycol bis(chloromethyl) ether | C(OCCl)COCCl |
Ethylene glycol bis(cyanoethyl) ether | C(OCCC#N)COCCC#N |
Ethylene glycol bis(glycidyl ether) | C(OCCOCC1CO1)C2CO2 |
Ethylene glycol bis(mercaptoacetate) | O(CCOC(=O)CS)C(=O)CS |
Ethylene glycol bis(methacrylate) | C(=O)(OCCOC(=O)C(C)=C)C(C)=C |
Ethylene glycol bis(thioglycolate) | O(CCOC(=O)CS)C(=O)CS |
Ethylene glycol bis(thioglycolic ester) | O(CCOC(=O)CS)C(=O)CS |
Ethylene glycol bis(trichloroacetate) | C(=O)(OCCOC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Ethylene glycol butyl ether | C(CCC)OCCO |
Ethylene glycol carbonate | O=C1OCCO1 |
Ethylene glycol cyclic sulfite | O=S1OCCO1 |
Ethylene glycol di(2, 3-epoxy-2-methylpropyl) ether | C(OCCOCC1(C)CO1)C2(C)CO2 |
Ethylene glycol di-BETA_-cyanoethyl ether | C(OCCC#N)COCCC#N |
Ethylene glycol diacetate | C(COC(C)=O)OC(C)=O |
Ethylene glycol diacrylate | O(CCOC(=O)C=C)C(=O)C=C |
Ethylene glycol dibenzoate | C(=O)(OCCOC(=O)c1ccccc1)c2ccccc2 |
Ethylene glycol didodecanoate | C(=O)(CCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCC |
Ethylene glycol diglycidyl ether | C(OCCOCC1CO1)C2CO2 |
Ethylene glycol dihexadecanoate | C(=O)(CCCCCCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCCCCCC |
Ethylene glycol dihydroxydiethyl ether | C(OCCO)COCCO |
Ethylene glycol dilaurate | C(=O)(CCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCC |
Ethylene glycol dimethacrylate | C(=O)(OCCOC(=O)C(C)=C)C(C)=C |
Ethylene glycol dimethanesulfonate | O(CCOS(C)(=O)=O)S(C)(=O)=O |
Ethylene glycol dimethyl ether | C(OC)COC |
Ethylene glycol dioctadecanoate | O(CCOC(=O)CCCCCCCCCCCCCCCCC)C(=O)CCCCCCCCCCCCCCCCC |
Ethylene glycol dipalmitate | C(=O)(CCCCCCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCCCCCC |
Ethylene glycol diphenyl ether | O(CCOc1ccccc1)c2ccccc2 |
Ethylene glycol dipropionate | O(CCOC(=O)CC)C(=O)CC |
Ethylene glycol distearate | O(CCOC(=O)CCCCCCCCCCCCCCCCC)C(=O)CCCCCCCCCCCCCCCCC |
Ethylene glycol divinyl ether | C(OC=C)COC=C |
Ethylene glycol ether of pinene | CC1(C)C2CC(O)C(C)(O)C1C2 |
Ethylene glycol ethyl ether acetate | C(COCC)OC(C)=O |
Ethylene glycol ethyl ether | C(CO)OCC |
Ethylene glycol homopolymer | C(O)CO |
Ethylene glycol isopropyl ether | O(CCO)C(C)C |
Ethylene glycol m-cresyl ether | O(CCO)c1cccc(C)c1 |
Ethylene glycol methacrylate | C(=O)(OCCO)C(C)=C |
Ethylene glycol methyl ether | C(CO)OC |
Ethylene glycol mono-2-naphthyl ether | O(CCO)c1ccc2ccccc2c1 |
Ethylene glycol mono-p-tolyl ether | O(CCO)c1ccc(C)cc1 |
Ethylene glycol monoallyl ether | O(CC=C)CCO |
Ethylene glycol monobenzoate | C(=O)(OCCO)c1ccccc1 |
Ethylene glycol monobenzyl ether | C(OCCO)c1ccccc1 |
Ethylene glycol monobutyl ether laurate | C(CCCCCCCCCC)C(=O)OCCOCCCC |
Ethylene glycol monobutyl ether | C(CCC)OCCO |
Ethylene glycol monoethyl ether acetate | C(COCC)OC(C)=O |
Ethylene glycol monoethyl ether acrylate | C(=O)(C=C)OCCOCC |
Ethylene glycol monoethyl ether propenoate | C(=O)(C=C)OCCOCC |
Ethylene glycol monoethyl ether | C(CO)OCC |
Ethylene glycol monoisopropyl ether | O(CCO)C(C)C |
Ethylene glycol monomethacrylate | C(=O)(OCCO)C(C)=C |
Ethylene glycol monomethyl ether acetylricinoleate | C(CCCCCC)(CC=CCCCCCCCC(=O)OCCOC)OC(C)=O |
Ethylene glycol monomethyl ether acrylate | C(=O)(C=C)OCCOC |
Ethylene glycol monomethyl ether formal | C(OCCOC)OCCOC |
Ethylene glycol monomethyl ether oleate | C(CCCCCC=CCCCCCCCC)CC(=O)OCCOC |
Ethylene glycol monomethyl ether | C(CO)OC |
Ethylene glycol monomyristate | C(CCCCCCCCCCCC)C(=O)OCCO |
Ethylene glycol monopalmitate | C(CCCCCCCCCCCCC)CC(=O)OCCO |
Ethylene glycol monophenyl ether | O(CCO)c1ccccc1 |
Ethylene glycol monosalicylate | C(=O)(OCCO)c1ccccc1O |
Ethylene glycol n-butyl ether | C(CCC)OCCO |
Ethylene glycol phenyl ether acetate | O(CCOC(C)=O)c1ccccc1 |
Ethylene glycol phenyl ether | O(CCO)c1ccccc1 |
Ethylene glycol polymer | C(O)CO |
Ethylene glycol salicylate | C(=O)(OCCO)c1ccccc1O |
Ethylene glycol | C(O)CO |
Ethylene glycol, acetate | O(CCO)C(C)=O |
Ethylene glycol, bis(bromoacetate) | O(CCOC(=O)CBr)C(=O)CBr |
Ethylene glycol, bis(iodoacetate) | O(CCOC(=O)CI)C(=O)CI |
Ethylene glycol, chlorohydrin | C(Cl)CO |
Ethylene glycol, cyclic carbonate | O=C1OCCO1 |
Ethylene glycol, cyclic phenyl phosphite | O(c1ccccc1)P2OCCO2 |
Ethylene glycol, cyclic phosphite, phenyl ester | O(c1ccccc1)P2OCCO2 |
Ethylene glycol, cyclic sulfite | O=S1OCCO1 |
Ethylene glycol, diacetate | C(COC(C)=O)OC(C)=O |
Ethylene glycol, dibenzenesulfonate | S(=O)(=O)(OCCOS(=O)(=O)c1ccccc1)c2ccccc2 |
Ethylene glycol, dibenzoate | C(=O)(OCCOC(=O)c1ccccc1)c2ccccc2 |
Ethylene glycol, diformate | C(OC=O)COC=O |
Ethylene glycol, dimethanesulfonate | O(CCOS(C)(=O)=O)S(C)(=O)=O |
Ethylene glycol, dipropionate | O(CCOC(=O)CC)C(=O)CC |
Ethylene glycol, dithio- | C(S)CS |
Ethylene glycol, mono(benzylcarbamate) | C(NC(=O)OCCO)c1ccccc1 |
Ethylene glycol, monoacetate | O(CCO)C(C)=O |
Ethylene glycol, monobenzoate | C(=O)(OCCO)c1ccccc1 |
Ethylene glycol, monocarbamate | O(CCO)C(N)=O |
Ethylene glycol, monoformate | C(CO)OC=O |
Ethylene glycol, monomethanesulfonate | O(CCO)S(C)(=O)=O |
Ethylene glycol, monosalicylate | C(=O)(OCCO)c1ccccc1O |
Ethylene glycol, monothio- | C(O)CS |
Ethylene glycol, salicylate | C(=O)(OCCO)c1ccccc1O |
Ethylene glycol-propylene glycol polymer | C1CO1.CC2CO2 |
Ethylene_glycol__diacetate | C(COC(C)=O)OC(C)=O |
Ethylene_glycol__dibenzenesulfonate | S(=O)(=O)(OCCOS(=O)(=O)c1ccccc1)c2ccccc2 |
Ethylene_glycol__dibenzoate | C(=O)(OCCOC(=O)c1ccccc1)c2ccccc2 |
Ethylene_glycol__dipropionate | O(CCOC(=O)CC)C(=O)CC |
Ethylene_glycol__dithio- | C(S)CS |
Ethylene_glycol__monoacetate | O(CCO)C(C)=O |
Ethylene_glycol__monobenzoate | C(=O)(OCCO)c1ccccc1 |
Ethylene_glycol__monoformate | C(CO)OC=O |
Ethylene_glycol__monomethanesulfonate | O(CCO)S(C)(=O)=O |
Ethylene_glycol_acetal_of_heptaldehyde | C(CCCCC)C1OCCO1 |
Ethylene_glycol_bis(chloromethyl)_ether | C(OCCl)COCCl |
Ethylene_glycol_m-cresyl_ether | O(CCO)c1cccc(C)c1 |
Ethylene_glycol_monoallyl_ether | O(CC=C)CCO |
Ethylene_glycol_monobenzyl_ether | C(OCCO)c1ccccc1 |
Ethylene_glycol_monobutyl_ether_laurate | C(CCCCCCCCCC)C(=O)OCCOCCCC |
Ethylene_glycol_monoethyl_ether_propenoate | C(=O)(C=C)OCCOCC |
Ethylene_glycol_monomethyl_ether_acrylate | C(=O)(C=C)OCCOC |
Ethylene_glycol_monomethyl_ether_formal | C(OCCOC)OCCOC |
Ethylene_glycol_monophenyl_ether | O(CCO)c1ccccc1 |
Ethylene_glycol_phenyl_ether_acetate | O(CCOC(C)=O)c1ccccc1 |
Ethylethylene glycol | C(O)(CC)CO |
Ethylhexylene glycol | C(CC)(CO)C(O)CCC |
Furfural propylene glycol acetal | CC1COC(O1)C2=CC=CO2 |
Glycol alcohol | C(O)CO |
Glycol benzyl ether | C(OCCO)c1ccccc1 |
Glycol bis(hydroxyethyl) ether | C(OCCO)COCCO |
Glycol bis(mercaptoacetate) | O(CCOC(=O)CS)C(=O)CS |
Glycol bis(trichloroacetate) | C(=O)(OCCOC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Glycol bromohydrin | C(Br)CO |
Glycol butyl ether | C(CCC)OCCO |
Glycol carbonate | O=C1OCCO1 |
Glycol chlorohydrin | C(Cl)CO |
Glycol cyanohydrin | C(C#N)CO |
Glycol diacetate | C(COC(C)=O)OC(C)=O |
Glycol dibenzoate | C(=O)(OCCOC(=O)c1ccccc1)c2ccccc2 |
Glycol diglycidyl ether | C(OCCOCC1CO1)C2CO2 |
Glycol dilaurate | C(=O)(CCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCC |
Glycol dimercaptoacetate | O(CCOC(=O)CS)C(=O)CS |
Glycol dimethacrylate | C(=O)(OCCOC(=O)C(C)=C)C(C)=C |
Glycol dimethyl ether | C(OC)COC |
Glycol distearate | O(CCOC(=O)CCCCCCCCCCCCCCCCC)C(=O)CCCCCCCCCCCCCCCCC |
Glycol ether | O(CCO)CCO |
Glycol ethyl ether | C(CO)OCC |
Glycol ethylene ether | C1COCCO1 |
Glycol methacrylate | C(=O)(OCCO)C(C)=C |
Glycol monobenzyl ether | C(OCCO)c1ccccc1 |
Glycol monobutyl ether | C(CCC)OCCO |
Glycol monochlorohydrin | C(Cl)CO |
Glycol monoester ricinoleate | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Glycol monoethyl ether acetate | C(COCC)OC(C)=O |
Glycol monoethyl ether | C(CO)OCC |
Glycol monoformate | C(CO)OC=O |
Glycol monomethacrylate | C(=O)(OCCO)C(C)=C |
Glycol monomethyl ether acetylricinoleate | C(CCCCCC)(CC=CCCCCCCCC(=O)OCCOC)OC(C)=O |
Glycol monomethyl ether acrylate | C(=O)(C=C)OCCOC |
Glycol monomethyl ether | C(CO)OC |
Glycol monophenyl ether | O(CCO)c1ccccc1 |
Glycol monosalicylate | C(=O)(OCCO)c1ccccc1O |
Glycol myristate | C(CCCCCCCCCCCC)C(=O)OCCO |
Glycol palmitate | C(CCCCCCCCCCCCC)CC(=O)OCCO |
Glycol salicylate | C(=O)(OCCO)c1ccccc1O |
Glycol sulfite | O=S1OCCO1 |
Glycol | C(O)CO |
Glycol, diformate | C(OC=O)COC=O |
Glycol, monoacetate | O(CCO)C(C)=O |
Glycol, polyethylene monostearate #200 | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Glycol, polyethylene monostearate #6000 | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Heptaldehyde, ethylene glycol acetal | C(CCCCC)C1OCCO1 |
Heptaldehyde-1,3-butylene glycol acetal | C(CCCCC)C1OCCC(C)O1 |
Hexaethylene glycol | O(CCOCCOCCO)CCOCCOCCO |
Hexafluoroamylene glycol | C(F)(F)(C(F)(F)CO)C(F)(F)CO |
Hexaldehyde-1,3-butylene glycol acetal | C(CCCC)C1OCCC(C)O1 |
Hexaldehyde-1_3-butylene_glycol_acetal | C(CCCC)C1OCCC(C)O1 |
Hexamethylene glycol | C(CCO)CCCO |
Hexaoxyethylene glycol | O(CCOCCOCCO)CCOCCOCCO |
Hexylene glycol diacetate | C(C(C)OC(C)=O)C(C)(C)OC(C)=O |
Hexylene glycol | C(C(C)O)C(C)(C)O |
Hexylene_glycol_diacetate | C(CCCCCOC(C)=O)OC(C)=O |
Isobutyraldehyde, propylene glycol acetal | C(C)(C)C1OCC(C)O1 |
Lauric acid, ester with nonaethylene glycol | C(=O)(CCCCCCCCCCC)OCCOCCOCCOCCOCCOCCOCCOCCOCCO |
Methacrylic acid, diester with tetraethylene glycol | O(CCOCCOCCOCCOC(=O)C(C)=C)C(=O)C(C)=C |
Methacrylic acid, diester with triethylene glycol | O(CCOCCOCCOC(=O)C(C)=C)C(=O)C(C)=C |
Methoxytriethylene glycol | C(COCCO)OCCOC |
Methyl glycol (VAN) | C(C)(O)CO |
Methyl glycol phthalate | C(=O)(OCCOC)c1ccccc1C(=O)OCCOC |
Methyl glycol | C(CO)OC |
Methyl-1,3-butylene glycol acetate | C(C)(OC)CCOC(C)=O |
Methyl-1_3-butylene_glycol_acetate | C(C)(OC)CCOC(C)=O |
Methylethyl glycol | C(C)(O)CO |
Methylethylene glycol | C(C)(O)CO |
Methyltrimethylene glycol | C(CO)C(C)O |
Methyltrimethylene_glycol | C(CO)C(C)O |
Monobutyl ether of ethylene glycol | C(CCC)OCCO |
Monobutyl glycol ether | C(CCC)OCCO |
Monobutyl_ether_of_ethylene_glycol | C(CCC)OCCO |
Monochlorhydrine du glycol(FRENCH) | C(Cl)CO |
Monoethyl ether of diethylene glycol | C(COCC)OCCO |
Monoethylene glycol dimethyl ether | C(OC)COC |
Monoethylene glycol | C(O)CO |
Monoethylene_glycol_dimethyl_ether | C(OC)COC |
Monoisopropyl ether of ethylene glycol | O(CCO)C(C)C |
Monoisopropyl_ether_of_ethylene_glycol | O(CCO)C(C)C |
Monomethyl ether of ethylene glycol | C(CO)OC |
Monomethyl glycol | C(CO)OC |
Monopropylene glycol | C(C)(O)CO |
Monothioethylene glycol | C(O)CS |
Neopentyl glycol diacetate | C(C)(C)(COC(C)=O)COC(C)=O |
Neopentyl glycol dibenzoate | C(=O)(OCC(C)(C)COC(=O)c1ccccc1)c2ccccc2 |
Neopentyl glycol dioleate | C(OC(=O)CCCCCCCC=CCCCCCCCC)C(C)(C)COC(=O)CCCCCCCC=CCCCCCCCC |
Neopentyl glycol | C(C)(C)(CO)CO |
Neopentylene glycol | C(C)(C)(CO)CO |
Nonaethylene glycol monolaurate | C(=O)(CCCCCCCCCCC)OCCOCCOCCOCCOCCOCCOCCOCCOCCO |
Nonaethylene glycol monostearate | O(CCOCCOCCOCCOCCOCCOCCOCCOCCO)C(=O)CCCCCCCCCCCCCCCCC |
O-Butyl diethylene glycol | C(COCCO)OCCCC |
O-Butyl ethylene glycol | C(CCC)OCCO |
Octanoic acid, diester with triethylene glycol | C(=O)(CCCCCCC)OCCOCCOCCOC(=O)CCCCCCC |
Octylene glycol | C(CC)(CO)C(O)CCC |
Pentamethylene glycol | C(CCO)CCO |
Pentylene glycol | C(CCO)CCO |
Phenyl acetaldehyde cyclic acetal with trimethylene glycol | C(c1ccccc1)C2OCCCO2 |
Phenyl glycol | C(O)(CO)c1ccccc1 |
Phenyl_acetaldehyde_cyclic_acetal_with_trimethylene_glycol | C(c1ccccc1)C2OCCCO2 |
Phenylacetaldehyde glycol acetal | C(c1ccccc1)C2OCCO2 |
Phenylacetaldehyde phenylethylene glycol acetal | C(c1ccccc1)C2OCC(O2)c3ccccc3 |
Phenylacetaldehyde_phenylethylene_glycol_acetal | C(c1ccccc1)C2OCC(O2)c3ccccc3 |
Phenylethylene glycol | C(O)(CO)c1ccccc1 |
Poly(ethylene ether) glycol | C(O)CO |
Poly(ethylene glycol) | C(O)CO |
Poly(mixed ethylene, propylene)glycol | C1CO1.CC2CO2 |
Poly(oxyethylene glycol) | C(O)CO |
Poly(oxyethylene) glycol | C(O)CO |
Poly(oxyethylene)-poly(oxypropylene) glycol | C1CO1.CC2CO2 |
Polyethylene Glycol 1500 | C(O)CO |
Polyethylene Glycol 1540 | C(O)CO |
Polyethylene Glycol 300 | C(O)CO |
Polyethylene Glycol 400 | C(O)CO |
Polyethylene Glycol 4000 | C(O)CO |
Polyethylene Glycol 600 | C(O)CO |
Polyethylene Glycol 6000 | C(O)CO |
Polyethylene Glycol, ointment | C(O)CO |
Polyethylene glycol (100) monostearate | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol 400 monoester of ricinoleic acid | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Polyethylene glycol 4000 | C(O)CO |
Polyethylene glycol 450 octyl phenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol 6000 | C(O)CO |
Polyethylene glycol 8 monostearate | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol mono(4-octylphenyl) ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol mono(4-tert-octylphenyl) ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol mono(p-(1,1,3, 3-tetramethylbutyl)phenyl) ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol mono(p-tert-octylphenyl) ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol monoether with p-tert-octylphenyl | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol monostearate #1000 | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol monostearate #200 | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol monostearate #400 | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol monostearate #6000 | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol monostearate | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol octylphenol ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol p-(1,1,3,3-tetramethylbutyl)phenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol p-octylphenyl ether (VAN) | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol p-tert-octylphenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol stearate | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol | C(O)CO |
Polyethylene glycol, ester with ricinoleic acid | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Polyethylene glycol, mono(alkylphenyl) ethers | C(O)CO |
Polyethylene glycol, propoxylated | C1CO1.CC2CO2 |
Polyethylene glycol, unrefined | C(O)CO |
Polyethylene glycol-ricinoleic acid monoester | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Polyethylene-polypropylene glycol | C1CO1.CC2CO2 |
Polypropylene glycol, ethoxylated | C1CO1.CC2CO2 |
Polypropylene glycol-ethylene oxide copolymer | C1CO1.CC2CO2 |
Propylene glycol 1,2-dinitrate | C(C)(CO[N+](=O)[O-])O[N+](=O)[O-] |
Propylene glycol 1-acetate | C(OC(C)=O)C(C)O |
Propylene glycol BETA_-monoethyl ether | C(CCO)OCC |
Propylene glycol cyclic carbonate | CC1COC(=O)O1 |
Propylene glycol diacetate | C(C)(COC(C)=O)OC(C)=O |
Propylene glycol dinitrate | C(C)(CO[N+](=O)[O-])O[N+](=O)[O-] |
Propylene glycol ethyl ether | C(OCC)C(C)O |
Propylene glycol isopropyl ether | O(CCCO)C(C)C |
Propylene glycol methyl ether | C(OC)C(C)O |
Propylene glycol monobenzoate | C(=O)(OCC(C)O)c1ccccc1 |
Propylene glycol monobutyl ether | O(CCCC)CC(C)O |
Propylene glycol monoethyl ether, BETA_ | C(CCO)OCC |
Propylene glycol monoisopropyl ether | O(CCCO)C(C)C |
Propylene glycol monolaurate | C(=O)(OCCCO)CCCCCCCCCCC |
Propylene glycol monostearate | C(CCCCCCCCCCC)CCCCCC(=O)O.OCC(C)O |
Propylene glycol stearate | C(CCCCCCCCCCC)CCCCCC(=O)O.OCC(C)O |
Propylene glycol stearic acid ester | C(CCCCCCCCCCC)CCCCCC(=O)O.OCC(C)O |
Propylene glycol | C(C)(O)CO |
Propylene_glycol_1-acetate | C(OC(C)=O)C(C)O |
Propylene_glycol_1_2-dinitrate | C(C)(CO[N+](=O)[O-])O[N+](=O)[O-] |
Propylene_glycol_ethyl_ether | C(OCC)C(C)O |
Propylene_glycol_monoethyl_ether__BETA_ | C(CCO)OCC |
Propylene_glycol_monoisopropyl_ether | O(CCCO)C(C)C |
Ricinoleic acid, monoester with polyethylene glycol | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Stearic acid, monoester with nonaethylene glycol | O(CCOCCOCCOCCOCCOCCOCCOCCOCCO)C(=O)CCCCCCCCCCCCCCCCC |
Styrene glycol | C(O)(CO)c1ccccc1 |
Sulfurous acid, cyclic ester with ethylene glycol | O=S1OCCO1 |
Sulfurous_acid__cyclic_ester_with_ethylene_glycol | O=S1OCCO1 |
THF glycol | C(O)C1CCC(CO)O1 |
Tetraethylene glycol dimethyl ether | O(CCOCCOC)CCOCCOC |
Tetraethylene glycol dodecyl ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
Tetraethylene glycol monododecyl ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
Tetraethylene glycol monolauryl ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
Tetraethylene glycol monomethyl ether | C(COCCOC)OCCOCCO |
Tetraethylene glycol | O(CCOCCO)CCOCCO |
Tetraethylene glycol, dimethacrylate | O(CCOCCOCCOCCOC(=O)C(C)=C)C(=O)C(C)=C |
Tetraethylene_glycol_monomethyl_ether | C(COCCOC)OCCOCCO |
Tetramethylene glycol diglycidyl ether | C(OCCCCOCC1CO1)C2CO2 |
Tetramethylene glycol | C(CO)CCO |
Tetramethylethylene glycol | C(C)(C)(O)C(C)(C)O |
Tetraoxyethylene glycol monododecyl ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
Tetraphenylethylene glycol | C(O)(c1ccccc1)(c2ccccc2)C(O)(c3ccccc3)c4ccccc4 |
Thiodiethylene glycol | S(CCO)CCO |
Thioethylene glycol | C(O)CS |
Tolyl aldehyde, propylene glycol acetal | CC1COC(O1)c2ccc(C)cc2 |
Tribromoneopentyl glycol | C(CBr)(CBr)(CBr)CO |
Triethylene glycol bis(2-ethyl butyrate) | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
Triethylene glycol bis(2-ethylbutyrate) | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
Triethylene glycol di(2-ethyl butyrate) | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
Triethylene glycol di-2-ethylbutyrate | C(CC)(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CC |
Triethylene glycol diacetate | C(COCCOCCOC(C)=O)OC(C)=O |
Triethylene glycol dibenzoate | C(=O)(OCCOCCOCCOC(=O)c1ccccc1)c2ccccc2 |
Triethylene glycol dicaprylate | C(=O)(CCCCCCC)OCCOCCOCCOC(=O)CCCCCCC |
Triethylene glycol diglycidyl ether | C(OCCOCCOCCOCC1CO1)C2CO2 |
Triethylene glycol dimethacrylate | O(CCOCCOCCOC(=O)C(C)=C)C(=O)C(C)=C |
Triethylene glycol dimethyl ether | C(OCCOC)COCCOC |
Triethylene glycol dioctanoate | C(=O)(CCCCCCC)OCCOCCOCCOC(=O)CCCCCCC |
Triethylene glycol methyl ether | C(COCCO)OCCOC |
Triethylene glycol mono-n-butyl ether | C(COCCCC)OCCOCCO |
Triethylene glycol monobutyl ether | C(COCCCC)OCCOCCO |
Triethylene glycol monochloride | C(OCCCl)COCCO |
Triethylene glycol monomethyl ether acetate | C(OCCOCCOC)COC(C)=O |
Triethylene glycol monomethyl ether | C(COCCO)OCCOC |
Triethylene glycol n-butyl ether | C(COCCCC)OCCOCCO |
Triethylene glycol | C(OCCO)COCCO |
Triethylene glycol, bis(2,3-epoxypropyl) ether | C(OCCOCCOCCOCC1CO1)C2CO2 |
Triethylene glycol, diacetate | C(COCCOCCOC(C)=O)OC(C)=O |
Triethylene glycol, dibenzoate | C(=O)(OCCOCCOCCOC(=O)c1ccccc1)c2ccccc2 |
Trihexylene glycol biborate | O(B1OC(C)CC(C)(C)O1)C(C)(C)CC(C)OB2OC(C)CC(C)(C)O2 |
Trimethyl glycol | C(C)(O)CO |
Trimethylene glycol di-p-chlorobenzoate | C(=O)(OCCCOC(=O)c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
Trimethylene glycol | C(CO)CO |
Vanillin 1, 3-butylene glycol acetal | O(C)c1cc(ccc1O)C2OCCC(C)O2 |
cis-1,2-Acenaphthylene glycol | OC1C(O)c2cccc3cccc1c23 |
meso-1,2-Diphenylethylene glycol | C(O)(c1ccccc1)C(O)c2ccccc2 |
meso-Stilbene glycol | C(O)(c1ccccc1)C(O)c2ccccc2 |
n-Dodecyl tetraethylene glycol ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
p-Chlorophenyl glycol ether | O(CCO)c1ccc(Cl)cc1 |
p-Xylene glycol | C(O)c1ccc(CO)cc1 |
p-Xylylene glycol | C(O)c1ccc(CO)cc1 |