If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1,3-Cyclobutanediol, 2,2,4,4-tetramethyl-, bis(trichloroacetate) | O(C(=O)C(Cl)(Cl)Cl)C1C(C)(C)C(OC(=O)C(Cl)(Cl)Cl)C1(C)C |
2,2,4,4-Tetramethyl-1,3-cyclobutanediol bis(trichloroacetate) | O(C(=O)C(Cl)(Cl)Cl)C1C(C)(C)C(OC(=O)C(Cl)(Cl)Cl)C1(C)C |
Allyl trichloroacetate | C(=O)(OCC=C)C(Cl)(Cl)Cl |
Butyl trichloroacetate | C(=O)(OCCCC)C(Cl)(Cl)Cl |
Ethyl trichloroacetate | C(=O)(OCC)C(Cl)(Cl)Cl |
Ethylene glycol bis(trichloroacetate) | C(=O)(OCCOC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Ethylene trichloroacetate | C(=O)(OCCOC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Glycol bis(trichloroacetate) | C(=O)(OCCOC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Isobutyl trichloroacetate | C(=O)(OCC(C)C)C(Cl)(Cl)Cl |
Isopropyl trichloroacetate | C(=O)(OC(C)C)C(Cl)(Cl)Cl |
Methyl trichloroacetate | C(=O)(OC)C(Cl)(Cl)Cl |
Phenoxyethyl trichloroacetate | O(CCOC(=O)C(Cl)(Cl)Cl)c1ccccc1 |
Propyl trichloroacetate | C(=O)(OCCC)C(Cl)(Cl)Cl |
Tripropyltin trichloroacetate | [Sn](CCC)(CCC)(CCC)OC(=O)C(Cl)(Cl)Cl |