If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
3'-(2,2-(Dimethylethyl)carbamoyloxy)propionanilide | O(C(=O)NC(C)(C)C)c1cccc(c1)NC(=O)CC |
Propionanilide | N(C(=O)CC)c1ccccc1 |
Propionanilide, 3', 4'-dichloro-2-methyl- | N(C(=O)C(C)C)c1ccc(Cl)c(Cl)c1 |
Propionanilide, 3',4'-dichloro- | N(C(=O)CC)c1ccc(Cl)c(Cl)c1 |
Propionanilide, 3'-hydroxy-, isobutylcarbamate | O(C(=O)NCC(C)C)c1cccc(c1)NC(=O)CC |
Propionanilide, 3'-hydroxy-, tert-butylcarbamate | O(C(=O)NC(C)(C)C)c1cccc(c1)NC(=O)CC |
Propionanilide, 3'-hydroxy-2-methyl- | N(C(=O)C(C)C)c1cccc(O)c1 |
Propionanilide, 3'-hydroxy-2-methyl-, isopropylcarbamate | N(C(=O)C(C)C)c1cccc(c1)OC(=O)NC(C)C |
Propionanilide, 3'-hydroxy-2-methyl-, tert-butylcarbamate | N(C(=O)C(C)C)c1cccc(c1)OC(=O)NC(C)(C)C |
Propionanilide, N-butyl- | N(CCCC)(C(=O)CC)c1ccccc1 |
Propionanilide, N-ethyl- | N(CC)(C(=O)CC)c1ccccc1 |
Propionanilide, N-isopentyl- | N(CCC(C)C)(C(=O)CC)c1ccccc1 |
Propionanilide, N-methyl- | N(C)(C(=O)CC)c1ccccc1 |
Propionanilide, N-pentyl- | N(CCCCC)(C(=O)CC)c1ccccc1 |
Propionanilide, o-phenyl- | N(C(=O)CC)c1ccccc1c2ccccc2 |
Propionanilide, p-acetamido- | N(C(=O)CC)c1ccc(cc1)NC(C)=O |
Propionanilide, p-hydroxy-, dimethylsulfamate | O(c1ccc(cc1)NC(=O)CC)S(=O)(=O)N(C)C |
Propionanilide__N-ethyl- | N(CC)(C(=O)CC)c1ccccc1 |