If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Pyrrolidinecarboxamide | C(N)(=O)N1CCCC1 |
1-Pyrrolidinecarboxamide, N-((4-methylphenyl)sulfonyl)- | S(=O)(=O)(NC(=O)N1CCCC1)c2ccc(C)cc2 |
1-Pyrrolidinecarboxamide, N-(p-tolylsulfonyl)- | S(=O)(=O)(NC(=O)N1CCCC1)c2ccc(C)cc2 |
1-Pyrrolidinecarboxamide__N-((4-methylphenyl)sulfonyl)- | S(=O)(=O)(NC(=O)N1CCCC1)c2ccc(C)cc2 |
N-(p-Tolylsulfonyl)-1-pyrrolidinecarboxamide | S(=O)(=O)(NC(=O)N1CCCC1)c2ccc(C)cc2 |
N-p-Tolylsulfonyl-1-pyrrolidinecarboxamide | S(=O)(=O)(NC(=O)N1CCCC1)c2ccc(C)cc2 |