If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
D-Ribonic acid, 2-(phenylmethyl)hydrazide | C(NNC(=O)C(O)C(O)C(O)CO)c1ccccc1 |
D-Ribonic acid, GAMMA_-lactone | C(O)C1OC(=O)C(O)C1O |
D-Ribonic_acid__2-(phenylmethyl)hydrazide | C(NNC(=O)C(O)C(O)C(O)CO)c1ccccc1 |
GAMMA_-Lactone of ribonic acid | C(O)C1OC(=O)C(O)C1O |
Ribonic acid, 2-benzylhydrazide, D- | C(NNC(=O)C(O)C(O)C(O)CO)c1ccccc1 |
Ribonic acid, GAMMA_-lactone, D- | C(O)C1OC(=O)C(O)C1O |
Ribonic_acid__GAMMA_-lactone__D- | C(O)C1OC(=O)C(O)C1O |