If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Acid Metanil Yellow | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Acidic metanil Yellow | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Aizen Metanil Yellow | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Brasilan Metanil Yellow | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Bucacid Metanil Yellow | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Diacid Metanil Yellow | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Eniacid Metanil Yellow GN | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Hidacid Metanil Yellow | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Java Metanil Yellow G | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow 1955 | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow C | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow E | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow Extra | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow F | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow G | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow Griesbach (Biological stain) | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow K | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow KRSU | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow M3X | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow O | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow PL | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow S | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow Supra P | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow VS | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow WS | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow Y | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow YK | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Metanil Yellow | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Mitsui Metanil Yellow | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Shikiso Metanil Yellow | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Symulon Metanil Yellow | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Takaoka Metanil Yellow | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Vondacid Metanil Yellow G | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Yodochrome Metanil Yellow | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |