If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Siegle Orange 2S | N(=Nc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Siegle Red 1 | N(=Nc1ccc(C)cc1[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Siegle Red B | N(=Nc1ccc(C)cc1[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Siegle Red BB | N(=Nc1ccc(C)cc1[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Siegle Yellow 10G | N(=NC(C(C)=O)C(=O)Nc1ccccc1Cl)c2ccc(Cl)cc2[N+](=O)[O-] |
Siegle Yellow G | N(=NC(C(C)=O)C(=O)Nc1ccccc1)c2ccc(C)cc2[N+](=O)[O-] |
Siegle Yellow GTR transparent | N(=NC(C(C)=O)C(=O)Nc1ccccc1)c2ccc(C)cc2[N+](=O)[O-] |