If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Hydroxy-4, 4'-diamidinostilbene di(BETA_-hydroxyethanesulfonate) | C(CO)S(=O)(=O)O.N=C(N)c1ccc(cc1)C=Cc2ccc(cc2O)C(=N)N |
4,4'-Stilbenedicarboxamidine di(BETA_-hydroxyethanesulfonate) | C(CO)S(=O)(=O)O.N=C(N)c1ccc(C=Cc2ccc(cc2)C(=N)N)cc1 |
Carbanilide, 3,3'-diamidino-, bis(BETA_-hydroxyethanesulfonate) | C(CO)S(=O)(=O)O.N=C(N)c1cccc(NC(=O)Nc2cccc(c2)C(=N)N)c1 |
Potassium 2-hydroxyethanesulfonate | C(CO)S(=O)(=O)O |
Sodium 2-hydroxyethanesulfonate | C(CO)S(=O)(=O)O |
Sodium BETA_-hydroxyethanesulfonate | C(CO)S(=O)(=O)O |
Stilbamidine di(BETA_-hydroxyethanesulfonate) | C(CO)S(=O)(=O)O.N=C(N)c1ccc(C=Cc2ccc(cc2)C(=N)N)cc1 |