If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
3(2H)-Pyridazinone | Oc1cccnn1 |
3(2H)-Pyridazinone, 4,5-dichloro-2-phenyl- | O=C1C(Cl)=C(Cl)C=NN1c2ccccc2 |
3(2H)-Pyridazinone, 4,5-dichloro-6-hydroxy- | Clc1c(O)nnc(O)c1Cl |
3(2H)-Pyridazinone, 4,5-dihydro-6-methyl- | CC1=NNC(=O)CC1 |
3(2H)-Pyridazinone, 4,5-dihydro-6-phenyl- | O=C1CCC(=NN1)c2ccccc2 |
3(2H)-Pyridazinone, 6-chloro- | Clc1ccc(O)nn1 |
3(2H)-Pyridazinone, 6-chloro-4-methyl- | Cc1cc(Cl)nnc1O |
3(2H)-Pyridazinone, 6-methoxy-2-methyl- | O(C)C1=NN(C)C(=O)C=C1 |
3(2H)-Pyridazinone, 6-methyl- | Cc1ccc(O)nn1 |
3(2H)-Pyridazinone__4_5-dichloro-2-phenyl- | O=C1C(Cl)=C(Cl)C=NN1c2ccccc2 |
3(2H)-Pyridazinone__4_5-dihydro-6-methyl- | CC1=NNC(=O)CC1 |
3(2H)-Pyridazinone__4_5-dihydro-6-phenyl- | O=C1CCC(=NN1)c2ccccc2 |
3(2H)-Pyridazinone__6-chloro- | Clc1ccc(O)nn1 |
3(2H)-Pyridazinone__6-chloro-4-methyl- | Cc1cc(Cl)nnc1O |
3(2H)-Pyridazinone__6-methoxy-2-methyl- | O(C)C1=NN(C)C(=O)C=C1 |
3(2H)-Pyridazinone__6-methyl- | Cc1ccc(O)nn1 |
3-(2H)-Pyridazinone | Oc1cccnn1 |
3-Pyridazinone (VAN) | Oc1cccnn1 |
3-Pyridazinone_(VAN) | Oc1cccnn1 |
4(1H)-Pyridazinone, 3,6-bis(chloromethyl)- | C(Cl)C1=CC(=O)C(CCl)=NN1 |
4(1H)-Pyridazinone__3_6-bis(chloromethyl)- | C(Cl)C1=CC(=O)C(CCl)=NN1 |
4,5-Dihydro-6-methyl-3(2H)-pyridazinone | CC1=NNC(=O)CC1 |
6-Chloro-3(2H)pyridazinone | Clc1ccc(O)nn1 |
6-Hydroxy-3(2H)-pyridazinone | Oc1ccc(O)nn1 |
6-Methyl-3(2H)-pyridazinone | Cc1ccc(O)nn1 |
6-Methyl-3-pyridazinone | Cc1ccc(O)nn1 |
6-Pyridazinone | Oc1cccnn1 |