If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
0,0-Dimethyl S-(1, 2-bis(ethoxycarbonyl)ethyl) dithiophosphate | C(CC(=O)OCC)(SP(=S)(OC)OC)C(=O)OCC |
Ammonium O,O-diethyl dithiophosphate | P(=S)(S)(OCC)OCC |
Diethyl dithiophosphate | P(=S)(S)(OCC)OCC |
Diethyl mercaptosuccinate, O,O-dimethyl dithiophosphate, S-ester | C(CC(=O)OCC)(SP(=S)(OC)OC)C(=O)OCC |
Dimethyl (((p-chlorophenyl)thio)methyl) dithiophosphate | S(CSP(=S)(OC)OC)c1ccc(Cl)cc1 |
O, O-Diethyl S-(((4-chlorophenyl)thio)methyl) dithiophosphate | P(=S)(OCC)(OCC)SCSc1ccc(Cl)cc1 |
O, O-Diethyl S-(((p-chlorophenyl)thio)methyl) dithiophosphate | P(=S)(OCC)(OCC)SCSc1ccc(Cl)cc1 |
O, O-Diisopropyl dithiophosphate | O(C(C)C)P(=S)(S)OC(C)C |
O, O-DimethylS-(1,2-dicarbethoxyethyl) dithiophosphate | C(CC(=O)OCC)(SP(=S)(OC)OC)C(=O)OCC |
O,O'-Di-m-cresyl dithiophosphate | O(c1cccc(C)c1)P(=S)(S)Oc2cccc(C)c2 |
O,O'-Diethyl dithiophosphate | P(=S)(S)(OCC)OCC |
O,O'-Diethyl hydrogen dithiophosphate | P(=S)(S)(OCC)OCC |
O,O-Diethyl (((p-chlorophenyl)mercapto)methyl) dithiophosphate | P(=S)(OCC)(OCC)SCSc1ccc(Cl)cc1 |
O,O-Diethyl dithiophosphate | P(=S)(S)(OCC)OCC |
O,O-Dimethyl S-(1,2-dicarbethoxyethyl) dithiophosphate | C(CC(=O)OCC)(SP(=S)(OC)OC)C(=O)OCC |
O,O-Dimethyl dithiophosphate of diethyl mercaptosuccinate | C(CC(=O)OCC)(SP(=S)(OC)OC)C(=O)OCC |
S-(1,2-Bis(carbethoxy)ethyl) O, O-dimethyl dithiophosphate | C(CC(=O)OCC)(SP(=S)(OC)OC)C(=O)OCC |