If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Ammonium ferric alum | S(=O)(=O)(O)O |
Ammonium ferric sulfate (NH4Fe(SO4)2) | S(=O)(=O)(O)O |
Ammonium ferric sulfate | S(=O)(=O)(O)O |
Basic ferric acetate | O(C(C)=O)[Fe](O)OC(C)=O |
Edathamil monosodium ferric salt | O=C1CN23CCN45CC(=O)O[Fe]24(O1)(OC(=O)C3)OC(=O)C5 |
Ferric HEDTA | O=C1CN23CCN45CCO[Fe]24(O1)(OC(=O)C3)OC(=O)C5 |
Ferric acetate (basic) | O(C(C)=O)[Fe](O)OC(C)=O |
Ferric acetate, basic | O(C(C)=O)[Fe](O)OC(C)=O |
Ferric acetylacetonate | CC1=O[Fe]234(O=C(C)C1)O=C(C)CC(C)=O2.CC(CC(C)=O4)=O3 |
Ferric ammonium disulfate | S(=O)(=O)(O)O |
Ferric ammonium sulfate (VAN) | S(=O)(=O)(O)O |
Ferric chloride | [Fe](Cl)(Cl)Cl |
Ferric chloride, solid (DOT) | [Fe](Cl)(Cl)Cl |
Ferric chloride, solid, anhydrous (DOT) | [Fe](Cl)(Cl)Cl |
Ferric chloride, solution (DOT) | [Fe](Cl)(Cl)Cl |
Ferric citrate (VAN) | C(O)(CC(=O)O)(CC(=O)O)C(=O)O |
Ferric ferrocyanide | [Fe](C#N)(C#N)(C#N)(C#N)(C#N)C#N |
Ferric hexacyanoferrate (II) | [Fe](C#N)(C#N)(C#N)(C#N)(C#N)C#N |
Ferric oleate | C(CC=CCCCCCCCC)CCCCCC(=O)O |
Ferric sodium edetate | O=C1CN23CCN45CC(=O)O[Fe]24(O1)(OC(=O)C3)OC(=O)C5 |
Ferric sodium ethylenediaminetetraacetate | O=C1CN23CCN45CC(=O)O[Fe]24(O1)(OC(=O)C3)OC(=O)C5 |
Ferric triacetylacetonate | CC1=O[Fe]234(O=C(C)C1)O=C(C)CC(C)=O2.CC(CC(C)=O4)=O3 |
Ferric tris(acetoacetonate) | CC1=O[Fe]234(O=C(C)C1)O=C(C)CC(C)=O2.CC(CC(C)=O4)=O3 |
Ferric tris(acetylacetonate) | CC1=O[Fe]234(O=C(C)C1)O=C(C)CC(C)=O2.CC(CC(C)=O4)=O3 |
Ferric_chloride__solid__anhydrous_(DOT) | [Fe](Cl)(Cl)Cl |
Monoammonium ferric disulfate | S(=O)(=O)(O)O |
Monosodium ferric EDTA | O=C1CN23CCN45CC(=O)O[Fe]24(O1)(OC(=O)C3)OC(=O)C5 |
Sodium ferric EDTA | O=C1CN23CCN45CC(=O)O[Fe]24(O1)(OC(=O)C3)OC(=O)C5 |
Sodium ferric ethylenediaminetetraacetate | O=C1CN23CCN45CC(=O)O[Fe]24(O1)(OC(=O)C3)OC(=O)C5 |