If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Thiazolecarboxylic acid | C(=O)(O)C1=CSC=N1 |
4-Thiazolecarboxylic_acid | C(=O)(O)C1=CSC=N1 |
5-Thiazolecarboxylic acid, 2-(((4-aminophenyl)sulfonyl)amino)- | S(=O)(=O)(NC1=NC=C(S1)C(=O)O)c2ccc(N)cc2 |
5-Thiazolecarboxylic acid, 2-amino-4-methyl-, ethyl ester | C(=O)(OCC)C1=C(C)NC(=N)S1 |
5-Thiazolecarboxylic acid, 2-amino-4-phenyl-, ethyl ester | C(=O)(OCC)C1=C(NC(=N)S1)c2ccccc2 |
5-Thiazolecarboxylic acid, 2-sulfanilamido- | S(=O)(=O)(NC1=NC=C(S1)C(=O)O)c2ccc(N)cc2 |
5-Thiazolecarboxylic_acid__2-(((4-aminophenyl)sulfonyl)amino)- | S(=O)(=O)(NC1=NC=C(S1)C(=O)O)c2ccc(N)cc2 |
5-Thiazolecarboxylic_acid__2-amino-4-methyl-__ethyl_ester | C(=O)(OCC)C1=C(C)NC(=N)S1 |
5-Thiazolecarboxylic_acid__2-amino-4-phenyl-__ethyl_ester | C(=O)(OCC)C1=C(NC(=N)S1)c2ccccc2 |