If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Alizarine Cyanone Green B (Biological stain) | N(c1ccc(Nc2ccc(C)cc2S(=O)(=O)O)c3C(=O)c4ccccc4C(=O)c13)c5ccc(C)cc5S(=O)(=O)O |
Alizarine Cyanone Green G | N(c1ccc(Nc2ccc(C)cc2S(=O)(=O)O)c3C(=O)c4ccccc4C(=O)c13)c5ccc(C)cc5S(=O)(=O)O |
Alizarine Cyanone Green GN | N(c1ccc(Nc2ccc(C)cc2S(=O)(=O)O)c3C(=O)c4ccccc4C(=O)c13)c5ccc(C)cc5S(=O)(=O)O |
Fast Wool Cyanone 3R | N(c1ccc(C)cc1)c2ccc(N=Nc3ccc(N=Nc4cccc(c4)S(=O)(=O)O)c5ccccc35)c6cccc(c26)S(=O)(=O)O |
Fast Wool Cyanone 3R(Biological stain) | N(c1ccc(C)cc1)c2ccc(N=Nc3ccc(N=Nc4cccc(c4)S(=O)(=O)O)c5ccccc35)c6cccc(c26)S(=O)(=O)O |
Fast Wool Cyanone R | N(c1ccc(C)cc1)c2ccc(N=Nc3ccc(N=Nc4cccc(c4)S(=O)(=O)O)c5ccccc35)c6cccc(c26)S(=O)(=O)O |