If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
CAT (herbicide) | N(CC)c1nc(Cl)nc(NCC)n1 |
Carbyne (herbicide) | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
Chipco turf herbicide d | O(CC(=O)O)c1ccc(Cl)cc1Cl |
Chipco turf herbicide mcpp | O(C(C)C(=O)O)c1ccc(Cl)cc1C |
Crag Experimental Herbicide 2 | C(O)(NC(=O)NC(O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Crag Experimental Herbicide 5,722 | O(CCOC(=O)C(Cl)(Cl)Cl)c1ccccc1 |
Crag Herbicide 2 | C(O)(NC(=O)NC(O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Dbn (the herbicide) | C(#N)c1c(Cl)cccc1Cl |
Du pont herbicide 1,318 | N(C(=O)Nc1ccccc1)C2CCCCC2C |
Esso Herbicide 10 | O(CC(=O)OCCCC)c1ccc(Cl)cc1Cl |
Experimental Herbicide 2 | C(O)(NC(=O)NC(O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Geigy Herbicide 444E | N(CC)(CC)c1nc(Cl)nc(n1)N(CC)CC |
Hedonal (the herbicide) | O(CC(=O)O)c1ccc(Cl)cc1Cl |
Hedonal, herbicide | O(CC(=O)O)c1ccc(Cl)cc1Cl |
Herbicide 82 | C(C)(C)N1C(=O)NC(C)=C(Br)C1=O |
Herbicide M | O(CC(=O)O)c1ccc(Cl)cc1C |
Karmex Diuron Herbicide | N(C(=O)N(C)C)c1ccc(Cl)c(Cl)c1 |
Karmex Monuron Herbicide | N(C(=O)N(C)C)c1ccc(Cl)cc1 |
Karmex W. monuron herbicide | N(C(=O)N(C)C)c1ccc(Cl)cc1 |
Propazine (herbicide) | N(C(C)C)c1nc(Cl)nc(n1)NC(C)C |