If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Piperidinecarboxamide, N,N-diethylthio- | C(=S)(N(CC)CC)N1CCCCC1 |
1-Piperidinecarboxamide__N_N-diethylthio- | C(=S)(N(CC)CC)N1CCCCC1 |
2-Benzothiazolyl-N, N-(diethylthio)carbamyl sulfide | S(C(=S)N(CC)CC)C1=Nc2ccccc2S1 |
Formamide, 1, 1'-dithiobis(N,N-diethylthio)- | N(CC)(CC)C(=S)SSC(=S)N(CC)CC |
Formamide, 1,1'-thiobis(N,N'-diethylthio- | N(CC)(CC)C(=S)SC(=S)N(CC)CC |
Formamide, 1,1'-thiobis(N,N-diethylthio- | N(CC)(CC)C(=S)SC(=S)N(CC)CC |
Formamide, 1-(bis(diethylamino)phosphinyl)-N,N-diethylthio- | P(=O)(N(CC)CC)(N(CC)CC)C(=S)N(CC)CC |
Formamide__1-(bis(diethylamino)phosphinyl)-N_N-diethylthio- | P(=O)(N(CC)CC)(N(CC)CC)C(=S)N(CC)CC |
N, N-Diethylthio-1-piperidinecarboxamide | C(=S)(N(CC)CC)N1CCCCC1 |