If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(+)-Xylose | C(O)(C(O)CO)C(O)C=O |
D-Xylose | C(O)(C(O)CO)C(O)C=O |
D-Xylose, (2,4-dinitrophenyl)hydrazone | N(N=CC(O)C(O)C(O)CO)c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
D-Xylose__(2_4-dinitrophenyl)hydrazone | N(N=CC(O)C(O)C(O)CO)c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
L(+)-Xylose | C(O)(C(O)CO)C(O)C=O |
L-Xylose | C(O)(C(O)CO)C(O)C=O |
Xylose (VAN) | C(O)(C(O)CO)C(O)C=O |
Xylose, D- | C(O)(C(O)CO)C(O)C=O |
Xylose, L- | C(O)(C(O)CO)C(O)C=O |
Xylose_(VAN) | C(O)(C(O)CO)C(O)C=O |