If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Butyramide | C(CC)C(N)=O |
Butyramide, 2,2,3,3,4,4,4-heptafluoro- | C(F)(F)(C(F)(F)F)C(F)(F)C(N)=O |
Butyramide, 2,3-epoxy-3-phenyl- | CC1(OC1C(N)=O)c2ccccc2 |
Butyramide, 2-allylthio-2-ethyl-N-methyl- | C(CC)(CC)(SCC=C)C(=O)NC |
Butyramide, 2-bromo-2-ethyl- | C(Br)(CC)(CC)C(N)=O |
Butyramide, 2-cyano- | C(CC)(C#N)C(N)=O |
Butyramide, 2-ethyl- | C(CC)(CC)C(N)=O |
Butyramide, 2-phenyl- | C(CC)(C(N)=O)c1ccccc1 |
Butyramide, 4-hydroxy- | C(CCO)C(N)=O |
Butyramide, N, N-dibenzyl- | N(Cc1ccccc1)(Cc2ccccc2)C(=O)CCC |
Butyramide, N, N-diethyl-3-methyl- | N(CC)(CC)C(=O)CC(C)C |
Butyramide, N, N-diisopropyl- | N(C(C)C)(C(C)C)C(=O)CCC |
Butyramide, N,N-dibutyl- | N(CCCC)(CCCC)C(=O)CCC |
Butyramide, N,N-diethyl- | N(CC)(CC)C(=O)CCC |
Butyramide, N,N-dimethyl- | C(=O)(CCC)N(C)C |
Butyramide, N,N-dipentyl- | N(CCCCC)(CCCCC)C(=O)CCC |
Butyramide, N-(2-carbamoylethyl)-2,4-dihydroxy-3, 3-dimethyl-, D- | C(O)(C(=O)NCCC(N)=O)C(C)(C)CO |
Butyramide, N-1-naphthyl- | N(C(=O)CCC)c1cccc2ccccc12 |
Butyramide, N-2-naphthyl- | N(C(=O)CCC)c1ccc2ccccc2c1 |
Butyramide, N-bItyl- | N(CCCC)C(=O)CCC |
Butyramide, N-benzyl- | C(NC(=O)CCC)c1ccccc1 |
Butyramide, N-cyclohexyl- | N(C(=O)CCC)C1CCCCC1 |
Butyramide, N-hexyl- | C(=O)(CCC)NCCCCCC |
Butyramide, N-isobutyl- | C(=O)(CCC)NCC(C)C |
Butyramide, N-methyl- | C(=O)(NC)CCC |
Butyramide, N-pentyl- | C(=O)(CCC)NCCCCC |
Butyramide, N-propyl- | C(=O)(CCC)NCCC |
Butyramide, N-sec-butyl- | N(C(C)CC)C(=O)CCC |
Butyramide__N-1-naphthyl- | N(C(=O)CCC)c1cccc2ccccc12 |
Butyramide__N__N-diethyl-3-methyl- | N(CC)(CC)C(=O)CC(C)C |
N, N-Diethyl-n-butyramide | N(CC)(CC)C(=O)CCC |
N, N-Dimethyl-n-butyramide | C(=O)(CCC)N(C)C |
N__N-Diethyl-n-butyramide | N(CC)(CC)C(=O)CCC |
N__N-Dimethyl-n-butyramide | C(=O)(CCC)N(C)C |
n-Butyramide | C(CC)C(N)=O |