If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
D-Glucuronic acid GAMMA_-lactone | C(O)(C=O)C1OC(=O)C(O)C1O |
D-Glucuronic acid lactone (VAN) | C(O)(C=O)C1OC(=O)C(O)C1O |
D-Glucuronic acid, 2-aminocyclohexanemethanamine platinum complex | C(O)(C(O)C(O)C=O)C1O[Pt]2(NCC3CCCCC3N2)OC1=O |
D-Glucuronic acid, GAMMA_-lactone | C(O)(C=O)C1OC(=O)C(O)C1O |
D-Glucuronic acid, platinum complex | C(O)(C(O)C(O)C=O)C1O[Pt]2(NCC3CCCCC3N2)OC1=O |
GLUCURONIC ACID (D) | C(=O)(O)C1OC(O)C(O)C(O)C1O |
Glucuronic acid GAMMA_-lactone | C(O)(C=O)C1OC(=O)C(O)C1O |
Glucuronic acid lactone | C(O)(C=O)C1OC(=O)C(O)C1O |
Glucuronic acid, GAMMA_-lactone, 1-((4-pyridinylcarbonyl)hydrazone) | C(O)(C=NNC(=O)c1ccncc1)C2OC(=O)C(O)C2O |
Glucuronic acid, GAMMA_-lactone, 1-(isonicotinoylhydrazone), D- | C(O)(C=NNC(=O)c1ccncc1)C2OC(=O)C(O)C2O |
Glucuronic acid, GAMMA_-lactone, D- | C(O)(C=O)C1OC(=O)C(O)C1O |
L-Mandelonitrile-BETA_-glucuronic acid | O(C(C#N)c1ccccc1)C2OC(C(=O)O)C(O)C(O)C2O |
Trimetrexate glucuronic acid salt | Cc1c(CNc2cc(OC)c(OC)c(OC)c2)ccc3nc(N)nc(N)c13.O=CC(O)C(O)C(O)C(O)C(=O)O |