If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Atlantichrome Blue Black RZN | N(=Nc1c(O)ccc2ccccc12)c3c(O)cc(c4ccccc34)S(=O)(=O)O |
Atlantichrome Brilliant Blue B | C(c1cc(C)c(O)c(c1)C(=O)O)(=C2C=C(C)C(=O)C(=C2)C(=O)O)c3c(Cl)cccc3Cl |
Atlantichrome Brown RH | N(=Nc1cc(ccc1O)[N+](=O)[O-])c2cc(c(N)cc2N)S(=O)(=O)O |
Atlantichrome Cyanine RA | O=S1(=O)OC(c2cc(C)c(O)c(c2)C(=O)O)(c3cc(C)c(O)c(c3)C(=O)O)c4ccccc14 |
Atlantichrome Fast Red B | N(=NC1C(C)=NN(C1=O)c2ccccc2)c3c(O)cc(c4ccccc34)S(=O)(=O)O |
Atlantichrome Garnet Y | N(=Nc1ccc(O)cc1O)c2cc(ccc2O)S(=O)(=O)O |
Atlantichrome Orange G | N(=Nc1ccc(cc1)N=Nc2ccc(cc2)S(=O)(=O)O)c3ccc(O)c(c3)C(=O)O |
Atlantichrome Violet B | N(=Nc1cc(ccc1O)S(=O)(=O)O)c2c(O)ccc3ccccc23 |
Atlantichrome Yellow 3G | N(=Nc1ccc(cc1)NC(C)=O)c2ccc(O)c(c2)C(=O)O |
Atlantichrome Yellow D | S(=O)(=O)(O)c1ccc2cc(N=Nc3ccc(O)c(c3)C(=O)O)ccc2c1 |