If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Devol Blue VB Salt | S(=O)(=O)(O)O.COc1ccc(cc1)Nc2ccc(N)cc2 |
Devol Blue VB | S(=O)(=O)(O)O.COc1ccc(cc1)Nc2ccc(N)cc2 |
Devol Bordeaux B | [N+](=O)([O-])c1cc(OC)ccc1N |
Devol Bordeaux GP Salt | [N+](=O)([O-])c1cc(OC)ccc1N |
Devol Brown Salt C | O(C)c1ccc(Cl)cc1N |
Devol Garnet GB Salt | N(=Nc1ccc(N)c(C)c1)c2ccccc2C |
Devol Orange B | [N+](=O)([O-])c1ccccc1N |
Devol Orange C | Clc1cccc(N)c1 |
Devol Orange GC Salt | Clc1cccc(N)c1 |
Devol Orange GC | Clc1cccc(N)c1 |
Devol Orange R | [N+](=O)([O-])c1cccc(N)c1 |
Devol Orange Salt B | [N+](=O)([O-])c1ccccc1N |
Devol Red E | O(C)c1cc(ccc1N)[N+](=O)[O-] |
Devol Red F | [N+](=O)([O-])c1cc(Cl)ccc1N |
Devol Red G | [N+](=O)([O-])c1cc(C)ccc1N |
Devol Red GG | [N+](=O)([O-])c1ccc(N)cc1 |
Devol Red J | O(C)c1ccc(Cl)cc1N |
Devol Red K | Cc1cc(Cl)ccc1N |
Devol Red RL | [N+](=O)([O-])c1ccc(N)c(C)c1 |
Devol Red Salt E | [N+](=O)([O-])c1ccc(N)c(C)c1 |
Devol Red Salt F | [N+](=O)([O-])c1cc(Cl)ccc1N |
Devol Red Salt G | [N+](=O)([O-])c1cc(C)ccc1N |
Devol Red TA Salt | Cc1cc(Cl)ccc1N |
Devol Red TR | Cc1cc(Cl)ccc1N |
Devol Scarlet 2GS Base | Nc1cc(Cl)ccc1Cl |
Devol Scarlet B | [N+](=O)([O-])c1ccc(C)c(N)c1 |
Devol Scarlet G Salt | [N+](=O)([O-])c1ccc(C)c(N)c1 |
Devol scarlet 2GS salt | Nc1cc(Cl)ccc1Cl |
Devol scarlet A (free base) | Nc1cc(Cl)ccc1Cl |
Devol scarlet salt A | Nc1cc(Cl)ccc1Cl |