If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Oxetanone | O=C1CCO1 |
2-Oxetanone, 3, 3-dimethyl-4-(1-methylethylidene)- | C(C)(C)=C1OC(=O)C1(C)C |
2-Oxetanone, 3,3-bis(trifluoromethyl)- | C(F)(F)(F)C1(CC(=O)O1)C(F)(F)F |
2-Oxetanone, 3,3-diphenyl- | O=C1OCC1(c2ccccc2)c3ccccc3 |
2-Oxetanone, 4,4-bis(trifluoromethyl)- | C(F)(F)(F)C1(CC(=O)O1)C(F)(F)F |
2-Oxetanone, 4-isopropylidene-3,3-dimethyl- | C(C)(C)=C1OC(=O)C1(C)C |
2-Oxetanone, 4-methylene- | C=C1CC(=O)O1 |
3, 3-Diphenyl-2-oxetanone | O=C1OCC1(c2ccccc2)c3ccccc3 |
4, 4-Bis(trifluoromethyl)-2-oxetanone | C(F)(F)(F)C1(CC(=O)O1)C(F)(F)F |
4-Isopropylidene-3,3-dimethyl-2-oxetanone | C(C)(C)=C1OC(=O)C1(C)C |
4-Methylene-2-oxetanone | C=C1CC(=O)O1 |