If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Methyluracil | O=C1NC(=O)C=CN1C |
2-Thio-6-methyluracil | Cc1cc(O)nc(S)n1 |
3-Isopropyl-5-bromo-6-methyluracil | C(C)(C)N1C(=O)NC(C)=C(Br)C1=O |
4-Methyluracil | Cc1cc(O)nc(S)n1 |
5,6-Dihydro-6-methyluracil | CC1CC(=O)NC(=O)N1 |
5-(Bis(2-chloroethyl)amino)-6-methyluracil | N(CCCl)(CCCl)c1c(C)nc(O)nc1O |
5-Bromo-1-methyluracil | BrC1=CN(C)C(=O)NC1=O |
5-Bromo-3-isopropyl-6-methyluracil | C(C)(C)N1C(=O)NC(C)=C(Br)C1=O |
5-Bromo-6-methyluracil | Brc1c(C)nc(O)nc1O |
5-Hydroxymethyl-4-methyluracil | C(O)c1c(C)nc(O)nc1O |
5-Hydroxymethyl-6-methyluracil | C(O)c1c(C)nc(O)nc1O |
5-Methyluracil | Oc1nc(O)ncc1C |
5-Nitro-6-methyluracil | [N+](=O)([O-])c1c(C)nc(O)nc1O |
6-Methyluracil | Cc1cc(O)nc(O)n1 |
6-Thio-4-methyluracil | Cc1cc(O)nc(S)n1 |
Dihydro-6-methyluracil | CC1CC(=O)NC(=O)N1 |