If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
6-Geranyl-7-hydroxycoumarin | C(C=C(C)CCC=C(C)C)c1cc2C=CC(=O)Oc2cc1O |
Geranyl ALPHA_-toluate | C(C(=O)OCC=C(C)CCC=C(C)C)c1ccccc1 |
Geranyl acetate | C(C)(CCC=C(C)C)=CCOC(C)=O |
Geranyl alcohol | C(C)(=CCO)CCC=C(C)C |
Geranyl butyrate | C(C)(CCC=C(C)C)=CCOC(=O)CCC |
Geranyl chloride | C(C)(=CCCl)CCC=C(C)C |
Geranyl formate | C(C)(=CCOC=O)CCC=C(C)C |
Geranyl phenylacetate | C(C(=O)OCC=C(C)CCC=C(C)C)c1ccccc1 |
Geranyl_chloride | C(C)(=CCCl)CCC=C(C)C |
Linalyl, neryl, geranyl acetates, mixture | C(C)(CCC=C(C)C)=CCOC(C)=O |
Phenylacetic acid, geranyl ester | C(C(=O)OCC=C(C)CCC=C(C)C)c1ccccc1 |