If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Alcohol, anhydrous | C(C)O |
Aluminum bromide, anhydrous(DOT) | [Al](Br)(Br)Br |
Aluminum_bromide__anhydrous(DOT) | [Al](Br)(Br)Br |
Anhydrous butylchloral | C(Cl)(Cl)(C=O)C(C)Cl |
Anhydrous calcium sulfate | S(=O)(=O)(O)O |
Anhydrous chlorobutanol | C(C)(C)(O)C(Cl)(Cl)Cl |
Anhydrous citric acid | C(C(=O)O)C(O)(CC(=O)O)C(=O)O |
Anhydrous dextrose | C(O)(C(O)CO)C(O)C(O)C=O |
Anhydrous sodium acetate | C(C)(=O)O |
Anhydrous tetrasodium pyrophosphate | O(P(=O)(O)O)P(=O)(O)O |
Azapropazone (anhydrous) | O=C1C(CCC)C(=O)N2C(=Nc3ccc(C)cc3N12)N(C)C |
Chlorobutanol, anhydrous | C(C)(C)(O)C(Cl)(Cl)Cl |
Citric acid, anhydrous | C(C(=O)O)C(O)(CC(=O)O)C(=O)O |
Cupric sulfate anhydrous | S(=O)(=O)(O)O |
D-Glucose, anhydrous | C(O)(C(O)CO)C(O)C(O)C=O |
Dextrose, anhydrous | C(O)(C(O)CO)C(O)C(O)C=O |
Dimethylamine (anhydrous) | N(C)C |
Dimethylamine anhydrous (DOT) | N(C)C |
Ethyl alcohol, anhydrous | C(C)O |
Ferric chloride, solid, anhydrous (DOT) | [Fe](Cl)(Cl)Cl |
Ferric_chloride__solid__anhydrous_(DOT) | [Fe](Cl)(Cl)Cl |
Glucose, anhydrous | C(O)(C(O)CO)C(O)C(O)C=O |
Glycerin, anhydrous | C(O)(CO)CO |
Hydrindantin, anhydrous | OC1(C(=O)c2ccccc2C1(O)O)C3(O)C(=O)c4ccccc4C3(O)O |
Methyl chloromethyl ether, anhydrous(DOT) | C(Cl)OC |
Methyl_chloromethyl_ether__anhydrous(DOT) | C(Cl)OC |
Piperazine, anhydrous | C1CNCCN1 |
Sodium phosphate, anhydrous | P(=O)(O)(O)O |
Sodium sulfate, anhydrous | S(=O)(=O)(O)O |
Sodium sulfide, anhydrous (DOT) | S([Na])[Na] |
Sodium thiosulfate anhydrous | S(=O)(=O)(O)S |
Sodium_sulfide__anhydrous_(DOT) | S([Na])[Na] |
Stannic chloride, anhydrous | [Sn](Cl)(Cl)(Cl)Cl |
Tetrasodium pyrophosphate, anhydrous | O(P(=O)(O)O)P(=O)(O)O |
Theophylline, anhydrous | O=C1N(C)C(=O)N(C)C2=C1N=CN2 |
Tin tetrachloride, anhydrous | [Sn](Cl)(Cl)(Cl)Cl |