If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Undecen-10-al | C(CCCC=C)CCCCC=O |
1-Undecen-11-ol | C(CCCC=C)CCCCCO |
1-Undecen-11-yl acetate | C(CCCCCCCC=C)COC(C)=O |
10-Undecen-1-al | C(CCCC=C)CCCCC=O |
10-Undecen-1-ol acetate | C(CCCCCCCC=C)COC(C)=O |
10-Undecen-1-ol | C(CCCC=C)CCCCCO |
10-Undecen-1-ol, acetate | C(CCCCCCCC=C)COC(C)=O |
10-Undecen-1-ol, propanoate | C(CCCCCCCC=C)COC(=O)CC |
10-Undecen-1-ol__propanoate | C(CCCCCCCC=C)COC(=O)CC |
10-Undecen-1-yl acetate | C(CCCCCCCC=C)COC(C)=O |
2,6,10-Trimethyl-9-undecen-1-al | C(C)(CCC=C(C)C)CCCC(C)C=O |
2_6_10-Trimethyl-9-undecen-1-al | C(C)(CCC=C(C)C)CCCC(C)C=O |
UNDECEN-10-ACID-1 | C(CCCCC=C)CCCC(=O)O |