If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Acetamidine acetate | C(C)(=O)O.CC(=N)N |
Acetamidine hydrochloride | C(C)(=N)N |
Acetamidine monoacetate | C(C)(=O)O.CC(=N)N |
Acetamidine monohydrochloride | C(C)(=N)N |
Acetamidine, 2,2'-dithiodi-, sulfate (1:1) | S(=O)(=O)(O)O.N=C(N)CSSCC(=N)N |
Acetamidine, 2-mercapto-, hydrogen sulfate (ester) | S(CC(=N)N)S(=O)(=O)O |
Acetamidine, N',2,2,2-tetrachloro- | C(=N)(NCl)C(Cl)(Cl)Cl |
Acetamidine, N,N'-bis(p-chlorophenyl)- | N(=C(C)Nc1ccc(Cl)cc1)c2ccc(Cl)cc2 |
Acetamidine, N,N'-bis(p-ethoxyphenyl)-, hydrochloride | N(=C(C)Nc1ccc(OCC)cc1)c2ccc(OCC)cc2 |
Acetamidine, N,N'-bis(p-ethoxyphenyl)-, monohydrochloride | N(=C(C)Nc1ccc(OCC)cc1)c2ccc(OCC)cc2 |
Acetamidine, N,N'-diphenyl- | N(=C(C)Nc1ccccc1)c2ccccc2 |
Acetamidine, N-(1-adamantylmethyl)-2-mercapto-, monohydrochloride | C(NC(=N)CS)C12CC3CC(C1)CC(C2)C3 |
Acetamidine, N-N'-o-phenylene- | CC1=Nc2ccccc2N1 |
Acetamidine, monohydrochloride | C(C)(=N)N |
Acetamidine__N'_2_2_2-tetrachloro- | C(=N)(NCl)C(Cl)(Cl)Cl |
Acetamidine__N-N'-o-phenylene- | CC1=Nc2ccccc2N1 |
N, N'-Bis(p-ethoxyphenyl)acetamidine hydrochloride | N(=C(C)Nc1ccc(OCC)cc1)c2ccc(OCC)cc2 |
N,N'-Bis(p-chlorophenyl)acetamidine | N(=C(C)Nc1ccc(Cl)cc1)c2ccc(Cl)cc2 |