If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-Furoic acid methyl ester | C(=O)(OC)C1=CC=CO1 |
2-Furoic acid | C(=O)(O)C1=CC=CO1 |
2-Furoic acid, 3, 4-dichloro- | C(=O)(O)C1=C(Cl)C(Cl)=CO1 |
2-Furoic acid, 3-methyl-, methyl ester | C(=O)(OC)C1=C(C)C=CO1 |
2-Furoic acid, 5-(hydroxymethyl)- | C(=O)(O)C1=CC=C(CO)O1 |
2-Furoic acid, 5-acetamido-, ethyl ester | C(=O)(OCC)C1=CC=C(O1)NC(C)=O |
2-Furoic acid, 5-bromo- | C(=O)(O)C1=CC=C(Br)O1 |
2-Furoic acid, 5-chloro- | C(=O)(O)C1=CC=C(Cl)O1 |
2-Furoic acid, 5-nitro- | C(=O)(O)C1=CC=C(O1)[N+](=O)[O-] |
2-Furoic acid, 5-nitro-, propyl ester | C(=O)(OCCC)C1=CC=C(O1)[N+](=O)[O-] |
2-Furoic acid, allyl ester | C(=O)(OCC=C)C1=CC=CO1 |
2-Furoic acid, butyl ester | C(=O)(OCCCC)C1=CC=CO1 |
2-Furoic acid, ethyl ester | C(=O)(OCC)C1=CC=CO1 |
2-Furoic acid, hydrazide | C(=O)(NN)C1=CC=CO1 |
2-Furoic acid, isopropyl ester | C(=O)(OC(C)C)C1=CC=CO1 |
2-Furoic acid, methyl ester | C(=O)(OC)C1=CC=CO1 |
2-Furoic acid, n-butyl ester | C(=O)(OCCCC)C1=CC=CO1 |
2-Furoic acid, n-propyl ester | C(=O)(OCCC)C1=CC=CO1 |
2-Furoic acid, propyl ester | C(=O)(OCCC)C1=CC=CO1 |
3-Furoic acid | C(=O)(O)C1=COC=C1 |
3-Furoic acid, methyl ester | C(=O)(OC)C1=COC=C1 |
3-Furoic acid, tetrahydro-4-methylene-5-oxo- | C(=O)(O)C1COC(=O)C1=C |
3-Furoic_acid__tetrahydro-4-methylene-5-oxo- | C(=O)(O)C1COC(=O)C1=C |
5-Hydroxymethyl-2-furoic acid | C(=O)(O)C1=CC=C(CO)O1 |
ALPHA_-Furoic acid | C(=O)(O)C1=CC=CO1 |
Furoic acid, hydrazide | C(=O)(NN)C1=CC=CO1 |