If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(p-Chlorobenzenesulfonyl)-3-propylurea | S(=O)(=O)(NC(=O)NCCC)c1ccc(Cl)cc1 |
1-Propyl-3-(p-chlorobenzenesulfonyl)urea | S(=O)(=O)(NC(=O)NCCC)c1ccc(Cl)cc1 |
2-Nitro-4-chlorobenzenesulfonyl chloride | [N+](=O)([O-])c1cc(Cl)ccc1S(Cl)(=O)=O |
4-Chlorobenzenesulfonyl chloride | S(Cl)(=O)(=O)c1ccc(Cl)cc1 |
4-Chlorobenzenesulfonyl fluoride | S(F)(=O)(=O)c1ccc(Cl)cc1 |
N-(p-Chlorobenzenesulfonyl)-N'-propylurea | S(=O)(=O)(NC(=O)NCCC)c1ccc(Cl)cc1 |
N-Propyl-N'-(p-chlorobenzenesulfonyl)urea | S(=O)(=O)(NC(=O)NCCC)c1ccc(Cl)cc1 |
p-Chlorobenzenesulfonyl chloride | S(Cl)(=O)(=O)c1ccc(Cl)cc1 |
p-Chlorobenzenesulfonyl fluoride | S(F)(=O)(=O)c1ccc(Cl)cc1 |