If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
ALPHA_-(2-Hydroxyethyl)acetoacetic acid GAMMA_-lactone | C(C)(=O)C1CCOC1=O |
Acetoacetic acid 3-hydroxyanilide | N(C(=O)CC(C)=O)c1cccc(O)c1 |
Acetoacetic acid anilide | N(C(=O)CC(C)=O)c1ccccc1 |
Acetoacetic acid m-xylidide | N(C(=O)CC(C)=O)c1ccc(C)cc1C |
Acetoacetic acid o-anisidide | N(C(=O)CC(C)=O)c1ccccc1OC |
Acetoacetic acid p-phenetidide | N(C(=O)CC(C)=O)c1ccc(OCC)cc1 |
Acetoacetic acid p-toluidide | N(C(=O)CC(C)=O)c1ccc(C)cc1 |
Acetoacetic acid, 2-(2,4-dinitrophenyl)-, ethyl ester | C(C(C)=O)(C(=O)OCC)c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
Acetoacetic acid, 2-acetyl-, ethyl ester | C(C(C)=O)(C(C)=O)C(=O)OCC |
Acetoacetic acid, 2-chloro-, ethyl ester | C(Cl)(C(C)=O)C(=O)OCC |
Acetoacetic acid, 2-ethyl-, ethyl ester | C(CC)(C(C)=O)C(=O)OCC |
Acetoacetic acid, 2-ethylhexyl ester | C(CC)(CCCC)COC(=O)CC(C)=O |
Acetoacetic acid, 2-isopropyl-, ethyl ester | C(C(C)C)(C(C)=O)C(=O)OCC |
Acetoacetic acid, 2-methyl-, ethyl ester | C(C)(C(C)=O)C(=O)OCC |
Acetoacetic acid, 2-methyl-, methyl ester | C(C)(C(C)=O)C(=O)OC |
Acetoacetic acid, 4,4,4-trifluoro-, ethyl ester | C(C(=O)OCC)C(=O)C(F)(F)F |
Acetoacetic acid, 4-fluoro-, ethyl ester | C(C(=O)CF)C(=O)OCC |
Acetoacetic acid, allyl ester | C(C(C)=O)C(=O)OCC=C |
Acetoacetic acid, benzyl ester | C(OC(=O)CC(C)=O)c1ccccc1 |
Acetoacetic acid, butyl ester | O(CCCC)C(=O)CC(C)=O |
Acetoacetic acid, cyclohexyl ester | O(C(=O)CC(C)=O)C1CCCCC1 |
Acetoacetic acid, ethyl ester | C(C(C)=O)C(=O)OCC |
Acetoacetic acid, ethyl ester, 1,2-propylene ketal | C(C(=O)OCC)C1(C)OCC(C)O1 |
Acetoacetic acid, ethyl ester, 3-semicarbazone | C(C(=O)OCC)C(C)=NNC(N)=O |
Acetoacetic acid, ethyl ester, copper complex | O(CC)C1=O[Cu]2(O=C(C)C1)O=C(C)CC(OCC)=O2 |
Acetoacetic acid, ethyl ester, semicarbazone | C(C(=O)OCC)C(C)=NNC(N)=O |
Acetoacetic acid, p-phenetidide | N(C(=O)CC(C)=O)c1ccc(OCC)cc1 |
Acetoacetic acid, propyl ester | C(C(C)=O)C(=O)OCCC |
Acetoacetic acid, tert-butyl ester | O(C(=O)CC(C)=O)C(C)(C)C |
Acetoacetic acid-2, 5-dichloroanilide | N(C(=O)CC(C)=O)c1cc(Cl)ccc1Cl |
Acetoacetic anilide | N(C(=O)CC(C)=O)c1ccccc1 |
Acetoacetic ester | C(C(C)=O)C(=O)OCC |