If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Hexanal | C(CCC)CC=O |
Hexanal | C(CCC)CC=O |
Hexanal, (2,4-dinitrophenyl)hydrazone | [N+](=O)([O-])c1cc(ccc1NN=CCCCCC)[N+](=O)[O-] |
Hexanal, 2-(phenylmethylene)- | C(=C(C=O)CCCC)c1ccccc1 |
Hexanal, 2-ethyl- | C(CC)(C=O)CCCC |
Hexanal, 3,5,5-trimethyl- | C(C)(CC=O)CC(C)(C)C |
Hexanal, 5-methyl-2-(1-methylethylidene)- | C(C=O)(CCC(C)C)=C(C)C |
Hexanal__(2_4-dinitrophenyl)hydrazone | [N+](=O)([O-])c1cc(ccc1NN=CCCCCC)[N+](=O)[O-] |
Hexanal__3_5_5-trimethyl- | C(C)(CC=O)CC(C)(C)C |
Hexanal__5-methyl-2-(1-methylethylidene)- | C(C=O)(CCC(C)C)=C(C)C |
n-Hexanal | C(CCC)CC=O |