If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Methanimidamide, N'-(3-methoxyphenyl)-N,N-dimethyl- | N(=CN(C)C)c1cccc(OC)c1 |
Methanimidamide, N'-(4-chlorophenyl)-N,N-dimethyl- | N(=CN(C)C)c1ccc(Cl)cc1 |
Methanimidamide, N'-butyl-N,N-dimethyl- | N(CCCC)=CN(C)C |
Methanimidamide, N, N'-bis(3-methoxyphenyl)- | N(=CNc1cccc(OC)c1)c2cccc(OC)c2 |
Methanimidamide, N, N-dimethyl-N'-phenyl- | N(=CN(C)C)c1ccccc1 |
Methanimidamide, N,N'-1, 2-ethenediyl- | C1=CNC=N1 |
Methanimidamide, N,N'-diphenyl- | N(=CNc1ccccc1)c2ccccc2 |
Methanimidamide, N,N-dimethyl-N'-(4-nitrophenyl)- | [N+](=O)([O-])c1ccc(cc1)N=CN(C)C |
Methanimidamide, N-hydroxy- | C(=N)NO |
Methanimidamide, monoacetate | C(C)(=O)O.N=CN |
Methanimidamide__N'-(3-methoxyphenyl)-N_N-dimethyl- | N(=CN(C)C)c1cccc(OC)c1 |
Methanimidamide__N'-(4-chlorophenyl)-N_N-dimethyl- | N(=CN(C)C)c1ccc(Cl)cc1 |
Methanimidamide__N'-butyl-N_N-dimethyl- | N(CCCC)=CN(C)C |
Methanimidamide__N-hydroxy- | C(=N)NO |
Methanimidamide__N_N'-1__2-ethenediyl- | C1=CNC=N1 |
Methanimidamide__N_N'-diphenyl- | N(=CNc1ccccc1)c2ccccc2 |
Methanimidamide__N_N-dimethyl-N'-(4-nitrophenyl)- | [N+](=O)([O-])c1ccc(cc1)N=CN(C)C |
Methanimidamide__N__N'-bis(3-methoxyphenyl)- | N(=CNc1cccc(OC)c1)c2cccc(OC)c2 |
Methanimidamide__N__N-dimethyl-N'-phenyl- | N(=CN(C)C)c1ccccc1 |
Methanimidamide__monoacetate | C(C)(=O)O.N=CN |