If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Bromobenzaldehyde | C(=O)c1ccccc1Br |
2-Hydroxy-5-bromobenzaldehyde | C(=O)c1cc(Br)ccc1O |
2-Nitro-5-bromobenzaldehyde | C(=O)c1cc(Br)ccc1[N+](=O)[O-] |
3-Bromobenzaldehyde | C(=O)c1cccc(Br)c1 |
4-Bromobenzaldehyde | C(=O)c1ccc(Br)cc1 |
4-Hydroxy-3-bromobenzaldehyde | C(=O)c1ccc(O)c(Br)c1 |
m-Bromobenzaldehyde | C(=O)c1cccc(Br)c1 |
o-Bromobenzaldehyde | C(=O)c1ccccc1Br |
p-Bromobenzaldehyde | C(=O)c1ccc(Br)cc1 |