If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Furfurylamine | C(N)C1=CC=CO1 |
ALPHA_-Furfurylamine | C(N)C1=CC=CO1 |
Furfurylamine | C(N)C1=CC=CO1 |
Furfurylamine, ALPHA_-benzyl-N-ethyl- | C(NCC)(Cc1ccccc1)C2=CC=CO2 |
Furfurylamine, ALPHA_-benzyl-N-methyl- | C(NC)(Cc1ccccc1)C2=CC=CO2 |
Furfurylamine, ALPHA_-benzyl-N-propyl- | C(NCCC)(Cc1ccccc1)C2=CC=CO2 |
Furfurylamine, N-methyl- | C(NC)C1=CC=CO1 |
Furfurylamine, tetrahydro- | C(N)C1CCCO1 |
Furfurylamine__ALPHA_-benzyl-N-methyl- | C(NC)(Cc1ccccc1)C2=CC=CO2 |
Furfurylamine__ALPHA_-benzyl-N-propyl- | C(NCCC)(Cc1ccccc1)C2=CC=CO2 |