If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
5-Pyrimidinemethanol, 2,4-dimethyl- | C(O)c1cnc(C)nc1C |
5-Pyrimidinemethanol, 4-amino-2-(methylthio)- | S(C)c1ncc(CO)c(N)n1 |
5-Pyrimidinemethanol, 4-amino-2-methoxy- | O(C)c1ncc(CO)c(N)n1 |
5-Pyrimidinemethanol, 4-amino-2-methyl- | C(O)c1cnc(C)nc1N |
5-Pyrimidinemethanol, ALPHA_-(2, 4-dichlorophenyl)-ALPHA_-phenyl- | C(O)(c1ccccc1)(c2cncnc2)c3ccc(Cl)cc3Cl |
5-Pyrimidinemethanol__4-amino-2-(methylthio)- | S(C)c1ncc(CO)c(N)n1 |
5-Pyrimidinemethanol__4-amino-2-methoxy- | O(C)c1ncc(CO)c(N)n1 |
5-Pyrimidinemethanol__4-amino-2-methyl- | C(O)c1cnc(C)nc1N |
5-Pyrimidinemethanol__ALPHA_-(2__4-dichlorophenyl)-ALPHA_-phenyl- | C(O)(c1ccccc1)(c2cncnc2)c3ccc(Cl)cc3Cl |
ALPHA_-(2,4-Dichlorophenyl)-ALPHA_-phenyl-5-pyrimidinemethanol | C(O)(c1ccccc1)(c2cncnc2)c3ccc(Cl)cc3Cl |