If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Formamidine acetate | C(C)(=O)O.N=CN |
Formamidine sulfinic acid | C(=N)(N)S(=O)O |
Formamidine, 1,1'-azobis(N-chloro- | C(=N)(NCl)N=NC(=N)NCl |
Formamidine, 1-cyano-N,N'-diphenyl- | C(C#N)(=Nc1ccccc1)Nc2ccccc2 |
Formamidine, N'-(m-methoxyphenyl)-N,N-dimethyl- | N(=CN(C)C)c1cccc(OC)c1 |
Formamidine, N'-(p-chlorophenyl)-N,N-dimethyl- | N(=CN(C)C)c1ccc(Cl)cc1 |
Formamidine, N'-butyl-N,N-dimethyl- | N(CCCC)=CN(C)C |
Formamidine, N,N'-bis(3-methoxyphenyl)- | N(=CNc1cccc(OC)c1)c2cccc(OC)c2 |
Formamidine, N,N'-dicarbamoyl- | C(=NC(N)=O)NC(N)=O |
Formamidine, N,N'-dicyclohexyl-1-morpholino- | C(=NC1CCCCC1)(NC2CCCCC2)N3CCOCC3 |
Formamidine, N,N'-diphenyl- | N(=CNc1ccccc1)c2ccccc2 |
Formamidine, N,N'-vinylene- | C1=CNC=N1 |
Formamidine, N,N-dimethyl-N'-(p-nitrophenyl)- | [N+](=O)([O-])c1ccc(cc1)N=CN(C)C |
Formamidine, N,N-dimethyl-N'-2-thiazolyl-, hydrochloride | N(=CN(C)C)C1=NC=CS1 |
Formamidine, N,N-dimethyl-N'-phenyl- | N(=CN(C)C)c1ccccc1 |
Formamidine, monoacetate | C(C)(=O)O.N=CN |
Formamidine__1-cyano-N_N'-diphenyl- | C(C#N)(=Nc1ccccc1)Nc2ccccc2 |
Formamidine__N_N'-dicarbamoyl- | C(=NC(N)=O)NC(N)=O |
Formamidine__N_N-dimethyl-N'-2-thiazolyl-__hydrochloride | N(=CN(C)C)C1=NC=CS1 |
N, N'-Bis(3-methoxyphenyl)formamidine | N(=CNc1cccc(OC)c1)c2cccc(OC)c2 |
N, N-Dimethyl-N'-(4-chlorophenyl)formamidine | N(=CN(C)C)c1ccc(Cl)cc1 |
N, N-Dimethyl-N'-(p-chlorophenyl)formamidine | N(=CN(C)C)c1ccc(Cl)cc1 |
N, N-Dimethyl-N'-(p-nitrophenyl)formamidine | [N+](=O)([O-])c1ccc(cc1)N=CN(C)C |