If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
3-(1-Aziridinyl)butyronitrile | C(C)(CC#N)N1CC1 |
3-(N-Aziridinyl)butyronitrile | C(C)(CC#N)N1CC1 |
4-(Dibutylamino)butyronitrile picrate | N(CCCC)(CCCC)CCCC#N.O=N(O)c1cc([N+](=O)[O-])c(O)c(c1)[N+](=O)[O-] |
Butyronitrile , 4-(dibutylamino)- | N(CCCC)(CCCC)CCCC#N |
Butyronitrile | C(CC)C#N |
Butyronitrile, 2-carbamoyl- | C(CC)(C#N)C(N)=O |
Butyronitrile, 2-hydroxy-2-methyl- | C(C)(O)(CC)C#N |
Butyronitrile, 2-phenyl- | C(CC)(C#N)c1ccccc1 |
Butyronitrile, 3,4-epoxy- | C(C#N)C1CO1 |
Butyronitrile, 3-methyl- | C(C#N)C(C)C |
Butyronitrile, 4,4, 4-trichloro- | C(CC#N)C(Cl)(Cl)Cl |
Butyronitrile, 4-(dibutylamino)-, picrate | N(CCCC)(CCCC)CCCC#N.O=N(O)c1cc([N+](=O)[O-])c(O)c(c1)[N+](=O)[O-] |
Butyronitrile, 4-(dimethylamino)- | C(CCC#N)N(C)C |
Butyronitrile, 4-anilino- | N(CCCC#N)c1ccccc1 |
Butyronitrile, 4-bromo- | C(CBr)CC#N |
Butyronitrile, 4-bromo-2,2-diphenyl- | C(C#N)(CCBr)(c1ccccc1)c2ccccc2 |
Butyronitrile, 4-chloro- | C(CCl)CC#N |
Butyronitrile, 4-phenyl- | C(CCC#N)c1ccccc1 |
Butyronitrile__2-carbamoyl- | C(CC)(C#N)C(N)=O |
Butyronitrile__3_4-epoxy- | C(C#N)C1CO1 |
Butyronitrile__4-phenyl- | C(CCC#N)c1ccccc1 |
Butyronitrile__4_4__4-trichloro- | C(CC#N)C(Cl)(Cl)Cl |
Indole-3-butyronitrile | C(CCC#N)C1=CNc2ccccc12 |
n-Butyronitrile | C(CC)C#N |