If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Bornyl 3-methylbutyrate | CC12CCC(CC1OC(=O)CC(C)C)C2(C)C |
2-Bornyl propionate | CC12CCC(CC1OC(=O)CC)C2(C)C |
Bornyl acetate | CC12CCC(CC1OC(C)=O)C2(C)C |
Bornyl acetic ether | CC12CCC(CC1OC(C)=O)C2(C)C |
Bornyl cinnamate | CC12CCC(CC1OC(=O)C=Cc3ccccc3)C2(C)C |
Bornyl isovalerate | CC12CCC(CC1OC(=O)CC(C)C)C2(C)C |
Bornyl salicylate | CC12CCC(CC1OC(=O)c3ccccc3O)C2(C)C |
Butyric acid, 2-bornyl ester | CC12CCC(CC1OC(=O)CCC)C2(C)C |
Cinnamic acid, 2-bornyl ester, endo- | CC12CCC(CC1OC(=O)C=Cc3ccccc3)C2(C)C |
Isovaleric acid, 2-bornyl ester | CC12CCC(CC1OC(=O)CC(C)C)C2(C)C |
Salicylic acid, 2-bornyl ester, endo- | CC12CCC(CC1OC(=O)c3ccccc3O)C2(C)C |