If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Naphthalenamine, N,N-bis(2-iodoethyl)- | N(CCI)(CCI)c1ccc2ccccc2c1 |
2-Naphthalenamine__N_N-bis(2-iodoethyl)- | N(CCI)(CCI)c1ccc2ccccc2c1 |
Benzaldehyde, 4-(bis(2-iodoethyl)amino)- | N(CCI)(CCI)c1ccc(C=O)cc1 |
Benzaldehyde__4-(bis(2-iodoethyl)amino)- | N(CCI)(CCI)c1ccc(C=O)cc1 |
Benzoic acid, 2-((4-(bis(2-iodoethyl)amino)-2-methylphenyl)azo)- | N(CCI)(CCI)c1ccc(N=Nc2ccccc2C(=O)O)c(C)c1 |
Benzoic_acid__2-((4-(bis(2-iodoethyl)amino)-2-methylphenyl)azo)- | N(CCI)(CCI)c1ccc(N=Nc2ccccc2C(=O)O)c(C)c1 |
Carbamic acid, 2-iodoethyl ester | O(CCI)C(N)=O |
Carbamic_acid__2-iodoethyl_ester | O(CCI)C(N)=O |