If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Bonide Krab Crabgrass Killer | C(#N)O |
Pryamoi krasnyi svetoprochnyi 2S | Oc1c2ccc(NC(=O)c3ccccc3)cc2cc(c1N=Nc4ccc(cc4)N=Nc5ccc(cc5)S(=O)(=O)O)S(=O)(=O)O |
Kratedyn | C(O)(C(C)NC)c1ccccc1 |
KRAUSSIANIN (B678021K218 | CC1CC2(OC34OC2C5C6OC6(CO)C(O)C7(O)C(OC(=O)c8ccccc8)C(C)C(C(C)CCCCCCC4O)C7C15O3)C(C)=C |
Kraussianin | CC1CC2(OC34OC2C5C6OC6(CO)C(O)C7(O)C(OC(=O)c8ccccc8)C(C)C(C(C)CCCCCCC4O)C7C15O3)C(C)=C |
Kreatin | N(C)(CC(=O)O)C(=N)N |
Krebiozon | N(C)(CC(=O)O)C(=N)N |
Krecalvin | P(=O)(OC)(OC)OC=C(Cl)Cl |
Kregasan | C(=S)(SSC(=S)N(C)C)N(C)C |
Krenite | [N+](=O)([O-])c1cc(cc(C)c1O)[N+](=O)[O-] |
Potassium perrhenate (KReO4) | [Re](=O)(=O)(=O)=O |
Potassium perrhenate, KReO4 | [Re](=O)(=O)(=O)=O |
Potassium rhenium oxide (KReO4) | [Re](=O)(=O)(=O)=O |
Kresamone | [N+](=O)([O-])c1cc(cc(C)c1O)[N+](=O)[O-] |
Kresatin | O(C(C)=O)c1cccc(C)c1 |
kresol | A sub-index is available for kresol... |
Kresoxypropandiol | O(CC(O)CO)c1ccccc1C |
Kresulfin | S(Sc1ccc(C)cc1)c2ccc(C)cc2 |
2, 2'-Bis-6-terc.butyl-p-kresylmethan(CZECH) | C(c1cc(C)cc(c1O)C(C)(C)C)c2cc(C)cc(c2O)C(C)(C)C |
Modr kresylova (CZECH) | N(C)(C)c1cc2oc3cc(N)ccc3nc2cc1C |
Krezidin | O(C)c1ccc(C)cc1N |
Dwunitro-o-krezol (POLISH) | [N+](=O)([O-])c1cc(cc(C)c1O)[N+](=O)[O-] |
Krezone | O(CC(=O)O)c1ccc(Cl)cc1C |
Krezotol 50 | [N+](=O)([O-])c1cc(cc(C)c1O)[N+](=O)[O-] |
Krinocorts | CC12CCC3C(CCC4=CC(=O)CCC34C)C1CCC2C(=O)COC(C)=O |
Kripid | N(C(N)=S)c1cccc2ccccc12 |
Kriptin | N(CCN(C)C)(Cc1ccc(OC)cc1)c2ccccn2.O=C(O)C=CC(=O)O |
Kriptofix 222 | N12CCOCCOCCN(CCOCCOCC1)CCOCCOCC2 |
Krisolamine | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Kristallose | O=S1(=O)NC(=O)c2ccccc12 |
Kromeko Brown 6G | N(=Nc1ccc(cc1)[N+](=O)[O-])c2cc(N=Nc3ccc(cc3)S(=O)(=O)O)cc(C(=O)O)c2O |
Kromfax solvent | S(CCO)CCO |
Kromfax@ Solvent | S(CCO)CCO |
kromon | A sub-index is available for kromon... |
Kronisol (VAN) | C(=O)(OCCOCCCC)c1ccccc1C(=O)OCCOCCCC |
Kronos 2073 | [Ti](=O)=O |
Kronos CL 220 | [Ti](=O)=O |
Kronos RN 40P | [Ti](=O)=O |
Kronos RN 56 | [Ti](=O)=O |
Kronos titanium dioxide | [Ti](=O)=O |
Krotenal | N(CC)(CC)C(=S)SSC(=S)N(CC)CC |
Krotiline | O(CC(=O)O)c1ccc(Cl)cc1Cl |
Metanil Yellow KRSU | N(c1ccccc1)c2ccc(cc2)N=Nc3cccc(c3)S(=O)(=O)O |
Kryogenin | N(NC(N)=O)c1ccccc1 |
Kryptocavin | CN1CCc2cc(OC)c(OC)cc2C(=O)Cc3ccc4OCOc4c3C1 |
Kryptocyanin | C(C=Cc1ccn(CC)c2ccccc12)=C3C=CN(CC)c4ccccc34 |
Kryptocyanine iodide | C(C=Cc1ccn(CC)c2ccccc12)=C3C=CN(CC)c4ccccc34 |
Kryptocyanine | C(C=Cc1ccn(CC)c2ccccc12)=C3C=CN(CC)c4ccccc34 |
kryptofix | A sub-index is available for kryptofix... |
Kryptogenin | CC12CCC3C(CC=C4CC(O)CCC34C)C1CC(=O)C2C(C)C(=O)CCC(C)CO |
Kryptogenin-3,26-diacetate | CC12CCC3C(CC=C4CC(CCC34C)OC(C)=O)C1CC(=O)C2C(C)C(=O)CCC(C)COC(C)=O |
Kryptopine | CN1CCc2cc(OC)c(OC)cc2C(=O)Cc3ccc4OCOc4c3C1 |
Kryptopyrrol | C(C)C1=C(C)NC=C1C |
Kryptopyrrole | C(C)C1=C(C)NC=C1C |
Krysid pi | N(C(N)=S)c1cccc2ccccc12 |
Krysid | N(C(N)=S)c1cccc2ccccc12 |
Etylu krzemian (POLISH) | [Si](OCC)(OCC)(OCC)OCC |
Krzewotoks | O(CC(=O)OCCCC)c1cc(Cl)c(Cl)cc1Cl |
Krzewotox | O(CC(=O)OCCCC)c1cc(Cl)c(Cl)cc1Cl |