If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Graphtol Blue 2GLS | [Cu]123N4C5=C6C=CC=CC6=C4N=C7N2=C(N=C8N1C(=NC9=N3C(=N5)c%10ccccc9%10)c%11ccccc8%11)c%12ccccc7%12 |
Graphtol Blue BL | [Cu]123N4C5=C6C=CC=CC6=C4N=C7N2=C(N=C8N1C(=NC9=N3C(=N5)c%10ccccc9%10)c%11ccccc8%11)c%12ccccc7%12 |
Graphtol Blue BLF | [Cu]123N4C5=C6C=CC=CC6=C4N=C7N2=C(N=C8N1C(=NC9=N3C(=N5)c%10ccccc9%10)c%11ccccc8%11)c%12ccccc7%12 |
Graphtol Blue RL | O=C1c2ccccc2C(=O)c3ccc4Nc5c(ccc6C(=O)c7ccccc7C(=O)c56)Nc4c13 |
Graphtol Bordeaux HB | S(=O)(=O)(O)c1cccc2c1ccc(N=Nc3cccc4ccccc34)c2O |
Graphtol Red 2GL | N(=Nc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Graphtol Red A-4RL | N(=Nc1ccc(C)cc1[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Graphtol Yellow 10GL | N(=NC(C(C)=O)C(=O)Nc1ccccc1Cl)c2ccc(Cl)cc2[N+](=O)[O-] |
Graphtol Yellow 4813-0 | N(=NC(C(C)=O)C(=O)Nc1ccccc1)c2ccc(C)cc2[N+](=O)[O-] |
Graphtol Yellow A-HG | Clc1cc(ccc1N=NC(C(C)=O)C(=O)Nc2ccccc2)c3ccc(N=NC(C(C)=O)C(=O)Nc4ccccc4)c(Cl)c3 |
Graphtol Yellow GL | N(=NC(C(C)=O)C(=O)Nc1ccccc1)c2ccc(C)cc2[N+](=O)[O-] |