If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(Acetonyl)-3,4-methylenedioxybenzene | C(C(C)=O)c1ccc2OCOc2c1 |
5-Acetonyl-1,3-benzodioxole | C(C(C)=O)c1ccc2OCOc2c1 |
Acetone, acetonyl- | C(CC(C)=O)C(C)=O |
Acetonyl acetate | C(OC(C)=O)C(C)=O |
Acetonyl acetone | C(CC(C)=O)C(C)=O |
Acetonyl chloride | C(C)(=O)CCl |
Acetonyl | C(=O)(O)c1ccccc1OC(C)=O |
Titanium acetonyl acetonate | O=[Ti]123O=C(C)CC(C)=O1.CC(CC(C)=O3)=O2 |