If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Chloro-2', 6'-diethyl-N-(butoxymethyl)acetanilide | N(COCCCC)(C(=O)CCl)c1c(CC)cccc1CC |
Acetamide, N-(butoxymethyl)-2-chloro-N-(2,6-diethylphenyl)- | N(COCCCC)(C(=O)CCl)c1c(CC)cccc1CC |
Acetamide__N-(butoxymethyl)-2-chloro-N-(2_6-diethylphenyl)- | N(COCCCC)(C(=O)CCl)c1c(CC)cccc1CC |
Acetanilide, N-(butoxymethyl)-2-chloro-2',6'-diethyl- | N(COCCCC)(C(=O)CCl)c1c(CC)cccc1CC |
Benzene, (butoxymethyl)- | C(OCCCC)c1ccccc1 |
Benzene__(butoxymethyl)- | C(OCCCC)c1ccccc1 |
N-(Butoxymethyl)-2-chloro-2',6'-diethylacetanilide | N(COCCCC)(C(=O)CCl)c1c(CC)cccc1CC |
Oxirane, (butoxymethyl)- | C(OCCCC)C1CO1 |