If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,2-Dichloroethyl ethyl ether | C(Cl)(CCl)OCC |
1,3-Dioxolane, 2-(1, 2-dichloroethyl)-4-methyl- | C(Cl)(CCl)C1OCC(C)O1 |
1_3-Dioxolane__2-(1__2-dichloroethyl)-4-methyl- | C(Cl)(CCl)C1OCC(C)O1 |
2,2'-Dichloroethyl ether | O(CCCl)CCCl |
2-(1, 2-Dichloroethyl)-4-methyl-1,3-dioxolane | C(Cl)(CCl)C1OCC(C)O1 |
ALPHA_-Amino-GAMMA_-((p-(dichloroethyl)amino)phenyl)butyric acid | N(CCCl)(CCCl)c1ccc(cc1)CCC(N)C(=O)O |
ALPHA_-Amino-GAMMA_-((p-(dichloroethyl)amino)phenyl)butyric_acid | N(CCCl)(CCCl)c1ccc(cc1)CCC(N)C(=O)O |
BETA_, BETA_'-Dichloroethyl ether | O(CCCl)CCCl |
Dichloroethyl ether | O(CCCl)CCCl |
Dichloroethyl formal | C(OCCCl)OCCCl |
Dichloroethyl oxide | O(CCCl)CCCl |
Dichloroethyl-BETA_-naphthylamine | N(CCCl)(CCCl)c1ccc2ccccc2c1 |
Ether, 1,2-dichloroethyl ethyl | C(Cl)(CCl)OCC |
Methyl 1,1-difluoro-2,2-dichloroethyl ether | C(F)(F)(OC)C(Cl)Cl |
Naphthalene, 2-(2,2-dichloroethyl)-1-methyl-4-phenyl- | C(C(Cl)Cl)c1cc(c2ccccc2)c3ccccc3c1C |
Naphthalene__2-(2_2-dichloroethyl)-1-methyl-4-phenyl- | C(C(Cl)Cl)c1cc(c2ccccc2)c3ccccc3c1C |
p-N, N-(Dichloroethyl)aminophenylacetic acid | N(CCCl)(CCCl)c1ccc(cc1)CC(=O)O |
sym-Dichloroethyl ether | O(CCCl)CCCl |