If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
5-(ALPHA_-Methylbenzyl)semioxamazide | C(C)(NC(=O)C(=O)NN)c1ccccc1 |
5-(ALPHA_-Phenylethyl)semioxamazide | C(C)(NC(=O)C(=O)NN)c1ccccc1 |
Semioxamazide | C(=O)(NN)C(N)=O |
Semioxamazide, 5-(ALPHA_-methylbenzyl)- | C(C)(NC(=O)C(=O)NN)c1ccccc1 |
Semioxamazide, 5-(ALPHA_-methylbenzyl)-, (-)- | C(C)(NC(=O)C(=O)NN)c1ccccc1 |
l-5-(ALPHA_-Phenylethyl)semioxamazide | C(C)(NC(=O)C(=O)NN)c1ccccc1 |