If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Carbonic acid, trithio-, cyclic ethylene ester | S=C1SCCS1 |
Carbonic acid, trithio-, cyclic propylene ester | CC1CSC(=S)S1 |
Carbonic acid, trithio-, cyclic trimethylene ester | S=C1SCCCS1 |
Carbonic acid, trithio-, diester with mercaptoacetic acid | C(=S)(SCC(=O)O)SCC(=O)O |
Carbonic acid, trithio-, diphenyl ester | S(C(=S)Sc1ccccc1)c2ccccc2 |
Carbonic acid, trithio-, dipotassium salt | C(=S)(S)S |
Carbonic acid, trithio-, mono-tert-butyl-ester, potassium salt | S(C(=S)S)C(C)(C)C |
Carbonic_acid__trithio-__cyclic_ethylene_ester | S=C1SCCS1 |
Carbonic_acid__trithio-__cyclic_propylene_ester | CC1CSC(=S)S1 |
Carbonic_acid__trithio-__cyclic_trimethylene_ester | S=C1SCCCS1 |
Carbonic_acid__trithio-__diester_with_mercaptoacetic_acid | C(=S)(SCC(=O)O)SCC(=O)O |
Carbonic_acid__trithio-__diphenyl_ester | S(C(=S)Sc1ccccc1)c2ccccc2 |
Carbonic_acid__trithio-__dipotassium_salt | C(=S)(S)S |
Cyanuric acid, trithio- | Sc1nc(S)nc(S)n1 |
Orthoformic acid, trithio-, triethyl ester | C(SCC)(SCC)SCC |
Orthoformic acid, trithio-, trimethyl ester | C(SC)(SC)SC |
Orthoformic_acid__trithio-__trimethyl_ester | C(SC)(SC)SC |
Peroxycarbonic acid, trithio-, O-methyl SS-(trichloromethyl) ester | S(SC(Cl)(Cl)Cl)C(=S)OC |
Peroxycarbonic_acid__trithio-__O-methyl_SS-(trichloromethyl)_ester | S(SC(Cl)(Cl)Cl)C(=S)OC |
Uric acid, 1,3-dimethyl-2,6, 8-trithio- | S=C1N(C)C(=S)N(C)C2=C1NC(=S)N2 |
Uric_acid__1_3-dimethyl-2_6__8-trithio- | S=C1N(C)C(=S)N(C)C2=C1NC(=S)N2 |