If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
((Propylmethylcarbinyl)allyl) barbituric acid sodium salt | C(C)(CCC)C1(CC=C)C(=O)NC(=O)NC1=O |
(1,2-(Methylenedioxy)-4-allyl)benzene | C(C=C)c1ccc2OCOc2c1 |
.pi.-Allyl palladium chloride | [Pd]1234CC1=C4.Cl2[Pd]56(Cl3)CC5=C6 |
1,3-Benzodioxole, 5-allyl- | C(C=C)c1ccc2OCOc2c1 |
1-Allyl-2,5-dimethoxy-3, 4-(methylenedioxy)benzene | O(C)c1c(CC=C)cc(OC)c2OCOc12 |
1-Allyl-2-methylbenzene | C(C=C)c1ccccc1C |
1-Allyl-2-thiourea | N(CC=C)C(N)=S |
1-Allyl-3,4-(methylenedioxy)benzene | C(C=C)c1ccc2OCOc2c1 |
1-Allyl-3,4-dimethoxybenzene | O(C)c1cc(CC=C)ccc1OC |
1-Allyl-3-(2-formylphenyl)-2-thiourea | N(C(=S)NCC=C)c1ccccc1C=O |
1-Allyl-3-(2-hydroxyethyl)-2-thiourea | C(=S)(NCC=C)NCCO |
1-Allyl-3-(3'-nitrophenyl)-2-thiourea | N(C(=S)NCC=C)c1cccc(c1)[N+](=O)[O-] |
1-Allyl-3-phenyl-2-thiourea | N(C(=S)NCC=C)c1ccccc1 |
1-Allyl-4-methoxybenzene | C(C=C)c1ccc(OC)cc1 |
1-Allyl-4-methylbenzene | C(C=C)c1ccc(C)cc1 |
1-Allyl-5-(allylamino)tetrazole | N(CC=C)C1=NN=NN1CC=C |
1-Aziridinepropionic acid, allyl ester | C(CC(=O)OCC=C)N1CC1 |
10-Undecenoic acid, allyl ester | C(CCCCCCCC=C)C(=O)OCC=C |
16BETA_-Estriol, 3-allyl ether | CC12CCC3c4ccc(OCC=C)cc4CCC3C1CC(O)C2O |
17ALPHA_-Allyl-17-BETA_-hydroxy-DELTA_(sup 4)-estren | CC12CCC3C4CCCC=C4CCC3C1CCC2(O)CC=C |
17ALPHA_-Allyl-17-BETA_-hydroxy-DELTA_(sup_4)-estren | CC12CCC3C4CCCC=C4CCC3C1CCC2(O)CC=C |
17ALPHA_-Allyl-17BETA_-hydroxy-4-estrene | CC12CCC3C4CCCC=C4CCC3C1CCC2(O)CC=C |
17ALPHA_-Allyl-3-deoxy-19-nortestosterone | CC12CCC3C4CCCC=C4CCC3C1CCC2(O)CC=C |
17ALPHA_-Allyl-4-destrene-17BETA_-ol | CC12CCC3C4CCCC=C4CCC3C1CCC2(O)CC=C |
17ALPHA_-Allyl-4-estren-17BETA_-ol | CC12CCC3C4CCCC=C4CCC3C1CCC2(O)CC=C |
17ALPHA_-Allyl-4-oestrene-17BETA_-ol | CC12CCC3C4CCCC=C4CCC3C1CCC2(O)CC=C |
2-(2-Allyl-6-methoxyphenoxy)triethylamine hydrochloride | O(CCN(CC)CC)c1c(OC)cccc1CC=C |
2-Allyl-1-methylbenzene | C(C=C)c1ccccc1C |
2-Allyl-4-chlorophenol | C(C=C)c1cc(Cl)ccc1O |
2-Allyl-4-methoxyphenol | C(C=C)c1cc(OC)ccc1O |
2-Allyl-6-methoxyphenol | C(C=C)c1cccc(OC)c1O |
2-Allyl-6-methylphenol | C(C=C)c1cccc(C)c1O |
2-Benzoxazolinone, 3-allyl-5-chloro- | C(C=C)N1C(=O)Oc2ccc(Cl)cc12 |
2-Benzoxazolinone__3-allyl-5-chloro- | C(C=C)N1C(=O)Oc2ccc(Cl)cc12 |
2-Cyanoethyl allyl ether | C(CC#N)OCC=C |
2-Cyclopenten-1-one, 2-allyl-4-hydroxy-3-methyl- (VAN8CI) | C(C=C)C1=C(C)C(O)CC1=O |
2-Cyclopenten-1-one__2-allyl-4-hydroxy-3-methyl-_(VAN8CI) | C(C=C)C1=C(C)C(O)CC1=O |
2-Furoic acid, allyl ester | C(=O)(OCC=C)C1=CC=CO1 |
3'-Allyl-4'-hydroxyacetophenone | C(C=C)c1cc(ccc1O)C(C)=O |
3,4-Epoxy-6-methylcyclohexanecarboxylic acid, allyl ester | C(=O)(OCC=C)C1CC2OC2CC1C |
3-Allyl-2-methyl-4-oxo-2-cyclopenten-1-yl chrysanthemate | C(=C(C)C)C1C(C(=O)OC2CC(=O)C(CC=C)=C2C)C1(C)C |
3-Allyl-4-keto-2-methylcyclopentenyl chrysanthemum monocarboxylate | C(=C(C)C)C1C(C(=O)OC2CC(=O)C(CC=C)=C2C)C1(C)C |
4-Allyl-1, 2-(methylenedioxy)benzene | C(C=C)c1ccc2OCOc2c1 |
4-Allyl-1, 2-dimethoxybenzene | O(C)c1cc(CC=C)ccc1OC |
4-Allyl-1,1-dimethyl-3-thiosemicarbazide | N(N(C)C)C(=S)NCC=C |
4-Allyl-1-hydroxy-2-methoxybenzene | O(C)c1cc(CC=C)ccc1O |
4-Allyl-1-methoxybenzene | C(C=C)c1ccc(OC)cc1 |
4-Allyl-2,6-dimethoxyphenol | O(C)c1cc(CC=C)cc(OC)c1O |
4-Allyl-2-methoxyphenol acetate | O(C(C)=O)c1ccc(CC=C)cc1OC |
4-Allyl-2-methoxyphenol | O(C)c1cc(CC=C)ccc1O |
4-Allyl-2-methoxyphenyl acetate | O(C(C)=O)c1ccc(CC=C)cc1OC |
4-Allyl-2-methoxyphenyl benzoate | O(C(=O)c1ccccc1)c2ccc(CC=C)cc2OC |
4-Allyl-2-methoxyphenyl phenylacetate | O(C(=O)Cc1ccccc1)c2ccc(CC=C)cc2OC |
4-Allyl-3-thiosemicarbazide | C(=S)(NN)NCC=C |
5-Allyl-1,3-benzodioxole | C(C=C)c1ccc2OCOc2c1 |
5-Allyl-5(1-methylbutyl)barbituric acid sodium derivative | C(C)(CCC)C1(CC=C)C(=O)NC(=O)NC1=O |
5-Allyl-5-(1-methylbutyl)barbituric acid, sodium salt | C(C)(CCC)C1(CC=C)C(=O)NC(=O)NC1=O |
5-Allyl-5-(1-methylbutyl)malonylurea sodium salt | C(C)(CCC)C1(CC=C)C(=O)NC(=O)NC1=O |
5-Allyl-5-butylbarbituric acid | C(CCC)C1(CC=C)C(=O)NC(=O)NC1=O |
5-Allyl-5-isopropylbarbiturate | C(C=C)C1(C(C)C)C(=O)NC(=O)NC1=O |
5-Allyl-5-isopropylbarbituric acid sodium salt | C(C=C)C1(C(C)C)C(=O)NC(=O)NC1=O |
5-Allyl-5-isopropylbarbituric acid | C(C=C)C1(C(C)C)C(=O)NC(=O)NC1=O |
5-Allyl-5-n-butylbarbituric acid | C(CCC)C1(CC=C)C(=O)NC(=O)NC1=O |
5-Allyl-5-propylbarbituric acid | C(CC)C1(CC=C)C(=O)NC(=O)NC1=O |
5H-Dibenz(c,e)azepine, 6, 7-dihydro-6-allyl-, phosphate (1:1) | P(=O)(O)(O)O.C=CCN1Cc2ccccc2c3ccccc3C1 |
5H-Dibenz(c,e)azepine, 6-allyl-6,7-dihydro-, phosphate (1:1) | P(=O)(O)(O)O.C=CCN1Cc2ccccc2c3ccccc3C1 |
6-Allyl-2-cresol | C(C=C)c1cccc(C)c1O |
6-Allyl-2-methoxyphenol | C(C=C)c1cccc(OC)c1O |
6-Allyl-2-methylphenol | C(C=C)c1cccc(C)c1O |
6-Allyl-6, 7-dihydro-5H-dibenz(c,e)azepine phosphate | P(=O)(O)(O)O.C=CCN1Cc2ccccc2c3ccccc3C1 |
6-Allyl-o-cresol | C(C=C)c1cccc(C)c1O |
9,10-Epoxystearic acid, allyl ester | C(CCCCCCC(=O)OCC=C)C1OC1CCCCCCCC |
ALLYL ISOTHIOCYANATE | C(C=C)N=C=S |
ALLYL THIOUREA | C(=S)(NCC=C)NCC=C |
ALPHA_-allyl phenethylamine hydrochloride | C(C(N)CC=C)c1ccccc1 |
ANISOLE, P-ALLYL- | C(C=C)c1ccc(OC)cc1 |
Acetamide, N-allyl- | N(CC=C)C(C)=O |
Acetic acid, allyl ester | O(CC=C)C(C)=O |
Acetic acid, chloro-, allyl ester | C(=O)(CCl)OCC=C |
Acetic acid, phenoxy-, allyl ester | O(CC(=O)OCC=C)c1ccccc1 |
Acetic acid, phenyl-, 4-allyl-2-methoxyphenyl ester | O(C(=O)Cc1ccccc1)c2ccc(CC=C)cc2OC |
Acetic acid, phenyl-, allyl ester | C(C(=O)OCC=C)c1ccccc1 |
Acetic acid, trichloro-, allyl ester | C(=O)(OCC=C)C(Cl)(Cl)Cl |
Acetic acid, trifluoro-, allyl ester | C(=O)(OCC=C)C(F)(F)F |
Acetoacetic acid, allyl ester | C(C(C)=O)C(=O)OCC=C |
Acetophenone, 3'-allyl-4'-hydroxy- | C(C=C)c1cc(ccc1O)C(C)=O |
Acetylenecarboxylic acid, allyl ester | C(=O)(C#C)OCC=C |
Acetylenecarboxylic_acid__allyl_ester | C(=O)(C#C)OCC=C |
Acrylic acid, allyl ester | C(=O)(C=C)OCC=C |
Adenosine, N-allyl-, hemihydrate | OC1C(O)C(CO)OC1N2C=Nc3c(NCC=C)ncnc23 |
Adenosine__N-allyl-__hemihydrate | OC1C(O)C(CO)OC1N2C=Nc3c(NCC=C)ncnc23 |
Allyl 10-undecenoate | C(CCCCCCCC=C)C(=O)OCC=C |
Allyl 2, 3-epoxypropyl ether | C(OCC=C)C1CO1 |
Allyl 2,4,6-tribromophenyl ether | O(CC=C)c1c(Br)cc(Br)cc1Br |
Allyl 2-cyanoethyl ether | C(CC#N)OCC=C |
Allyl 2-ethylbutyrate | C(CC)(CC)C(=O)OCC=C |
Allyl 2-furancarboxylate | C(=O)(OCC=C)C1=CC=CO1 |
Allyl 2-furoate | C(=O)(OCC=C)C1=CC=CO1 |
Allyl 3,4-epoxy-6-methylcyclohexanecarboxylate | C(=O)(OCC=C)C1CC2OC2CC1C |
Allyl 3-chloro-2-hydroxypropyl ether | C(O)(CCl)COCC=C |
Allyl 3-phenylacrylate | C(=CC(=O)OCC=C)c1ccccc1 |
Allyl BETA_-(1-aziridinyl)propionate | C(CC(=O)OCC=C)N1CC1 |
Allyl BETA_-cyanoethyl ether | C(CC#N)OCC=C |
Allyl Cellosolve | O(CC=C)CCO |
Allyl acetate | O(CC=C)C(C)=O |
Allyl acetoacetate | C(C(C)=O)C(=O)OCC=C |
Allyl acetylacetate | C(C(C)=O)C(=O)OCC=C |
Allyl acrylate | C(=O)(C=C)OCC=C |
Allyl adipate | C(=O)(OCC=C)CCCCC(=O)OCC=C |
Allyl al | C(=C)CO |
Allyl alcohol oxide | C(O)C1CO1 |
Allyl alcohol | C(=C)CO |
Allyl alcohol, 1-ethyl-3-methyl- | C(O)(CC)C=CC |
Allyl aldehyde | C(=C)C=O |
Allyl anthranilate | C(=O)(OCC=C)c1ccccc1N |
Allyl benzoate | C(=O)(OCC=C)c1ccccc1 |
Allyl borate, (C3H5O)3B | B(OCC=C)(OCC=C)OCC=C |
Allyl bromide | C(Br)C=C |
Allyl butanoate | C(=O)(CCC)OCC=C |
Allyl butyrate | C(=O)(CCC)OCC=C |
Allyl caproate | C(CCCC)C(=O)OCC=C |
Allyl caprylate | C(=O)(OCC=C)CCCCCCC |
Allyl carbamate | O(CC=C)C(N)=O |
Allyl carbonate | C(=O)(OCC=C)OCC=C |
Allyl chloride | C(=C)CCl |
Allyl chloroacetate | C(=O)(CCl)OCC=C |
Allyl cinerin I | C(=C(C)C)C1C(C(=O)OC2CC(=O)C(CC=C)=C2C)C1(C)C |
Allyl cinerin | C(=C(C)C)C1C(C(=O)OC2CC(=O)C(CC=C)=C2C)C1(C)C |
Allyl cinnamate | C(=CC(=O)OCC=C)c1ccccc1 |
Allyl crotonate | C(=O)(C=CC)OCC=C |
Allyl cyanide | C(C=C)C#N |
Allyl cyclohexanehexanoate | C(CCCCC(=O)OCC=C)C1CCCCC1 |
Allyl cyclopentane | C(C=C)C1CCCC1 |
Allyl diglycol carbonate | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Allyl disulfide | S(CC=C)SCC=C |
Allyl dodecyl thiourea | N(CCCCCCCCCCCC)C(=S)NCC=C |
Allyl enanthate | C(CCCCC)C(=O)OCC=C |
Allyl ether | O(CC=C)CC=C |
Allyl formate | C(C=C)OC=O |
Allyl glycidyl ether | C(OCC=C)C1CO1 |
Allyl glycol | O(CC=C)CCO |
Allyl heptanoate | C(CCCCC)C(=O)OCC=C |
Allyl heptoate | C(CCCCC)C(=O)OCC=C |
Allyl heptylate | C(CCCCC)C(=O)OCC=C |
Allyl hexanoate | C(CCCC)C(=O)OCC=C |
Allyl homolog of cinerin I | C(=C(C)C)C1C(C(=O)OC2CC(=O)C(CC=C)=C2C)C1(C)C |
Allyl iodide hexamethylenetetramine | C(C=C)N12CN3CN(C1)CN(C2)C3 |
Allyl iodide hexamine | C(C=C)N12CN3CN(C1)CN(C2)C3 |
Allyl iodide | C(=C)CI |
Allyl isocyanate | C(C=C)N=C=O |
Allyl isosulfocyanate | C(C=C)N=C=S |
Allyl isothiocyanate | C(C=C)N=C=S |
Allyl isothiocyanate, non-perfume grade | C(C=C)N=C=S |
Allyl isovalerate | C(C(C)C)C(=O)OCC=C |
Allyl m-hydroxycarbanilate | N(C(=O)OCC=C)c1cccc(O)c1 |
Allyl mercaptan | C(=C)CS |
Allyl methacrylate | C(=O)(OCC=C)C(C)=C |
Allyl methyl sulfone | C(C=C)S(C)(=O)=O |
Allyl monosulfide | S(CC=C)CC=C |
Allyl mustard oil | C(C=C)N=C=S |
Allyl nonanoate | C(=O)(OCC=C)CCCCCCCC |
Allyl o-methoxyphenyl ether | O(CC=C)c1ccccc1OC |
Allyl octanoate | C(=O)(OCC=C)CCCCCCC |
Allyl p-chlorophenyl ether | O(CC=C)c1ccc(Cl)cc1 |
Allyl p-nitrophenyl ether | [N+](=O)([O-])c1ccc(OCC=C)cc1 |
Allyl p-tolyl sulfone | S(=O)(=O)(CC=C)c1ccc(C)cc1 |
Allyl p-tolyl thiourea | N(C(=S)NCC=C)c1ccc(C)cc1 |
Allyl palladium chloride dimer | [Pd]1234CC1=C4.Cl2[Pd]56(Cl3)CC5=C6 |
Allyl pelargonate | C(=O)(OCC=C)CCCCCCCC |
Allyl phenoxyacetate | O(CC(=O)OCC=C)c1ccccc1 |
Allyl phenoxylate | O(CC=C)c1ccccc1 |
Allyl phenyl ether | O(CC=C)c1ccccc1 |
Allyl phenyl sulfone | S(=O)(=O)(CC=C)c1ccccc1 |
Allyl phenyl thiourea | N(C(=S)NCC=C)c1ccccc1 |
Allyl phenylacetate | C(C(=O)OCC=C)c1ccccc1 |
Allyl phosphate ((C3H5O)3PO) | P(=O)(OCC=C)(OCC=C)OCC=C |
Allyl phosphate | P(=O)(OCC=C)(OCC=C)OCC=C |
Allyl phosphite | P(OCC=C)(OCC=C)OCC=C |
Allyl phosphite, (C3H5O)3P | P(OCC=C)(OCC=C)OCC=C |
Allyl phthalate | C(=O)(OCC=C)c1ccccc1C(=O)OCC=C |
Allyl propionate | C(=O)(CC)OCC=C |
Allyl propyl ether | O(CCC)CC=C |
Allyl propyl sulfide | S(CCC)CC=C |
Allyl salicylate | C(=O)(OCC=C)c1ccccc1O |
Allyl silicate ((C3H5O)4Si) | [Si](OCC=C)(OCC=C)(OCC=C)OCC=C |
Allyl sodium sulfate | O(CC=C)S(=O)(=O)O |
Allyl stearate | C(CCCCCCCCCCCCCCC)CC(=O)OCC=C |
Allyl sulfide | S(CC=C)CC=C |
Allyl sulfone | S(=O)(=O)(CC=C)CC=C |
Allyl trichloride | C(Cl)(CCl)CCl |
Allyl trichloroacetate | C(=O)(OCC=C)C(Cl)(Cl)Cl |
Allyl trichlorosilane | C(C=C)[Si](Cl)(Cl)Cl |
Allyl trifluoroacetate | C(=O)(OCC=C)C(F)(F)F |
Allyl vinyl ether | C(C=C)OC=C |
Allyl-(o-aldehydrophenyl)thiourea | N(C(=S)NCC=C)c1ccccc1C=O |
Allyl-1-phenylethyl(2)ether | C(COCC=C)c1ccccc1 |
Allyl-4-oxo-2-thioxothiazolidin | C(C=C)N1C(=O)CSC1=S |
Allyl-9,10-epoxystearate | C(CCCCCCC(=O)OCC=C)C1OC1CCCCCCCC |
Allyl-Chlorhydrinether | C(O)(CCl)COCC=C |
Allyl_sodium_sulfate | O(CC=C)S(=O)(=O)O |
Allyl_sulfone | S(=O)(=O)(CC=C)CC=C |
Aniline, N-allyl-2,4-dinitro- | [N+](=O)([O-])c1cc(ccc1NCC=C)[N+](=O)[O-] |
Anisole, p-allyl- | C(C=C)c1ccc(OC)cc1 |
Anthranilic acid, allyl ester | C(=O)(OCC=C)c1ccccc1N |
Barbituric acid , 5-allyl-5-propyl- | C(CC)C1(CC=C)C(=O)NC(=O)NC1=O |
Barbituric acid, 1-allyl-5,5-diethyl-2-thio-, sodium salt | C(C)C1(CC)C(=O)NC(=S)N(CC=C)C1=O |
Barbituric acid, 1-allyl-5-ethyl-5-isopentyl-2-thio-, sodium salt | C(CC(C)C)C1(CC)C(=O)NC(=S)N(CC=C)C1=O |
Barbituric acid, 1-allyl-5-ethyl-5-isopropenyl- | C(C)(=C)C1(CC)C(=O)NC(=O)N(CC=C)C1=O |
Barbituric acid, 5-allyl- | C(C=C)C1C(=O)NC(=O)NC1=O |
Barbituric acid, 5-allyl-5-(1-methylbutyl)-, sodium salt | C(C)(CCC)C1(CC=C)C(=O)NC(=O)NC1=O |
Barbituric acid, 5-allyl-5-(1-methylbutyl)-2-thio- (VAN8CI) | C(C)(CCC)C1(CC=C)C(=O)NC(=S)NC1=O |
Barbituric acid, 5-allyl-5-(1-methylpropenyl)- | C(C)(=CC)C1(CC=C)C(=O)NC(=O)NC1=O |
Barbituric acid, 5-allyl-5-butyl- | C(CCC)C1(CC=C)C(=O)NC(=O)NC1=O |
Barbituric acid, 5-allyl-5-butyl-, sodium salt | C(CCC)C1(CC=C)C(=O)NC(=O)NC1=O |
Barbituric acid, 5-allyl-5-isopropenyl- | C(C=C)C1(C(C)=C)C(=O)NC(=O)NC1=O |
Barbituric acid, 5-allyl-5-isopropyl- | C(C=C)C1(C(C)C)C(=O)NC(=O)NC1=O |
Barbituric acid, 5-allyl-5-isopropyl-, sodium deriv | C(C=C)C1(C(C)C)C(=O)NC(=O)NC1=O |
Barbituric acid, 5-allyl-5-isopropyl-, sodium salt | C(C=C)C1(C(C)C)C(=O)NC(=O)NC1=O |
Barbituric acid, 5-allyl-5-isopropyl-1-methyl- | C(C=C)C1(C(C)C)C(=O)NC(=O)N(C)C1=O |
Benzamide, N-allyl- | C(=O)(NCC=C)c1ccccc1 |
Benzene, 1-allyl-2,5-dimethoxy-3, 4-(methylenedioxy)- | O(C)c1c(CC=C)cc(OC)c2OCOc12 |
Benzene, 4-allyl-1, 2-dimethoxy- | O(C)c1cc(CC=C)ccc1OC |
Benzene, 4-allyl-1,2-(methylenedioxy)- | C(C=C)c1ccc2OCOc2c1 |
Benzene, 5-allyl-1,2,3-trimethoxy- | O(C)c1c(OC)cc(CC=C)cc1OC |
Benzene, allyl- | C(C=C)c1ccccc1 |
Benzene__1-allyl-2_5-dimethoxy-3__4-(methylenedioxy)- | O(C)c1c(CC=C)cc(OC)c2OCOc12 |
Benzoic acid, allyl ester | C(=O)(OCC=C)c1ccccc1 |
Bis(.pi.-allyl)dichlorodipalladium | [Pd]1234CC1=C4.Cl2[Pd]56(Cl3)CC5=C6 |
Butyric acid, 2-ethyl-, allyl ester | C(CC)(CC)C(=O)OCC=C |
Butyric acid, 3-methyl-, allyl ester | C(C(C)C)C(=O)OCC=C |
Butyric acid, allyl ester | C(=O)(CCC)OCC=C |
CINNAMIC ACID, TRANS-TRANS-3-METHYL-SULFONYL-ALLYL ESTER | C(=CC(=O)OCC=CS(C)(=O)=O)c1ccccc1 |
CINNAMIC_ACID__TRANS-TRANS-3-METHYL-SULFONYL-ALLYL_ESTER | C(=CC(=O)OCC=CS(C)(=O)=O)c1ccccc1 |
Carbamic acid, allyl ester | O(CC=C)C(N)=O |
Carbamic acid, allyl-, ethyl ester | C(=O)(OCC)NCC=C |
Carbamic acid, allyl-, m-(3,3-dimethylureido)phenyl ester | O(C(=O)NCC=C)c1cccc(c1)NC(=O)N(C)C |
Carbamic acid, m-chlorophenyl-, allyl ester | N(C(=O)OCC=C)c1cccc(Cl)c1 |
Carbamic_acid__m-chlorophenyl-__allyl_ester | N(C(=O)OCC=C)c1cccc(Cl)c1 |
Carbanilic acid, m-chloro-, allyl ester | N(C(=O)OCC=C)c1cccc(Cl)c1 |
Carbanilic acid, m-hydroxy-, allyl ester | N(C(=O)OCC=C)c1cccc(O)c1 |
Carbonic acid, allyl ester, diester with diethylene glycol | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Cinerin I allyl homolog | C(=C(C)C)C1C(C(=O)OC2CC(=O)C(CC=C)=C2C)C1(C)C |
Cinnamamide, N-allyl-ALPHA_,BETA_-dimethyl-4-fluoro-, (E)- | C(C)(c1ccc(F)cc1)=C(C)C(=O)NCC=C |
Cinnamic acid, 4-allyl-2-methoxyphenyl ester | O(C(=O)C=Cc1ccccc1)c2ccc(CC=C)cc2OC |
Cinnamic acid, allyl ester | C(=CC(=O)OCC=C)c1ccccc1 |
Coumarin, 6-allyl-7-hydroxy-4,8-dimethyl-, acetate | Cc1c(OC(C)=O)c(CC=C)cc2C(C)=CC(=O)Oc12 |
Coumarin__6-allyl-7-hydroxy-4_8-dimethyl-__acetate | Cc1c(OC(C)=O)c(CC=C)cc2C(C)=CC(=O)Oc12 |
Crotonamide, N-allyl- | C(=O)(C=CC)NCC=C |
Crotonic acid, allyl ester | C(=O)(C=CC)OCC=C |
Cyclohexane, allyl- | C(C=C)C1CCCCC1 |
Cyclohexanehexanoic acid, allyl ester | C(CCCCC(=O)OCC=C)C1CCCCC1 |
Cyclohexanone, 2-allyl- | C(C=C)C1CCCCC1=O |
Cyclopentane, allyl- | C(C=C)C1CCCC1 |
Dichloro(allyl)phenylsilane | [Si](Cl)(Cl)(CC=C)c1ccccc1 |
Diethylene glycol bis(allyl carbonate) | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Estr-4-en-17BETA_-ol, 17-allyl- | CC12CCC3C4CCCC=C4CCC3C1CCC2(O)CC=C |
Estrenol, allyl- | CC12CCC3C4CCCC=C4CCC3C1CCC2(O)CC=C |
Ether, allyl (3-chloro-2-hydroxypropyl) | C(O)(CCl)COCC=C |
Ether, allyl 2,3-epoxypropyl | C(OCC=C)C1CO1 |
Ether, allyl 2,4, 6-tribromophenyl | O(CC=C)c1c(Br)cc(Br)cc1Br |
Ether, allyl glyceryl | C(O)(CO)COCC=C |
Ether, allyl p-bromophenyl | O(CC=C)c1ccc(Br)cc1 |
Ether, allyl p-chlorophenyl | O(CC=C)c1ccc(Cl)cc1 |
Ether, allyl p-nitrophenyl | [N+](=O)([O-])c1ccc(OCC=C)cc1 |
Ether, allyl phenethyl | C(COCC=C)c1ccccc1 |
Ether, allyl phenyl | O(CC=C)c1ccccc1 |
Ether, allyl propyl | O(CCC)CC=C |
Ether, allyl vinyl | C(C=C)OC=C |
Ether__allyl_(3-chloro-2-hydroxypropyl) | C(O)(CCl)COCC=C |
Ether__allyl_p-bromophenyl | O(CC=C)c1ccc(Br)cc1 |
Ethylamine, 1-allyl-2-phenyl-, hydrochloride | C(C(N)CC=C)c1ccccc1 |
Formic acid, allyl ester | C(C=C)OC=O |
Glycerol ALPHA_-allyl ether | C(O)(CO)COCC=C |
Glycidyl allyl ether | C(OCC=C)C1CO1 |
Guaiacol allyl ether | O(CC=C)c1ccccc1OC |
Guaiacol, 6-allyl- | C(C=C)c1cccc(OC)c1O |
Heptanoic acid, allyl ester | C(CCCCC)C(=O)OCC=C |
Hexamethylenetetramine allyl iodide | C(C=C)N12CN3CN(C1)CN(C2)C3 |
Hexanoic acid, allyl ester | C(CCCC)C(=O)OCC=C |
Isocyanic acid, allyl ester | C(C=C)N=C=O |
Isocyanic_acid__allyl_ester | C(C=C)N=C=O |
Isothiocyanic acid, allyl ester | C(C=C)N=C=S |
Isovaleric acid, allyl ester | C(C(C)C)C(=O)OCC=C |
Itaconic acid, diester with allyl lactate | C(C(=O)OC(C)C(=O)OCC=C)C(=C)C(=O)OC(C)C(=O)OCC=C |
Lactamide, N-allyl- | C(=O)(NCC=C)C(C)O |
Lactamide__N-allyl- | C(=O)(NCC=C)C(C)O |
Maleimide, N-allyl- | C(C=C)N1C(=O)C=CC1=O |
Malonic acid, allyl- | C(CC=C)(C(=O)O)C(=O)O |
Malonic acid, allyl-, diethyl ester | C(CC=C)(C(=O)OCC)C(=O)OCC |
Methacrylic acid, allyl ester | C(=O)(OCC=C)C(C)=C |
Methenamine allyl iodide | C(C=C)N12CN3CN(C1)CN(C2)C3 |
Methyl 2-allyl acrylate | C(=C)(CC=C)C(=O)OC |
Methylenesuccinic acid ester with lactic acid allyl ester (1:1) | C(C(=O)OC(C)C(=O)OCC=C)C(=C)C(=O)OC(C)C(=O)OCC=C |
Morphinan-6-one, 17-allyl-4,5ALPHA_-epoxy-3,14-dihydroxy- | OC12CCC(=O)C3Oc4c(O)ccc5CC2N(CC=C)CCC13c45 |
Morpholine, 4-(3-(pentyloxy)allyl)- | C(C=COCCCCC)N1CCOCC1 |
N-Allyl pyridinium bromide | C(C=C)n1ccccc1 |
N-Allyl-N'-(BETA_-hydroxyethyl)thiourea | C(=S)(NCC=C)NCCO |
N-Allyl-N'-(p-methylphenyl)thiourea | N(C(=S)NCC=C)c1ccc(C)cc1 |
N-Allyl-N'-(p-tolyl)thiourea | N(C(=S)NCC=C)c1ccc(C)cc1 |
N-Allyl-N'-ethylthiourea | C(=S)(NCC)NCC=C |
N-Allyl-N'-phenylthiourea | N(C(=S)NCC=C)c1ccccc1 |
N-Allyl-N,N-dimethylamine | C(C=C)N(C)C |
N-Allyl-N-nitrosourea | N(N=O)(CC=C)C(N)=O |
N-Allyl-o-ethylthionocarbamate | C(=S)(OCC)NCC=C |
Nonanoic acid, allyl ester | C(=O)(OCC=C)CCCCCCCC |
Normorphinone, N-allyl-dihydro-14-hydroxy- | OC12CCC(=O)C3Oc4c(O)ccc5CC2N(CC=C)CCC13c45 |
Octadecanoic acid, 9,10-epoxy-, allyl ester | C(CCCCCCC(=O)OCC=C)C1OC1CCCCCCCC |
Octanoic acid, allyl ester | C(=O)(OCC=C)CCCCCCC |
Palladium allyl chloride dimer | [Pd]1234CC1=C4.Cl2[Pd]56(Cl3)CC5=C6 |
Palladium chloride, allyl- (dimer) | [Pd]1234CC1=C4.Cl2[Pd]56(Cl3)CC5=C6 |
Phenethylamine, ALPHA_-allyl-, hydrochloride | C(C(N)CC=C)c1ccccc1 |
Phenol, 2-allyl-4-chloro- | C(C=C)c1cc(Cl)ccc1O |
Phenol, 2-allyl-4-methoxy- | C(C=C)c1cc(OC)ccc1O |
Phenol, 2-allyl-6-methoxy- | C(C=C)c1cccc(OC)c1O |
Phenol, 4-allyl-2,6-dimethoxy- | O(C)c1cc(CC=C)cc(OC)c1O |
Phenol, 4-allyl-2-methoxy- | O(C)c1cc(CC=C)ccc1O |
Phenol, 4-allyl-2-methoxy-, acetate | O(C(C)=O)c1ccc(CC=C)cc1OC |
Phenol, 4-allyl-2-methoxy-, benzoate | O(C(=O)c1ccccc1)c2ccc(CC=C)cc2OC |
Phenol, 4-allyl-2-methoxy-, propionate | O(C(=O)CC)c1ccc(CC=C)cc1OC |
Phenol, o-allyl- | C(C=C)c1ccccc1O |
Phenol, o-allyl-, acetate | O(C(C)=O)c1ccccc1CC=C |
Phenol, p-allyl- | C(C=C)c1ccc(O)cc1 |
Phenol__4-allyl-2-methoxy-__propionate | O(C(=O)CC)c1ccc(CC=C)cc1OC |
Phenyl allyl ether | O(CC=C)c1ccccc1 |
Phenylacetic acid allyl ester | C(C(=O)OCC=C)c1ccccc1 |
Potassium allyl isothiocyanate | C(C=C)N=C=S |
Propiolic acid, allyl ester | C(=O)(C#C)OCC=C |
Propionic acid, 3-(1-aziridinyl)-, allyl ester | C(CC(=O)OCC=C)N1CC1 |
Propionic acid, allyl ester | C(=O)(CC)OCC=C |
Propionic_acid__3-(1-aziridinyl)-__allyl_ester | C(CC(=O)OCC=C)N1CC1 |
Propyl allyl ether | O(CCC)CC=C |
Propyl allyl sulfide | S(CCC)CC=C |
Pyridinium, 1-allyl-, bromide | C(C=C)n1ccccc1 |
Quinaldinium bromide, 1-allyl- | C(C=C)n1c(C)ccc2ccccc12 |
Quinaldinium, 1-allyl-, bromide | C(C=C)n1c(C)ccc2ccccc12 |
Rhodanine, 3-allyl- | C(C=C)N1C(=O)CSC1=S |
Salicylamide, N-allyl- | C(=O)(NCC=C)c1ccccc1O |
Salicylic acid, allyl ester | C(=O)(OCC=C)c1ccccc1O |
Semicarbazide, 4-allyl-1,1-dimethyl-3-thio- | N(N(C)C)C(=S)NCC=C |
Semicarbazide, 4-allyl-3-thio- | C(=S)(NN)NCC=C |
Semicarbazide__4-allyl-1_1-dimethyl-3-thio- | N(N(C)C)C(=S)NCC=C |
Silane adduct, allyl methacrylate trimethoxy- | [Si](OC)(OC)(OC)CCCOC(=O)C(C)=C |
Sodium 5-allyl-5-(1-methylbutyl)barbiturate | C(C)(CCC)C1(CC=C)C(=O)NC(=O)NC1=O |
Sodium 5-allyl-5-isopropylbarbiturate | C(C=C)C1(C(C)C)C(=O)NC(=O)NC1=O |
Sodium allyl sulfonate | C(C=C)S(=O)(=O)O |
Stearic acid, 9,10-epoxy-, allyl ester | C(CCCCCCC(=O)OCC=C)C1OC1CCCCCCCC |
Stearic acid, allyl ester | C(CCCCCCCCCCCCCCC)CC(=O)OCC=C |
Succinic acid, methylene-, 4-allyl ester | C(=C)(CC(=O)OCC=C)C(=O)O |
Succinic acid, methylene-, ester with lactic acid allyl ester (1:1) | C(C(=O)OC(C)C(=O)OCC=C)C(=C)C(=O)OC(C)C(=O)OCC=C |
Succinic_acid__methylene-__4-allyl_ester | C(=C)(CC(=O)OCC=C)C(=O)O |
Sulfide, allyl propyl | S(CCC)CC=C |
Sulfone, allyl methyl | C(C=C)S(C)(=O)=O |
Sulfone, allyl p-tolyl | S(=O)(=O)(CC=C)c1ccc(C)cc1 |
Sulfone, allyl phenyl | S(=O)(=O)(CC=C)c1ccccc1 |
Theobromine, 1-allyl- | O=C1N(CC=C)C(=O)N(C)C2=C1N(C)C=N2 |
Theophylline, 8-allyl- | O=C1N(C)C(=O)N(C)C2=C1N=C(CC=C)N2 |
Toluene, o-allyl- | C(C=C)c1ccccc1C |
Toluene, p-allyl- | C(C=C)c1ccc(C)cc1 |
Trichloroacetic acid allyl ester | C(=O)(OCC=C)C(Cl)(Cl)Cl |
Triethylamine, 2-(2-allyl-6-methoxyphenoxy)- | O(CCN(CC)CC)c1c(OC)cccc1CC=C |
Triethylamine, 2-(2-allyl-6-methoxyphenoxy)-, hydrochloride | O(CCN(CC)CC)c1c(OC)cccc1CC=C |
Urea, 1-allyl-1-nitroso- | N(N=O)(CC=C)C(N)=O |
Urea, 1-allyl-2-thio- | N(CC=C)C(N)=S |
Urea, 1-allyl-2-thio-3-p-tolyl- | N(C(=S)NCC=C)c1ccc(C)cc1 |
Urea, 1-allyl-2-thio-p-tolyl- | N(C(=S)NCC=C)c1ccc(C)cc1 |
Urea, 1-allyl-3-(2-formylphenyl)-2-thio- | N(C(=S)NCC=C)c1ccccc1C=O |
Urea, 1-allyl-3-(2-hydroxyethyl)-2-thio- | C(=S)(NCC=C)NCCO |
Urea, 1-allyl-3-(m-nitrophenyl)-2-thio- | N(C(=S)NCC=C)c1cccc(c1)[N+](=O)[O-] |
Urea, 1-allyl-3-dodecyl-2-thio- | N(CCCCCCCCCCCC)C(=S)NCC=C |
Urea, 1-allyl-3-ethyl-2-thio- | C(=S)(NCC)NCC=C |
Urea, 1-allyl-3-phenyl-2-thio- | N(C(=S)NCC=C)c1ccccc1 |
Urea, allyl- | N(CC=C)C(N)=O |
Urea__1-allyl-3-ethyl-2-thio- | C(=S)(NCC)NCC=C |
Uric acid, 9-allyl-1,3,7-trimethyl- | C(C=C)N1C(=O)N(C)C2=C1N(C)C(=O)N(C)C2=O |
Uric_acid__9-allyl-1_3_7-trimethyl- | C(C=C)N1C(=O)N(C)C2=C1N(C)C(=O)N(C)C2=O |
Uridine, 5-allyl-2'-deoxy- | O=C1NC(=O)C(CC=C)=CN1C2CC(O)C(CO)O2 |
Uridine__5-allyl-2'-deoxy- | O=C1NC(=O)C(CC=C)=CN1C2CC(O)C(CO)O2 |
Vinyl allyl ether | C(C=C)OC=C |
m-Chlorophenylcarbamic acid allyl ester | N(C(=O)OCC=C)c1cccc(Cl)c1 |
m-Hydroxycarbanilic acid allyl ester | N(C(=O)OCC=C)c1cccc(O)c1 |
o-Cresol, 6-allyl- | C(C=C)c1cccc(C)c1O |
o-Methoxyphenyl allyl ether | O(CC=C)c1ccccc1OC |
p-Chlorophenyl allyl ether | O(CC=C)c1ccc(Cl)cc1 |
p-Toluidine, N-allyl- | N(CC=C)c1ccc(C)cc1 |
p-Toluidine__N-allyl- | N(CC=C)c1ccc(C)cc1 |
p-Tolyl allyl sulfone | S(=O)(=O)(CC=C)c1ccc(C)cc1 |