If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(Chloromethyl)-2-fluorobenzene | C(Cl)c1ccccc1F |
1-(Chloromethyl)-3-fluorobenzene | C(Cl)c1cccc(F)c1 |
1-(Chloromethyl)-4-fluorobenzene | C(Cl)c1ccc(F)cc1 |
1-(Dichloromethyl)-2-fluorobenzene | C(Cl)(Cl)c1ccccc1F |
1-(Trifluoromethyl)-3-fluorobenzene | C(F)(F)(F)c1cccc(F)c1 |
1-Amino-2-fluorobenzene | Fc1ccccc1N |
1-Amino-4-fluorobenzene | Fc1ccc(N)cc1 |
1-Bromo-2-fluorobenzene | Brc1ccccc1F |
1-Bromo-3-fluorobenzene | Brc1cccc(F)c1 |
1-Bromo-4-fluorobenzene | Brc1ccc(F)cc1 |
1-Chloro-2-fluorobenzene | Clc1ccccc1F |
1-Chloro-3-fluorobenzene | Clc1cccc(F)c1 |
1-Chloro-4-fluorobenzene | Clc1ccc(F)cc1 |
1-Methyl-2-fluorobenzene | Cc1ccccc1F |
1-Methyl-3-fluorobenzene | Cc1cccc(F)c1 |
1-Methyl-4-fluorobenzene | Cc1ccc(F)cc1 |
1-Nitro-4-fluorobenzene | [N+](=O)([O-])c1ccc(F)cc1 |
2,4-Dinitro-1-fluorobenzene | [N+](=O)([O-])c1cc(ccc1F)[N+](=O)[O-] |
Fluorobenzene | Fc1ccccc1 |
Trifluoromethyl-3-fluorobenzene | C(F)(F)(F)c1cccc(F)c1 |
p-(Trifluoromethyl)fluorobenzene | C(F)(F)(F)c1ccc(F)cc1 |