If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2, 5-Dihydroxy-ALPHA_-toluic acid | C(C(=O)O)c1cc(O)ccc1O |
2-Hydroxy-m-toluic acid | C(=O)(O)c1cccc(C)c1O |
2-Hydroxy-p-toluic acid | C(=O)(O)c1ccc(C)cc1O |
2-Nitro-m-toluic acid | [N+](=O)([O-])c1c(C)cccc1C(=O)O |
3,5-Dinitro-o-toluic acid | C(=O)(O)c1cc(cc([N+](=O)[O-])c1C)[N+](=O)[O-] |
3,5-Dinitro-p-toluic acid | [N+](=O)([O-])c1cc(cc([N+](=O)[O-])c1C)C(=O)O |
3-(Bis(2-chloroethyl)amino)-p-toluic acid | N(CCCl)(CCCl)c1cc(ccc1C)C(=O)O |
3-Nitro-para-toluic acid | [N+](=O)([O-])c1cc(ccc1C)C(=O)O |
4-Chloro-o-toluic acid | C(=O)(O)c1ccc(Cl)cc1C |
4-Nitro-m-toluic acid | C(=O)(O)c1ccc([N+](=O)[O-])c(C)c1 |
4-Toluic acid | C(=O)(O)c1ccc(C)cc1 |
5-Chloro-o-toluic acid | C(=O)(O)c1cc(Cl)ccc1C |
6-Hydroxy-m-toluic acid | C(=O)(O)c1cc(C)ccc1O |
6-Hydroxy-o-toluic acid | C(=O)(O)c1c(C)cccc1O |
ALPHA_-Amino-p-toluic acid | C(=O)(O)c1ccc(CN)cc1 |
ALPHA_-Benzoyl-o-toluic acid | C(C(=O)c1ccccc1)c2ccccc2C(=O)O |
ALPHA_-Bromo-p-toluic acid | C(=O)(O)c1ccc(CBr)cc1 |
ALPHA_-Carboxy-o-toluic acid | C(=O)(O)c1ccccc1CC(=O)O |
ALPHA_-Ethyl-p-phenyl-ALPHA_-toluic acid | C(CC)(C(=O)O)c1ccc(cc1)c2ccccc2 |
ALPHA_-Hydroxy-ALPHA_-toluic acid | C(O)(C(=O)O)c1ccccc1 |
ALPHA_-Hydroxy-o-toluic acid | C(O)c1ccccc1C(=O)O |
ALPHA_-Methyl-ALPHA_-toluic aldehyde | C(C)(C=O)c1ccccc1 |
ALPHA_-Methyl-ALPHA_-toluic_aldehyde | C(C)(C=O)c1ccccc1 |
ALPHA_-Toluic acid | C(C(=O)O)c1ccccc1 |
ALPHA_-Toluic acid, ALPHA_,ALPHA_-dimethyl- | C(C)(C)(C(=O)O)c1ccccc1 |
ALPHA_-Toluic acid, ALPHA_,ALPHA_-diphenyl- | C(C(=O)O)(c1ccccc1)(c2ccccc2)c3ccccc3 |
ALPHA_-Toluic acid, ALPHA_-(hydroxymethyl)- | C(CO)(C(=O)O)c1ccccc1 |
ALPHA_-Toluic acid, ALPHA_-amino- | C(N)(C(=O)O)c1ccccc1 |
ALPHA_-Toluic acid, ALPHA_-ethyl- | C(CC)(C(=O)O)c1ccccc1 |
ALPHA_-Toluic acid, ALPHA_-hydroxy- | C(O)(C(=O)O)c1ccccc1 |
ALPHA_-Toluic acid, ALPHA_-methylene- | C(=C)(C(=O)O)c1ccccc1 |
ALPHA_-Toluic acid, ALPHA_-phenyl- | C(C(=O)O)(c1ccccc1)c2ccccc2 |
ALPHA_-Toluic acid, ethyl ester | C(C(=O)OCC)c1ccccc1 |
ALPHA_-Toluic aldehyde | C(C=O)c1ccccc1 |
ALPHA_-Toluic_acid__ALPHA_-(hydroxymethyl)- | C(CO)(C(=O)O)c1ccccc1 |
ALPHA_-Toluic_acid__ALPHA_-amino- | C(N)(C(=O)O)c1ccccc1 |
ALPHA_-Toluic_acid__ALPHA_-ethyl- | C(CC)(C(=O)O)c1ccccc1 |
ALPHA_-Toluic_acid__ALPHA_-hydroxy- | C(O)(C(=O)O)c1ccccc1 |
ALPHA_-Toluic_acid__ALPHA_-methylene- | C(=C)(C(=O)O)c1ccccc1 |
ALPHA_-Toluic_acid__ALPHA_-phenyl- | C(C(=O)O)(c1ccccc1)c2ccccc2 |
ALPHA_-Toluic_acid__ALPHA__ALPHA_-diphenyl- | C(C(=O)O)(c1ccccc1)(c2ccccc2)c3ccccc3 |
ALPHA_-Toluic_aldehyde | C(C=O)c1ccccc1 |
Toluic acid | C(=O)(O)c1ccccc1C |
m-Toluic acid diethylamide | C(=O)(N(CC)CC)c1cccc(C)c1 |
m-Toluic acid | C(=O)(O)c1cccc(C)c1 |
m-Toluic acid, 2-(diethylamino)ethyl ester, hydrochloride | C(=O)(OCCN(CC)CC)c1cccc(C)c1 |
m-Toluic acid, 2-amino- | C(=O)(O)c1cccc(C)c1N |
m-Toluic acid, 4-chloro- | C(=O)(O)c1ccc(Cl)c(C)c1 |
m-Toluic acid, 4-nitro- | C(=O)(O)c1ccc([N+](=O)[O-])c(C)c1 |
m-Toluic acid, 6-amino- | C(=O)(O)c1cc(C)ccc1N |
m-Toluic acid, 6-nitro- | [N+](=O)([O-])c1ccc(C)cc1C(=O)O |
m-Toluic acid, ALPHA_,ALPHA_, ALPHA_-trifluoro- | C(F)(F)(F)c1cccc(c1)C(=O)O |
m-Toluic acid, ethyl ester | C(=O)(OCC)c1cccc(C)c1 |
m-Toluic acid, methyl ester | C(=O)(OC)c1cccc(C)c1 |
m-Toluic anhydride | C(=O)(OC(=O)c1cccc(C)c1)c2cccc(C)c2 |
m-Toluic_acid__ALPHA__ALPHA___ALPHA_-trifluoro- | C(F)(F)(F)c1cccc(c1)C(=O)O |
m-Toluic_anhydride | C(=O)(OC(=O)c1cccc(C)c1)c2cccc(C)c2 |
meta-Toluic acid, methyl ester | C(=O)(OC)c1cccc(C)c1 |
o-Toluic acid | C(=O)(O)c1ccccc1C |
o-Toluic acid, 2-(diethylamino)ethyl ester, hydrochloride | C(=O)(OCCN(CC)CC)c1ccccc1C |
o-Toluic acid, 3,5-dinitro- | C(=O)(O)c1cc(cc([N+](=O)[O-])c1C)[N+](=O)[O-] |
o-Toluic acid, 3-chloro- | C(=O)(O)c1cccc(Cl)c1C |
o-Toluic acid, 4-chloro- | C(=O)(O)c1ccc(Cl)cc1C |
o-Toluic acid, 5-chloro- | C(=O)(O)c1cc(Cl)ccc1C |
o-Toluic acid, ALPHA_-benzoyl- | C(C(=O)c1ccccc1)c2ccccc2C(=O)O |
o-Toluic acid, ALPHA_-carboxy- | C(=O)(O)c1ccccc1CC(=O)O |
o-Toluic acid, ALPHA_-hydroxy- | C(O)c1ccccc1C(=O)O |
o-Toluic acid, ALPHA_-p-anisoyl- | C(C(=O)c1ccc(OC)cc1)c2ccccc2C(=O)O |
o-Toluic acid, ALPHA_-phenyl-, methyl ester | C(c1ccccc1)c2ccccc2C(=O)OC |
o-Toluic acid, ethyl ester | C(=O)(OCC)c1ccccc1C |
o-Toluic acid, methyl ester | C(=O)(OC)c1ccccc1C |
o-Toluic aldehyde | C(=O)c1ccccc1C |
o-Toluic amide | C(N)(=O)c1ccccc1C |
o-Toluic nitrile | C(#N)c1ccccc1C |
p-Toluic acid ethyl ester | C(=O)(OCC)c1ccc(C)cc1 |
p-Toluic acid | C(=O)(O)c1ccc(C)cc1 |
p-Toluic acid, 2-(diethylamino)ethyl ester hydrochloride | C(=O)(OCCN(CC)CC)c1ccc(C)cc1 |
p-Toluic acid, 3,5-dinitro- | [N+](=O)([O-])c1cc(cc([N+](=O)[O-])c1C)C(=O)O |
p-Toluic acid, 3-(bis(2-chloroethyl)amino)- | N(CCCl)(CCCl)c1cc(ccc1C)C(=O)O |
p-Toluic acid, 3-(bis(2-chloroethyl)amino)-, methyl ester | N(CCCl)(CCCl)c1cc(ccc1C)C(=O)OC |
p-Toluic acid, 3-nitro- | [N+](=O)([O-])c1cc(ccc1C)C(=O)O |
p-Toluic acid, 3-nitro-, methyl ester | C(=O)(OC)c1ccc(C)c(c1)[N+](=O)[O-] |
p-Toluic acid, ALPHA_,ALPHA_,ALPHA_-trichloro- | C(Cl)(Cl)(Cl)c1ccc(cc1)C(=O)O |
p-Toluic acid, ALPHA_-(p-(4-chloro-3-oxo-1-butenyl)anilino)- | C(Nc1ccc(C=CC(=O)CCl)cc1)c2ccc(cc2)C(=O)O |
p-Toluic acid, ALPHA_-amino- | C(=O)(O)c1ccc(CN)cc1 |
p-Toluic acid, ALPHA_-bromo- | C(=O)(O)c1ccc(CBr)cc1 |
p-Toluic acid, butyl ester | C(=O)(OCCCC)c1ccc(C)cc1 |
p-Toluic acid, ethyl ester | C(=O)(OCC)c1ccc(C)cc1 |
p-Toluic acid, hydrazide | C(=O)(NN)c1ccc(C)cc1 |
p-Toluic acid, isobutyl ester | C(=O)(OCC(C)C)c1ccc(C)cc1 |
p-Toluic acid, methyl ester | C(=O)(OC)c1ccc(C)cc1 |
p-Toluic nitrile | C(#N)c1ccc(C)cc1 |
p-Toluic_acid__ALPHA_-(p-(4-chloro-3-oxo-1-butenyl)anilino)- | C(Nc1ccc(C=CC(=O)CCl)cc1)c2ccc(cc2)C(=O)O |
p-Toluic_acid__ALPHA__ALPHA__ALPHA_-trichloro- | C(Cl)(Cl)(Cl)c1ccc(cc1)C(=O)O |