If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Methyldiphenyl ether | O(c1ccccc1)c2ccc(C)cc2 |
4-Methyldiphenyl | Cc1ccc(cc1)c2ccccc2 |
Phosphine oxide, methyldiphenyl- | P(C)(=O)(c1ccccc1)c2ccccc2 |
Phosphine, methyldiphenyl- | P(C)(c1ccccc1)c2ccccc2 |
Phosphine__methyldiphenyl- | P(C)(c1ccccc1)c2ccccc2 |
Phosphine_oxide__methyldiphenyl- | P(C)(=O)(c1ccccc1)c2ccccc2 |
Silane, methyldiphenyl- | [Si](C)(c1ccccc1)c2ccccc2 |
Silane__methyldiphenyl- | [Si](C)(c1ccccc1)c2ccccc2 |
p-Methyldiphenyl | Cc1ccc(cc1)c2ccccc2 |