If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(((Diisobutyl)phenoxyethoxyethyl)dimethylbenzyl)ammonium chloride | C(C)(C)(CC(C)(C)C)c1ccc(OCCOCCN(C)(C)Cc2ccccc2)cc1 |
(Diisobutyl(phenoxyethoxy)ethyl)dimethylbenzylammonium chloride | C(C)(C)(CC(C)(C)C)c1ccc(OCCOCCN(C)(C)Cc2ccccc2)cc1 |
1, 4-Diisobutyl-1,4-dimethylbutynediol | C(C)(O)(C#CC(C)(O)CC(C)C)CC(C)C |
2(1H)-Pyrazinone, 3,6-diisobutyl- | C(C(C)C)c1ncc(CC(C)C)nc1O |
Acetylenedicarboxylic acid, diisobutyl ester | C(=O)(OCC(C)C)C#CC(=O)OCC(C)C |
Acetylenedicarboxylic_acid__diisobutyl_ester | C(=O)(OCC(C)C)C#CC(=O)OCC(C)C |
Adipic acid, diisobutyl ester | C(=O)(CCCCC(=O)OCC(C)C)OCC(C)C |
Carbonic acid, diisobutyl ester | C(=O)(OCC(C)C)OCC(C)C |
Diisobutyl adipate | C(=O)(CCCCC(=O)OCC(C)C)OCC(C)C |
Diisobutyl carbonate | C(=O)(OCC(C)C)OCC(C)C |
Diisobutyl fumarate | C(=O)(OCC(C)C)C=CC(=O)OCC(C)C |
Diisobutyl ketone | C(C(C)C)C(=O)CC(C)C |
Diisobutyl phthalate | C(=O)(OCC(C)C)c1ccccc1C(=O)OCC(C)C |
Diisobutyl sulfide | S(CC(C)C)CC(C)C |
Diisobutyl sulfone | C(C(C)C)S(=O)(=O)CC(C)C |
Fumaric acid, diisobutyl ester | C(=O)(OCC(C)C)C=CC(=O)OCC(C)C |
Maleic acid dibutyltin salt (2:1) diisobutyl ester | [Sn](CCCC)(CCCC)(OC(=O)C=CC(=O)OCCCC)OC(=O)C=CC(=O)OCCCC |
Phthalic acid, diisobutyl ester | C(=O)(OCC(C)C)c1ccccc1C(=O)OCC(C)C |
Pyrazinol, 3,6-diisobutyl- | C(C(C)C)c1ncc(CC(C)C)nc1O |
Sulfide, diisobutyl-, hydrate | S(CC(C)C)CC(C)C |
Urea, 1, 1-diisobutyl-3-phenyl-2-thio- | N(CC(C)C)(CC(C)C)C(=S)Nc1ccccc1 |
p-Diisobutyl(phenoxyethoxy)ethyl)dimethylbenzylammonium chloride | C(C)(C)(CC(C)(C)C)c1ccc(OCCOCCN(C)(C)Cc2ccccc2)cc1 |