If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Perliton Blue B | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Perliton Blue FFR | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Perliton Blue Green B | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Perliton Brilliant Pink R | O=C1c2ccccc2C(=O)c3c(O)cc(OC)c(N)c13 |
Perliton Orange 3R | O=C1c2ccccc2C(=O)c3ccc(C)c(N)c13 |
Perliton Pink 3B | O=C1c2ccccc2C(=O)c3c(O)ccc(N)c13 |
Perliton Red Violet FFB | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Perliton Violet 3R | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Perliton Violet B | O=C1c2c(N)ccc(N)c2C(=O)c3cccc([N+](=O)[O-])c13 |
Perliton Yellow RR | [N+](=O)([O-])c1cc(ccc1Nc2ccc(O)cc2)[N+](=O)[O-] |