If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Amino-3-chlorobenzoic acid | C(=O)(O)c1cccc(Cl)c1N |
2-Amino-4-chlorobenzoic acid | C(=O)(O)c1ccc(Cl)cc1N |
2-Amino-5-chlorobenzoic acid | C(=O)(O)c1cc(Cl)ccc1N |
2-Bromo-5-chlorobenzoic acid | C(=O)(O)c1cc(Cl)ccc1Br |
2-Chlorobenzoic acid anilide | C(=O)(Nc1ccccc1)c2ccccc2Cl |
2-Chlorobenzoic acid | C(=O)(O)c1ccccc1Cl |
2-Hydroxy-4-chlorobenzoic acid | C(=O)(O)c1ccc(Cl)cc1O |
2-Hydroxy-5-chlorobenzoic acid | C(=O)(O)c1cc(Cl)ccc1O |
2-Nitro-4-chlorobenzoic acid | C(=O)(O)c1ccc(Cl)cc1[N+](=O)[O-] |
3, 5-Dinitro-4-chlorobenzoic acid | [N+](=O)([O-])c1cc(cc([N+](=O)[O-])c1Cl)C(=O)O |
3-Chlorobenzoic acid | C(=O)(O)c1cccc(Cl)c1 |
3-Nitro-4-chlorobenzoic acid | [N+](=O)([O-])c1cc(ccc1Cl)C(=O)O |
4-Amino-2-chlorobenzoic acid | C(=O)(O)c1ccc(N)cc1Cl |
4-Chlorobenzoic acid | C(=O)(O)c1ccc(Cl)cc1 |
4-Chlorobenzoic acid, hydrazide | C(=O)(NN)c1ccc(Cl)cc1 |
4-Chlorobenzoic anhydride | C(=O)(OC(=O)c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
5-Amino-2-chlorobenzoic acid | C(=O)(O)c1cc(N)ccc1Cl |
m-Chlorobenzoic acid | C(=O)(O)c1cccc(Cl)c1 |
o-Chlorobenzoic acid | C(=O)(O)c1ccccc1Cl |
p-Chlorobenzoic acid amide | C(N)(=O)c1ccc(Cl)cc1 |
p-Chlorobenzoic acid anhydride | C(=O)(OC(=O)c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
p-Chlorobenzoic acid | C(=O)(O)c1ccc(Cl)cc1 |
p-Chlorobenzoic acid, hydrazide | C(=O)(NN)c1ccc(Cl)cc1 |
p-Chlorobenzoic anhydride | C(=O)(OC(=O)c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
p-Chlorobenzoic hydrazide | C(=O)(NN)c1ccc(Cl)cc1 |
p-Chlorobenzoic_acid_amide | C(N)(=O)c1ccc(Cl)cc1 |