If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Dualar | P(=O)(NC(=O)OCc1ccccc1)(N2CC2)N3CC3 |
Duatok | S(=O)(=O)(NC1=NC=CS1)c2ccc(N)cc2 |
DUAZOMYCIN B | C(CCC(=O)C=N=N)(NC(=O)CCC(N)C(=O)O)C(=O)NC(CCC(=O)C=N=N)C(=O)O |
Duazomycin (USAN) | C(CCC(=O)C=N=N)(NC(C)=O)C(=O)O |
Duazomycin A | C(CCC(=O)C=N=N)(NC(C)=O)C(=O)O |
Duazomycin B | C(CCC(=O)C=N=N)(NC(=O)CCC(N)C(=O)O)C(=O)NC(CCC(=O)C=N=N)C(=O)O |
Dubimax | C(=O)(O)C(=O)O.CCN(CC)CCOC(=O)C(CC1CCCO1)Cc2cccc3ccccc23 |
Duboisene | O(C(=O)C(CO)c1ccccc1)C2CC3CCC(C2)N3C |
DUCLAUXIN | O(C(C)=O)C1C2C(=O)c3c(C)cc(O)c4C(=O)OCC1(c34)C5C(=O)C6=COC(=O)c7c(O)cc(C)c(c67)C25OC |
Dufalone | OC1=C(CC2=C(O)c3ccccc3OC2=O)C(=O)Oc4ccccc14 |
Dufaston | CC12CCC(=O)C=C2C=CC3C1CCC4(C)C(CCC34)C(C)=O |
Duiramid | S(N)(=O)(=O)C1=NN=C(S1)NC(C)=O |
Duirexol | N12CN3CN(C1)CN(C2)C3 |
Duksen | CN1C(=O)CN=C(c2ccccc2)c3cc(Cl)ccc13 |
Dulana | S(=O)(=O)(NC1=NC=CS1)c2ccc(N)cc2 |
Dularin | N(C(C)=O)c1ccc(O)cc1 |
Dulcin | N(C(N)=O)c1ccc(OCC)cc1 |
Dulcine | N(C(N)=O)c1ccc(OCC)cc1 |
Dulcite | C(O)(C(O)CO)C(O)C(O)CO |
dulcitol | A sub-index is available for dulcitol... |
Dulcose | C(O)(C(O)CO)C(O)C(O)CO |
Dulein | N(C(N)=O)c1ccc(OCC)cc1 |
Dulzor-Etas | N(C1CCCCC1)S(=O)(=O)O |
Dumasin | O=C1CCCC1 |
Dumitone | S(=O)(=O)(c1ccc(N)cc1)c2ccc(N)cc2 |
Oxy-Dumocyclin | OC12C(=O)C(C(N)=O)=C(O)C(N(C)C)C1C(O)C3C(=C2O)C(=O)c4c(O)cccc4C3(C)O |
Dumogran | CC12CCC(=O)C=C2CCC3C1CCC4(C)C3CCC4(C)O |
Dumolid | [N+](=O)([O-])c1ccc2NC(=O)CN=C(c3ccccc3)c2c1 |
5-Methyl-dUMP | O=C1NC(=O)C(C)=CN1C2CC(O)C(COP(=O)(O)O)O2 |
Duncaine | N(C(=O)CN(CC)CC)c1c(C)cccc1C |
WLN: L6V DYJ BE DUNE FE | N(Br)=C1C=C(Br)C(=O)C(Br)=C1 |
WLN: L6V DYJ BG DUNE FG | N(Br)=C1C=C(Cl)C(=O)C(Cl)=C1 |
WLN: L6V DYJ DUNE | N(Br)=C1C=CC(=O)C=C1 |
Duneryl | C(C)C1(C(=O)NC(=O)NC1=O)c2ccccc2 |
WLN: L6V DYJ BE DUNG FE | N(Cl)=C1C=C(Br)C(=O)C(Br)=C1 |
WLN: L6V DYJ BG DUNG FG | N(Cl)=C1C=C(Cl)C(=O)C(Cl)=C1 |
WLN: L6V DYJ DUNG | N(Cl)=C1C=CC(=O)C=C1 |
Dunkelgelb | N(=Nc1ccccc1)c2c(O)ccc3ccccc23 |
WLN: T56 BNVYJ B1 DUNMYZUS | N(NC(N)=S)=C1C(=O)N(C)c2ccccc12 |
dl-Dunnione | CC1(C)C(C)OC2=C1C(=O)C(=O)c3ccccc23 |
dunq | A sub-index is available for dunq... |
dunr | A sub-index is available for dunr... |
Eastern states duocide | C(CC(C)=O)(c1ccccc1)C2=C(O)c3ccccc3OC2=O |
Duodecyl alcohol | C(CCCCCC)CCCCCO |
Duodecylic acid | C(CCCCCCCC)CCC(=O)O |
Duodecylic aldehyde | C(CCCCCC)CCCCC=O |
Duodex | S=C1Nc2ccccc2S1 |
Duofas | C(=O)(Nc1ccc(Oc2ccc(Cl)cc2)c(Cl)c1)c3cc(I)cc(I)c3O |
component of Duogen | CC12CCC(=O)C=C2CCC3C1CCC4(C)C(O)CCC34 |
Duotal | O(C(=O)Oc1ccccc1OC)c2ccccc2OC |
Dupanol WAQ | C(CCCCCCCCCC)COS(=O)(=O)O |
Duphacillin | C(=O)(O)C1N2C(=O)C(NC(=O)C(N)c3ccccc3)C2SC1(C)C |
Duphaston | CC12CCC(=O)C=C2C=CC3C1CCC4(C)C(CCC34)C(C)=O |
Duplex Para Red XD 20-2900 | N(=Nc1ccc(cc1)[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Duplex Toluidine Red L 20-3140 | N(=Nc1ccc(C)cc1[N+](=O)[O-])c2c(O)ccc3ccccc23 |
component of Sulfonamide Duplex | S(=O)(=O)(Nc1nccc(C)n1)c2ccc(N)cc2 |
Duponal WAQE | C(CCCCCCCCCC)COS(=O)(=O)O |
Duponal | C(CCCCCCCCCC)COS(=O)(=O)O |
duponol | A sub-index is available for duponol... |
Dupont PC Crabgrass Killer | C(#N)O |
Dura Dex | C(C(C)N)c1ccccc1.O=S(=O)(O)O |
Dura clofibrat | O(c1ccc(Cl)cc1)C(C)(C)C(=O)OCC |
Dura-Estradiol | CC12CCC3c4ccc(O)cc4CCC3C1CCC2OC(=O)CCCC |
Dura-Tab S.M. Aminophylline | O=C1N(C)C(=O)N(C)C2=C1N=CN2.NCCN |
Durabolin | CC12CCC3C4CCC(=O)C=C4CCC3C1CCC2OC(=O)CCc5ccccc5 |
Durabolin-O | CC12CCC3C4CCCC=C4CCC3C1CCC2(O)CC |
Duraboral | CC12CCC3C4CCCC=C4CCC3C1CCC2(O)CC |
Duracaine | C(=O)(OCCN(CC)CC)c1ccc(N)cc1 |
durafur | A sub-index is available for durafur... |
Duramax | C(=O)(O)c1ccccc1OC(C)=O |
Duran | N(C(=O)N(C)C)c1ccc(Cl)c(Cl)c1 |
Durandro | CC12CCC(=O)C=C2CCC3C1CCC4(C)C(CCC34)OC(=O)CCC5CCCC5 |
Duranil Aerosol | C(C(CC)CCCC)N1CN(CC(CC)CCCC)CC(C)(N)C1 |
duranol | A sub-index is available for duranol... |
Durapav | C(c1ccc(OC)c(OC)c1)c2nccc3cc(OC)c(OC)cc23 |
Durapred | CC12CC(O)C3C(CCC4=CC(=O)C=CC34C)C1CCC2(O)C(=O)COC(C)=O |
Duraset 20W | C(=O)(Nc1cccc(C)c1)c2ccccc2C(=O)O |
Duraset | C(=O)(Nc1cccc(C)c1)c2ccccc2C(=O)O |
Durasorb | S(C)(C)=O |
Duratint Blue 1001 | [Cu]123N4C5=C6C=CC=CC6=C4N=C7N2=C(N=C8N1C(=NC9=N3C(=N5)c%10ccccc9%10)c%11ccccc8%11)c%12ccccc7%12 |
Duratrad | CC12CCC3c4ccc(O)cc4CCC3C1CCC2OC(=O)CCCC |
durazol | A sub-index is available for durazol... |
Duremesin | C(c1ccccc1)(c2ccc(Cl)cc2)N3CCN(CC3)Cc4cccc(C)c4 |
1,4-Bis(chloromethyl)durene | C(Cl)c1c(C)c(C)c(CCl)c(C)c1C |
3,6-Bis(chloromethyl)durene | C(Cl)c1c(C)c(C)c(CCl)c(C)c1C |
Bis(chloromethyl)durene | C(Cl)c1c(C)c(C)c(CCl)c(C)c1C |
Durene | Cc1cc(C)c(C)cc1C |
Durenol | Cc1c(C)cc(C)c(C)c1O |
Duresthin 5 | C(=O)(OOC(=O)c1ccccc1)c2ccccc2 |
Duretic | O=S1(=O)N(C)C(CCl)Nc2cc(Cl)c(cc12)S(N)(=O)=O |
Duretter | S(=O)(=O)(O)O |
Durgacet Scarlet B | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Durgasol Bordeaux GP Salt | [N+](=O)([O-])c1cc(OC)ccc1N |
Durgasol scarlet GG salt | Nc1cc(Cl)ccc1Cl |
durindone | A sub-index is available for durindone... |
Duro-p-hydroquinone | Cc1c(C)c(O)c(C)c(C)c1O |
durochrome | A sub-index is available for durochrome... |
Duroferon | S(=O)(=O)(O)O |
Durohydroquinone | Cc1c(C)c(O)c(C)c(C)c1O |
durol | A sub-index is available for durol... |
Duromine | C(c1ccccc1)C(C)(C)N |
Durophet | S(=O)(=O)(O)O.CC(N)Cc1ccccc1 |
Duroquinone | CC1=C(C)C(=O)C(C)=C(C)C1=O |
Durotox | Clc1c(Cl)c(Cl)c(O)c(Cl)c1Cl |
Sorbifer durules | S(=O)(=O)(O)O |
Isopropyl duryl ketone | C(=O)(C(C)C)c1c(C)c(C)cc(C)c1C |
Methyl duryl ketone | C(C)(=O)c1c(C)c(C)cc(C)c1C |
Durylic acid | C(=O)(O)c1cc(C)c(C)cc1C |
Dusicnan cerity (CZECH) | N(O)(O)O |
Dusitan sodny (CZECH) | [N+](=O)[O-] |
Dusodril | C(=O)(O)C(=O)O.CCN(CC)CCOC(=O)C(CC1CCCO1)Cc2cccc3ccccc23 |
Dusoline | CC12CCC3C(CC=C4CC(O)CCC34C)C1CCC2C(C)CCCC(C)C |
Dusoran | CC12CCC3C(CC=C4CC(O)CCC34C)C1CCC2C(C)CCCC(C)C |
Duspatalin | C(=O)(OCCCCN(CC)C(C)Cc1ccc(OC)cc1)c2ccc(OC)c(OC)c2 |
dust | A sub-index is available for dust... |
Curex flea duster | O=C1c2ccc3OC(Cc3c2OC4COc5cc(OC)c(OC)cc5C14)C(C)=C |
Ortho N-4 and N-5 dusts | CN1CCCC1c2cccnc2 |
dutch | A sub-index is available for dutch... |
Duter extra | [Sn](O)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Duter | [Sn](O)(c1ccccc1)(c2ccccc2)c3ccccc3 |
WLN: L F6 E6 B666 CV DUTJ A1 HVQ H1 K1 N1 O1 S1 S1 TQ -ALPHA_ | CC12CCC3C(C)(C)C(O)CCC3(C)C1C(=O)C=C4C5CC(C)(CCC5(C)CCC24C)C(=O)O |
WLN: L F6 E6 B666 CV DUTJ A1 HVQ H1 K1 N1 O1 S1 S1 TQ -BETA | CC12CCC3C(C)(C)C(O)CCC3(C)C1C(=O)C=C4C5CC(C)(CCC5(C)CCC24C)C(=O)O |
WLN: T55 AN DN FS DUTJ CR &GH -R | C1(CN2CCSC2=N1)c3ccccc3 |
WLN: T66 A B AO BO DUTJ CY F | C(C)(C)C12CCC(C)(C=C1)OO2 |
WLN: T B666 GN DUTT&J E2 LO1 MO1 D1- BT66 CMT&J HO1 IO1 &GH 2 | C(C1NCCc2cc(OC)c(OC)cc12)C3=C(CC)CN4CCc5cc(OC)c(OC)cc5C4C3 |
Duvaron | CC12CCC(=O)C=C2C=CC3C1CCC4(C)C(CCC34)C(C)=O |
Duxen | CN1C(=O)CN=C(c2ccccc2)c3cc(Cl)ccc13 |
WLN: L6Y DYTJ AUYCN&CN DUYCN&CN | C(C#N)(C#N)=C1CCC(CC1)=C(C#N)C#N |
WLN: T6K DYTJ A1 A1 DUYR&R & WSO&O1 | S(=O)(=O)(O)OC.CN1(C)CCC(CC1)=C(c2ccccc2)c3ccccc3 |