If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Isoquinolinecarboxylic acid | C(=O)(O)c1nccc2ccccc12 |
1-Isoquinolinecarboxylic_acid | C(=O)(O)c1nccc2ccccc12 |
2(1H)-Isoquinolinecarboxylic acid, 1-cyano-, ethyl ester | C(#N)C1N(C=Cc2ccccc12)C(=O)OCC |
2(1H)-Isoquinolinecarboxylic_acid__1-cyano-__ethyl_ester | C(#N)C1N(C=Cc2ccccc12)C(=O)OCC |
3-Isoquinolinecarboxylic acid | C(=O)(O)c1ncc2ccccc2c1 |
3-Isoquinolinecarboxylic_acid | C(=O)(O)c1ncc2ccccc2c1 |
5-Isoquinolinecarboxylic acid | C(=O)(O)c1cccc2cnccc12 |
5-Isoquinolinecarboxylic_acid | C(=O)(O)c1cccc2cnccc12 |