If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-Propenal, polymer with formaldehyde | C(=C)C=O.C=O |
2-Propenal__polymer_with_formaldehyde | C(=C)C=O.C=O |
4-Allylpyrocatechol formaldehyde acetal | C(C=C)c1ccc2OCOc2c1 |
4-Allylpyrocatechol_formaldehyde_acetal | C(C=C)c1ccc2OCOc2c1 |
4:4'-Diaminodiphenylsulfone disodium formaldehyde sulfoxylate | S(=O)(=O)(c1ccc(cc1)NCS(=O)O)c2ccc(cc2)NCS(=O)O |
5,5-Dimethyl-1, 3-cyclohexanedione formaldehyde deriv | C(C1C(=O)CC(C)(C)CC1=O)C2C(=O)CC(C)(C)CC2=O |
Acrolein, formaldehyde polymer | C(=C)C=O.C=O |
Bis-(2,2-dinitropropyl) acetal formaldehyde | C(C)(COCOCC(C)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
Cyclohexane formaldehyde | C(=O)C1CCCCC1 |
Formaldehyde 2,2-dimethylhydrazone | N(C)(C)N=C |
Formaldehyde bis(2-chloroethyl) acetal | C(OCCCl)OCCCl |
Formaldehyde bis(2-fluoro-2,2-dinitroethyl) acetal | C(F)(COCOCC(F)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
Formaldehyde bis(BETA_-chloroethyl) acetal | C(OCCCl)OCCCl |
Formaldehyde cyanohydrin | C(#N)CO |
Formaldehyde dibutyl acetal | C(OCCCC)OCCCC |
Formaldehyde diethyl acetal | C(OCC)OCC |
Formaldehyde diethyl mercaptal | C(SCC)SCC |
Formaldehyde diethylthioacetal | C(C)(SCC)SCC |
Formaldehyde dimethyl mercaptal S-oxide | C(SC)S(C)=O |
Formaldehyde dimethyl mercaptal | C(SC)SC |
Formaldehyde methyl mercaptal S-oxide | C(SC)S(C)=O |
Formaldehyde sodium bisulfite adduct | S(=O)(O)CO |
Formaldehyde sodium bisulfite | S(=O)(=O)(O)CO |
Formaldehyde sodium sulfoxylate | S(=O)(O)CO |
Formaldehyde solution | C=O |
Formaldehyde sulfite sodium salt | S(=O)(=O)(O)CO |
Formaldehyde | C=O |
Formaldehyde, (2,4-dinitrophenyl)hydrazone | [N+](=O)([O-])c1cc(ccc1NN=C)[N+](=O)[O-] |
Formaldehyde, 37%, methanol-free | C=O |
Formaldehyde, as formalin solution (DOT) | C=O |
Formaldehyde, compd. with monosodium sulfite | S(=O)(=O)(O)CO |
Formaldehyde, cyanohydrin | C(#N)CO |
Formaldehyde, cyclic 1,1, 3-trimethyltrimethylene acetal | CC1(C)OCOC(C)C1 |
Formaldehyde, cyclic diacetal with pentaerythritol | C123COCOC1.C2OCOC3 |
Formaldehyde, cyclic tetramethylene acetal | C1CCOCOC1 |
Formaldehyde, diethyl acetal | C(OCC)OCC |
Formaldehyde, dimedon deriv. (VAN) | C(C1C(=O)CC(C)(C)CC1=O)C2C(=O)CC(C)(C)CC2=O |
Formaldehyde, dimethylhydrazone | N(C)(C)N=C |
Formaldehyde, gas | C=O |
Formaldehyde, thio-, trimer | C1SCSCS1 |
Formaldehyde, trimer | C1OCOCO1 |
Formaldehyde-sodium bisulfite compound | S(=O)(=O)(O)CO |
Formaldehyde_2_2-dimethylhydrazone | N(C)(C)N=C |
Formaldehyde__(2_4-dinitrophenyl)hydrazone | [N+](=O)([O-])c1cc(ccc1NN=C)[N+](=O)[O-] |
Formaldehyde__as_formalin_solution_(DOT) | C=O |
Formaldehyde__cyanohydrin | C(#N)CO |
Formaldehyde__cyclic_1_1__3-trimethyltrimethylene_acetal | CC1(C)OCOC(C)C1 |
Formaldehyde__cyclic_tetramethylene_acetal | C1CCOCOC1 |
Formaldehyde__thio-__trimer | C1SCSCS1 |
Formaldehyde_dimethyl_mercaptal | C(SC)SC |
Formaldehyde_dimethyl_mercaptal_S-oxide | C(SC)S(C)=O |
L-Cysteine thioacetal of formaldehyde | C(N)(CSCSCC(N)C(=O)O)C(=O)O |
Methylol formaldehyde | C(O)C=O |
Pentaerythritol, bis(cyclic acetal) with formaldehyde- | C123COCOC1.C2OCOC3 |
Pentaerythritol__bis(cyclic_acetal)_with_formaldehyde- | C123COCOC1.C2OCOC3 |
Polymerized formaldehyde | C1OCOCO1 |
Polymerized_formaldehyde | C1OCOCO1 |
Sodium formaldehyde bisulfite | S(=O)(=O)(O)CO |
Sodium formaldehyde sulfoxylate | S(=O)(O)CO |
Sodium sulfoxylate formaldehyde | S(=O)(O)CO |