If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Amino-6-chloropurine | Clc1nc(N)nc2NC=Nc12 |
2-Chloropurine | Clc1ncc2NC=Nc2n1 |
6-Chloropurine riboside | OC1C(O)C(CO)OC1N2C=Nc3c(Cl)ncnc23 |
6-Chloropurine | Clc1ncnc2NC=Nc12 |
7-Methyl-6-chloropurine | Clc1ncnc2N=CN(C)c12 |
9-(p-Anisyl)-6-chloropurine | Clc1ncnc2c1N=CN2c3ccc(OC)cc3 |
9-Methyl-6-chloropurine | Clc1ncnc2N(C)C=Nc12 |