If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Benzoyl-2-phenylacetylene | C(=O)(C#Cc1ccccc1)c2ccccc2 |
Phenylacetylene monocarboxylic acid ethyl ester | C(#CC(=O)OCC)c1ccccc1 |
Phenylacetylene monocarboxylic acid | C(#CC(=O)O)c1ccccc1 |
Phenylacetylene | C(#C)c1ccccc1 |
Phenylacetylene_monocarboxylic_acid | C(#CC(=O)O)c1ccccc1 |
Phenylacetylene_monocarboxylic_acid_ethyl_ester | C(#CC(=O)OCC)c1ccccc1 |