If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Ethyl-2-phenylbenzene | C(C)c1ccccc1c2ccccc2 |
1-Ethyl-3-phenylbenzene | C(C)c1cccc(c1)c2ccccc2 |
1-Ethyl-4-phenylbenzene | C(C)c1ccc(cc1)c2ccccc2 |
1-Hydroxy-2-phenylbenzene | Oc1ccccc1c2ccccc2 |
1-Hydroxy-4-phenylbenzene | Oc1ccc(cc1)c2ccccc2 |
1-Methyl-2-phenylbenzene | Cc1ccccc1c2ccccc2 |
1-Methyl-4-phenylbenzene | Cc1ccc(cc1)c2ccccc2 |
1-Nitro-4-phenylbenzene | [N+](=O)([O-])c1ccc(cc1)c2ccccc2 |
Phenylbenzene | c1(ccccc1)c2ccccc2 |