If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Benzylimidazole | C(c1ccccc1)N2C=CN=C2 |
1-Benzylimidazole-2-carboxaldehyde | C(c1ccccc1)N2C=CN=C2C=O |
1-Benzylimidazole-2-methanol | C(c1ccccc1)N2C=CN=C2CO |
Methyl 1-benzylimidazole-5-carboxylate | C(c1ccccc1)N2C=NC=C2C(=O)OC |
N-Benzylimidazole | C(c1ccccc1)N2C=CN=C2 |