If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-Acetyl-5-hydroxy-3-oxo-4-hexenoic acid, DELTA_-lactone | C(C)(=O)C1=C(O)C=C(C)OC1=O |
2-Amino-4-methyl-5-hexenoic acid | C(C(C)C=C)C(N)C(=O)O |
2-Amino-4-methyl-5-hexenoic_acid | C(C(C)C=C)C(N)C(=O)O |
3-Hexenoic acid | C(C=CCC)C(=O)O |
3-Hexenoic acid, 4-hydroxy-, GAMMA_-lactone | C(C)C1=CCC(=O)O1 |
3-Hexenoic_acid__4-hydroxy-__GAMMA_-lactone | C(C)C1=CCC(=O)O1 |
4-Hexenoic acid | C(CC=CC)C(=O)O |
4-Hexenoic acid, 2-acetyl-5-hydroxy-3-oxo-, DELTA_-lactone | C(C)(=O)C1=C(O)C=C(C)OC1=O |
4-Hexenoic_acid | C(CC=CC)C(=O)O |
4-Hexenoic_acid__2-acetyl-5-hydroxy-3-oxo-__DELTA_-lactone | C(C)(=O)C1=C(O)C=C(C)OC1=O |
5-Hexenoic acid, 2, 4-dioxo-6-phenyl-, butyl ester | C(=CC(=O)CC(=O)C(=O)OCCCC)c1ccccc1 |
5-Hexenoic acid, 6-(1-naphthalenyl)-4-oxo- | C(=CC(=O)CCC(=O)O)c1cccc2ccccc12 |
5-Hexenoic acid, 6-(1-naphthyl)-4-oxo- | C(=CC(=O)CCC(=O)O)c1cccc2ccccc12 |
5-Hexenoic acid, 6-(3-nitrophenyl)-4-oxo- | C(=CC(=O)CCC(=O)O)c1cccc(c1)[N+](=O)[O-] |
5-Hexenoic acid, 6-(m-nitrophenyl)-4-oxo- | C(=CC(=O)CCC(=O)O)c1cccc(c1)[N+](=O)[O-] |
5-Hexenoic_acid__2__4-dioxo-6-phenyl-__butyl_ester | C(=CC(=O)CC(=O)C(=O)OCCCC)c1ccccc1 |
5-Hexenoic_acid__6-(1-naphthalenyl)-4-oxo- | C(=CC(=O)CCC(=O)O)c1cccc2ccccc12 |
5-Hexenoic_acid__6-(m-nitrophenyl)-4-oxo- | C(=CC(=O)CCC(=O)O)c1cccc(c1)[N+](=O)[O-] |
5-Hydroxy-2-hexenoic acid lactone | CC1CC=CC(=O)O1 |
6-(1-Naphthyl)-4-oxo-5-hexenoic acid | C(=CC(=O)CCC(=O)O)c1cccc2ccccc12 |
6-(m-Nitrophenyl)-4-oxo-5-hexenoic acid | C(=CC(=O)CCC(=O)O)c1cccc(c1)[N+](=O)[O-] |
AMINO-4-METHYL-5-HEXENOIC ACID | C(C(C)C=C)C(N)C(=O)O |