If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
GLYCOLIC ACID | C(=O)(O)CO |
Glycolic acid, 2-thio- | C(=O)(O)CS |
Glycolic acid, 8-ester with mutilin | CC1C(O)C(C)(C=C)CC(OC(=O)CO)C2(C)C(C)CCC13CCC(=O)C23 |
Glycolic acid, calcium salt (2:1) | C(=O)(O)CO |
Glycolic acid, diphenyl- | C(O)(C(=O)O)(c1ccccc1)c2ccccc2 |
Glycolic acid, diphenylene- | C(=O)(O)C1(O)c2ccccc2c3ccccc13 |
Glycolic acid, ethyl ester | C(=O)(CO)OCC |
Glycolic acid, ethyl ester, methyl phthalate | C(=O)(OCC(=O)OCC)c1ccccc1C(=O)OC |
Glycolic acid, methanesulfonate | O(CC(=O)O)S(C)(=O)=O |
Glycolic acid, methyl ester | C(=O)(CO)OC |
Glycolic acid, phenyl ether | O(CC(=O)O)c1ccccc1 |
Glycolic acid, phenyl- | C(O)(C(=O)O)c1ccccc1 |
Glycolic acid, thio- | C(=O)(O)CS |
Glycolic aldehyde | C(O)C=O |
Glycolic nitrile | C(#N)CO |
Glycolic_acid__calcium_salt_(2:1) | C(=O)(O)CO |
Glycolic_acid__phenyl_ether | O(CC(=O)O)c1ccccc1 |
O-(2-Naphthyl)glycolic acid | O(CC(=O)O)c1ccc2ccccc2c1 |
S-2-(Benzothiazolylthio)glycolic acid | S(CC(=O)O)C1=Nc2ccccc2S1 |
S-2-(Benzothiazolylthio)glycolic_acid | S(CC(=O)O)C1=Nc2ccccc2S1 |