If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
9-ALPHA_-D-Arabinofuranosyladenine | OC1C(O)C(CO)OC1N2C=Nc3c(N)ncnc23 |
9-BETA_-D-Arabinofuranosyladenine 5'-formate | OC1C(O)C(COC=O)OC1N2C=Nc3c(N)ncnc23 |
9-BETA_-D-Arabinofuranosyladenine 5'-monophosphate | OC1C(O)C(COP(=O)(O)O)OC1N2C=Nc3c(N)ncnc23 |
9-BETA_-D-Arabinofuranosyladenine 5'-phosphate | OC1C(O)C(COP(=O)(O)O)OC1N2C=Nc3c(N)ncnc23 |
9-BETA_-D-Arabinofuranosyladenine monophosphate | OC1C(O)C(COP(=O)(O)O)OC1N2C=Nc3c(N)ncnc23 |
9-BETA_-D-Arabinofuranosyladenine | OC1C(O)C(CO)OC1N2C=Nc3c(N)ncnc23 |
9BETA_-D-Arabinofuranosyladenine | OC1C(O)C(CO)OC1N2C=Nc3c(N)ncnc23 |
ALPHA_-D-Arabinofuranosyladenine | OC1C(O)C(CO)OC1N2C=Nc3c(N)ncnc23 |