If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Diethyl phosphorodithioic acid | P(=S)(S)(OCC)OCC |
O, O-Diethyl phosphorodithioic acid | P(=S)(S)(OCC)OCC |
Phosphorodithioic acid, O, O-bis(1-methylethyl) ester | O(C(C)C)P(=S)(S)OC(C)C |
Phosphorodithioic acid, O, O-bis(3-methylphenyl) ester | O(c1cccc(C)c1)P(=S)(S)Oc2cccc(C)c2 |
Phosphorodithioic acid, O, O-di-m-tolyl ester | O(c1cccc(C)c1)P(=S)(S)Oc2cccc(C)c2 |
Phosphorodithioic acid, O, O-dibutyl ester, mercury(2+) salt | O(CCCC)P(=S)(S)OCCCC |
Phosphorodithioic acid, O, O-diisopropyl ester | O(C(C)C)P(=S)(S)OC(C)C |
Phosphorodithioic acid, O,O-diethyl ester | P(=S)(S)(OCC)OCC |
Phosphorodithioic acid, O,O-diethyl ester, ammonium salt | P(=S)(S)(OCC)OCC |
Phosphorodithioic acid, O,O-diisopropyl ester, copper(2+) salt | O(C(C)C)P(=S)(S)OC(C)C |
Phosphorodithioic_acid__O_O-diethyl_ester__ammonium_salt | P(=S)(S)(OCC)OCC |
Phosphorodithioic_acid__O__O-bis(1-methylethyl)_ester | O(C(C)C)P(=S)(S)OC(C)C |
Phosphorodithioic_acid__O__O-bis(3-methylphenyl)_ester | O(c1cccc(C)c1)P(=S)(S)Oc2cccc(C)c2 |
Phosphorodithioic_acid__O__O-dibutyl_ester__mercury(2+)_salt | O(CCCC)P(=S)(S)OCCCC |