If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1-Ethenyl-2-pyrrolidinone polymers | C(=C)N1CCCC1=O |
2-Pyrrolidinone, 1-vinyl-, polymers | C(=C)N1CCCC1=O |
2-Pyrrolidinone, 1-vinyl-, polymers, compd. with aluminum acetate | C(=C)N1CCCC1=O |
2-Pyrrolidinone, 1-vinyl-, polymers, compd. with iodine | II.C=CN1CCCC1=O |
5'-Cytidylic acid, polymers | OC1C(O)C(COP(=O)(O)O)OC1N2C=CC(=N)NC2=O |
5'-Inosinic acid polymers | OC1C(O)C(COP(=O)(O)O)OC1N2C=Nc3c(O)ncnc23 |
5'-Inosinic acid, polymers | OC1C(O)C(COP(=O)(O)O)OC1N2C=Nc3c(O)ncnc23 |
Acrylamide polymers | C(N)(=O)C=C |
Acrylamide, polymers | C(N)(=O)C=C |
Acrylic acid, polymers | C(=O)(O)C=C |
Acrylic polymers | C(=O)(O)C=C |
Acrylonitrile polymers | C(=C)C#N |
Acrylonitrile, polymers | C(=C)C#N |
Aniline, p-vinyl-, polymers | C(=C)c1ccc(N)cc1 |
Copper, (phthalocyaninato(2-))-, polymers | [Cu]123N4C5=C6C=CC=CC6=C4N=C7N2=C(N=C8N1C(=NC9=N3C(=N5)c%10ccccc9%10)c%11ccccc8%11)c%12ccccc7%12 |
Ether, methyl vinyl, polymers | C(=C)OC |
Ethylenimine, polymers | C1CN1 |
Maleic acid-methyl vinyl ether polymers | C(=CC(=O)O)C(=O)O.C=COC |
Maleic acid-vinyl methyl ether polymers | C(=CC(=O)O)C(=O)O.C=COC |
Methacrylonitrile, polymers | C(C)(=C)C#N |
Nickel, diiodophthaloyl-, polymers | O=C1c2ccccc2C(=O)[Ni]1(I)I |
Nickel__diiodophthaloyl-__polymers | O=C1c2ccccc2C(=O)[Ni]1(I)I |
Phenol, p-vinyl-, polymers | C(=C)c1ccc(O)cc1 |
Phthalic acid, monovinyl ester, polymers | C(=O)(OC=C)c1ccccc1C(=O)O |
Pyridine, 2-vinyl-, 1-oxide, polymers | C(=C)c1ccccn1=O |
Vinyl alcohol, polymers | C(=C)O |
Vinyl hydrogen phthalate polymers | C(=O)(OC=C)c1ccccc1C(=O)O |
p-Aminostyrene polymers | C(=C)c1ccc(N)cc1 |