If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-(2-(Butoxy)ethoxy)ethyl thiocyanic acid ester | C(COCCCC)OCCSC#N |
THIOCYANIC ACID | C(#N)S |
Thiocyanic acid ammonium salt | C(#N)S |
Thiocyanic acid p-(dimethylamino)phenyl ester | N(C)(C)c1ccc(SC#N)cc1 |
Thiocyanic acid, (4-chlorophenyl)methyl ester | C(SC#N)c1ccc(Cl)cc1 |
Thiocyanic acid, (4-nitrophenyl)methyl ester | [N+](=O)([O-])c1ccc(CSC#N)cc1 |
Thiocyanic acid, (diethylcarbamoyl)methyl ester | N(CC)(CC)C(=O)CSC#N |
Thiocyanic acid, (p-nitrobenzyl) ester | [N+](=O)([O-])c1ccc(CSC#N)cc1 |
Thiocyanic acid, 1,2-cyclooctanediyl ester, trans-(.+-.)- | S(C#N)C1CCCCCCC1SC#N |
Thiocyanic acid, 1,2-ethanediyl ester | C(SC#N)CSC#N |
Thiocyanic acid, 1-ALPHA_-L-arabinopyranosyl-1H-indol-5-yl ester | OC1C(O)C(O)COC1N2C=Cc3cc(SC#N)ccc23 |
Thiocyanic acid, 1H-indol-3-yl ester | S(C#N)C1=CNc2ccccc12 |
Thiocyanic acid, 1H-purin-6-yl ester | S(C#N)c1ncnc2NC=Nc12 |
Thiocyanic acid, 2, 4-dinitrophenyl ester | [N+](=O)([O-])c1cc(ccc1SC#N)[N+](=O)[O-] |
Thiocyanic acid, 2,3-dihydro-3-thienyl ester, S,S-dioxide | S(C#N)C1C=CS(=O)(=O)C1 |
Thiocyanic acid, 2,4-dichlorobenzyl ester | C(SC#N)c1ccc(Cl)cc1Cl |
Thiocyanic acid, 2-(2-butoxyethoxy)ethyl ester | C(COCCCC)OCCSC#N |
Thiocyanic acid, 2-(2-naphthalenyl)-2-oxoethyl ester | C(=O)(CSC#N)c1ccc2ccccc2c1 |
Thiocyanic acid, 2-(diethylamino)-2-oxoethyl ester | N(CC)(CC)C(=O)CSC#N |
Thiocyanic acid, 2-amino-6-benzothiazolyl ester | N=C1Nc2ccc(SC#N)cc2S1 |
Thiocyanic acid, 2-benzothiazolyl ester | S(C#N)C1=Nc2ccccc2S1 |
Thiocyanic acid, 2-chloroethyl ester | C(CCl)SC#N |
Thiocyanic acid, 2-hydroxyethyl ester laurate (ester) | C(=O)(OCCSC#N)CCCCCCCCCCC |
Thiocyanic acid, 2-hydroxyethyl ester, laurate | C(=O)(OCCSC#N)CCCCCCCCCCC |
Thiocyanic acid, 2-naphthoylmethyl ester | C(=O)(CSC#N)c1ccc2ccccc2c1 |
Thiocyanic acid, 4-(dimethylamino)phenyl ester | N(C)(C)c1ccc(SC#N)cc1 |
Thiocyanic acid, 4-aminophenyl ester | S(C#N)c1ccc(N)cc1 |
Thiocyanic acid, 4-chlorobenzyl ester | C(SC#N)c1ccc(Cl)cc1 |
Thiocyanic acid, 4-hydroxyphenyl ester | S(C#N)c1ccc(O)cc1 |
Thiocyanic acid, 4-nitrobenzyl ester | [N+](=O)([O-])c1ccc(CSC#N)cc1 |
Thiocyanic acid, DL-trans-1,2-cyclooctylene ester | S(C#N)C1CCCCCCC1SC#N |
Thiocyanic acid, ammonium salt | C(#N)S |
Thiocyanic acid, benzyl ester | C(SC#N)c1ccccc1 |
Thiocyanic acid, butyl ester | C(CCC)SC#N |
Thiocyanic acid, chloromethyl ester | S(CCl)C#N |
Thiocyanic acid, cis-2-carbamoylvinyl ester | C(=CSC#N)C(N)=O |
Thiocyanic acid, compd. with guanidine (1:1) | C(#N)S.N=C(N)N |
Thiocyanic acid, decyl ester | C(CCCCCC)CCCSC#N |
Thiocyanic acid, di-, 1,2-cyclooctylene ester, DL-(E)- | S(C#N)C1CCCCCCC1SC#N |
Thiocyanic acid, diester with p,p'-iminodiphenol | N(c1ccc(SC#N)cc1)c2ccc(SC#N)cc2 |
Thiocyanic acid, dodecyl ester | C(CCCCCCC)CCCCSC#N |
Thiocyanic acid, ethyl ester | S(CC)C#N |
Thiocyanic acid, ethylene ester | C(SC#N)CSC#N |
Thiocyanic acid, hexyl ester | C(CCCC)CSC#N |
Thiocyanic acid, iminodi-4,1-phenylene ester | N(c1ccc(SC#N)cc1)c2ccc(SC#N)cc2 |
Thiocyanic acid, indol-3-yl ester | S(C#N)C1=CNc2ccccc12 |
Thiocyanic acid, methyl ester | C(#N)SC |
Thiocyanic acid, methylene ester | C(SC#N)SC#N |
Thiocyanic acid, o-chlorobenzyl ester | C(SC#N)c1ccccc1Cl |
Thiocyanic acid, octyl ester | C(CCCCC)CCSC#N |
Thiocyanic acid, oxydi-2,1-ethanediyl ester | O(CCSC#N)CCSC#N |
Thiocyanic acid, oxydiethylene ester | O(CCSC#N)CCSC#N |
Thiocyanic acid, p-(dimethylamino)phenyl ester | N(C)(C)c1ccc(SC#N)cc1 |
Thiocyanic acid, p-aminophenyl ester | S(C#N)c1ccc(N)cc1 |
Thiocyanic acid, p-hydroxyphenyl ester | S(C#N)c1ccc(O)cc1 |
Thiocyanic acid, phenylmethyl ester | C(SC#N)c1ccccc1 |
Thiocyanic acid, silver(1+) salt | C(#N)S |
Thiocyanic acid, thallium(1+) salt | C(#N)S |
Thiocyanic_acid__(4-chlorophenyl)methyl_ester | C(SC#N)c1ccc(Cl)cc1 |
Thiocyanic_acid__(4-nitrophenyl)methyl_ester | [N+](=O)([O-])c1ccc(CSC#N)cc1 |
Thiocyanic_acid__1-ALPHA_-L-arabinopyranosyl-1H-indol-5-yl_ester | OC1C(O)C(O)COC1N2C=Cc3cc(SC#N)ccc23 |
Thiocyanic_acid__1H-indol-3-yl_ester | S(C#N)C1=CNc2ccccc12 |
Thiocyanic_acid__1H-purin-6-yl_ester | S(C#N)c1ncnc2NC=Nc12 |
Thiocyanic_acid__1_2-cyclooctanediyl_ester__trans-(.+-.)- | S(C#N)C1CCCCCCC1SC#N |
Thiocyanic_acid__1_2-ethanediyl_ester | C(SC#N)CSC#N |
Thiocyanic_acid__2-(2-naphthalenyl)-2-oxoethyl_ester | C(=O)(CSC#N)c1ccc2ccccc2c1 |
Thiocyanic_acid__2-(diethylamino)-2-oxoethyl_ester | N(CC)(CC)C(=O)CSC#N |
Thiocyanic_acid__2-amino-6-benzothiazolyl_ester | N=C1Nc2ccc(SC#N)cc2S1 |
Thiocyanic_acid__2-benzothiazolyl_ester | S(C#N)C1=Nc2ccccc2S1 |
Thiocyanic_acid__2-chloroethyl_ester | C(CCl)SC#N |
Thiocyanic_acid__2_3-dihydro-3-thienyl_ester__S_S-dioxide | S(C#N)C1C=CS(=O)(=O)C1 |
Thiocyanic_acid__2_4-dichlorobenzyl_ester | C(SC#N)c1ccc(Cl)cc1Cl |
Thiocyanic_acid__2__4-dinitrophenyl_ester | [N+](=O)([O-])c1cc(ccc1SC#N)[N+](=O)[O-] |
Thiocyanic_acid__ammonium_salt | C(#N)S |
Thiocyanic_acid__butyl_ester | C(CCC)SC#N |
Thiocyanic_acid__chloromethyl_ester | S(CCl)C#N |
Thiocyanic_acid__cis-2-carbamoylvinyl_ester | C(=CSC#N)C(N)=O |
Thiocyanic_acid__decyl_ester | C(CCCCCC)CCCSC#N |
Thiocyanic_acid__diester_with_p_p'-iminodiphenol | N(c1ccc(SC#N)cc1)c2ccc(SC#N)cc2 |
Thiocyanic_acid__dodecyl_ester | C(CCCCCCC)CCCCSC#N |
Thiocyanic_acid__ethyl_ester | S(CC)C#N |
Thiocyanic_acid__hexyl_ester | C(CCCC)CSC#N |
Thiocyanic_acid__methyl_ester | C(#N)SC |
Thiocyanic_acid__methylene_ester | C(SC#N)SC#N |
Thiocyanic_acid__o-chlorobenzyl_ester | C(SC#N)c1ccccc1Cl |
Thiocyanic_acid__octyl_ester | C(CCCCC)CCSC#N |
Thiocyanic_acid__oxydi-2_1-ethanediyl_ester | O(CCSC#N)CCSC#N |
Thiocyanic_acid__p-(dimethylamino)phenyl_ester | N(C)(C)c1ccc(SC#N)cc1 |
Thiocyanic_acid__p-aminophenyl_ester | S(C#N)c1ccc(N)cc1 |
Thiocyanic_acid__p-hydroxyphenyl_ester | S(C#N)c1ccc(O)cc1 |
Thiocyanic_acid__phenylmethyl_ester | C(SC#N)c1ccccc1 |
Thiocyanic_acid__thallium(1+)_salt | C(#N)S |