If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Carbonodithioic acid, O,S-diethyl ester | C(=S)(OCC)SCC |
Carbonodithioic acid, O-(1-methylethyl) ester, potassium salt | O(C(C)C)C(=S)S |
Carbonodithioic acid, O-(1-methylethyl) ester, sodium salt | O(C(C)C)C(=S)S |
Carbonodithioic acid, O-(1-methylpropyl) ester, potassium salt | C(C)(CC)OC(=S)S |
Carbonodithioic acid, O-(3-methylbutyl) ester, potassium salt | C(CC(C)C)OC(=S)S |
Carbonodithioic acid, O-2-propenyl ester, potassium salt | O(CC=C)C(=S)S |
Carbonodithioic acid, O-butyl ester, zinc salt | O(CCCC)C(=S)S |
Carbonodithioic acid, O-ethyl ester, nickel(2+) salt | O(CC)C(=S)S |
Carbonodithioic acid, O-ethyl ester, potassium salt | O(CC)C(=S)S |
Carbonodithioic acid, O-isopropyl ester, sodium salt | O(C(C)C)C(=S)S |
Carbonodithioic acid, O-methyl ester, potassium salt | C(=S)(S)OC |
Carbonodithioic acid, O-pentyl ester, potassium salt | C(CCCC)OC(=S)S |
Carbonodithioic acid, S,S'-1,2-ethanediyl O,O'-dibutyl ester | C(=S)(OCCCC)SCCSC(=S)OCCCC |
Carbonodithioic acid, S,S-dimethyl ester | C(=O)(SC)SC |
Carbonodithioic_acid__O-(1-methylethyl)_ester__potassium_salt | O(C(C)C)C(=S)S |
Carbonodithioic_acid__O-(1-methylethyl)_ester__sodium_salt | O(C(C)C)C(=S)S |
Carbonodithioic_acid__O-(1-methylpropyl)_ester__potassium_salt | C(C)(CC)OC(=S)S |
Carbonodithioic_acid__O-(3-methylbutyl)_ester__potassium_salt | C(CC(C)C)OC(=S)S |
Carbonodithioic_acid__O-2-propenyl_ester__potassium_salt | O(CC=C)C(=S)S |
Carbonodithioic_acid__S_S'-1_2-ethanediyl_O_O'-dibutyl_ester | C(=S)(OCCCC)SCCSC(=S)OCCCC |