If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1-Methyl-3-piperidinol | OC1CCCN(C)C1 |
1-Methyl-4-piperidinol | OC1CCN(C)CC1 |
2,2,6, 6-Tetramethyl-4-piperidinol 1-oxide | ON1C(C)(C)CC(O)CC1(C)C |
2,2,6, 6-Tetramethyl-4-piperidinol | CC1(C)CC(O)CC(C)(C)N1 |
3-Piperidinol 1-ethyl- diphenylacetate hydrochloride | C(C(=O)OC1CCCN(CC)C1)(c2ccccc2)c3ccccc3 |
3-Piperidinol | OC1CCCNC1 |
3-Piperidinol, 1-amino- | OC1CCCN(N)C1 |
3-Piperidinol, 1-ethyl-, benzilate (ester) | C(O)(C(=O)OC1CCCN(CC)C1)(c2ccccc2)c3ccccc3 |
3-Piperidinol, 1-methyl- | OC1CCCN(C)C1 |
3-Piperidinol__1-amino- | OC1CCCN(N)C1 |
4-(4-Chlorophenyl)-4-piperidinol | OC1(CCNCC1)c2ccc(Cl)cc2 |
4-(p-Chlorophenyl)-4-piperidinol | OC1(CCNCC1)c2ccc(Cl)cc2 |
4-Piperidinol | OC1CCNCC1 |
4-Piperidinol, 1-methyl- | OC1CCN(C)CC1 |
4-Piperidinol, 2,2,6,6-tetramethyl- | CC1(C)CC(O)CC(C)(C)N1 |
4-Piperidinol, 2,2,6-trimethyl-, benzoate (ester) | O(C(=O)c1ccccc1)C2CC(C)NC(C)(C)C2 |
4-Piperidinol, 4-(4-chlorophenyl)- | OC1(CCNCC1)c2ccc(Cl)cc2 |
4-p-Chlorophenyl-4-piperidinol | OC1(CCNCC1)c2ccc(Cl)cc2 |
N-Methyl-3-piperidinol | OC1CCCN(C)C1 |
N-Methyl-4-piperidinol | OC1CCN(C)CC1 |