If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
SEBACIC ACID | C(CCCCCCC(=O)O)CC(=O)O |
Sebacic acid bis(2-ethylhexyl) ester | C(CC)(CCCC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC |
Sebacic acid dichloride | C(CCCCCCC(Cl)=O)CC(Cl)=O |
Sebacic acid dihydrazide | C(=O)(NN)CCCCCCCCC(=O)NN |
Sebacic acid | C(CCCCCCC(=O)O)CC(=O)O |
Sebacic acid, bis(2-ethoxyethyl) ester | C(=O)(OCCOCC)CCCCCCCCC(=O)OCCOCC |
Sebacic acid, bis(2-ethylhexyl) ester | C(CC)(CCCC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC |
Sebacic acid, cadmium salt (1:1) | C(CCCCCCC(=O)O)CC(=O)O |
Sebacic acid, diallyl ester | C(CCCCCCCC(=O)OCC=C)C(=O)OCC=C |
Sebacic acid, dibenzyl ester | C(OC(=O)CCCCCCCCC(=O)OCc1ccccc1)c2ccccc2 |
Sebacic acid, dibutyl ester | C(CCCCCCCC(=O)OCCCC)C(=O)OCCCC |
Sebacic acid, diethyl ester | C(CCCCCCCC(=O)OCC)C(=O)OCC |
Sebacic acid, dihydrazide | C(=O)(NN)CCCCCCCCC(=O)NN |
Sebacic acid, dimethyl ester | C(=O)(OC)CCCCCCCCC(=O)OC |
Sebacic acid, dioctyl ester | C(=O)(OCCCCCCCC)CCCCCCCCC(=O)OCCCCCCCC |
Sebacic acid, monoethyl ester | C(CCCCCC(=O)O)CCC(=O)OCC |
Sebacic acids | C(CCCCCCC(=O)O)CC(=O)O |
Sebacic dihydrazide | C(=O)(NN)CCCCCCCCC(=O)NN |
Sebacic_acid_dichloride | C(CCCCCCC(Cl)=O)CC(Cl)=O |