If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Nitro-3,4, 5-trimethoxybenzoic acid | O(C)c1c(OC)c(OC)cc(C(=O)O)c1[N+](=O)[O-] |
3,4,5-Trimethoxybenzoic acid methyl ester | O(C)c1c(OC)cc(cc1OC)C(=O)OC |
3,4,5-Trimethoxybenzoic acid | O(C)c1c(OC)cc(cc1OC)C(=O)O |
3,4,5-Trimethoxybenzoic acid, methyl ester | O(C)c1c(OC)cc(cc1OC)C(=O)OC |
Methyl reserpate 3,4,5-trimethoxybenzoic acid ester | C(=O)(OC)C1C(OC)C(OC(=O)c2cc(OC)c(OC)c(OC)c2)CC3CN4CCC5=C(Nc6cc(OC)ccc56)C4CC13 |