If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(Chlorophenoxy)isobutyric acid | O(c1ccc(Cl)cc1)C(C)(C)C(=O)O |
(p-Chlorophenoxy)isobutyric acid | O(c1ccc(Cl)cc1)C(C)(C)C(=O)O |
2-(p-Chlorophenoxy)isobutyric acid | O(c1ccc(Cl)cc1)C(C)(C)C(=O)O |
4-(Chlorophenoxy)isobutyric acid (VAN) | O(c1ccc(Cl)cc1)C(C)(C)C(=O)O |
ALPHA_-(4-Chlorophenoxy)isobutyric acid | O(c1ccc(Cl)cc1)C(C)(C)C(=O)O |
ALPHA_-(p-Chlorophenoxy)isobutyric acid | O(c1ccc(Cl)cc1)C(C)(C)C(=O)O |
ALPHA_-(p-Chlorophenoxy)isobutyric acid, ethyl ester | O(c1ccc(Cl)cc1)C(C)(C)C(=O)OCC |
ISOBUTYRIC ACID | C(C)(C)C(=O)O |
Isobutyric acid anilide | N(C(=O)C(C)C)c1ccccc1 |
Isobutyric acid | C(C)(C)C(=O)O |
Isobutyric acid, 1,5-dimethyl-1-vinyl-4-hexenyl ester | C(C)(C=C)(CCC=C(C)C)OC(=O)C(C)C |
Isobutyric acid, 2,4-hexadienyl ester | O(CC=CC=CC)C(=O)C(C)C |
Isobutyric acid, 2-methylbutyl ester | O(CC(C)CC)C(=O)C(C)C |
Isobutyric acid, 2-phenoxyethyl ester | O(CCOC(=O)C(C)C)c1ccccc1 |
Isobutyric acid, 3,7-dimethyl-6-octenyl ester | C(=O)(OCCC(C)CCC=C(C)C)C(C)C |
Isobutyric acid, 3-phenylpropyl ester | C(CCOC(=O)C(C)C)c1ccccc1 |
Isobutyric acid, ALPHA_-(p-chlorophenoxy)-, ethyl ester | O(c1ccc(Cl)cc1)C(C)(C)C(=O)OCC |
Isobutyric acid, benzyl ester | C(OC(=O)C(C)C)c1ccccc1 |
Isobutyric acid, cinnamyl ester | C(=CCOC(=O)C(C)C)c1ccccc1 |
Isobutyric acid, dodecyl ester | C(CCCCCCCCCCC)OC(=O)C(C)C |
Isobutyric acid, ethyl ester | C(=O)(OCC)C(C)C |
Isobutyric acid, hexyl ester | O(CCCCCC)C(=O)C(C)C |
Isobutyric acid, isobutyl ester | C(=O)(OCC(C)C)C(C)C |
Isobutyric acid, methyl ester | C(=O)(OC)C(C)C |
Isobutyric acid, octyl ester | O(CCCCCCCC)C(=O)C(C)C |
Isobutyric acid, propyl ester | C(=O)(OCCC)C(C)C |
Isobutyric aldehyde | C(C)(C)C=O |
Isobutyric_acid__dodecyl_ester | C(CCCCCCCCCCC)OC(=O)C(C)C |
p-(2,4-Chlorophenoxy)isobutyric acid | O(c1ccc(Cl)cc1)C(C)(C)C(=O)O |