If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Octanal | C(CCCC)CCC=O |
1-Octanal, 3,7-dimethyl-7-hydroxy- | C(CCC(C)CC=O)C(C)(C)O |
1-Octanal__3_7-dimethyl-7-hydroxy- | C(CCC(C)CC=O)C(C)(C)O |
Octanal diethyl acetal | C(OCC)(OCC)CCCCCCC |
Octanal | C(CCCC)CCC=O |
Octanal, 2-(phenylmethylene)- | C(=C(C=O)CCCCCC)c1ccccc1 |
Octanal, 7-hydroxy-3,7-dimethyl- | C(CCC(C)CC=O)C(C)(C)O |
Octanal, 7-hydroxy-3,7-dimethyl-, dimethyl acetal | C(C(C)CCCC(C)(C)O)C(OC)OC |
Octanal, azine | N(=CCCCCCCC)N=CCCCCCCC |
Octanal, oxime | C(CCCC)CCC=NO |
Octanal, tech. | C(CCCC)CCC=O |
Octanal__7-hydroxy-3_7-dimethyl-__dimethyl_acetal | C(C(C)CCCC(C)(C)O)C(OC)OC |
Octanal__azine | N(=CCCCCCCC)N=CCCCCCCC |
Octanal_diethyl_acetal | C(OCC)(OCC)CCCCCCC |
n-Octanal | C(CCCC)CCC=O |