If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Butenenitrile | C(=CC)C#N |
2-Butenenitrile, 3-amino- | C(C#N)=C(C)N |
2-Butenenitrile, 4-phenyl-2-(phenylamino)- | N(C(C#N)=CCc1ccccc1)c2ccccc2 |
2-Butenenitrile__3-amino- | C(C#N)=C(C)N |
2-Butenenitrile__4-phenyl-2-(phenylamino)- | N(C(C#N)=CCc1ccccc1)c2ccccc2 |
3-Butenenitrile | C(C=C)C#N |
3-Butenenitrile, 2-anilino-4-phenyl- | N(C(C#N)C=Cc1ccccc1)c2ccccc2 |
3-Butenenitrile, 3-methyl- | C(C#N)C(C)=C |
3-Butenenitrile__2-anilino-4-phenyl- | N(C(C#N)C=Cc1ccccc1)c2ccccc2 |
3-Butenenitrile__3-methyl- | C(C#N)C(C)=C |
3-Methyl-3-butenenitrile | C(C#N)C(C)=C |