If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1-(4-(1-Pyrrolidinyl)-2-butynyl)-2-pyrrolidinone | C(C#CCN1CCCC1)N2CCCC2=O |
1-Hexadecanaminium, N-(4-chloro-2-butynyl)-N, N-dimethyl-, chloride | N(C)(C)(CC#CCCl)CCCCCCCCCCCCCCCC |
1-Hexadecanaminium__N-(4-chloro-2-butynyl)-N__N-dimethyl-__chloride | N(C)(C)(CC#CCCl)CCCCCCCCCCCCCCCC |
2-Butynyl 4-chloro-m-chlorocarbanilate | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
2-Butynyl alcohol | C(#CC)CO |
2-Butynyl_alcohol | C(#CC)CO |
2-Pyrrolidinone, 1-(4-(1-pyrrolidinyl)-2-butynyl)- | C(C#CCN1CCCC1)N2CCCC2=O |
2-Pyrrolidinone__1-(4-(1-pyrrolidinyl)-2-butynyl)- | C(C#CCN1CCCC1)N2CCCC2=O |
3-Butynyl alcohol | C(C#C)CO |
4-Chloro-2-butynyl 3-chlorocarbanilate | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
4-Chloro-2-butynyl N-(3-chlorophenyl)carbamate | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
4-Chloro-2-butynyl m-chlorocarbanilate | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
Ammonium, (4-chloro-2-butynyl)dimethylhexadecyl-, chloride | N(C)(C)(CC#CCCl)CCCCCCCCCCCCCCCC |
Carbamic acid, (3-chlorophenyl)-, 4-chloro-2-butynyl ester | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
Carbanilic acid, m-chloro-, 4-chloro-2-butynyl ester | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
Dimethylhexadecyl(4-chloro-2-butynyl)ammonium chloride | N(C)(C)(CC#CCCl)CCCCCCCCCCCCCCCC |
m-Chlorocarbanilic acid, 4-chloro-2-butynyl ester | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |