If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Bis(2-chloroethyl)phosphoramidothioic acid dichloride | N(CCCl)(CCCl)P(Cl)(Cl)=S |
Phosphoramidothioic acid, N-amidino-, O,O-diethyl ester | P(=S)(OCC)(OCC)NC(=N)N |
Phosphoramidothioic acid, O, O-diethyl ester | P(N)(=S)(OCC)OCC |
Phosphoramidothioic acid, O, O-dimethyl ester | P(N)(=S)(OC)OC |
Phosphoramidothioic acid, O,O-bis(p-chlorophenyl) ester | O(c1ccc(Cl)cc1)P(N)(=S)Oc2ccc(Cl)cc2 |
Phosphoramidothioic acid, O-ethyl S-methyl ester | P(N)(=O)(SC)OCC |
Phosphoramidothioic acid, O-methyl O-(2,4,5-trichlorophenyl) ester | O(c1cc(Cl)c(Cl)cc1Cl)P(N)(=S)OC |
Phosphoramidothioic acid, amidino-, O,O-diethyl ester | P(=S)(OCC)(OCC)NC(=N)N |
Phosphoramidothioic acid, diammonium salt | P(N)(=O)(O)S |
Phosphoramidothioic dichloride, N,N-bis(2-chloroethyl)- | N(CCCl)(CCCl)P(Cl)(Cl)=S |
Phosphoramidothioic dichloride, bis(2-chloroethyl)- | N(CCCl)(CCCl)P(Cl)(Cl)=S |
Phosphoramidothioic_acid__N-amidino-__O_O-diethyl_ester | P(=S)(OCC)(OCC)NC(=N)N |
Phosphoramidothioic_acid__O_O-bis(p-chlorophenyl)_ester | O(c1ccc(Cl)cc1)P(N)(=S)Oc2ccc(Cl)cc2 |
Phosphoramidothioic_acid__O__O-diethyl_ester | P(N)(=S)(OCC)OCC |
Phosphoramidothioic_acid__O__O-dimethyl_ester | P(N)(=S)(OC)OC |
Phosphoramidothioic_acid__diammonium_salt | P(N)(=O)(O)S |
Phosphoramidothioic_dichloride__N_N-bis(2-chloroethyl)- | N(CCCl)(CCCl)P(Cl)(Cl)=S |