If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2, 2'-Dihydroxydiphenyl | Oc1ccccc1c2ccccc2O |
2,2'-Dihydroxydiphenyl sulfide | S(c1ccccc1O)c2ccccc2O |
2,2-(4,4'-Dihydroxydiphenyl)propane | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2 |
2,4'-Dihydroxydiphenyl sulfone | S(=O)(=O)(c1ccc(O)cc1)c2ccccc2O |
2_2'-Dihydroxydiphenyl_sulfide | S(c1ccccc1O)c2ccccc2O |
4, 4'-Dihydroxydiphenyl sulfide | S(c1ccc(O)cc1)c2ccc(O)cc2 |
4, 4'-Dihydroxydiphenyl sulfone | S(=O)(=O)(c1ccc(O)cc1)c2ccc(O)cc2 |
4, 4'-Dihydroxydiphenyl | Oc1ccc(cc1)c2ccc(O)cc2 |
4, 4'-Dihydroxydiphenyl-2,2-butane | C(C)(CC)(c1ccc(O)cc1)c2ccc(O)cc2 |
4, 4'-Dihydroxydiphenyl-2,2-propane | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2 |
4,4'-Dihydroxydiphenyl sulfoxide | S(=O)(c1ccc(O)cc1)c2ccc(O)cc2 |
4_4'-Dihydroxydiphenyl_sulfoxide | S(=O)(c1ccc(O)cc1)c2ccc(O)cc2 |
4__4'-Dihydroxydiphenyl_sulfide | S(c1ccc(O)cc1)c2ccc(O)cc2 |
5, 5'-Dichloro-2,2'-dihydroxydiphenyl sulfide | S(c1cc(Cl)ccc1O)c2cc(Cl)ccc2O |
5,5'-Dichloro-2,2'-dihydroxydiphenyl sulfone | S(=O)(=O)(c1cc(Cl)ccc1O)c2cc(Cl)ccc2O |
Silane, dihydroxydiphenyl- | [Si](O)(O)(c1ccccc1)c2ccccc2 |
Silane__dihydroxydiphenyl- | [Si](O)(O)(c1ccccc1)c2ccccc2 |
o-Dihydroxydiphenyl | Oc1ccccc1c2ccccc2O |
p,p'-Dihydroxydiphenyl sulfide | S(c1ccc(O)cc1)c2ccc(O)cc2 |
p-Dihydroxydiphenyl | Oc1ccc(cc1)c2ccc(O)cc2 |