If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Methoxyethyl m-hydroxycarbanilate methylcarbamate | N(C(=O)OCCOC)c1cccc(c1)OC(=O)NC |
2-Propynyl m-hydroxycarbanilate methylcarbamate | N(C(=O)OCC#C)c1cccc(c1)OC(=O)NC |
Allyl m-hydroxycarbanilate | N(C(=O)OCC=C)c1cccc(O)c1 |
Cyclohexyl m-hydroxycarbanilate | N(C(=O)OC1CCCCC1)c2cccc(O)c2 |
Ethyl 3-hydroxycarbanilate | N(C(=O)OCC)c1cccc(O)c1 |
Ethyl m-hydroxycarbanilate | N(C(=O)OCC)c1cccc(O)c1 |
Isopentyl m-hydroxycarbanilate | N(C(=O)OCCC(C)C)c1cccc(O)c1 |
Isopropyl m-hydroxycarbanilate methylcarbamate | N(C(=O)OC(C)C)c1cccc(c1)OC(=O)NC |
Methyl m-hydroxycarbanilate butylcarbamate | O(C(=O)NCCCC)c1cccc(c1)NC(=O)OC |
Methyl m-hydroxycarbanilate ethylcarbamate | O(C(=O)NCC)c1cccc(c1)NC(=O)OC |
Methyl m-hydroxycarbanilate isobutylcarbamate | O(C(=O)NCC(C)C)c1cccc(c1)NC(=O)OC |
Methyl o-hydroxycarbanilate methylcarbamate | N(C(=O)OC)c1ccccc1OC(=O)NC |
Propyl m-hydroxycarbanilate | N(C(=O)OCCC)c1cccc(O)c1 |
p-Aminophenyl p-hydroxycarbanilate | N(C(=O)Oc1ccc(N)cc1)c2ccc(O)cc2 |