If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
5-Bromosalicylic acid acetate | O(C(C)=O)c1ccc(Br)cc1C(=O)O |
5-Bromosalicylic acid p-bromoanilide | C(=O)(Nc1ccc(Br)cc1)c2cc(Br)ccc2O |
5-Bromosalicylic acid | C(=O)(O)c1cc(Br)ccc1O |
Acetyl 5-bromosalicylic acid | O(C(C)=O)c1ccc(Br)cc1C(=O)O |