If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Kromon Azo Orange | N(=Nc1ccccc1[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Kromon Geranium Lake | N(=Nc1ccccc1C(=O)O)c2c(O)c(cc3cc(ccc23)S(=O)(=O)O)S(=O)(=O)O |
Kromon Green B | Cc1cc(Cl)ccc1N |
Kromon Helio Fast Red YS | N(=Nc1ccc(C)cc1[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Kromon Helio Fast Red | N(=Nc1ccc(C)cc1[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Kromon Lake Orange Toner | N(=Nc1ccc(cc1)S(=O)(=O)O)c2c(O)ccc3ccccc23 |
Kromon Para Red BS | N(=Nc1ccc(cc1)[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Kromon Para Red YS | N(=Nc1ccc(cc1)[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Kromon Primrose Yellow | N(=NC(C(C)=O)C(=O)Nc1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
Kromon Yellow 10G Extra | N(=NC(C(C)=O)C(=O)Nc1ccccc1Cl)c2ccc(Cl)cc2[N+](=O)[O-] |
Kromon Yellow G | N(=NC(C(C)=O)C(=O)Nc1ccccc1)c2ccc(C)cc2[N+](=O)[O-] |
Kromon Yellow GXR | Clc1cc(ccc1N=NC(C(C)=O)C(=O)Nc2ccc(C)cc2C)c3ccc(N=NC(C(C)=O)C(=O)Nc4ccc(C)cc4C)c(Cl)c3 |
Kromon Yellow GXT Conc | Clc1cc(ccc1N=NC(C(C)=O)C(=O)Nc2ccccc2)c3ccc(N=NC(C(C)=O)C(=O)Nc4ccccc4)c(Cl)c3 |
Kromon Yellow MTB | Clc1cc(ccc1N=NC(C(C)=O)C(=O)Nc2ccccc2)c3ccc(N=NC(C(C)=O)C(=O)Nc4ccccc4)c(Cl)c3 |