If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(Trimethylammonio)-2, 3-epoxypropane chloride | C(C1CO1)N(C)(C)C |
Carbamic acid, N-methyl-, p-(trimethylammonio)phenyl ester, iodide | N(C)(C)(C)c1ccc(cc1)OC(=O)NC |
Carbamic acid, diethyl-, (6-trimethylammonio)thymyl ester, iodide | O(C(=O)N(CC)CC)c1cc(C)c(cc1C(C)C)N(C)(C)C |
Carbamic acid, methyl-, 5-(trimethylammonio)-o-tolyl ester, iodide | O(C(=O)NC)c1cc(ccc1C)N(C)(C)C |