If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
N-(4-Nitrophenyl)oxamic acid | N(C(=O)C(=O)O)c1ccc(cc1)[N+](=O)[O-] |
N-(p-Aminophenyl)oxamic acid | N(C(=O)C(=O)O)c1ccc(N)cc1 |
Oxamic acid hydrazide | C(=O)(NN)C(N)=O |
Oxamic acid | C(N)(=O)C(=O)O |
Oxamic acid, N-(p-aminophenyl)- | N(C(=O)C(=O)O)c1ccc(N)cc1 |
Oxamic acid, N-amidino-N-methyl- | C(=O)(C(=O)O)N(C)C(=N)N |
Oxamic acid, dimethyl-, ethyl ester | C(=O)(N(C)C)C(=O)OCC |
Oxamic acid, ethyl ester | C(=O)(OCC)C(N)=O |
Oxamic acid, phenyl- | N(C(=O)C(=O)O)c1ccccc1 |
Oxamic hydrazide | C(=O)(NN)C(N)=O |