If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Tetralone | O=C1CCCc2ccccc12 |
2,5, 8-Trimethyl-1-tetralone | O=C1C(C)CCc2c(C)ccc(C)c12 |
2-Bromo-1-tetralone | O=C1C(Br)CCc2ccccc12 |
2-Bromo-ALPHA_-tetralone | O=C1C(Br)CCc2ccccc12 |
2-Tetralone | O=C1CCc2ccccc2C1 |
3, 3,6,8-Tetramethyl-1-tetralone | O=C1CC(C)(C)Cc2cc(C)cc(C)c12 |
4-Methyl-1-tetralone | CC1CCC(=O)c2ccccc12 |
4-Methyl-ALPHA_-tetralone | CC1CCC(=O)c2ccccc12 |
5, 7-Dimethyl-1-tetralone | Cc1cc(C)cc2C(=O)CCCc12 |
5-Methyl-1-tetralone | Cc1cccc2C(=O)CCCc12 |
6, 7-Dimethyl-ALPHA_-tetralone | O=C1CCCc2cc(C)c(C)cc12 |
6-Methoxy-1-tetralone | O=C1CCCc2cc(OC)ccc12 |
6-Methoxy-ALPHA_-tetralone | O=C1CCCc2cc(OC)ccc12 |
7-Methyl-1-tetralone | O=C1CCCc2ccc(C)cc12 |
7-Methyl-ALPHA_-tetralone | O=C1CCCc2ccc(C)cc12 |
7-Nitro-1-tetralone | O=C1CCCc2ccc(cc12)[N+](=O)[O-] |
ALPHA_-Tetralone | O=C1CCCc2ccccc12 |
BETA_-Tetralone | O=C1CCc2ccccc2C1 |