If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Furanacrylic acid ethyl ester | C(=CC(=O)OCC)C1=CC=CO1 |
2-Furanacrylic acid | C(=CC(=O)O)C1=CC=CO1 |
2-Furanacrylic acid, (E)- | C(=CC(=O)O)C1=CC=CO1 |
2-Furanacrylic acid, 5-nitro-, ethyl ester | C(=CC(=O)OCC)C1=CC=C(O1)[N+](=O)[O-] |
2-Furanacrylic acid, ethyl ester | C(=CC(=O)OCC)C1=CC=CO1 |
Furanacrylic acid | C(=CC(=O)O)C1=CC=CO1 |
trans-2-Furanacrylic acid | C(=CC(=O)O)C1=CC=CO1 |