If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Tridecanol | C(CCCCCC)CCCCCCO |
2-Tridecanol | C(CCCCCCCC)CCC(C)O |
3, 9-Diethyl-6-tridecanol | C(CC)(CCCC)CCC(O)CCC(CC)CC |
4-Tridecanol | C(CCCCCCCC)C(O)CCC |
5-Tridecanol | C(O)(CCCC)CCCCCCCC |
6-Tridecanol | C(O)(CCCCC)CCCCCCC |
6-Tridecanol, 3,9-diethyl- | C(CC)(CCCC)CCC(O)CCC(CC)CC |
7-Tridecanol | C(CCCCC)C(O)CCCCCC |
Tridecanol stearate | C(CCCCCCCCCCCCCCCC)C(=O)OCCCCCCCCCCCCC |
Tridecanol | C(CCCCCC)CCCCCCO |
n-Tridecanol | C(CCCCCC)CCCCCCO |