If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Glycol, polyethylene monostearate #200 | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Glycol, polyethylene monostearate #6000 | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Glycols, polyethylene | C(O)CO |
Glycols, polyethylene, monoricinoleate | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Glycols, polyethylene, monostearate | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Glycols, polyethylene-polypropylene | C1CO1.CC2CO2 |
Polyethylene (600) monoricinoleate | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Polyethylene Glycol 1500 | C(O)CO |
Polyethylene Glycol 1540 | C(O)CO |
Polyethylene Glycol 300 | C(O)CO |
Polyethylene Glycol 400 | C(O)CO |
Polyethylene Glycol 4000 | C(O)CO |
Polyethylene Glycol 600 | C(O)CO |
Polyethylene Glycol 6000 | C(O)CO |
Polyethylene Glycol, ointment | C(O)CO |
Polyethylene diol | C(O)CO |
Polyethylene glycol (100) monostearate | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol 400 monoester of ricinoleic acid | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Polyethylene glycol 4000 | C(O)CO |
Polyethylene glycol 450 octyl phenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol 6000 | C(O)CO |
Polyethylene glycol 8 monostearate | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol mono(4-octylphenyl) ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol mono(4-tert-octylphenyl) ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol mono(p-(1,1,3, 3-tetramethylbutyl)phenyl) ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol mono(p-tert-octylphenyl) ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol monoether with p-tert-octylphenyl | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol monostearate #1000 | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol monostearate #200 | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol monostearate #400 | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol monostearate #6000 | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol monostearate | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol octylphenol ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol p-(1,1,3,3-tetramethylbutyl)phenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol p-octylphenyl ether (VAN) | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol p-tert-octylphenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol stearate | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene glycol | C(O)CO |
Polyethylene glycol, ester with ricinoleic acid | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Polyethylene glycol, mono(alkylphenyl) ethers | C(O)CO |
Polyethylene glycol, propoxylated | C1CO1.CC2CO2 |
Polyethylene glycol, unrefined | C(O)CO |
Polyethylene glycol-ricinoleic acid monoester | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Polyethylene oxide monostearate | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyethylene oxide | C(O)CO |
Polyethylene oxide-polypropylene oxide copolymer | C1CO1.CC2CO2 |
Polyethylene oxide-polypropylene oxide | C1CO1.CC2CO2 |
Polyethylene-Pluronic L-62LF | C1CO1.CC2CO2 |
Polyethylene-polypropylene glycol | C1CO1.CC2CO2 |
Ricinoleic acid, monoester with polyethylene glycol | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |