If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Methyl-D-lysergic acid butanolamide dimaleate | C(=CC(=O)O)C(=O)O.CCC(CO)NC(=O)C1CN(C)C2CC3=CN(C)c4cccc(C2=C1)c34 |
Acetophenazine dimaleate | C(=CC(=O)O)C(=O)O.OCCN1CCN(CCCN2c3ccccc3Sc4ccc(cc24)C(C)=O)CC1 |
Carphenazine dimaleate | C(=CC(=O)O)C(=O)O.OCCN1CCN(CCCN2c3ccccc3Sc4ccc(cc24)C(=O)CC)CC1 |
Procethazine dimaleate | C(=CC(=O)O)C(=O)O.OCCN1CCN(CCCN2c3ccccc3Sc4ccc(cc24)C(=O)CC)CC1 |
Proketazine dimaleate | C(=CC(=O)O)C(=O)O.OCCN1CCN(CCCN2c3ccccc3Sc4ccc(cc24)C(=O)CC)CC1 |
Thiethylperazine dimaleate | C(=CC(=O)O)C(=O)O.CCSc1ccc2Sc3ccccc3N(CCCN4CCN(C)CC4)c2c1 |