If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(ortho-Nitrophenyl)acetic acid | [N+](=O)([O-])c1ccccc1CC(=O)O |
(ortho-Nitrophenyl)acetic_acid | [N+](=O)([O-])c1ccccc1CC(=O)O |
3'-Chloro-ortho-acetoacetotoluidide | N(C(=O)CC(C)=O)c1cccc(Cl)c1C |
4''-(ortho-Tolylazo)-ortho-diacetoluidide | N(C(C)=O)(C(C)=O)c1ccc(N=Nc2ccccc2C)cc1C |
5-Amino-ortho-toluenesulfonanilide | S(=O)(=O)(Nc1ccccc1)c2cc(N)ccc2C |
ALPHA_-Bromo-ortho-xylene | C(Br)c1ccccc1C |
CYMENE, ORTHO | C(C)(C)c1ccccc1C |
Ethyl formate(ortho) | C(OCC)(OCC)OCC |
ISOPROPYLPHENOL, ORTHO | C(C)(C)c1ccccc1O |
Ortho Malathion | C(CC(=O)OCC)(SP(=S)(OC)OC)C(=O)OCC |
Ortho N-4 and N-5 dusts | CN1CCCC1c2cccnc2 |
Ortho N-4 dust | CN1CCCC1c2cccnc2 |
Ortho N-5 dust | CN1CCCC1c2cccnc2 |
Ortho grass killer | N(C(=O)OC(C)C)c1ccccc1 |
Ortho-ALPHA_-dichlorotoluene | C(Cl)c1ccccc1Cl |
Ortho-Gynest | CC12CCC3c4ccc(O)cc4CCC3C1CC(O)C2O |
Ortho-Klor | ClC12C(Cl)=C(Cl)C(Cl)(C3C(Cl)C(Cl)CC13)C2(Cl)Cl |
Ortho-Mite | O(CC(C)OS(=O)OCCCl)c1ccc(cc1)C(C)(C)C |
Silicic acid, methyl ester of ortho- | [Si](OC)(OC)(OC)OC |
Sodium ortho-phenylphenate | Oc1ccccc1c2ccccc2 |
Sodium vanadate (ortho) | [V](=O)(=O)(=O)=O |
Tetrabromo-ortho-xylene | Brc1c(Br)c(Br)c(C)c(C)c1Br |
Tri-ortho-toylphosphine | P(c1ccccc1C)(c2ccccc2C)c3ccccc3C |
component of Ortho-Novum | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
ortho-Toluenesulfonamide | S(N)(=O)(=O)c1ccccc1C |
ortho-Toluenesulfonic acid, methyl ester | S(=O)(=O)(OC)c1ccc(C)cc1 |
para-Nitro-ortho-xylene | [N+](=O)([O-])c1ccc(C)c(C)c1 |