If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(E)-2,2-Dimethyl-3-hexene | C(=CCC)C(C)(C)C |
(E)-2,5-Dimethyl-3-hexene | C(=CC(C)C)C(C)C |
(E)-2-Hexene | C(CC)C=CC |
(E)-2-Methyl-3-hexene | C(=CCC)C(C)C |
(E)-3-Hexene | C(CC)=CCC |
(E)-3-Methyl-2-hexene | C(C)(=CC)CCC |
(E)-3-Methyl-3-hexene | C(C)(CC)=CCC |
(E)-4-Methyl-2-hexene | C(C)(CC)C=CC |
(E)-5-Methyl-2-hexene | C(C=CC)C(C)C |
(Z)-2,2-Dimethyl-3-hexene | C(=CCC)C(C)(C)C |
(Z)-2-Hexene | C(CC)C=CC |
(Z)-3-Hexene | C(CC)=CCC |
(Z)-3-Methyl-2-hexene | C(C)(=CC)CCC |
(Z)-3-Methyl-3-hexene | C(C)(CC)=CCC |
(Z)-4-Methyl-2-hexene | C(C)(CC)C=CC |
1,2-Hexene oxide | C(CCC)C1CO1 |
1-Hexene epoxide | C(CCC)C1CO1 |
1-Hexene oxide | C(CCC)C1CO1 |
1-Hexene | C(CC)CC=C |
1-Hexene, 1-bromo-, (E)- | C(C=CBr)CCC |
1-Hexene, 2,5-dimethyl- | C(CC(C)=C)C(C)C |
1-Hexene, 2-ethyl- | C(=C)(CC)CCCC |
1-Hexene, 2-methyl- | C(CCC)C(C)=C |
1-Hexene, 3,4-dimethyl- | C(C)(CC)C(C)C=C |
1-Hexene, 3-methyl- | C(C)(C=C)CCC |
1-Hexene, 4,5-dimethyl- | C(C)(CC=C)C(C)C |
1-Hexene, 4-methyl- | C(C)(CC)CC=C |
1-Hexene, 5-methyl- | C(CC=C)C(C)C |
1-Hexene__1-bromo-__(E)- | C(C=CBr)CCC |
1-Hexene__2-methyl- | C(CCC)C(C)=C |
1-Hexene__2_5-dimethyl- | C(CC(C)=C)C(C)C |
1-Hexene__3-methyl- | C(C)(C=C)CCC |
1-Hexene__3_4-dimethyl- | C(C)(CC)C(C)C=C |
1-Hexene__4-methyl- | C(C)(CC)CC=C |
1-Hexene__4_5-dimethyl- | C(C)(CC=C)C(C)C |
1-Hexene__5-methyl- | C(CC=C)C(C)C |
1-n-Hexene | C(CC)CC=C |
2, 2-Dimethyl-cis-3-hexene | C(=CCC)C(C)(C)C |
2, 2-Dimethyl-trans-3-hexene | C(=CCC)C(C)(C)C |
2,3-Dimethyl-2-hexene | C(C)(CCC)=C(C)C |
2,5-Dimethyl-1-hexene | C(CC(C)=C)C(C)C |
2,5-Dimethyl-2-hexene | C(C=C(C)C)C(C)C |
2,5-Dimethyl-trans-3-hexene | C(=CC(C)C)C(C)C |
2-Ethyl-1-hexene | C(=C)(CC)CCCC |
2-Hexene, (E)- | C(CC)C=CC |
2-Hexene, (Z)- | C(CC)C=CC |
2-Hexene, 2,3-dimethyl- | C(C)(CCC)=C(C)C |
2-Hexene, 2,5-dimethyl- | C(C=C(C)C)C(C)C |
2-Hexene, 2-methyl- | C(CCC)=C(C)C |
2-Hexene, 3-methyl-, (E)- | C(C)(=CC)CCC |
2-Hexene, 3-methyl-, (Z)- | C(C)(=CC)CCC |
2-Hexene, 4,5-dimethyl- | C(C)(C=CC)C(C)C |
2-Hexene, 4-methyl-, (E)- | C(C)(CC)C=CC |
2-Hexene, 4-methyl-, (Z)- | C(C)(CC)C=CC |
2-Hexene, 5-methyl-, (E)- | C(C=CC)C(C)C |
2-Hexene, cis- | C(CC)C=CC |
2-Hexene__(Z)- | C(CC)C=CC |
2-Hexene__2-methyl- | C(CCC)=C(C)C |
2-Hexene__2_3-dimethyl- | C(C)(CCC)=C(C)C |
2-Hexene__2_5-dimethyl- | C(C=C(C)C)C(C)C |
2-Hexene__3-methyl-__(E)- | C(C)(=CC)CCC |
2-Hexene__3-methyl-__(Z)- | C(C)(=CC)CCC |
2-Hexene__4-methyl-__(E)- | C(C)(CC)C=CC |
2-Hexene__4-methyl-__(Z)- | C(C)(CC)C=CC |
2-Hexene__4_5-dimethyl- | C(C)(C=CC)C(C)C |
2-Hexene__5-methyl-__(E)- | C(C=CC)C(C)C |
2-Methyl-1-hexene | C(CCC)C(C)=C |
2-Methyl-2-hexene | C(CCC)=C(C)C |
2-Methyl-trans-3-hexene | C(=CCC)C(C)C |
3, 4-Bis(p-hydroxyphenyl)-3-hexene | C(CC)(c1ccc(O)cc1)=C(CC)c2ccc(O)cc2 |
3, 4-Dianisyl-3-hexene | C(CC)(c1ccc(OC)cc1)=C(CC)c2ccc(OC)cc2 |
3,4-Bis(p-dipalmitoyloxyphenyl)-3-hexene | C(CC)(c1ccc(cc1)OC(=O)CCCCCCCCCCCCCCC)=C(CC)c2ccc(cc2)OC(=O)CCCCCCCCCCCCCCC |
3,4-Bis(p-methoxyphenyl)-3-hexene | C(CC)(c1ccc(OC)cc1)=C(CC)c2ccc(OC)cc2 |
3,4-Dimethyl-1-hexene | C(C)(CC)C(C)C=C |
3-Hexene, (E)- | C(CC)=CCC |
3-Hexene, (Z)- | C(CC)=CCC |
3-Hexene, 2, 5-dimethyl-, (E)- | C(=CC(C)C)C(C)C |
3-Hexene, 2,2-dimethyl-, (E)- | C(=CCC)C(C)(C)C |
3-Hexene, 2,2-dimethyl-, (Z)- | C(=CCC)C(C)(C)C |
3-Hexene, 2,3-dimethyl- | C(C)(=CCC)C(C)C |
3-Hexene, 2-methyl-, (E)- | C(=CCC)C(C)C |
3-Hexene, 3, 4-bis(4-methoxyphenyl)- | C(CC)(c1ccc(OC)cc1)=C(CC)c2ccc(OC)cc2 |
3-Hexene, 3,4-bis(p-methoxyphenyl)- | C(CC)(c1ccc(OC)cc1)=C(CC)c2ccc(OC)cc2 |
3-Hexene, 3-methyl-, (E)- | C(C)(CC)=CCC |
3-Hexene, 3-methyl-, (Z)- | C(C)(CC)=CCC |
3-Hexene,3,4-bis(p-hydroxyphenyl)- | C(CC)(c1ccc(O)cc1)=C(CC)c2ccc(O)cc2 |
3-Hexene-2,5-diol | C(=CC(C)O)C(C)O |
3-Hexene-2,5-diol, 2,5-dimethyl- | C(=CC(C)(C)O)C(C)(C)O |
3-Hexene-2,5-dione | C(=CC(C)=O)C(C)=O |
3-Hexene-2_5-diol__2_5-dimethyl- | C(=CC(C)(C)O)C(C)(C)O |
3-Hexene__(Z)- | C(CC)=CCC |
3-Hexene__2-methyl-__(E)- | C(=CCC)C(C)C |
3-Hexene__2_2-dimethyl-__(E)- | C(=CCC)C(C)(C)C |
3-Hexene__2_2-dimethyl-__(Z)- | C(=CCC)C(C)(C)C |
3-Hexene__2_3-dimethyl- | C(C)(=CCC)C(C)C |
3-Hexene__2__5-dimethyl-__(E)- | C(=CC(C)C)C(C)C |
3-Hexene__3-methyl-__(E)- | C(C)(CC)=CCC |
3-Hexene__3-methyl-__(Z)- | C(C)(CC)=CCC |
3-Hydroxy-1-hexene | C(O)(C=C)CCC |
3-Methyl-1-hexene | C(C)(C=C)CCC |
3-Methyl-cis-2-hexene | C(C)(=CC)CCC |
3-Methyl-cis-3-hexene | C(C)(CC)=CCC |
3-Methyl-trans-2-hexene | C(C)(=CC)CCC |
3-Methyl-trans-3-hexene | C(C)(CC)=CCC |
4,4,5-Trimethyl-5-hexene-3-one (2,4-dinitrophenyl)hydrazone | N(N=C(CC)C(C)(C)C(C)=C)c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
4,5-Dimethyl-1-hexene | C(C)(CC=C)C(C)C |
4-Methyl-1-hexene | C(C)(CC)CC=C |
4-Methyl-cis-2-hexene | C(C)(CC)C=CC |
4-Methyl-trans-2-hexene | C(C)(CC)C=CC |
5-Hexene-2-one | C(CC=C)C(C)=O |
5-Methyl-1-hexene | C(CC=C)C(C)C |
5-Methyl-trans-2-hexene | C(C=CC)C(C)C |
Hexene 1,2-oxide | C(CCC)C1CO1 |
Hexene-1 | C(CC)CC=C |
cis-2,2-Dimethyl-3-hexene | C(=CCC)C(C)(C)C |
cis-2-Hexene | C(CC)C=CC |
cis-3-Hexene | C(CC)=CCC |
cis-3-Hexene-1-ol | C(=CCC)CCO |
cis-3-Methyl-2-hexene | C(C)(=CC)CCC |
cis-3-Methyl-3-hexene | C(C)(CC)=CCC |
cis-4-Methyl-2-hexene | C(C)(CC)C=CC |
tert-Hexene | C(C)(C)(C)C=C |
trans-1-Bromo-1-hexene | C(C=CBr)CCC |
trans-2, 5-Dimethyl-3-hexene | C(=CC(C)C)C(C)C |
trans-2,2-Dimethyl-3-hexene | C(=CCC)C(C)(C)C |
trans-2-Hexene | C(CC)C=CC |
trans-2-Methyl-3-hexene | C(=CCC)C(C)C |
trans-3-Hexene | C(CC)=CCC |
trans-4-Methyl-2-hexene | C(C)(CC)C=CC |
trans-5-Methyl-2-hexene | C(C=CC)C(C)C |