If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Phenylacrylic acid | C(=C)(C(=O)O)c1ccccc1 |
3-(o-Nitrophenyl)-2-phenylacrylic acid | C(c1ccccc1[N+](=O)[O-])=C(C(=O)O)c2ccccc2 |
3-Phenylacrylic acid | C(=CC(=O)O)c1ccccc1 |
Phenylacrylic acid | C(=CC(=O)O)c1ccccc1 |
tert-BETA_-Phenylacrylic acid | C(=CC(=O)O)c1ccccc1 |
tert-BETA_-Phenylacrylic_acid | C(=CC(=O)O)c1ccccc1 |
trans-3-Phenylacrylic acid | C(=CC(=O)O)c1ccccc1 |