If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Ziarnik | OC(C)=O.c1ccccc1 |
Zidafimia | C(=O)(NN)c1ccncc1 |
Zidovudine | C1(=O)NC(=O)N(C=C1C)C2OC(CO)C(N=N=N)C2 |
Methyl zimate | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Zimate | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Zimate, ethyl | N(CC)(CC)C1=S[Zn]2(S1)SC(=S2)N(CC)CC |
Zimate, methyl | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Zimco | O(C)c1cc(C=O)ccc1O |
Zimelidine hydrochloride | C(=CCN(C)C)(c1cccnc1)c2ccc(Br)cc2 |
Zimtaldehyde | C(=CC=O)c1ccccc1 |
Zimtsaeure (GERMAN) | C(=CC(=O)O)c1ccccc1 |
Dyna-Zina | C(CCN(C)C)N1c2ccccc2CCc3ccccc13 |
Zinadon | C(=O)(NN)c1ccncc1 |
Zinamide | C(N)(=O)c1cnccn1 |
zinc | A sub-index is available for zinc... |
zincate | A sub-index is available for zincate... |
Bis(N, N-dimetil-ditiocarbammato)di zinco(ITALIAN) | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Bis(N__N-dimetil-ditiocarbammato)di_zinco(ITALIAN) | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Zinco (cloruro di) (ITALIAN) | [Zn](Cl)Cl |
Zincomed | S(=O)(=O)(O)O |
Zincon Dandruff Shampoo | [Zn]123ON4C=CC=CC4=S1.O2N5C=CC=CC5=S3 |
Zincon | C(=NNc1cc(ccc1O)S(=O)(=O)O)(N=Nc2ccccc2C(=O)O)c3ccccc3 |
Methyl zineb (VAN) | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
o-Aminothiofenolat zinecnaty (CZECH) | [Zn]123Nc4ccccc4S1.N2c5ccccc5S3 |
Zineol | CC12CCC(CC2)C(C)(C)O1 |
ZINGERONE | C(CC(C)=O)c1ccc(O)c(OC)c1 |
Zingiberone | C(CC(C)=O)c1ccc(O)c(OC)c1 |
Zink-bis(N, N-dimethyl-dithiocarbamaat)(DUTCH) | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Zink-bis(N, N-dimethyl-dithiocarbamat)(GERMAN) | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Zinkcarbamate | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Zinkchlorid (GERMAN) | [Zn](Cl)Cl |
Zinkchloride (DUTCH) | [Zn](Cl)Cl |
Zinkosite | S(=O)(=O)(O)O |
zinn | A sub-index is available for zinn... |
Triphenyl-zinnacetat (GERMAN) | [Sn](OC(C)=O)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Triphenyl-zinnhydroxid (GERMAN) | [Sn](O)(c1ccccc1)(c2ccccc2)c3ccccc3 |
ZINNIOL | C(O)c1c(CO)cc(OCC=C(C)C)c(C)c1OC |
Zinochlor | N(c1nc(Cl)nc(Cl)n1)c2ccccc2Cl |
Zinoprost | C(N)(CO)(CO)CO.CCCCCC(O)C=CC1C(O)CC(O)C1CC=CCCCC(=O)O |
Zinterol hydrochloride | C(O)(CNC(C)(C)Cc1ccccc1)c2ccc(O)c(c2)NS(C)(=O)=O |
Zipan | CN1C(=O)CN=C(c2ccccc2)c3cc(Cl)ccc13 |
Ethyl Ziram | N(CC)(CC)C1=S[Zn]2(S1)SC(=S2)N(CC)CC |
Methyl Ziram | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Orchard brand Ziram | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Ziram (VAN) | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Zirame | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Zirberk | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
zirconate | A sub-index is available for zirconate... |
Zirconia | [Zr](=O)=O |
Zirconic acid butyl ester | C(CC)CO |
Zirconic anhydride | [Zr](=O)=O |
zirconium | A sub-index is available for zirconium... |
Zirconyl chloride (ZrOCl2) (VAN) | [Zr](Cl)(Cl)=O |
Zirconyl nitrate (Zr(NO3)2) | O([N+](=O)[O-])[Zr](=O)O[N+](=O)[O-] |
Zirconyl nitrate | O([N+](=O)[O-])[Zr](=O)O[N+](=O)[O-] |
Zirconyl sulfate | S(=O)(=O)(O)O |
Ziride | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Zirox Zt 35 | [Zr](=O)=O |
Zirpon | C(C)(CCC)(COC(N)=O)COC(N)=O |
Oil Violet ZIRS | N(c1ccc(C)cc1)c2ccc(O)c3C(=O)c4ccccc4C(=O)c23 |
Zithiol | C(CC(=O)OCC)(SP(=S)(OC)OC)C(=O)OCC |
Zitox | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |