If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Naphthamidine, N,N-diheptyl-4-methoxy-, hydrochloride | C(=N)(N(CCCCCCC)CCCCCCC)c1ccc(OC)c2ccccc12 |
1-Naphthamidine, N,N-diheptyl-4-methoxy-, monohydrochloride | C(=N)(N(CCCCCCC)CCCCCCC)c1ccc(OC)c2ccccc12 |
1-Naphthamidine__N_N-diheptyl-4-methoxy-__monohydrochloride | C(=N)(N(CCCCCCC)CCCCCCC)c1ccc(OC)c2ccccc12 |
Diheptyl disulfide | S(CCCCCCC)SCCCCCCC |
Diheptyl ether | O(CCCCCCC)CCCCCCC |
Diheptyl ketone | C(=O)(CCCCCCC)CCCCCCC |
Disulfide, diheptyl | S(CCCCCCC)SCCCCCCC |
Ether, diheptyl | O(CCCCCCC)CCCCCCC |
N,N-Diheptyl-4-methoxy-1-naphthamidine hydrochloride | C(=N)(N(CCCCCCC)CCCCCCC)c1ccc(OC)c2ccccc12 |