If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Amino-2-deoxy-D-glucosamine | C(O)(C(N)C=O)C(O)C(O)CO |
BETA_-Glucosamine, tetraacetate, hydrochloride | O(C(C)=O)C1C(COC(C)=O)OC(OC(C)=O)C(N)C1OC(C)=O |
D(+)-Glucosamine hydrochloride | C(O)(C(N)C=O)C(O)C(O)CO |
D-Glucosamine hydrochloride | C(O)(C(N)C=O)C(O)C(O)CO |
D-Glucosamine monohydrochloride | C(O)(C(N)C=O)C(O)C(O)CO |
GLUCOSAMINE,(D) | C(O)(C(N)C=O)C(O)C(O)CO |
Glucosamine hydrochloride | C(O)(C(N)C=O)C(O)C(O)CO |
N-Acetyl-D-glucosamine | C(C=O)(NC(C)=O)C(O)C(O)C(O)CO |