If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Methacrylic acid, diester with tetraethylene glycol | O(CCOCCOCCOCCOC(=O)C(C)=C)C(=O)C(C)=C |
Tetraethylene glycol dimethyl ether | O(CCOCCOC)CCOCCOC |
Tetraethylene glycol dodecyl ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
Tetraethylene glycol monododecyl ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
Tetraethylene glycol monolauryl ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
Tetraethylene glycol monomethyl ether | C(COCCOC)OCCOCCO |
Tetraethylene glycol | O(CCOCCO)CCOCCO |
Tetraethylene glycol, dimethacrylate | O(CCOCCOCCOCCOC(=O)C(C)=C)C(=O)C(C)=C |
Tetraethylene_glycol_monomethyl_ether | C(COCCOC)OCCOCCO |
n-Dodecyl tetraethylene glycol ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |