If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Hexyne | C(CC)CC#C |
1-Hexyne, 1-bromo- | C(C#CBr)CCC |
1-Hexyne-3-ol | C(O)(C#C)CCC |
1-Hexyne__1-bromo- | C(C#CBr)CCC |
2,5-Dimethyl-3-hexyne-2,5-diol | C(#CC(C)(C)O)C(C)(C)O |
3-Hexyne-2, 5-diol, 2,5-dimethyl- | C(#CC(C)(C)O)C(C)(C)O |
3-Hexyne-2,5-diol | C(#CC(C)O)C(C)O |
3-Hexyne-2,5-diol, 2,5-diphenyl- | C(C)(O)(C#CC(C)(O)c1ccccc1)c2ccccc2 |
3-Hexyne-2_5-diol__2_5-diphenyl- | C(C)(O)(C#CC(C)(O)c1ccccc1)c2ccccc2 |
3-Hexyne-2__5-diol__2_5-dimethyl- | C(#CC(C)(C)O)C(C)(C)O |
3-Hexyne-3,5-diol | C(#CC(C)O)C(C)O |
3-Hydroxy-1-hexyne | C(O)(C#C)CCC |
6-Diethylamino-1-pyrrolidino-2-hexyne | C(C#CCCCN(CC)CC)N1CCCC1 |
Hexyne-3-diol-2,5 | C(#CC(C)O)C(C)O |
Hexyne-3-diol-2_5 | C(#CC(C)O)C(C)O |