If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
8-Quinolinol, copper (II) chelate | [Cu]123Oc4cccc5cccn1c45.O3c6cccc7cccn2c67 |
Copper(II) N-ethylsalicylaldimine chelate | C(C)N1=Cc2ccccc2O[Cu]13Oc4ccccc4C=N3CC |
Copper(II) N-methylsalicylaldimine chelate | CN1=Cc2ccccc2O[Cu]13Oc4ccccc4C=N3C |
Copper(II) N-n-butylsalicylaldimine chelate | C(CCC)N1=Cc2ccccc2O[Cu]13Oc4ccccc4C=N3CCCC |
Copper(II) N-n-propylsalicylaldimine chelate | C(CC)N1=Cc2ccccc2O[Cu]13Oc4ccccc4C=N3CCC |
Ethylenediaminetetraacetic acid, calcium disodium chelate | O=C1CN23CCN45CC(=O)O[Ca]24(O1)(OC(=O)C3)OC(=O)C5 |
Sequestrene Na Fe iron chelate | O=C1CN23CCN45CC(=O)O[Fe]24(O1)(OC(=O)C3)OC(=O)C5 |
Zinc acetylacetone chelate | CC1=O[Zn]2(O=C(C)C1)O=C(C)CC(C)=O2 |