If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 2-Benzenedicarbothioic acid, cyclic anhydrosulfide | O=C1SC(=O)c2ccccc12 |
1__2-Benzenedicarbothioic_acid__cyclic_anhydrosulfide | O=C1SC(=O)c2ccccc12 |
Benzenesulfonic acid, thio-, anhydrosulfide | S(=O)(=O)(SS(=O)(=O)c1ccccc1)c2ccccc2 |
Benzenesulfonic_acid__thio-__anhydrosulfide | S(=O)(=O)(SS(=O)(=O)c1ccccc1)c2ccccc2 |
Benzenesulfonothioic acid, 4-methyl-, anhydrosulfide | S(=O)(=O)(SS(=O)(=O)c1ccc(C)cc1)c2ccc(C)cc2 |
Benzenesulfonothioic acid, anhydrosulfide | S(=O)(=O)(SS(=O)(=O)c1ccccc1)c2ccccc2 |
Benzenesulfonothioic_acid__4-methyl-__anhydrosulfide | S(=O)(=O)(SS(=O)(=O)c1ccc(C)cc1)c2ccc(C)cc2 |
Carbamic acid, diethyldithio-, anhydrosulfide | N(CC)(CC)C(=S)SC(=S)N(CC)CC |
Carbamic acid, dimethyldithio-, anhydrosulfide | C(=S)(SC(=S)N(C)C)N(C)C |
Carbamodithioic acid, diethyl-, anhydrosulfide | N(CC)(CC)C(=S)SC(=S)N(CC)CC |
Carbamodithioic acid, dimethyl-, anhydrosulfide | C(=S)(SC(=S)N(C)C)N(C)C |
Phosphonotrithioic acid, methyl-, bimol. cyclic anhydrosulfide | CP1(=S)SP(C)(=S)S1 |
Phosphonotrithioic_acid__methyl-__bimol._cyclic_anhydrosulfide | CP1(=S)SP(C)(=S)S1 |
Phthalic acid, 1,2-dithio-, cyclic anhydrosulfide | O=C1SC(=O)c2ccccc12 |
Tetramethyldithiocarbamic acid anhydrosulfide | C(=S)(SC(=S)N(C)C)N(C)C |
Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiocarbonate | C(=O)(OCC)SC(=S)OCC |
Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiolcarbonate | C(=O)(OCC)SC(=S)OCC |
p-Toluenesulfonic acid, thio-, anhydrosulfide | S(=O)(=O)(SS(=O)(=O)c1ccc(C)cc1)c2ccc(C)cc2 |