If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(-)-Thebaine hydrochloride | O(C)C1=CC=C2C3Cc4ccc(OC)c5OC1C2(CCN3C)c45 |
THEBAINE, HYDROCHLORIDE | O(C)C1=CC=C2C3Cc4ccc(OC)c5OC1C2(CCN3C)c45 |
Thebaine hydrochloride | O(C)C1=CC=C2C3Cc4ccc(OC)c5OC1C2(CCN3C)c45 |
Thebaine, demethyldihydro-, acetate (ester) | O(C(C)=O)C1=CCC2C3Cc4ccc(OC)c5OC1C2(CCN3C)c45 |
Thebaine, demethyldihydro-, acetate | O(C(C)=O)C1=CCC2C3Cc4ccc(OC)c5OC1C2(CCN3C)c45 |
Thebaine, hydrochloride | O(C)C1=CC=C2C3Cc4ccc(OC)c5OC1C2(CCN3C)c45 |