If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(+)-Mazethramycin A methyl ether | O(C)C1Nc2c(O)c(C)ccc2C(=O)N3C=C(C=CC(=O)NC)CC13 |
(+)-Mazethramycin_A_methyl_ether | O(C)C1Nc2c(O)c(C)ccc2C(=O)N3C=C(C=CC(=O)NC)CC13 |
(2-Chloro-1-methylethyl) ether | O(C(C)CCl)C(C)CCl |
(2-Methoxyethyl) ether | O(CCOC)CCOC |
(3,4-Methylenedioxy-6-propylbenzyl) (butyl) diethylene glicol ether | C(OCCOCCOCCCC)c1cc2OCOc2cc1CCC |
(Allyldioxy)benzene methylene ether | C(C=C)c1ccc2OCOc2c1 |
.DELTA.13-Dehydroailanthinone methyl ether | CC12C(OC)C(=O)C=C(C)C2CC3OC(=O)C(OC(=O)C(C)CC)C4C(=C)C(O)C5(O)OCC34C15 |
.DELTA.13-Dehydroailanthinone_methyl_ether | CC12C(OC)C(=O)C=C(C)C2CC3OC(=O)C(OC(=O)C(C)CC)C4C(=C)C(O)C5(O)OCC34C15 |
.epsilon.-Caprolactim ether | O(C)C1=NCCCCC1 |
1, 1'-Diphenyldiethyl ether | C(C)(OC(C)c1ccccc1)c2ccccc2 |
1, 4-Butane diglycidyl ether | C(OCCCCOCC1CO1)C2CO2 |
1,1,1',1'-Tetraphenyldimethyl ether | C(OC(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
1,1-Dichloromethyl methyl ether | C(Cl)(Cl)OC |
1,2,3-Propanetriol, ether with 2-methoxyphenol | O(CC(O)CO)c1ccccc1OC |
1,2-Dichloroethyl ethyl ether | C(Cl)(CCl)OCC |
1,2-Ethanediol dimethyl ether | C(OC)COC |
1,2-Propylene glycol 1-monobutyl ether | O(CCCC)CC(C)O |
1,3,4-Eugenol methyl ether | O(C)c1cc(CC=C)ccc1OC |
1,3,4-Isoeugenol methyl ether | O(C)c1cc(C=CC)ccc1OC |
1,3-Butadienyl methyl ether | C(C=C)=COC |
1,3-Glycerine diethyl ether | C(O)(COCC)COCC |
1,4-Butanediol bis(3-aminopropyl)ether | C(COCCCN)CCOCCCN |
1,4-Butanediol diglycidyl ether | C(OCCCCOCC1CO1)C2CO2 |
1,4-Butanediol divinyl ether | C(COC=C)CCOC=C |
1-(p-Methoxy phenyl)-2-methyl-1,3-propanediol methylene ether | CC1COCOC1c2ccc(OC)cc2 |
1-Buten-3-ynyl methyl ether | C(C#C)=COC |
1-Cyclohexen-1-yl ethyl ether | O(CC)C1=CCCCC1 |
1-Cyclohexyl glycerol ether | O(CC(O)CO)C1CCCCC1 |
1-Isoamyl glycerol ether | C(OCCC(C)C)C(O)CO |
1-Naphthyl ether | O(c1cccc2ccccc12)c3cccc4ccccc34 |
1-Phenyl ether-2,3-diacetate glycerol | O(CC(COC(C)=O)OC(C)=O)c1ccccc1 |
1-o-Tolylglycerol ether | O(CC(O)CO)c1ccccc1C |
1-p-nonylphenyl glycerol ether | O(CC(O)CO)c1ccc(CCCCCCCCC)cc1 |
16BETA_-Estradiol-3-methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CC(O)C2 |
16BETA_-Estriol, 3-allyl ether | CC12CCC3c4ccc(OCC=C)cc4CCC3C1CC(O)C2O |
17-Ethynylestradiol 3-methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
17-trifluorovinyl-3-methyl ether of 17-BETA_-estradiol | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C(F)=C(F)F |
17ALPHA_-Ethinyl estradiol 3-methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
17ALPHA_-Ethinyl oestradiol 3-methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
17ALPHA_-Ethinylestradiol 3-methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
17ALPHA_-Ethynylestradiol 3-methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
17ALPHA_-Ethynylestradiol methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
17ALPHA_-Ethynyloestradiol 3-methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
17BETA_-Estradiol 3-methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2O |
17BETA_-Estradiol, 16BETA_-hydroxy-16-methyl-, 3-methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CC(C)(O)C2O |
17BETA_-Estradiol, 17-ethynyl-, 3-(methyl ether) | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
17BETA_-Estradiol, 3-(tetrahydropyran-2-yl ether) | CC12CCC3c4ccc(OC5CCCCO5)cc4CCC3C1CCC2O |
18-Crown-6 ether | C1COCCOCCOCCOCCOCCO1 |
1_2-Propylene_glycol_1-monobutyl_ether | O(CCCC)CC(C)O |
1_2_3-Propanetriol__ether_with_2-methoxyphenol | O(CC(O)CO)c1ccccc1OC |
2, 2'-Dichlorodiethyl ether | O(CCCl)CCCl |
2, 2'-Dichlorodiisopropyl ether | O(C(C)CCl)C(C)CCl |
2, 2'-Dihydroxyisopropyl ether | O(CC(C)O)CC(C)O |
2, 2-Bis(4-hydroxyphenyl)propane diglycidyl ether | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
2, 2-Bis(p-hydroxyphenyl)propane diglycidyl ether | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
2, 2-Bis(p-hydroxyphenyl)propane, diglycidyl ether | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
2, 3-Epoxypropyl butyl ether | C(OCCCC)C1CO1 |
2, 3-Epoxypropyl phenyl ether | O(CC1CO1)c2ccccc2 |
2, 4'-Dinitro-4-(trifluoromethyl)diphenyl ether | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2[N+](=O)[O-])C(F)(F)F |
2, 4-Dinitro-p-trifluoromethyl phenyl ether | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2[N+](=O)[O-])C(F)(F)F |
2, 4-Dinitrophenyl o-tolyl ether | O(c1ccccc1C)c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
2, 4-Dinitrophenylmethyl ether | [N+](=O)([O-])c1cc(ccc1OC)[N+](=O)[O-] |
2,2',4, 4'-Tetranitrodiphenyl ether | O(c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
2,2'-Dibromodiethyl ether | O(CCBr)CCBr |
2,2'-Dichlorethyl ether | O(CCCl)CCCl |
2,2'-Dichloroethyl ether | O(CCCl)CCCl |
2,2'-Dichloroisopropyl ether | O(C(C)CCl)C(C)CCl |
2,2'-Dihydroxydibenzyl ether | C(OCc1ccccc1O)c2ccccc2O |
2,2'-Dihydroxydipropyl ether | O(CC(C)O)CC(C)O |
2,2'-Dihydroxyethyl ether monododecanoate | C(=O)(OCCOCCO)CCCCCCCCCCC |
2,2'-Dimercaptodiethyl ether | O(CCS)CCS |
2,2'-Dimorpholinodiethyl ether | C(COCCN1CCOCC1)N2CCOCC2 |
2,2-Di(hydroxyethyl) ether | O(CCO)CCO |
2,2-Dichloro-1,1-difluoroethyl methyl ether | C(F)(F)(OC)C(Cl)Cl |
2,2-Dichloroisopropyl ether | O(C(C)CCl)C(C)CCl |
2,3-Epithiopropyl methyl ether | C(OC)C1CS1 |
2,3-Epoxypropyl phenyl ether | O(CC1CO1)c2ccccc2 |
2,4, 5-Trichlorophenyl iodopropargyl ether | O(CC#CI)c1cc(Cl)c(Cl)cc1Cl |
2,4,5-Trichlorophenyl GAMMA_-iodopropargil ether | O(CC#CI)c1cc(Cl)c(Cl)cc1Cl |
2,4,5-Trichlorophenyl GAMMA_-iodopropargyl ether | O(CC#CI)c1cc(Cl)c(Cl)cc1Cl |
2,4,6-Tribromophenylallyl ether | O(CC=C)c1c(Br)cc(Br)cc1Br |
2,4-Dinitrophenyl ethyl ether | [N+](=O)([O-])c1cc(ccc1OCC)[N+](=O)[O-] |
2,4-Dinitrophenyl methyl ether | [N+](=O)([O-])c1cc(ccc1OC)[N+](=O)[O-] |
2,4-Dinitrophenyl phenyl ether | O(c1ccccc1)c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
2-(2-(4-Morpholinyl)ethyl) ether-2-thiopseudourea, dihydrochloride | C(CSC(=N)N)N1CCOCC1 |
2-(2-Pyridyl)ethyl methyl ether | C(COC)c1ccccn1 |
2-(2-Pyridyl)ethyl_methyl_ether | C(COC)c1ccccn1 |
2-(Dimethylamino)ethyl vinyl ether | C(COC=C)N(C)C |
2-ALPHA_-Methyldihydrotestosterone pyran-2-yl ether | CC12CC(C)C(=O)CC2CCC3C1CCC4(C)C(CCC34)OC5CCCCO5 |
2-Amino-2'-hydroxydiethyl ether | O(CCN)CCO |
2-Amino-4, 4'-dichlorodiphenyl ether | O(c1ccc(Cl)cc1)c2ccc(Cl)cc2N |
2-Amino-4-chlorodiphenyl ether | O(c1ccccc1)c2ccc(Cl)cc2N |
2-Amino-5-benzoylaminohydroquinone diethyl ether | N(C(=O)c1ccccc1)c2cc(OCC)c(N)cc2OCC |
2-Amino-5-benzoylaminohydroquinone_diethyl_ether | N(C(=O)c1ccccc1)c2cc(OCC)c(N)cc2OCC |
2-Aminodiphenyl ether | O(c1ccccc1)c2ccccc2N |
2-Aminophenyl phenyl ether | O(c1ccccc1)c2ccccc2N |
2-Biphenylyl phenyl ether | O(c1ccccc1)c2ccccc2c3ccccc3 |
2-Bromoethyl ethyl ether | C(CBr)OCC |
2-Bromoethyl methyl ether | C(CBr)OC |
2-Bromoethyl phenyl ether | O(CCBr)c1ccccc1 |
2-Butoxy-2'-thiocyanodiethyl ether | C(COCCCC)OCCSC#N |
2-Butoxyethyl vinyl ether | C(COC=C)OCCCC |
2-Chloro-1,1,2-trifluoroethyl difluoromethyl ether | C(F)(F)(OC(F)F)C(Cl)F |
2-Chloro-2'-(2,4,6-trichlorophenoxy)diethyl ether | O(CCOCCCl)c1c(Cl)cc(Cl)cc1Cl |
2-Chlorodiphenyl ether | O(c1ccccc1)c2ccccc2Cl |
2-Chloroethyl 2-(2,4,6-trichlorophenoxy)ethyl ether | O(CCOCCCl)c1c(Cl)cc(Cl)cc1Cl |
2-Chloroethyl 2-hydroxyethyl ether | O(CCCl)CCO |
2-Chloroethyl ether | O(CCCl)CCCl |
2-Chloroethyl phenyl ether | O(CCCl)c1ccccc1 |
2-Chloroethyl vinyl ether | C(CCl)OC=C |
2-Chloroethyl-2-xenyl ether | O(CCCl)c1ccccc1c2ccccc2 |
2-Chloroethyl_2-hydroxyethyl_ether | O(CCCl)CCO |
2-Chlorophenol ethyl ether | O(CC)c1ccccc1Cl |
2-Chlorophenol methyl ether | O(C)c1ccccc1Cl |
2-Cyanoethyl allyl ether | C(CC#N)OCC=C |
2-Cyanoethyl hexyl ether | C(CCCCC)OCCC#N |
2-Cyanoethyl methyl ether | C(C#N)COC |
2-Cyclopenten-1-yl ether | O(C1CCC=C1)C2CCC=C2 |
2-Dimethylaminoethyl 2-methylbenzhydryl ether hydrochloride | C(OCCN(C)C)(c1ccccc1)c2ccccc2C |
2-Ethylhexyl 3-aminopropyl ether | C(CC)(CCCC)COCCCN |
2-Ethylhexyl glycidyl ether | C(OCC(CC)CCCC)C1CO1 |
2-Ethylhexyl vinyl ether | C(CC)(CCCC)COC=C |
2-Furfuryl methyl ether | C(OC)C1=CC=CO1 |
2-Hydroxyethyl phenyl ether | O(CCO)c1ccccc1 |
2-Mercaptoethyl ether | O(CCS)CCS |
2-Methoxy-6-allylphenol diethylaminoethyl ether hydrochloride | O(CCN(CC)CC)c1c(OC)cccc1CC=C |
2-Methoxydiphenyl ether | O(c1ccccc1)c2ccccc2OC |
2-Methoxyethyl ethenyl ether | C(COC)OC=C |
2-Methoxyethyl phenyl ether | O(CCOC)c1ccccc1 |
2-Methoxyethyl vinyl ether | C(COC)OC=C |
2-Methylallyl phenyl ether | O(CC(C)=C)c1ccccc1 |
2-Methylhydroquinone dimethyl ether | O(C)c1ccc(OC)c(C)c1 |
2-Methylhydroquinone_dimethyl_ether | O(C)c1ccc(OC)c(C)c1 |
2-Methylphenyl phenyl ether | O(c1ccccc1)c2ccccc2C |
2-Naphthol ethyl ether | O(CC)c1ccc2ccccc2c1 |
2-Naphthol methyl ether | O(C)c1ccc2ccccc2c1 |
2-Naphthyl methyl ether | O(C)c1ccc2ccccc2c1 |
2-Nitrodiphenyl ether | O(c1ccccc1)c2ccccc2[N+](=O)[O-] |
2-Nitrophenyl phenyl ether | O(c1ccccc1)c2ccccc2[N+](=O)[O-] |
2-Phenylethyl methyl ether | C(COC)c1ccccc1 |
2-Propynyl 2-pyranyl ether | O(CC#C)C1CCCCO1 |
2_2'_4__4'-Tetranitrodiphenyl_ether | O(c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
2__2'-Dihydroxyisopropyl_ether | O(CC(C)O)CC(C)O |
3,4-Methylenedioxy-6-propylbenzyl N-butyl diethyleneglycol ether | C(OCCOCCOCCCC)c1cc2OCOc2cc1CCC |
3-(Methyldiethoxysilyl)propyl glycidyl ether | [Si](C)(OCC)(OCC)CCCOCC1CO1 |
3-Amino-p-cresol methyl ether | O(C)c1ccc(C)cc1N |
3-Aminodiphenyl ether | O(c1ccccc1)c2cccc(N)c2 |
3-Aminopropyl methyl ether | C(CN)COC |
3-Aminopropyl_methyl_ether | C(CN)COC |
3-Bromopropyl phenyl ether | O(CCCBr)c1ccccc1 |
3-Chloro-4'-nitrodiphenyl ether | O(c1ccc(cc1)[N+](=O)[O-])c2cccc(Cl)c2 |
3-Iodo-2-propynyl 2,4, 5-trichlorophenyl ether | O(CC#CI)c1cc(Cl)c(Cl)cc1Cl |
3-Mercaptobenzoic acid S-methyl ether | C(=O)(O)c1cccc(SC)c1 |
3-Mercaptobenzoic_acid_S-methyl_ether | C(=O)(O)c1cccc(SC)c1 |
3-Nitrodiphenyl ether | O(c1ccccc1)c2cccc(c2)[N+](=O)[O-] |
4, 4'-Bis(chloromethyl)diphenyl ether | O(c1ccc(CCl)cc1)c2ccc(CCl)cc2 |
4, 4'-Diacetamidodiphenyl ether | O(c1ccc(cc1)NC(C)=O)c2ccc(cc2)NC(C)=O |
4, 4'-Dibromodiphenyl ether | O(c1ccc(Br)cc1)c2ccc(Br)cc2 |
4, 4'-Dichloro-2-aminodiphenyl ether | O(c1ccc(Cl)cc1)c2ccc(Cl)cc2N |
4, 4'-Dichloro-2-nitrodiphenyl ether | O(c1ccc(Cl)cc1)c2ccc(Cl)cc2[N+](=O)[O-] |
4, 4'-Dichlorodibutyl ether | O(CCCCCl)CCCCCl |
4, 4'-Dichlorodiphenyl ether | O(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
4, 4'-Dicyanodiphenyl ether | O(c1ccc(C#N)cc1)c2ccc(C#N)cc2 |
4, 4'-Dihydroxydiphenyldimethylmethane diglycidyl ether | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
4, 4'-Isopropylidenediphenol diglycidyl ether | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
4,4'-Chloro-2-aminodiphenyl ether | O(c1ccc(Cl)cc1)c2ccc(Cl)cc2N |
4,4'-Di(chloromethyl)diphenyl ether | O(c1ccc(CCl)cc1)c2ccc(CCl)cc2 |
4,4'-Diacetamido-3,3'-dinitrophenyl ether | [N+](=O)([O-])c1cc(ccc1NC(C)=O)Oc2ccc(NC(C)=O)c(c2)[N+](=O)[O-] |
4,4'-Diamidino diphenyl ether dihydrochloride | O(c1ccc(cc1)C(=N)N)c2ccc(cc2)C(=N)N |
4,4'-Diaminodiphenyl ether | O(c1ccc(N)cc1)c2ccc(N)cc2 |
4,4'-Diaminophenyl ether | O(c1ccc(N)cc1)c2ccc(N)cc2 |
4,4'-Diiododiphenyl ether | O(c1ccc(I)cc1)c2ccc(I)cc2 |
4,4'-Dinitrodiphenyl ether | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2)[N+](=O)[O-] |
4,4-Diaminodiphenyl ether | O(c1ccc(N)cc1)c2ccc(N)cc2 |
4-Amino-4'-chlorodiphenyl ether | O(c1ccc(Cl)cc1)c2ccc(N)cc2 |
4-Aminodiphenyl ether | O(c1ccccc1)c2ccc(N)cc2 |
4-Aminophenyl benzyl ether | O(Cc1ccccc1)c2ccc(N)cc2 |
4-Aminophenyl ether | O(c1ccc(N)cc1)c2ccc(N)cc2 |
4-Aminophenyl phenyl ether | O(c1ccccc1)c2ccc(N)cc2 |
4-Biphenylyl phenyl ether | O(c1ccccc1)c2ccc(cc2)c3ccccc3 |
4-Bromo-ALPHA_-phenylbenzyl 2-(dimethylamino)ethyl ether | C(OCCN(C)C)(c1ccccc1)c2ccc(Br)cc2 |
4-Bromo-ALPHA_-phenylbenzyl 2-dimethylaminoethyl ether | C(OCCN(C)C)(c1ccccc1)c2ccc(Br)cc2 |
4-Bromodiphenyl ether | O(c1ccccc1)c2ccc(Br)cc2 |
4-Bromophenyl phenyl ether | O(c1ccccc1)c2ccc(Br)cc2 |
4-Chloro-2-aminodiphenyl ether | O(c1ccccc1)c2ccc(Cl)cc2N |
4-Chloro-2-nitrophenyl p-chlorophenyl ether | O(c1ccc(Cl)cc1)c2ccc(Cl)cc2[N+](=O)[O-] |
4-Chloro-4'-aminodiphenyl ether | O(c1ccc(Cl)cc1)c2ccc(N)cc2 |
4-Chlorodiphenyl ether | O(c1ccccc1)c2ccc(Cl)cc2 |
4-Chlorophenol ethyl ether | O(CC)c1ccc(Cl)cc1 |
4-Chlorophenol methyl ether | O(C)c1ccc(Cl)cc1 |
4-Chlorophenyl phenyl ether | O(c1ccccc1)c2ccc(Cl)cc2 |
4-Hydroxydiphenyl ether | O(c1ccccc1)c2ccc(O)cc2 |
4-Iododiphenyl ether | O(c1ccc(I)cc1)c2ccc(I)cc2 |
4-Methyldiphenyl ether | O(c1ccccc1)c2ccc(C)cc2 |
4-Methylphenol methyl ether | O(C)c1ccc(C)cc1 |
4-Methylphenyl phenyl ether | O(c1ccccc1)c2ccc(C)cc2 |
4-Methylphenyl trimethylsilyl ether | O(c1ccc(C)cc1)[Si](C)(C)C |
4-Nitrodiphenyl ether | O(c1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
4-Nitroestrone 3-methyl ether | CC12CCC3C(CCc4c3ccc(OC)c4[N+](=O)[O-])C1CCC2=O |
4-Nitrophenyl 4-(trifluoromethyl)-2-nitrophenyl ether | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2[N+](=O)[O-])C(F)(F)F |
4-Nitrophenyl phenyl ether | O(c1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
4-Propenylcatechol methylene ether | C(=CC)c1ccc2OCOc2c1 |
4-Trifluoromethyl-2, 4'-dinitrodiphenyl ether | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2[N+](=O)[O-])C(F)(F)F |
4-Trifluoromethyl-2,4'-dinitrophenyl ether | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2[N+](=O)[O-])C(F)(F)F |
4-tert-Butyldiphenyl ether | O(c1ccccc1)c2ccc(cc2)C(C)(C)C |
4-tert-Butylphenyl methyl ether | C(C)(C)(C)c1ccc(OC)cc1 |
4__4'-Dicyanodiphenyl_ether | O(c1ccc(C#N)cc1)c2ccc(C#N)cc2 |
5-Methylresorcinol dimethyl ether | O(C)c1cc(C)cc(OC)c1 |
5-Methylresorcinol_dimethyl_ether | O(C)c1cc(C)cc(OC)c1 |
5-Nitro-2-furfuryl methyl ether | [N+](=O)([O-])C1=CC=C(COC)O1 |
6-(Propylpiperonyl)butylcarbityl ether | C(OCCOCCOCCCC)c1cc2OCOc2cc1CCC |
6-Chlorohexyl trimethylsilyl ether | O(CCCCCCCl)[Si](C)(C)C |
6-Propylpiperonyl butyl diethylene glycol ether | C(OCCOCCOCCCC)c1cc2OCOc2cc1CCC |
ALPHA_,ALPHA_-Dichlorodimethyl ether | C(Cl)OC |
ALPHA_,ALPHA_-Dichloromethyl methyl ether | C(Cl)(Cl)OC |
ALPHA_-(o-Tolyl)glyceryl ether | O(CC(O)CO)c1ccccc1C |
ALPHA_-Glyceryl guaiacol ether | O(CC(O)CO)c1ccccc1OC |
ALPHA_-Glyceryl guaiacolate ether | O(CC(O)CO)c1ccccc1OC |
ALPHA_-Methyl D-glucose ether | C(O)C1OC(OC)C(O)C(O)C1O |
ALPHA_-Methyl benzyl ether | C(C)(OC(C)c1ccccc1)c2ccccc2 |
ALPHA_-Methylbenzyl ethyl ether | C(C)(OCC)c1ccccc1 |
ALPHA_-Naphthyl methyl ether | O(C)c1cccc2ccccc12 |
ALPHA_-Naphthyl_methyl_ether | O(C)c1cccc2ccccc12 |
ALPHA_-Phenyldiethyl ether | C(C)(OCC)c1ccccc1 |
ALPHA_-Propylene glycol monomethyl ether | C(OC)C(C)O |
ALPHA_-Propylene_glycol_monomethyl_ether | C(OC)C(C)O |
ALPHA__ALPHA_-Dichloromethyl_methyl_ether | C(Cl)(Cl)OC |
ANTHRAMYCIN METHYL ETHER | O(C)C1Nc2c(O)c(C)ccc2C(=O)N3C=C(C=CC(N)=O)CC13 |
Acetate de l'ether monoethylique de l'ethylene-glycol(FRENCH) | C(COCC)OC(C)=O |
Acetate_de_l'ether_monoethylique_de_l'ethylene-glycol(FRENCH) | C(COCC)OC(C)=O |
Acetic ether | O(CC)C(C)=O |
Acetimidoethyl ether hydrochloride | O(CC)C(C)=N |
Adipic acid, bis(ethylene glycol monobutyl ether) ester | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Adipic_acid__bis(ethylene_glycol_monobutyl_ether)_ester | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Aldol ether | C(C)(OC)CC=O |
Allyl 2, 3-epoxypropyl ether | C(OCC=C)C1CO1 |
Allyl 2,4,6-tribromophenyl ether | O(CC=C)c1c(Br)cc(Br)cc1Br |
Allyl 2-cyanoethyl ether | C(CC#N)OCC=C |
Allyl 3-chloro-2-hydroxypropyl ether | C(O)(CCl)COCC=C |
Allyl BETA_-cyanoethyl ether | C(CC#N)OCC=C |
Allyl ether | O(CC=C)CC=C |
Allyl glycidyl ether | C(OCC=C)C1CO1 |
Allyl o-methoxyphenyl ether | O(CC=C)c1ccccc1OC |
Allyl p-chlorophenyl ether | O(CC=C)c1ccc(Cl)cc1 |
Allyl p-nitrophenyl ether | [N+](=O)([O-])c1ccc(OCC=C)cc1 |
Allyl phenyl ether | O(CC=C)c1ccccc1 |
Allyl propyl ether | O(CCC)CC=C |
Allyl vinyl ether | C(C=C)OC=C |
Allyl-1-phenylethyl(2)ether | C(COCC=C)c1ccccc1 |
Allylcatechol methylene ether | C(C=C)c1ccc2OCOc2c1 |
Allylpyrocatechol methylene ether | C(C=C)c1ccc2OCOc2c1 |
Aminohydroquinone dimethyl ether | O(C)c1ccc(OC)c(N)c1 |
Aminohydroquinone_dimethyl_ether | O(C)c1ccc(OC)c(N)c1 |
Amyl ether | O(CCCCC)CCCCC |
Amyl ethyl ether | C(CCC)COCC |
Anaesthetic ether | O(CC)CC |
Anesthesia ether | O(CC)CC |
Anesthetic ether | O(CC)CC |
Ansul Ether 161 | C(OCCOC)COCCOC |
Ansul Ether 181AT | O(CCOCCOC)CCOCCOC |
Anthramycin 11-methyl ether | O(C)C1Nc2c(O)c(C)ccc2C(=O)N3C=C(C=CC(N)=O)CC13 |
Anthramycin methyl ether | O(C)C1Nc2c(O)c(C)ccc2C(=O)N3C=C(C=CC(N)=O)CC13 |
Anthramycin, methyl ether, hydrate | O(C)C1Nc2c(O)c(C)ccc2C(=O)N3C=C(C=CC(N)=O)CC13 |
Anthranol methyl ether | O(C)c1c2ccccc2cc3ccccc13 |
Apigenin 4',7-dimethyl ether | O=C1C=C(Oc2cc(OC)cc(O)c12)c3ccc(OC)cc3 |
Apigenin 4'-dimethyl ether | O=C1C=C(Oc2cc(O)cc(O)c12)c3ccc(OC)cc3 |
Apigenin 4'-methyl ether | O=C1C=C(Oc2cc(O)cc(O)c12)c3ccc(OC)cc3 |
Apigenin 7,4'-dimethyl ether | O=C1C=C(Oc2cc(OC)cc(O)c12)c3ccc(OC)cc3 |
Apisenin 4'-methyl ether | O=C1C=C(Oc2cc(O)cc(O)c12)c3ccc(OC)cc3 |
Asarol methyl ether | O(C)c1cc(OC)c(OC)cc1OC |
BETA_, BETA_'-Dichloroethyl ether | O(CCCl)CCCl |
BETA_, BETA_'-Dicyanodiethyl ether | O(CCC#N)CCC#N |
BETA_,BETA_'-Bis(cyanoethyl) ether | O(CCC#N)CCC#N |
BETA_,BETA_'-Dibromodiethyl ether | O(CCBr)CCBr |
BETA_,BETA_'-Dichlorodiethyl ether | O(CCCl)CCCl |
BETA_,BETA_'-Dichlorodiisopropyl ether | O(C(C)CCl)C(C)CCl |
BETA_,BETA_'-Dihydroxydiethyl ether | O(CCO)CCO |
BETA_,BETA_'-Dimercaptodiethyl ether | O(CCS)CCS |
BETA_,BETA_'-Dimorpholinodiethyl ether | C(COCCN1CCOCC1)N2CCOCC2 |
BETA_,BETA_'-Dithiocyano diethyl ether | O(CCSC#N)CCSC#N |
BETA_,BETA_'-Dithiocyanodiethyl ether | O(CCSC#N)CCSC#N |
BETA_-Butoxy-BETA_'-thiocyanodiethyl ether | C(COCCCC)OCCSC#N |
BETA_-Chloroethyl vinyl ether | C(CCl)OC=C |
BETA_-Chloroethyl_vinyl_ether | C(CCl)OC=C |
BETA_-Diethylaminoethylbenzhydryl ether hydrochloride | C(OCCN(CC)CC)(c1ccccc1)c2ccccc2 |
BETA_-Dimethylaminoethyl benzhydryl ether hydrochloride | C(OCCN(C)C)(c1ccccc1)c2ccccc2 |
BETA_-Hydroxy-BETA_'-aminoethyl ether | O(CCN)CCO |
BETA_-Hydroxyethyl 2,4-dinitrophenyl ether | [N+](=O)([O-])c1cc(ccc1OCCO)[N+](=O)[O-] |
BETA_-Hydroxyethyl BETA_-naphthol ether | O(CCO)c1ccc2ccccc2c1 |
BETA_-Hydroxyethyl ether of o-cresol | O(CCO)c1ccccc1C |
BETA_-Hydroxyethyl ether of o-phenylphenol | O(CCO)c1ccccc1c2ccccc2 |
BETA_-Hydroxyethyl isopropyl ether | O(CCO)C(C)C |
BETA_-Hydroxyethyl p-methylphenyl ether | O(CCO)c1ccc(C)cc1 |
BETA_-Hydroxyethyl p-nitrophenyl ether | [N+](=O)([O-])c1ccc(OCCO)cc1 |
BETA_-Hydroxyethyl phenyl ether | O(CCO)c1ccccc1 |
BETA_-Hydroxyethyl-2-naphthyl ether | O(CCO)c1ccc2ccccc2c1 |
BETA_-Hydroxyethyl_2_4-dinitrophenyl_ether | [N+](=O)([O-])c1cc(ccc1OCCO)[N+](=O)[O-] |
BETA_-Hydroxyethyl_BETA_-naphthol_ether | O(CCO)c1ccc2ccccc2c1 |
BETA_-Hydroxyethyl_ether_of_o-cresol | O(CCO)c1ccccc1C |
BETA_-Hydroxyethyl_ether_of_o-phenylphenol | O(CCO)c1ccccc1c2ccccc2 |
BETA_-Hydroxyethyl_p-methylphenyl_ether | O(CCO)c1ccc(C)cc1 |
BETA_-Hydroxyethyl_p-nitrophenyl_ether | [N+](=O)([O-])c1ccc(OCCO)cc1 |
BETA_-Mercaptoethyl ether | O(CCS)CCS |
BETA_-Methoxy-BETA_'-hydroxydiethyl ether | C(COC)OCCO |
BETA_-Methoxy-BETA_'-hydroxydiethyl_ether | C(COC)OCCO |
BETA_-Naphthol ethyl ether | O(CC)c1ccc2ccccc2c1 |
BETA_-Naphthol methyl ether | O(C)c1ccc2ccccc2c1 |
BETA_-Naphthol_ethyl_ether | O(CC)c1ccc2ccccc2c1 |
BETA_-Naphthol_methyl_ether | O(C)c1ccc2ccccc2c1 |
BETA_-Naphthyl ethyl ether | O(CC)c1ccc2ccccc2c1 |
BETA_-Naphthyl methyl ether | O(C)c1ccc2ccccc2c1 |
BETA_-Phenylethyl methyl ether | C(COC)c1ccccc1 |
BETA_-Phenylethyl_methyl_ether | C(COC)c1ccccc1 |
BETA_-Piperidinoethyl benzhydryl ether hydrochloride | C(OCCN1CCCCC1)(c2ccccc2)c3ccccc3 |
BETA__BETA_'-Bis(cyanoethyl)_ether | O(CCC#N)CCC#N |
BETA__BETA_'-Dibromodiethyl_ether | O(CCBr)CCBr |
BETA__BETA_'-Dichlorodiisopropyl_ether | O(C(C)CCl)C(C)CCl |
BETA__BETA_'-Dihydroxydiethyl_ether | O(CCO)CCO |
BETA__BETA_'-Dimercaptodiethyl_ether | O(CCS)CCS |
BOUVARDIN, METHYL ETHER (B613763K151) | O(C)c1ccc2cc1Oc3ccc(cc3)C(O)C4N(C)C(=O)C(C)NC(=O)C(Cc5ccc(OC)cc5)N(C)C(=O)C(C)NC(=O)C(C)NC(=O)C(C2)N(C)C4=O |
BOUVARDIN__METHYL_ETHER_(B613763K151) | O(C)c1ccc2cc1Oc3ccc(cc3)C(O)C4N(C)C(=O)C(C)NC(=O)C(Cc5ccc(OC)cc5)N(C)C(=O)C(C)NC(=O)C(C)NC(=O)C(C2)N(C)C4=O |
Benzhydrol ether | C(OC(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Benzhydryl 2-(piperidino)ethyl ether hydrochloride | C(OCCN1CCCCC1)(c2ccccc2)c3ccccc3 |
Benzhydryl ether | C(OC(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Benzimido ethyl ether hydrochloride | C(=N)(OCC)c1ccccc1 |
Benzimidoyl ethyl ether hydrochloride | C(=N)(OCC)c1ccccc1 |
Benzohydrol ether | C(OC(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Benzoic ether | C(=O)(OCC)c1ccccc1 |
Benzoin methyl ether | C(OC)(C(=O)c1ccccc1)c2ccccc2 |
Benzyl 2-methoxy-4-propenylphenyl ether | O(Cc1ccccc1)c2ccc(C=CC)cc2OC |
Benzyl alcohol, ether with isoeugenol | O(Cc1ccccc1)c2ccc(C=CC)cc2OC |
Benzyl butyl ether | C(OCCCC)c1ccccc1 |
Benzyl ether | C(OCc1ccccc1)c2ccccc2 |
Benzyl ethyl ether | C(OCC)c1ccccc1 |
Benzyl isoamyl ether | C(OCCC(C)C)c1ccccc1 |
Benzyl isoeugenol ether | O(Cc1ccccc1)c2ccc(C=CC)cc2OC |
Benzyl isopentyl ether | C(OCCC(C)C)c1ccccc1 |
Benzyl methyl ether | C(OC)c1ccccc1 |
Benzyl p-hydroxyphenyl ether | O(Cc1ccccc1)c2ccc(O)cc2 |
Benzyl p-nitrophenyl ether | O(Cc1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
Benzyl phenyl ether | C(Oc1ccccc1)c2ccccc2 |
Benzyl trityl ether | C(OCc1ccccc1)(c2ccccc2)(c3ccccc3)c4ccccc4 |
Bis(1-hexyl)ether | O(CCCCCC)CCCCCC |
Bis(2,3-epoxy-1 propyl) ether | C(OCC1CO1)C2CO2 |
Bis(2,3-epoxy-2-methylpropyl) ether | C(OCC1(C)CO1)C2(C)CO2 |
Bis(2,3-epoxycyclopentyl) ether | O(C1CCC2OC12)C3CCC4OC34 |
Bis(2,3-epoxypropyl) ether | C(OCC1CO1)C2CO2 |
Bis(2,4-dinitrophenyl) ether | O(c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
Bis(2-(2-chloroethoxy)ethyl) ether | O(CCOCCCl)CCOCCCl |
Bis(2-(2-methoxyethoxy)ethyl) ether | O(CCOCCOC)CCOCCOC |
Bis(2-(dimethylamino)ethyl) ether | C(OCCN(C)C)CN(C)C |
Bis(2-(vinyloxy)ethyl) ether | O(CCOC=C)CCOC=C |
Bis(2-bromoethyl) ether | O(CCBr)CCBr |
Bis(2-chloro-1-methylethyl) ether | O(C(C)CCl)C(C)CCl |
Bis(2-chloroethyl) ether | O(CCCl)CCCl |
Bis(2-chloroisopropyl) ether | O(C(C)CCl)C(C)CCl |
Bis(2-chloropropyl)ether | O(CC(C)Cl)CC(C)Cl |
Bis(2-cyanoethyl) ether | O(CCC#N)CCC#N |
Bis(2-dimethylaminoethyl) ether, dimethochloride | C(COCCN(C)(C)C)N(C)(C)C |
Bis(2-hydroxyethyl) ether | O(CCO)CCO |
Bis(2-hydroxypropyl) ether | O(CC(C)O)CC(C)O |
Bis(2-mercaptoethyl) ether | O(CCS)CCS |
Bis(2-methoxyethyl) ether | O(CCOC)CCOC |
Bis(2-methylglycidyl) ether | C(OCC1(C)CO1)C2(C)CO2 |
Bis(2-thiocyanatoethyl) ether | O(CCSC#N)CCSC#N |
Bis(2-thiocyanoethyl) ether | O(CCSC#N)CCSC#N |
Bis(3, 4-dichlorofuranon-5-yl-2) ether | O(C1OC(=O)C(Cl)=C1Cl)C2OC(=O)C(Cl)=C2Cl |
Bis(3,4-dichloro-2(5)-furanonyl) ether | O(C1OC(=O)C(Cl)=C1Cl)C2OC(=O)C(Cl)=C2Cl |
Bis(4-aminophenyl) ether | O(c1ccc(N)cc1)c2ccc(N)cc2 |
Bis(4-bromophenyl) ether | O(c1ccc(Br)cc1)c2ccc(Br)cc2 |
Bis(4-chlorobutyl) ether | O(CCCCCl)CCCCCl |
Bis(4-chlorosulfonylphenyl) ether | S(Cl)(=O)(=O)c1ccc(cc1)Oc2ccc(cc2)S(Cl)(=O)=O |
Bis(4-hydroxyphenyl)dimethylmethane diglycidyl ether | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
Bis(4-nitrophenyl) ether | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2)[N+](=O)[O-] |
Bis(ALPHA_-methylbenzyl) ether | C(C)(OC(C)c1ccccc1)c2ccccc2 |
Bis(ALPHA_-phenylethyl) ether | C(C)(OC(C)c1ccccc1)c2ccccc2 |
Bis(BETA_-chloroethyl) ether | O(CCCl)CCCl |
Bis(BETA_-chloroisopropyl) ether | O(C(C)CCl)C(C)CCl |
Bis(BETA_-hydroxyethyl) ether | O(CCO)CCO |
Bis(BETA_-hydroxyethyl) hydroquinone ether | O(CCO)c1ccc(OCCO)cc1 |
Bis(BETA_-hydroxyethyl)_hydroquinone_ether | O(CCO)c1ccc(OCCO)cc1 |
Bis(benzhydryl) ether | C(OC(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Bis(bromophenyl) ether | O(c1ccc(Br)cc1)c2ccc(Br)cc2 |
Bis(carboxymethyl) ether | O(CC(=O)O)CC(=O)O |
Bis(chloroethyl) ether | O(CCCl)CCCl |
Bis(diethyleneglycol) monoethyl ether phthalate | C(=O)(OCCOCCOCC)c1ccccc1C(=O)OCCOCCOCC |
Bis(dimethylsilyl) ether | O([Si](C)C)[Si](C)C |
Bis(diphenylmethyl) ether | C(OC(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Bis(ethylene glycol monobutyl ether) adipate | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Bis(m-phenoxyphenyl)ether | O(c1cccc(c1)Oc2ccccc2)c3cccc(c3)Oc4ccccc4 |
Bis(morpholinoethyl)ether | C(COCCN1CCOCC1)N2CCOCC2 |
Bis(p-(chloromethyl)phenyl) ether | O(c1ccc(CCl)cc1)c2ccc(CCl)cc2 |
Bis(p-acetylaminophenyl) ether | O(c1ccc(cc1)NC(C)=O)c2ccc(cc2)NC(C)=O |
Bis(p-aminophenyl) ether | O(c1ccc(N)cc1)c2ccc(N)cc2 |
Bis(p-bromophenyl) ether | O(c1ccc(Br)cc1)c2ccc(Br)cc2 |
Bis(p-chlorophenyl) ether | O(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
Bis(p-iodophenyl) ether | O(c1ccc(I)cc1)c2ccc(I)cc2 |
Bis(p-nitrophenyl) ether | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2)[N+](=O)[O-] |
Bis(pentabromophenyl) ether | O(c1c(Br)c(Br)c(Br)c(Br)c1Br)c2c(Br)c(Br)c(Br)c(Br)c2Br |
Bis(trimethylsilyl) ether | O([Si](C)(C)C)[Si](C)(C)C |
Bis(triphenylsilyl)ether | [Si](O[Si](c1ccccc1)(c2ccccc2)c3ccccc3)(c4ccccc4)(c5ccccc5)c6ccccc6 |
Bisphenol A bis(2-hydroxyethyl)ether | C(C)(C)(c1ccc(OCCO)cc1)c2ccc(OCCO)cc2 |
Bisphenol A bis(2-hydroxypropyl) ether | C(C)(C)(c1ccc(cc1)OCC(C)O)c2ccc(cc2)OCC(C)O |
Bisphenol A bis(BETA_-hydroxypropyl) ether | C(C)(C)(c1ccc(cc1)OCC(C)O)c2ccc(cc2)OCC(C)O |
Bisphenol A diallyl ether | C(C)(C)(c1ccc(OCC=C)cc1)c2ccc(OCC=C)cc2 |
Bisphenol A diglycidyl ether | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
Boldine dimethyl ether | O(C)c1c(OC)cc2CCN(C)C3Cc4cc(OC)c(OC)cc4c1c23 |
Bornyl acetic ether | CC12CCC(CC1OC(C)=O)C2(C)C |
Bromic ether | C(Br)C |
Bromomethyl methyl ether | C(Br)OC |
Bromophloroglucinol trimethyl ether | O(C)c1cc(OC)cc(OC)c1Br |
Bromophloroglucinol_trimethyl_ether | O(C)c1cc(OC)cc(OC)c1Br |
Bulbocapnine methyl ether | O(C)c1c(OC)ccc2CC3N(C)CCc4cc5OCOc5c(c12)c34 |
Butanediol diglycidyl ether | C(OCCCCOCC1CO1)C2CO2 |
Butanediol divinyl ether | C(COC=C)CCOC=C |
Butoxyrhodanodiethyl ether | C(COCCCC)OCCSC#N |
Butyl 3-chloro-2-hydroxypropyl ether | C(O)(CCl)COCCCC |
Butyl carbitol 6-propylpiperonyl ether | C(OCCOCCOCCCC)c1cc2OCOc2cc1CCC |
Butyl ether | O(CCCC)CCCC |
Butyl glycidyl ether | C(OCCCC)C1CO1 |
Butyl phenethyl ether | C(COCCCC)c1ccccc1 |
Butyl phenyl ether | O(CCCC)c1ccccc1 |
Butyl trityl ether | C(OCCCC)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Butyl vinyl ether | C(CCC)OC=C |
Butylcarbityl (6-propylpiperonyl) ether | C(OCCOCCOCCCC)c1cc2OCOc2cc1CCC |
Butylene glycol ethyl ether | C(CCO)COCC |
Butylene glycol methyl ether | C(CCO)COC |
Butylene glycol monoethyl ether | C(CCO)COCC |
Butylene glycol monomethyl ether | C(CCO)COC |
Butylene_glycol_monoethyl_ether | C(CCO)COCC |
Butylene_glycol_monomethyl_ether | C(CCO)COC |
Butyric ether | C(=O)(CCC)OCC |
C18:0 Glyceryl 1-ether | C(CCCCCCCCCCCCCCC)CCOCC(O)CO |
CAROTOL ETHER | CC12CCC(C(C)C)C13CCC(C)(CC2)O3 |
Caffeic acid dimethyl ether | O(C)c1cc(C=CC(=O)O)ccc1OC |
Capric ether | O(CCCCCCCCCC)CCCCCCCCCC |
Caprolactim methyl ether | O(C)C1=NCCCCC1 |
Caprolactim-O-methyl ether | O(C)C1=NCCCCC1 |
Caprylic ether | O(CCCCCCCC)CCCCCCCC |
Carotol ether | CC12CCC(C(C)C)C13CCC(C)(CC2)O3 |
Carotol_ether | CC12CCC(C(C)C)C13CCC(C)(CC2)O3 |
Carvacrol methyl ether | O(C)c1cc(ccc1C)C(C)C |
Catechol diallyl ether | O(CC=C)c1ccccc1OCC=C |
Catechol monoethyl ether | O(CC)c1ccccc1O |
Catechol_monoethyl_ether | O(CC)c1ccccc1O |
Cephaeline methyl ether HCl | C(C1NCCc2cc(OC)c(OC)cc12)C3CC4N(CCc5cc(OC)c(OC)cc45)CC3CC |
Cephaeline methyl ether hydrochloride | C(C1NCCc2cc(OC)c(OC)cc12)C3CC4N(CCc5cc(OC)c(OC)cc45)CC3CC |
Cetyl vinyl ether | C(CCCCCCCCC)CCCCCCOC=C |
Chavicol methyl ether | C(C=C)c1ccc(OC)cc1 |
Chlorodimethyl ether | C(Cl)OC |
Chloroethyl ether | O(CCCl)CCCl |
Chlorohydroquinone dimethyl ether | O(C)c1ccc(OC)c(Cl)c1 |
Chlorohydroquinone_dimethyl_ether | O(C)c1ccc(OC)c(Cl)c1 |
Chloromethyl m-nitrobenzyl ether | C(OCCl)c1cccc(c1)[N+](=O)[O-] |
Chloromethyl methyl ether | C(Cl)OC |
Chlorophloroglucinol trimethyl ether | O(C)c1cc(OC)cc(OC)c1Cl |
Chlorophloroglucinol_trimethyl_ether | O(C)c1cc(OC)cc(OC)c1Cl |
Cholesterin ethyl ether | CC12CCC3C(CC=C4CC(OCC)CCC34C)C1CCC2C(C)CCCC(C)C |
Cholesterin methyl ether | CC12CCC3C(CC=C4CC(OC)CCC34C)C1CCC2C(C)CCCC(C)C |
Cholesterol methyl ether | CC12CCC3C(CC=C4CC(OC)CCC34C)C1CCC2C(C)CCCC(C)C |
Cholesteryl ether | CC12CCC(OC3CCC4(C)C(=CCC5C6CCC(C(C)CCCC(C)C)C6(C)CCC45)C3)CC2=CCC7C1CCC8(C)C(CCC78)C(C)CCCC(C)C |
Cholesteryl ethyl ether | CC12CCC3C(CC=C4CC(OCC)CCC34C)C1CCC2C(C)CCCC(C)C |
Cholesteryl methyl ether | CC12CCC3C(CC=C4CC(OC)CCC34C)C1CCC2C(C)CCCC(C)C |
Choline, ethyl ether, hydrochloride | C(COCC)N(C)(C)C |
Cinnamyl phenyl ether | C(=CCOc1ccccc1)c2ccccc2 |
Cinnamyl_phenyl_ether | C(=CCOc1ccccc1)c2ccccc2 |
Colchicinic acid, N-benzoyltrimethyl-, methyl ether | O(C)c1c(OC)c(OC)cc2CCC(NC(=O)c3ccccc3)C4=CC(=O)C(OC)=CC=C4c12 |
Colchinol, N-acetyl-, methyl ether | O(C)c1c(OC)c(OC)cc2CCC(NC(C)=O)c3cc(OC)ccc3c12 |
Cyanidanon 4'-methyl ether 1626 | O=C1CC(Oc2cc(O)cc(O)c12)c3ccc(OC)c(O)c3 |
Cyclohexyl ether | O(C1CCCCC1)C2CCCCC2 |
Cyclotene monomethyl ether | O(C)C1=C(C)CCC1=O |
D-Tubocurarine iodide dimethyl ether | O(C)c1c(OC)cc2CCN(C)(C)C3Cc4ccc(OC)c(c4)Oc5cc6c(CCN(C)(C)C6Cc7ccc(cc7)Oc1c23)cc5OC |
DEOXYBOUVARDIN METHYL ETHER B613763K152 | N(C1CC1)[Pt](Cl)(Cl)NCC |
DIBROMOPHENYL ETHER | O(c1ccc(Br)cc1Br)c2ccc(Br)cc2Br |
DIBROMOPHENYL_ETHER | O(c1ccc(Br)cc1Br)c2ccc(Br)cc2Br |
DIHYDROISOPOMIFERITIN, TRIMETHYL ETHER | C(=O)(Cc1ccc(OC)c(OC)c1)c2c(OC)c3CCC(C)(C)Oc3c4CCC(C)(C)Oc24 |
DIHYDROISOPOMIFERITIN__TRIMETHYL_ETHER | C(=O)(Cc1ccc(OC)c(OC)c1)c2c(OC)c3CCC(C)(C)Oc3c4CCC(C)(C)Oc24 |
Decabromobiphenyl ether | O(c1c(Br)c(Br)c(Br)c(Br)c1Br)c2c(Br)c(Br)c(Br)c(Br)c2Br |
Decabromodiphenyl ether | O(c1c(Br)c(Br)c(Br)c(Br)c1Br)c2c(Br)c(Br)c(Br)c(Br)c2Br |
Decabromophenyl ether | O(c1c(Br)c(Br)c(Br)c(Br)c1Br)c2c(Br)c(Br)c(Br)c(Br)c2Br |
Decyl ether | O(CCCCCCCCCC)CCCCCCCCCC |
Dehydrailanthinone 1-methyl ether | CC12C(OC)C(=O)C=C(C)C2CC3OC(=O)C(OC(=O)C(C)CC)C4C(=C)C(O)C5(O)OCC34C15 |
Di(2, 3-epoxypropyl) ether | C(OCC1CO1)C2CO2 |
Di(2-Methoxyethyl) ether | O(CCOC)CCOC |
Di(2-chloroethyl) ether | O(CCCl)CCCl |
Di(BETA_-chloroethyl) ether | O(CCCl)CCCl |
Di(chlorobutyl)ether | O(CCCCCl)CCCCCl |
Di(ethylene glycol monobutyl ether) phthalate | C(=O)(OCCOCCOCCCC)c1ccccc1C(=O)OCCOCCOCCCC |
Di(ethyleneglycol) ethyl ether phthalate | C(=O)(OCCOCCOCC)c1ccccc1C(=O)OCCOCCOCC |
Di-4-nitrophenyl ether | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2)[N+](=O)[O-] |
Di-n-amyl ether | O(CCCCC)CCCCC |
Di-n-butyl ether | O(CCCC)CCCC |
Di-n-decyl ether | O(CCCCCCCCCC)CCCCCCCCCC |
Di-n-heptyl ether | O(CCCCCCC)CCCCCCC |
Di-n-hexyl ether | O(CCCCCC)CCCCCC |
Di-n-octyl ether | O(CCCCCCCC)CCCCCCCC |
Di-n-pentyl ether | O(CCCCC)CCCCC |
Diacetic ether | C(C(C)=O)C(=O)OCC |
Diallyl ether | O(CC=C)CC=C |
Diaminodiphenyl ether | O(c1ccc(N)cc1)c2ccc(N)cc2 |
Diamyl ether | O(CCCCC)CCCCC |
Dian diglycidyl ether | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
Dibenzhydryl ether | C(OC(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Dibenzo-18-crown-6-ether | c12ccccc1OCCOCCOc3ccccc3OCCOCCO2 |
Dibenzohydryl ether | C(OC(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Dibenzyl ether | C(OCc1ccccc1)c2ccccc2 |
Dibutyl ether | O(CCCC)CCCC |
Dichlorodiethyl ether | O(CCCl)CCCl |
Dichlorodiisopropyl ether | O(C(C)CCl)C(C)CCl |
Dichloroethyl ether | O(CCCl)CCCl |
Dichloroisopropyl ether | O(C(C)CCl)C(C)CCl |
Dichloromethyl methyl ether | C(Cl)(Cl)OC |
Dicyclohexyl ether | O(C1CCCCC1)C2CCCCC2 |
Dicyclohexyl-18-crown-6 ether | C12CCCCC1OCCOCCOC3CCCCC3OCCOCCO2 |
Didecyl ether | O(CCCCCCCCCC)CCCCCCCCCC |
Didodecyl ether | O(CCCCCCCCCCCC)CCCCCCCCCCCC |
Diepoxy propyl ether | C(OCC1CO1)C2CO2 |
Diethyl ether | O(CC)CC |
Diethylaminoethylbenzhydryl ether hydrochloride | C(OCCN(CC)CC)(c1ccccc1)c2ccccc2 |
Diethylene Glycol Monophenyl Ether | O(CCOCCO)c1ccccc1 |
Diethylene ether | C1COCCO1 |
Diethylene glycol bis(2-chloroethyl) ether | O(CCOCCCl)CCOCCCl |
Diethylene glycol bis-glycidyl ether | C(OCCOCCOCC1CO1)C2CO2 |
Diethylene glycol butyl ether acetate | C(OCCOCCCC)COC(C)=O |
Diethylene glycol butyl ether | C(COCCO)OCCCC |
Diethylene glycol diglycidyl ether | C(OCCOCCOCC1CO1)C2CO2 |
Diethylene glycol dimethyl ether | O(CCOC)CCOC |
Diethylene glycol divinyl ether | O(CCOC=C)CCOC=C |
Diethylene glycol ethyl ether acetate | C(OCCOCC)COC(C)=O |
Diethylene glycol ethyl ether | C(COCC)OCCO |
Diethylene glycol hexyl ether | O(CCCCCC)CCOCCO |
Diethylene glycol methyl ether | C(COC)OCCO |
Diethylene glycol mono(n-hexyl) ether | O(CCCCCC)CCOCCO |
Diethylene glycol monobutyl ether acetate | C(OCCOCCCC)COC(C)=O |
Diethylene glycol monobutyl ether | C(COCCO)OCCCC |
Diethylene glycol monoethyl ether acetate | C(OCCOCC)COC(C)=O |
Diethylene glycol monoethyl ether | C(COCC)OCCO |
Diethylene glycol monohexyl ether | O(CCCCCC)CCOCCO |
Diethylene glycol monomethyl ether formal | C(OCCOCCOC)OCCOCCOC |
Diethylene glycol monomethyl ether | C(COC)OCCO |
Diethylene glycol monophenyl ether | O(CCOCCO)c1ccccc1 |
Diethylene glycol monovinyl ether | C(COC=C)OCCO |
Diethylene glycol n-butyl ether | C(COCCO)OCCCC |
Diethylene glycol n-hexyl ether | O(CCCCCC)CCOCCO |
Diethylene glycolphenyl ether | O(CCOCCO)c1ccccc1 |
Diethylene gylcol monobutyl ether | C(COCCO)OCCCC |
Diethylene_glycol_bis(2-chloroethyl)_ether | O(CCOCCCl)CCOCCCl |
Diethylene_glycol_mono(n-hexyl)_ether | O(CCCCCC)CCOCCO |
Diethylene_glycol_monobutyl_ether_acetate | C(OCCOCCCC)COC(C)=O |
Diethylene_glycol_monoethyl_ether_acetate | C(OCCOCC)COC(C)=O |
Diethylene_glycol_monomethyl_ether_formal | C(OCCOCCOC)OCCOCCOC |
Diethylene_glycol_monophenyl_ether | O(CCOCCO)c1ccccc1 |
Diethylstilbestrol dimethyl ether | C(CC)(c1ccc(OC)cc1)=C(CC)c2ccc(OC)cc2 |
Difurfuryl ether | C(OCC1=CC=CO1)C2=CC=CO2 |
Diglycidyl bisphenol A ether | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
Diglycidyl diphenylolpropane ether | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
Diglycidyl ether of 2, 2-bis(4-hydroxyphenyl)propane | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
Diglycidyl ether of 2, 2-bis(p-hydroxyphenyl)propane | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
Diglycidyl ether of 4, 4'-isopropylidenediphenol | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
Diglycidyl ether of bisphenol A | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
Diglycidyl ether of resorcinol | O(CC1CO1)c2cccc(c2)OCC3CO3 |
Diglycidyl ether | C(OCC1CO1)C2CO2 |
Diglycidyl resorcinol ether | O(CC1CO1)c2cccc(c2)OCC3CO3 |
Diglycol monobutyl ether acetate | C(OCCOCCCC)COC(C)=O |
Diglycol monobutyl ether | C(COCCO)OCCCC |
Diglycol monoethyl ether acetate | C(OCCOCC)COC(C)=O |
Diglycol monoethyl ether | C(COCC)OCCO |
Diglycol monomethyl ether | C(COC)OCCO |
Diheptyl ether | O(CCCCCCC)CCCCCCC |
Dihexadecyl ether | O(CCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCC |
Dihexyl ether | O(CCCCCC)CCCCCC |
Dihydromorphine alcoholic ethyl ether | O(CC)C1CCC2C3Cc4ccc(O)c5OC1C2(CCN3C)c45 |
Dihydrotestosterone n-octyl enol ether | CC12CC=C(OCCCCCCCC)CC2CCC3C1CCC4(C)C(O)CCC34 |
Diisoamyl ether | C(OCCC(C)C)CC(C)C |
Diisopentyl ether | C(OCCC(C)C)CC(C)C |
Dilauryl ether | O(CCCCCCCCCCCC)CCCCCCCCCCCC |
Dimercaptodiethyl ether | O(CCS)CCS |
Dimethallyl ether diepoxide | C(OCC1(C)CO1)C2(C)CO2 |
Dimethyl ether hydroquinone | O(C)c1ccc(OC)cc1 |
Dimethyl ether tubocurarine iodide | O(C)c1c(OC)cc2CCN(C)(C)C3Cc4ccc(OC)c(c4)Oc5cc6c(CCN(C)(C)C6Cc7ccc(cc7)Oc1c23)cc5OC |
Dimethylaminoethyl vinyl ether | C(COC=C)N(C)C |
Dimethylhydroquinone ether | O(C)c1ccc(OC)cc1 |
Dimethylolurea dimethyl ether | C(=O)(NCOC)NCOC |
Dimethylsilyl ether | O([Si](C)C)[Si](C)C |
Dimorpholinodiethyl ether | C(COCCN1CCOCC1)N2CCOCC2 |
Dinonafluorobutyl ether | C(F)(F)(C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
Dioctyl ether | O(CCCCCCCC)CCCCCCCC |
Diomethane diglycidyl ether | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
Dioxyethylene ether | C1COCCO1 |
Dipentyl ether | O(CCCCC)CCCCC |
Diperfluorobutyl ether | C(F)(F)(C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
Diphenyl ether 4,4'-disulfohydrazide | S(=O)(=O)(NN)c1ccc(cc1)Oc2ccc(cc2)S(=O)(=O)NN |
Diphenyl ether 4,4'-disulfonyl chloride | S(Cl)(=O)(=O)c1ccc(cc1)Oc2ccc(cc2)S(Cl)(=O)=O |
Diphenyl ether 4-carboxylic acid | O(c1ccccc1)c2ccc(cc2)C(=O)O |
Diphenyl ether | O(c1ccccc1)c2ccccc2 |
Diphenyl ether, 4-bromo- | O(c1ccccc1)c2ccc(Br)cc2 |
Diphenyl_ether_4-carboxylic_acid | O(c1ccccc1)c2ccc(cc2)C(=O)O |
Diphenylmethyl ether | C(OC(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Divinyl ether- maleic anhydride copolymer | O=C1C=CC(=O)O1.C=COC=C |
Divinyl ether- maleic anhydride copolymers | O=C1C=CC(=O)O1.C=COC=C |
Divinyl ether- maleic anhydride cyclic copolymer | O=C1C=CC(=O)O1.C=COC=C |
Divinyl ether- maleic anhydride cyclopolymer | O=C1C=CC(=O)O1.C=COC=C |
Divinyl ether- maleic anhydride polymer | O=C1C=CC(=O)O1.C=COC=C |
Dodecyl ether | O(CCCCCCCCCCCC)CCCCCCCCCCCC |
Dopamine dimethyl ether | O(C)c1cc(CCN)ccc1OC |
Emodin 3-methyl ether | O=C1c2cc(C)cc(O)c2C(=O)c3c(O)cc(OC)cc13 |
Enanthylic ether | C(=O)(OCC)CCCCCC |
Estradiol 3-methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2O |
Estrone 3-methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2=O |
Estrone methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2=O |
Estrone, oxime, 3-(methyl ether) | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2=NO |
Ethanol, 2, 2'-oxybis-, monobutyl ether | C(COCCO)OCCCC |
Ethanol, 2,2'-oxybis-, dimethyl ether | O(CCOC)CCOC |
Ethanol, 2,2'-oxybis-, monoethyl ether | C(COCC)OCCO |
Ethanol, 2,2'-oxybis-, monomethyl ether | C(COC)OCCO |
Ethanol__2_2'-oxybis-__dimethyl_ether | O(CCOC)CCOC |
Ethanol__2_2'-oxybis-__monoethyl_ether | C(COCC)OCCO |
Ethanol__2__2'-oxybis-__monobutyl_ether | C(COCCO)OCCCC |
Ethenyl n-butyl ether | C(CCC)OC=C |
Ether , 1-cyclohexen-1-yl ethyl | O(CC)C1=CCCCC1 |
Ether butylique(FRENCH) | O(CCCC)CCCC |
Ether cyanatus | C(C)C#N |
Ether dichlore(FRENCH) | O(CCCl)CCCl |
Ether ethylique (FRENCH) | O(CC)CC |
Ether methylique monochlore(FRENCH) | C(Cl)OC |
Ether monoethylique de l'ethylene-glycol(FRENCH) | C(CO)OCC |
Ether monomethylique de l'ethylene-glycol(FRENCH) | C(CO)OC |
Ether | O(CC)CC |
Ether, (2-methoxyethyl) vinyl- | C(COC)OC=C |
Ether, 1,2-dichloroethyl ethyl | C(Cl)(CCl)OCC |
Ether, 1,3-butadienyl methyl | C(C=C)=COC |
Ether, 1-buten-3-ynyl methyl | C(C#C)=COC |
Ether, 2, 3-epoxypropyl phenyl | O(CC1CO1)c2ccccc2 |
Ether, 2, 4'-dinitro-4-trifluoromethyldiphenyl | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2[N+](=O)[O-])C(F)(F)F |
Ether, 2, 4-dinitrophenyl 4-methylcyclohexyl | [N+](=O)([O-])c1cc(ccc1OC2CCC(C)CC2)[N+](=O)[O-] |
Ether, 2,2-dichloro-1,1-difluoroethyl methyl | C(F)(F)(OC)C(Cl)Cl |
Ether, 2,3-epithiopropyl methyl | C(OC)C1CS1 |
Ether, 2,4,6-cycloheptatrien-1-yl methyl | O(C)C1C=CC=CC=C1 |
Ether, 2,4-dinitrophenyl 2,4,5-trichlorophenyl | O(c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])c2cc(Cl)c(Cl)cc2Cl |
Ether, 2,4-dinitrophenyl o-tolyl | O(c1ccccc1C)c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
Ether, 2,4-dinitrophenyl phenyl | O(c1ccccc1)c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
Ether, 2-(N,N-dimethylamino)ethyl vinyl | C(COC=C)N(C)C |
Ether, 2-(ethylthio)ethyl vinyl | C(OC=C)CSCC |
Ether, 2-(hydroxyethyl) o-tolyl | O(CCO)c1ccccc1C |
Ether, 2-biphenylyl phenyl | O(c1ccccc1)c2ccccc2c3ccccc3 |
Ether, 2-bromoethyl 2-propynyl | O(CCBr)CC#C |
Ether, 2-bromoethyl ethyl | C(CBr)OCC |
Ether, 2-bromoethyl methyl | C(CBr)OC |
Ether, 2-chloro-1,1,2-trifluoroethyl difluoromethyl | C(F)(F)(OC(F)F)C(Cl)F |
Ether, 2-chloro-1-methylvinylisopropyl, (E)- | C(C)(=CCl)OC(C)C |
Ether, 2-chloroethyl phenyl | O(CCCl)c1ccccc1 |
Ether, 2-chloroethyl vinyl | C(CCl)OC=C |
Ether, 2-cyclohexyl-4,6-dinitrophenyl 2,4-dinitrophenyl | O(c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])c2c(cc(cc2C3CCCCC3)[N+](=O)[O-])[N+](=O)[O-] |
Ether, 2-ethylhexyl vinyl | C(CC)(CCCC)COC=C |
Ether, 2-methylallyl phenyl | O(CC(C)=C)c1ccccc1 |
Ether, 2-nitrophenyl phenyl | O(c1ccccc1)c2ccccc2[N+](=O)[O-] |
Ether, 3-bromopropyl phenyl | O(CCCBr)c1ccccc1 |
Ether, 3-iodo-2-propynyl 2,4,5-trichlorophenyl | O(CC#CI)c1cc(Cl)c(Cl)cc1Cl |
Ether, 3-iodo-2-propypyl 2,3,4,6-tetrachlorophenyl | O(CC#CI)c1c(Cl)cc(Cl)c(Cl)c1Cl |
Ether, 4, 4'-diaminodiphenyl- | O(c1ccc(N)cc1)c2ccc(N)cc2 |
Ether, 4-aminophenyl phenyl | O(c1ccccc1)c2ccc(N)cc2 |
Ether, 4-biphenylyl butyl | O(CCCC)c1ccc(cc1)c2ccccc2 |
Ether, 4-biphenylyl phenyl | O(c1ccccc1)c2ccc(cc2)c3ccccc3 |
Ether, 4-bromophenyl phenyl | O(c1ccccc1)c2ccc(Br)cc2 |
Ether, 4-chloro-2-nitrophenyl p-chlorophenyl | O(c1ccc(Cl)cc1)c2ccc(Cl)cc2[N+](=O)[O-] |
Ether, 4-chlorobutyl methyl | C(CCCl)COC |
Ether, 4-chlorophenyl 4-nitrophenyl | O(c1ccc(Cl)cc1)c2ccc(cc2)[N+](=O)[O-] |
Ether, 4-chlorophenyl(4'-chloro-2'-nitro)phenyl | O(c1ccc(Cl)cc1)c2ccc(Cl)cc2[N+](=O)[O-] |
Ether, 4-nitrophenyl phenyl | O(c1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
Ether, 6-methylheptyl vinyl | C(CCOC=C)CCC(C)C |
Ether, allyl (3-chloro-2-hydroxypropyl) | C(O)(CCl)COCC=C |
Ether, allyl 2,3-epoxypropyl | C(OCC=C)C1CO1 |
Ether, allyl 2,4, 6-tribromophenyl | O(CC=C)c1c(Br)cc(Br)cc1Br |
Ether, allyl glyceryl | C(O)(CO)COCC=C |
Ether, allyl p-bromophenyl | O(CC=C)c1ccc(Br)cc1 |
Ether, allyl p-chlorophenyl | O(CC=C)c1ccc(Cl)cc1 |
Ether, allyl p-nitrophenyl | [N+](=O)([O-])c1ccc(OCC=C)cc1 |
Ether, allyl phenethyl | C(COCC=C)c1ccccc1 |
Ether, allyl phenyl | O(CC=C)c1ccccc1 |
Ether, allyl propyl | O(CCC)CC=C |
Ether, allyl vinyl | C(C=C)OC=C |
Ether, benzyl butyl | C(OCCCC)c1ccccc1 |
Ether, benzyl ethyl | C(OCC)c1ccccc1 |
Ether, benzyl isopentyl | C(OCCC(C)C)c1ccccc1 |
Ether, benzyl methyl | C(OC)c1ccccc1 |
Ether, benzyl p-methoxyphenyl | O(Cc1ccccc1)c2ccc(OC)cc2 |
Ether, benzyl p-nitrophenyl | O(Cc1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
Ether, benzyl p-tolyl | O(Cc1ccccc1)c2ccc(C)cc2 |
Ether, benzyl phenyl | C(Oc1ccccc1)c2ccccc2 |
Ether, benzyl trityl | C(OCc1ccccc1)(c2ccccc2)(c3ccccc3)c4ccccc4 |
Ether, bis(2,3-epoxy-2-methylpropyl) | C(OCC1(C)CO1)C2(C)CO2 |
Ether, bis(2,3-epoxycyclopentyl) | O(C1CCC2OC12)C3CCC4OC34 |
Ether, bis(2,3-epoxypropyl) | C(OCC1CO1)C2CO2 |
Ether, bis(2,4-dinitrophenyl) | O(c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
Ether, bis(2-(2,3-epoxypropoxy)ethyl) | C(OCCOCCOCC1CO1)C2CO2 |
Ether, bis(2-(2-chloroethoxy)ethyl) | O(CCOCCCl)CCOCCCl |
Ether, bis(2-(2-chloroethylmercapto)ethyl) | O(CCSCCCl)CCSCCCl |
Ether, bis(2-(2-methoxyethoxy)ethyl) | O(CCOCCOC)CCOCCOC |
Ether, bis(2-(vinyloxy)ethyl) | O(CCOC=C)CCOC=C |
Ether, bis(2-bromoethyl) | O(CCBr)CCBr |
Ether, bis(2-chloro-1-methylethyl) | O(C(C)CCl)C(C)CCl |
Ether, bis(2-chloroallyl) | O(CC(=C)Cl)CC(=C)Cl |
Ether, bis(2-chloroethyl) | O(CCCl)CCCl |
Ether, bis(2-cyanoethyl) | O(CCC#N)CCC#N |
Ether, bis(2-cyclopentenyl) | O(C1CCC=C1)C2CCC=C2 |
Ether, bis(2-methoxyethyl) | O(CCOC)CCOC |
Ether, bis(2-methylglycidyl) | C(OCC1(C)CO1)C2(C)CO2 |
Ether, bis(2-thiocyanatoethyl) | O(CCSC#N)CCSC#N |
Ether, bis(4-bromophenyl) | O(c1ccc(Br)cc1)c2ccc(Br)cc2 |
Ether, bis(4-chlorobutyl) | O(CCCCCl)CCCCCl |
Ether, bis(4-nitrophenyl) | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2)[N+](=O)[O-] |
Ether, bis(ALPHA_-chloro-p-tolyl) | O(c1ccc(CCl)cc1)c2ccc(CCl)cc2 |
Ether, bis(ALPHA_-methylbenzyl) | C(C)(OC(C)c1ccccc1)c2ccccc2 |
Ether, bis(diphenylmethyl) | C(OC(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Ether, bis(m-phenoxyphenyl) | O(c1cccc(c1)Oc2ccccc2)c3cccc(c3)Oc4ccccc4 |
Ether, bis(nonafluorobutyl) | C(F)(F)(C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
Ether, bis(o-hydroxybenzyl) | C(OCc1ccccc1O)c2ccccc2O |
Ether, bis(p-bromophenyl) | O(c1ccc(Br)cc1)c2ccc(Br)cc2 |
Ether, bis(p-chlorophenyl) | O(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
Ether, bis(p-iodophenyl) | O(c1ccc(I)cc1)c2ccc(I)cc2 |
Ether, bis(p-nitrophenyl) | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2)[N+](=O)[O-] |
Ether, bis(pentabromophenyl) | O(c1c(Br)c(Br)c(Br)c(Br)c1Br)c2c(Br)c(Br)c(Br)c(Br)c2Br |
Ether, bromomethyl methyl | C(Br)OC |
Ether, butyl (3-chloro-2-hydroxypropyl) | C(O)(CCl)COCCCC |
Ether, butyl 2,3-epoxypropyl | C(OCCCC)C1CO1 |
Ether, butyl glycidyl | C(OCCCC)C1CO1 |
Ether, butyl phenyl | O(CCCC)c1ccccc1 |
Ether, butyl trityl | C(OCCCC)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Ether, butyl vinyl | C(CCC)OC=C |
Ether, carvacryl methyl | O(C)c1cc(ccc1C)C(C)C |
Ether, chloromethyl methyl | C(Cl)OC |
Ether, cyclohexyl 2,4-dinitrophenyl | O(C1CCCCC1)c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
Ether, decabromodiphenyl | O(c1c(Br)c(Br)c(Br)c(Br)c1Br)c2c(Br)c(Br)c(Br)c(Br)c2Br |
Ether, di-n-heptyl | O(CCCCCCC)CCCCCCC |
Ether, di-n-octyl- | O(CCCCCCCC)CCCCCCCC |
Ether, di-n-pentyl- | O(CCCCC)CCCCC |
Ether, diallyl | O(CC=C)CC=C |
Ether, dichloromethyl methyl | C(Cl)(Cl)OC |
Ether, diglycidyl | C(OCC1CO1)C2CO2 |
Ether, diheptyl | O(CCCCCCC)CCCCCCC |
Ether, dihexyl | O(CCCCCC)CCCCCC |
Ether, dimethyl chloro | C(Cl)OC |
Ether, diphenyl- | O(c1ccccc1)c2ccccc2 |
Ether, ethyl (DOT) | O(CC)CC |
Ether, ethyl ALPHA_-methylbenzyl | C(C)(OCC)c1ccccc1 |
Ether, ethyl pentyl | C(CCC)COCC |
Ether, ethyl phenyl- | O(CC)c1ccccc1 |
Ether, ethyl propenyl | C(=CC)OCC |
Ether, ethyl trityl | C(OCC)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Ether, ethyl vinyl (inhibited) | O(CC)C=C |
Ether, ethyl vinyl | O(CC)C=C |
Ether, hexadecyl vinyl | C(CCCCCCCCC)CCCCCCOC=C |
Ether, hexyl vinyl | C(CCCC)COC=C |
Ether, isobornyl methyl | CC12CCC(CC2OC)C1(C)C |
Ether, isobutyl phenyl | O(CC(C)C)c1ccccc1 |
Ether, isobutyl vinyl | C(OC=C)C(C)C |
Ether, m-chlorophenyl p-nitrophenyl | O(c1ccc(cc1)[N+](=O)[O-])c2cccc(Cl)c2 |
Ether, m-nitrophenyl phenyl | O(c1ccccc1)c2cccc(c2)[N+](=O)[O-] |
Ether, methyl 2,4, 6-trinitrophenyl | O(C)c1c(cc(cc1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
Ether, methyl phenethyl | C(COC)c1ccccc1 |
Ether, methyl phenyl- | O(C)c1ccccc1 |
Ether, methyl picryl | O(C)c1c(cc(cc1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
Ether, methyl trityl | C(OC)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Ether, methyl vinyl, polymers | C(=C)OC |
Ether, o-chlorophenyl phenyl | O(c1ccccc1)c2ccccc2Cl |
Ether, o-cumenyl 2,4-dinitrophenyl | [N+](=O)([O-])c1cc(ccc1Oc2ccccc2C(C)C)[N+](=O)[O-] |
Ether, o-nitrophenyl phenyl | O(c1ccccc1)c2ccccc2[N+](=O)[O-] |
Ether, octadecyl vinyl | C(CCCCCCCCCC)CCCCCCCOC=C |
Ether, p-bromophenyl phenyl | O(c1ccccc1)c2ccc(Br)cc2 |
Ether, p-chloro-ALPHA_-phenylbenzyl methyl | C(OC)(c1ccccc1)c2ccc(Cl)cc2 |
Ether, p-chlorophenyl p-nitrophenyl | O(c1ccc(Cl)cc1)c2ccc(cc2)[N+](=O)[O-] |
Ether, p-chlorophenyl phenyl | O(c1ccccc1)c2ccc(Cl)cc2 |
Ether, p-nitrophenyl phenyl | O(c1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
Ether, phenyl o-tolyl | O(c1ccccc1)c2ccccc2C |
Ether, phenyl p-tolyl | O(c1ccccc1)c2ccc(C)cc2 |
Ether, phenylglycidyl | O(CC1CO1)c2ccccc2 |
Ether, tert-butyl ethyl | O(CC)C(C)(C)C |
Ether, tert-butyl phenyl | O(c1ccccc1)C(C)(C)C |
Ether, vinyl ethyl | O(CC)C=C |
Ether__1-buten-3-ynyl_methyl | C(C#C)=COC |
Ether__1_3-butadienyl_methyl | C(C=C)=COC |
Ether__2-(ethylthio)ethyl_vinyl | C(OC=C)CSCC |
Ether__2-biphenylyl_phenyl | O(c1ccccc1)c2ccccc2c3ccccc3 |
Ether__2-bromoethyl_2-propynyl | O(CCBr)CC#C |
Ether__2-chloro-1-methylvinylisopropyl__(E)- | C(C)(=CCl)OC(C)C |
Ether__2-cyclohexyl-4_6-dinitrophenyl_2_4-dinitrophenyl | O(c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])c2c(cc(cc2C3CCCCC3)[N+](=O)[O-])[N+](=O)[O-] |
Ether__2_3-epithiopropyl_methyl | C(OC)C1CS1 |
Ether__2_4-dinitrophenyl_2_4_5-trichlorophenyl | O(c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])c2cc(Cl)c(Cl)cc2Cl |
Ether__2_4_6-cycloheptatrien-1-yl_methyl | O(C)C1C=CC=CC=C1 |
Ether__3-iodo-2-propypyl_2_3_4_6-tetrachlorophenyl | O(CC#CI)c1c(Cl)cc(Cl)c(Cl)c1Cl |
Ether__4-aminophenyl_phenyl | O(c1ccccc1)c2ccc(N)cc2 |
Ether__4-biphenylyl_butyl | O(CCCC)c1ccc(cc1)c2ccccc2 |
Ether__4-biphenylyl_phenyl | O(c1ccccc1)c2ccc(cc2)c3ccccc3 |
Ether__4-chlorophenyl(4'-chloro-2'-nitro)phenyl | O(c1ccc(Cl)cc1)c2ccc(Cl)cc2[N+](=O)[O-] |
Ether__4__4'-diaminodiphenyl- | O(c1ccc(N)cc1)c2ccc(N)cc2 |
Ether__6-methylheptyl_vinyl | C(CCOC=C)CCC(C)C |
Ether___1-cyclohexen-1-yl_ethyl | O(CC)C1=CCCCC1 |
Ether__allyl_(3-chloro-2-hydroxypropyl) | C(O)(CCl)COCC=C |
Ether__allyl_p-bromophenyl | O(CC=C)c1ccc(Br)cc1 |
Ether__bis(2-(2-methoxyethoxy)ethyl) | O(CCOCCOC)CCOCCOC |
Ether__bis(2-cyclopentenyl) | O(C1CCC=C1)C2CCC=C2 |
Ether__bromomethyl_methyl | C(Br)OC |
Ether__butyl_(3-chloro-2-hydroxypropyl) | C(O)(CCl)COCCCC |
Ether__cyclohexyl_2_4-dinitrophenyl | O(C1CCCCC1)c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
Ether__ethyl_ALPHA_-methylbenzyl | C(C)(OCC)c1ccccc1 |
Ether__ethyl_pentyl | C(CCC)COCC |
Ether__ethyl_phenyl- | O(CC)c1ccccc1 |
Ether__ethyl_vinyl_(inhibited) | O(CC)C=C |
Ether__methyl_phenyl- | O(C)c1ccccc1 |
Ether__p-chloro-ALPHA_-phenylbenzyl_methyl | C(OC)(c1ccccc1)c2ccc(Cl)cc2 |
Ether_butylique(FRENCH) | O(CCCC)CCCC |
Ether_monoethylique_de_l'ethylene-glycol(FRENCH) | C(CO)OCC |
Ether_monomethylique_de_l'ethylene-glycol(FRENCH) | C(CO)OC |
Ethinylestradiol 3-methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
Ethinyloestradiol 3-methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
Ethoxymethyl ethyl ether | C(OCC)OCC |
Ethyl 1-cyclohexen-1-yl ether | O(CC)C1=CCCCC1 |
Ethyl 1-naphthyl ether | O(CC)c1cccc2ccccc12 |
Ethyl 1-propenyl ether | C(=CC)OCC |
Ethyl 2,4-dichlorophenyl ether | O(CC)c1ccc(Cl)cc1Cl |
Ethyl 2-naphthyl ether | O(CC)c1ccc2ccccc2c1 |
Ethyl ALPHA_-naphthyl ether | O(CC)c1cccc2ccccc12 |
Ethyl BETA_-naphthyl ether | O(CC)c1ccc2ccccc2c1 |
Ethyl amyl ether | C(CCC)COCC |
Ethyl benzyl ether | C(OCC)c1ccccc1 |
Ethyl ethenyl ether | O(CC)C=C |
Ethyl ether dimercaptan | O(CCS)CCS |
Ethyl ether | O(CC)CC |
Ethyl ether, tech. | O(CC)CC |
Ethyl glycidyl ether | C(OCC)C1CO1 |
Ethyl m-tolyl ether | O(CC)c1cccc(C)c1 |
Ethyl o-nitrophenyl ether | [N+](=O)([O-])c1ccccc1OCC |
Ethyl p-nitrophenyl ether | [N+](=O)([O-])c1ccc(OCC)cc1 |
Ethyl p-tolyl ether | O(CC)c1ccc(C)cc1 |
Ethyl pentyl ether | C(CCC)COCC |
Ethyl phenethyl ether | C(COCC)c1ccccc1 |
Ethyl phenyl ether | O(CC)c1ccccc1 |
Ethyl propenyl ether | C(=CC)OCC |
Ethyl propyl thio ether | C(CC)SCC |
Ethyl tert-butyl ether | O(CC)C(C)(C)C |
Ethyl trimethylsilyl ether | O(CC)[Si](C)(C)C |
Ethyl triphenylsilyl ether | [Si](OCC)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Ethyl trityl ether | C(OCC)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Ethyl vinyl ether | O(CC)C=C |
Ethyl_1-propenyl_ether | C(=CC)OCC |
Ethyl_ALPHA_-naphthyl_ether | O(CC)c1cccc2ccccc12 |
Ethyl_propyl_thio_ether | C(CC)SCC |
Ethyl_trimethylsilyl_ether | O(CC)[Si](C)(C)C |
Ethyl_triphenylsilyl_ether | [Si](OCC)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Ethylene diglycidyl ether | C(OCCOCC1CO1)C2CO2 |
Ethylene diglycol monoethyl ether | C(COCC)OCCO |
Ethylene diglycol monomethyl ether | C(COC)OCCO |
Ethylene dimethyl ether | C(OC)COC |
Ethylene glycol bis(2,3-epoxy-2-methylpropyl) ether | C(OCCOCC1(C)CO1)C2(C)CO2 |
Ethylene glycol bis(2,3-epoxypropyl) ether | C(OCCOCC1CO1)C2CO2 |
Ethylene glycol bis(2-cyanoethyl) ether | C(OCCC#N)COCCC#N |
Ethylene glycol bis(chloromethyl) ether | C(OCCl)COCCl |
Ethylene glycol bis(cyanoethyl) ether | C(OCCC#N)COCCC#N |
Ethylene glycol bis(glycidyl ether) | C(OCCOCC1CO1)C2CO2 |
Ethylene glycol butyl ether | C(CCC)OCCO |
Ethylene glycol di(2, 3-epoxy-2-methylpropyl) ether | C(OCCOCC1(C)CO1)C2(C)CO2 |
Ethylene glycol di-BETA_-cyanoethyl ether | C(OCCC#N)COCCC#N |
Ethylene glycol diglycidyl ether | C(OCCOCC1CO1)C2CO2 |
Ethylene glycol dihydroxydiethyl ether | C(OCCO)COCCO |
Ethylene glycol dimethyl ether | C(OC)COC |
Ethylene glycol diphenyl ether | O(CCOc1ccccc1)c2ccccc2 |
Ethylene glycol divinyl ether | C(OC=C)COC=C |
Ethylene glycol ether of pinene | CC1(C)C2CC(O)C(C)(O)C1C2 |
Ethylene glycol ethyl ether acetate | C(COCC)OC(C)=O |
Ethylene glycol ethyl ether | C(CO)OCC |
Ethylene glycol isopropyl ether | O(CCO)C(C)C |
Ethylene glycol m-cresyl ether | O(CCO)c1cccc(C)c1 |
Ethylene glycol methyl ether | C(CO)OC |
Ethylene glycol mono-2-naphthyl ether | O(CCO)c1ccc2ccccc2c1 |
Ethylene glycol mono-p-tolyl ether | O(CCO)c1ccc(C)cc1 |
Ethylene glycol monoallyl ether | O(CC=C)CCO |
Ethylene glycol monobenzyl ether | C(OCCO)c1ccccc1 |
Ethylene glycol monobutyl ether laurate | C(CCCCCCCCCC)C(=O)OCCOCCCC |
Ethylene glycol monobutyl ether | C(CCC)OCCO |
Ethylene glycol monoethyl ether acetate | C(COCC)OC(C)=O |
Ethylene glycol monoethyl ether acrylate | C(=O)(C=C)OCCOCC |
Ethylene glycol monoethyl ether propenoate | C(=O)(C=C)OCCOCC |
Ethylene glycol monoethyl ether | C(CO)OCC |
Ethylene glycol monoisopropyl ether | O(CCO)C(C)C |
Ethylene glycol monomethyl ether acetylricinoleate | C(CCCCCC)(CC=CCCCCCCCC(=O)OCCOC)OC(C)=O |
Ethylene glycol monomethyl ether acrylate | C(=O)(C=C)OCCOC |
Ethylene glycol monomethyl ether formal | C(OCCOC)OCCOC |
Ethylene glycol monomethyl ether oleate | C(CCCCCC=CCCCCCCCC)CC(=O)OCCOC |
Ethylene glycol monomethyl ether | C(CO)OC |
Ethylene glycol monophenyl ether | O(CCO)c1ccccc1 |
Ethylene glycol n-butyl ether | C(CCC)OCCO |
Ethylene glycol phenyl ether acetate | O(CCOC(C)=O)c1ccccc1 |
Ethylene glycol phenyl ether | O(CCO)c1ccccc1 |
Ethylene glycolide, (2, 3-epoxy-2-methylpropyl) ether | C(OCCOCC1(C)CO1)C2(C)CO2 |
Ethylene_glycol_bis(chloromethyl)_ether | C(OCCl)COCCl |
Ethylene_glycol_m-cresyl_ether | O(CCO)c1cccc(C)c1 |
Ethylene_glycol_monoallyl_ether | O(CC=C)CCO |
Ethylene_glycol_monobenzyl_ether | C(OCCO)c1ccccc1 |
Ethylene_glycol_monobutyl_ether_laurate | C(CCCCCCCCCC)C(=O)OCCOCCCC |
Ethylene_glycol_monoethyl_ether_propenoate | C(=O)(C=C)OCCOCC |
Ethylene_glycol_monomethyl_ether_acrylate | C(=O)(C=C)OCCOC |
Ethylene_glycol_monomethyl_ether_formal | C(OCCOC)OCCOC |
Ethylene_glycol_monophenyl_ether | O(CCO)c1ccccc1 |
Ethylene_glycol_phenyl_ether_acetate | O(CCOC(C)=O)c1ccccc1 |
Ethyleneglycol monophenyl ether propionate | O(CCOC(=O)CC)c1ccccc1 |
Ethyleneglycol_monophenyl_ether_propionate | O(CCOC(=O)CC)c1ccccc1 |
Ethylidene diethyl ether | C(C)(OCC)OCC |
Ethynylestradiol 3-methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
Ethynylestradiol methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
Ethynyloestradiol 3-methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2(O)C#C |
Eugenol benzyl ether | O(Cc1ccccc1)c2ccc(CC=C)cc2OC |
Eugenol methyl ether | O(C)c1cc(CC=C)ccc1OC |
Eugenyl methyl ether | O(C)c1cc(CC=C)ccc1OC |
Fluoren-2-yl methyl ether | O(C)c1ccc2c(c1)Cc3ccccc23 |
Fluoren-2-yl_methyl_ether | O(C)c1ccc2c(c1)Cc3ccccc23 |
Furfuryl ether | C(OCC1=CC=CO1)C2=CC=CO2 |
Furfuryl methyl ether | C(OC)C1=CC=CO1 |
GAMMA_-Morpholinopropyl 4-N-butoxyphenyl ether hydrochloride | O(CCCN1CCOCC1)c2ccc(OCCCC)cc2 |
GAMMA_-Morpholinopropyl_4-N-butoxyphenyl_ether_hydrochloride | O(CCCN1CCOCC1)c2ccc(OCCCC)cc2 |
Gallaldehyde 3,5-dimethyl ether | O(C)c1cc(C=O)cc(OC)c1O |
Gallic acid trimethyl ether | O(C)c1c(OC)cc(cc1OC)C(=O)O |
Genistein 4-methyl ether | O=C1C(=COc2cc(O)cc(O)c12)c3ccc(OC)cc3 |
Genkwanin 4'-methyl ether | O=C1C=C(Oc2cc(OC)cc(O)c12)c3ccc(OC)cc3 |
Glycerin 1-tetradecyl ether | C(CCCCCCCCCCCC)COCC(O)CO |
Glycerin monoguaiacol ether | O(CC(O)CO)c1ccccc1OC |
Glycerin-ALPHA_-monomethyl ether | C(O)(CO)COC |
Glycerin-ALPHA_-monomethyl_ether | C(O)(CO)COC |
Glycerinisopropylidene ether | C(O)C1COC(C)(C)O1 |
Glycerol 1, 3-bis(ethyl ether) | C(O)(COCC)COCC |
Glycerol 1,3-diethyl ether | C(O)(COCC)COCC |
Glycerol 1,3-dimethyl ether | C(O)(COC)COC |
Glycerol 1,3-diphenyl ether | O(CC(O)COc1ccccc1)c2ccccc2 |
Glycerol 1-dodecylthio ether | C(CCCCCCCCCCC)SCC(O)CO |
Glycerol 1-ethyl ether | C(O)(CO)COCC |
Glycerol 1-monomethyl ether | C(O)(CO)COC |
Glycerol 1-octadecyl ether | C(CCCCCCCCCCCCCCC)CCOCC(O)CO |
Glycerol ALPHA_,GAMMA_-diethyl ether | C(O)(COCC)COCC |
Glycerol ALPHA_,GAMMA_-diisopropyl ether | C(O)(COC(C)C)COC(C)C |
Glycerol ALPHA_-(2-methoxyphenyl) ether | O(CC(O)CO)c1ccccc1OC |
Glycerol ALPHA_-(o-methoxyphenyl)ether | O(CC(O)CO)c1ccccc1OC |
Glycerol ALPHA_-allyl ether | C(O)(CO)COCC=C |
Glycerol ALPHA_-ethyl ether | C(O)(CO)COCC |
Glycerol ALPHA_-guaiacyl ether | O(CC(O)CO)c1ccccc1OC |
Glycerol ALPHA_-guiacyl ether | O(CC(O)CO)c1ccccc1OC |
Glycerol ALPHA_-isopropyl ether | C(O)(CO)COC(C)C |
Glycerol ALPHA_-monoallyl ether | C(O)(CO)COCC=C |
Glycerol ALPHA_-monoethyl ether | C(O)(CO)COCC |
Glycerol ALPHA_-monoguaiacol ether | O(CC(O)CO)c1ccccc1OC |
Glycerol ALPHA_-monophenyl ether | O(CC(O)CO)c1ccccc1 |
Glycerol ALPHA_-p-chlorophenyl ether | O(CC(O)CO)c1ccc(Cl)cc1 |
Glycerol ALPHA_-phenyl ether | O(CC(O)CO)c1ccccc1 |
Glycerol mono(2-methoxyphenyl) ether | O(CC(O)CO)c1ccccc1OC |
Glycerol monooctadecyl ether | C(CCCCCCCCCCCCCCC)CCOCC(O)CO |
Glycerol_1_3-dimethyl_ether | C(O)(COC)COC |
Glycerol_ALPHA_-monoethyl_ether | C(O)(CO)COCC |
Glycerol_ALPHA_-monophenyl_ether | O(CC(O)CO)c1ccccc1 |
Glycerol_ALPHA__GAMMA_-diethyl_ether | C(O)(COCC)COCC |
Glycerol_ALPHA__GAMMA_-diisopropyl_ether | C(O)(COC(C)C)COC(C)C |
Glyceryl ALPHA_,GAMMA_-diphenyl ether | O(CC(O)COc1ccccc1)c2ccccc2 |
Glyceryl guaiacol ether | O(CC(O)CO)c1ccccc1OC |
Glyceryl guaiacolate ether | O(CC(O)CO)c1ccccc1OC |
Glyceryl guaiacyl ether | O(CC(O)CO)c1ccccc1OC |
Glyceryl o-tolyl ether | O(CC(O)CO)c1ccccc1C |
Glyceryl-1-octadecyl ether | C(CCCCCCCCCCCCCCC)CCOCC(O)CO |
Glycidol methyl ether | C(OC)C1CO1 |
Glycidol phenyl ether | O(CC1CO1)c2ccccc2 |
Glycidyl 2-ethylhexyl ether | C(OCC(CC)CCCC)C1CO1 |
Glycidyl 2-methylphenyl ether | O(CC1CO1)c2ccccc2C |
Glycidyl 3-(trimethoxysilyl)propyl ether | [Si](OC)(OC)(OC)CCCOCC1CO1 |
Glycidyl 4-nitrophenyl ether | [N+](=O)([O-])c1ccc(cc1)OCC2CO2 |
Glycidyl allyl ether | C(OCC=C)C1CO1 |
Glycidyl butyl ether | C(OCCCC)C1CO1 |
Glycidyl ether | C(OCC1CO1)C2CO2 |
Glycidyl isopropyl ether | C(OC(C)C)C1CO1 |
Glycidyl methyl ether | C(OC)C1CO1 |
Glycidyl o-tolyl ether | O(CC1CO1)c2ccccc2C |
Glycidyl phenyl ether | O(CC1CO1)c2ccccc2 |
Glycidyl propyl ether | C(OCCC)C1CO1 |
Glycidylnitrophenyl ether | [N+](=O)([O-])c1ccc(cc1)OCC2CO2 |
Glycol benzyl ether | C(OCCO)c1ccccc1 |
Glycol bis(hydroxyethyl) ether | C(OCCO)COCCO |
Glycol butyl ether | C(CCC)OCCO |
Glycol diglycidyl ether | C(OCCOCC1CO1)C2CO2 |
Glycol dimethyl ether | C(OC)COC |
Glycol ether | O(CCO)CCO |
Glycol ethyl ether | C(CO)OCC |
Glycol ethylene ether | C1COCCO1 |
Glycol monobenzyl ether | C(OCCO)c1ccccc1 |
Glycol monobutyl ether | C(CCC)OCCO |
Glycol monoethyl ether acetate | C(COCC)OC(C)=O |
Glycol monoethyl ether | C(CO)OCC |
Glycol monomethyl ether acetylricinoleate | C(CCCCCC)(CC=CCCCCCCCC(=O)OCCOC)OC(C)=O |
Glycol monomethyl ether acrylate | C(=O)(C=C)OCCOC |
Glycol monomethyl ether | C(CO)OC |
Glycol monophenyl ether | O(CCO)c1ccccc1 |
Glycolic acid, phenyl ether | O(CC(=O)O)c1ccccc1 |
Glycolic_acid__phenyl_ether | O(CC(=O)O)c1ccccc1 |
Glycolmethyl ether | C(CO)OC |
Govanine methyl ether | O(C)c1cc2c(CCN3Cc4cc(OC)c(OC)cc4CC23)cc1OC |
Guaiacol allyl ether | O(CC=C)c1ccccc1OC |
Guaiacol ethylene ether | O(CCOc1ccccc1OC)c2ccccc2OC |
Guaiacol glycerin ether | O(CC(O)CO)c1ccccc1OC |
Guaiacol glycerol ether | O(CC(O)CO)c1ccccc1OC |
Guaiacol glyceryl ether carbamate | O(CC(O)COC(N)=O)c1ccccc1OC |
Guaiacol glyceryl ether | O(CC(O)CO)c1ccccc1OC |
Guaiacyl glyceryl ether | O(CC(O)CO)c1ccccc1OC |
Guaicol glycerine ether | O(CC(O)CO)c1ccccc1OC |
Guaicol glyceryl ether | O(CC(O)CO)c1ccccc1OC |
Guajacol-ALPHA_-glycerin-ether | O(CC(O)CO)c1ccccc1OC |
HONOKIOL DIMETHYL ETHER | O(C)c1ccc(CC=C)cc1c2ccc(OC)c(CC=C)c2 |
HONOKIOL MONO-METHYL ETHER | Oc1ccc(CC=C)cc1c2ccc(OC)c(CC=C)c2 |
HONOKIOL_MONO-METHYL_ETHER | Oc1ccc(CC=C)cc1c2ccc(OC)c(CC=C)c2 |
Heptyl ether | O(CCCCCCC)CCCCCCC |
Hexadecyl ether | O(CCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCC |
Hexestrol dimethyl ether | C(CC)(c1ccc(OC)cc1)C(CC)c2ccc(OC)cc2 |
Hexestrol, dimethyl ether | C(CC)(c1ccc(OC)cc1)C(CC)c2ccc(OC)cc2 |
Hexestrol, methyl ether | C(CC)(c1ccc(OC)cc1)C(CC)c2ccc(O)cc2 |
Hexestrol, monomethyl ether | C(CC)(c1ccc(OC)cc1)C(CC)c2ccc(O)cc2 |
Hexyl ether | O(CCCCCC)CCCCCC |
Honokiol dimethyl ether | O(C)c1ccc(CC=C)cc1c2ccc(OC)c(CC=C)c2 |
Honokiol_dimethyl_ether | O(C)c1ccc(CC=C)cc1c2ccc(OC)c(CC=C)c2 |
Hydriodic ether | C(C)I |
Hydriodic_ether | C(C)I |
Hydrobromic ether | C(Br)C |
Hydrocyanic ether | C(C)C#N |
Hydrocyanic_ether | C(C)C#N |
Hydroquinone 1,4-diglycidyl ether | O(CC1CO1)c2ccc(cc2)OCC3CO3 |
Hydroquinone benzyl ether | O(Cc1ccccc1)c2ccc(O)cc2 |
Hydroquinone bis(2-hydroxyethyl) ether | O(CCO)c1ccc(OCCO)cc1 |
Hydroquinone bis(BETA_-hydroxyethyl) ether | O(CCO)c1ccc(OCCO)cc1 |
Hydroquinone bis(trimethylsilyl) ether | O(c1ccc(cc1)O[Si](C)(C)C)[Si](C)(C)C |
Hydroquinone di(2-hydroxyethyl) ether | O(CCO)c1ccc(OCCO)cc1 |
Hydroquinone di(BETA_-hydroxyethyl) ether | O(CCO)c1ccc(OCCO)cc1 |
Hydroquinone diethyl ether | O(CC)c1ccc(OCC)cc1 |
Hydroquinone diethylol ether | O(CCO)c1ccc(OCCO)cc1 |
Hydroquinone dimethyl ether | O(C)c1ccc(OC)cc1 |
Hydroquinone methyl ether | O(C)c1ccc(O)cc1 |
Hydroquinone monobenzyl ether | O(Cc1ccccc1)c2ccc(O)cc2 |
Hydroquinone monoethyl ether | O(CC)c1ccc(O)cc1 |
Hydroquinone monomethyl ether | O(C)c1ccc(O)cc1 |
Hydroquinone, di(BETA_-hydroxyethyl) ether | O(CCO)c1ccc(OCCO)cc1 |
Hydroquinone_diethyl_ether | O(CC)c1ccc(OCC)cc1 |
Hydroquinone_monobenzyl_ether | O(Cc1ccccc1)c2ccc(O)cc2 |
Hydroquinone_monoethyl_ether | O(CC)c1ccc(O)cc1 |
Hydroquinone_monomethyl_ether | O(C)c1ccc(O)cc1 |
Hydroxy ether | C(CO)OCC |
ISOPOMIFERIN, DIMETHYL ETHER | O=C1C(=COc2c3C=CC(C)(C)Oc3c4CCC(C)(C)Oc4c12)c5ccc(OC)c(OC)c5 |
ISOPOMIFERIN__DIMETHYL_ETHER | O=C1C(=COc2c3C=CC(C)(C)Oc3c4CCC(C)(C)Oc4c12)c5ccc(OC)c(OC)c5 |
Iminobenzyl ethyl ether | C(=N)(OCC)c1ccccc1 |
Isoamyl benzyl ether | C(OCCC(C)C)c1ccccc1 |
Isoamyl ether | C(OCCC(C)C)CC(C)C |
Isobornyl methyl ether | CC12CCC(CC2OC)C1(C)C |
Isobutanol vinyl ether | C(OC=C)C(C)C |
Isobutyl phenyl ether | O(CC(C)C)c1ccccc1 |
Isobutyl vinyl ether | C(OC=C)C(C)C |
Isoeugenol methyl ether | O(C)c1cc(C=CC)ccc1OC |
Isoeugenol, benzyl ether | O(Cc1ccccc1)c2ccc(C=CC)cc2OC |
Isoeugenyl ethyl ether | O(C)c1cc(C=CC)ccc1OCC |
Isoeugenyl methyl ether | O(C)c1cc(C=CC)ccc1OC |
Isopentyl ether | C(OCCC(C)C)CC(C)C |
Isopropyl glycidyl ether | C(OC(C)C)C1CO1 |
Isopropyl p-hydroxyphenyl ether | O(C(C)C)c1ccc(O)cc1 |
Isopropyl_p-hydroxyphenyl_ether | O(C(C)C)c1ccc(O)cc1 |
Kampferol-3, 4'-dimethyl ether | O=C1C=C(Oc2cc(O)cc(O)c12)c3ccc(OC)c(OC)c3 |
Lucidin, dimethyl ether | O(C)c1c(OC)c(OC)c(OC)c2C(=O)C=C(Oc12)c3ccc4OCOc4c3 |
Lucidin__dimethyl_ether | O(C)c1c(OC)c(OC)c(OC)c2C(=O)C=C(Oc12)c3ccc4OCOc4c3 |
Maleic acid, polymer with methyl vinyl ether | C(=CC(=O)O)C(=O)O.C=COC |
Maleic acid-methyl vinyl ether copolymer | C(=CC(=O)O)C(=O)O.C=COC |
Maleic acid-methyl vinyl ether polymer | C(=CC(=O)O)C(=O)O.C=COC |
Maleic acid-methyl vinyl ether polymers | C(=CC(=O)O)C(=O)O.C=COC |
Maleic acid-vinyl methyl ether polymers | C(=CC(=O)O)C(=O)O.C=COC |
Maleic acid-vinylmethyl ether polymer | C(=CC(=O)O)C(=O)O.C=COC |
Maleic anhydride methyl vinyl ether, copolymer | O=C1C=CC(=O)O1.C=COC |
Maleic anhydride polymer with methyl vinyl ether | O=C1C=CC(=O)O1.C=COC |
Maleic anhydride, polymer with methyl vinyl ether | O=C1C=CC(=O)O1.C=COC |
Maleic anhydride, polymer with vinyl ether | O=C1C=CC(=O)O1.C=COC=C |
Maleic anhydride- vinyl ether copolymer | O=C1C=CC(=O)O1.C=COC=C |
Maleic anhydride- vinyl ether polymer | O=C1C=CC(=O)O1.C=COC=C |
Maleic anhydride-methyl vinyl ether copolymer | O=C1C=CC(=O)O1.C=COC |
Maleic anhydride-methyl vinyl ether polymer | O=C1C=CC(=O)O1.C=COC |
Maleic anhydride-vinyl methyl ether copolymer | O=C1C=CC(=O)O1.C=COC |
Maleic anhydride-vinyl methyl ether polymer | O=C1C=CC(=O)O1.C=COC |
Maleic_anhydride__polymer_with_methyl_vinyl_ether | O=C1C=CC(=O)O1.C=COC |
Maxima isoflavone G methyl ether | O(C)c1cc2OCOc2cc1C3=COc4cc(OC)ccc4C3=O |
Maxima_isoflavone_G_methyl_ether | O(C)c1cc2OCOc2cc1C3=COc4cc(OC)ccc4C3=O |
Methallyl phenyl ether | O(CC(C)=C)c1ccccc1 |
Methyl 1,1-difluoro-2,2-dichloroethyl ether | C(F)(F)(OC)C(Cl)Cl |
Methyl 1-naphthyl ether | O(C)c1cccc2ccccc12 |
Methyl 2,4,6-tribromophenyl ether | O(C)c1c(Br)cc(Br)cc1Br |
Methyl 2,4,6-trichlorophenyl ether | O(C)c1c(Cl)cc(Cl)cc1Cl |
Methyl 2-naphthyl ether | O(C)c1ccc2ccccc2c1 |
Methyl 2-phenethyl ether | C(COC)c1ccccc1 |
Methyl 3-methylphenyl ether | O(C)c1cccc(C)c1 |
Methyl 4-methylphenyl ether | O(C)c1ccc(C)cc1 |
Methyl BETA_-naphthyl ether | O(C)c1ccc2ccccc2c1 |
Methyl benzyl ether | C(OC)c1ccccc1 |
Methyl carvacryl ether | O(C)c1cc(ccc1C)C(C)C |
Methyl chloromethyl ether | C(Cl)OC |
Methyl chloromethyl ether, anhydrous(DOT) | C(Cl)OC |
Methyl diphenyl ether | O(C)c1ccccc1c2ccccc2 |
Methyl ether of 3, 5-di-tert-butyl-4-hydroxybenzene | Oc1c(cc(COC)cc1C(C)(C)C)C(C)(C)C |
Methyl eugenol ether | O(C)c1cc(CC=C)ccc1OC |
Methyl glycidyl ether | C(OC)C1CO1 |
Methyl m-cresyl ether | O(C)c1cccc(C)c1 |
Methyl m-tolyl ether | O(C)c1cccc(C)c1 |
Methyl o-cresyl ether | O(C)c1ccccc1C |
Methyl o-tolyl ether | O(C)c1ccccc1C |
Methyl p-cresyl ether | O(C)c1ccc(C)cc1 |
Methyl p-tolyl ether | O(C)c1ccc(C)cc1 |
Methyl pentafluorophenyl ether | O(C)c1c(F)c(F)c(F)c(F)c1F |
Methyl phenethyl ether | C(COC)c1ccccc1 |
Methyl phenyl ether | O(C)c1ccccc1 |
Methyl phenylethyl ether | C(COC)c1ccccc1 |
Methyl thymyl ether | O(C)c1cc(C)ccc1C(C)C |
Methyl trimethylsilyl ether | [Si](C)(C)(C)OC |
Methyl trityl ether | C(OC)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Methyl vinyl ether homopolymer | C(=C)OC |
Methyl vinyl ether polymer | C(=C)OC |
Methyl vinyl ether-maleic acid copolymer | C(=CC(=O)O)C(=O)O.C=COC |
Methyl vinyl ether-maleic acid polymer | C(=CC(=O)O)C(=O)O.C=COC |
Methyl vinyl ether-maleic anhydride copolymer | O=C1C=CC(=O)O1.C=COC |
Methyl vinyl ether-maleic anhydride polymer | O=C1C=CC(=O)O1.C=COC |
Methyl_chloromethyl_ether__anhydrous(DOT) | C(Cl)OC |
Methyl_trimethylsilyl_ether | [Si](C)(C)(C)OC |
Methyl_vinyl_ether_homopolymer | C(=C)OC |
Methylchloromethyl ether | C(Cl)OC |
Methylene ether of oxyhydroquinone | Oc1ccc2OCOc2c1 |
Methylene_ether_of_oxyhydroquinone | Oc1ccc2OCOc2c1 |
Methylglycidyl ether | C(OC)C1CO1 |
Monobenzyl ether hydroquinone | O(Cc1ccccc1)c2ccc(O)cc2 |
Monobutyl ether of ethylene glycol | C(CCC)OCCO |
Monobutyl glycol ether | C(CCC)OCCO |
Monobutyl_ether_of_ethylene_glycol | C(CCC)OCCO |
Monochlorodimethyl ether | C(Cl)OC |
Monochloromethyl methyl ether | C(Cl)OC |
Monoethyl ether of diethylene glycol | C(COCC)OCCO |
Monoethylene glycol dimethyl ether | C(OC)COC |
Monoethylene_glycol_dimethyl_ether | C(OC)COC |
Monoisopropyl ether of ethylene glycol | O(CCO)C(C)C |
Monoisopropyl_ether_of_ethylene_glycol | O(CCO)C(C)C |
Monomethyl ether hydroquinone | O(C)c1ccc(O)cc1 |
Monomethyl ether of ethylene glycol | C(CO)OC |
Myristyl glyceryl ether | C(CCCCCCCCCCCC)COCC(O)CO |
N,N'-Dimethylolurea dimethyl ether | C(=O)(NCOC)NCOC |
N-(Methylamino)ethyl 2-methylbenzhydryl ether hydrochloride | C(OCCNC)(c1ccccc1)c2ccccc2C |
N-Acetylcolchinol, methyl ether | O(C)c1c(OC)c(OC)cc2CCC(NC(C)=O)c3cc(OC)ccc3c12 |
N_N'-Dimethylolurea_dimethyl_ether | C(=O)(NCOC)NCOC |
Nitric ether | O(CC)[N+](=O)[O-] |
OSAJETIN, DIMETHYL ETHER | C(C=C(C)C)c1c(OC)c(C(=O)Cc2ccc(OC)cc2)c(O)c3C=CC(C)(C)Oc13 |
OSAJETIN__DIMETHYL_ETHER | C(C=C(C)C)c1c(OC)c(C(=O)Cc2ccc(OC)cc2)c(O)c3C=CC(C)(C)Oc13 |
Octadecyl ether | O(CCCCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCCCC |
Octadecyl vinyl ether | C(CCCCCCCCCC)CCCCCCCOC=C |
Octadecyl_ether | O(CCCCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCCCC |
Octyl ether | O(CCCCCCCC)CCCCCCCC |
Oenanthic ether | C(=O)(OCC)CCCCCC |
Oestrone methyl ether | CC12CCC3c4ccc(OC)cc4CCC3C1CCC2=O |
Orcinol dimethyl ether | O(C)c1cc(C)cc(OC)c1 |
PELTATIN, BETA, ALPHA METHYL ETHER | O=C1OCC2Cc3c(OC)c4OCOc4cc3C(c5cc(OC)c(OC)c(OC)c5)C12 |
PINOSYLVIN METHYL ETHER | C(=Cc1ccccc1)c2cc(O)cc(OC)c2 |
PODOPHYLLOTOXIN, SECODEOXY CYCLIC ETHER | C(c1cc(OC)c(OC)c(OC)c1)C2COCC2Cc3ccc4OCOc4c3 |
PODOPHYLLOTOXIN__SECODEOXY_CYCLIC_ETHER | C(c1cc(OC)c(OC)c(OC)c1)C2COCC2Cc3ccc4OCOc4c3 |
POLYBROMINATED DIPHENYL ETHER | O(c1cc(Br)cc(Br)c1O)c2c(Br)c(Br)c(Br)c(Br)c2O |
Peg-9 octyl phenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Pentabromophenyl ether | O(c1c(Br)c(Br)c(Br)c(Br)c1Br)c2c(Br)c(Br)c(Br)c(Br)c2Br |
Pentafluorophenyl methyl ether | O(C)c1c(F)c(F)c(F)c(F)c1F |
Pentyl ether | O(CCCCC)CCCCC |
Perfluoro-n-dibutyl ether | C(F)(F)(C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
Perfluorodibutyl ether | C(F)(F)(C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
Phenol glycerol ether | O(CC(O)CO)c1ccccc1 |
Phenol glyceryl ether | O(CC(O)CO)c1ccccc1 |
Phenol glycidyl ether | O(CC1CO1)c2ccccc2 |
Phenyl 2,3-epoxypropyl ether | O(CC1CO1)c2ccccc2 |
Phenyl 2,4-dinitrophenyl ether | O(c1ccccc1)c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
Phenyl 2-propenyl ether | O(CC=C)c1ccccc1 |
Phenyl allyl ether | O(CC=C)c1ccccc1 |
Phenyl benzyl ether | C(Oc1ccccc1)c2ccccc2 |
Phenyl butyl ether | O(CCCC)c1ccccc1 |
Phenyl ether | O(c1ccccc1)c2ccccc2 |
Phenyl ether, 4-bromo- | O(c1ccccc1)c2ccc(Br)cc2 |
Phenyl ethyl ether | O(CC)c1ccccc1 |
Phenyl glycidyl ether | O(CC1CO1)c2ccccc2 |
Phenyl methyl ether | O(C)c1ccccc1 |
Phenyl o-nitrophenyl ether | O(c1ccccc1)c2ccccc2[N+](=O)[O-] |
Phenyl o-tolyl ether | O(c1ccccc1)c2ccccc2C |
Phenyl p-tolyl ether | O(c1ccccc1)c2ccc(C)cc2 |
Phenyl-(o-tolylmethyl) (methylamino)ethyl ether hydrochloride | C(OCCNC)(c1ccccc1)c2ccccc2C |
Phenyl-ALPHA_-glycerol ether | O(CC(O)CO)c1ccccc1 |
Phenylethyl methyl ether | C(COC)c1ccccc1 |
Phenylglyceryl ether | O(CC(O)CO)c1ccccc1 |
Phenylglycydyl ether | O(CC1CO1)c2ccccc2 |
Phenylmonoglycol ether | O(CCO)c1ccccc1 |
Phenylpropenyl ether | O(CC=C)c1ccccc1 |
Phloracetophenone dimethyl ether | O(C)c1cc(OC)cc(O)c1C(C)=O |
Phloroacetophenone 2,4-dimethyl ether | O(C)c1cc(OC)cc(O)c1C(C)=O |
Phloroglucinol dimethyl ether | O(C)c1cc(O)cc(OC)c1 |
Phloroglucinol trimethyl ether | O(C)c1cc(OC)cc(OC)c1 |
Phloroglucinol_trimethyl_ether | O(C)c1cc(OC)cc(OC)c1 |
Picryl ethyl ether | O(CC)c1c(cc(cc1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
Poly(ethylene ether) glycol | C(O)CO |
Poly(maleic acid-methyl vinyl ether) | C(=CC(=O)O)C(=O)O.C=COC |
Poly(methyl vinyl ether) | C(=C)OC |
Poly(oxyethylene)-p-tert-octylphenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Poly(vinyl methyl ether) | C(=C)OC |
Polyethylene glycol 450 octyl phenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol mono(4-octylphenyl) ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol mono(4-tert-octylphenyl) ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol mono(p-(1,1,3, 3-tetramethylbutyl)phenyl) ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol mono(p-tert-octylphenyl) ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol octylphenol ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol p-(1,1,3,3-tetramethylbutyl)phenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol p-octylphenyl ether (VAN) | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyethylene glycol p-tert-octylphenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyoxyethylene (13) octylphenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyoxyethylene (9) octylphenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyoxyethylene mono(octylphenyl) ether (VAN) | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyoxyethylene octyl phenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyoxyethylene(4) lauryl ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
Polyvinyl Methyl Ether | C(=C)OC |
Pregnenolone 3-methyl ether | CC12CCC3C(CC=C4CC(OC)CCC34C)C1CCC2C(C)=O |
Pregnenolone methyl ether | CC12CCC3C(CC=C4CC(OC)CCC34C)C1CCC2C(C)=O |
Propanoic acid, 3-methoxy-, methyl ether | C(=O)(OC)CCOC |
Propargyl 2-tetrahydropyranyl ether | O(CC#C)C1CCCCO1 |
Propargyl alcohol tetrahydropyranyl ether | O(CC#C)C1CCCCO1 |
Propargyl_alcohol_tetrahydropyranyl_ether | O(CC#C)C1CCCCO1 |
Propenyl ethyl ether | C(=CC)OCC |
Propionic ether | C(=O)(CC)OCC |
Propyl allyl ether | O(CCC)CC=C |
Propyl glycidyl ether | C(OCCC)C1CO1 |
Propylene glycol BETA_-monoethyl ether | C(CCO)OCC |
Propylene glycol ethyl ether | C(OCC)C(C)O |
Propylene glycol isopropyl ether | O(CCCO)C(C)C |
Propylene glycol methyl ether | C(OC)C(C)O |
Propylene glycol monobutyl ether | O(CCCC)CC(C)O |
Propylene glycol monoethyl ether, BETA_ | C(CCO)OCC |
Propylene glycol monoisopropyl ether | O(CCCO)C(C)C |
Propylene_glycol_ethyl_ether | C(OCC)C(C)O |
Propylene_glycol_monoethyl_ether__BETA_ | C(CCO)OCC |
Propylene_glycol_monoisopropyl_ether | O(CCCO)C(C)C |
Protocatechualdehyde dimethyl ether | O(C)c1cc(C=O)ccc1OC |
Protocatechuic acid methylene ether | C(=O)(O)c1ccc2OCOc2c1 |
Protocatechuic aldehyde dimethyl ether | O(C)c1cc(C=O)ccc1OC |
Protocatechuic aldehyde ethyl ether | O(CC)c1cc(C=O)ccc1O |
Protocatechuic aldehyde methylene ether | C(=O)c1ccc2OCOc2c1 |
Protocatechuic_aldehyde_dimethyl_ether | O(C)c1cc(C=O)ccc1OC |
Protocatechuic_aldehyde_ethyl_ether | O(CC)c1cc(C=O)ccc1O |
Pseudostrychnine methyl ether | O(C)C12CC3C4=CCOC5CC(=O)N6c7ccccc7C1(CCN2C4)C6C35 |
Pseudostrychnine_methyl_ether | O(C)C12CC3C4=CCOC5CC(=O)N6c7ccccc7C1(CCN2C4)C6C35 |
Pyroacetic ether | C(C)(C)=O |
Pyrocatechol diallyl ether | O(CC=C)c1ccccc1OCC=C |
Pyrocatechol dimethyl ether | O(C)c1ccccc1OC |
Pyrocatechol ethylene ether | c12ccccc1OCCO2 |
Pyrocatechol monomethyl ether | O(C)c1ccccc1O |
Pyrocatechol_dimethyl_ether | O(C)c1ccccc1OC |
Pyrocatechol_monomethyl_ether | O(C)c1ccccc1O |
Pyrogallol 1,2,3-(diethylaminoethyl ether) tris(ethyliodide) | O(CCN(CC)(CC)CC)c1c(cccc1OCCN(CC)(CC)CC)OCCN(CC)(CC)CC |
Pyrogallol 1-methyl ether | O(C)c1cccc(O)c1O |
Pyrogallol 1-monomethyl ether | O(C)c1cccc(O)c1O |
Pyrogallol trimethyl ether | O(C)c1c(OC)cccc1OC |
Quercetin 3, 3'-dimethyl ether | O(C)C1=C(Oc2cc(O)cc(O)c2C1=O)c3ccc(O)c(OC)c3 |
Quercetin 3,7, 3',4'-tetramethyl ether | O(C)C1=C(Oc2cc(OC)cc(O)c2C1=O)c3ccc(OC)c(OC)c3 |
Quercetin 7-methyl ether | O=C1C(O)=C(Oc2cc(OC)cc(O)c12)c3ccc(O)c(O)c3 |
Quercetin pentamethyl ether | O(C)c1cc(OC)cc2OC(c3ccc(OC)c(OC)c3)=C(OC)C(=O)c12 |
Quercetin-3, 3'-dimethyl ether | O(C)C1=C(Oc2cc(O)cc(O)c2C1=O)c3ccc(O)c(OC)c3 |
Quercetin-3,3-dimethyl ether | O(C)C1=C(Oc2cc(O)cc(O)c2C1=O)c3ccc(O)c(OC)c3 |
Quinizarin, dimethyl ether | O=C1c2ccccc2C(=O)c3c(OC)ccc(OC)c13 |
Quinol dimethyl ether | O(C)c1ccc(OC)cc1 |
RUBROCOMATULIN 6-METHYL ETHER (AN) | C(=O)(CCC)c1c(O)cc(O)c2C(=O)c3c(O)cc(OC)cc3C(=O)c12 |
Raspberry ketone methyl ether | C(CC(C)=O)c1ccc(OC)cc1 |
Resacetophenone-4-methyl ether | C(C)(=O)c1ccc(OC)cc1O |
Resorcinol bis(2,3-epoxypropyl) ether | O(CC1CO1)c2cccc(c2)OCC3CO3 |
Resorcinol bis(BETA_-hydroxyethyl) ether | O(CCO)c1cccc(OCCO)c1 |
Resorcinol diglycidyl ether | O(CC1CO1)c2cccc(c2)OCC3CO3 |
Resorcinol dimethyl ether | O(C)c1cccc(OC)c1 |
Resorcinol glycidyl ether | O(CC1CO1)c2cccc(c2)OCC3CO3 |
Resorcinol methyl ether | O(C)c1cccc(O)c1 |
Resorcinol monoethyl ether | O(CC)c1cccc(O)c1 |
Resorcinol monomethyl ether | O(C)c1cccc(O)c1 |
Resorcinol_dimethyl_ether | O(C)c1cccc(OC)c1 |
Resorcinol_monoethyl_ether | O(CC)c1cccc(O)c1 |
Resorcinol_monomethyl_ether | O(C)c1cccc(O)c1 |
Resorcinyl diglycidyl ether | O(CC1CO1)c2cccc(c2)OCC3CO3 |
Rifamycin S 15-iminomethyl ether | O=C1c2c3OC1(C)OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(OC)=NC4=CC(=O)c2c(c(O)c3C)C4=O |
Rifamycin_S_15-iminomethyl_ether | O=C1c2c3OC1(C)OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(OC)=NC4=CC(=O)c2c(c(O)c3C)C4=O |
Rubrocomatulin 6-methyl ether | C(=O)(CCC)c1c(O)cc(O)c2C(=O)c3c(O)cc(OC)cc3C(=O)c12 |
Salicyl ether | C(OCc1ccccc1O)c2ccccc2O |
Salicylic acid methyl ether | O(C)c1ccccc1C(=O)O |
Salicylic_acid_methyl_ether | O(C)c1ccccc1C(=O)O |
Scutellarein tetramethyl ether | O(C)c1c(OC)c(OC)cc2OC(=CC(=O)c12)c3ccc(OC)cc3 |
Sodium lauryl sulfate ether | C(CCCCCCCCCC)COS(=O)(=O)O |
Sodiumlauryl ether sulfate | C(CCCCCCCCCC)COS(=O)(=O)O |
Solvent ether | O(CC)CC |
Stearyl vinyl ether | C(CCCCCCCCCC)CCCCCCCOC=C |
Stilbestrol dimethyl ether | C(CC)(c1ccc(OC)cc1)=C(CC)c2ccc(OC)cc2 |
THP ETHER OF BETULALDEHYDE | C(=O)C12CCC(C(C)=C)C1C3CCC4C5(C)CCC(OC6CCCCO6)C(C)(C)C5CCC4(C)C3(C)CC2 |
THP ETHER OF BETULIN | C(O)C12CCC(C(C)=C)C1C3CCC4C5(C)CCC(OC6CCCCO6)C(C)(C)C5CCC4(C)C3(C)CC2 |
THP ETHER OF METHYL BETULINATE | C(=O)(OC)C12CCC(C(C)=C)C1C3CCC4C5(C)CCC(OC6CCCCO6)C(C)(C)C5CCC4(C)C3(C)CC2 |
THP_ETHER_OF_BETULALDEHYDE | C(=O)C12CCC(C(C)=C)C1C3CCC4C5(C)CCC(OC6CCCCO6)C(C)(C)C5CCC4(C)C3(C)CC2 |
THP_ETHER_OF_BETULIN | C(O)C12CCC(C(C)=C)C1C3CCC4C5(C)CCC(OC6CCCCO6)C(C)(C)C5CCC4(C)C3(C)CC2 |
THP_ETHER_OF_METHYL_BETULINATE | C(=O)(OC)C12CCC(C(C)=C)C1C3CCC4C5(C)CCC(OC6CCCCO6)C(C)(C)C5CCC4(C)C3(C)CC2 |
Testosterone trimethylsilyl ether | CC12CCC(=O)C=C2CCC3C1CCC4(C)C(CCC34)O[Si](C)(C)C |
Tetra(oxydiethanol) monodecyl ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
Tetra(oxyethylene) dodecyl ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
Tetradecyl ether | O(CCCCCCCCCCCCCC)CCCCCCCCCCCCCC |
Tetradecyl_ether | O(CCCCCCCCCCCCCC)CCCCCCCCCCCCCC |
Tetraethylene glycol dimethyl ether | O(CCOCCOC)CCOCCOC |
Tetraethylene glycol dodecyl ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
Tetraethylene glycol monododecyl ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
Tetraethylene glycol monolauryl ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
Tetraethylene glycol monomethyl ether | C(COCCOC)OCCOCCO |
Tetraethylene_glycol_monomethyl_ether | C(COCCOC)OCCOCCO |
Tetramethylene glycol diglycidyl ether | C(OCCCCOCC1CO1)C2CO2 |
Tetraoxyethylene glycol monododecyl ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
Thioallyl ether | S(CC=C)CC=C |
Thioethyl ether | S(CC)CC |
Thymol methyl ether | O(C)c1cc(C)ccc1C(C)C |
Thymyl methyl ether | O(C)c1cc(C)ccc1C(C)C |
Tmca methyl ether | O(C)c1c(OC)c(OC)cc2CCC(N)C3=CC(=O)C(OC)=CC=C3c12 |
Triethylene glycol diglycidyl ether | C(OCCOCCOCCOCC1CO1)C2CO2 |
Triethylene glycol dimethyl ether | C(OCCOC)COCCOC |
Triethylene glycol methyl ether | C(COCCO)OCCOC |
Triethylene glycol mono-n-butyl ether | C(COCCCC)OCCOCCO |
Triethylene glycol monobutyl ether | C(COCCCC)OCCOCCO |
Triethylene glycol monomethyl ether acetate | C(OCCOCCOC)COC(C)=O |
Triethylene glycol monomethyl ether | C(COCCO)OCCOC |
Triethylene glycol n-butyl ether | C(COCCCC)OCCOCCO |
Triethylene glycol, bis(2,3-epoxypropyl) ether | C(OCCOCCOCCOCC1CO1)C2CO2 |
Triethyleneglycol monobutyl ether | C(COCCCC)OCCOCCO |
Triglycol monobutyl ether | C(COCCCC)OCCOCCO |
Triglycol monomethyl ether | C(COCCO)OCCOC |
Trimethylcolchicinic acid methyl ether | O(C)c1c(OC)c(OC)cc2CCC(N)C3=CC(=O)C(OC)=CC=C3c12 |
Trimethylcolchicinic acid, methyl ether, L-tartrate | C(O)(C(=O)O)C(O)C(=O)O.COC1=CC=C2C(=CC1=O)C(N)CCc3cc(OC)c(OC)c(OC)c23 |
Trimethylsilyl ethyl ether | O(CC)[Si](C)(C)C |
Triphenylmethyl methyl ether | C(OC)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Trityl ethyl ether | C(OCC)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Trityl methyl ether | C(OC)(c1ccccc1)(c2ccccc2)c3ccccc3 |
Tropine benzohydryl ether methanesulfonate | S(C)(=O)(=O)O.CN1C2CCC1CC(C2)OC(c3ccccc3)c4ccccc4 |
Tubocurarine dimethyl ether iodide | O(C)c1c(OC)cc2CCN(C)(C)C3Cc4ccc(OC)c(c4)Oc5cc6c(CCN(C)(C)C6Cc7ccc(cc7)Oc1c23)cc5OC |
UVARETIN MONOMETHYL ETHER (B643656K059) | C(c1ccccc1O)c2c(O)c(C(=O)CCc3ccccc3)c(OC)cc2OC |
UVARETIN_MONOMETHYL_ETHER_(B643656K059) | C(c1ccccc1O)c2c(O)c(C(=O)CCc3ccccc3)c(OC)cc2OC |
Uvaretin dimethyl ether | C(c1ccccc1OC)c2c(O)c(C(=O)CCc3ccccc3)c(OC)cc2OC |
Uvaretin monomethyl ether | C(c1ccccc1O)c2c(O)c(C(=O)CCc3ccccc3)c(OC)cc2OC |
Uvaretin_dimethyl_ether | C(c1ccccc1OC)c2c(O)c(C(=O)CCc3ccccc3)c(OC)cc2OC |
Vanillin methyl ether | O(C)c1cc(C=O)ccc1OC |
Veratrole methyl ether | O(C)c1cc(CC=C)ccc1OC |
Vinyl 2-(butoxyethyl) ether | C(COC=C)OCCCC |
Vinyl 2-chloroethyl ether | C(CCl)OC=C |
Vinyl 2-ethylhexyl ether | C(CC)(CCCC)COC=C |
Vinyl 2-methoxyethyl ether | C(COC)OC=C |
Vinyl BETA_-chloroethyl ether | C(CCl)OC=C |
Vinyl allyl ether | C(C=C)OC=C |
Vinyl butyl ether | C(CCC)OC=C |
Vinyl cetyl ether | C(CCCCCCCCC)CCCCCCOC=C |
Vinyl ether- maleic anhydride copolymer | O=C1C=CC(=O)O1.C=COC=C |
Vinyl ether- maleic anhydride polymer | O=C1C=CC(=O)O1.C=COC=C |
Vinyl ethyl ether | O(CC)C=C |
Vinyl ethyl ether, inhibited | O(CC)C=C |
Vinyl hexyl ether | C(CCCC)COC=C |
Vinyl isobutyl ether | C(OC=C)C(C)C |
Vinyl methyl ether polymer | C(=C)OC |
Vinyl methyl ether-maleic anhydride copolymer | O=C1C=CC(=O)O1.C=COC |
Vinyl methyl ether-maleic anhydride polymer | O=C1C=CC(=O)O1.C=COC |
Vinyl n-butyl ether | C(CCC)OC=C |
Vinyl octadecyl ether | C(CCCCCCCCCC)CCCCCCCOC=C |
Vinyl stearyl ether | C(CCCCCCCCCC)CCCCCCCOC=C |
Vinyl-2-(N, N-dimethylamino)ethyl ether | C(COC=C)N(C)C |
Vinylmethyl ether-maleic acid polymer | C(=CC(=O)O)C(=O)O.C=COC |
Wine ether | C(=O)(OCC)CCCCCCCC |
dl-cis-Bisdehydrodoisynolic acid methyl ether | C(C)C1c2ccc3cc(OC)ccc3c2CCC1(C)C(=O)O |
i-Cholesteryl methyl ether | CC12CCC3CC13C(OC)CC4C2CCC5(C)C(CCC45)C(C)CCCC(C)C |
m-Allylpyrocatechin methylene ether | C(C=C)c1ccc2OCOc2c1 |
m-Aminophenyl phenyl ether | O(c1ccccc1)c2cccc(N)c2 |
m-Aminophenyl_phenyl_ether | O(c1ccccc1)c2cccc(N)c2 |
m-Bromophenyl methyl ether | O(C)c1cccc(Br)c1 |
m-Chlorophenyl p-nitrophenyl ether | O(c1ccc(cc1)[N+](=O)[O-])c2cccc(Cl)c2 |
m-Cresol methyl ether | O(C)c1cccc(C)c1 |
m-Methoxyphenyl phenyl ether | O(c1ccccc1)c2cccc(OC)c2 |
m-Nitrodiphenyl ether | O(c1ccccc1)c2cccc(c2)[N+](=O)[O-] |
m-Nitrophenyl phenyl ether | O(c1ccccc1)c2cccc(c2)[N+](=O)[O-] |
m-Phenoxyphenol monomethyl ether | O(c1ccccc1)c2cccc(OC)c2 |
m-Phenoxyphenol_monomethyl_ether | O(c1ccccc1)c2cccc(OC)c2 |
n-Amyl ether | O(CCCCC)CCCCC |
n-Butyl benzyl ether | C(OCCCC)c1ccccc1 |
n-Butyl ether | O(CCCC)CCCC |
n-Butyl glycidyl ether | C(OCCCC)C1CO1 |
n-Butyl phenyl ether | O(CCCC)c1ccccc1 |
n-Butyl vinyl ether | C(CCC)OC=C |
n-Butyl-ALPHA_-glycerol ether | C(O)(CO)COCCCC |
n-Butyl-ALPHA_-glycerol_ether | C(O)(CO)COCCCC |
n-Butyl_phenyl_ether | O(CCCC)c1ccccc1 |
n-Dibutyl ether | O(CCCC)CCCC |
n-Dodecyl tetraethylene glycol ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
n-Hexyl ether | O(CCCCCC)CCCCCC |
n-Octyl ether | O(CCCCCCCC)CCCCCCCC |
n-Pentyl ether | O(CCCCC)CCCCC |
o-Aminophenyl phenyl ether | O(c1ccccc1)c2ccccc2N |
o-Aminophenyl_phenyl_ether | O(c1ccccc1)c2ccccc2N |
o-Bromophenyl methyl ether | O(C)c1ccccc1Br |
o-Chlorophenyl ethyl ether | O(CC)c1ccccc1Cl |
o-Chlorophenyl methyl ether | O(C)c1ccccc1Cl |
o-Chlorophenyl phenyl ether | O(c1ccccc1)c2ccccc2Cl |
o-Cresol glyceryl ether | O(CC(O)CO)c1ccccc1C |
o-Cresol glycidyl ether | O(CC1CO1)c2ccccc2C |
o-Cresol methyl ether | O(C)c1ccccc1C |
o-Cresyl ALPHA_-glyceryl ether | O(CC(O)CO)c1ccccc1C |
o-Cresyl glycerol ether | O(CC(O)CO)c1ccccc1C |
o-Cresyl methyl ether | O(C)c1ccccc1C |
o-Cumenyl 2,4-dinitrophenyl ether | [N+](=O)([O-])c1cc(ccc1Oc2ccccc2C(C)C)[N+](=O)[O-] |
o-Diphenyl phenyl ether | O(c1ccccc1)c2ccccc2c3ccccc3 |
o-Isopropylphenyl 2, 4-dinitrophenyl ether | [N+](=O)([O-])c1cc(ccc1Oc2ccccc2C(C)C)[N+](=O)[O-] |
o-Methoxyphenyl allyl ether | O(CC=C)c1ccccc1OC |
o-Methoxyphenyl glyceryl ether | O(CC(O)CO)c1ccccc1OC |
o-Methoxyphenyl phenyl ether | O(c1ccccc1)c2ccccc2OC |
o-Methylphenyl phenyl ether | O(c1ccccc1)c2ccccc2C |
o-Nitrophenyl methyl ether | O(C)c1ccccc1[N+](=O)[O-] |
o-Nitrophenyl phenyl ether | O(c1ccccc1)c2ccccc2[N+](=O)[O-] |
o-Tolyl 2,4-dinitrophenyl ether | O(c1ccccc1C)c2ccc(cc2[N+](=O)[O-])[N+](=O)[O-] |
p,p'-Diaminodiphenyl ether | O(c1ccc(N)cc1)c2ccc(N)cc2 |
p,p'-Dibromodiphenyl ether | O(c1ccc(Br)cc1)c2ccc(Br)cc2 |
p,p'-Dihydroxydiphenyldimethylmethane diglycidyl ether | C(C)(C)(c1ccc(cc1)OCC2CO2)c3ccc(cc3)OCC4CO4 |
p,p'-Dinitrodiphenyl ether | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2)[N+](=O)[O-] |
p-Aminophenyl ether | O(c1ccc(N)cc1)c2ccc(N)cc2 |
p-Aminophenyl phenyl ether | O(c1ccccc1)c2ccc(N)cc2 |
p-Bromodiphenyl ether | O(c1ccccc1)c2ccc(Br)cc2 |
p-Bromophenol ethyl ether | O(CC)c1ccc(Br)cc1 |
p-Bromophenyl methyl ether | O(C)c1ccc(Br)cc1 |
p-Bromophenyl phenyl ether | O(c1ccccc1)c2ccc(Br)cc2 |
p-Butoxyphenyl GAMMA_-morpholinopropyl ether hydrochloride | O(CCCN1CCOCC1)c2ccc(OCCCC)cc2 |
p-Chlorophenyl 2-hydroxyethyl ether | O(CCO)c1ccc(Cl)cc1 |
p-Chlorophenyl allyl ether | O(CC=C)c1ccc(Cl)cc1 |
p-Chlorophenyl ethyl ether | O(CC)c1ccc(Cl)cc1 |
p-Chlorophenyl glyceryl ether | O(CC(O)CO)c1ccc(Cl)cc1 |
p-Chlorophenyl glycol ether | O(CCO)c1ccc(Cl)cc1 |
p-Chlorophenyl methyl ether | O(C)c1ccc(Cl)cc1 |
p-Chlorophenyl monoglycol ether | O(CCO)c1ccc(Cl)cc1 |
p-Chlorophenyl p-nitrophenyl ether | O(c1ccc(Cl)cc1)c2ccc(cc2)[N+](=O)[O-] |
p-Chlorophenyl phenyl ether | O(c1ccccc1)c2ccc(Cl)cc2 |
p-Chlorophenyl-ALPHA_-glyceryl ether | O(CC(O)CO)c1ccc(Cl)cc1 |
p-Cresol methyl ether | O(C)c1ccc(C)cc1 |
p-Cresol phenyl ether | O(c1ccccc1)c2ccc(C)cc2 |
p-Cresyl methyl ether | O(C)c1ccc(C)cc1 |
p-Cymene-2-ol methyl ether | O(C)c1cc(ccc1C)C(C)C |
p-Diphenyl phenyl ether | O(c1ccccc1)c2ccc(cc2)c3ccccc3 |
p-Fluorophenyl methyl ether | O(C)c1ccc(F)cc1 |
p-Hydroxydiphenyl ether | O(c1ccccc1)c2ccc(O)cc2 |
p-Hydroxydiphenyl_ether | O(c1ccccc1)c2ccc(O)cc2 |
p-Hydroxydiphenylamine isopropyl ether | N(c1ccccc1)c2ccc(cc2)OC(C)C |
p-Hydroxyphenyl benzyl ether | O(Cc1ccccc1)c2ccc(O)cc2 |
p-Iodophenyl methyl ether | O(C)c1ccc(I)cc1 |
p-Iodophenyl phenyl ether | O(c1ccc(I)cc1)c2ccc(I)cc2 |
p-Methoxydiphenyl ether | O(c1ccccc1)c2ccc(OC)cc2 |
p-Methoxyphenyl phenyl ether | O(c1ccccc1)c2ccc(OC)cc2 |
p-Methylphenyl phenyl ether | O(c1ccccc1)c2ccc(C)cc2 |
p-Nitrodiphenyl ether | O(c1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
p-Nitrophenol glycidyl ether | [N+](=O)([O-])c1ccc(cc1)OCC2CO2 |
p-Nitrophenyl 2-nitro-4-(trifluoromethyl) phenyl ether | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2[N+](=O)[O-])C(F)(F)F |
p-Nitrophenyl 2-nitro-4-(trifluoromethyl)phenyl ether | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2[N+](=O)[O-])C(F)(F)F |
p-Nitrophenyl ALPHA_,ALPHA_,ALPHA_-trifluoro-2-nitro-p-tolyl ether | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2[N+](=O)[O-])C(F)(F)F |
p-Nitrophenyl ether | O(c1ccc(cc1)[N+](=O)[O-])c2ccc(cc2)[N+](=O)[O-] |
p-Nitrophenyl glycidyl ether | [N+](=O)([O-])c1ccc(cc1)OCC2CO2 |
p-Nitrophenyl phenyl ether | O(c1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
p-Phenylenebis(BETA_-hydroxyethyl) ether | O(CCO)c1ccc(OCCO)cc1 |
p-Propenylphenyl methyl ether | C(=CC)c1ccc(OC)cc1 |
p-Tolyl methyl ether | O(C)c1ccc(C)cc1 |
p-Tolyl phenyl ether | O(c1ccccc1)c2ccc(C)cc2 |
p-tert-Amylphenyl methyl ether | C(C)(C)(CC)c1ccc(OC)cc1 |
sym-Dichloroethyl ether | O(CCCl)CCCl |
tert-Butyl ethyl ether | O(CC)C(C)(C)C |
tert-Butyl phenyl ether | O(c1ccccc1)C(C)(C)C |