Alphabetical Indicies

If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.

If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.

Select from

2-Amino-3-methylbenzoic acid C(=O)(O)c1cccc(C)c1N
2-Amino-5-methylbenzoic acid C(=O)(O)c1cc(C)ccc1N
2-Hydroxy-3-methylbenzoic acid C(=O)(O)c1cccc(C)c1O
2-Hydroxy-4-methylbenzoic acid C(=O)(O)c1ccc(C)cc1O
2-Hydroxy-5-methylbenzoic acid C(=O)(O)c1cc(C)ccc1O
2-Methylbenzoic acid anilide C(=O)(Nc1ccccc1)c2ccccc2C
2-Methylbenzoic acid C(=O)(O)c1ccccc1C
2-Nitro-3-methylbenzoic acid, methyl ester C(=O)(OC)c1cccc(C)c1[N+](=O)[O-]
3-(Bis(2-chloroethyl)amino)-4-methylbenzoic acid N(CCCl)(CCCl)c1cc(ccc1C)C(=O)O
3-Methylbenzoic acid C(=O)(O)c1cccc(C)c1
3-Nitro-4-methylbenzoic acid [N+](=O)([O-])c1cc(ccc1C)C(=O)O
4-Chloro-3-methylbenzoic acid C(=O)(O)c1ccc(Cl)c(C)c1
4-Methylbenzoic acid hydrazide C(=O)(NN)c1ccc(C)cc1
4-Methylbenzoic acid methyl ester O(C(C)=O)c1ccc(C)cc1
4-Methylbenzoic acid C(=O)(O)c1ccc(C)cc1
5-Chloro-2-methylbenzoic acid C(=O)(O)c1cc(Cl)ccc1C
6-Hydroxy-3-methylbenzoic acid C(=O)(O)c1cc(C)ccc1O
m-Methylbenzoic acid C(=O)(O)c1cccc(C)c1
o-Methylbenzoic acid C(=O)(O)c1ccccc1C
p-Methylbenzoic acid hydrazide C(=O)(NN)c1ccc(C)cc1
p-Methylbenzoic acid C(=O)(O)c1ccc(C)cc1


The Random Factory - 2001