If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Hydroxy-5-sulfoaniline | S(=O)(=O)(O)c1ccc(O)c(N)c1 |
2-Methoxy-5-sulfoaniline | S(=O)(=O)(O)c1ccc(OC)c(N)c1 |
4-(p-Aminoanilino)-3-sulfoaniline | N(c1ccc(N)cc1)c2ccc(N)cc2S(=O)(=O)O |
4-Hydroxy-3-sulfoaniline | S(=O)(=O)(O)c1cc(N)ccc1O |
4-Methyl-3-sulfoaniline | S(=O)(=O)(O)c1cc(N)ccc1C |
4-Nitro-2-sulfoaniline | S(=O)(=O)(O)c1cc(ccc1N)[N+](=O)[O-] |
N, N-Diethyl-3-sulfoaniline | N(CC)(CC)c1cccc(c1)S(=O)(=O)O |