If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Mercapto-5,6-dihydro-1,3,4-thiazine | S=C1NCCCS1 |
2H-1, 3-Thiazine-2-thione, tetrahydro- | S=C1NCCCS1 |
2H-1,3-Thiazine-2,4(3H)-dione, dihydro-3-methyl-2-thio- | CN1C(=O)CCSC1=S |
2H-1,3-Thiazine-2-thione, 3, 6-dihydro-4,6,6-trimethyl- | CC1(C)C=C(C)NC(=S)S1 |
2H-1_3-Thiazine-2-thione__3__6-dihydro-4_6_6-trimethyl- | CC1(C)C=C(C)NC(=S)S1 |
2H-1_3-Thiazine-2_4(3H)-dione__dihydro-3-methyl-2-thio- | CN1C(=O)CCSC1=S |
2H-1__3-Thiazine-2-thione__tetrahydro- | S=C1NCCCS1 |
4H-1, 3-Thiazine-2-thiol, 5,6-dihydro- | S=C1NCCCS1 |
4H-1,3-Thiazine-6-carboxylic acid, 2-amino-4-oxo-, methyl ester | C(=O)(OC)C1=CC(=O)NC(=N)S1 |
6H-1,3-Thiazine-2-thiol, 4,6, 6-trimethyl- | CC1(C)C=C(C)NC(=S)S1 |
Dibenzo-1,4-thiazine | c12ccccc1Sc3ccccc3N2 |
Dibenzo-p-thiazine | c12ccccc1Sc3ccccc3N2 |
Thiazine Red R | S(=O)(=O)(O)c1c(C)ccc2N=C(Sc12)c3ccc(cc3)N=Nc4cc(c5ccccc5c4O)S(=O)(=O)O |