If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Nitraniline | [N+](=O)([O-])c1ccc(N)cc1 |
N-Methyl-p-nitraniline | [N+](=O)([O-])c1ccc(NC)cc1 |
Para Nitraniline Red | N(=Nc1ccc(cc1)[N+](=O)[O-])c2c(O)ccc3ccccc23 |
o-Nitraniline | [N+](=O)([O-])c1ccccc1N |
p-Nitraniline red | N(=Nc1ccc(cc1)[N+](=O)[O-])c2c(O)ccc3ccccc23 |
p-Nitraniline | [N+](=O)([O-])c1ccc(N)cc1 |