If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,2-Benzenedicarboxylic acid, monomethyl ester | C(=O)(OC)c1ccccc1C(=O)O |
1,4-Benzenedicarboxylic acid, monomethyl ester | C(=O)(OC)c1ccc(cc1)C(=O)O |
1-Phenyl-3-monomethyl-triazene | N(=NNC)c1ccccc1 |
1_2-Benzenedicarboxylic_acid__monomethyl_ester | C(=O)(OC)c1ccccc1C(=O)O |
1_4-Benzenedicarboxylic_acid__monomethyl_ester | C(=O)(OC)c1ccc(cc1)C(=O)O |
2-Butenedioic acid (E)-, monomethyl ester | C(=O)(OC)C=CC(=O)O |
2-Butenedioic acid (Z)-, monomethyl ester | C(=O)(OC)C=CC(=O)O |
2-Butenedioic acid, monomethyl ester | C(=O)(OC)C=CC(=O)O |
2-Butenedioic_acid_(E)-__monomethyl_ester | C(=O)(OC)C=CC(=O)O |
2-Butenedioic_acid_(Z)-__monomethyl_ester | C(=O)(OC)C=CC(=O)O |
5-(3-Monomethyl-1-triazeno)imidazole-4-carboxamide | C(N)(=O)C1=C(N=NNC)NC=N1 |
ALPHA_-Propylene glycol monomethyl ether | C(OC)C(C)O |
ALPHA_-Propylene_glycol_monomethyl_ether | C(OC)C(C)O |
Adipic acid monomethyl ester | C(CCCC(=O)O)C(=O)OC |
Adipic acid, monomethyl ester | C(CCCC(=O)O)C(=O)OC |
Azelaic acid monomethyl ester | C(=O)(OC)CCCCCCCC(=O)O |
Azelaic acid, monomethyl ester | C(=O)(OC)CCCCCCCC(=O)O |
Bicyclo(2.2.1)hept-5-ene-2,3-dicarboxylic acid, monomethyl ester | C(=O)(OC)C1C2C=CC(C2)C1C(=O)O |
Bicyclo(2.2.1)hept-5-ene-2_3-dicarboxylic_acid__monomethyl_ester | C(=O)(OC)C1C2C=CC(C2)C1C(=O)O |
Butanedioic acid, monomethyl ester | C(=O)(OC)CCC(=O)O |
Butanedioic_acid__monomethyl_ester | C(=O)(OC)CCC(=O)O |
Butylene glycol monomethyl ether | C(CCO)COC |
Butylene_glycol_monomethyl_ether | C(CCO)COC |
Cyclotene monomethyl ether | O(C)C1=C(C)CCC1=O |
Diethylene glycol monomethyl ether formal | C(OCCOCCOC)OCCOCCOC |
Diethylene glycol monomethyl ether | C(COC)OCCO |
Diethylene_glycol_monomethyl_ether_formal | C(OCCOCCOC)OCCOCCOC |
Diglycol monomethyl ether | C(COC)OCCO |
Ethanol, 2,2'-oxybis-, monomethyl ether | C(COC)OCCO |
Ethylene diglycol monomethyl ether | C(COC)OCCO |
Ethylene glycol monomethyl ether acetylricinoleate | C(CCCCCC)(CC=CCCCCCCCC(=O)OCCOC)OC(C)=O |
Ethylene glycol monomethyl ether acrylate | C(=O)(C=C)OCCOC |
Ethylene glycol monomethyl ether formal | C(OCCOC)OCCOC |
Ethylene glycol monomethyl ether oleate | C(CCCCCC=CCCCCCCCC)CC(=O)OCCOC |
Ethylene glycol monomethyl ether | C(CO)OC |
Ethylene_glycol_monomethyl_ether_acrylate | C(=O)(C=C)OCCOC |
Ethylene_glycol_monomethyl_ether_formal | C(OCCOC)OCCOC |
Fumaric acid, monomethyl ester | C(=O)(OC)C=CC(=O)O |
Glutaric acid, monomethyl ester | C(=O)(OC)CCCC(=O)O |
Glycerin-ALPHA_-monomethyl ether | C(O)(CO)COC |
Glycerin-ALPHA_-monomethyl_ether | C(O)(CO)COC |
Glycerol 1-monomethyl ether | C(O)(CO)COC |
Glycol monomethyl ether acetylricinoleate | C(CCCCCC)(CC=CCCCCCCCC(=O)OCCOC)OC(C)=O |
Glycol monomethyl ether acrylate | C(=O)(C=C)OCCOC |
Glycol monomethyl ether | C(CO)OC |
Hexanedioic acid, monomethyl ester | C(CCCC(=O)O)C(=O)OC |
Hexanedioic_acid__monomethyl_ester | C(CCCC(=O)O)C(=O)OC |
Hexestrol, monomethyl ether | C(CC)(c1ccc(OC)cc1)C(CC)c2ccc(O)cc2 |
Hydroquinone monomethyl ether | O(C)c1ccc(O)cc1 |
Hydroquinone_monomethyl_ether | O(C)c1ccc(O)cc1 |
Maleic acid, monomethyl ester | C(=O)(OC)C=CC(=O)O |
Monomethyl 1,2-benzenedicarboxylate | C(=O)(OC)c1ccccc1C(=O)O |
Monomethyl adipate | C(CCCC(=O)O)C(=O)OC |
Monomethyl azelate | C(=O)(OC)CCCCCCCC(=O)O |
Monomethyl dihydrogen phosphate | P(=O)(O)(O)OC |
Monomethyl ether hydroquinone | O(C)c1ccc(O)cc1 |
Monomethyl ether of ethylene glycol | C(CO)OC |
Monomethyl fumarate | C(=O)(OC)C=CC(=O)O |
Monomethyl glutarate | C(=O)(OC)CCCC(=O)O |
Monomethyl glycol | C(CO)OC |
Monomethyl maleate | C(=O)(OC)C=CC(=O)O |
Monomethyl mercury chloride | C.Cl |
Monomethyl nonanedioate | C(=O)(OC)CCCCCCCC(=O)O |
Monomethyl phosphate | P(=O)(O)(O)OC |
Monomethyl phthalate | C(=O)(OC)c1ccccc1C(=O)O |
Monomethyl succinate | C(=O)(OC)CCC(=O)O |
Monomethyl terephthalate | C(=O)(OC)c1ccc(cc1)C(=O)O |
Monomethyl-aminoaethanol(GERMAN) | C(CO)NC |
Monomethyl_mercury_chloride | C.Cl |
N-Monomethyl-p-nitroaniline | [N+](=O)([O-])c1ccc(NC)cc1 |
Neostigmine monomethyl sulfate | S(=O)(=O)(O)OC.CN(C)C(=O)Oc1cccc(c1)N(C)(C)C |
Nonanedioic acid, monomethyl ester | C(=O)(OC)CCCCCCCC(=O)O |
Nonanedioic_acid__monomethyl_ester | C(=O)(OC)CCCCCCCC(=O)O |
Norborene-2,3-dicarboxylic acid, monomethyl ester | C(=O)(OC)C1C2C=CC(C2)C1C(=O)O |
Pentanedioic acid, monomethyl ester | C(=O)(OC)CCCC(=O)O |
Pentanedioic_acid__monomethyl_ester | C(=O)(OC)CCCC(=O)O |
Phosphonic acid, methyl-, monomethyl ester, chromium(3+) salt | P(C)(=O)(O)OC |
Phosphonic acid, methyl-, monomethyl ester, titanium(3+) salt | P(C)(=O)(O)OC |
Phosphonic acid, methyl-, monomethyl ester, vanadium(3+) salt | P(C)(=O)(O)OC |
Phosphonic acid, monomethyl ester, compd. with piperidine (1:1) | C1CCNCC1.COP(=O)O |
Phosphonic_acid__methyl-__monomethyl_ester__chromium(3+)_salt | P(C)(=O)(O)OC |
Phosphonic_acid__methyl-__monomethyl_ester__titanium(3+)_salt | P(C)(=O)(O)OC |
Phosphonic_acid__methyl-__monomethyl_ester__vanadium(3+)_salt | P(C)(=O)(O)OC |
Phosphonic_acid__monomethyl_ester__compd._with_piperidine_(1:1) | C1CCNCC1.COP(=O)O |
Phosphoric acid, monomethyl ester | P(=O)(O)(O)OC |
Phosphoric acid, monomethyl monophenyl ester | O(c1ccccc1)P(=O)(O)OC |
Phosphoric_acid__monomethyl_ester | P(=O)(O)(O)OC |
Phosphoric_acid__monomethyl_monophenyl_ester | O(c1ccccc1)P(=O)(O)OC |
Phthalic acid, monomethyl ester | C(=O)(OC)c1ccccc1C(=O)O |
Phthalic acid, monomethyl ester, ester with ethyl glycolate | C(=O)(OCC(=O)OCC)c1ccccc1C(=O)OC |
Pyrocatechol monomethyl ether | O(C)c1ccccc1O |
Pyrocatechol_monomethyl_ether | O(C)c1ccccc1O |
Pyrogallol 1-monomethyl ether | O(C)c1cccc(O)c1O |
Resorcinol monomethyl ether | O(C)c1cccc(O)c1 |
Resorcinol_monomethyl_ether | O(C)c1cccc(O)c1 |
Succinic acid monomethyl ester | C(=O)(OC)CCC(=O)O |
Succinic acid, monomethyl ester | C(=O)(OC)CCC(=O)O |
Sulfuric acid, monomethyl ester, ammonium salt | S(=O)(=O)(O)OC |
Sulfuric acid, monomethyl ester, potassium salt | S(=O)(=O)(O)OC |
Sulfuric_acid__monomethyl_ester__ammonium_salt | S(=O)(=O)(O)OC |
Sulfuric_acid__monomethyl_ester__potassium_salt | S(=O)(=O)(O)OC |
Terephthalic acid, monomethyl ester | C(=O)(OC)c1ccc(cc1)C(=O)O |
Tetraethylene glycol monomethyl ether | C(COCCOC)OCCOCCO |
Tetraethylene_glycol_monomethyl_ether | C(COCCOC)OCCOCCO |
Triazene, 3-monomethyl-1-phenyl- | N(=NNC)c1ccccc1 |
Triazene__3-monomethyl-1-phenyl- | N(=NNC)c1ccccc1 |
Triethylene glycol monomethyl ether acetate | C(OCCOCCOC)COC(C)=O |
Triethylene glycol monomethyl ether | C(COCCO)OCCOC |
Triglycol monomethyl ether | C(COCCO)OCCOC |
UVARETIN MONOMETHYL ETHER (B643656K059) | C(c1ccccc1O)c2c(O)c(C(=O)CCc3ccccc3)c(OC)cc2OC |
UVARETIN_MONOMETHYL_ETHER_(B643656K059) | C(c1ccccc1O)c2c(O)c(C(=O)CCc3ccccc3)c(OC)cc2OC |
Undecanedioic acid, monomethyl ester | C(=O)(OC)CCCCCCCCCC(=O)O |
Undecanedioic_acid__monomethyl_ester | C(=O)(OC)CCCCCCCCCC(=O)O |
Uvaretin monomethyl ether | C(c1ccccc1O)c2c(O)c(C(=O)CCc3ccccc3)c(OC)cc2OC |
m-Phenoxyphenol monomethyl ether | O(c1ccccc1)c2cccc(OC)c2 |
m-Phenoxyphenol_monomethyl_ether | O(c1ccccc1)c2cccc(OC)c2 |