If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
.omega.-Phenylacetic acid | C(C(=O)O)c1ccccc1 |
.omega.-Phenylacetic_acid | C(C(=O)O)c1ccccc1 |
2-Amino-2-phenylacetic acid | C(N)(C(=O)O)c1ccccc1 |
2-Anilino-2-phenylacetic acid | C(Nc1ccccc1)(C(=O)O)c2ccccc2 |
2-Mercapto-2-phenylacetic acid | S(CC(=O)O)c1ccccc1 |
2-Mercapto-2-phenylacetic_acid | S(CC(=O)O)c1ccccc1 |
2-Oxo-2-phenylacetic acid | C(=O)(C(=O)O)c1ccccc1 |
Metahydroxy phenylacetic acid | C(C(=O)O)c1cccc(O)c1 |
PHENYLACETIC ACID, SODIUM SALT | C(C(=O)O)c1ccccc1 |
Parahydroxy phenylacetic acid | C(C(=O)O)c1ccc(O)cc1 |
Phenylacetic acid (p-chloro-1-(chloromethyl)ethylidene) hydrazide | C(C(=O)NN=C(CCl)CCl)c1ccccc1 |
Phenylacetic acid 2,2-bis(2-chloroallyl) hydrazide | N(CC(=C)Cl)(CC(=C)Cl)NC(=O)Cc1ccccc1 |
Phenylacetic acid N,N-dimethylamide | C(C(=O)N(C)C)c1ccccc1 |
Phenylacetic acid allyl ester | C(C(=O)OCC=C)c1ccccc1 |
Phenylacetic acid amide | C(C(N)=O)c1ccccc1 |
Phenylacetic acid hydrazide | C(C(=O)NN)c1ccccc1 |
Phenylacetic acid thiomorpholide | C(=S)(Cc1ccccc1)N2CCOCC2 |
Phenylacetic acid | C(C(=O)O)c1ccccc1 |
Phenylacetic acid, ethyl ester | C(C(=O)OCC)c1ccccc1 |
Phenylacetic acid, geranyl ester | C(C(=O)OCC=C(C)CCC=C(C)C)c1ccccc1 |
Phenylacetic acid, isobutyl ester | C(C(=O)OCC(C)C)c1ccccc1 |
Phenylacetic acid, isopentyl ester | C(C(=O)OCCC(C)C)c1ccccc1 |
Phenylacetic acid, m-tolyl ester | O(C(=O)Cc1ccccc1)c2cccc(C)c2 |
Phenylacetic acid, methyl ester | C(C(=O)OC)c1ccccc1 |
Phenylacetic acid, p-tolyl ester | O(C(=O)Cc1ccccc1)c2ccc(C)cc2 |
Phenylacetic acid, phenethyl ester | C(C(=O)OCCc1ccccc1)c2ccccc2 |
Phenylacetic aldehyde dimethyl acetal | C(C(OC)OC)c1ccccc1 |
Phenylacetic aldehyde | C(C=O)c1ccccc1 |
Phenylacetic_acid_N_N-dimethylamide | C(C(=O)N(C)C)c1ccccc1 |
p-(N,N-Di(2-chloroethyl)amino)phenylacetic acid | N(CCCl)(CCCl)c1ccc(cc1)CC(=O)O |