If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Bis(carboxymethyl) trithiocarbonate | C(=S)(SCC(=O)O)SCC(=O)O |
Cyclic ethylene trithiocarbonate | S=C1SCCS1 |
Cylic ethylene trithiocarbonate | S=C1SCCS1 |
Diphenyl trithiocarbonate | S(C(=S)Sc1ccccc1)c2ccccc2 |
Ethyl trithiocarbonate potassium salt | S(CC)C(=S)S |
Ethylene trithiocarbonate | S=C1SCCS1 |
Phenyl trithiocarbonate | S(C(=S)Sc1ccccc1)c2ccccc2 |
Potassium ethyl trithiocarbonate | S(CC)C(=S)S |
Potassium trithiocarbonate (VAN) | C(=S)(S)S |
Trimethylene trithiocarbonate | S=C1SCCCS1 |
cyclic trithiocarbonate-1,2-Propanedithiol | CC1CSC(=S)S1 |