If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Piperidineethanol benzilate (ester), hydrochloride | C(O)(C(=O)OCCN1CCCCC1)(c2ccccc2)c3ccccc3 |
1-Piperidineethanol benzilate hydrochloride | C(O)(C(=O)OCCN1CCCCC1)(c2ccccc2)c3ccccc3 |
1-Piperidineethanol | C(CO)N1CCCCC1 |
1-Piperidineethanol, 4,4'-(1,3-propanediyl)bis- | C(CCC1CCN(CCO)CC1)C2CCN(CCO)CC2 |
1-Piperidineethanol, 4,4'-trimethylenedi- | C(CCC1CCN(CCO)CC1)C2CCN(CCO)CC2 |
1-Piperidineethanol, ALPHA_-((1-naphthyloxy)methyl)-, hydrochloride | O(CC(O)CN1CCCCC1)c2cccc3ccccc23 |
1-Piperidineethanol, ALPHA_-carvacryl-, hydrochloride | C(O)(CN1CCCCC1)c2cc(ccc2C)C(C)C |
1-Piperidineethanol, ALPHA_-phenyl- | C(O)(CN1CCCCC1)c2ccccc2 |
1-Piperidineethanol__4_4'-(1_3-propanediyl)bis- | C(CCC1CCN(CCO)CC1)C2CCN(CCO)CC2 |
2-Piperidineethanol | C(CO)C1CCCCN1 |
2-Piperidineethanol, 1-methyl- | C(CO)C1CCCCN1C |
2-Piperidineethanol__1-methyl- | C(CO)C1CCCCN1C |
4-Piperidineethanol | C(CO)C1CCNCC1 |