If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-(2-Propynyloxy)tetrahydropyran | O(CC#C)C1CCCCO1 |
2-Oxazolidinone, 3-phenyl-5-((2-propynyloxy)methyl)- | O=C1OC(COCC#C)CN1c2ccccc2 |
2-Oxazolidinone__3-phenyl-5-((2-propynyloxy)methyl)- | O=C1OC(COCC#C)CN1c2ccccc2 |
2H-Pyran, tetrahydro-2-(2-propynyloxy)- | O(CC#C)C1CCCCO1 |
Cyclohexanol, 2-(2-propynyloxy)-, trans- | O(CC#C)C1CCCCC1O |
Cyclohexanol__2-(2-propynyloxy)-__trans- | O(CC#C)C1CCCCC1O |
Propanoic acid, 3-(2-propynyloxy)- | C(OCC#C)CC(=O)O |
Propanoic_acid__3-(2-propynyloxy)- | C(OCC#C)CC(=O)O |