If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Conco Sulfate C | C(CCCCCCCCCCCCCC)COS(=O)(=O)O |
Conco Sulfate WAS | C(CCCCCCCCCC)COS(=O)(=O)O |
Conco nix-100 | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Conco sulfate WAS | C(CCCCCCCCCC)COS(=O)(=O)O |
Conco sulfate wa | C(CCCCCCCCCC)COS(=O)(=O)O |
Conco sulfate wa-1200 | C(CCCCCCCCCC)COS(=O)(=O)O |
Conco sulfate wa-1245 | C(CCCCCCCCCC)COS(=O)(=O)O |
Conco sulfate wag | C(CCCCCCCCCC)COS(=O)(=O)O |
Conco sulfate wan | C(CCCCCCCCCC)COS(=O)(=O)O |
Conco sulfate wn | C(CCCCCCCCCC)COS(=O)(=O)O |