If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
6-Azaspiro(2.5)octa-4,7-diene, 6-acetyl-1,1-dimethyl- | CC1(C)CC12C=CN(C=C2)C(C)=O |
6-Azaspiro(2.5)octa-4_7-diene__6-acetyl-1_1-dimethyl- | CC1(C)CC12C=CN(C=C2)C(C)=O |
Bicyclo(4.2.0)octa-1,3,5-trien-7-one | O=C1Cc2ccccc12 |
Bicyclo(4.2.0)octa-1,3,5-triene, 7,7-dichloro- | ClC1(Cl)Cc2ccccc12 |
Bicyclo(4.2.0)octa-1_3_5-trien-7-one | O=C1Cc2ccccc12 |
Bicyclo(4.2.0)octa-1_3_5-triene__7_7-dichloro- | ClC1(Cl)Cc2ccccc12 |
OCTA | N(CC(=O)O)(CC(=O)O)C1CCCCC1N(CC(=O)O)CC(=O)O |
Octa-1,7-diene | C(CC=C)CCC=C |
Octa-Klor | ClC12C(Cl)=C(Cl)C(Cl)(C3C(Cl)C(Cl)CC13)C2(Cl)Cl |
Octa-O-methylsucrose | O(C1OC(COC)C(OC)C(OC)C1OC)C2(COC)OC(COC)C(OC)C2OC |
Octa-klor | ClC12C(Cl)=C(Cl)C(Cl)(C3C(Cl)C(Cl)CC13)C2(Cl)Cl |
Tricyclo(4.2.0.02,5)octa-3,7-diene, 1,2,3,4,5,6,7,8-octamethyl- | CC12C(C)=C(C)C2(C)C3(C)C(C)=C(C)C13C |
Tricyclo(4.2.0.02_5)octa-3_7-diene__1_2_3_4_5_6_7_8-octamethyl- | CC12C(C)=C(C)C2(C)C3(C)C(C)=C(C)C13C |