If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2,5-Dichloro-3-aminobenzoic acid, methyl ester | C(=O)(OC)c1cc(Cl)cc(N)c1Cl |
2-((3-Trifluromethyl)phenyl)aminobenzoic acid | N(c1cccc(c1)C(F)(F)F)c2ccccc2C(=O)O |
2-(2, 6-Dichloro-3-methylphenyl)aminobenzoic acid | N(c1ccccc1C(=O)O)c2c(Cl)ccc(C)c2Cl |
2-Aminobenzoic acid 3-phenyl-2-propenyl ester | C(=O)(OCC=Cc1ccccc1)c2ccccc2N |
2-Aminobenzoic acid hydrazide | C(=O)(NN)c1ccccc1N |
2-Aminobenzoic acid methyl ester | C(=O)(OC)c1ccccc1N |
2-Aminobenzoic acid | C(=O)(O)c1ccccc1N |
2-Aminobenzoic acid, butyl ester | C(=O)(OCCCC)c1ccccc1N |
2-Aminobenzoic acid, ethyl ester | C(=O)(OCC)c1ccccc1N |
2-Chloro-4-aminobenzoic acid | C(=O)(O)c1ccc(N)cc1Cl |
2-Chloro-p-aminobenzoic acid | C(=O)(O)c1ccc(N)cc1Cl |
2-Hydroxy-4-aminobenzoic acid | C(=O)(O)c1ccc(N)cc1O |
3,5-Dichloro-2-aminobenzoic acid | C(=O)(O)c1cc(Cl)cc(Cl)c1N |
3-Acetamido-5-aminobenzoic acid | N(C(C)=O)c1cc(N)cc(c1)C(=O)O |
3-Acetylamino-5-aminobenzoic acid | N(C(C)=O)c1cc(N)cc(c1)C(=O)O |
3-Aminobenzoic acid ethyl ester methanesulfonate | S(C)(=O)(=O)O.CCOC(=O)c1cccc(N)c1 |
3-Aminobenzoic acid | C(=O)(O)c1cccc(N)c1 |
3-Methoxy-2-aminobenzoic acid | C(=O)(O)c1cccc(OC)c1N |
3-Methyl-2-aminobenzoic acid | C(=O)(O)c1cccc(C)c1N |
3-Nitro-4-aminobenzoic acid | [N+](=O)([O-])c1cc(ccc1N)C(=O)O |
4-Aminobenzoic acid diethylaminoethyl ester | C(=O)(OCCN(CC)CC)c1ccc(N)cc1 |
4-Aminobenzoic acid hydrazide | C(=O)(NN)c1ccc(N)cc1 |
4-Aminobenzoic acid methyl ester | C(=O)(OC)c1ccc(N)cc1 |
4-Aminobenzoic acid | C(=O)(O)c1ccc(N)cc1 |
4-Aminobenzoic acid, ethyl ester | C(=O)(OCC)c1ccc(N)cc1 |
5-Bromo-2-aminobenzoic acid | C(=O)(O)c1cc(Br)ccc1N |
5-Chloro-2-aminobenzoic acid | C(=O)(O)c1cc(Cl)ccc1N |
AMINOBENZOIC ACID, PARA | C(=O)(O)c1ccc(N)cc1 |
Aminobenzoic acid | C(=O)(O)c1ccc(N)cc1 |
Ethyl-m-aminobenzoic acid | C(=O)(OCC)c1cccc(N)c1 |
GAMMA_-Aminobenzoic acid | C(=O)(O)c1ccc(N)cc1 |
N, N-Dimethyl-4-aminobenzoic acid | C(=O)(O)c1ccc(cc1)N(C)C |
N, N-Dimethyl-m-aminobenzoic acid | C(=O)(O)c1cccc(c1)N(C)C |
N,N-Dimethyl-p-aminobenzoic acid | C(=O)(O)c1ccc(cc1)N(C)C |
N-((m-Trifluoromethyl)phenyl)-2-aminobenzoic acid | N(c1cccc(c1)C(F)(F)F)c2ccccc2C(=O)O |
N-(2,3-Xylyl)-2-aminobenzoic acid | N(c1cccc(C)c1C)c2ccccc2C(=O)O |
N-(m-(Trifluoromethyl)phenyl)-2-aminobenzoic acid | N(c1cccc(c1)C(F)(F)F)c2ccccc2C(=O)O |
N-Acetyl-m-aminobenzoic acid | N(C(C)=O)c1cccc(c1)C(=O)O |
N-Acetyl-p-aminobenzoic acid | N(C(C)=O)c1ccc(cc1)C(=O)O |
N-Benzylsulfonyl-p-aminobenzoic acid | N(c1ccc(cc1)C(=O)O)S(=O)(=O)Cc2ccccc2 |
N-Methyl-2-aminobenzoic acid | N(C)c1ccccc1C(=O)O |
N-Methyl-4-aminobenzoic acid | C(=O)(O)c1ccc(NC)cc1 |
N-Methyl-o-aminobenzoic acid | N(C)c1ccccc1C(=O)O |
N-Phenyl-o-aminobenzoic acid | N(c1ccccc1)c2ccccc2C(=O)O |
N__N-Dimethyl-m-aminobenzoic_acid | C(=O)(O)c1cccc(c1)N(C)C |
m-Aminobenzoic acid | C(=O)(O)c1cccc(N)c1 |
m-Aminobenzoic acid, ethyl ester | C(=O)(OCC)c1cccc(N)c1 |
o-Aminobenzoic acid copper complex | O=C1O[Cu]2(OC(=O)c3ccccc3N2)Nc4ccccc14 |
o-Aminobenzoic acid hydrazide | C(=O)(NN)c1ccccc1N |
o-Aminobenzoic acid | C(=O)(O)c1ccccc1N |
o-Aminobenzoic acid, methyl ester | C(=O)(OC)c1ccccc1N |
o-Aminobenzoic hydrazide | C(=O)(NN)c1ccccc1N |
o-Aminobenzoic_acid_copper_complex | O=C1O[Cu]2(OC(=O)c3ccccc3N2)Nc4ccccc14 |
o-Chloro-p-aminobenzoic acid | C(=O)(O)c1ccc(N)cc1Cl |
p-Aminobenzoic acid 1-(2,6-dimethyl-4-heptylamino)-2-propyl ester | C(=O)(OC(C)CNC(CC(C)C)CC(C)C)c1ccc(N)cc1 |
p-Aminobenzoic acid 2-(diisopentylamino)ethyl ester hydrochloride | C(=O)(OCCN(CCC(C)C)CCC(C)C)c1ccc(N)cc1 |
p-Aminobenzoic acid 2-(dipentylamino)ethyl ester hydrochloride | C(=O)(OCCN(CCCCC)CCCCC)c1ccc(N)cc1 |
p-Aminobenzoic acid 2-(n-amylamino)ethyl ester | C(=O)(OCCNCCCCC)c1ccc(N)cc1 |
p-Aminobenzoic acid 2-(n-pentylamino)ethyl ester | C(=O)(OCCNCCCCC)c1ccc(N)cc1 |
p-Aminobenzoic acid 2-N-amylaminoethyl ester hydrochloride | C(=O)(OCCNCCCCC)c1ccc(N)cc1 |
p-Aminobenzoic acid 2-N-pentylaminoethyl ester hydrochloride | C(=O)(OCCNCCCCC)c1ccc(N)cc1 |
p-Aminobenzoic acid 2-diethylaminoethyl ester | C(=O)(OCCN(CC)CC)c1ccc(N)cc1 |
p-Aminobenzoic acid 3-(di-2-butyl)aminopropyl ester hydrochloride | N(CCCOC(=O)c1ccc(N)cc1)(C(C)CC)C(C)CC |
p-Aminobenzoic acid amide | C(N)(=O)c1ccc(N)cc1 |
p-Aminobenzoic acid hydrazide | C(=O)(NN)c1ccc(N)cc1 |
p-Aminobenzoic acid methyl ester | C(=O)(OC)c1ccc(N)cc1 |
p-Aminobenzoic acid | C(=O)(O)c1ccc(N)cc1 |
p-Aminobenzoic acid, butyl ester | C(=O)(OCCCC)c1ccc(N)cc1 |
p-Aminobenzoic acid, ethyl ester | C(=O)(OCC)c1ccc(N)cc1 |
p-Aminobenzoic acid, propyl ester | C(=O)(OCCC)c1ccc(N)cc1 |
p-Aminobenzoic diethylaminoethylamide | C(=O)(NCCN(CC)CC)c1ccc(N)cc1 |
p-Aminobenzoic hydrazide | C(=O)(NN)c1ccc(N)cc1 |
p-Aminobenzoic_acid_amide | C(N)(=O)c1ccc(N)cc1 |