If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,3-Dimethyl butylamine | C(C(C)C)C(C)N |
1-Hydroxy-2-butylamine | C(N)(CC)CO |
1-Methyl-n-butylamine | C(CC)C(C)N |
2-Butylamine | C(C)(N)CC |
2-Butylamine, 4-phenyl-, hydrochloride | C(CC(C)N)c1ccccc1 |
4-(Diethoxymethylsilyl)butylamine | [Si](C)(OCC)(OCC)CCCCN |
4-Phenyl-2-butylamine hydrochloride | C(CC(C)N)c1ccccc1 |
BUTYLAMINE | C(CC)CN.F[Si](F)(F)(F)(F)F |
BUTYLAMINE, N | C(CC)CN |
Butylamine | C(CC)CN |
Butylamine, 1,1, 3,3-tetramethyl- | C(C(C)(C)C)C(C)(C)N |
Butylamine, 1,1,2,2,3,3,4,4,4-nonafluoro-N, N-bis(nonafluorobutyl)- | N(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
Butylamine, 1,3-dimethyl- | C(C(C)C)C(C)N |
Butylamine, 1-methyl- | C(CC)C(C)N |
Butylamine, 3-methyl- | C(CN)C(C)C |
Butylamine, 4-(diethoxymethylsilyl)- | [Si](C)(OCC)(OCC)CCCCN |
Butylamine, N-((trimethylsilyl)methyl)-, hydrobromide | N(CCCC)C[Si](C)(C)C |
Butylamine, N-(1,3-dimethylbutylidene)-1,3-dimethyl- | C(C)(CC(C)C)N=C(C)CC(C)C |
Butylamine, N-benzylidene- | C(=NCCCC)c1ccccc1 |
Butylamine, N-butylidene- | N(CCCC)=CCCC |
Butylamine, N-ethyl-N-nitroso- | N(CC)(N=O)CCCC |
Butylamine, N-nitrosodi- | N(N=O)(CCCC)CCCC |
Butylamine, bis(1,3-dimethyl)- | C(C(C)(C)C)C(C)(C)N |
Butylamine__1_1__3_3-tetramethyl- | C(C(C)(C)C)C(C)(C)N |
Butylamine__1_3-dimethyl- | C(C(C)C)C(C)N |
Butylamine__N-(1_3-dimethylbutylidene)-1_3-dimethyl- | C(C)(CC(C)C)N=C(C)CC(C)C |
Di-sec-Butylamine | N(C(C)CC)C(C)CC |
Di-sec-butylamine, N-nitroso- | N(N=O)(C(C)CC)C(C)CC |
Hydroxy-tert-butylamine | C(C)(C)(N)CO |
Mono-n-butylamine | C(CC)CN |
N,N-Bis(2-hydroxyethyl)butylamine | N(CCO)(CCO)CCCC |
N-((Trimethylsilyl)methyl)butylamine hydrobromide | N(CCCC)C[Si](C)(C)C |
N-Nitrosodi-N-butylamine | N(N=O)(CCCC)CCCC |
N-Nitrosoethyl-N-butylamine | N(CC)(N=O)CCCC |
Nitrosodi-N-butylamine | N(N=O)(CCCC)CCCC |
Nitrosodi-sec-butylamine | N(N=O)(C(C)CC)C(C)CC |
n-Butylamine | C(CC)CN |
p-Hydroxyphenyl-n-butylamine | N(CCCC)c1ccc(O)cc1 |
sec-Butylamine | C(C)(N)CC |
t-Butylamine hydrochloride | C(C)(C)(C)N |
tert-Butylamine borane | N(B)C(C)(C)C |
tert-Butylamine | C(C)(C)(C)N |
tert-Butylamine, compd. with borane (1:1) | N(B)C(C)(C)C |
tert-Butylamine, hydrochloride | C(C)(C)(C)N |
tert-Butylamine-borane (1:1) | N(B)C(C)(C)C |