If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Benzophenone-2-carbonic acid | C(=O)(c1ccccc1)c2ccccc2C(=O)O |
Carbonic acid barium salt (1:1) | C(=O)(O)O |
Carbonic acid bis(2-methoxyphenyl) ester | O(C(=O)Oc1ccccc1OC)c2ccccc2OC |
Carbonic acid dicesium salt | C(=O)(O)O |
Carbonic acid diethyl ester | C(=O)(OCC)OCC |
Carbonic acid dirubidium salt | C(=O)(O)O |
Carbonic acid disodium salt | C(=O)(O)O |
Carbonic acid lithium salt (Li2CO3) | C(=O)(O)O |
Carbonic acid sodium salt (VAN) | C(=O)(O)O |
Carbonic acid strontium salt (1:1) | C(=O)(O)O |
Carbonic acid, 2-chloro-4,6-dinitrophenyl 2-chloroethyl ester | O(C(=O)OCCCl)c1c(Cl)cc(cc1[N+](=O)[O-])[N+](=O)[O-] |
Carbonic acid, 4-nitrophenyl phenylmethyl ester | O(C(=O)OCc1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
Carbonic acid, allyl ester, diester with diethylene glycol | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Carbonic acid, barium salt (1:1) | C(=O)(O)O |
Carbonic acid, benzyl p-nitrophenyl ester | O(C(=O)OCc1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
Carbonic acid, beryllium salt (1:1) | C(=O)(O)O |
Carbonic acid, bis(2,2, 2-trichloroethyl) ester | C(=O)(OCC(Cl)(Cl)Cl)OCC(Cl)(Cl)Cl |
Carbonic acid, bis(2,4-dichlorobenzyl) ester | C(OC(=O)OCc1ccc(Cl)cc1Cl)c2ccc(Cl)cc2Cl |
Carbonic acid, bis(2-chloroethyl) ester | C(=O)(OCCCl)OCCCl |
Carbonic acid, bis(2-methylpropyl) ester | C(=O)(OCC(C)C)OCC(C)C |
Carbonic acid, bis(4-nitrophenyl) ester | O(C(=O)Oc1ccc(cc1)[N+](=O)[O-])c2ccc(cc2)[N+](=O)[O-] |
Carbonic acid, bis(o-methoxyphenyl) ester | O(C(=O)Oc1ccccc1OC)c2ccccc2OC |
Carbonic acid, bis(p-aminophenyl) ester, dihydrochloride | O(C(=O)Oc1ccc(N)cc1)c2ccc(N)cc2 |
Carbonic acid, bis(p-nitrophenyl) ester | O(C(=O)Oc1ccc(cc1)[N+](=O)[O-])c2ccc(cc2)[N+](=O)[O-] |
Carbonic acid, bis(phenylmethyl) ester | C(OC(=O)OCc1ccccc1)c2ccccc2 |
Carbonic acid, bismuth salt (3:2) | C(=O)(O)O |
Carbonic acid, bismuth(3+) salt (3:2) | C(=O)(O)O |
Carbonic acid, butyl ethyl ester | O(CCCC)C(=O)OCC |
Carbonic acid, cadmium salt (1:1) | C(=O)(O)O |
Carbonic acid, cadmium salt | C(=O)(O)O |
Carbonic acid, cadmium(2+) salt (1:1) | C(=O)(O)O |
Carbonic acid, cerium(3+) salt (3:2) | C(=O)(O)O |
Carbonic acid, cholesteryl methyl ester | CC12CCC(OC(=O)OC)CC2=CCC3C1CCC4(C)C(CCC34)C(C)CCCC(C)C |
Carbonic acid, cobalt(2+) salt (1:1) | C(=O)(O)O |
Carbonic acid, cobalt(2+) salt | C(=O)(O)O |
Carbonic acid, compd. with aminoguanidine (1:1) | C(=O)(O)O.NNC(=N)N |
Carbonic acid, compd. with guanidine (1:2) | C(=N)(N)N.O=C(O)O |
Carbonic acid, compd. with hydrazinecarboximidamide (1:1) | C(=O)(O)O.NNC(=N)N |
Carbonic acid, cyclic 1,2-dichloroethylene ester | ClC1OC(=O)OC1Cl |
Carbonic acid, cyclic 2-methyl-2-propyltrimethylene ester | C(CC)C1(C)COC(=O)OC1 |
Carbonic acid, cyclic ethylene ester | O=C1OCCO1 |
Carbonic acid, cyclic phenylethylene ester (VAN8CI) | O=C1OCC(O1)c2ccccc2 |
Carbonic acid, cyclic propylene ester | CC1COC(=O)O1 |
Carbonic acid, cyclic vinylene ester | O=C1OC=CO1 |
Carbonic acid, di-2-propenyl ester | C(=O)(OCC=C)OCC=C |
Carbonic acid, diallyl ester | C(=O)(OCC=C)OCC=C |
Carbonic acid, dibenzyl ester | C(OC(=O)OCc1ccccc1)c2ccccc2 |
Carbonic acid, dibutyl ester | O(CCCC)C(=O)OCCCC |
Carbonic acid, dicesium salt | C(=O)(O)O |
Carbonic acid, diester with 4'-hydroxyacetophenone | O(C(=O)Oc1ccc(cc1)C(C)=O)c2ccc(cc2)C(C)=O |
Carbonic acid, diester with ethyl salicylate | C(=O)(OCC)c1ccccc1OC(=O)Oc2ccccc2C(=O)OCC |
Carbonic acid, diethyl ester | C(=O)(OCC)OCC |
Carbonic acid, dihydrazide | C(=O)(NN)NN |
Carbonic acid, diisobutyl ester | C(=O)(OCC(C)C)OCC(C)C |
Carbonic acid, dilithium salt | C(=O)(O)O |
Carbonic acid, dimethyl ester | C(=O)(OC)OC |
Carbonic acid, dipentyl ester | O(CCCCC)C(=O)OCCCCC |
Carbonic acid, diphenyl ester | O(C(=O)Oc1ccccc1)c2ccccc2 |
Carbonic acid, dipropyl ester | C(=O)(OCCC)OCCC |
Carbonic acid, dirubidium salt | C(=O)(O)O |
Carbonic acid, disilver(1+) salt | C(=O)(O)O |
Carbonic acid, disodium salt | C(=O)(O)O |
Carbonic acid, dithallium(1+) salt | C(=O)(O)O |
Carbonic acid, dithio-, O,S-diethyl ester | C(=S)(OCC)SCC |
Carbonic acid, dithio-, O-butyl ester, zinc salt | O(CCCC)C(=S)S |
Carbonic acid, dithio-, O-ethyl ester, nickel(2+) salt | O(CC)C(=S)S |
Carbonic acid, dithio-, O-ethyl ester, potassium salt | O(CC)C(=S)S |
Carbonic acid, dithio-, O-isopropyl ester, potassium salt | O(C(C)C)C(=S)S |
Carbonic acid, dithio-, O-isopropyl ester, sodium salt | O(C(C)C)C(=S)S |
Carbonic acid, dithio-, O-methyl ester, potassium salt | C(=S)(S)OC |
Carbonic acid, dithio-, O-pentyl ester, potassium salt | C(CCCC)OC(=S)S |
Carbonic acid, dithio-, O-sec-butyl ester, potassium salt | C(C)(CC)OC(=S)S |
Carbonic acid, dithio-, S,S-dimethyl ester | C(=O)(SC)SC |
Carbonic acid, dithio-, S-carboxymethyl o-ethyl ester | C(=S)(OCC)SCC(=O)O |
Carbonic acid, ethyl 2-methoxyphenyl ester | O(C(=O)OCC)c1ccccc1OC |
Carbonic acid, ethyl 4-methylphenyl ester | O(C(=O)OCC)c1ccc(C)cc1 |
Carbonic acid, ethyl o-methoxyphenyl ester | O(C(=O)OCC)c1ccccc1OC |
Carbonic acid, ethyl p-tolyl ester | O(C(=O)OCC)c1ccc(C)cc1 |
Carbonic acid, ethylenebis(dithio-, O,O'-dibutyl ester | C(=S)(OCCCC)SCCSC(=S)OCCCC |
Carbonic acid, europium(3+) salt (3:2) | C(=O)(O)O |
Carbonic acid, magnesium salt (1:1) | C(=O)(O)O |
Carbonic acid, magnesium salt | C(=O)(O)O |
Carbonic acid, manganese(2+) salt (1:1) (8CI 9CI) | C(=O)(O)O |
Carbonic acid, monosodium salt | C(=O)(O)O |
Carbonic acid, oxydi-2,1-ethanediyl di-2-propenyl ester | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Carbonic acid, oxydi-2,1-ethanediyl dibutyl ester | O(CCOCCOC(=O)OCCCC)C(=O)OCCCC |
Carbonic acid, oxydiethylene diallyl ester | O(CCOCCOC(=O)OCC=C)C(=O)OCC=C |
Carbonic acid, phenyl ester, diester with diethylene glycol | O(C(=O)OCCOCCOC(=O)Oc1ccccc1)c2ccccc2 |
Carbonic acid, strontium salt (1:1) | C(=O)(O)O |
Carbonic acid, thallium(1+) salt (1:2) | C(=O)(O)O |
Carbonic acid, thio-, O,O-diphenyl ester | O(C(=S)Oc1ccccc1)c2ccccc2 |
Carbonic acid, thio-, O-ethyl S-(1-methylimidazol-2-yl) ester | S(C(=O)OCC)C1=NC=CN1C |
Carbonic acid, thio-, cyclic 0(1), s(2)-3-hydroxy-0-phenylene ester | Oc1cccc2OC(=O)Sc12 |
Carbonic acid, thio-, cyclic 0, S-ester with 2-mercaptoresorcinol | Oc1cccc2OC(=O)Sc12 |
Carbonic acid, trithio-, cyclic ethylene ester | S=C1SCCS1 |
Carbonic acid, trithio-, cyclic propylene ester | CC1CSC(=S)S1 |
Carbonic acid, trithio-, cyclic trimethylene ester | S=C1SCCCS1 |
Carbonic acid, trithio-, diester with mercaptoacetic acid | C(=S)(SCC(=O)O)SCC(=O)O |
Carbonic acid, trithio-, diphenyl ester | S(C(=S)Sc1ccccc1)c2ccccc2 |
Carbonic acid, trithio-, dipotassium salt | C(=S)(S)S |
Carbonic acid, trithio-, mono-tert-butyl-ester, potassium salt | S(C(=S)S)C(C)(C)C |
Carbonic anhydrase inhibitor no. 6063 | S(N)(=O)(=O)C1=NN=C(S1)NC(C)=O |
Carbonic dichloride, (phenylimino)- | N(=C(Cl)Cl)c1ccccc1 |
Carbonic dihydrazide | C(=O)(NN)NN |
Carbonic dihydrazide, 2,2'-bis(4-nitrophenyl)- | N(NC(=O)NNc1ccc(cc1)[N+](=O)[O-])c2ccc(cc2)[N+](=O)[O-] |
Carbonic dihydrazide, 2,2'-diphenyl- | N(NC(=O)NNc1ccccc1)c2ccccc2 |
Carbonic_acid__2-chloro-4_6-dinitrophenyl_2-chloroethyl_ester | O(C(=O)OCCCl)c1c(Cl)cc(cc1[N+](=O)[O-])[N+](=O)[O-] |
Carbonic_acid__4-nitrophenyl_phenylmethyl_ester | O(C(=O)OCc1ccccc1)c2ccc(cc2)[N+](=O)[O-] |
Carbonic_acid__barium_salt_(1:1) | C(=O)(O)O |
Carbonic_acid__beryllium_salt_(1:1) | C(=O)(O)O |
Carbonic_acid__bis(2-chloroethyl)_ester | C(=O)(OCCCl)OCCCl |
Carbonic_acid__bis(2-methylpropyl)_ester | C(=O)(OCC(C)C)OCC(C)C |
Carbonic_acid__bis(2_2__2-trichloroethyl)_ester | C(=O)(OCC(Cl)(Cl)Cl)OCC(Cl)(Cl)Cl |
Carbonic_acid__bis(o-methoxyphenyl)_ester | O(C(=O)Oc1ccccc1OC)c2ccccc2OC |
Carbonic_acid__bis(p-aminophenyl)_ester__dihydrochloride | O(C(=O)Oc1ccc(N)cc1)c2ccc(N)cc2 |
Carbonic_acid__bis(p-nitrophenyl)_ester | O(C(=O)Oc1ccc(cc1)[N+](=O)[O-])c2ccc(cc2)[N+](=O)[O-] |
Carbonic_acid__bis(phenylmethyl)_ester | C(OC(=O)OCc1ccccc1)c2ccccc2 |
Carbonic_acid__bismuth(3+)_salt_(3:2) | C(=O)(O)O |
Carbonic_acid__butyl_ethyl_ester | O(CCCC)C(=O)OCC |
Carbonic_acid__cadmium(2+)_salt_(1:1) | C(=O)(O)O |
Carbonic_acid__cerium(3+)_salt_(3:2) | C(=O)(O)O |
Carbonic_acid__cobalt(2+)_salt_(1:1) | C(=O)(O)O |
Carbonic_acid__compd._with_guanidine_(1:2) | C(=N)(N)N.O=C(O)O |
Carbonic_acid__compd._with_hydrazinecarboximidamide_(1:1) | C(=O)(O)O.NNC(=N)N |
Carbonic_acid__cyclic_1_2-dichloroethylene_ester | ClC1OC(=O)OC1Cl |
Carbonic_acid__cyclic_2-methyl-2-propyltrimethylene_ester | C(CC)C1(C)COC(=O)OC1 |
Carbonic_acid__cyclic_ethylene_ester | O=C1OCCO1 |
Carbonic_acid__cyclic_phenylethylene_ester_(VAN8CI) | O=C1OCC(O1)c2ccccc2 |
Carbonic_acid__cyclic_propylene_ester | CC1COC(=O)O1 |
Carbonic_acid__cyclic_vinylene_ester | O=C1OC=CO1 |
Carbonic_acid__di-2-propenyl_ester | C(=O)(OCC=C)OCC=C |
Carbonic_acid__dibutyl_ester | O(CCCC)C(=O)OCCCC |
Carbonic_acid__dicesium_salt | C(=O)(O)O |
Carbonic_acid__diethyl_ester | C(=O)(OCC)OCC |
Carbonic_acid__dimethyl_ester | C(=O)(OC)OC |
Carbonic_acid__dipentyl_ester | O(CCCCC)C(=O)OCCCCC |
Carbonic_acid__diphenyl_ester | O(C(=O)Oc1ccccc1)c2ccccc2 |
Carbonic_acid__dipropyl_ester | C(=O)(OCCC)OCCC |
Carbonic_acid__dirubidium_salt | C(=O)(O)O |
Carbonic_acid__disilver(1+)_salt | C(=O)(O)O |
Carbonic_acid__dithio-__O-butyl_ester__zinc_salt | O(CCCC)C(=S)S |
Carbonic_acid__dithio-__O-ethyl_ester__nickel(2+)_salt | O(CC)C(=S)S |
Carbonic_acid__dithio-__O-ethyl_ester__potassium_salt | O(CC)C(=S)S |
Carbonic_acid__dithio-__O-methyl_ester__potassium_salt | C(=S)(S)OC |
Carbonic_acid__dithio-__O-pentyl_ester__potassium_salt | C(CCCC)OC(=S)S |
Carbonic_acid__dithio-__O_S-diethyl_ester | C(=S)(OCC)SCC |
Carbonic_acid__dithio-__S-carboxymethyl_o-ethyl_ester | C(=S)(OCC)SCC(=O)O |
Carbonic_acid__dithio-__S_S-dimethyl_ester | C(=O)(SC)SC |
Carbonic_acid__ethyl_4-methylphenyl_ester | O(C(=O)OCC)c1ccc(C)cc1 |
Carbonic_acid__ethyl_o-methoxyphenyl_ester | O(C(=O)OCC)c1ccccc1OC |
Carbonic_acid__europium(3+)_salt_(3:2) | C(=O)(O)O |
Carbonic_acid__magnesium_salt_(1:1) | C(=O)(O)O |
Carbonic_acid__manganese(2+)_salt_(1:1)_(8CI_9CI) | C(=O)(O)O |
Carbonic_acid__monosodium_salt | C(=O)(O)O |
Carbonic_acid__oxydi-2_1-ethanediyl_dibutyl_ester | O(CCOCCOC(=O)OCCCC)C(=O)OCCCC |
Carbonic_acid__phenyl_ester__diester_with_diethylene_glycol | O(C(=O)OCCOCCOC(=O)Oc1ccccc1)c2ccccc2 |
Carbonic_acid__strontium_salt_(1:1) | C(=O)(O)O |
Carbonic_acid__thallium(1+)_salt_(1:2) | C(=O)(O)O |
Carbonic_acid__thio-__O_O-diphenyl_ester | O(C(=S)Oc1ccccc1)c2ccccc2 |
Carbonic_acid__thio-__cyclic_0(1)__s(2)-3-hydroxy-0-phenylene_ester | Oc1cccc2OC(=O)Sc12 |
Carbonic_acid__trithio-__cyclic_ethylene_ester | S=C1SCCS1 |
Carbonic_acid__trithio-__cyclic_propylene_ester | CC1CSC(=S)S1 |
Carbonic_acid__trithio-__cyclic_trimethylene_ester | S=C1SCCCS1 |
Carbonic_acid__trithio-__diester_with_mercaptoacetic_acid | C(=S)(SCC(=O)O)SCC(=O)O |
Carbonic_acid__trithio-__diphenyl_ester | S(C(=S)Sc1ccccc1)c2ccccc2 |
Carbonic_acid__trithio-__dipotassium_salt | C(=S)(S)S |
Carbonic_acid_lithium_salt_(Li2CO3) | C(=O)(O)O |
Carbonic_acid_sodium_salt_(VAN) | C(=O)(O)O |
Carbonic_dihydrazide__2_2'-bis(4-nitrophenyl)- | N(NC(=O)NNc1ccc(cc1)[N+](=O)[O-])c2ccc(cc2)[N+](=O)[O-] |
Carbonic_dihydrazide__2_2'-diphenyl- | N(NC(=O)NNc1ccccc1)c2ccccc2 |
Ethylene carbonic acid | O=C1OCCO1 |
Guaiacol carbonic acid neutral ester | O(C(=O)Oc1ccccc1OC)c2ccccc2OC |
Pyridine-3-carbonic acid | C(=O)(O)c1cccnc1 |