If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Butyne-1,4-diol, bis(p-chlorophenylcarbamate) | N(C(=O)OCC#CCOC(=O)Nc1ccc(Cl)cc1)c2ccc(Cl)cc2 |
2-Butyne-1_4-diol__bis(p-chlorophenylcarbamate) | N(C(=O)OCC#CCOC(=O)Nc1ccc(Cl)cc1)c2ccc(Cl)cc2 |
2-Butynylene 1,4-bis(N-4-chlorophenylcarbamate) | N(C(=O)OCC#CCOC(=O)Nc1ccc(Cl)cc1)c2ccc(Cl)cc2 |
4-Chlorobut-2-ynyl 3-chlorophenylcarbamate | N(C(=O)OCC#CCCl)c1cccc(Cl)c1 |
Isopropyl 3-chlorophenylcarbamate | N(C(=O)OC(C)C)c1cccc(Cl)c1 |
Isopropyl N-4-chlorophenylcarbamate | N(C(=O)OC(C)C)c1ccc(Cl)cc1 |
Isopropyl N-chlorophenylcarbamate | N(C(=O)OC(C)C)c1cccc(Cl)c1 |