If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
ALPHA_-Glyceryl guaiacol ether | O(CC(O)CO)c1ccccc1OC |
GUAIACOL | O(C)c1ccccc1O |
Glyceryl guaiacol ether | O(CC(O)CO)c1ccccc1OC |
Glyceryl guaiacol | O(CC(O)CO)c1ccccc1OC |
Guaiacol acetate | O(C(C)=O)c1ccccc1OC |
Guaiacol allyl ether | O(CC=C)c1ccccc1OC |
Guaiacol benzoate | O(C(=O)c1ccccc1)c2ccccc2OC |
Guaiacol carbonate | O(C(=O)Oc1ccccc1OC)c2ccccc2OC |
Guaiacol carbonic acid neutral ester | O(C(=O)Oc1ccccc1OC)c2ccccc2OC |
Guaiacol ethylene ether | O(CCOc1ccccc1OC)c2ccccc2OC |
Guaiacol glycerin ether | O(CC(O)CO)c1ccccc1OC |
Guaiacol glycerol ether | O(CC(O)CO)c1ccccc1OC |
Guaiacol glyceryl ether carbamate | O(CC(O)COC(N)=O)c1ccccc1OC |
Guaiacol glyceryl ether | O(CC(O)CO)c1ccccc1OC |
Guaiacol salicylate | C(=O)(Oc1ccccc1OC)c2ccccc2O |
Guaiacol salol | C(=O)(Oc1ccccc1OC)c2ccccc2O |
Guaiacol | O(C)c1ccccc1O |
Guaiacol, 4-nitro- | O(C)c1cc(ccc1O)[N+](=O)[O-] |
Guaiacol, 6-allyl- | C(C=C)c1cccc(OC)c1O |
m-Guaiacol | O(C)c1cccc(O)c1 |
o-Guaiacol | O(C)c1ccccc1O |
p-Guaiacol | O(C)c1ccc(O)cc1 |