If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2,4-Dihydroxy-5-bromobenzoic acid | C(=O)(O)c1cc(Br)c(O)cc1O |
2-Acetoxy-5-bromobenzoic acid | O(C(C)=O)c1ccc(Br)cc1C(=O)O |
2-Amino-5-bromobenzoic acid | C(=O)(O)c1cc(Br)ccc1N |
2-Bromobenzoic acid | C(=O)(O)c1ccccc1Br |
2-Hydroxy-5-bromobenzoic acid | C(=O)(O)c1cc(Br)ccc1O |
3-Bromobenzoic acid | C(=O)(O)c1cccc(Br)c1 |
3-Bromobenzoic acid, methyl ester | C(=O)(OC)c1cccc(Br)c1 |
4-Bromobenzoic acid | C(=O)(O)c1ccc(Br)cc1 |
m-Bromobenzoic acid benzoylhydrazide | C(=O)(NNC(=O)c1ccccc1)c2cccc(Br)c2 |
m-Bromobenzoic acid | C(=O)(O)c1cccc(Br)c1 |
o-Bromobenzoic acid | C(=O)(O)c1ccccc1Br |
p-Bromobenzoic acid amide | C(N)(=O)c1ccc(Br)cc1 |
p-Bromobenzoic acid hydrazide | C(=O)(NN)c1ccc(Br)cc1 |
p-Bromobenzoic acid | C(=O)(O)c1ccc(Br)cc1 |
p-Bromobenzoic acid, methyl ester | C(=O)(OC)c1ccc(Br)cc1 |
p-Bromobenzoic_acid_amide | C(N)(=O)c1ccc(Br)cc1 |