If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(o-Chloro-ALPHA_, ALPHA_-diphenylbenzyl)imidazole | C(N1C=CN=C1)(c2ccccc2)(c3ccccc3)c4ccccc4Cl |
Alanine, 3-((p-chloro-ALPHA_,ALPHA_-diphenylbenzyl)thio)-, L- | C(SCC(N)C(=O)O)(c1ccccc1)(c2ccccc2)c3ccc(Cl)cc3 |
Alanine__3-((p-chloro-ALPHA__ALPHA_-diphenylbenzyl)thio)-__L- | C(SCC(N)C(=O)O)(c1ccccc1)(c2ccccc2)c3ccc(Cl)cc3 |
Imidazole, 1-(o-chloro-ALPHA_,ALPHA_-diphenylbenzyl)- | C(N1C=CN=C1)(c2ccccc2)(c3ccccc3)c4ccccc4Cl |
Imidazole__1-(o-chloro-ALPHA__ALPHA_-diphenylbenzyl)- | C(N1C=CN=C1)(c2ccccc2)(c3ccccc3)c4ccccc4Cl |