If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,2,3-Propanetriol | C(O)(CO)CO |
1,2,3-Propanetriol, 1,2-diacetate | C(CO)(COC(C)=O)OC(C)=O |
1,2,3-Propanetriol, 1,3-diphenyl diether | O(CC(O)COc1ccccc1)c2ccccc2 |
1,2,3-Propanetriol, 1-(dihydrogen phosphate) | C(OP(=O)(O)O)C(O)CO |
1,2,3-Propanetriol, 1-acetate | C(O)(CO)COC(C)=O |
1,2,3-Propanetriol, ether with 2-methoxyphenol | O(CC(O)CO)c1ccccc1OC |
1,2,3-Propanetriol, triacetate | C(COC(C)=O)(COC(C)=O)OC(C)=O |
1,2,3-Propanetriol, tribenzoate | C(=O)(OC(COC(=O)c1ccccc1)COC(=O)c2ccccc2)c3ccccc3 |
1,2,3-Propanetriol, tripropanoate | C(COC(=O)CC)(COC(=O)CC)OC(=O)CC |
1_2_3-Propanetriol__1-(dihydrogen_phosphate) | C(OP(=O)(O)O)C(O)CO |
1_2_3-Propanetriol__1-acetate | C(O)(CO)COC(C)=O |
1_2_3-Propanetriol__1_2-diacetate | C(CO)(COC(C)=O)OC(C)=O |
1_2_3-Propanetriol__1_3-diphenyl_diether | O(CC(O)COc1ccccc1)c2ccccc2 |
1_2_3-Propanetriol__ether_with_2-methoxyphenol | O(CC(O)CO)c1ccccc1OC |
1_2_3-Propanetriol__triacetate | C(COC(C)=O)(COC(C)=O)OC(C)=O |
1_2_3-Propanetriol__tribenzoate | C(=O)(OC(COC(=O)c1ccccc1)COC(=O)c2ccccc2)c3ccccc3 |
1_2_3-Propanetriol__tripropanoate | C(COC(=O)CC)(COC(=O)CC)OC(=O)CC |
Dodecanoic acid, monoester with 1,2,3-propanetriol | C(CCCCCCCC)CCC(=O)O.OCC(O)CO |
Dodecanoic_acid__monoester_with_1_2_3-propanetriol | C(CCCCCCCC)CCC(=O)O.OCC(O)CO |
Propanetriol (VAN) | C(O)(CO)CO |