If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Naphthalenepropionic acid | C(CC(=O)O)c1cccc2ccccc12 |
1-Naphthalenepropionic_acid | C(CC(=O)O)c1cccc2ccccc12 |
2-Hydroxy-6-naphthalenepropionic acid | C(CC(=O)O)c1ccc2cc(O)ccc2c1 |
2-Naphthalenepropionic acid | C(CC(=O)O)c1ccc2ccccc2c1 |
2-Naphthalenepropionic acid, 6-hydroxy- | C(CC(=O)O)c1ccc2cc(O)ccc2c1 |
2-Naphthalenepropionic_acid | C(CC(=O)O)c1ccc2ccccc2c1 |
6-Hydroxy-2-naphthalenepropionic acid | C(CC(=O)O)c1ccc2cc(O)ccc2c1 |