If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Hydroxydiphenylmethane | C(c1ccccc1)c2ccc(O)cc2 |
5-Chloro-2-hydroxydiphenylmethane | C(c1ccccc1)c2cc(Cl)ccc2O |
Hydroxydiphenylmethane | C(O)(c1ccccc1)c2ccccc2 |
p-Hydroxydiphenylmethane carbamic acid ester | C(c1ccccc1)c2ccc(cc2)OC(N)=O |
p-Hydroxydiphenylmethane_carbamic_acid_ester | C(c1ccccc1)c2ccc(cc2)OC(N)=O |