If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
5-Pyrimidinecarboxamide | C(N)(=O)c1cncnc1 |
5-Pyrimidinecarboxamide, hexahydro-2,4,6-trioxo-N-phenyl- | c1(ccccc1)NC(=O)c2c(O)nc(O)nc2O |
5-Pyrimidinecarboxamide, hexahydro-4, 6-dioxo-N-phenyl-2-thioxo- | c1(ccccc1)NC(=O)c2c(O)nc(S)nc2O |
5-Pyrimidinecarboxamide__hexahydro-2_4_6-trioxo-N-phenyl- | c1(ccccc1)NC(=O)c2c(O)nc(O)nc2O |
5-Pyrimidinecarboxamide__hexahydro-4__6-dioxo-N-phenyl-2-thioxo- | c1(ccccc1)NC(=O)c2c(O)nc(S)nc2O |