If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,1'-Biphenyl, 4,4'-diisocyanato-3,3'-dimethoxy- | O(C)c1cc(ccc1N=C=O)c2ccc(N=C=O)c(OC)c2 |
1,1'-Biphenyl, 4,4'-diisocyanato-3,3'-dimethyl- | Cc1cc(ccc1N=C=O)c2ccc(N=C=O)c(C)c2 |
2,4-Diisocyanato-1-methylbenzene | N(=C=O)c1cc(N=C=O)ccc1C |
4, 4'-Diisocyanato-3,3'-dimethylbiphenyl | Cc1cc(ccc1N=C=O)c2ccc(N=C=O)c(C)c2 |
4, 4'-Diisocyanato-3,3'-dimethyldiphenylmethane | C(c1ccc(N=C=O)c(C)c1)c2ccc(N=C=O)c(C)c2 |
4,4'-Diisocyanato-3, 3'-dimethoxy-1,1'-biphenyl | O(C)c1cc(ccc1N=C=O)c2ccc(N=C=O)c(OC)c2 |
4,4'-Diisocyanato-3,3'-bitolyl | Cc1cc(ccc1N=C=O)c2ccc(N=C=O)c(C)c2 |
Benzene, 1, 3-diisocyanato- | N(=C=O)c1cccc(N=C=O)c1 |
Benzene, 1, 4-diisocyanato- | N(=C=O)c1ccc(N=C=O)cc1 |
Benzene, 1,4-diisocyanato-2,3,5,6-tetramethyl- | N(=C=O)c1c(C)c(C)c(N=C=O)c(C)c1C |
Benzene, 2,4-diisocyanato-1-methyl- | N(=C=O)c1cc(N=C=O)ccc1C |
Benzene, m-diisocyanato- | N(=C=O)c1cccc(N=C=O)c1 |
Benzene__1_4-diisocyanato-2_3_5_6-tetramethyl- | N(=C=O)c1c(C)c(C)c(N=C=O)c(C)c1C |
Hexane, 1,6-diisocyanato- | C(CCN=C=O)CCCN=C=O |
Naphthalene, 1, 5-diisocyanato- | N(=C=O)c1cccc2c(N=C=O)cccc12 |