If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Methylbenzamide | C(N)(=O)c1ccccc1C |
3-Methylbenzamide | C(N)(=O)c1cccc(C)c1 |
4-Methylbenzamide | C(N)(=O)c1ccc(C)cc1 |
N,N-Diethyl-3-methylbenzamide | C(=O)(N(CC)CC)c1cccc(C)c1 |
N-Methylbenzamide | C(=O)(NC)c1ccccc1 |
m-Methylbenzamide | C(N)(=O)c1cccc(C)c1 |
o-Methylbenzamide | C(N)(=O)c1ccccc1C |
p-Methylbenzamide | C(N)(=O)c1ccc(C)cc1 |