If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Lepidine | Cc1ccnc2ccccc12 |
Lepidine ethiodide | C(C)n1ccc(C)c2ccccc12 |
Lepidine | Cc1ccnc2ccccc12 |
Lepidine, 2-chloro- | Cc1cc(Cl)nc2ccccc12 |
Lepidine, 2-chloro-6-methoxy- | Cc1cc(Cl)nc2ccc(OC)cc12 |
Lepidine, 2-phenyl- | Cc1cc(nc2ccccc12)c3ccccc3 |
Lepidine, 8-nitro- | [N+](=O)([O-])c1cccc2c(C)ccnc12 |
Lepidine, ALPHA_-benzylidene- | C(=Cc1ccccc1)c2ccnc3ccccc23 |
Lepidine__ALPHA_-benzylidene- | C(=Cc1ccccc1)c2ccnc3ccccc23 |