If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
3-(2-Furyl)acrolein | C(=CC=O)C1=CC=CO1 |
ACROLEIN, 2,3-DIHYDROXY- | C(=O)(CO)C=O |
ACROLEIN__2_3-DIHYDROXY- | C(=O)(CO)C=O |
Acrolein 2,4-dinitrophenylhydrazone | N(N=CC=C)c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
Acrolein acetal | C(C=C)(OCC)OCC |
Acrolein diethyl acetal | C(C=C)(OCC)OCC |
Acrolein dimer | C(=O)C1CCC=CO1 |
Acrolein pentaerythritol bisacetal | C(=C)C1OCC2(CO1)COC(C=C)OC2 |
Acrolein phenylhydrazone | N(N=CC=C)c1ccccc1 |
Acrolein | C(=C)C=O |
Acrolein, (2, 4-dinitrophenyl)hydrazone | N(N=CC=C)c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
Acrolein, (p-nitrophenyl)hydrazone | N(N=CC=C)c1ccc(cc1)[N+](=O)[O-] |
Acrolein, 2-ethyl-3-propyl- | C(CC)(C=O)=CCCC |
Acrolein, 2-methyl- | C(C)(=C)C=O |
Acrolein, 3,3-diphenyl- | C(=CC=O)(c1ccccc1)c2ccccc2 |
Acrolein, 3-ethoxy-, diethyl acetal | C(OCC)(OCC)C=COCC |
Acrolein, 3-phenyl- | C(=CC=O)c1ccccc1 |
Acrolein, acrylic acid polymer | C(=C)C=O.C=CC(=O)O |
Acrolein, cyclic diacetal with pentaerythritol | C(=C)C1OCC2(CO1)COC(C=C)OC2 |
Acrolein, cyclic neopentanetetrayl acetal | C(=C)C1OCC2(CO1)COC(C=C)OC2 |
Acrolein, diacetate | C(C=C)(OC(C)=O)OC(C)=O |
Acrolein, diethyl acetal | C(C=C)(OCC)OCC |
Acrolein, formaldehyde polymer | C(=C)C=O.C=O |
Acrolein, monohydrate, diacetate | C(C=C)(OC(C)=O)OC(C)=O |
Acrolein, phenylhydrazone | N(N=CC=C)c1ccccc1 |
Acrolein-pentaerythritol dicyclic acetal | C(=C)C1OCC2(CO1)COC(C=C)OC2 |
Acrolein__(p-nitrophenyl)hydrazone | N(N=CC=C)c1ccc(cc1)[N+](=O)[O-] |
Acrolein__3-ethoxy-__diethyl_acetal | C(OCC)(OCC)C=COCC |
Acrolein__monohydrate__diacetate | C(C=C)(OC(C)=O)OC(C)=O |
BETA_-(o-Methoxyphenyl)acrolein | C(=CC=O)c1ccccc1OC |
BETA_-Methyl acrolein | C(=CC)C=O |
BETA_-Methyl_acrolein | C(=CC)C=O |
Pyran aldehyde (Acrolein dimer) | C(=O)C1CCC=CO1 |
trans-Acrolein | C(=C)C=O |