If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
6-Nonenamide, 8-methyl-N-vanillyl-, (E)- | C(NC(=O)CCCCC=CC(C)C)c1ccc(O)c(OC)c1 |
Nonanamide, N-vanillyl- | C(NC(=O)CCCCCCCC)c1ccc(O)c(OC)c1 |
Vanillyl alcohol | O(C)c1cc(CO)ccc1O |
Vanillyl methyl ketone | C(C(C)=O)c1ccc(O)c(OC)c1 |
Vanillyl n-nonoylamide | C(NC(=O)CCCCCCCC)c1ccc(O)c(OC)c1 |
Vanillyl pelargonic amide | C(NC(=O)CCCCCCCC)c1ccc(O)c(OC)c1 |
Vanillyl_alcohol | O(C)c1cc(CO)ccc1O |