If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Tridecene | C(CCCCCC)CCCCC=C |
2,2,4,10,12,12-Hexamethyl-7-(3,5,5-trimethylhexyl)-6-tridecene | C(CCC(C)CC(C)(C)C)(CCC(C)CC(C)(C)C)=CCC(C)CC(C)(C)C |
6-Tridecene | C(CCCCCC)=CCCCCC |
6-Tridecene, 2,2,4,10,12,12-hexamethyl-7-(3,5,5-trimethylhexyl)- | C(CCC(C)CC(C)(C)C)(CCC(C)CC(C)(C)C)=CCC(C)CC(C)(C)C |
6-Tridecene__2_2_4_10_12_12-hexamethyl-7-(3_5_5-trimethylhexyl)- | C(CCC(C)CC(C)(C)C)(CCC(C)CC(C)(C)C)=CCC(C)CC(C)(C)C |
7-Phenyl-6-tridecene | C(CCCCCC)(=CCCCCC)c1ccccc1 |