If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
ALPHA_-Methacrylic acid | C(C)(=C)C(=O)O |
Methacrylic acid BETA_-chloroethyl ester | C(=O)(OCCCl)C(C)=C |
Methacrylic acid amide | C(C)(=C)C(N)=O |
Methacrylic acid anhydride | C(=O)(OC(=O)C(C)=C)C(C)=C |
Methacrylic acid methyl ester | C(=O)(OC)C(C)=C |
Methacrylic acid | C(C)(=C)C(=O)O |
Methacrylic acid, 1,2, 3-propanetriyl ester | C(COC(=O)C(C)=C)(COC(=O)C(C)=C)OC(=O)C(C)=C |
Methacrylic acid, 2,2,2-trifluoroethyl ester | O(CC(F)(F)F)C(=O)C(C)=C |
Methacrylic acid, 2,3-epoxypropyl ester | C(OC(=O)C(C)=C)C1CO1 |
Methacrylic acid, 2-(diethylamino)ethyl ester | N(CC)(CC)CCOC(=O)C(C)=C |
Methacrylic acid, 2-(dimethylamino)ethyl ester | O(CCN(C)C)C(=O)C(C)=C |
Methacrylic acid, 2-chloroethyl ester | C(=O)(OCCCl)C(C)=C |
Methacrylic acid, 2-ethoxyethyl ester | C(=O)(OCCOCC)C(C)=C |
Methacrylic acid, 2-ethylbutyl ester | C(CC)(CC)COC(=O)C(C)=C |
Methacrylic acid, 2-ethylhexyl ester | C(CC)(CCCC)COC(=O)C(C)=C |
Methacrylic acid, 2-hydroxyethyl ester | C(=O)(OCCO)C(C)=C |
Methacrylic acid, 2-methoxyethyl ester | C(=O)(OCCOC)C(C)=C |
Methacrylic acid, 3-(trimethoxysilyl)propyl ester | [Si](OC)(OC)(OC)CCCOC(=O)C(C)=C |
Methacrylic acid, allyl ester | C(=O)(OCC=C)C(C)=C |
Methacrylic acid, benzyl ester | C(OC(=O)C(C)=C)c1ccccc1 |
Methacrylic acid, butyl ester | C(=O)(OCCCC)C(C)=C |
Methacrylic acid, cyclohexyl ester | O(C(=O)C(C)=C)C1CCCCC1 |
Methacrylic acid, decyl ester | C(CCCCCCCCC)OC(=O)C(C)=C |
Methacrylic acid, diester with tetraethylene glycol | O(CCOCCOCCOCCOC(=O)C(C)=C)C(=O)C(C)=C |
Methacrylic acid, diester with triethylene glycol | O(CCOCCOCCOC(=O)C(C)=C)C(=O)C(C)=C |
Methacrylic acid, dodecyl ester | C(CCCCCCCCCCC)OC(=O)C(C)=C |
Methacrylic acid, ethyl ester | C(=O)(OCC)C(C)=C |
Methacrylic acid, ethylene ester | C(=O)(OCCOC(=O)C(C)=C)C(C)=C |
Methacrylic acid, furfuryl ester | C(OC(=O)C(C)=C)C1=CC=CO1 |
Methacrylic acid, heptyl ester | O(CCCCCCC)C(=O)C(C)=C |
Methacrylic acid, hexyl ester | O(CCCCCC)C(=O)C(C)=C |
Methacrylic acid, isobutyl ester | C(=O)(OCC(C)C)C(C)=C |
Methacrylic acid, isopropyl ester | C(=O)(OC(C)C)C(C)=C |
Methacrylic acid, lauryl ester | C(CCCCCCCCCCC)OC(=O)C(C)=C |
Methacrylic acid, methyl ester | C(=O)(OC)C(C)=C |
Methacrylic acid, oxybis(ethyleneoxyethylene) ester | O(CCOCCOCCOCCOC(=O)C(C)=C)C(=O)C(C)=C |
Methacrylic acid, pentyl ester | C(=O)(OCCCCC)C(C)=C |
Methacrylic acid, phenyl ester | O(C(=O)C(C)=C)c1ccccc1 |
Methacrylic acid, propyl ester | C(=O)(OCCC)C(C)=C |
Methacrylic acid, sec-butyl ester | O(C(C)CC)C(=O)C(C)=C |
Methacrylic acid, tert-butyl ester | C(=O)(OC(C)(C)C)C(C)=C |
Methacrylic acid, tetrahydrofurfuryl ester | C(OC(=O)C(C)=C)C1CCCO1 |
Methacrylic acid, triester with glycerol | C(COC(=O)C(C)=C)(COC(=O)C(C)=C)OC(=O)C(C)=C |
Methacrylic acid, vinyl ester | C(=O)(OC=C)C(C)=C |
Methacrylic aldehyde | C(C)(=C)C=O |
Methacrylic amide | C(C)(=C)C(N)=O |
Methacrylic anhydride | C(=O)(OC(=O)C(C)=C)C(C)=C |
Methacrylic_acid__2-ethylbutyl_ester | C(CC)(CC)COC(=O)C(C)=C |