If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(3,4-Dichlorophenyl)-3-hydroxyurea | N(C(=O)NO)c1ccc(Cl)c(Cl)c1 |
1-Ethyl-1-hydroxyurea | N(O)(CC)C(N)=O |
Hydroxyurea (D4) | C(N)(=O)NO |
Hydroxyurea (USAN) | C(N)(=O)NO |
Hydroxyurea | C(N)(=O)NO |
Hydroxyurea(USAN) | C(N)(=O)NO |
Hydroxyurea(d4) | C(N)(=O)NO |
N-(3,4-Dichlorophenyl)-N'-hydroxyurea | N(C(=O)NO)c1ccc(Cl)c(Cl)c1 |
N-(4-Chlorophenyl)-N'-hydroxyurea | N(C(=O)NO)c1ccc(Cl)cc1 |
N-(p-Chlorophenyl)-N'-hydroxyurea | N(C(=O)NO)c1ccc(Cl)cc1 |
N-Hydroxyurea | C(N)(=O)NO |