If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,1,1-Trichloro-2,3-epoxypropane | C(Cl)(Cl)(Cl)C1CO1 |
1,3-Epoxypropane | C1COC1 |
1-(2-Methylphenoxy)-2,3-epoxypropane | O(CC1CO1)c2ccccc2C |
1-(Allyloxy)-2,3-epoxypropane | C(OCC=C)C1CO1 |
1-(Diethylamino)-2,3-epoxypropane | C(N(CC)CC)C1CO1 |
1-(Trimethylammonio)-2, 3-epoxypropane chloride | C(C1CO1)N(C)(C)C |
1-(o-Methylphenoxy)-2,3-epoxypropane | O(CC1CO1)c2ccccc2C |
1-(p-Nitrophenoxy)-2,3-epoxypropane | [N+](=O)([O-])c1ccc(cc1)OCC2CO2 |
1-Allyloxy-2,3-epoxypropane | C(OCC=C)C1CO1 |
1-Bromo-2,3-epoxypropane | C(Br)C1CO1 |
1-Butoxy-2,3-epoxypropane | C(OCCCC)C1CO1 |
1-Chloro-2,3-epoxypropane | C(Cl)C1CO1 |
1-Diethylamino-2,3-epoxypropane | C(N(CC)CC)C1CO1 |
1-Hydroxy-2,3-epoxypropane | C(O)C1CO1 |
1-Phenoxy-2,3-epoxypropane | O(CC1CO1)c2ccccc2 |
2-Methyl-1, 2-epoxypropane | CC1(C)CO1 |
2-Phenyl-1,2-epoxypropane | CC1(CO1)c2ccccc2 |
3,3, 3-Trichloro-1,2-epoxypropane | C(Cl)(Cl)(Cl)C1CO1 |
3-(2-Diphenylyloxy)-1,2-epoxypropane | O(CC1CO1)c2ccccc2c3ccccc3 |
3-(2-Xenolyl)-1, 2-epoxypropane | O(CC1CO1)c2ccccc2c3ccccc3 |
3-(2-Xenyloxy)-1,2-epoxypropane | O(CC1CO1)c2ccccc2c3ccccc3 |
3-Bromo-1, 2-epoxypropane | C(Br)C1CO1 |
3-Butoxy-1,2-epoxypropane | C(OCCCC)C1CO1 |
3-Chloro-1, 2-epoxypropane | C(Cl)C1CO1 |
3-Diethylamino-1,2-epoxypropane | C(N(CC)CC)C1CO1 |
3-Ethoxy-1,2-epoxypropane | C(OCC)C1CO1 |
3-Hydroxy-1,2-epoxypropane | C(O)C1CO1 |
3-Isopropoxy-1,2-epoxypropane | C(OC(C)C)C1CO1 |
3-Methoxy-1,2-epoxypropane | C(OC)C1CO1 |
3-Phenoxy-1,2-epoxypropane | O(CC1CO1)c2ccccc2 |
3-Phenyloxy-1,2-epoxypropane | O(CC1CO1)c2ccccc2 |
Tetraethylenepentamine, polymer with 1-chloro-2,3-epoxypropane | C(Cl)C1CO1.NCCNCCNCCNCCN |