If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
0, 0-Dimethyl 0-2,2-dichlorovinyl phosphate | P(=O)(OC)(OC)OC=C(Cl)Cl |
1-(2, 5-Dichlorophenyl)-2,2-dichlorovinyl diethyl phosphate | C(OP(=O)(OCC)OCC)(=C(Cl)Cl)c1cc(Cl)ccc1Cl |
2,2-Dichlorovinyl dimethyl phosphate | P(=O)(OC)(OC)OC=C(Cl)Cl |
Alanine, 3-((1,2-dichlorovinyl)thio)-, L- | C(SC(Cl)=CCl)C(N)C(=O)O |
Alanine__3-((1_2-dichlorovinyl)thio)-__L- | C(SC(Cl)=CCl)C(N)C(=O)O |
Dimethyl 2,2-dichlorovinyl phosphate | P(=O)(OC)(OC)OC=C(Cl)Cl |
Dimethyl O, O-dichlorovinyl-2,2-phosphate | P(=O)(OC)(OC)OC=C(Cl)Cl |
Dimethyl dichlorovinyl phosphate | P(=O)(OC)(OC)OC=C(Cl)Cl |
O, O-Dimethyl dichlorovinyl phosphate | P(=O)(OC)(OC)OC=C(Cl)Cl |
Phosphate, 2-2-dichlorovinyl dimethyl | P(=O)(OC)(OC)OC=C(Cl)Cl |
Phosphoric acid 2,2-dichlorovinyl dimethyl ester | P(=O)(OC)(OC)OC=C(Cl)Cl |
Phosphoric acid, 2,2-dichlorovinyl dimethyl ester | P(=O)(OC)(OC)OC=C(Cl)Cl |
Phosphorothioic acid, S-(2, 2-dichlorovinyl) O,O-diethyl ester | P(=O)(OCC)(OCC)SC=C(Cl)Cl |
Phosphorothioic_acid__S-(2__2-dichlorovinyl)_O_O-diethyl_ester | P(=O)(OCC)(OCC)SC=C(Cl)Cl |
S-(1,2-Dichlorovinyl)-L-cysteine | C(SC(Cl)=CCl)C(N)C(=O)O |
S-Dichlorovinyl-L-cysteine | C(SC(Cl)=CCl)C(N)C(=O)O |