If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Cinchonine, compd. with mandelic acid | C(O)(C(=O)O)c1ccccc1.C=CC2CN3CCC2CC3C(O)c4ccnc5ccccc45 |
Cinchonine, salt with 1 f. wt. mandelic acid | C(O)(C(=O)O)c1ccccc1.C=CC2CN3CCC2CC3C(O)c4ccnc5ccccc45 |
MANDELIC ACID | C(O)(C(=O)O)c1ccccc1 |
Mandelic acid isoamyl ester | C(O)(C(=O)OCCC(C)C)c1ccccc1 |
Mandelic acid nitrile | C(O)(C#N)c1ccccc1 |
Mandelic acid | C(O)(C(=O)O)c1ccccc1 |
Mandelic acid, 2-chloroethyl ester | C(O)(C(=O)OCCCl)c1ccccc1 |
Mandelic acid, ALPHA_-methyl- | C(C)(O)(C(=O)O)c1ccccc1 |
Mandelic acid, ALPHA_-methyl-, DL- | C(C)(O)(C(=O)O)c1ccccc1 |
Mandelic acid, ALPHA_-phenyl- | C(O)(C(=O)O)(c1ccccc1)c2ccccc2 |
Mandelic acid, benzyl ester | C(O)(C(=O)OCc1ccccc1)c2ccccc2 |
Mandelic acid, butyl ester | C(O)(C(=O)OCCCC)c1ccccc1 |
Mandelic acid, ethyl ester | C(O)(C(=O)OCC)c1ccccc1 |
Mandelic acid, hexyl ester | C(O)(C(=O)OCCCCCC)c1ccccc1 |
Mandelic acid, isopentyl ester | C(O)(C(=O)OCCC(C)C)c1ccccc1 |
Mandelic acid, isopropyl ester | C(O)(C(=O)OC(C)C)c1ccccc1 |
Mandelic acid, methyl ester | C(O)(C(=O)OC)c1ccccc1 |
Mandelic acid, p-bromo- | C(O)(C(=O)O)c1ccc(Br)cc1 |
Mandelic acid, p-chloro- | C(O)(C(=O)O)c1ccc(Cl)cc1 |
Racemic mandelic acid | C(O)(C(=O)O)c1ccccc1 |
p-Mandelic acid | C(O)(C(=O)O)c1ccccc1 |