If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
D-Homoserine | C(N)(CCO)C(=O)O |
DL-Homoserine | C(N)(CCO)C(=O)O |
Homoserine (VAN) | C(N)(CCO)C(=O)O |
Homoserine, O-methyl- | C(N)(CCOC)C(=O)O |
L-Homoserine | C(N)(CCO)C(=O)O |
p-Isothiocyanatobenzoyl-DL-homoserine lactone | N(C(=O)c1ccc(N=C=S)cc1)C2CCOC2=O |
p-Isothiocyanatobenzoyl-DL-homoserine_lactone | N(C(=O)c1ccc(N=C=S)cc1)C2CCOC2=O |