If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(+-)-Isoproterenol hydrochloride | C(O)(CNC(C)C)c1ccc(O)c(O)c1 |
(.+-.)-Isoproterenol hydrochloride | C(O)(CNC(C)C)c1ccc(O)c(O)c1 |
DL-Isoproterenol hydrochloride | C(O)(CNC(C)C)c1ccc(O)c(O)c1 |
Isoproterenol (VAN) | C(O)(CNC(C)C)c1ccc(O)c(O)c1 |
Isoproterenol hydrochloride | C(O)(CNC(C)C)c1ccc(O)c(O)c1 |
Isoproterenol monohydrochloride | C(O)(CNC(C)C)c1ccc(O)c(O)c1 |
L-Isoproterenol | C(O)(CNC(C)C)c1ccc(O)c(O)c1 |
dl-Isoproterenol hydrochloride | C(O)(CNC(C)C)c1ccc(O)c(O)c1 |