If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Benzylideneamino-1-methyl-2-nitroguanidine | C(=NN(C)C(=N)NN(O)O)c1ccccc1 |
4-(Benzylideneamino)antipyrine | O=C1C(N=Cc2ccccc2)=C(C)N(C)N1c3ccccc3 |
Antipyrine, 4-(benzylideneamino)- | O=C1C(N=Cc2ccccc2)=C(C)N(C)N1c3ccccc3 |
Ethyl p-(N-benzylideneamino)benzoate | C(=O)(OCC)c1ccc(cc1)N=Cc2ccccc2 |
Phenol, p-(benzylideneamino)- | N(=Cc1ccccc1)c2ccc(O)cc2 |
p-(Benzylideneamino)phenol | N(=Cc1ccccc1)c2ccc(O)cc2 |