If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Indanol | OC1CCc2ccccc12 |
1-Indanol, 2-dimethylamino-, benzoate, hydrochloride, (Z)- | O(C(=O)c1ccccc1)C2C(Cc3ccccc23)N(C)C |
1-Morpholino-2-indanol hydrochloride | OC1Cc2ccccc2C1N3CCOCC3 |
2-Indanol | OC1Cc2ccccc2C1 |
2-Indanol, 1-morpholino-, hydrochloride | OC1Cc2ccccc2C1N3CCOCC3 |
4-Indanol | Oc1cccc2CCCc12 |
4-Indanol, 7-chloro- | Clc1ccc(O)c2CCCc12 |
5-Indanol | Oc1ccc2CCCc2c1 |
7-Chloro-4-indanol | Clc1ccc(O)c2CCCc12 |