If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(4-Aminobenzenesulfonyl)urea | S(=O)(=O)(NC(N)=O)c1ccc(N)cc1 |
4-Aminobenzenesulfonyl fluoride | S(F)(=O)(=O)c1ccc(N)cc1 |
N'-(4-Aminobenzenesulfonyl)-N-butylurea | S(=O)(=O)(NC(=O)NCCCC)c1ccc(N)cc1 |
N-(4-Aminobenzenesulfonyl)-N'-butylurea | S(=O)(=O)(NC(=O)NCCCC)c1ccc(N)cc1 |
N-(p-Aminobenzenesulfonyl)benzamide | S(=O)(=O)(NC(=O)c1ccccc1)c2ccc(N)cc2 |
m-Aminobenzenesulfonyl fluoride | S(F)(=O)(=O)c1cccc(N)c1 |
p-Aminobenzenesulfonyl fluoride | S(F)(=O)(=O)c1ccc(N)cc1 |