If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
Aldrin mixture, dry (DOT) | ClC12C(Cl)=C(Cl)C(Cl)(C3C4C=CC(C4)C13)C2(Cl)Cl |
Aldrin mixture, liquid (DOT) | ClC12C(Cl)=C(Cl)C(Cl)(C3C4C=CC(C4)C13)C2(Cl)Cl |
Calcium cyanide (mixture) | [Ca](C#N)C#N |
Calcium cyanide mixture, solid (DOT) | [Ca](C#N)C#N |
Calcium hypochlorite mixture, dry (DOT) | ClO |
Calcium_cyanide_mixture__solid_(DOT) | [Ca](C#N)C#N |
Calcium_hypochlorite_mixture__dry_(DOT) | ClO |
Cyclohexanone cyclohexanol mixture | OC1CCCCC1 |
Cyclohexanone_cyclohexanol_mixture | OC1CCCCC1 |
D-d Mixture | C(C)(Cl)CCl |
Linalyl, neryl, geranyl acetates, mixture | C(C)(CCC=C(C)C)=CCOC(C)=O |
Methanol-water mixture | CO |
Mixture of sulfadiazine, sulfamerazine, and sulfamethazine | S(=O)(=O)(Nc1ncccn1)c2ccc(N)cc2 |
Mixture_of_sulfadiazine__sulfamerazine__and_sulfamethazine | S(=O)(=O)(Nc1ncccn1)c2ccc(N)cc2 |
Pyrophosphoric acid, tetraethyl ester (dry mixture) | O(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
Pyrophosphoric acid, tetraethyl ester (liquid mixture) | O(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
Pyrophosphoric acid, tetraethyldithio-, (liquid mixture) | O(P(=S)(OCC)OCC)P(=S)(OCC)OCC |
Pyrophosphoric_acid__tetraethyldithio-__(liquid_mixture) | O(P(=S)(OCC)OCC)P(=S)(OCC)OCC |
STREPTOZOTOCIN (ZELALAN MIXTURE) | C(C=O)(NC(=O)N(C)N=O)C(O)C(O)C(O)CO |
Tetraethyl dithiopyrophosphate mixture, liquid (DOT) | O(P(=S)(OCC)OCC)P(=S)(OCC)OCC |
Tetraethyl pyrophosphate mixture, dry (DOT) | O(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
Tetraethyl pyrophosphate mixture, liquid (DOT) | O(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
Tordon 101 mixture | C(=O)(O)c1nc(Cl)c(Cl)c(N)c1Cl |
p,p'-DDE-p, p'-DDT mixture | C(=C(Cl)Cl)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |