If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Phenylvinyl acetate | C(=C)(OC(C)=O)c1ccccc1 |
2-Phenylvinyl methyl ketone | C(=CC(C)=O)c1ccccc1 |
2-Phenylvinyl_methyl_ketone | C(=CC(C)=O)c1ccccc1 |
4-(2-Phenylvinyl)pyridine | C(=Cc1ccncc1)c2ccccc2 |
Bis(2-phenylvinyl) ketone | C(=CC(=O)C=Cc1ccccc1)c2ccccc2 |
Ethyl 2-phenylvinyl ketone | C(=CC(=O)CC)c1ccccc1 |