If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Lauroylamidopropyl betaine | N(C)(C)(CCCNC(=O)CCCCCCCCCCC)CC(=O)O |
BETAINE HYDRATE | C(C(=O)O)N(C)(C)C |
Betaine (VAN8CI) | C(C(=O)O)N(C)(C)C |
Betaine chloride | C(C(=O)O)N(C)(C)C |
Betaine hydrazide hydrochloride | C(C(=O)NN)N(C)(C)C |
Betaine hydrochloride | C(C(=O)O)N(C)(C)C |
Betaine, hydrochloride | C(C(=O)O)N(C)(C)C |
Glycine betaine | C(C(=O)O)N(C)(C)C |
Glycocoll betaine | C(C(=O)O)N(C)(C)C |
Histidine, 2-mercapto-N,N-dimethyl-, betaine | C(CC1=CNC(=S)N1)(C(=O)O)N(C)(C)C |
Piperazine-1-carbodithioic acid betaine | C(=S)(S)N1CCNCC1 |
Piperazine-1-carbodithioic_acid_betaine | C(=S)(S)N1CCNCC1 |
Thiolhistidine-betaine | C(CC1=CNC(=S)N1)(C(=O)O)N(C)(C)C |