If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(3-Ethyl-n-heptyl)methylcarbinol | C(CC)(CCCC)CCC(C)O |
1-Heptanamine, N-heptyl- | N(CCCCCCC)CCCCCCC |
1-Heptanamine__N-heptyl- | N(CCCCCCC)CCCCCCC |
1-Heptyl acetate | C(CCCCC)COC(C)=O |
1-Undecanol, 2-heptyl- | C(CO)(CCCCCCC)CCCCCCCCC |
1-Undecanol__2-heptyl- | C(CO)(CCCCCCC)CCCCCCCCC |
10-n-Heptyl-10-n-octyleicosane | C(CCCCCCC)(CCCCCCCC)(CCCCCCCCC)CCCCCCCCCC |
2-(n-Heptyl)cyclopentanone | C(CCCCCC)C1CCCC1=O |
2-Heptyl alcohol | C(CCCC)C(C)O |
2-Heptyl bromide | C(CCCC)C(Br)C |
2-Heptyl-1-undecanol | C(CO)(CCCCCCC)CCCCCCCCC |
2-Propenoic acid, 2-methyl-, heptyl ester | O(CCCCCCC)C(=O)C(C)=C |
2-Propenoic acid, heptyl ester | C(CCCCC)COC(=O)C=C |
2-Propenoic_acid__2-methyl-__heptyl_ester | O(CCCCCCC)C(=O)C(C)=C |
2-Propenoic_acid__heptyl_ester | C(CCCCC)COC(=O)C=C |
Acetic acid, heptyl ester | C(CCCCC)COC(C)=O |
Acetic_acid__heptyl_ester | C(CCCCC)COC(C)=O |
Acrylic acid, heptyl ester | C(CCCCC)COC(=O)C=C |
Ammonium, (2-(p-chlorocinnamoyl)heptyl)trimethyl-, iodide, (E)- | C(CCCCC)(CN(C)(C)C)C(=O)C=Cc1ccc(Cl)cc1 |
Ammonium__(2-(p-chlorocinnamoyl)heptyl)trimethyl-__iodide__(E)- | C(CCCCC)(CN(C)(C)C)C(=O)C=Cc1ccc(Cl)cc1 |
Aniline, N-heptyl- | N(CCCCCCC)c1ccccc1 |
Benzenamine, N-heptyl- | N(CCCCCCC)c1ccccc1 |
Benzene, heptyl- | C(CCCCCC)c1ccccc1 |
Benzeneacetic acid, heptyl ester | C(C(=O)OCCCCCCC)c1ccccc1 |
Benzeneacetic_acid__heptyl_ester | C(C(=O)OCCCCCCC)c1ccccc1 |
Benzoic acid, 4-hydroxy-, heptyl ester | C(=O)(OCCCCCCC)c1ccc(O)cc1 |
Benzoic acid, 4-methoxy-, heptyl ester | C(=O)(OCCCCCCC)c1ccc(OC)cc1 |
Benzoic acid, p-hydroxy-, heptyl ester | C(=O)(OCCCCCCC)c1ccc(O)cc1 |
Benzoic_acid__4-methoxy-__heptyl_ester | C(=O)(OCCCCCCC)c1ccc(OC)cc1 |
Benzoic_acid__p-hydroxy-__heptyl_ester | C(=O)(OCCCCCCC)c1ccc(O)cc1 |
Bis(2,6-dimethyl-4-heptyl)phosphoric acid | C(CC(C)C)(CC(C)C)OP(=O)(O)OC(CC(C)C)CC(C)C |
Butyl heptyl ketone | C(=O)(CCCC)CCCCCCC |
Butyl_heptyl_ketone | C(=O)(CCCC)CCCCCCC |
CHAPARRINONE, 15-HEPTYL- | CC12C(O)C(=O)C=C(C)C2CC3OC(=O)C(CCCCCCC)C4C(C)C(O)C5(O)OCC34C15 |
Carbamothioic acid, heptyl-, O-ethyl ester | C(=S)(OCC)NCCCCCCC |
Cyclohexane, heptyl- | C(CCCCCC)C1CCCCC1 |
Cyclopentanone, 2-heptyl- | C(CCCCCC)C1CCCC1=O |
Cyclopentanone, 2-n-heptyl- | C(CCCCCC)C1CCCC1=O |
Di-n-heptyl ether | O(CCCCCCC)CCCCCCC |
Di-n-heptyl ketone | C(=O)(CCCCCCC)CCCCCCC |
Di-n-heptyl_ketone | C(=O)(CCCCCCC)CCCCCCC |
Eicosane, 10-heptyl-10-octyl- | C(CCCCCCC)(CCCCCCCC)(CCCCCCCCC)CCCCCCCCCC |
Ether, di-n-heptyl | O(CCCCCCC)CCCCCCC |
Formamide, N-heptyl- | C(CCCC)CCNC=O |
Formamide__N-heptyl- | C(CCCC)CCNC=O |
GAMMA_-Heptyl-GAMMA_-butyrolactone | C(CCCCCC)C1CCC(=O)O1 |
HEPTYL ALCOHOL, N- | C(CCC)CCCO |
HEPTYL_ALCOHOL__N- | C(CCC)CCCO |
Heptyl 4-hydroxybenzoate | C(=O)(OCCCCCCC)c1ccc(O)cc1 |
Heptyl acetate | C(CCCCC)COC(C)=O |
Heptyl acrylate | C(CCCCC)COC(=O)C=C |
Heptyl alcohol | C(CCC)CCCO |
Heptyl aldehyde | C(CCC)CCC=O |
Heptyl bromide | C(CCBr)CCCC |
Heptyl caprylate | C(=O)(CCCCCCC)OCCCCCCC |
Heptyl carbinol | C(CCCC)CCCO |
Heptyl disulfide | S(CCCCCCC)SCCCCCCC |
Heptyl ether | O(CCCCCCC)CCCCCCC |
Heptyl hydride | C(CCC)CCC |
Heptyl iodide | C(CCC)CCCI |
Heptyl ketone | C(=O)(CCCCCCC)CCCCCCC |
Heptyl mercaptan | C(CCC)CCCS |
Heptyl methacrylate | O(CCCCCCC)C(=O)C(C)=C |
Heptyl methyl ketone | C(CCCCC)CC(C)=O |
Heptyl octanoate | C(=O)(CCCCCCC)OCCCCCCC |
Heptyl p-hydroxybenzoate | C(=O)(OCCCCCCC)c1ccc(O)cc1 |
Heptyl paraben | C(=O)(OCCCCCCC)c1ccc(O)cc1 |
Heptyl phenyl ketone | C(=O)(CCCCCCC)c1ccccc1 |
Heptyl phenylacetate | C(C(=O)OCCCCCCC)c1ccccc1 |
Heptyl propyl ketone | C(=O)(CCC)CCCCCCC |
Heptyl sulfoxide | S(=O)(CCCCCCC)CCCCCCC |
Heptyl thiol | C(CCC)CCCS |
Heptyl valerate | C(=O)(CCCC)OCCCCCCC |
Heptyl_propyl_ketone | C(=O)(CCC)CCCCCCC |
Heptyl_sulfoxide | S(=O)(CCCCCCC)CCCCCCC |
Hydrazine, heptyl- | C(CCCC)CCNN |
Hydrazine__heptyl- | C(CCCC)CCNN |
Isobutyl heptyl ketone | C(C)(CC(C)C)CC(=O)CC(C)C |
Ketone, heptyl methyl | C(CCCCC)CC(C)=O |
Ketone, heptyl phenyl | C(=O)(CCCCCCC)c1ccccc1 |
Ketone__heptyl_phenyl | C(=O)(CCCCCCC)c1ccccc1 |
METHYL N-HEPTYL KETONE | C(CCCCC)CC(C)=O |
Malonic acid, heptyl- | C(CCCCCCC)(C(=O)O)C(=O)O |
Methacrylic acid, heptyl ester | O(CCCCCCC)C(=O)C(C)=C |
Methyl heptyl ketone | C(CCCCC)CC(C)=O |
Methyl n-heptyl ketone | C(CCCCC)CC(C)=O |
Methyl_n-heptyl_ketone | C(CCCCC)CC(C)=O |
N-Heptyl-o-ethylthionocarbamate | C(=S)(OCC)NCCCCCCC |
Octadecane, 9-ethyl-9-heptyl- | C(CC)(CCCCCCC)(CCCCCCCC)CCCCCCCCC |
Octadecane__9-ethyl-9-heptyl- | C(CC)(CCCCCCC)(CCCCCCCC)CCCCCCCCC |
Octanoic acid, heptyl ester | C(=O)(CCCCCCC)OCCCCCCC |
Octanoic_acid__heptyl_ester | C(=O)(CCCCCCC)OCCCCCCC |
Pentanoic acid, heptyl ester | C(=O)(CCCC)OCCCCCCC |
Pentanoic_acid__heptyl_ester | C(=O)(CCCC)OCCCCCCC |
Phosphoric acid, bis(2, 6-dimethyl-4-heptyl) ester | C(CC(C)C)(CC(C)C)OP(=O)(O)OC(CC(C)C)CC(C)C |
Propanedioic acid, heptyl- | C(CCCCCCC)(C(=O)O)C(=O)O |
Valeric acid, heptyl ester | C(=O)(CCCC)OCCCCCCC |
n-Heptyl acetate | C(CCCCC)COC(C)=O |
n-Heptyl acrylate | C(CCCCC)COC(=O)C=C |
n-Heptyl alcohol | C(CCC)CCCO |
n-Heptyl bromide | C(CCBr)CCCC |
n-Heptyl ethanoate | C(CCCCC)COC(C)=O |
n-Heptyl iodide | C(CCC)CCCI |
n-Heptyl methacrylate | O(CCCCCCC)C(=O)C(C)=C |
n-Heptyl p-hydroxybenzoate | C(=O)(OCCCCCCC)c1ccc(O)cc1 |
s-Heptyl alcohol | C(CCCC)C(C)O |