If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Heptanol, 1H,1H,7H-dodecafluoro- | C(F)(F)(C(F)(F)C(F)(F)CO)C(F)(F)C(F)(F)C(F)F |
1-Heptanol, 2,2,3,3,4,4,5,5,6, 6,7,7-dodecafluoro- | C(F)(F)(C(F)(F)C(F)(F)CO)C(F)(F)C(F)(F)C(F)F |
1-Heptanol__2_2_3_3_4_4_5_5_6__6_7_7-dodecafluoro- | C(F)(F)(C(F)(F)C(F)(F)CO)C(F)(F)C(F)(F)C(F)F |
1H,1H, 7H-Dodecafluoro-1-heptanol | C(F)(F)(C(F)(F)C(F)(F)CO)C(F)(F)C(F)(F)C(F)F |
1H,1H, 7H-Dodecafluoro-1-hydroxyheptane | C(F)(F)(C(F)(F)C(F)(F)CO)C(F)(F)C(F)(F)C(F)F |
2,2,3,3,4,4,5,5,6,6,7, 7-Dodecafluoro-1-heptanol | C(F)(F)(C(F)(F)C(F)(F)CO)C(F)(F)C(F)(F)C(F)F |
Cyclohexane, dodecafluoro- | FC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
Cyclohexane__dodecafluoro- | FC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |