If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
ISOPHTHALIC ACID, 4-HYDROXY-5-METHYL- | C(=O)(O)c1cc(cc(C)c1O)C(=O)O |
ISOPHTHALIC_ACID__4-HYDROXY-5-METHYL- | C(=O)(O)c1cc(cc(C)c1O)C(=O)O |
Isophthalic acid chloride | C(Cl)(=O)c1cccc(c1)C(Cl)=O |
Isophthalic acid dichloride | C(Cl)(=O)c1cccc(c1)C(Cl)=O |
Isophthalic acid dihydrazide | C(=O)(NN)c1cccc(c1)C(=O)NN |
Isophthalic acid dimethyl ester | C(=O)(OC)c1cccc(c1)C(=O)OC |
Isophthalic acid hydrazide | C(=O)(NN)c1cccc(c1)C(=O)NN |
Isophthalic acid | C(=O)(O)c1cccc(c1)C(=O)O |
Isophthalic acid, 4-chloro- | C(=O)(O)c1cc(ccc1Cl)C(=O)O |
Isophthalic acid, 4-hydroxy- | C(=O)(O)c1cc(ccc1O)C(=O)O |
Isophthalic acid, 4-hydroxy-, diethyl ester | C(=O)(OCC)c1cc(ccc1O)C(=O)OCC |
Isophthalic acid, 4-hydroxy-, dimethyl ester | C(=O)(OC)c1cc(ccc1O)C(=O)OC |
Isophthalic acid, 5-amino- | C(=O)(O)c1cc(N)cc(c1)C(=O)O |
Isophthalic acid, 5-amino-, dimethyl ester | C(=O)(OC)c1cc(N)cc(c1)C(=O)OC |
Isophthalic acid, 5-hydroxy- | C(=O)(O)c1cc(O)cc(c1)C(=O)O |
Isophthalic acid, 5-methyl- | C(=O)(O)c1cc(C)cc(c1)C(=O)O |
Isophthalic acid, 5-nitro- | C(=O)(O)c1cc(cc(c1)[N+](=O)[O-])C(=O)O |
Isophthalic acid, 5-nitro-, dimethyl ester | C(=O)(OC)c1cc(cc(c1)C(=O)OC)[N+](=O)[O-] |
Isophthalic acid, bis(2-ethylhexyl) ester | C(=O)(OCC(CC)CCCC)c1cccc(c1)C(=O)OCC(CC)CCCC |
Isophthalic acid, bis(2-ethylhexyl)ester | C(=O)(OCC(CC)CCCC)c1cccc(c1)C(=O)OCC(CC)CCCC |
Isophthalic acid, di-(2-ethylhexyl)ester | C(=O)(OCC(CC)CCCC)c1cccc(c1)C(=O)OCC(CC)CCCC |
Isophthalic acid, diallyl ester | C(=O)(OCC=C)c1cccc(c1)C(=O)OCC=C |
Isophthalic acid, didecyl ester | C(=O)(OCCCCCCCCCC)c1cccc(c1)C(=O)OCCCCCCCCCC |
Isophthalic acid, diethyl ester | C(=O)(OCC)c1cccc(c1)C(=O)OCC |
Isophthalic acid, dihydrazide | C(=O)(NN)c1cccc(c1)C(=O)NN |
Isophthalic acid, dimethyl ester | C(=O)(OC)c1cccc(c1)C(=O)OC |
Isophthalic acid, diphenyl ester | C(=O)(Oc1ccccc1)c2cccc(c2)C(=O)Oc3ccccc3 |
Isophthalic chloride | C(Cl)(=O)c1cccc(c1)C(Cl)=O |
Isophthalic dihydrazide | C(=O)(NN)c1cccc(c1)C(=O)NN |
Isophthalic hydrazide | C(=O)(NN)c1cccc(c1)C(=O)NN |