If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Benzothiazolinethione | S=C1Nc2ccccc2S1 |
2-Benzothiazolinethione, 3-(morpholinomethyl)- | C(N1CCOCC1)N2C(=S)Sc3ccccc23 |
2-Benzothiazolinethione, 3-methyl- | CN1C(=S)Sc2ccccc12 |
2-Benzothiazolinethione, 6-nitro- | [N+](=O)([O-])c1ccc2NC(=S)Sc2c1 |
2-Benzothiazolinethione__3-(morpholinomethyl)- | C(N1CCOCC1)N2C(=S)Sc3ccccc23 |