If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(2-Hydroxybut-1-enyl)aziridine | C(C(O)C=C)N1CC1 |
1-(Cyclopent-1'-enyl)pyrrolidine | C1(=CCCC1)N2CCCC2 |
2-(Cyclohex-1-enyl)cyclohexanone | O=C1CCCCC1C2=CCCCC2 |
Aziridine, 1-(2-hydroxybut-1-enyl)- | C(C(O)C=C)N1CC1 |
Aziridine__1-(2-hydroxybut-1-enyl)- | C(C(O)C=C)N1CC1 |
Caffeine, 8-(prop-1-enyl)- | CN1C(=O)N(C)C(=O)C2=C1N=C(C=CC)N2C |
Diethyl 2-(prop-2-enyl)malonate | C(CC=C)(C(=O)OCC)C(=O)OCC |
Undec-10-enyl propanoate | C(CCCCCCCC=C)COC(=O)CC |
trans-Bicyclo(2.2.1)hept-5-enyl-2,3-dicarbonylchloride | C(Cl)(=O)C1C2C=CC(C2)C1C(Cl)=O |