If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Butanesulfonic acid , 3-methyl-, 1,4-butanediyl ester | S(=O)(=O)(OCCCCOS(=O)(=O)CCC(C)C)CCC(C)C |
1-Butanesulfonic acid, 2-nitro-, ammonium salt | C(CC)(CS(=O)(=O)O)[N+](=O)[O-] |
1-Butanesulfonic acid, 3-methyl-, sodium salt | C(CC(C)C)S(=O)(=O)O |
1-Butanesulfonic acid, 3-methyl-, tetramethylene ester | S(=O)(=O)(OCCCCOS(=O)(=O)CCC(C)C)CCC(C)C |
1-Butanesulfonic_acid__2-nitro-__ammonium_salt | C(CC)(CS(=O)(=O)O)[N+](=O)[O-] |
1-Butanesulfonic_acid__3-methyl-__sodium_salt | C(CC(C)C)S(=O)(=O)O |
1-Butanesulfonic_acid___3-methyl-__1_4-butanediyl_ester | S(=O)(=O)(OCCCCOS(=O)(=O)CCC(C)C)CCC(C)C |
Butanesulfonic acid, 2-nitro-, ammonium salt | C(CC)(CS(=O)(=O)O)[N+](=O)[O-] |