If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
WLN: T6MVMVJ EF | Oc1nc(O)ncc1F |
WLN: T6MVMVJ EN2G2G F1 | N(CCCl)(CCCl)c1c(C)nc(O)nc1O |
WLN: T6MVMVJ EN2G2G | N(CCCl)(CCCl)c1cnc(O)nc1O |
WLN: T6MVMVJ ENUM | N(=N)=C1C=NC(=O)NC1=O |
WLN: T6MVMVJ EXFFF | C(F)(F)(F)c1cnc(O)nc1O |
WLN: T6MVMVJ F1 | Cc1cc(O)nc(O)n1 |
WLN: T6MVMVJ FI | Oc1nc(O)ncc1I |
WLN: T6MVMVJ FZ | Nc1cc(O)nc(O)n1 |