If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 1-Ethanediol, 2,2,2-trifluoro- | C(F)(F)(F)C(O)O |
1, 1-Ethanediol, diacetate | O(C(C)=O)C(C)OC(C)=O |
1, 2-Ethanediol dimethanesulfonate | O(CCOS(C)(=O)=O)S(C)(=O)=O |
1, 2-Ethanediol, 1,1,2,2-tetraphenyl- | C(O)(c1ccccc1)(c2ccccc2)C(O)(c3ccccc3)c4ccccc4 |
1, 2-Ethanediol, 1,2-diphenyl- | C(O)(c1ccccc1)C(O)c2ccccc2 |
1, 2-Ethanediol, 1-phenyl-, diacetate | C(COC(C)=O)(OC(C)=O)c1ccccc1 |
1, 2-Ethanediol, monoformate | C(CO)OC=O |
1, 2-Ethanediol, monomethanesulfonate | O(CCO)S(C)(=O)=O |
1,1,2,2-Tetraphenyl-1,2-ethanediol | C(O)(c1ccccc1)(c2ccccc2)C(O)(c3ccccc3)c4ccccc4 |
1,1-Ethanediol, 2,2,2-trichloro- | C(Cl)(Cl)(Cl)C(O)O |
1,2-Diphenyl-1,2-ethanediol | C(O)(c1ccccc1)C(O)c2ccccc2 |
1,2-Ethanediol dimethyl ether | C(OC)COC |
1,2-Ethanediol homopolymer | C(O)CO |
1,2-Ethanediol monoricinoleate | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
1,2-Ethanediol | C(O)CO |
1,2-Ethanediol, 1,2-diphenyl-, (R*,S*)- | C(O)(c1ccccc1)C(O)c2ccccc2 |
1,2-Ethanediol, 1,2-diphenyl-, cyclic sulfite | O=S1OC(c2ccccc2)C(O1)c3ccccc3 |
1,2-Ethanediol, 1,2-diphenyl-, meso- | C(O)(c1ccccc1)C(O)c2ccccc2 |
1,2-Ethanediol, 1-(2-piperidinyl)- | C(O)(CO)C1CCCCN1 |
1,2-Ethanediol, 1-(2-piperidyl)- | C(O)(CO)C1CCCCN1 |
1,2-Ethanediol, 1-chloromethyl-, diacetate | C(CCl)(COC(C)=O)OC(C)=O |
1,2-Ethanediol, 1-phenyl- | C(O)(CO)c1ccccc1 |
1,2-Ethanediol, 1-phenyl-, 2-carbamate | C(O)(COC(N)=O)c1ccccc1 |
1,2-Ethanediol, diacetate | C(COC(C)=O)OC(C)=O |
1,2-Ethanediol, dibenzenesulfonate | S(=O)(=O)(OCCOS(=O)(=O)c1ccccc1)c2ccccc2 |
1,2-Ethanediol, dibenzoate | C(=O)(OCCOC(=O)c1ccccc1)c2ccccc2 |
1,2-Ethanediol, dicarbamate | C(COC(N)=O)OC(N)=O |
1,2-Ethanediol, diformate | C(OC=O)COC=O |
1,2-Ethanediol, dimethanesulfonate | O(CCOS(C)(=O)=O)S(C)(=O)=O |
1,2-Ethanediol, dipropanoate | O(CCOC(=O)CC)C(=O)CC |
1,2-Ethanediol, monoacetate | O(CCO)C(C)=O |
1,2-Ethanediol, monobenzoate | C(=O)(OCCO)c1ccccc1 |
1,2-Ethanediol, monocarbamate | O(CCO)C(N)=O |
1-(2-Piperidyl)-1,2-ethanediol | C(O)(CO)C1CCCCN1 |
1-Phenyl-1,2-ethanediol diacetate | C(COC(C)=O)(OC(C)=O)c1ccccc1 |
1-Phenyl-1,2-ethanediol | C(O)(CO)c1ccccc1 |
1_2-Ethanediol__1-(2-piperidinyl)- | C(O)(CO)C1CCCCN1 |
1_2-Ethanediol__1-chloromethyl-__diacetate | C(CCl)(COC(C)=O)OC(C)=O |
1_2-Ethanediol__1_2-diphenyl-__(R*_S*)- | C(O)(c1ccccc1)C(O)c2ccccc2 |
1_2-Ethanediol__1_2-diphenyl-__cyclic_sulfite | O=S1OC(c2ccccc2)C(O1)c3ccccc3 |
1_2-Ethanediol__dicarbamate | C(COC(N)=O)OC(N)=O |
1__1-Ethanediol__diacetate | O(C(C)=O)C(C)OC(C)=O |
1__2-Ethanediol__1-phenyl-__diacetate | C(COC(C)=O)(OC(C)=O)c1ccccc1 |
1__2-Ethanediol__1_1_2_2-tetraphenyl- | C(O)(c1ccccc1)(c2ccccc2)C(O)(c3ccccc3)c4ccccc4 |
2,2, 2-Trichloro-1,1-ethanediol | C(Cl)(Cl)(Cl)C(O)O |
2,2,2-Trifluoro-1, 1-ethanediol | C(F)(F)(F)C(O)O |
Ethanediol diacetate | C(COC(C)=O)OC(C)=O |
Ethanediol dimethacrylate | C(=O)(OCCOC(=O)C(C)=C)C(C)=C |
Ethanediol, trimer | C(=O)C=O |
Ethoxylated 1,2-ethanediol | C(O)CO |
Phenyl-1, 2-ethanediol | C(O)(CO)c1ccccc1 |
Tetraphenyl-1,2-ethanediol | C(O)(c1ccccc1)(c2ccccc2)C(O)(c3ccccc3)c4ccccc4 |
meso-1,2-Diphenyl-1, 2-ethanediol | C(O)(c1ccccc1)C(O)c2ccccc2 |