If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(Diethylenetriamine)pentaacetic acid | N(CCN(CC(=O)O)CC(=O)O)(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
Bromo(diethylenetriamine)platinium bromide | Br[Pt]12NCCN1CCN2 |
Cobalt, triazido(diethylenetriamine)-, mer- | N(=N=N)[Co]12(N=N=N)(N=N=N)NCCN1CCN2 |
Diethylenetriamine | N(CCN)CCN |
Diethylenetriamine, 1,1,4,7,7-pentabutyl- | N(CCCC)(CCN(CCCC)CCCC)CCN(CCCC)CCCC |
Diethylenetriamine, 1,1,4,7,7-pentamethyl- | N(C)(CCN(C)C)CCN(C)C |
Diethylenetriamine, 1,1,7,7-tetraethyl- | N(CC)(CC)CCNCCN(CC)CC |
Diethylenetriamine, 1,1,7,7-tetraethyl-4-phenyl- | N(CCN(CC)CC)(CCN(CC)CC)c1ccccc1 |
Diethylenetriamine, 1,1-diethyl- | N(CC)(CC)CCNCCN |
Diethylenetriamine, 1,1-dimethyl- | C(NCCN)CN(C)C |
Diethylenetriamine, 1,4,7-trimethyl- | N(C)(CCNC)CCNC |
Diethylenetriamine, 1,7-dibenzyl- | C(NCCNCCNCc1ccccc1)c2ccccc2 |
Diethylenetriamine, 1-benzyl- | C(NCCNCCN)c1ccccc1 |
Diethylenetriamine, 1-dodecyl- | C(CCCCCCCCC)CCNCCNCCN |
Diethylenetriamine, 4-(2-aminoethyl)-, trihydrochloride | N(CCN)(CCN)CCN |
Diethylenetriamine-N,N,N',N'',N''-pentaacetic acid | N(CCN(CC(=O)O)CC(=O)O)(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
Diethylenetriamine__1_7-dibenzyl- | C(NCCNCCNCc1ccccc1)c2ccccc2 |
N-Lauryl-diethylenetriamine | C(CCCCCCCCC)CCNCCNCCN |
Platinum(1+), bromo(diethylenetriamine)-, bromide | Br[Pt]12NCCN1CCN2 |
mer-Triazido(diethylenetriamine)cobalt | N(=N=N)[Co]12(N=N=N)(N=N=N)NCCN1CCN2 |