If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1-Benzyl-2-picolinium chloride | C(c1ccccc1)n2ccccc2C |
1-Benzyl-3-picolinium chloride | C(c1ccccc1)n2cccc(C)c2 |
1-Ethoxyethyl-4-picolinium iodide | C(COCC)n1ccc(C)cc1 |
1-Methyl-4-picolinium iodide | Cc1ccn(C)cc1 |
1-Phenethyl-2-picolinium bromide | C(Cc1ccccc1)n2ccccc2C |
2-Picolinium, 1-benzyl-, chloride | C(c1ccccc1)n2ccccc2C |
2-Picolinium, 1-methyl-, iodide | Cc1ccccn1C |
2-Picolinium, 1-phenethyl-, bromide | C(Cc1ccccc1)n2ccccc2C |
3-Picolinium, (4, 4'-biphenylylenebis(2-oxoethylene))di-, dibromide | C(=O)(Cn1cccc(C)c1)c2ccc(cc2)c3ccc(cc3)C(=O)Cn4cccc(C)c4 |
3-Picolinium, 1-benzyl-, chloride | C(c1ccccc1)n2cccc(C)c2 |
4-Picolinium, 1-ethoxyethyl-, iodide | C(COCC)n1ccc(C)cc1 |
4-Picolinium, 1-methyl-, iodide | Cc1ccn(C)cc1 |
4-Picolinium, 1-tetradecyl-, chloride | C(CCCCCCCCCCCCC)n1ccc(C)cc1 |
ALPHA_-Picolinium-BETA_-phenylethyl bromide | C(Cc1ccccc1)n2ccccc2C |
Benzyl-ALPHA_-picolinium chloride | C(c1ccccc1)n2ccccc2C |
Myristyl-GAMMA_-picolinium chloride | C(CCCCCCCCCCCCC)n1ccc(C)cc1 |
N-Phenethyl-ALPHA_-picolinium bromide | C(Cc1ccccc1)n2ccccc2C |