If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Acetamido-5-methylpyrrolin-4-one(4, 3-d)-1,2-dithiole | N(C(C)=O)C1=C2SSC=C2N(C)C1=O |
3H-1, 2-Dithiole-3-thione, 4-neopentyl- | C(C1=CSSC1=S)C(C)(C)C |
3H-1,2-Dithiole-3-thione, 4,5-diphenyl- | S=C1SSC(c2ccccc2)=C1c3ccccc3 |
3H-1,2-Dithiole-3-thione, 4-(2,2-dimethylpropyl)- | C(C1=CSSC1=S)C(C)(C)C |
3H-1,2-Dithiole-3-thione, 4-phenyl- | S=C1SSC=C1c2ccccc2 |
3H-1,2-Dithiole-3-thione, 5-phenyl- | S=C1SSC(=C1)c2ccccc2 |
3H-1_2-Dithiole-3-thione__4-(2_2-dimethylpropyl)- | C(C1=CSSC1=S)C(C)(C)C |
3H-1_2-Dithiole-3-thione__4-phenyl- | S=C1SSC=C1c2ccccc2 |
3H-1_2-Dithiole-3-thione__4_5-diphenyl- | S=C1SSC(c2ccccc2)=C1c3ccccc3 |
3H-1_2-Dithiole-3-thione__5-phenyl- | S=C1SSC(=C1)c2ccccc2 |
4-Phenyl-3H-1, 2-dithiole-3-thione | S=C1SSC=C1c2ccccc2 |