If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Octadecanamine | C(CCCCCCCCC)CCCCCCCCN |
1-Octadecanamine, N, N-dimethyl-, hydrochloride | C(CCCCCCCCCCCC)CCCCCN(C)C |
1-Octadecanamine, N-methyl- | C(CCCCCCCCC)CCCCCCCCNC |
1-Octadecanamine, N-octadecyl-, hydrochloride | N(CCCCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCCCC |
1-Octadecanamine, acetate | C(CCCCCCCCC)CCCCCCCCN.CC(=O)O |
1-Octadecanamine__N-methyl- | C(CCCCCCCCC)CCCCCCCCNC |
1-Octadecanamine__N-octadecyl-__hydrochloride | N(CCCCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCCCC |
1-Octadecanamine__N__N-dimethyl-__hydrochloride | C(CCCCCCCCCCCC)CCCCCN(C)C |
1-Octadecanamine__acetate | C(CCCCCCCCC)CCCCCCCCN.CC(=O)O |