If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Lithosol Blue 6G | C(c1ccc(cc1)N(C)C)(=C2C=CC(C=C2)=N(C)C)c3ccccc3Cl |
Lithosol Blue G | C(c1ccc(NCC)c(C)c1)(=C2C=CC(=NCC)C(C)=C2)c3ccccc3Cl |
Lithosol Claret B | N(=Nc1cccc2ccccc12)c3c(O)c(cc4cc(ccc34)S(=O)(=O)O)S(=O)(=O)O |
Lithosol Deep Blue B | O=C1c2ccccc2NC1=C3Nc4ccccc4C3=O |
Lithosol Fast Yellow ARP | N(C(=O)c1ccccc1)c2cccc3C(=O)c4c(cccc4C(=O)c23)NC(=O)c5ccccc5 |
Lithosol Fast Yellow HL | N(=NC(C(C)=O)C(=O)Nc1ccccc1)c2ccc(C)cc2[N+](=O)[O-] |
Lithosol Fast Yellow HV | N(=NC(C(C)=O)C(=O)Nc1ccccc1)c2ccc(C)cc2[N+](=O)[O-] |
Lithosol Orange R Base | [N+](=O)([O-])c1ccc(C)c(N)c1 |
Lithosol Scarlet 3BI | N(=Nc1ccccc1C(=O)O)c2c(O)c(cc3cc(ccc23)S(=O)(=O)O)S(=O)(=O)O |
Lithosol Scarlet Base M | [N+](=O)([O-])c1cc(C)ccc1N |
Lithosol Scarlet Base MB | [N+](=O)([O-])c1cc(C)ccc1N |
Lithosol Scarlet Base MBW | [N+](=O)([O-])c1cc(C)ccc1N |
Lithosol Scarlet Base MW | [N+](=O)([O-])c1cc(C)ccc1N |