If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Benzimidazolecarbamic acid, 5-(2-thienylcarbonyl)-, methyl ester | C(=O)(C1=CC=CS1)c2ccc3NC(NC(=O)OC)=Nc3c2 |
Benzeneacetic acid, ALPHA_-methyl-4-(2-thienylcarbonyl)- | C(=O)(C1=CC=CS1)c2ccc(cc2)C(C)C(=O)O |
Benzeneacetic_acid__ALPHA_-methyl-4-(2-thienylcarbonyl)- | C(=O)(C1=CC=CS1)c2ccc(cc2)C(C)C(=O)O |
Methyl (5-(2-thienylcarbonyl)-1H-benzimidazol-2-yl)carbamate | C(=O)(C1=CC=CS1)c2ccc3NC(NC(=O)OC)=Nc3c2 |
Methyl(5-(2-thienylcarbonyl))-1H-benzimidazole-2-yl carbamate | C(=O)(C1=CC=CS1)c2ccc3NC(NC(=O)OC)=Nc3c2 |