If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-(Diacetoxymethyl)-5-nitrofuran | C(OC(C)=O)(OC(C)=O)C1=CC=C(O1)[N+](=O)[O-] |
2-(Methoxymethyl)-5-nitrofuran | [N+](=O)([O-])C1=CC=C(COC)O1 |
2-Acetyl-5-nitrofuran | C(C)(=O)C1=CC=C(O1)[N+](=O)[O-] |
2-Nitrofuran | [N+](=O)([O-])C1=CC=CO1 |
2-Nitrofuran-5-carboxylate propyl ester | C(=O)(OCCC)C1=CC=C(O1)[N+](=O)[O-] |
5-Nitrofuran | [N+](=O)([O-])C1=CC=CO1 |
5-Nitrofuran-2-aldehyde semicarbazone | [N+](=O)([O-])C1=CC=C(O1)C=NNC(N)=O |
Nitrofuran (VAN) | [N+](=O)([O-])C1=CC=CO1 |
Nitrofuran (bactericide) | [N+](=O)([O-])C1=CC=C(O1)C=NNC(N)=O |
Nitrofuran | [N+](=O)([O-])C1=CC=C(O1)C=NNC(N)=O |
Nitrofuran_(VAN) | [N+](=O)([O-])C1=CC=CO1 |