If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(E)-Crotonic acid | C(=CC)C(=O)O |
3-(p-Chloroanilino)crotonic acid ethyl ester | N(C(C)=CC(=O)OCC)c1ccc(Cl)cc1 |
3-Chloro-cis-crotonic acid | C(=C(C)Cl)C(=O)O |
ALPHA_-Crotonic acid | C(=CC)C(=O)O |
CROTONIC ACID | C(=CC)C(=O)O |
Crotonic acid anhydride | C(=O)(C=CC)OC(=O)C=CC |
Crotonic acid | C(=CC)C(=O)O |
Crotonic acid, (E)- | C(=CC)C(=O)O |
Crotonic acid, 2-acetamido-3-methyl- | C(NC(C)=O)(=C(C)C)C(=O)O |
Crotonic acid, 2-bromo- | C(Br)(=CC)C(=O)O |
Crotonic acid, 2-cyano-3-methyl-, ethyl ester | C(C#N)(=C(C)C)C(=O)OCC |
Crotonic acid, 2-methyl-, (E)- | C(C)(=CC)C(=O)O |
Crotonic acid, 2-methyl-, (Z)- | C(C)(=CC)C(=O)O |
Crotonic acid, 2-methyl-, ethyl ester, (E)- | C(=O)(OCC)C(C)=CC |
Crotonic acid, 2-methyl-, methyl ester, (E)- | C(C)(=CC)C(=O)OC |
Crotonic acid, 3-(1-pyrrolidinyl)-, methyl ester | C(C)(=CC(=O)OC)N1CCCC1 |
Crotonic acid, 3-(ethylamino)-, ethyl ester | C(C)(NCC)=CC(=O)OCC |
Crotonic acid, 3-(methylamino)-, ethyl ester | C(=C(C)NC)C(=O)OCC |
Crotonic acid, 3-(p-chloroanilino)-, ethyl ester | N(C(C)=CC(=O)OCC)c1ccc(Cl)cc1 |
Crotonic acid, 3-amino-, ethyl ester | C(=C(C)N)C(=O)OCC |
Crotonic acid, 3-anilino-, ethyl ester | N(C(C)=CC(=O)OCC)c1ccccc1 |
Crotonic acid, 3-chloro-, (E)- | C(=C(C)Cl)C(=O)O |
Crotonic acid, 3-chloro-, (Z)- | C(=C(C)Cl)C(=O)O |
Crotonic acid, 3-ethoxy-, ethyl ester | C(C)(OCC)=CC(=O)OCC |
Crotonic acid, 3-hydroxy-, methyl ester, dimethyl phosphate | P(=O)(OC)(OC)OC(C)=CC(=O)OC |
Crotonic acid, 3-hydroxy-, methyl ester, dimethyl phosphate, (E)- | P(=O)(OC)(OC)OC(C)=CC(=O)OC |
Crotonic acid, 3-methyl- | C(=C(C)C)C(=O)O |
Crotonic acid, 3-methyl-, anhydride | C(=O)(C=C(C)C)OC(=O)C=C(C)C |
Crotonic acid, 3-methyl-, ethyl ester | C(=C(C)C)C(=O)OCC |
Crotonic acid, 3-phenyl- | C(C)(=CC(=O)O)c1ccccc1 |
Crotonic acid, 4-bromo-, methyl ester | C(=O)(OC)C=CCBr |
Crotonic acid, 4-fluoro-, ethyl ester | C(=O)(OCC)C=CCF |
Crotonic acid, 4-oxo-4-phenyl- | C(=O)(C=CC(=O)O)c1ccccc1 |
Crotonic acid, allyl ester | C(=O)(C=CC)OCC=C |
Crotonic acid, ethyl ester | C(=O)(C=CC)OCC |
Crotonic acid, hexyl ester | C(=O)(C=CC)OCCCCCC |
Crotonic acid, methyl ester | C(=O)(OC)C=CC |
Crotonic acid, octyl ester | O(CCCCCCCC)C(=O)C=CC |
Crotonic acid, propyl ester | C(=O)(C=CC)OCCC |
Crotonic acid, vinyl ester | C(=O)(C=CC)OC=C |
Crotonic aldehyde | C(=CC)C=O |
Crotonic anhydride | C(=O)(C=CC)OC(=O)C=CC |
Crotonic nitrile | C(=CC)C#N |
Crotonic_acid__3-(ethylamino)-__ethyl_ester | C(C)(NCC)=CC(=O)OCC |
Solid crotonic acid | C(=CC)C(=O)O |
trans-Crotonic acid | C(=CC)C(=O)O |