If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Furfuraldehyde | C(=O)C1=CC=CO1 |
5-(Hydroxymethyl)-2-furfuraldehyde | C(O)C1=CC=C(C=O)O1 |
5-Nitro-2-furfuraldehyde diacetate | C(OC(C)=O)(OC(C)=O)C1=CC=C(O1)[N+](=O)[O-] |
5-Nitro-2-furfuraldehyde semicarbazone | [N+](=O)([O-])C1=CC=C(O1)C=NNC(N)=O |
5-Nitro-2-furfuraldehyde-N'-methyl-N-piperazinoacethydrazone | C(=NNC(=O)CN1CCN(C)CC1)C2=CC=C(O2)[N+](=O)[O-] |
Furfuraldehyde | C(=O)C1=CC=CO1 |