If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(E)-3,4-Dimethyl-2-pentene | C(C)(=CC)C(C)C |
(E)-3-Methyl-2-pentene | C(C)(CC)=CC |
(E)-4,4-Dimethyl-2-pentene | C(=CC)C(C)(C)C |
(E)-4-Methyl-2-pentene | C(=CC)C(C)C |
(Z)-3,4-Dimethyl-2-pentene | C(C)(=CC)C(C)C |
(Z)-3-Methyl-2-pentene | C(C)(CC)=CC |
(Z)-4,4-Dimethyl-2-pentene | C(=CC)C(C)(C)C |
(Z)-4-Methyl-2-pentene | C(=CC)C(C)C |
1, 5-Dicyclopentyl-3-(2-cyclopentyl-ethyl)-2-pentene | C(CCC1CCCC1)(CCC2CCCC2)=CCC3CCCC3 |
1,5-Diphenyl-3-(2-phenylethyl)-2-pentene | C(CCc1ccccc1)(CCc2ccccc2)=CCc3ccccc3 |
1-Chloro-5-methoxy-2-pentene | C(=CCCl)CCOC |
1-Pentene oxide | C(CC)C1CO1 |
1-Pentene, 2,3-dimethyl- | C(C)(CC)C(C)=C |
1-Pentene, 2,4,4-trimethyl- | C(C(C)=C)C(C)(C)C |
1-Pentene, 2,4-dimethyl- | C(C(C)C)C(C)=C |
1-Pentene, 2-cyclopropyl- | C(=C)(CCC)C1CC1 |
1-Pentene, 2-methyl- | C(CC)C(C)=C |
1-Pentene, 3,3-dimethyl- | C(C)(C)(CC)C=C |
1-Pentene, 3,4-dimethyl- | C(C)(C=C)C(C)C |
1-Pentene, 3-ethyl- | C(CC)(CC)C=C |
1-Pentene, 3-ethyl-2-methyl- | C(CC)(CC)C(C)=C |
1-Pentene, 3-methyl- | C(C)(CC)C=C |
1-Pentene, 4,4-dimethyl- | C(C=C)C(C)(C)C |
1-Pentene, 4-methyl- | C(C=C)C(C)C |
1-Pentene-3-ol | C(O)(CC)C=C |
1-Pentene__2-cyclopropyl- | C(=C)(CCC)C1CC1 |
1-Pentene__2-methyl- | C(CC)C(C)=C |
1-Pentene__2_3-dimethyl- | C(C)(CC)C(C)=C |
1-Pentene__2_4-dimethyl- | C(C(C)C)C(C)=C |
1-Pentene__2_4_4-trimethyl- | C(C(C)=C)C(C)(C)C |
1-Pentene__3-ethyl- | C(CC)(CC)C=C |
1-Pentene__3-ethyl-2-methyl- | C(CC)(CC)C(C)=C |
1-Pentene__3-methyl- | C(C)(CC)C=C |
1-Pentene__3_3-dimethyl- | C(C)(C)(CC)C=C |
1-Pentene__3_4-dimethyl- | C(C)(C=C)C(C)C |
1-Pentene__4-methyl- | C(C=C)C(C)C |
1-Pentene__4_4-dimethyl- | C(C=C)C(C)(C)C |
2,2,4-Trimethyl-4-pentene | C(C(C)=C)C(C)(C)C |
2,2-Dimethyl-4-pentene | C(C=C)C(C)(C)C |
2,3,4-Trimethyl-2-pentene | C(C)(C(C)C)=C(C)C |
2,3-Dimethyl-1-pentene | C(C)(CC)C(C)=C |
2,4,4-Trimethyl-1-pentene | C(C(C)=C)C(C)(C)C |
2,4-Dimethyl-1-pentene | C(C(C)C)C(C)=C |
2,4-Dimethyl-2-pentene | C(C(C)C)=C(C)C |
2-Methyl-1-pentene | C(CC)C(C)=C |
2-Methyl-2-pentene | C(CC)=C(C)C |
2-Methyl-3-ethyl-1-pentene | C(CC)(CC)C(C)=C |
2-Methyl-3-pentene | C(=CC)C(C)C |
2-Oxo-3-pentene | C(=CC)C(C)=O |
2-Pentene | C(CC)=CC |
2-Pentene, 1-chloro-5-methoxy- | C(=CCCl)CCOC |
2-Pentene, 2,3,4-trimethyl- | C(C)(C(C)C)=C(C)C |
2-Pentene, 2,4-dimethyl- | C(C(C)C)=C(C)C |
2-Pentene, 2-methyl- | C(CC)=C(C)C |
2-Pentene, 3,4,4-trimethyl- | C(C)(=CC)C(C)(C)C |
2-Pentene, 3,4-dimethyl-, (E)- | C(C)(=CC)C(C)C |
2-Pentene, 3,4-dimethyl-, (Z)- | C(C)(=CC)C(C)C |
2-Pentene, 3-ethyl- | C(CC)(CC)=CC |
2-Pentene, 3-methyl-, (E)- | C(C)(CC)=CC |
2-Pentene, 3-methyl-, (Z)- | C(C)(CC)=CC |
2-Pentene, 4,4-dimethyl-, (E)- | C(=CC)C(C)(C)C |
2-Pentene, 4,4-dimethyl-, (Z)- | C(=CC)C(C)(C)C |
2-Pentene, 4-methyl- | C(=CC)C(C)C |
2-Pentene, 4-methyl-, (E)- | C(=CC)C(C)C |
2-Pentene, 4-methyl-, (Z)- | C(=CC)C(C)C |
2-Pentene, 4-methyl-2,4-diphenyl- | C(C)(C)(C=C(C)c1ccccc1)c2ccccc2 |
2-Pentene__1-chloro-5-methoxy- | C(=CCCl)CCOC |
2-Pentene__2-methyl- | C(CC)=C(C)C |
2-Pentene__2_3_4-trimethyl- | C(C)(C(C)C)=C(C)C |
2-Pentene__2_4-dimethyl- | C(C(C)C)=C(C)C |
2-Pentene__3-ethyl- | C(CC)(CC)=CC |
2-Pentene__3-methyl-__(E)- | C(C)(CC)=CC |
2-Pentene__3-methyl-__(Z)- | C(C)(CC)=CC |
2-Pentene__3_4-dimethyl-__(E)- | C(C)(=CC)C(C)C |
2-Pentene__3_4-dimethyl-__(Z)- | C(C)(=CC)C(C)C |
2-Pentene__3_4_4-trimethyl- | C(C)(=CC)C(C)(C)C |
2-Pentene__4-methyl-__(E)- | C(=CC)C(C)C |
2-Pentene__4-methyl-__(Z)- | C(=CC)C(C)C |
2-Pentene__4_4-dimethyl-__(E)- | C(=CC)C(C)(C)C |
2-Pentene__4_4-dimethyl-__(Z)- | C(=CC)C(C)(C)C |
3, 4-Dimethyl-trans-2-pentene | C(C)(=CC)C(C)C |
3,3-Dimethyl-1-pentene | C(C)(C)(CC)C=C |
3,4,4-Trimethyl-2-pentene | C(C)(=CC)C(C)(C)C |
3,4-Dimethyl-1-pentene | C(C)(C=C)C(C)C |
3,4-Dimethyl-cis-2-pentene | C(C)(=CC)C(C)C |
3-Ethyl-1-pentene | C(CC)(CC)C=C |
3-Ethyl-2-pentene | C(CC)(CC)=CC |
3-Methyl-1-pentene | C(C)(CC)C=C |
3-Methyl-3-pentene-2-one | C(C)(=CC)C(C)=O |
3-Methyl-cis-2-pentene | C(C)(CC)=CC |
3-Methyl-trans-2-pentene | C(C)(CC)=CC |
3-Pentene | C(CC)=CC |
4, 4-Dimethyl-1-pentene | C(C=C)C(C)(C)C |
4, 4-Dimethyl-trans-2-pentene | C(=CC)C(C)(C)C |
4,4-Dimethyl-cis-2-pentene | C(=CC)C(C)(C)C |
4-Methyl-1-pentene | C(C=C)C(C)C |
4-Methyl-2-cis-pentene | C(=CC)C(C)C |
4-Methyl-2-pentene | C(=CC)C(C)C |
4-Methyl-2-pentene-1-al | C(=CC=O)C(C)C |
4-Methyl-3-pentene | C(CC)=C(C)C |
4-Methyl-3-pentene-2-one | C(=C(C)C)C(C)=O |
4-Methyl-4-pentene | C(CC)C(C)=C |
4-Methyl-cis-2-pentene | C(=CC)C(C)C |
4-Methyl-trans-2-pentene | C(=CC)C(C)C |
Benzenamine, N,N'-2-pentene-1,5-diylidenebis-, monohydrochloride | N(=CCC=CC=Nc1ccccc1)c2ccccc2 |
Benzenamine__N_N'-2-pentene-1_5-diylidenebis-__monohydrochloride | N(=CCC=CC=Nc1ccccc1)c2ccccc2 |
Cyclohexane, 1,1'-(3-(2-cyclohexylethyl)-2-pentene-1,5-diyl)bis- | C(CCC1CCCCC1)(CCC2CCCCC2)=CCC3CCCCC3 |
Cyclohexane__1_1'-(3-(2-cyclohexylethyl)-2-pentene-1_5-diyl)bis- | C(CCC1CCCCC1)(CCC2CCCCC2)=CCC3CCCCC3 |
Pentene 1, 2-oxide | C(CC)C1CO1 |
Pentene-1,2-oxide | C(CC)C1CO1 |
cis-3,4-Dimethyl-2-pentene | C(C)(=CC)C(C)C |
cis-3-Methyl-2-pentene | C(C)(CC)=CC |
cis-4,4-Dimethyl-2-pentene | C(=CC)C(C)(C)C |
cis-4-Methyl-2-pentene | C(=CC)C(C)C |
trans-3,4-Dimethyl-2-pentene | C(C)(=CC)C(C)C |
trans-3-Methyl-2-pentene | C(C)(CC)=CC |
trans-4,4-Dimethyl-2-pentene | C(=CC)C(C)(C)C |
trans-4-Methyl-2-pentene | C(=CC)C(C)C |