If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Furanmethanamine | C(N)C1=CC=CO1 |
2-Furanmethanamine, N-1H-purin-6-yl- | N(CC1=CC=CO1)c2ncnc3NC=Nc23 |
2-Furanmethanamine, N-ethyl-ALPHA_-(phenylmethyl)- | C(NCC)(Cc1ccccc1)C2=CC=CO2 |
2-Furanmethanamine, N-methyl- | C(NC)C1=CC=CO1 |
2-Furanmethanamine, tetrahydro- | C(N)C1CCCO1 |
2-Furanmethanamine__N-ethyl-ALPHA_-(phenylmethyl)- | C(NCC)(Cc1ccccc1)C2=CC=CO2 |
2-Furanmethanamine__N-methyl- | C(NC)C1=CC=CO1 |
2-Furanmethanamine__tetrahydro- | C(N)C1CCCO1 |
Tetrahydro-2-furanmethanamine | C(N)C1CCCO1 |