If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Naphthaleneacetamide | C(C(N)=O)c1cccc2ccccc12 |
1-Naphthaleneacetamide, N-(2-aminoethyl)-, monohydrochloride | C(C(=O)NCCN)c1cccc2ccccc12 |
1-Naphthaleneacetamide__N-(2-aminoethyl)-__monohydrochloride | C(C(=O)NCCN)c1cccc2ccccc12 |
2-Naphthaleneacetamide | C(C(N)=O)c1ccc2ccccc2c1 |
2-Naphthaleneacetamide, N-benzyl-6,7-dimethoxy- | O(C)c1cc2cc(ccc2cc1OC)CC(=O)NCc3ccccc3 |
2-Naphthaleneacetamide__N-benzyl-6_7-dimethoxy- | O(C)c1cc2cc(ccc2cc1OC)CC(=O)NCc3ccccc3 |
ALPHA_-Naphthaleneacetamide | C(C(N)=O)c1cccc2ccccc12 |