If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
10-Undecenoic acid | C(CCCCC=C)CCCC(=O)O |
10-Undecenoic acid, 1-methylethyl ester | C(=O)(CCCCCCCCC=C)OC(C)C |
10-Undecenoic acid, 2-methylpropyl ester | C(=O)(CCCCCCCCC=C)OCC(C)C |
10-Undecenoic acid, 2-propenyl ester | C(CCCCCCCC=C)C(=O)OCC=C |
10-Undecenoic acid, allyl ester | C(CCCCCCCC=C)C(=O)OCC=C |
10-Undecenoic acid, butyl ester | C(CCCCCCCC=C)C(=O)OCCCC |
10-Undecenoic acid, methyl ester | C(CCCCCC=C)CCC(=O)OC |
10-Undecenoic acid, sodium salt | C(CCCCC=C)CCCC(=O)O |
10-Undecenoic acid, zinc salt | C(CCCCC=C)CCCC(=O)O |
10-Undecenoic_acid__1-methylethyl_ester | C(=O)(CCCCCCCCC=C)OC(C)C |
10-Undecenoic_acid__2-methylpropyl_ester | C(=O)(CCCCCCCCC=C)OCC(C)C |
10-Undecenoic_acid__2-propenyl_ester | C(CCCCCCCC=C)C(=O)OCC=C |
10-Undecenoic_acid__butyl_ester | C(CCCCCCCC=C)C(=O)OCCCC |
10-Undecenoic_acid__methyl_ester | C(CCCCCC=C)CCC(=O)OC |
10-Undecenoic_acid__zinc_salt | C(CCCCC=C)CCCC(=O)O |
9-Undecenoic acid | C(CCCC=CC)CCCC(=O)O |
9-Undecenoic acid, nickel(2+ ) salt | C(CCCC=CC)CCCC(=O)O |
9-Undecenoic_acid | C(CCCC=CC)CCCC(=O)O |
Undecenoic acid, methyl ester | C(CCCCCC=C)CCC(=O)OC |
Undecenoic acid, sodium salt | C(CCCCC=C)CCCC(=O)O |