If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
4-(Acetylamino)benzenethiol | N(C(C)=O)c1ccc(S)cc1 |
Benzenethiol | Sc1ccccc1 |
Benzenethiol, 2,4-dimethyl- | Cc1cc(C)ccc1S |
Benzenethiol, 2,5-dichloro- | Sc1cc(Cl)ccc1Cl |
Benzenethiol, 2-amino- | Nc1ccccc1S |
Benzenethiol, 2-amino-4,5-dimethyl-, hydrochloride | Cc1cc(N)c(S)cc1C |
Benzenethiol, 2-amino-4-chloro-, hydrochloride | Nc1cc(Cl)ccc1S |
Benzenethiol, 2-amino-5-fluoro- | Sc1cc(F)ccc1N |
Benzenethiol, 2-amino-5-methyl- | Sc1cc(C)ccc1N |
Benzenethiol, 2-bromo- | Brc1ccccc1S |
Benzenethiol, 2-chloro- | Clc1ccccc1S |
Benzenethiol, 2-methyl- | Cc1ccccc1S |
Benzenethiol, 3-chloro- | Clc1cccc(S)c1 |
Benzenethiol, 3-methyl- | Cc1cccc(S)c1 |
Benzenethiol, 4-(1, 1-dimethylethyl)- | C(C)(C)(C)c1ccc(S)cc1 |
Benzenethiol, 4-(1, 1-dimethylethyl)-2-methyl- | C(C)(C)(C)c1ccc(S)c(C)c1 |
Benzenethiol, 4-bromo- | Brc1ccc(S)cc1 |
Benzenethiol, 4-chloro- | Clc1ccc(S)cc1 |
Benzenethiol, 4-methoxy- | O(C)c1ccc(S)cc1 |
Benzenethiol, 4-methyl- | Cc1ccc(S)cc1 |
Benzenethiol, 4-nitro- | [N+](=O)([O-])c1ccc(S)cc1 |
Benzenethiol, m-chloro- | Clc1cccc(S)c1 |
Benzenethiol, o-amino- | Nc1ccccc1S |
Benzenethiol, o-bromo- | Brc1ccccc1S |
Benzenethiol, o-chloro- | Clc1ccccc1S |
Benzenethiol, p-bromo- | Brc1ccc(S)cc1 |
Benzenethiol, p-chloro- | Clc1ccc(S)cc1 |
Benzenethiol, p-methoxy- | O(C)c1ccc(S)cc1 |
Benzenethiol, p-nitro- | [N+](=O)([O-])c1ccc(S)cc1 |
Benzenethiol, p-tert-butyl- | C(C)(C)(C)c1ccc(S)cc1 |
Benzenethiol, p-tert-butylthio- | C(C)(C)(C)c1ccc(S)cc1 |
Benzenethiol, pentachloro- | Clc1c(Cl)c(Cl)c(S)c(Cl)c1Cl |
Benzenethiol, pentafluoro- | Fc1c(F)c(F)c(S)c(F)c1F |
Benzenethiol__2-amino-4-chloro-__hydrochloride | Nc1cc(Cl)ccc1S |
Benzenethiol__2-amino-4_5-dimethyl-__hydrochloride | Cc1cc(N)c(S)cc1C |
Benzenethiol__2-amino-5-fluoro- | Sc1cc(F)ccc1N |
Benzenethiol__2-amino-5-methyl- | Sc1cc(C)ccc1N |
Benzenethiol__2-methyl- | Cc1ccccc1S |
Benzenethiol__2_4-dimethyl- | Cc1cc(C)ccc1S |
Benzenethiol__2_5-dichloro- | Sc1cc(Cl)ccc1Cl |
Benzenethiol__3-methyl- | Cc1cccc(S)c1 |
Benzenethiol__4-(1__1-dimethylethyl)- | C(C)(C)(C)c1ccc(S)cc1 |
Benzenethiol__4-(1__1-dimethylethyl)-2-methyl- | C(C)(C)(C)c1ccc(S)c(C)c1 |
Benzenethiol__m-chloro- | Clc1cccc(S)c1 |
Benzenethiol__o-bromo- | Brc1ccccc1S |
Benzenethiol__p-bromo- | Brc1ccc(S)cc1 |
Benzenethiol__p-methoxy- | O(C)c1ccc(S)cc1 |
Benzenethiol__pentachloro- | Clc1c(Cl)c(Cl)c(S)c(Cl)c1Cl |
Benzenethiol__pentafluoro- | Fc1c(F)c(F)c(S)c(F)c1F |