If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Nitrobenzenediazonium fluoborate | B(F)(F)(F)F.N#Nc1ccc(cc1)[N+](=O)[O-] |
4-Trimethylammoniumphenyldiazonium chloride fluoborate | B(F)(F)(F)F.N#Nc1ccc(cc1)N(C)(C)C |
Potassium fluoborate | B(F)(F)(F)F |
Sodium fluoborate | B(F)(F)(F)F |
Triethyloxonium fluoborate | B(F)(F)(F)F.CCO(CC)CC |
p-Nitrobenzenediazonium fluoborate | B(F)(F)(F)F.N#Nc1ccc(cc1)[N+](=O)[O-] |