If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Aminonaphthalene-3,6,8-trisulfonic acid | S(=O)(=O)(O)c1cc(cc2cc(cc(N)c12)S(=O)(=O)O)S(=O)(=O)O |
1-Naphthol-3,6, 8-trisulfonic acid | S(=O)(=O)(O)c1cc(cc2cc(cc(O)c12)S(=O)(=O)O)S(=O)(=O)O |
2-Naphthylamine-3,6,8-trisulfonic acid | S(=O)(=O)(O)c1cc(cc2cc(c(N)cc12)S(=O)(=O)O)S(=O)(=O)O |
8-Hydroxypyrene-1,3,6-trisulfonic acid sodium salt | S(=O)(=O)(O)c1cc(c2ccc3c(O)cc(c4C=Cc1c2c34)S(=O)(=O)O)S(=O)(=O)O |