If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Phenylsemicarbazide | N(NC(N)=O)c1ccccc1 |
4,4', 4''-Phosphinylidynetris(1-phenylsemicarbazide) | P(=O)(NC(=O)NNc1ccccc1)(NC(=O)NNc2ccccc2)NC(=O)NNc3ccccc3 |
4-Phenylsemicarbazide hydrochloride | N(C(=O)NN)c1ccccc1 |
4-Phenylsemicarbazide | N(C(=O)NN)c1ccccc1 |
N-Dichloroacetyl-N-phenylsemicarbazide | N(SC(Cl)(Cl)F)(c1ccccc1)S(=O)(=O)N(C)C |
Phenylsemicarbazide | N(NC(N)=O)c1ccccc1 |