If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Ethylene glycol monobenzyl ether | C(OCCO)c1ccccc1 |
Ethylene_glycol_monobenzyl_ether | C(OCCO)c1ccccc1 |
Glycol monobenzyl ether | C(OCCO)c1ccccc1 |
Hydroquinone monobenzyl ether | O(Cc1ccccc1)c2ccc(O)cc2 |
Hydroquinone_monobenzyl_ether | O(Cc1ccccc1)c2ccc(O)cc2 |
Monobenzyl ether hydroquinone | O(Cc1ccccc1)c2ccc(O)cc2 |
Monobenzyl hydroquinone | O(Cc1ccccc1)c2ccc(O)cc2 |
Monobenzyl-p-aminophenol hydrochloride | N(Cc1ccccc1)c2ccc(O)cc2 |
Sodium monobenzyl succinate | C(OC(=O)CCC(=O)O)c1ccccc1 |
Succinic acid, monobenzyl ester, sodium salt | C(OC(=O)CCC(=O)O)c1ccccc1 |