If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Aminobenzenesulfonamide | S(N)(=O)(=O)c1ccccc1N |
3-Aminobenzenesulfonamide | S(N)(=O)(=O)c1cccc(N)c1 |
4-Aminobenzenesulfonamide | S(N)(=O)(=O)c1ccc(N)cc1 |
N(sup1)-(4-Isopropoxybenzoyl)-p-aminobenzenesulfonamide | S(=O)(=O)(NC(=O)c1ccc(cc1)OC(C)C)c2ccc(N)cc2 |
N-Acetyl-4-aminobenzenesulfonamide | S(=O)(=O)(NC(C)=O)c1ccc(N)cc1 |
N-Ethyl-N-phenyl-o-aminobenzenesulfonamide | N(CC)(c1ccccc1)S(=O)(=O)c2ccccc2N |
m-Aminobenzenesulfonamide | S(N)(=O)(=O)c1cccc(N)c1 |
o-Aminobenzenesulfonamide | S(N)(=O)(=O)c1ccccc1N |
p-Aminobenzenesulfonamide | S(N)(=O)(=O)c1ccc(N)cc1 |