If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2,5-Hexanedione, cyclic bis(1,2-ethanediyl acetal) | C(CC1(C)OCCO1)C2(C)OCCO2 |
2-(Methylamino)acetaldehyde dimethyl acetal | C(OC)(OC)CNC |
2-Aminoacetaldehyde diethyl acetal | C(CN)(OCC)OCC |
2-Bromo-3-methoxypropionaldehyde dimethyl acetal | C(OC)(OC)C(Br)COC |
2-Bromoacetaldehyde diethyl acetal | C(CBr)(OCC)OCC |
2-Bromoacetaldehyde dimethyl acetal | C(CBr)(OC)OC |
2-Butanone, cyclic 1,2-ethanediyl acetal | C(C)C1(C)OCCO1 |
2-Butanone, cyclic ethylene acetal | C(C)C1(C)OCCO1 |
2-Butanone__cyclic_1_2-ethanediyl_acetal | C(C)C1(C)OCCO1 |
2-Chloroacetaldehyde diethyl acetal | C(CCl)(OCC)OCC |
2-Chloroacetaldehyde, dimethyl acetal | C(CCl)(OC)OC |
2-Furaldehyde, cyclic (hydroxymethyl)ethylene acetal | C(O)C1COC(O1)C2=CC=CO2 |
2-Furaldehyde__cyclic_(hydroxymethyl)ethylene_acetal | C(O)C1COC(O1)C2=CC=CO2 |
2-Heptanone, cyclic (hydroxymethyl)ethylene acetal | C(CCCC)C1(C)OCC(CO)O1 |
2-Heptanone, cyclic o-phenylene acetal | C(CCCC)C1(C)Oc2ccccc2O1 |
2-Heptanone__cyclic_(hydroxymethyl)ethylene_acetal | C(CCCC)C1(C)OCC(CO)O1 |
2-Heptanone__cyclic_o-phenylene_acetal | C(CCCC)C1(C)Oc2ccccc2O1 |
2-Nitro-2-ethyl-1, 3-propanediol butyraldehyde acetal | [N+](=O)([O-])C1(CC)COC(CCC)OC1 |
2-Octanone, cyclic (hydroxymethyl)ethylene acetal | C(CCCCC)C1(C)OCC(CO)O1 |
2-Octanone__cyclic_(hydroxymethyl)ethylene_acetal | C(CCCCC)C1(C)OCC(CO)O1 |
2-Pentanone, 4-methyl-, cyclic (hydroxymethyl)ethylene acetal | C(C(C)C)C1(C)OCC(CO)O1 |
2-Pentanone__4-methyl-__cyclic_(hydroxymethyl)ethylene_acetal | C(C(C)C)C1(C)OCC(CO)O1 |
2-Phenylpropionaldehyde dimethyl acetal | C(C)(C(OC)OC)c1ccccc1 |
2-Propanone, 1-phenyl-, cyclic 1,2-ethanediyl acetal | C(c1ccccc1)C2(C)OCCO2 |
2-Propanone__1-phenyl-__cyclic_1_2-ethanediyl_acetal | C(c1ccccc1)C2(C)OCCO2 |
2-Pyridinecarboxaldehyde, cyclic 1,2-ethanediyl acetal | C1(OCCO1)c2ccccn2 |
2-Pyridinecarboxaldehyde__cyclic_1_2-ethanediyl_acetal | C1(OCCO1)c2ccccn2 |
2_5-Hexanedione__cyclic_bis(1_2-ethanediyl_acetal) | C(CC1(C)OCCO1)C2(C)OCCO2 |
3-Butene-2-one ethylene acetal | C(=C)C1(C)OCCO1 |
3-Ethoxypropionaldehyde diethyl acetal | C(OCC)(OCC)CCOCC |
3-Methoxybutyraldehyde dimethyl acetal | C(OC)(OC)CC(C)OC |
3-Oxobutyraldehyde dimethyl acetal | C(OC)(OC)CC(C)=O |
3-Pentanone, cyclic 1, 2-ethanediyl acetal | C(C)C1(CC)OCCO1 |
3-Pentanone__cyclic_1__2-ethanediyl_acetal | C(C)C1(CC)OCCO1 |
3-Phenyl-2-propenal dimethyl acetal | C(=C(C=O)CCCCCC)c1ccccc1 |
3-Phenylpropionaldehyde, ethylene acetal | C(CC1OCCO1)c2ccccc2 |
3-Phenylpropynal diethyl acetal | C(#CC(OCC)OCC)c1ccccc1 |
4-Allylpyrocatechol formaldehyde acetal | C(C=C)c1ccc2OCOc2c1 |
4-Allylpyrocatechol_formaldehyde_acetal | C(C=C)c1ccc2OCOc2c1 |
4-Chlorobenzaldehyde diethyl acetal | C(OCC)(OCC)c1ccc(Cl)cc1 |
7-Hydroxy-3,7-dimethyloctanal, dimethyl acetal | C(C(C)CCCC(C)(C)O)C(OC)OC |
ALPHA_-Aminoacetaldehyde diethyl acetal | C(CN)(OCC)OCC |
ALPHA_-Aminoacetaldehyde_diethyl_acetal | C(CN)(OCC)OCC |
ALPHA_-Bromoacetaldehyde diethyl acetal | C(CBr)(OCC)OCC |
ALPHA_-Bromoacetaldehyde_diethyl_acetal | C(CBr)(OCC)OCC |
ALPHA_-Methyl-p-isopropyl hydrocinnamic aldehyde diethyl acetal | C(C(C)C(OCC)OCC)c1ccc(cc1)C(C)C |
ALPHA_-Methyl-p-isopropyl_hydrocinnamic_aldehyde_diethyl_acetal | C(C(C)C(OCC)OCC)c1ccc(cc1)C(C)C |
ALPHA_-Methylphenacetaldehyde dimethyl acetal | C(C)(C(OC)OC)c1ccccc1 |
ALPHA_-Methylphenacetaldehyde_dimethyl_acetal | C(C)(C(OC)OC)c1ccccc1 |
ALPHA_-Tolylaldehyde dimethyl acetal | C(C(OC)OC)c1ccccc1 |
Acetal (VAN) | C(=O)(O)c1ccccc1OC(C)=O |
Acetal diethylique(FRENCH) | C(C)(OCC)OCC |
Acetaldehyde diethyl acetal | C(C)(OCC)OCC |
Acetaldehyde, (methylamino)-, dimethyl acetal | C(OC)(OC)CNC |
Acetaldehyde, amino-, diethyl acetal | C(CN)(OCC)OCC |
Acetaldehyde, amino-, dimethyl acetal | C(CN)(OC)OC |
Acetaldehyde, bis(2-chloroethyl) acetal | C(C)(OCCCl)OCCCl |
Acetaldehyde, bromo-, diethyl acetal | C(CBr)(OCC)OCC |
Acetaldehyde, bromo-, dimethyl acetal | C(CBr)(OC)OC |
Acetaldehyde, chloro-, diethyl acetal | C(CCl)(OCC)OCC |
Acetaldehyde, chloro-, dimethyl acetal | C(CCl)(OC)OC |
Acetaldehyde, dibutyl acetal | O(CCCC)C(C)OCCCC |
Acetaldehyde, diethyl acetal | C(C)(OCC)OCC |
Acetaldehyde, dihexyl acetal | C(C)(OCCCCCC)OCCCCCC |
Acetaldehyde, ethyl phenyl acetal | O(C(C)OCC)c1ccccc1 |
Acetaldehyde, hydroxy-, cyclic 1,2-ethanediyl acetal | C(O)C1OCCO1 |
Acetaldehyde, phenoxy-, diethyl acetal | O(CC(OCC)OCC)c1ccccc1 |
Acetaldehyde, phenyl-, diethyl acetal | C(OCC)(OCC)Cc1ccccc1 |
Acetaldehyde, phenyl-, dimethyl acetal | C(C(OC)OC)c1ccccc1 |
Acetaldehyde__(methylamino)-__dimethyl_acetal | C(OC)(OC)CNC |
Acetaldehyde__amino-__dimethyl_acetal | C(CN)(OC)OC |
Acetaldehyde__bromo-__dimethyl_acetal | C(CBr)(OC)OC |
Acetaldehyde__chloro-__diethyl_acetal | C(CCl)(OCC)OCC |
Acetaldehyde__chloro-__dimethyl_acetal | C(CCl)(OC)OC |
Acetaldehyde__ethyl_phenyl_acetal | O(C(C)OCC)c1ccccc1 |
Acetaldehyde__hydroxy-__cyclic_1_2-ethanediyl_acetal | C(O)C1OCCO1 |
Acetaldehyde__phenoxy-__diethyl_acetal | O(CC(OCC)OCC)c1ccccc1 |
Acetaldehyde__phenyl-__diethyl_acetal | C(OCC)(OCC)Cc1ccccc1 |
Acetaldehyde__phenyl-__dimethyl_acetal | C(C(OC)OC)c1ccccc1 |
Acetoacetaldehyde dimethyl acetal | C(OC)(OC)CC(C)=O |
Acetoacetaldehyde, 1-(dimethyl acetal) | C(OC)(OC)CC(C)=O |
Acetone diethyl acetal | C(C)(C)(OCC)OCC |
Acetone dimethyl acetal | C(C)(C)(OC)OC |
Acetone, dibutyl acetal | O(CCCC)C(C)(C)OCCCC |
Acetone, diethyl acetal | C(C)(C)(OCC)OCC |
Acetone, dimethyl acetal | C(C)(C)(OC)OC |
Acetone__diethyl_acetal | C(C)(C)(OCC)OCC |
Acetone__dimethyl_acetal | C(C)(C)(OC)OC |
Acetylacetaldehyde dimethyl acetal | C(OC)(OC)CC(C)=O |
Acrolein acetal | C(C=C)(OCC)OCC |
Acrolein diethyl acetal | C(C=C)(OCC)OCC |
Acrolein, 3-ethoxy-, diethyl acetal | C(OCC)(OCC)C=COCC |
Acrolein, cyclic neopentanetetrayl acetal | C(=C)C1OCC2(CO1)COC(C=C)OC2 |
Acrolein, diethyl acetal | C(C=C)(OCC)OCC |
Acrolein-pentaerythritol dicyclic acetal | C(=C)C1OCC2(CO1)COC(C=C)OC2 |
Acrolein__3-ethoxy-__diethyl_acetal | C(OCC)(OCC)C=COCC |
Acrylaldehyde diethyl acetal | C(C=C)(OCC)OCC |
Acrylaldehyde_diethyl_acetal | C(C=C)(OCC)OCC |
Aldophosphamide diethyl acetal | N(CCCl)(CCCl)P(N)(=O)OCCC(OCC)OCC |
Aldophosphamide_diethyl_acetal | N(CCCl)(CCCl)P(N)(=O)OCCC(OCC)OCC |
Aminoacetaldehyde diethyl acetal | C(CN)(OCC)OCC |
Aminoacetaldehyde dimethyl acetal | C(CN)(OC)OC |
BETA_-Aminoacetaldehyde diethyl acetal | C(CN)(OCC)OCC |
BETA_-Ethoxypropionaldehyde diethyl acetal | C(OCC)(OCC)CCOCC |
BETA_-Ethoxypropionaldehyde_diethyl_acetal | C(OCC)(OCC)CCOCC |
BETA_-Oxobutyraldehyde dimethyl acetal | C(OC)(OC)CC(C)=O |
BETA_-Oxobutyraldehyde_dimethyl_acetal | C(OC)(OC)CC(C)=O |
Benzaldehyde dimethyl acetal | C(OC)(OC)c1ccccc1 |
Benzaldehyde ethylene acetal | C1(OCCO1)c2ccccc2 |
Benzaldehyde, cyclic (hydroxymethyl)ethylene acetal | C(O)C1COC(O1)c2ccccc2 |
Benzaldehyde, cyclic 1,2-dimethylethylene acetal | CC1OC(OC1C)c2ccccc2 |
Benzaldehyde, diethyl acetal | C(OCC)(OCC)c1ccccc1 |
Benzaldehyde, dimethyl acetal | C(OC)(OC)c1ccccc1 |
Benzaldehyde, p-chloro-, diethyl acetal | C(OCC)(OCC)c1ccc(Cl)cc1 |
Benzaldehyde-, 2,2-dimethyl-1, 3-propanediol acetal | CC1(C)COC(OC1)c2ccccc2 |
Benzaldehyde-__2_2-dimethyl-1__3-propanediol_acetal | CC1(C)COC(OC1)c2ccccc2 |
Benzaldehyde__cyclic_(hydroxymethyl)ethylene_acetal | C(O)C1COC(O1)c2ccccc2 |
Benzaldehyde__cyclic_1_2-dimethylethylene_acetal | CC1OC(OC1C)c2ccccc2 |
Benzaldehyde__p-chloro-__diethyl_acetal | C(OCC)(OCC)c1ccc(Cl)cc1 |
Benzaldehyde_ethylene_acetal | C1(OCCO1)c2ccccc2 |
Benzeneacetaldehyde, diethyl acetal | C(OCC)(OCC)Cc1ccccc1 |
Benzenepropanal, cyclic 1,2-ethanediyl acetal | C(CC1OCCO1)c2ccccc2 |
Benzenepropanal__cyclic_1_2-ethanediyl_acetal | C(CC1OCCO1)c2ccccc2 |
Bis-(2,2-dinitropropyl) acetal formaldehyde | C(C)(COCOCC(C)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
Bromoacetaldehyde diethyl acetal | C(CBr)(OCC)OCC |
Bromoacetaldehyde dimethyl acetal | C(CBr)(OC)OC |
Butanal, cyclic 1,2-ethanediyl acetal | C(CC)C1OCCO1 |
Butanal__cyclic_1_2-ethanediyl_acetal | C(CC)C1OCCO1 |
Butyraldehyde, 3-ethoxy-, diethyl acetal | C(OCC)(OCC)CC(C)OCC |
Butyraldehyde, 3-methoxy-, dimethyl acetal | C(OC)(OC)CC(C)OC |
Butyraldehyde, cyclic 2-ethyl-2-nitrotrimethylene acetal | [N+](=O)([O-])C1(CC)COC(CCC)OC1 |
Butyraldehyde-1,3-butylene glycol acetal | C(CC)C1OCCC(C)O1 |
Butyraldehyde-1_3-butylene_glycol_acetal | C(CC)C1OCCC(C)O1 |
Butyraldehyde__3-ethoxy-__diethyl_acetal | C(OCC)(OCC)CC(C)OCC |
Butyraldehyde__3-methoxy-__dimethyl_acetal | C(OC)(OC)CC(C)OC |
Butyraldehyde__cyclic_2-ethyl-2-nitrotrimethylene_acetal | [N+](=O)([O-])C1(CC)COC(CCC)OC1 |
Chloroacetaldehyde diethyl acetal | C(CCl)(OCC)OCC |
Chloroacetaldehyde ethylene acetal | C(Cl)C1OCCO1 |
Chloroacetaldehyde, dimethyl acetal | C(CCl)(OC)OC |
Chloroacetaldehyde_ethylene_acetal | C(Cl)C1OCCO1 |
Cinnamaldehyde diethyl acetal | C(=CC(OCC)OCC)c1ccccc1 |
Cinnamaldehyde ethylene glycol acetal | C(=CC1OCCO1)c2ccccc2 |
Cinnamaldehyde, cyclic ethylene acetal | C(=CC1OCCO1)c2ccccc2 |
Cinnamaldehyde, diethyl acetal | C(=CC(OCC)OCC)c1ccccc1 |
Cinnamaldehyde, dimethyl acetal | C(=C(C=O)CCCCCC)c1ccccc1 |
Cinnamaldehyde-1,3-butylene glycol acetal | C(=Cc1ccccc1)C2OCCC(C)O2 |
Cinnamaldehyde__cyclic_ethylene_acetal | C(=CC1OCCO1)c2ccccc2 |
Cinnamic aldehyde dimethyl acetal | C(=C(C=O)CCCCCC)c1ccccc1 |
Cyclamen aldehyde diethyl acetal | C(C(C)C(OCC)OCC)c1ccc(cc1)C(C)C |
Cyclohexanone ethylene acetal | C123OCCO1.C2CCCC3 |
Cyclohexanone, 3-methyl-, cyclic 2-hydroxytrimethylene acetal | CC1CCCC2(C1)OCC(O)CO2 |
Cyclohexanone, cyclic propylene acetal | CC1COC2(CCCCC2)O1 |
Cyclohexanone, cyclic trimethylene acetal | C123CCCCC1.O2CCCO3 |
Cyclohexanone__3-methyl-__cyclic_2-hydroxytrimethylene_acetal | CC1CCCC2(C1)OCC(O)CO2 |
Cyclohexanone__cyclic_propylene_acetal | CC1COC2(CCCCC2)O1 |
Cyclohexanone__cyclic_trimethylene_acetal | C123CCCCC1.O2CCCO3 |
Decanal diethyl acetal | C(OCC)(OCC)CCCCCCCCC |
Decanal dimethyl acetal | C(OC)(OC)CCCCCCCCC |
Decanal, dimethyl acetal | C(OC)(OC)CCCCCCCCC |
Decanal, propylene glycol acetal | C(CCCCCCCC)C1OCC(C)O1 |
Decanal__dimethyl_acetal | C(OC)(OC)CCCCCCCCC |
Decanal__propylene_glycol_acetal | C(CCCCCCCC)C1OCC(C)O1 |
Di(2-chloroethyl)acetal | C(C)(OCCCl)OCCCl |
Di-n-butyl acetal | O(CCCC)C(C)OCCCC |
Diethyl acetal | C(C)(OCC)OCC |
Diethyl bromoacetaldehyde acetal | C(CBr)(OCC)OCC |
Diethyl formylsuccinate diethyl acetal | C(CC(=O)OCC)(C(=O)OCC)C(OCC)OCC |
Ethanedial, cyclic 1,2:1, 2-bis(1,2-ethanediyl acetal) | C12OCCOC1OCCO2 |
Ethanedial__cyclic_1_2:1__2-bis(1_2-ethanediyl_acetal) | C12OCCOC1OCCO2 |
Ethyl acetoacetate 3-ethylene acetal | C(C(=O)OCC)C1(C)OCCO1 |
Ethylene glycol acetal of heptaldehyde | C(CCCCC)C1OCCO1 |
Ethylene_glycol_acetal_of_heptaldehyde | C(CCCCC)C1OCCO1 |
Formaldehyde bis(2-chloroethyl) acetal | C(OCCCl)OCCCl |
Formaldehyde bis(2-fluoro-2,2-dinitroethyl) acetal | C(F)(COCOCC(F)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
Formaldehyde bis(BETA_-chloroethyl) acetal | C(OCCCl)OCCCl |
Formaldehyde dibutyl acetal | C(OCCCC)OCCCC |
Formaldehyde diethyl acetal | C(OCC)OCC |
Formaldehyde, cyclic 1,1, 3-trimethyltrimethylene acetal | CC1(C)OCOC(C)C1 |
Formaldehyde, cyclic tetramethylene acetal | C1CCOCOC1 |
Formaldehyde, diethyl acetal | C(OCC)OCC |
Formaldehyde__cyclic_1_1__3-trimethyltrimethylene_acetal | CC1(C)OCOC(C)C1 |
Formaldehyde__cyclic_tetramethylene_acetal | C1CCOCOC1 |
Furfural propylene glycol acetal | CC1COC(O1)C2=CC=CO2 |
Glutaraldehyde, bis(dimethyl acetal) | C(OC)(OC)CCCC(OC)OC |
Glutaraldehyde__bis(dimethyl_acetal) | C(OC)(OC)CCCC(OC)OC |
Glutardialdehyde tetramethyl acetal | C(OC)(OC)CCCC(OC)OC |
Glycinaldehyde diethyl acetal | C(CN)(OCC)OCC |
Glycolaldehyde diethyl acetal | C(CO)(OCC)OCC |
Glycolaldehyde, diethyl acetal | C(CO)(OCC)OCC |
Glycolaldehyde__diethyl_acetal | C(CO)(OCC)OCC |
Glyoxal tetraallyl acetal | C(OCC=C)(OCC=C)C(OCC=C)OCC=C |
Glyoxal, bis(diallyl acetal) | C(OCC=C)(OCC=C)C(OCC=C)OCC=C |
Glyoxal, phenyl-, 2-(diethyl acetal) | C(OCC)(OCC)C(=O)c1ccccc1 |
Glyoxal, tetrabutyl acetal | C(OCCCC)(OCCCC)C(OCCCC)OCCCC |
Glyoxal, tetrabutyl-, acetal | C(OCCCC)(OCCCC)C(OCCCC)OCCCC |
Glyoxal__phenyl-__2-(diethyl_acetal) | C(OCC)(OCC)C(=O)c1ccccc1 |
Glyoxylic acid methyl ester dimethyl acetal | C(OC)(OC)C(=O)OC |
Glyoxylic acid, methyl ester, 2-(dimethyl acetal) | C(OC)(OC)C(=O)OC |
Glyoxylic_acid__methyl_ester__2-(dimethyl_acetal) | C(OC)(OC)C(=O)OC |
Heptaldehyde, ethylene glycol acetal | C(CCCCC)C1OCCO1 |
Heptaldehyde-1,3-butylene glycol acetal | C(CCCCC)C1OCCC(C)O1 |
Heptanal, cyclic 1,2-ethanediyl acetal | C(CCCCC)C1OCCO1 |
Heptanal, cyclic 1,3-propanediyl acetal | C(CCCCC)C1OCCC(C)O1 |
Heptanal, cyclic 1-methyltrimethylene acetal | C(CCCCC)C1OCCC(C)O1 |
Heptanal, cyclic ethylene acetal | C(CCCCC)C1OCCO1 |
Heptanal, cyclic propylene acetal | C(CCCCC)C1OCC(C)O1 |
Heptanal, cyclic trimethylene acetal | C(CCCCC)C1OCCC(C)O1 |
Heptanal__cyclic_1-methyltrimethylene_acetal | C(CCCCC)C1OCCC(C)O1 |
Heptanal__cyclic_propylene_acetal | C(CCCCC)C1OCC(C)O1 |
Hexaldehyde-1,3-butylene glycol acetal | C(CCCC)C1OCCC(C)O1 |
Hexaldehyde-1_3-butylene_glycol_acetal | C(CCCC)C1OCCC(C)O1 |
Hydratropaldehyde dimethyl acetal | C(C)(C(OC)OC)c1ccccc1 |
Hydratropaldehyde, dimethyl acetal | C(C)(C(OC)OC)c1ccccc1 |
Hydratropic aldehyde dimethyl acetal | C(C)(C(OC)OC)c1ccccc1 |
Hydrocinnamaldehyde, cyclic ethylene acetal | C(CC1OCCO1)c2ccccc2 |
Hydrocinnamaldehyde, diethyl acetal | C(CC(OCC)OCC)c1ccccc1 |
Hydrocinnamaldehyde, p-isopropyl-ALPHA_-methyl-, diethyl acetal | C(C(C)C(OCC)OCC)c1ccc(cc1)C(C)C |
Hydrocinnamaldehyde__diethyl_acetal | C(CC(OCC)OCC)c1ccccc1 |
Hydroxycitronella dimethyl acetal | C(C(C)CCCC(C)(C)O)C(OC)OC |
Hydroxycitronellal dimethyl acetal | C(C(C)CCCC(C)(C)O)C(OC)OC |
Isobutyraldehyde, bis(2-methylallyl)acetal | C(OCC(C)=C)(OCC(C)=C)C(C)C |
Isobutyraldehyde, propylene glycol acetal | C(C)(C)C1OCC(C)O1 |
Laurine dimethyl acetal | C(C(C)CCCC(C)(C)O)C(OC)OC |
Malonaldehyde bis(diethyl acetal) | C(OCC)(OCC)CC(OCC)OCC |
Malonaldehyde bis(dimethyl acetal) | C(OC)(OC)CC(OC)OC |
Malonaldehyde diethyl acetal | C(OCC)(OCC)CC(OCC)OCC |
Malonaldehyde tetraethyl acetal | C(OCC)(OCC)CC(OCC)OCC |
Malonaldehyde tetramethyl acetal | C(OC)(OC)CC(OC)OC |
Malonaldehyde, bis(diethyl acetal) | C(OCC)(OCC)CC(OCC)OCC |
Malonaldehyde, bis(dimethyl acetal) | C(OC)(OC)CC(OC)OC |
Malonaldehyde__bis(diethyl_acetal) | C(OCC)(OCC)CC(OCC)OCC |
Malonaldehyde__bis(dimethyl_acetal) | C(OC)(OC)CC(OC)OC |
Methyl vinyl ketone ethylene acetal | C(=C)C1(C)OCCO1 |
Methyl_vinyl_ketone_ethylene_acetal | C(=C)C1(C)OCCO1 |
Methylaminoacetaldehyde dimethyl acetal | C(OC)(OC)CNC |
Methylglyoxal dimethyl acetal | C(OC)(OC)C(C)=O |
Monochloroacetaldehyde diethyl acetal | C(CCl)(OCC)OCC |
N-Methylaminoacetaldehyde dimethyl acetal | C(OC)(OC)CNC |
Octanal diethyl acetal | C(OCC)(OCC)CCCCCCC |
Octanal, 7-hydroxy-3,7-dimethyl-, dimethyl acetal | C(C(C)CCCC(C)(C)O)C(OC)OC |
Octanal__7-hydroxy-3_7-dimethyl-__dimethyl_acetal | C(C(C)CCCC(C)(C)O)C(OC)OC |
Octanal_diethyl_acetal | C(OCC)(OCC)CCCCCCC |
Pentaerythritol, bis(cyclic acetal) with formaldehyde- | C123COCOC1.C2OCOC3 |
Pentaerythritol__bis(cyclic_acetal)_with_formaldehyde- | C123COCOC1.C2OCOC3 |
Phenacetaldehyde dimethyl acetal | C(C(OC)OC)c1ccccc1 |
Phenoxyacetaldehyde diethyl acetal | O(CC(OCC)OCC)c1ccccc1 |
Phenyl acetaldehyde cyclic acetal with trimethylene glycol | C(c1ccccc1)C2OCCCO2 |
Phenyl_acetaldehyde_cyclic_acetal_with_trimethylene_glycol | C(c1ccccc1)C2OCCCO2 |
Phenylacetaldehyde dibenzyl acetal | C(OCc1ccccc1)(OCc2ccccc2)Cc3ccccc3 |
Phenylacetaldehyde diethyl acetal | C(OCC)(OCC)Cc1ccccc1 |
Phenylacetaldehyde dimethyl acetal | C(C(OC)OC)c1ccccc1 |
Phenylacetaldehyde ethylene acetal | C(c1ccccc1)C2OCCO2 |
Phenylacetaldehyde ethyleneglycol acetal | C(c1ccccc1)C2OCCO2 |
Phenylacetaldehyde glycol acetal | C(c1ccccc1)C2OCCO2 |
Phenylacetaldehyde phenylethylene glycol acetal | C(c1ccccc1)C2OCC(O2)c3ccccc3 |
Phenylacetaldehyde propyleneglycol acetal | C(c1ccccc1)C2OCC(C)O2 |
Phenylacetaldehyde_ethyleneglycol_acetal | C(c1ccccc1)C2OCCO2 |
Phenylacetaldehyde_phenylethylene_glycol_acetal | C(c1ccccc1)C2OCC(O2)c3ccccc3 |
Phenylacetaldehyde_propyleneglycol_acetal | C(c1ccccc1)C2OCC(C)O2 |
Phenylacetic aldehyde dimethyl acetal | C(C(OC)OC)c1ccccc1 |
Phenylethyl acetal | O(C(C)OCC)c1ccccc1 |
Phenylglyoxal diethyl acetal | C(OCC)(OCC)C(=O)c1ccccc1 |
Phenylpropargyl aldehyde diethyl acetal | C(#CC(OCC)OCC)c1ccccc1 |
Picolinaldehyde, cyclic ethylene acetal | C1(OCCO1)c2ccccn2 |
Piperonal bis(2-(2-butoxyethoxy)ethyl) acetal | C(OCCOCCOCCCC)(OCCOCCOCCCC)c1ccc2OCOc2c1 |
Piperonal bis(2-(2-butoxyethoxy)ethyl)acetal | C(OCCOCCOCCCC)(OCCOCCOCCCC)c1ccc2OCOc2c1 |
Piperonal diethyl acetal | C(OCC)(OCC)c1ccc2OCOc2c1 |
Piperonal, bis(2-(2-butoxyethoxy)ethyl) acetal | C(OCCOCCOCCCC)(OCCOCCOCCCC)c1ccc2OCOc2c1 |
Propenal diethyl acetal | C(C=C)(OCC)OCC |
Propiolaldehyde, phenyl-, diethyl acetal | C(#CC(OCC)OCC)c1ccccc1 |
Propionaldehyde diethyl acetal | C(CC)(OCC)OCC |
Propionaldehyde, 2-bromo-3-methoxy-, dimethyl acetal | C(OC)(OC)C(Br)COC |
Propionaldehyde, 2-chloro-3-ethoxy-, diethyl acetal | C(OCC)(OCC)C(Cl)COCC |
Propionaldehyde, 3-(2-chloroethoxy)-, bis(2-chloroethyl) acetal | C(OCCCl)(OCCCl)CCOCCCl |
Propionaldehyde, 3-ethoxy-, diethyl acetal | C(OCC)(OCC)CCOCC |
Propionaldehyde, diethyl acetal | C(CC)(OCC)OCC |
Propionaldehyde__2-bromo-3-methoxy-__dimethyl_acetal | C(OC)(OC)C(Br)COC |
Propionaldehyde__2-chloro-3-ethoxy-__diethyl_acetal | C(OCC)(OCC)C(Cl)COCC |
Propionaldehyde__3-(2-chloroethoxy)-__bis(2-chloroethyl)_acetal | C(OCCCl)(OCCCl)CCOCCCl |
Propionaldehyde__diethyl_acetal | C(CC)(OCC)OCC |
Pyruvaldehyde dimethyl acetal | C(OC)(OC)C(C)=O |
Pyruvaldehyde, 1-(diethyl acetal) | C(OCC)(OCC)C(C)=O |
Pyruvaldehyde, 1-(dimethyl acetal) | C(OC)(OC)C(C)=O |
Pyruvaldehyde__1-(diethyl_acetal) | C(OCC)(OCC)C(C)=O |
Pyruvaldehyde__1-(dimethyl_acetal) | C(OC)(OC)C(C)=O |
Tetraethyl malondialdehyde acetal | C(OCC)(OCC)CC(OCC)OCC |
Tolyl aldehyde, propylene glycol acetal | CC1COC(O1)c2ccc(C)cc2 |
Vanillin 1, 3-butylene glycol acetal | O(C)c1cc(ccc1O)C2OCCC(C)O2 |
p-Chlorobenzaldehyde diethyl acetal | C(OCC)(OCC)c1ccc(Cl)cc1 |
p-Nitrobenzaldehyde ethylene acetal | [N+](=O)([O-])c1ccc(cc1)C2OCCO2 |
p-Nitrobenzaldehyde_ethylene_acetal | [N+](=O)([O-])c1ccc(cc1)C2OCCO2 |