If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Nitro-2-aminofenol(CZECH) | [N+](=O)([O-])c1ccc(O)c(N)c1 |
Acet-o-aminofenol (CZECH) | N(C(C)=O)c1ccccc1O |
Kyselina 4-nitro-2-aminofenol-6-sulfonova (CZECH) | S(=O)(=O)(O)c1cc(cc(N)c1O)[N+](=O)[O-] |
Kyselina_4-nitro-2-aminofenol-6-sulfonova_(CZECH) | S(=O)(=O)(O)c1cc(cc(N)c1O)[N+](=O)[O-] |
m-Aminofenol (CZECH) | Nc1cccc(O)c1 |
p-Aminofenol(CZECH) | Nc1ccc(O)cc1 |