If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Propanone, methylhydrazone | N(NC)=C(C)C |
2-Propanone__methylhydrazone | N(NC)=C(C)C |
3-Pyridinecarboxaldehyde, methylhydrazone | C(=NNC)c1cccnc1 |
3-Pyridinecarboxaldehyde__methylhydrazone | C(=NNC)c1cccnc1 |
Acetaldehyde N-formyl-N-methylhydrazone | N(C)(C=O)N=CC |
Acetaldehyde, N-formyl-N-methylhydrazone | N(C)(C=O)N=CC |
Actidione, methylhydrazone | C(O)(CC1CC(=O)NC(=O)C1)C2CC(C)CC(C)C2=NNC |
Actidione__methylhydrazone | C(O)(CC1CC(=O)NC(=O)C1)C2CC(C)CC(C)C2=NNC |
Butanal, 3-methyl-, N-formyl-N-methylhydrazone | N(C)(C=O)N=CCC(C)C |
N-Formyl-N-methylhydrazone 3-methylbutanal | N(C)(C=O)N=CCC(C)C |
Nicotinaldehyde, methylhydrazone | C(=NNC)c1cccnc1 |
Terephthalaldehydamide, N-isopropyl-, 4-(methylhydrazone) | C(=O)(NC(C)C)c1ccc(C=NNC)cc1 |