If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Butenedinitrile, (E)- | C(C#N)=CC#N |
2-Butenedinitrile, 2,3-bis(methylthio)-, (Z)- | C(C#N)(SC)=C(C#N)SC |
2-Butenedinitrile, 2,3-diamino-, (Z)- | C(N)(C#N)=C(N)C#N |
2-Butenedinitrile, 2,3-dichloro-, (E)- | C(Cl)(C#N)=C(Cl)C#N |
2-Butenedinitrile, 2,3-dimercapto-, disodium salt, (Z)- | C(S)(C#N)=C(S)C#N |
2-Butenedinitrile, 2,3-diphenyl-, (E)- | C(C#N)(c1ccccc1)=C(C#N)c2ccccc2 |
2-Butenedinitrile__2_3-bis(methylthio)-__(Z)- | C(C#N)(SC)=C(C#N)SC |
2-Butenedinitrile__2_3-diamino-__(Z)- | C(N)(C#N)=C(N)C#N |
2-Butenedinitrile__2_3-dichloro-__(E)- | C(Cl)(C#N)=C(Cl)C#N |
2-Butenedinitrile__2_3-dimercapto-__disodium_salt__(Z)- | C(S)(C#N)=C(S)C#N |