If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Isopropyl-5-methylcyclohexanone | C(C)(C)C1CCC(C)CC1=O |
2-Methyl-cyclohexanon (german, dutch)o-methylcyclohexanone | CC1CCCCC1=O |
2-Methyl-cyclohexanon_(german__dutch)o-methylcyclohexanone | CC1CCCCC1=O |
2-Methylcyclohexanone (VAN) | CC1CCCCC1=O |
2-Methylcyclohexanone oxime | N(O)=C1CCCCC1C |
3-Methylcyclohexanone 2,4-dinitrophenylhydrazone | [N+](=O)([O-])c1cc(ccc1NN=C2CCCC(C)C2)[N+](=O)[O-] |
3-Methylcyclohexanone oxime | N(O)=C1CCCC(C)C1 |
3-Methylcyclohexanone | CC1CCCC(=O)C1 |
4-Methylcyclohexanone 2,4-dinitrophenylhydrazone | [N+](=O)([O-])c1cc(ccc1NN=C2CCC(C)CC2)[N+](=O)[O-] |
4-Methylcyclohexanone oxime | N(O)=C1CCC(C)CC1 |
4-Methylcyclohexanone | CC1CCC(=O)CC1 |
ALPHA_-Methylcyclohexanone | CC1CCCCC1=O |