If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 3-Dicyclopentyl-2-n-dodecylcyclopentane | C(CCCCCCCCCCC)C1C(CCC1C2CCCC2)C3CCCC3 |
1, 5-Dicyclopentyl-3-(2-cyclopentyl-ethyl)-2-pentene | C(CCC1CCCC1)(CCC2CCCC2)=CCC3CCCC3 |
1, 7-Dicyclopentyl-4-n-octylheptane | C(CCCCCCCC)(CCCC1CCCC1)CCCC2CCCC2 |
1,5-Dicyclopentyl-3-(2-cyclopentylethyl)pentane | C(CCC1CCCC1)(CCC2CCCC2)CCC3CCCC3 |
1,7-Dicyclopentyl-4-(2'-cyclohexylethyl)heptane | C(CCCC1CCCC1)(CCCC2CCCC2)CCC3CCCCC3 |
1,7-Dicyclopentyl-4-(3-cyclopentylpropyl)heptane | C(CCCC1CCCC1)(CCCC2CCCC2)CCCC3CCCC3 |
1__3-Dicyclopentyl-2-n-dodecylcyclopentane | C(CCCCCCCCCCC)C1C(CCC1C2CCCC2)C3CCCC3 |
Cyclopentane, 1,3-dicyclopentyl- | C1(CCC(C1)C2CCCC2)C3CCCC3 |
Cyclopentane__1_3-dicyclopentyl- | C1(CCC(C1)C2CCCC2)C3CCCC3 |
Dicyclopentyl | C1(CCCC1)C2CCCC2 |
Disulfide, dicyclopentyl | S(SC1CCCC1)C2CCCC2 |
Disulfide__dicyclopentyl | S(SC1CCCC1)C2CCCC2 |
Ethane, 1, 1-dicyclopentyl- | C(C)(C1CCCC1)C2CCCC2 |
Phosphinous acid, dicyclopentyl-, 1-methylethyl ester | P(OC(C)C)(C1CCCC1)C2CCCC2 |
Phosphinous acid, dicyclopentyl-, isopropyl ester | P(OC(C)C)(C1CCCC1)C2CCCC2 |
Phosphinous_acid__dicyclopentyl-__1-methylethyl_ester | P(OC(C)C)(C1CCCC1)C2CCCC2 |