If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,3,4-Thiadiazole, 5-isobutyl-2-(p-methoxybenzenesulfonamido)- | S(=O)(=O)(NC1=NN=C(CC(C)C)S1)c2ccc(OC)cc2 |
1,3-Dioxolane-4-methanol, 2-isobutyl-2-methyl- | C(C(C)C)C1(C)OCC(CO)O1 |
1,3-Propanediol, 2-isobutyl-2-methyl-, dicarbamate | C(C)(COC(N)=O)(COC(N)=O)CC(C)C |
1-Piperidinebutyraldehyde, ALPHA_-isobutyl-ALPHA_-1-naphthyl- | C(C=O)(CCN1CCCCC1)(CC(C)C)c2cccc3ccccc23 |
1_3-Propanediol__2-isobutyl-2-methyl-__dicarbamate | C(C)(COC(N)=O)(COC(N)=O)CC(C)C |
2,4,6-Trimethylphenyl isobutyl ketone | C(=O)(CC(C)C)c1c(C)cc(C)cc1C |
2,4-D Isobutyl ester | O(CC(=O)OCC(C)C)c1ccc(Cl)cc1Cl |
2,4-Dichlorophenoxyacetic acid isobutyl ester | O(CC(=O)OCC(C)C)c1ccc(Cl)cc1Cl |
2,4-Dichlorophenoxyacetic acid, isobutyl ester | O(CC(=O)OCC(C)C)c1ccc(Cl)cc1Cl |
2-(p-Anisylsulfonamido)-5-isobutyl-1,3,4-thiadiazole | S(=O)(=O)(NC1=NN=C(CC(C)C)S1)c2ccc(OC)cc2 |
2-(p-Methoxybenzenesulfonamido)-5-isobutyl-1,3,4-thiadiazole | S(=O)(=O)(NC1=NN=C(CC(C)C)S1)c2ccc(OC)cc2 |
2-Thio-5-isobutyl-3-phenylhydantoin | O=C1C(CC(C)C)NC(=S)N1c2ccccc2 |
5-Isobutyl-2-p-methoxybenzenesulfonamido-1,3,4-thiadiazole | S(=O)(=O)(NC1=NN=C(CC(C)C)S1)c2ccc(OC)cc2 |
8-Isobutyl theophylline | O=C1N(C)C(=O)N(C)C2=C1N=C(CC(C)C)N2 |
9H-Purine, 2-amino-6-(2,4-dichlorobenzylthio)-9-isobutyl- | C(C(C)C)N1C=Nc2c1nc(N)nc2SCc3ccc(Cl)cc3Cl |
9H-Purine, 2-amino-6-(p-bromobenzylthio)-9-isobutyl- | C(C(C)C)N1C=Nc2c1nc(N)nc2SCc3ccc(Br)cc3 |
9H-Purine-6-thiol, 2-amino-9-isobutyl- | C(C(C)C)N1C=Nc2c(S)nc(N)nc12 |
9H-Purine-6-thiol__2-amino-9-isobutyl- | C(C(C)C)N1C=Nc2c(S)nc(N)nc12 |
Acetamide, N-isobutyl- | C(NC(C)=O)C(C)C |
Acetic acid, (2,4-dichlorophenoxy)-, isobutyl ester | O(CC(=O)OCC(C)C)c1ccc(Cl)cc1Cl |
Acetic acid, chloro-, isobutyl ester | C(=O)(CCl)OCC(C)C |
Acetic acid, isobutyl ester | C(OC(C)=O)C(C)C |
Acetic acid, phenyl-, isobutyl ester | C(C(=O)OCC(C)C)c1ccccc1 |
Acetic acid, trichloro-, isobutyl ester | C(=O)(OCC(C)C)C(Cl)(Cl)Cl |
Acetophenone, 4-isobutyl- | C(C(C)C)c1ccc(cc1)C(C)=O |
Acide (isobutyl-4 phenyl)-2 propionique (FRENCH) | C(C)(C(=O)O)c1ccc(cc1)CC(C)C |
Acrylic acid, isobutyl ester | C(=O)(C=C)OCC(C)C |
Barbituric acid, 5-(2-butenyl)-5-isobutyl-2-thio-, sodium salt | C(C=CC)C1(CC(C)C)C(=O)NC(=S)NC1=O |
Benzamide, N-isobutyl- | C(=O)(NCC(C)C)c1ccccc1 |
Benzene, isobutyl- | C(C(C)C)c1ccccc1 |
Benzoic acid, 3,5-dinitro-, isobutyl ester | C(=O)(OCC(C)C)c1cc(cc(c1)[N+](=O)[O-])[N+](=O)[O-] |
Benzoic acid, isobutyl ester | C(=O)(OCC(C)C)c1ccccc1 |
Benzoic acid, p-amino-, isobutyl ester | C(=O)(OCC(C)C)c1ccc(N)cc1 |
Benzoic acid, p-nitro-, isobutyl ester | C(=O)(OCC(C)C)c1ccc(cc1)[N+](=O)[O-] |
Benzoic_acid__3_5-dinitro-__isobutyl_ester | C(=O)(OCC(C)C)c1cc(cc(c1)[N+](=O)[O-])[N+](=O)[O-] |
Benzyl isobutyl ketone | C(C(=O)CC(C)C)c1ccccc1 |
Butyramide, N-isobutyl- | C(=O)(CCC)NCC(C)C |
Butyric acid, isobutyl ester | C(=O)(CCC)OCC(C)C |
Carbamic acid, isobutyl ester | C(OC(N)=O)C(C)C |
Carbamic acid, isobutyl-, m-(3,3-dimethylureido)phenyl ester | O(C(=O)NCC(C)C)c1cccc(c1)NC(=O)N(C)C |
Chlorocarbonic acid isobutyl ester | C(OC(Cl)=O)C(C)C |
Chloroformic acid isobutyl ester | C(OC(Cl)=O)C(C)C |
Cinnamamide, N-isobutyl-3,4-(methylenedioxy)- | C(=CC(=O)NCC(C)C)c1ccc2OCOc2c1 |
Cinnamamide, N-isobutyl-3,4-(methylenedioxy)-, stereoisomer | C(=CC(=O)NCC(C)C)c1ccc2OCOc2c1 |
Cinnamic acid, isobutyl ester | C(=CC(=O)OCC(C)C)c1ccccc1 |
Cyclohexane, isobutyl- | C(C(C)C)C1CCCCC1 |
Cyclopentane, isobutyl- | C(C(C)C)C1CCCC1 |
Ether, isobutyl phenyl | O(CC(C)C)c1ccccc1 |
Ether, isobutyl vinyl | C(OC=C)C(C)C |
Ethylamine, 1,2-diphenyl-N-isobutyl-, hydrochloride | C(NCC(C)C)(Cc1ccccc1)c2ccccc2 |
Formamide, N-isobutyl- | C(NC=O)C(C)C |
Formic acid, chloro-, isobutyl ester | C(OC(Cl)=O)C(C)C |
Formic acid, isobutyl ester | C(OC=O)C(C)C |
Guanidine, 1-isobutyl-3-nitro-1-nitroso- | N(N=O)(CC(C)C)C(=N)NN(O)O |
Hydantoin, 5-isobutyl-3-phenyl-2-thio- | O=C1C(CC(C)C)NC(=S)N1c2ccccc2 |
Hydantoin, 5-isobutyl-5-methyl- | C(C(C)C)C1(C)NC(=O)NC1=O |
Hydratropic acid, p-isobutyl- | C(C)(C(=O)O)c1ccc(cc1)CC(C)C |
Imidazole-4-carboxamide, 5-(3-isobutyl-3-methyl-1-triazeno)- | N(=NN(C)CC(C)C)C1=C(NC=N1)C(N)=O |
Isobutyl 2,4-D | O(CC(=O)OCC(C)C)c1ccc(Cl)cc1Cl |
Isobutyl 2,4-dichlorophenoxyacetate | O(CC(=O)OCC(C)C)c1ccc(Cl)cc1Cl |
Isobutyl 2-(4-(4-chlorophenoxy)phenoxy)propionate | O(c1ccc(Cl)cc1)c2ccc(cc2)OC(C)C(=O)OCC(C)C |
Isobutyl 2-ethylhexyl phthalate | C(=O)(OCC(CC)CCCC)c1ccccc1C(=O)OCC(C)C |
Isobutyl 2-methyl-2-propenoate | C(=O)(OCC(C)C)C(C)=C |
Isobutyl 2-propenoate | C(=O)(C=C)OCC(C)C |
Isobutyl 3-methylpropanoate | C(=O)(OCC(C)C)CC(C)C |
Isobutyl 4-aminobenzoate | C(=O)(OCC(C)C)c1ccc(N)cc1 |
Isobutyl ALPHA_-methacrylate | C(=O)(OCC(C)C)C(C)=C |
Isobutyl ALPHA_-methylacrylate | C(=O)(OCC(C)C)C(C)=C |
Isobutyl ALPHA_-toluate | C(C(=O)OCC(C)C)c1ccccc1 |
Isobutyl Keloform | C(=O)(OCC(C)C)c1ccc(N)cc1 |
Isobutyl T. G. | S(CC(C)C)c1nc(N)nc2NC=Nc12 |
Isobutyl acetate | C(OC(C)=O)C(C)C |
Isobutyl acrylate | C(=O)(C=C)OCC(C)C |
Isobutyl adipate | C(=O)(CCCCC(=O)OCC(C)C)OCC(C)C |
Isobutyl alcohol | C(C)(C)CO |
Isobutyl benzoate | C(=O)(OCC(C)C)c1ccccc1 |
Isobutyl borate, (C4H9O)3B | B(OCC(C)C)(OCC(C)C)OCC(C)C |
Isobutyl bromide | C(C)(C)CBr |
Isobutyl butanoate | C(=O)(CCC)OCC(C)C |
Isobutyl butyrate | C(=O)(CCC)OCC(C)C |
Isobutyl caprylate | C(=O)(CCCCCCC)OCC(C)C |
Isobutyl carbamate | C(OC(N)=O)C(C)C |
Isobutyl carbinol | C(CO)C(C)C |
Isobutyl carbonate | C(=O)(OCC(C)C)OCC(C)C |
Isobutyl chloroacetate | C(=O)(CCl)OCC(C)C |
Isobutyl chlorocarbonate | C(OC(Cl)=O)C(C)C |
Isobutyl chloroformate | C(OC(Cl)=O)C(C)C |
Isobutyl cinnamate | C(=CC(=O)OCC(C)C)c1ccccc1 |
Isobutyl ethanoate | C(OC(C)=O)C(C)C |
Isobutyl formate | C(OC=O)C(C)C |
Isobutyl heptyl ketone | C(C)(CC(C)C)CC(=O)CC(C)C |
Isobutyl iodide | C(C)(C)CI |
Isobutyl isobutanoate | C(=O)(OCC(C)C)C(C)C |
Isobutyl isobutyrate | C(=O)(OCC(C)C)C(C)C |
Isobutyl isopropyl ketone | C(=O)(CC(C)C)C(C)C |
Isobutyl isovalerate | C(=O)(OCC(C)C)CC(C)C |
Isobutyl ketone | C(C(C)C)C(=O)CC(C)C |
Isobutyl methacrylate | C(=O)(OCC(C)C)C(C)=C |
Isobutyl methanoate | C(OC=O)C(C)C |
Isobutyl methyl ketone | C(C(C)C)C(C)=O |
Isobutyl methyl sulfide | C(SC)C(C)C |
Isobutyl n-butyrate | C(=O)(CCC)OCC(C)C |
Isobutyl o-hydroxybenzoate | C(=O)(OCC(C)C)c1ccccc1O |
Isobutyl p-aminobenzoate | C(=O)(OCC(C)C)c1ccc(N)cc1 |
Isobutyl p-nitrobenzoate | C(=O)(OCC(C)C)c1ccc(cc1)[N+](=O)[O-] |
Isobutyl phenyl ether | O(CC(C)C)c1ccccc1 |
Isobutyl phenyl ketone | C(=O)(CC(C)C)c1ccccc1 |
Isobutyl phenylacetate | C(C(=O)OCC(C)C)c1ccccc1 |
Isobutyl phenylethanoate | C(C(=O)OCC(C)C)c1ccccc1 |
Isobutyl phosphate | P(=O)(OCC(C)C)(OCC(C)C)OCC(C)C |
Isobutyl phosphate, (C4H9O)3PO | P(=O)(OCC(C)C)(OCC(C)C)OCC(C)C |
Isobutyl phosphonate, (C4H9O)2HPO | P(=O)(OCC(C)C)OCC(C)C |
Isobutyl phthalate (VAN) | C(=O)(OCC(C)C)c1ccccc1C(=O)OCC(C)C |
Isobutyl propanoate | C(=O)(CC)OCC(C)C |
Isobutyl propenoate | C(=O)(C=C)OCC(C)C |
Isobutyl propionate | C(=O)(CC)OCC(C)C |
Isobutyl propyl sulfide | C(SCCC)C(C)C |
Isobutyl salicylate | C(=O)(OCC(C)C)c1ccccc1O |
Isobutyl sulfate | O(CC(C)C)S(=O)(=O)O |
Isobutyl sulfide | S(CC(C)C)CC(C)C |
Isobutyl sulfone | C(C(C)C)S(=O)(=O)CC(C)C |
Isobutyl trichloroacetate | C(=O)(OCC(C)C)C(Cl)(Cl)Cl |
Isobutyl undecylenate | C(=O)(CCCCCCCCC=C)OCC(C)C |
Isobutyl vinyl ether | C(OC=C)C(C)C |
Isobutyl-methylketon(CZECH) | C(C(C)C)C(C)=O |
Isobutyl_phosphonate__(C4H9O)2HPO | P(=O)(OCC(C)C)OCC(C)C |
Isobutyl_sulfate | O(CC(C)C)S(=O)(=O)O |
Isobutyric acid, isobutyl ester | C(=O)(OCC(C)C)C(C)C |
Isovaleric acid, isobutyl ester | C(=O)(OCC(C)C)CC(C)C |
Ketone, isobutyl methyl | C(C(C)C)C(C)=O |
Malonic acid, isobutyl-, diethyl ester | C(CC(C)C)(C(=O)OCC)C(=O)OCC |
Methacrylic acid, isobutyl ester | C(=O)(OCC(C)C)C(C)=C |
Methyl isobutyl carbinol | C(C)(CO)CCC |
Methyl isobutyl ketone | C(C(C)C)C(C)=O |
Methyl isobutyl ketoxime | C(C)(=NO)CC(C)C |
Methyl isobutyl oxime | C(C)(=NO)CC(C)C |
Methyl isobutyl sulfide | C(SC)C(C)C |
Methyl-isobutyl-cetone(FRENCH) | C(C(C)C)C(C)=O |
Morpholine, 4-isobutyl- | C(C(C)C)N1CCOCC1 |
N-(5-Isobutyl-1,3,4-thiadiazol-2-yl)-p-methoxybenzenesulfonamide | S(=O)(=O)(NC1=NN=C(CC(C)C)S1)c2ccc(OC)cc2 |
N-Isobutyl-N'-nitro-N-nitrosoguanidine | N(N=O)(CC(C)C)C(=N)NN(O)O |
Naphthalene, 1,2,3,4-tetrahydro-5-isobutyl- | C(C(C)C)c1cccc2CCCCc12 |
Naphthalene__1_2_3_4-tetrahydro-5-isobutyl- | C(C(C)C)c1cccc2CCCCc12 |
Octanoic acid, isobutyl ester | C(=O)(CCCCCCC)OCC(C)C |
Phenethylamine, N-isobutyl-ALPHA_-phenyl-, hydrochloride | C(NCC(C)C)(Cc1ccccc1)c2ccccc2 |
Phenylacetic acid, isobutyl ester | C(C(=O)OCC(C)C)c1ccccc1 |
Phosphoric acid, bis(1-isobutyl-3-methylbutyl) ester | C(CC(C)C)(CC(C)C)OP(=O)(O)OC(CC(C)C)CC(C)C |
Phosphoric_acid__bis(1-isobutyl-3-methylbutyl)_ester | C(CC(C)C)(CC(C)C)OP(=O)(O)OC(CC(C)C)CC(C)C |
Phthalic acid, cyclohexyl isobutyl ester | C(=O)(OC1CCCCC1)c2ccccc2C(=O)OCC(C)C |
Propionic acid, 2-(4-(4'-chlorophenoxy)phenoxy)-, isobutyl ester | O(c1ccc(Cl)cc1)c2ccc(cc2)OC(C)C(=O)OCC(C)C |
Propionic acid, isobutyl ester | C(=O)(CC)OCC(C)C |
Purine-6-sulfonamide, N-isobutyl- | S(=O)(=O)(NCC(C)C)c1ncnc2NC=Nc12 |
Salicylic acid, isobutyl ester | C(=O)(OCC(C)C)c1ccccc1O |
Styryl isobutyl ketone | C(=CC(=O)CC(C)C)c1ccccc1 |
Sulfide, isobutyl isopropyl | C(SC(C)C)C(C)C |
Sulfide, isobutyl methyl | C(SC)C(C)C |
Sulfide, isobutyl propyl | C(SCCC)C(C)C |
Sulfide__isobutyl_isopropyl | C(SC(C)C)C(C)C |
Theophylline, 8-isobutyl- | O=C1N(C)C(=O)N(C)C2=C1N=C(CC(C)C)N2 |
Thiazole, 2-isobutyl- | C(C(C)C)C1=NC=CS1 |
Trichloroacetic acid isobutyl ester | C(=O)(OCC(C)C)C(Cl)(Cl)Cl |
Urea, 1-isobutyl-3-phenyl-2-thio- | N(C(=S)NCC(C)C)c1ccccc1 |
Vinyl isobutyl ether | C(OC=C)C(C)C |
Xanthine, 1,3-dimethyl-8-isobutyl- | O=C1N(C)C(=O)N(C)C2=C1N=C(CC(C)C)N2 |
Xanthine, 3-isobutyl-1-methyl- | C(C(C)C)N1C(=O)N(C)C(=O)C2=C1N=CN2 |
p-Nitrobenzoic acid, isobutyl ester | C(=O)(OCC(C)C)c1ccc(cc1)[N+](=O)[O-] |
p-Toluic acid, isobutyl ester | C(=O)(OCC(C)C)c1ccc(C)cc1 |