If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-Nitro-2-ethyl-1, 3-propanediol butyraldehyde acetal | [N+](=O)([O-])C1(CC)COC(CCC)OC1 |
ALPHA_,ALPHA_,BETA_-Trichloro-n-butyraldehyde | C(Cl)(Cl)(C=O)C(C)Cl |
BUTYRALDEHYDE | C(CC)C=O |
Butyraldehyde aniline | N(=CCCC)c1ccccc1 |
Butyraldehyde oxime | C(CC)C=NO |
Butyraldehyde thiosemicarbazone | N(=CCCC)NC(N)=S |
Butyraldehyde | C(CC)C=O |
Butyraldehyde(CZECH | C(CC)C=O |
Butyraldehyde, (2, 4-dinitrophenyl)hydrazone | [N+](=O)([O-])c1cc(ccc1NN=CCCC)[N+](=O)[O-] |
Butyraldehyde, 2,2,3-trichloro- | C(Cl)(Cl)(C=O)C(C)Cl |
Butyraldehyde, 2-ethyl- | C(CC)(CC)C=O |
Butyraldehyde, 2-methyl- | C(C)(CC)C=O |
Butyraldehyde, 3-ethoxy-, diethyl acetal | C(OCC)(OCC)CC(C)OCC |
Butyraldehyde, 3-ethoxy-2-oxo-, bis(thiosemicarbazone) | C(C=NNC(N)=S)(=NNC(N)=S)C(C)OCC |
Butyraldehyde, 3-ethoxy-2-oxo-, bis(thiosemicarbazone, hemihydrate | C(C=NNC(N)=S)(=NNC(N)=S)C(C)OCC |
Butyraldehyde, 3-hydroxy- | C(C=O)C(C)O |
Butyraldehyde, 3-methoxy- | C(C)(OC)CC=O |
Butyraldehyde, 3-methoxy-, dimethyl acetal | C(OC)(OC)CC(C)OC |
Butyraldehyde, 3-methyl- | C(C=O)C(C)C |
Butyraldehyde, 3-methyl-, (2,4-dinitrophenyl)hydrazone | N(N=CCC(C)C)c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
Butyraldehyde, cyclic 2-ethyl-2-nitrotrimethylene acetal | [N+](=O)([O-])C1(CC)COC(CCC)OC1 |
Butyraldehyde, oxime | C(CC)C=NO |
Butyraldehyde, thiosemicarbazone | N(=CCCC)NC(N)=S |
Butyraldehyde-1,3-butylene glycol acetal | C(CC)C1OCCC(C)O1 |
Butyraldehyde-1_3-butylene_glycol_acetal | C(CC)C1OCCC(C)O1 |
Butyraldehyde-aniline condensate | N(=CCCC)c1ccccc1 |
Butyraldehyde-butylidene-aniline condensate | N(=CCCC)c1ccccc1 |
Butyraldehyde-butylidene-aniline_condensate | N(=CCCC)c1ccccc1 |
Butyraldehyde__(2__4-dinitrophenyl)hydrazone | [N+](=O)([O-])c1cc(ccc1NN=CCCC)[N+](=O)[O-] |
Butyraldehyde__3-ethoxy-__diethyl_acetal | C(OCC)(OCC)CC(C)OCC |
Butyraldehyde__3-methoxy-__dimethyl_acetal | C(OC)(OC)CC(C)OC |
Butyraldehyde__3-methyl- | C(C=O)C(C)C |
Butyraldehyde__3-methyl-__(2_4-dinitrophenyl)hydrazone | N(N=CCC(C)C)c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
Butyraldehyde__cyclic_2-ethyl-2-nitrotrimethylene_acetal | [N+](=O)([O-])C1(CC)COC(CCC)OC1 |
Heptafluorobutyl butyraldehyde, ethyl hemiacetal | C(F)(F)(C(O)OCC)C(F)(F)C(F)(F)F |
Heptafluorobutyl_butyraldehyde__ethyl_hemiacetal | C(F)(F)(C(O)OCC)C(F)(F)C(F)(F)F |
Phenyl butyraldehyde aldimine | N(=CCCC)c1ccccc1 |
n-Butyraldehyde | C(CC)C=O |
n-Butyraldehyde, ALPHA_,ALPHA_, BETA_-trichloro- | C(Cl)(Cl)(C=O)C(C)Cl |
n-Butyraldehyde, oxime | C(CC)C=NO |
n-Butyraldehyde-aniline condensate | N(=CCCC)c1ccccc1 |
n-Butyraldehyde__ALPHA__ALPHA___BETA_-trichloro- | C(Cl)(Cl)(C=O)C(C)Cl |
n-Butyraldehyde__oxime | C(CC)C=NO |