If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,3,5-Trioxane, 2,4,6-triisopropyl- | C(C)(C)C1OC(OC(O1)C(C)C)C(C)C |
2,4, 6-Triisopropyl-1,3,5-trioxane | C(C)(C)C1OC(OC(O1)C(C)C)C(C)C |
Acetophenone, 2',4',6'-triisopropyl- | C(C)(=O)c1c(cc(cc1C(C)C)C(C)C)C(C)C |
Benzene, 1,3,5-triisopropyl- | C(C)(C)c1cc(cc(c1)C(C)C)C(C)C |
Benzenesulfonyl chloride, 2,4,6-triisopropyl- | S(Cl)(=O)(=O)c1c(cc(cc1C(C)C)C(C)C)C(C)C |
Boric acid (H3BO3), triisopropyl ester | B(OC(C)C)(OC(C)C)OC(C)C |
Boric acid, triisopropyl ester | B(OC(C)C)(OC(C)C)OC(C)C |
Hexahydro-1,3, 5-triisopropyl-s-triazine | C(C)(C)N1CN(CN(C1)C(C)C)C(C)C |
Phosphine, triisopropyl- | P(C(C)C)(C(C)C)C(C)C |
Phosphorous acid, triisopropyl ester | P(OC(C)C)(OC(C)C)OC(C)C |
Stannane, triisopropyl(undecanoyloxy)- | [Sn](OC(=O)CCCCCCCCCC)(C(C)C)(C(C)C)C(C)C |
Triisopropyl borate | B(OC(C)C)(OC(C)C)OC(C)C |
Triisopropyl phosphite | P(OC(C)C)(OC(C)C)OC(C)C |
Triisopropyl-s-trioxane | C(C)(C)C1OC(OC(O1)C(C)C)C(C)C |
s-Triazine, hexahydro-1,3,5-triisopropyl- | C(C)(C)N1CN(CN(C1)C(C)C)C(C)C |
s-Trioxane, 2,4,6-triisopropyl- | C(C)(C)C1OC(OC(O1)C(C)C)C(C)C |