If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Acetoacetylamino-2,4-dimethylbenzene | N(C(=O)CC(C)=O)c1ccc(C)cc1C |
1-Acetoacetylamino-2-methoxybenzene | N(C(=O)CC(C)=O)c1ccccc1OC |
1-Acetoacetylamino-2-methyl-4-chlorobenzene | N(C(=O)CC(C)=O)c1ccc(Cl)cc1C |
3,3'-Dimethyl-4,4'-bis(acetoacetylamino)biphenyl | Cc1cc(ccc1NC(=O)CC(C)=O)c2ccc(NC(=O)CC(C)=O)c(C)c2 |
4, 4'-Bis(acetoacetylamino)-3,3'-dimethylbiphenyl | Cc1cc(ccc1NC(=O)CC(C)=O)c2ccc(NC(=O)CC(C)=O)c(C)c2 |
4-(Acetoacetylamino)acetanilide | N(C(=O)CC(C)=O)c1ccc(cc1)NC(C)=O |
m-(Acetoacetylamino)phenol | N(C(=O)CC(C)=O)c1cccc(O)c1 |