If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Dimethyldithiocarbamic acid compd with dimethylamine (1:1) | N(C)C.S=C(S)N(C)C |
Dimethyldithiocarbamic acid compd. with dimethylamine (1:1) | N(C)C.S=C(S)N(C)C |
Dimethyldithiocarbamic acid dimethylamine salt | N(C)C.S=C(S)N(C)C |
Dimethyldithiocarbamic acid methyl ester | C(=S)(SC)N(C)C |
Dimethyldithiocarbamic acid sodium salt | C(=S)(S)N(C)C |
Dimethyldithiocarbamic acid zinc salt | N(C)(C)C1=S[Zn]2(S1)SC(=S2)N(C)C |
Dimethyldithiocarbamic acid, manganes salt | N(C)(C)C1=S[Mn]2(S1)SC(=S2)N(C)C |
Dimethyldithiocarbamic acid, manganese salt | N(C)(C)C1=S[Mn]2(S1)SC(=S2)N(C)C |
Dimethyldithiocarbamic acid, sodium salt | C(=S)(S)N(C)C |
N,N-Dimethyldithiocarbamic acid dimethylaminomethyl ester | C(=S)(SCN(C)C)N(C)C |
N,N-Dimethyldithiocarbamic acid, sodium salt | C(=S)(S)N(C)C |