If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Decanal(mixed isomers) | C(CCCCC)CCCC=O |
1-Decanal(mixed_isomers) | C(CCCCC)CCCC=O |
2-Octene(mixed cis, trans isomers) | C(CCC)CC=CC |
2-Octene(mixed_cis__trans_isomers) | C(CCC)CC=CC |
4,7-Methanoindan, 1,2:5,6-diepoxyhexahydro-, mixed isomers | C12C3OC3CC2C4CC1C5OC45 |
Acetic acid, pentyl ester (mixed isomers) | C(CCCC)OC(C)=O |
Acetic_acid__pentyl_ester_(mixed_isomers) | C(CCCC)OC(C)=O |
Amyl acetate (mixed isomers) | C(CCCC)OC(C)=O |
Cleve's acid, mixed | Nc1cccc2cc(ccc12)S(=O)(=O)O |
Isohexanoic acid, mixed isomers | C(CC(=O)O)C(C)C |
Isohexanoic_acid__mixed_isomers | C(CC(=O)O)C(C)C |
Octanoic acid (mixed isomers) | C(CCCCC)CC(=O)O |
Octanoic acid, ethenyl ester (mixed isomers) | C(=O)(OC=C)CCCCCCC |
Octanoic acid, vinyl ester (mixed isomers) | C(=O)(OC=C)CCCCCCC |
Octanoic_acid_(mixed_isomers) | C(CCCCC)CC(=O)O |
Octanoic_acid__ethenyl_ester_(mixed_isomers) | C(=O)(OC=C)CCCCCCC |
Poly(mixed ethylene, propylene)glycol | C1CO1.CC2CO2 |