If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Veratryl-1-propene | O(C)c1cc(C=CC)ccc1OC |
6-Isoquinolinol, 1,2,3, 4-tetrahydro-7-methoxy-2-methyl-1-veratryl- | C(c1ccc(OC)c(OC)c1)C2N(C)CCc3cc(O)c(OC)cc23 |
Anthranilic acid, N-(p-tolylsulfonyl)-N-veratryl-, methyl ester | N(Cc1ccc(OC)c(OC)c1)(c2ccccc2C(=O)OC)S(=O)(=O)c3ccc(C)cc3 |
Anthranilic_acid__N-(p-tolylsulfonyl)-N-veratryl-__methyl_ester | N(Cc1ccc(OC)c(OC)c1)(c2ccccc2C(=O)OC)S(=O)(=O)c3ccc(C)cc3 |
Isoquinoline, 6,7-dimethoxy-1-veratryl- | C(c1ccc(OC)c(OC)c1)c2nccc3cc(OC)c(OC)cc23 |
Isoquinoline, 6,7-dimethoxy-1-veratryl-, hydrochloride | C(c1ccc(OC)c(OC)c1)c2nccc3cc(OC)c(OC)cc23 |
Pyrimidine, 2,4-diamino-5-veratryl- | C(c1ccc(OC)c(OC)c1)c2cnc(N)nc2N |
Veratryl alcohol | O(C)c1cc(CO)ccc1OC |
Veratryl aldehyde | O(C)c1cc(C=O)ccc1OC |
Veratryl cyanide | O(C)c1cc(CC#N)ccc1OC |
o-Veratryl alcohol | O(C)c1c(CO)cccc1OC |
o-Veratryl_alcohol | O(C)c1c(CO)cccc1OC |