If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
5-Dehydroepiandrosterone | CC12CCC(O)CC2=CCC3C1CCC4(C)C(=O)CCC34 |
Dehydroepiandrosterone mustard | CC12CCC(OC(=O)Cc3ccc(cc3)N(CCCl)CCCl)CC2=CCC4C1CCC5(C)C(=O)CCC45 |
Dehydroepiandrosterone sulfate sodium salt | CC12CCC(CC2=CCC3C1CCC4(C)C(=O)CCC34)OS(=O)(=O)O |
Dehydroepiandrosterone | CC12CCC(O)CC2=CCC3C1CCC4(C)C(=O)CCC34 |
Sodium dehydroepiandrosterone sulfate | CC12CCC(CC2=CCC3C1CCC4(C)C(=O)CCC34)OS(=O)(=O)O |
Sodium dehydroepiandrosterone-3-sulfate | CC12CCC(CC2=CCC3C1CCC4(C)C(=O)CCC34)OS(=O)(=O)O |