If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(Dimethylamino)ethyl methacrylate | O(CCN(C)C)C(=O)C(C)=C |
1-Propanol, 3-(trimethoxysilyl)-, methacrylate | [Si](OC)(OC)(OC)CCCOC(=O)C(C)=C |
2,2,2-Trifluoroethyl methacrylate | O(CC(F)(F)F)C(=O)C(C)=C |
2,3-Epoxypropyl methacrylate | C(OC(=O)C(C)=C)C1CO1 |
2-(Dimethylamino)ethyl methacrylate | O(CCN(C)C)C(=O)C(C)=C |
2-(N,N-Diethylamino)ethyl methacrylate | N(CC)(CC)CCOC(=O)C(C)=C |
2-(N,N-Dimethylamino)ethyl methacrylate | O(CCN(C)C)C(=O)C(C)=C |
2-Chloroethyl methacrylate | C(=O)(OCCCl)C(C)=C |
2-Diethylaminoethyl methacrylate | N(CC)(CC)CCOC(=O)C(C)=C |
2-Dimethylaminoethyl methacrylate | O(CCN(C)C)C(=O)C(C)=C |
2-Ethoxyethyl methacrylate | C(=O)(OCCOCC)C(C)=C |
2-Ethyl-1-hexyl methacrylate | C(CC)(CCCC)COC(=O)C(C)=C |
2-Ethylbutyl methacrylate | C(CC)(CC)COC(=O)C(C)=C |
2-Ethylhexyl methacrylate | C(CC)(CCCC)COC(=O)C(C)=C |
2-Hydroxy-5-(phenylazo)-2,4, 6-cycloheptatrien-1-one methacrylate | O(C(=O)C(C)=C)C1=CC=C(C=CC1=O)N=Nc2ccccc2 |
2-Hydroxyethyl methacrylate | C(=O)(OCCO)C(C)=C |
2-Methoxyethyl methacrylate | C(=O)(OCCOC)C(C)=C |
2-Methylpropyl methacrylate | C(=O)(OCC(C)C)C(C)=C |
3-(Trimethoxysilyl)propyl methacrylate | [Si](OC)(OC)(OC)CCCOC(=O)C(C)=C |
Allyl methacrylate | C(=O)(OCC=C)C(C)=C |
Amyl methacrylate | C(=O)(OCCCCC)C(C)=C |
BETA_-(Diethylamino)ethyl methacrylate | N(CC)(CC)CCOC(=O)C(C)=C |
BETA_-(Dimethylamino)ethyl methacrylate | O(CCN(C)C)C(=O)C(C)=C |
BETA_-(N, N-Diethylamino)ethyl methacrylate | N(CC)(CC)CCOC(=O)C(C)=C |
BETA_-(N, N-Dimethylamino)ethyl methacrylate | O(CCN(C)C)C(=O)C(C)=C |
BETA_-Chloroethyl methacrylate | C(=O)(OCCCl)C(C)=C |
BETA_-Hydroxyethyl methacrylate | C(=O)(OCCO)C(C)=C |
BETA_-Methoxyethyl methacrylate | C(=O)(OCCOC)C(C)=C |
Benzyl methacrylate | C(OC(=O)C(C)=C)c1ccccc1 |
Butyl 2-methacrylate | C(=O)(OCCCC)C(C)=C |
Butyl methacrylate | C(=O)(OCCCC)C(C)=C |
Cyclohexyl methacrylate | O(C(=O)C(C)=C)C1CCCCC1 |
Decyl methacrylate | C(CCCCCCCCC)OC(=O)C(C)=C |
Diethylaminoethyl methacrylate | N(CC)(CC)CCOC(=O)C(C)=C |
Dodecyl methacrylate | C(CCCCCCCCCCC)OC(=O)C(C)=C |
ERIOFLORIN METHACRYLATE | O(C(=O)C(C)=C)C1CC2(C)OC2CC(OC(=O)C(C)=C)C(C)=CC3OC(=O)C(=C)C13 |
ERIOFLORIN_METHACRYLATE | O(C(=O)C(C)=C)C1CC2(C)OC2CC(OC(=O)C(C)=C)C(C)=CC3OC(=O)C(=C)C13 |
Ethanol, 2-(diethylamino)-, methacrylate (ester) | N(CC)(CC)CCOC(=O)C(C)=C |
Ethanol, 2-(dimethylamino)-, methacrylate | O(CCN(C)C)C(=O)C(C)=C |
Ethoxyethyl methacrylate | C(=O)(OCCOCC)C(C)=C |
Ethyl methacrylate | C(=O)(OCC)C(C)=C |
Ethylene glycol bis(methacrylate) | C(=O)(OCCOC(=O)C(C)=C)C(C)=C |
Ethylene glycol methacrylate | C(=O)(OCCO)C(C)=C |
Ethylene methacrylate | C(=O)(OCCOC(=O)C(C)=C)C(C)=C |
Ethylenebis(oxyethylene) methacrylate | O(CCOCCOCCOC(=O)C(C)=C)C(=O)C(C)=C |
Furfuryl methacrylate | C(OC(=O)C(C)=C)C1=CC=CO1 |
Glycidol methacrylate | C(OC(=O)C(C)=C)C1CO1 |
Glycidyl methacrylate | C(OC(=O)C(C)=C)C1CO1 |
Glycol methacrylate | C(=O)(OCCO)C(C)=C |
Heptyl methacrylate | O(CCCCCCC)C(=O)C(C)=C |
Hexyl methacrylate | O(CCCCCC)C(=O)C(C)=C |
Hydroxyethyl methacrylate | C(=O)(OCCO)C(C)=C |
Isobutyl ALPHA_-methacrylate | C(=O)(OCC(C)C)C(C)=C |
Isobutyl methacrylate | C(=O)(OCC(C)C)C(C)=C |
Isopropyl methacrylate | C(=O)(OC(C)C)C(C)=C |
Lauryl methacrylate | C(CCCCCCCCCCC)OC(=O)C(C)=C |
Methacrylate de butyle(FRENCH) | C(=O)(OCCCC)C(C)=C |
Methacrylate de methyle (FRENCH) | C(=O)(OC)C(C)=C |
Methoxyethyl methacrylate | C(=O)(OCCOC)C(C)=C |
Methyl methacrylate monomer, inhibited (DOT) | C(=O)(OC)C(C)=C |
Methyl methacrylate | C(=O)(OC)C(C)=C |
Methyl_methacrylate_monomer__inhibited_(DOT) | C(=O)(OC)C(C)=C |
N, N-(Dimethylamino)ethyl methacrylate | O(CCN(C)C)C(=O)C(C)=C |
N, N-Diethylaminoethyl methacrylate | N(CC)(CC)CCOC(=O)C(C)=C |
N,N-Dimethylethanolamine methacrylate | O(CCN(C)C)C(=O)C(C)=C |
Phenyl methacrylate | O(C(=O)C(C)=C)c1ccccc1 |
Propyl methacrylate | C(=O)(OCCC)C(C)=C |
Silane adduct, allyl methacrylate trimethoxy- | [Si](OC)(OC)(OC)CCCOC(=O)C(C)=C |
Silane, (3-hydroxypropyl)trimethoxy-, methacrylate | [Si](OC)(OC)(OC)CCCOC(=O)C(C)=C |
Tetrahydrofurfuryl methacrylate | C(OC(=O)C(C)=C)C1CCCO1 |
Tributylstannyl methacrylate | [Sn](CCCC)(CCCC)(CCCC)OC(=O)C(C)=C |
Tributyltin methacrylate | [Sn](CCCC)(CCCC)(CCCC)OC(=O)C(C)=C |
Trifluoroethyl methacrylate | O(CC(F)(F)F)C(=O)C(C)=C |
Trimethoxysilylpropyl methacrylate | [Si](OC)(OC)(OC)CCCOC(=O)C(C)=C |
Vinyl methacrylate | C(=O)(OC=C)C(C)=C |
monocite Methacrylate monomer | C(=O)(OC)C(C)=C |
n-Butyl methacrylate | C(=O)(OCCCC)C(C)=C |
n-Decyl methacrylate | C(CCCCCCCCC)OC(=O)C(C)=C |
n-Heptyl methacrylate | O(CCCCCCC)C(=O)C(C)=C |
n-Propyl methacrylate | C(=O)(OCCC)C(C)=C |
sec-Butyl methacrylate | O(C(C)CC)C(=O)C(C)=C |
tert-Butyl methacrylate | C(=O)(OC(C)(C)C)C(C)=C |