If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Butylsulfonyl chloride | C(CCC)S(Cl)(=O)=O |
Acetic acid, ((butylsulfonyl)hydrazono)- | S(=O)(=O)(CCCC)NN=CC(=O)O |
Acetic_acid__((butylsulfonyl)hydrazono)- | S(=O)(=O)(CCCC)NN=CC(=O)O |
Benzothiazole, 2-(butylsulfonyl)-6-nitro- | S(=O)(=O)(CCCC)C1=Nc2ccc(cc2S1)[N+](=O)[O-] |
Benzothiazole__2-(butylsulfonyl)-6-nitro- | S(=O)(=O)(CCCC)C1=Nc2ccc(cc2S1)[N+](=O)[O-] |
Butylsulfonyl chloride | C(CCC)S(Cl)(=O)=O |