If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-(2-Chloroethyl)-2, 3-dihydro-4H-1,3-benzoxazin-4-one | O=C1NC(CCCl)Oc2ccccc12 |
2H-1,3-Benzoxazin-2-one, 3,4-dihydro-4-hydroxy- | OC1NC(=O)Oc2ccccc12 |
2H-1,3-Benzoxazin-2-one, 3,4-dihydro-4-methoxy- | O(C)C1NC(=O)Oc2ccccc12 |
2H-1,4-Benzoxazin-3(4H)-one | O=C1COc2ccccc2N1 |
2H-1,4-Benzoxazin-3-one | O=C1COc2ccccc2N1 |
2H-1_3-Benzoxazin-2-one__3_4-dihydro-4-hydroxy- | OC1NC(=O)Oc2ccccc12 |
2H-1_3-Benzoxazin-2-one__3_4-dihydro-4-methoxy- | O(C)C1NC(=O)Oc2ccccc12 |
2H-1_4-Benzoxazin-3(4H)-one | O=C1COc2ccccc2N1 |
4H-1, 3-Benzoxazin-4-one, 2-(2-chloroethyl)-2,3-dihydro- | O=C1NC(CCCl)Oc2ccccc12 |
4H-3,1-Benzoxazin-4-one, 2-methyl- | O=C1OC(C)=Nc2ccccc12 |
4H-3,1-Benzoxazin-4-one, 2-phenyl- | O=C1OC(=Nc2ccccc12)c3ccccc3 |
4H-3_1-Benzoxazin-4-one__2-methyl- | O=C1OC(C)=Nc2ccccc12 |
4H-3_1-Benzoxazin-4-one__2-phenyl- | O=C1OC(=Nc2ccccc12)c3ccccc3 |
7-Chloro-3, 3a-dihydro-2H,9H-isoxazolo(3,2-b)(1,3)benzoxazin-9-one | O=C1N2OCCC2Oc3ccc(Cl)cc13 |