If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Phenylethyl phenylacetate | C(C(=O)OCCc1ccccc1)c2ccccc2 |
2-Propenyl phenylacetate | C(C(=O)OCC=C)c1ccccc1 |
4-Allyl-2-methoxyphenyl phenylacetate | O(C(=O)Cc1ccccc1)c2ccc(CC=C)cc2OC |
Adriamycin, 14-(phenylacetate), hydrochloride | Oc1c2CC(O)(CC(OC3CC(N)C(O)C(C)O3)c2c(O)c4C(=O)c5c(OC)cccc5C(=O)c14)C(=O)COC(=O)Cc6ccccc6 |
Allyl phenylacetate | C(C(=O)OCC=C)c1ccccc1 |
Amyl phenylacetate | C(C(=O)OCCCCC)c1ccccc1 |
BETA_-Phenylethyl phenylacetate | C(C(=O)OCCc1ccccc1)c2ccccc2 |
Carbamide phenylacetate | C(C(=O)NC(N)=O)c1ccccc1 |
Cyclohexyl phenylacetate | C(C(=O)OC1CCCCC1)c2ccccc2 |
Ethyl 2-oxo-2-phenylacetate | C(=O)(C(=O)OCC)c1ccccc1 |
Ethyl phenylacetate | C(C(=O)OCC)c1ccccc1 |
Eugenol phenylacetate | O(C(=O)Cc1ccccc1)c2ccc(CC=C)cc2OC |
Eugenyl phenylacetate | O(C(=O)Cc1ccccc1)c2ccc(CC=C)cc2OC |
Geranyl phenylacetate | C(C(=O)OCC=C(C)CCC=C(C)C)c1ccccc1 |
Heptyl phenylacetate | C(C(=O)OCCCCCCC)c1ccccc1 |
Hexyl phenylacetate | C(C(=O)OCCCCCC)c1ccccc1 |
Isoamyl phenylacetate | C(C(=O)OCCC(C)C)c1ccccc1 |
Isobutyl phenylacetate | C(C(=O)OCC(C)C)c1ccccc1 |
Isopentyl phenylacetate | C(C(=O)OCCC(C)C)c1ccccc1 |
Linalyl phenylacetate | C(C)(C=C)(CCC=C(C)C)OC(=O)Cc1ccccc1 |
Methyl 2-phenylacetate | C(C(=O)OC)c1ccccc1 |
Methyl ALPHA_-bromo-ALPHA_-phenylacetate | C(Br)(C(=O)OC)c1ccccc1 |
Methyl phenylacetate | C(C(=O)OC)c1ccccc1 |
Pentyl phenylacetate | C(C(=O)OCCCCC)c1ccccc1 |
Phenethyl phenylacetate | C(C(=O)OCCc1ccccc1)c2ccccc2 |
Phenylethyl phenylacetate | C(C(=O)OCCc1ccccc1)c2ccccc2 |
Propyl phenylacetate | C(C(=O)OCCC)c1ccccc1 |
Sodium phenylacetate | C(C(=O)O)c1ccccc1 |
m-Cresyl phenylacetate | O(C(=O)Cc1ccccc1)c2cccc(C)c2 |
m-Tolyl phenylacetate | O(C(=O)Cc1ccccc1)c2cccc(C)c2 |
n-Hexyl phenylacetate | C(C(=O)OCCCCCC)c1ccccc1 |
p-(N-Anisylideneamino)phenylacetate | N(=Cc1ccc(OC)cc1)c2ccc(cc2)OC(C)=O |
p-Cresyl phenylacetate | O(C(=O)Cc1ccccc1)c2ccc(C)cc2 |
p-Tolyl phenylacetate | O(C(=O)Cc1ccccc1)c2ccc(C)cc2 |
tert-Butyl phenylacetate | C(C(=O)OC(C)(C)C)c1ccccc1 |
trans-3,7-Dimethyl-2,6-octadienyl phenylacetate | C(C(=O)OCC=C(C)CCC=C(C)C)c1ccccc1 |