If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
WLN: 1OSWR D1 | S(=O)(=O)(OC)c1ccc(C)cc1 |
WLN: 2-PB-2&2&OSWR D1 | [Pb](CC)(CC)(CC)OS(=O)(=O)c1ccc(C)cc1 |
WLN: 2K2&2&2OVR CO1 DO1 EO1 &Q &OSWR D1 | S(=O)(=O)(O)c1ccc(C)cc1.COc2cc(cc(OC)c2OC)C(=O)OCCN(CC)(CC)CC |
WLN: 2OSWR D1 | S(=O)(=O)(OCC)c1ccc(C)cc1 |
WLN: 3Y1&OSWR D1 | S(=O)(=O)(OC(C)CCC)c1ccc(C)cc1 |
WLN: 4OSWR D1 | S(=O)(=O)(OCCCC)c1ccc(C)cc1 |
WLN: ER B1K2&1&1 &OSWR D1 | S(=O)(=O)(O)c1ccc(C)cc1.CCN(C)(C)Cc2ccccc2Br |
WLN: G2OSWR D1 | S(=O)(=O)(OCCCl)c1ccc(C)cc1 |
WLN: T5O COTJ B1 B1 D1OSWR D1& E1 -DL | C(OS(=O)(=O)c1ccc(C)cc1)C2OC(C)(C)OC2C |