If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
WLN: 1VMR DSWR DMV1 | S(=O)(=O)(c1ccc(cc1)NC(C)=O)c2ccc(cc2)NC(C)=O |
WLN: ER DSWR DE | S(=O)(=O)(c1ccc(Br)cc1)c2ccc(Br)cc2 |
WLN: GR DSWR DG | S(=O)(=O)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
WLN: NCR DSWR DCN | S(=O)(=O)(c1ccc(C#N)cc1)c2ccc(C#N)cc2 |
WLN: QR DSWR DQ | S(=O)(=O)(c1ccc(O)cc1)c2ccc(O)cc2 |
WLN: T5N CSJ BZ DSWR DNW | S(=O)(=O)(c1ccc(cc1)[N+](=O)[O-])C2=CNC(=N)S2 |
WLN: T6MVVVNJ FMR DSWR DZ | S(=O)(=O)(c1ccc(N)cc1)c2ccc(cc2)NC3=NC(=O)C(=O)C(=O)N3 |
WLN: VHMR DSWR DMVH | S(=O)(=O)(c1ccc(NC=O)cc1)c2ccc(NC=O)cc2 |
WLN: ZR DSWR DZ | S(=O)(=O)(c1ccc(N)cc1)c2ccc(N)cc2 |