If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(+)-Triiodothyronine | O(c1ccc(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
3,3',5-Triiodothyronine | O(c1ccc(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
3,5,3'-Triiodothyronine | O(c1ccc(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
D-3,5,3'-Triiodothyronine | O(c1ccc(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
D-Triiodothyronine | O(c1ccc(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
Dextro-3:5:3'-triiodothyronine | O(c1ccc(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
L-3,3',5-TriioDOThyronine | O(c1ccc(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |
Triiodothyronine | O(c1ccc(O)c(I)c1)c2c(I)cc(cc2I)CC(N)C(=O)O |