If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2, 4-Dichlorophenol acetate | O(C(C)=O)c1ccc(Cl)cc1Cl |
2,2'-Methylenebis(4, 6-dichlorophenol) | C(c1cc(Cl)cc(Cl)c1O)c2cc(Cl)cc(Cl)c2O |
2,2'-Thiobis(4,6-dichlorophenol) | S(c1cc(Cl)cc(Cl)c1O)c2cc(Cl)cc(Cl)c2O |
2,2'-Thiobis-(4,6-dichlorophenol) | S(c1cc(Cl)cc(Cl)c1O)c2cc(Cl)cc(Cl)c2O |
2,3-Dichlorophenol | Clc1c(Cl)cccc1O |
2,4-Dichlorophenol | Clc1cc(Cl)ccc1O |
2,5-Dichlorophenol | Oc1cc(Cl)ccc1Cl |
2,6-Dichlorophenol indophenol sodium salt | N(c1ccc(O)cc1)=C2C=C(Cl)C(=O)C(Cl)=C2 |
2,6-Dichlorophenol | Oc1c(Cl)cccc1Cl |
3,4-Dichlorophenol | Clc1cc(O)ccc1Cl |
3,5-Dichlorophenol | Clc1cc(Cl)cc(O)c1 |
3,5-Dimethyl-2, 4-dichlorophenol | Clc1c(C)cc(O)c(Cl)c1C |
3-(3,4-Dichlorophenol)-1, 1-dimethylurea | N(C(=O)N(C)C)c1ccc(Cl)c(Cl)c1 |
4, 4'-Isopropylidenebis(2,6-dichlorophenol) | C(C)(C)(c1cc(Cl)c(O)c(Cl)c1)c2cc(Cl)c(O)c(Cl)c2 |
4, 5-Dichlorophenol | Clc1cc(O)ccc1Cl |
4, 6-Dichlorophenol | Clc1cc(Cl)ccc1O |
4,4'-(1-Methylethylidene)bis(2,6-dichlorophenol) | C(C)(C)(c1cc(Cl)c(O)c(Cl)c1)c2cc(Cl)c(O)c(Cl)c2 |
4-Amino-2,6-dichlorophenol | Oc1c(Cl)cc(N)cc1Cl |
4-Bromo-2,6-dichlorophenol | Oc1c(Cl)cc(Br)cc1Cl |
4-Methyl-2,6-dichlorophenol | Oc1c(Cl)cc(C)cc1Cl |
4-Nitro-2,6-dichlorophenol | [N+](=O)([O-])c1cc(Cl)c(O)c(Cl)c1 |
6,6'-Sulfinylbis(2,4-dichlorophenol) | S(=O)(c1cc(Cl)cc(Cl)c1O)c2cc(Cl)cc(Cl)c2O |