If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
L-Aspartic acid, N-(phosphonoacetyl)-, calcium salt (2:3) | C(CC(=O)O)(NC(=O)CP(=O)(O)O)C(=O)O |
L-Aspartic acid, N-(phosphonoacetyl)-, disodium salt | C(CC(=O)O)(NC(=O)CP(=O)(O)O)C(=O)O.[Na] |
L-Aspartic acid, N-(phosphonoacetyl)-, platinum complex | O=C1O[Pt]2(OC(=O)CC1NC(=O)CP(=O)(O)O)NC3CCCCC3N2 |
L-Aspartic_acid__N-(phosphonoacetyl)-__calcium_salt_(2:3) | C(CC(=O)O)(NC(=O)CP(=O)(O)O)C(=O)O |
L-Aspartic_acid__N-(phosphonoacetyl)-__disodium_salt | C(CC(=O)O)(NC(=O)CP(=O)(O)O)C(=O)O.[Na] |