If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Benzoyl-1, 2-dihydro-2-quinolinecarbonitrile | C(=O)(c1ccccc1)N2C(C#N)C=Cc3ccccc23 |
2-Quinolinecarbonitrile, 1,2-dihydro-1-benzoyl- | C(=O)(c1ccccc1)N2C(C#N)C=Cc3ccccc23 |
2-Quinolinecarbonitrile, 1-benzoyl-1, 2-dihydro- | C(=O)(c1ccccc1)N2C(C#N)C=Cc3ccccc23 |
2-Quinolinecarbonitrile__1-benzoyl-1__2-dihydro- | C(=O)(c1ccccc1)N2C(C#N)C=Cc3ccccc23 |
3-Quinolinecarbonitrile | C(#N)c1cnc2ccccc2c1 |