If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Celliton Blue BB-CF | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Celliton Blue Extra | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Celliton Blue FFR | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Celliton Blue G | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Celliton Blue GA-CF | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Celliton Blue Green B | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Celliton Blue RN | O=C1c2ccccc2C(=O)c3ccc4Nc5c(ccc6C(=O)c7ccccc7C(=O)c56)Nc4c13 |
Celliton Discharge Scarlet B | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Celliton Discharge Yellow 5RL | N(=Nc1ccc(cc1)N=Nc2ccccc2)c3ccc(O)c(C)c3 |
Celliton Fast Blue B | O=C1c2ccccc2C(=O)c3c(NC)ccc(NC)c13 |
Celliton Fast Blue BF | N(CCO)c1ccc(NCCO)c2C(=O)c3ccccc3C(=O)c12 |
Celliton Fast Blue FBBN | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Celliton Fast Blue FFR | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Celliton Fast Blue FFRN | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Celliton Fast Blue FFRS | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Celliton Fast Blue Green B | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Celliton Fast Blue Green BA-CF | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Celliton Fast Pink BA-CF | O=C1c2ccccc2C(=O)c3c(O)ccc(N)c13 |
Celliton Fast Pink BN | O=C1c2ccccc2C(=O)c3c(O)ccc(N)c13 |
Celliton Fast Pink FF3B | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Celliton Fast Pink FF3BA-CF | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Celliton Fast Pink RF | O=C1c2ccccc2C(=O)c3c(O)cc(OC)c(N)c13 |
Celliton Fast Pink RFA-CF | O=C1c2ccccc2C(=O)c3c(O)cc(OC)c(N)c13 |
Celliton Fast Red Violet RN | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Celliton Fast Red Violet RNA-CF | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Celliton Fast Red Violet | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Celliton Fast Violet B | O=C1c2c(N)ccc(N)c2C(=O)c3cccc([N+](=O)[O-])c13 |
Celliton Fast Violet BA-CF | O=C1c2c(N)ccc(N)c2C(=O)c3cccc([N+](=O)[O-])c13 |
Celliton Fast Violet R | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Celliton Fast Yellow 4RL-CF | N(=Nc1ccc(O)cc1)c2ccc(cc2)N=Nc3ccccc3 |
Celliton Fast Yellow 5R | N(=Nc1ccc(cc1)N=Nc2ccccc2)c3ccc(O)c(C)c3 |
Celliton Fast Yellow GGLL-CF | N(c1ccccc1)c2ccc(cc2[N+](=O)[O-])S(=O)(=O)Nc3ccccc3 |
Celliton Fast Yellow RR | [N+](=O)([O-])c1cc(ccc1Nc2ccc(O)cc2)[N+](=O)[O-] |
Celliton Fast Yellow RRA-CF | [N+](=O)([O-])c1cc(ccc1Nc2ccc(O)cc2)[N+](=O)[O-] |
Celliton Orange R | O=C1c2ccccc2C(=O)c3ccc(C)c(N)c13 |
Celliton Pink R | O=C1c2ccccc2C(=O)c3cccc(NC)c13 |
Celliton Red B | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Celliton Rose FF3B | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Celliton Scarlet B | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Celliton Scarlet BA-CF | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Celliton Violet B | O=C1c2c(N)ccc(N)c2C(=O)c3cccc([N+](=O)[O-])c13 |
Celliton Yellow 5R | N(=Nc1ccc(cc1)N=Nc2ccccc2)c3ccc(O)c(C)c3 |