If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,2-Ethanediol, monobenzoate | C(=O)(OCCO)c1ccccc1 |
1,2-Propane glycol monobenzoate | C(=O)(OCC(C)O)c1ccccc1 |
1,3-Benzenediol, monobenzoate | C(=O)(Oc1cccc(O)c1)c2ccccc2 |
17BETA_-Estradiol monobenzoate | CC12CCC3c4ccc(OC(=O)c5ccccc5)cc4CCC3C1CCC2O |
1_2-Propane_glycol_monobenzoate | C(=O)(OCC(C)O)c1ccccc1 |
Diethylene glycol monobenzoate | C(=O)(OCCOCCO)c1ccccc1 |
Diethylene glycol, monobenzoate | C(=O)(OCCOCCO)c1ccccc1 |
Estradiol monobenzoate | CC12CCC3c4ccc(OC(=O)c5ccccc5)cc4CCC3C1CCC2O |
Ethanol, 2,2'-oxybis-, monobenzoate | C(=O)(OCCOCCO)c1ccccc1 |
Ethanol__2_2'-oxybis-__monobenzoate | C(=O)(OCCOCCO)c1ccccc1 |
Ethylene glycol monobenzoate | C(=O)(OCCO)c1ccccc1 |
Ethylene glycol, monobenzoate | C(=O)(OCCO)c1ccccc1 |
Ethylene_glycol__monobenzoate | C(=O)(OCCO)c1ccccc1 |
Ethyleneglycol monobenzoate | C(=O)(OCCO)c1ccccc1 |
Oestradiol monobenzoate | CC12CCC3c4ccc(OC(=O)c5ccccc5)cc4CCC3C1CCC2O |
Propylene glycol monobenzoate | C(=O)(OCC(C)O)c1ccccc1 |
Resorcinol monobenzoate | C(=O)(Oc1cccc(O)c1)c2ccccc2 |
Resorcinol, monobenzoate | C(=O)(Oc1cccc(O)c1)c2ccccc2 |