If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Amino-2-thiazolin-4-one | O=C1CSC(=N)N1 |
2-Thiazolin-4-one, 2-amino- | O=C1CSC(=N)N1 |
2-Thiazolin-4-one, 2-anilino-5-benzylidene- | N(c1ccccc1)C2=NC(=O)C(S2)=Cc3ccccc3 |
2-Thiazolin-4-one__2-amino- | O=C1CSC(=N)N1 |
2-Thiazolin-5-one, 4-benzylidene-2-phenyl- | C(c1ccccc1)=C2N=C(SC2=O)c3ccccc3 |
4-Thiazolin-2-onimine | N=C1NC=CS1 |
Pyrido(4,3-b)(1,4)thiazolin-3(4H)-one | n1ccc2SCC(=O)Nc2c1 |
Pyrido(4_3-b)(1_4)thiazolin-3(4H)-one | n1ccc2SCC(=O)Nc2c1 |