If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Methyl benzimidazolecarbamate | N(C(=O)OC)C1=Nc2ccccc2N1 |
Ethyl 2-benzimidazolecarbamate | N(C(=O)OCC)C1=Nc2ccccc2N1 |
Methyl 1-(butylcarbamoyl)-2-benzimidazolecarbamate | C(=O)(NCCCC)N1C(NC(=O)OC)=Nc2ccccc12 |
Methyl 2-benzimidazolecarbamate | N(C(=O)OC)C1=Nc2ccccc2N1 |
Methyl 5-(2-thenoyl)-2-benzimidazolecarbamate | C(=O)(C1=CC=CS1)c2ccc3NC(NC(=O)OC)=Nc3c2 |
Methyl 5-(2-thienoyl)-2-benzimidazolecarbamate | C(=O)(C1=CC=CS1)c2ccc3NC(NC(=O)OC)=Nc3c2 |
Methyl 5-(cyclopropylcarbonyl)-2-benzimidazolecarbamate | C(=O)(C1CC1)c2ccc3NC(NC(=O)OC)=Nc3c2 |
Methyl 5-(p-fluorobenzoyl)-2-benzimidazolecarbamate | C(=O)(c1ccc(F)cc1)c2ccc3NC(NC(=O)OC)=Nc3c2 |
Methyl 5-(propylthio)-2-benzimidazolecarbamate | N(C(=O)OC)C1=Nc2ccc(SCCC)cc2N1 |
Methyl 5-benzoyl-2-benzimidazolecarbamate | C(=O)(c1ccccc1)c2ccc3NC(NC(=O)OC)=Nc3c2 |