If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Vulcafor BSM | S(N1CCOCC1)C2=Nc3ccccc3S2 |
Vulcafor Blue A | O=C1c2ccccc2NC1=C3Nc4ccccc4C3=O |
Vulcafor CBS | S(NC1CCCCC1)C2=Nc3ccccc3S2 |
Vulcafor DPG | N(C(=N)Nc1ccccc1)c2ccccc2 |
Vulcafor Fast Blue 3R | O=C1c2ccccc2C(=O)c3ccc4Nc5c(ccc6C(=O)c7ccccc7C(=O)c56)Nc4c13 |
Vulcafor Fast Yellow 2G | Clc1cc(ccc1N=NC(C(C)=O)C(=O)Nc2ccccc2C)c3ccc(N=NC(C(C)=O)C(=O)Nc4ccccc4C)c(Cl)c3 |
Vulcafor Fast Yellow GT | Clc1cc(ccc1N=NC(C(C)=O)C(=O)Nc2ccccc2)c3ccc(N=NC(C(C)=O)C(=O)Nc4ccccc4)c(Cl)c3 |
Vulcafor Fast Yellow GTA | Clc1cc(ccc1N=NC(C(C)=O)C(=O)Nc2ccccc2)c3ccc(N=NC(C(C)=O)C(=O)Nc4ccccc4)c(Cl)c3 |
Vulcafor MBTS | S(SC1=Nc2ccccc2S1)C3=Nc4ccccc4S3 |
Vulcafor Scarlet A | N(=Nc1ccc(C)cc1[N+](=O)[O-])c2c(O)ccc3ccccc23 |
Vulcafor TMT | C(=S)(SSC(=S)N(C)C)N(C)C |
Vulcafor TMTD | C(=S)(SSC(=S)N(C)C)N(C)C |