If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Aminodiphenyl ether | O(c1ccccc1)c2ccccc2N |
2-Aminodiphenyl | Nc1ccccc1c2ccccc2 |
3-Aminodiphenyl ether | O(c1ccccc1)c2cccc(N)c2 |
4'-Fluoro-4-aminodiphenyl | Fc1ccc(cc1)c2ccc(N)cc2 |
4, 4'-Dichloro-2-aminodiphenyl ether | O(c1ccc(Cl)cc1)c2ccc(Cl)cc2N |
4,4'-Chloro-2-aminodiphenyl ether | O(c1ccc(Cl)cc1)c2ccc(Cl)cc2N |
4-Aminodiphenyl ether | O(c1ccccc1)c2ccc(N)cc2 |
4-Aminodiphenyl | Nc1ccc(cc1)c2ccccc2 |
4-Chloro-2-aminodiphenyl ether | O(c1ccccc1)c2ccc(Cl)cc2N |
4-Chloro-4'-aminodiphenyl ether | O(c1ccc(Cl)cc1)c2ccc(N)cc2 |
o-Aminodiphenyl | Nc1ccccc1c2ccccc2 |
p-Aminodiphenyl | Nc1ccc(cc1)c2ccccc2 |