If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(3-Pyridyl)-3,3-dimethyltriazine | N(=NN(C)C)c1cccnc1 |
1-(4-Methyloxyphenyl)-3,3-dimethyltriazine | N(=NN(C)C)c1ccc(OC)cc1 |
1-(m-Nitrophenyl)-3,3-dimethyltriazine | N(=NN(C)C)c1cccc(c1)[N+](=O)[O-] |
1-(m-Tolyl)-3,3-dimethyltriazine | N(=NN(C)C)c1cccc(C)c1 |
1-(p-Carbethoxyphenyl)-3,3-dimethyltriazine | C(=O)(OCC)c1ccc(cc1)N=NN(C)C |
1-(p-Chlorophenyl)-3, 3-dimethyltriazine | N(=NN(C)C)c1ccc(Cl)cc1 |
1-(p-Methoxyphenyl)-3, 3-dimethyltriazine | N(=NN(C)C)c1ccc(OC)cc1 |
1-(p-Nitrophenyl)-3, 3-dimethyltriazine | [N+](=O)([O-])c1ccc(cc1)N=NN(C)C |