If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Naphthol-8-sulphonic acid | S(=O)(=O)(O)c1cccc2cccc(O)c12 |
6-Naphthylamine-2-sulphonic acid | S(=O)(=O)(O)c1ccc2cc(N)ccc2c1 |
8-Hydroxyquinoline-5-sulphonic acid | S(=O)(=O)(O)c1ccc(O)c2ncccc12 |
Aniline-o-sulphonic acid | S(=O)(=O)(O)c1ccccc1N |
Aniline-p-sulphonic acid | S(=O)(=O)(O)c1ccc(N)cc1 |
Quinizarin-3-sulphonic acid | O=C1c2ccccc2C(=O)c3c(O)cc(c(O)c13)S(=O)(=O)O |