If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
6-MMPR | c1(SC)ncnc2c1N=CN2C3OC(CO)C(O)C3O |
MMPR | c1(SC)ncnc2c1N=CN2C3OC(CO)C(O)C3O |
WLN: SUYM4&MMSWR D1 | S(=O)(=O)(NNC(=S)NCCCC)c1ccc(C)cc1 |
MMTP | S(C)c1ccc(O)cc1C |
WLN: SUYM1&MMYUS&MY1U1 | N(C(C)C=C)C(=S)NNC(=S)NC |