If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Aminoaniline | Nc1ccccc1N |
3-Aminoaniline | Nc1cccc(N)c1 |
4-Aminoaniline dihydrochloride | Nc1ccc(N)cc1 |
4-Aminoaniline | Nc1ccc(N)cc1 |
N, N-Diethyl-4-aminoaniline | N(CC)(CC)c1ccc(N)cc1 |
N-Oxalyl-4-aminoaniline | N(C(=O)C(=O)O)c1ccc(N)cc1 |
N-Phenyl-p-aminoaniline | N(c1ccccc1)c2ccc(N)cc2 |
m-Aminoaniline | Nc1cccc(N)c1 |
p-Aminoaniline dihydrochloride | Nc1ccc(N)cc1 |
p-Aminoaniline | Nc1ccc(N)cc1 |