If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Porofor 505 | N(=NC(=O)N)C(=O)N |
Porofor 57 | C(C)(C)(C#N)N=NC(C)(C)C#N |
Porofor ADC/R | N(=NC(=O)N)C(=O)N |
Porofor BSH | S(=O)(=O)(NN)c1ccccc1 |
Porofor ChKhZ 21 | N(=NC(=O)N)C(=O)N |
Porofor ChKhZ 21R | N(=NC(=O)N)C(=O)N |
Porofor ChKhZ 9 | S(=O)(=O)(NN)c1ccccc1 |
Porofor DF 9 | S(=O)(=O)(NN)c1cccc(c1)S(=O)(=O)NN |
Porofor DNO/F | N(=O)N1CN2CN(N=O)CN(C1)C2 |
Porofor DhKhZ 21 | N(=NC(=O)N)C(=O)N |
Porofor N | C(C)(C)(C#N)N=NC(C)(C)C#N |
Porofor chkhc-18 | N(=O)N1CN2CN(N=O)CN(C1)C2 |
Porofor | S(=O)(=O)(NN)c1ccccc1 |
Porofor-BSH-Pulver | S(=O)(=O)(NN)c1ccccc1 |