If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Carbamidophenyl bis(o-carboxyphenylthio)arsenite | [As](Sc1ccccc1C(=O)O)(Sc2ccccc2C(=O)O)c3ccc(cc3)NC(N)=O |
Potassium arsenite | [As](=O)O |
Potassium arsenite, (KAsO2) | [As](=O)O |
Pyrocatechol, cyclic arsenite | O([As]1Oc2ccccc2O1)[As]3Oc4ccccc4O3 |
Pyrocatechol__cyclic_arsenite | O([As]1Oc2ccccc2O1)[As]3Oc4ccccc4O3 |