If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Boric acid, tri-o-cresyl ester | B(Oc1ccccc1C)(Oc2ccccc2C)Oc3ccccc3C |
Brilliant Cresyl Purple | N(C)(C)c1cc2oc3cc(N)ccc3nc2cc1C |
Cresyl Fast Violet | Nc1cc2oc3cc(ccc3nc2c4ccccc14)N(CC)CC |
Cresyl acetate | O(C(C)=O)c1ccc(C)cc1 |
Ethyl p-cresyl carbonate | O(C(=O)OCC)c1ccc(C)cc1 |
Ethyl p-cresyl sulfide | S(CC)c1ccc(C)cc1 |
Ethylene glycol m-cresyl ether | O(CCO)c1cccc(C)c1 |
Ethylene_glycol_m-cresyl_ether | O(CCO)c1cccc(C)c1 |
Methane, 2,2'-bis(6-tert-butyl-p-cresyl)- | C(c1cc(C)cc(c1O)C(C)(C)C)c2cc(C)cc(c2O)C(C)(C)C |
Methyl m-cresyl ether | O(C)c1cccc(C)c1 |
Methyl o-cresyl ether | O(C)c1ccccc1C |
Methyl p-cresyl ether | O(C)c1ccc(C)cc1 |
Methyl p-cresyl sulfide | S(C)c1ccc(C)cc1 |
O,O'-Di-m-cresyl dithiophosphate | O(c1cccc(C)c1)P(=S)(S)Oc2cccc(C)c2 |
Phosphoric acid, tri-o-cresyl ester | P(=O)(Oc1ccccc1C)(Oc2ccccc2C)Oc3ccccc3C |
Tri-m-cresyl phosphate | P(=O)(Oc1cccc(C)c1)(Oc2cccc(C)c2)Oc3cccc(C)c3 |
Tri-m-cresyl phosphite | P(=O)(Oc1cccc(C)c1)(Oc2cccc(C)c2)Oc3cccc(C)c3 |
Tri-o-cresyl borate | B(Oc1ccccc1C)(Oc2ccccc2C)Oc3ccccc3C |
Tri-o-cresyl phosphate | P(=O)(Oc1ccccc1C)(Oc2ccccc2C)Oc3ccccc3C |
Tri-p-cresyl phosphate | P(=O)(Oc1ccc(C)cc1)(Oc2ccc(C)cc2)Oc3ccc(C)cc3 |
Tri-p-cresyl phosphite | P(Oc1ccc(C)cc1)(Oc2ccc(C)cc2)Oc3ccc(C)cc3 |
Tris-m-cresyl phosphate | P(=O)(Oc1cccc(C)c1)(Oc2cccc(C)c2)Oc3cccc(C)c3 |
m-Cresyl ALPHA_-toluate | O(C(=O)Cc1ccccc1)c2cccc(C)c2 |
m-Cresyl N-methylcarbamate | O(C(=O)NC)c1cccc(C)c1 |
m-Cresyl acetate | O(C(C)=O)c1cccc(C)c1 |
m-Cresyl benzoate | C(=O)(Oc1cccc(C)c1)c2ccccc2 |
m-Cresyl butanoate | O(C(=O)CCC)c1cccc(C)c1 |
m-Cresyl ester of N-methylcarbamic acid | O(C(=O)NC)c1cccc(C)c1 |
m-Cresyl methylcarbamate | O(C(=O)NC)c1cccc(C)c1 |
m-Cresyl phenylacetate | O(C(=O)Cc1ccccc1)c2cccc(C)c2 |
m-Cresyl propionate | O(C(=O)CC)c1cccc(C)c1 |
o-Cresyl ALPHA_-glyceryl ether | O(CC(O)CO)c1ccccc1C |
o-Cresyl acetate | O(C(C)=O)c1ccccc1C |
o-Cresyl ethyl sulfide | S(CC)c1ccccc1C |
o-Cresyl glycerol ether | O(CC(O)CO)c1ccccc1C |
o-Cresyl methyl ether | O(C)c1ccccc1C |
o-Cresyl methyl sulfide | S(C)c1ccccc1C |
o-Cresyl phosphate | P(=O)(Oc1ccccc1C)(Oc2ccccc2C)Oc3ccccc3C |
p-Cresyl ALPHA_-toluate | O(C(=O)Cc1ccccc1)c2ccc(C)cc2 |
p-Cresyl acetate | O(C(C)=O)c1ccc(C)cc1 |
p-Cresyl butanoate | O(C(=O)CCC)c1ccc(C)cc1 |
p-Cresyl caprylate | O(C(=O)CCCCCCC)c1ccc(C)cc1 |
p-Cresyl capyrlate | O(C(=O)CCCCCCC)c1ccc(C)cc1 |
p-Cresyl ethyl sulfide | S(CC)c1ccc(C)cc1 |
p-Cresyl isovalerate | O(C(=O)CC(C)C)c1ccc(C)cc1 |
p-Cresyl methyl ether | O(C)c1ccc(C)cc1 |
p-Cresyl methyl sulfide | S(C)c1ccc(C)cc1 |
p-Cresyl octanoate | O(C(=O)CCCCCCC)c1ccc(C)cc1 |
p-Cresyl phenylacetate | O(C(=O)Cc1ccccc1)c2ccc(C)cc2 |
p-Cresyl salicylate | C(=O)(Oc1ccc(C)cc1)c2ccccc2O |
para-Cresyl ethylacetate | C(COC(C)=O)c1ccc(C)cc1 |