If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2, 5-Bis(4-toluidino)terephthalic acid | N(c1ccc(C)cc1)c2cc(C(=O)O)c(Nc3ccc(C)cc3)cc2C(=O)O |
2, 5-Bis(p-toluidino)terephthalic acid | N(c1ccc(C)cc1)c2cc(C(=O)O)c(Nc3ccc(C)cc3)cc2C(=O)O |
2,5-Bis(2-hydroxyethylamino)terephthalic acid | N(CCO)c1cc(C(=O)O)c(NCCO)cc1C(=O)O |
2_5-Bis(2-hydroxyethylamino)terephthalic_acid | N(CCO)c1cc(C(=O)O)c(NCCO)cc1C(=O)O |
Terephthalic acid bishydrazide | C(=O)(NN)c1ccc(cc1)C(=O)NN |
Terephthalic acid chloride | C(Cl)(=O)c1ccc(cc1)C(Cl)=O |
Terephthalic acid diamide | C(N)(=O)c1ccc(cc1)C(N)=O |
Terephthalic acid dianilide | C(=O)(Nc1ccccc1)c2ccc(cc2)C(=O)Nc3ccccc3 |
Terephthalic acid dichloride | C(Cl)(=O)c1ccc(cc1)C(Cl)=O |
Terephthalic acid dihydrazide | C(=O)(NN)c1ccc(cc1)C(=O)NN |
Terephthalic acid dinitrile | C(#N)c1ccc(C#N)cc1 |
Terephthalic acid hydrazide | C(=O)(NN)c1ccc(cc1)C(=O)NN |
Terephthalic acid methyl ester | C(=O)(OC)c1ccc(cc1)C(=O)OC |
Terephthalic acid | C(=O)(O)c1ccc(cc1)C(=O)O |
Terephthalic acid, 1,4-dithio- | C(=O)(S)c1ccc(cc1)C(=O)S |
Terephthalic acid, 2, 5-dihydroxy-, diethyl ester | C(=O)(OCC)c1cc(O)c(cc1O)C(=O)OCC |
Terephthalic acid, 2,5-di-p-toluidino- | N(c1ccc(C)cc1)c2cc(C(=O)O)c(Nc3ccc(C)cc3)cc2C(=O)O |
Terephthalic acid, 2,5-dichloro- | C(=O)(O)c1cc(Cl)c(cc1Cl)C(=O)O |
Terephthalic acid, amino-, dimethyl ester | C(=O)(OC)c1ccc(cc1N)C(=O)OC |
Terephthalic acid, chloro- | C(=O)(O)c1ccc(C(=O)O)c(Cl)c1 |
Terephthalic acid, diallyl ester | C(=O)(OCC=C)c1ccc(cc1)C(=O)OCC=C |
Terephthalic acid, diethyl ester | C(=O)(OCC)c1ccc(cc1)C(=O)OCC |
Terephthalic acid, dihydrazide | C(=O)(NN)c1ccc(cc1)C(=O)NN |
Terephthalic acid, dimethyl ester | C(=O)(OC)c1ccc(cc1)C(=O)OC |
Terephthalic acid, diphenyl ester | C(=O)(Oc1ccccc1)c2ccc(cc2)C(=O)Oc3ccccc3 |
Terephthalic acid, methyl- | C(=O)(O)c1ccc(C(=O)O)c(C)c1 |
Terephthalic acid, monomethyl ester | C(=O)(OC)c1ccc(cc1)C(=O)O |
Terephthalic acid, nitro- | [N+](=O)([O-])c1cc(ccc1C(=O)O)C(=O)O |
Terephthalic acid, nitro-, dimethyl ester | C(=O)(OC)c1ccc(cc1[N+](=O)[O-])C(=O)OC |
Terephthalic acid, tetrachloro- | C(=O)(O)c1c(Cl)c(Cl)c(C(=O)O)c(Cl)c1Cl |
Terephthalic acid, tetrachloro-, dimethyl ester | C(=O)(OC)c1c(Cl)c(Cl)c(C(=O)OC)c(Cl)c1Cl |
Terephthalic aldehyde | C(=O)c1ccc(C=O)cc1 |
Terephthalic diamide | C(N)(=O)c1ccc(cc1)C(N)=O |
Terephthalic dichloride | C(Cl)(=O)c1ccc(cc1)C(Cl)=O |
Terephthalic dihydrazide | C(=O)(NN)c1ccc(cc1)C(=O)NN |
Terephthalic hydrazide | C(=O)(NN)c1ccc(cc1)C(=O)NN |
Terephthalic_acid_diamide | C(N)(=O)c1ccc(cc1)C(N)=O |