If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-Amino-D-gluconic acid | C(O)(C(N)C(=O)O)C(O)C(O)CO |
D-Gluconic acid | C(O)(C(O)C(=O)O)C(O)C(O)CO |
D-Gluconic acid, 2-amino-2-deoxy- | C(O)(C(N)C(=O)O)C(O)C(O)CO |
D-Gluconic acid, 2-phenylhydrazide | C(O)(C(O)C(O)CO)C(O)C(=O)NNc1ccccc1 |
D-Gluconic acid, 4-O-BETA_-D-galactopyranosyl-, DELTA_-lactone | O(C1OC(CO)C(O)C(O)C1O)C2C(O)C(O)C(=O)OC2CO |
D-Gluconic acid, 4-O-BETA_-D-galactopyranosyl-, calcium salt (2:1) | C(OC1OC(CO)C(O)C(O)C1O)(C(O)CO)C(O)C(O)C(=O)O |
D-Gluconic acid, manganese(2+) salt (2:1) | C(O)(C(O)C(=O)O)C(O)C(O)CO |
D-Gluconic_acid__2-phenylhydrazide | C(O)(C(O)C(O)CO)C(O)C(=O)NNc1ccccc1 |
D-Gluconic_acid__4-O-BETA_-D-galactopyranosyl-__DELTA_-lactone | O(C1OC(CO)C(O)C(O)C1O)C2C(O)C(O)C(=O)OC2CO |
D-Gluconic_acid__4-O-BETA_-D-galactopyranosyl-__calcium_salt_(2:1) | C(OC1OC(CO)C(O)C(O)C1O)(C(O)CO)C(O)C(O)C(=O)O |
Gluconic acid (VAN) | C(O)(C(O)C(=O)O)C(O)C(O)CO |
Gluconic acid, 2-amino-2-deoxy-, D- | C(O)(C(N)C(=O)O)C(O)C(O)CO |
Gluconic acid, D- | C(O)(C(O)C(=O)O)C(O)C(O)CO |
Gluconic acid, manganese(2+) salt (2:1), D- | C(O)(C(O)C(=O)O)C(O)C(O)CO |
Gluconic acid, phenylhydrazide | C(O)(C(O)C(O)CO)C(O)C(=O)NNc1ccccc1 |
Gluconic acid, technical | C(O)(C(O)C(=O)O)C(O)C(O)CO |
Gluconic_acid__2-amino-2-deoxy-__D- | C(O)(C(N)C(=O)O)C(O)C(O)CO |
Gluconic_acid__manganese(2+)_salt_(2:1)__D- | C(O)(C(O)C(=O)O)C(O)C(O)CO |