If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Naphthaleneacetaldehyde, ALPHA_, ALPHA_-bis(2-pyrrolidinoethyl)- | C(C=O)(CCN1CCCC1)(CCN2CCCC2)c3cccc4ccccc34 |
2-Pyrrolidinoethyl amine | C(CN)N1CCCC1 |
6-Thio-(8-(BETA_-N-pyrrolidinoethyl)thio)theophylline | S=C1N(C)C(=O)N(C)C2=C1N=C(SCCN3CCCC3)N2 |
N-(2-Pyrrolidinoethyl)phenothiazine hydrochloride | C(CN1CCCC1)N2c3ccccc3Sc4ccccc24 |
Theophylline, 8-((2-pyrrolidinoethyl)thio)-6-thio- | S=C1N(C)C(=O)N(C)C2=C1N=C(SCCN3CCCC3)N2 |
Uric acid, 1, 3-dimethyl-8-((2-pyrrolidinoethyl)thio)-6-thio- | S=C1N(C)C(=O)N(C)C2=C1N=C(SCCN3CCCC3)N2 |
Uric_acid__1__3-dimethyl-8-((2-pyrrolidinoethyl)thio)-6-thio- | S=C1N(C)C(=O)N(C)C2=C1N=C(SCCN3CCCC3)N2 |