If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Setacyl Blue 2GS II | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Setacyl Blue 2GS | O=C1c2c(N)ccc(N)c2C(=O)c3c(N)ccc(N)c13 |
Setacyl Blue 6GN | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Setacyl Blue BN | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Setacyl Blue BS | O=C1c2ccccc2C(=O)c3c(NC)ccc(NC)c13 |
Setacyl Blue FG | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Setacyl Blue Green P-BS | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Setacyl Blue RF | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Setacyl Brilliant Blue BG | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Setacyl Brilliant Blue | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Setacyl Diazo Navy R | O(C)c1cc(ccc1N)c2ccc(N)c(OC)c2 |
Setacyl Pink 3B | O=C1c2ccccc2C(=O)c3c(O)ccc(N)c13 |
Setacyl Red P-3B | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Setacyl Scarlet 2BD | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Setacyl Scarlet B | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Setacyl Scarlet RNA | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Setacyl Turquoise Blue 2G | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Setacyl Turquoise Blue 4G | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Setacyl Turquoise Blue G | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Setacyl Turquoise Blue GD | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Setacyl Violet P-R | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Setacyl Violet R | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Setacyl Yellow 3RN | N(=Nc1ccc(O)cc1)c2ccc(cc2)N=Nc3ccccc3 |
Setacyl Yellow FL | N(c1ccccc1)c2ccc(cc2[N+](=O)[O-])S(=O)(=O)Nc3ccccc3 |
Setacyl Yellow P-3RL | N(=Nc1ccc(O)cc1)c2ccc(cc2)N=Nc3ccccc3 |
Setacyl Yellow P-BS | [N+](=O)([O-])c1cc(ccc1Nc2ccc(O)cc2)[N+](=O)[O-] |
Setacyl Yellow P-FL | N(c1ccccc1)c2ccc(cc2[N+](=O)[O-])S(=O)(=O)Nc3ccccc3 |