If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(2, 3-Dihydroxypropyl)theobromine | O=C1N(CC(O)CO)C(=O)N(C)C2=C1N(C)C=N2 |
8-(Butylthio)theobromine | CN1C(=O)NC(=O)C2=C1N=C(SCCCC)N2C |
8-(Octylthio)theobromine | CN1C(SCCCCCCCC)=NC2=C1C(=O)NC(=O)N2C |
8-(Propylthio)theobromine | CN1C(=O)NC(=O)C2=C1N=C(SCCC)N2C |
THEOBROMINE | CN1C(=O)NC(=O)C2=C1N=CN2C |
Theobromine, 1-(2,3-dihydroxypropyl)- | O=C1N(CC(O)CO)C(=O)N(C)C2=C1N(C)C=N2 |
Theobromine, 1-allyl- | O=C1N(CC=C)C(=O)N(C)C2=C1N(C)C=N2 |
Theobromine, 1-butyl- | O=C1N(CCCC)C(=O)N(C)C2=C1N(C)C=N2 |
Theobromine, 1-isopentyl- | O=C1N(CCC(C)C)C(=O)N(C)C2=C1N(C)C=N2 |
Theobromine, 1-methyl- | O=C1N(C)C(=O)N(C)C2=C1N(C)C=N2 |
Theobromine, 8-(butylthio)- | CN1C(=O)NC(=O)C2=C1N=C(SCCCC)N2C |
Theobromine, 8-(octylthio)- | CN1C(SCCCCCCCC)=NC2=C1C(=O)NC(=O)N2C |
Theobromine, 8-(propylthio)- | CN1C(=O)NC(=O)C2=C1N=C(SCCC)N2C |
Theobromine, monohydriodide | CN1C(=O)NC(=O)C2=C1N=CN2C |