If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Phenyl-2-propen-1-yl cinnamate | C(=CC(=O)OCC=Cc1ccccc1)c2ccccc2 |
Allyl cinnamate | C(=CC(=O)OCC=C)c1ccccc1 |
Amyl cinnamate | C(=CC(=O)OCCCCC)c1ccccc1 |
BETA_-Phenethyl cinnamate | C(=CC(=O)OCCc1ccccc1)c2ccccc2 |
BETA_-Phenylethyl cinnamate | C(=CC(=O)OCCc1ccccc1)c2ccccc2 |
Benzyl alcohol, cinnamate | C(=CC(=O)OCc1ccccc1)c2ccccc2 |
Benzyl cinnamate | C(=CC(=O)OCc1ccccc1)c2ccccc2 |
Benzylcarbinyl cinnamate | C(=CC(=O)OCCc1ccccc1)c2ccccc2 |
Bornyl cinnamate | CC12CCC(CC1OC(=O)C=Cc3ccccc3)C2(C)C |
Butyl cinnamate | C(=CC(=O)OCCCC)c1ccccc1 |
Cinnamate, methyl p-methoxy- | C(=CC(=O)OC)c1ccc(OC)cc1 |
Cinnamyl alcohol, cinnamate | C(=CC(=O)OCC=Cc1ccccc1)c2ccccc2 |
Cinnamyl cinnamate | C(=CC(=O)OCC=Cc1ccccc1)c2ccccc2 |
Cyclohexyl cinnamate | O(C(=O)C=Cc1ccccc1)C2CCCCC2 |
Ethyl cinnamate | C(=CC(=O)OCC)c1ccccc1 |
Eugenol cinnamate | O(C(=O)C=Cc1ccccc1)c2ccc(CC=C)cc2OC |
Isobutyl cinnamate | C(=CC(=O)OCC(C)C)c1ccccc1 |
Linalyl cinnamate | C(C)(C=C)(CCC=C(C)C)OC(=O)C=Cc1ccccc1 |
Methyl cinnamate | C(=CC(=O)OC)c1ccccc1 |
Pentyl cinnamate | C(=CC(=O)OCCCCC)c1ccccc1 |
Phenethyl cinnamate | C(=CC(=O)OCCc1ccccc1)c2ccccc2 |
Phenylallyl cinnamate | C(=CC(=O)OCC=Cc1ccccc1)c2ccccc2 |
Phenylethyl cinnamate | C(=CC(=O)OCCc1ccccc1)c2ccccc2 |
Propenyl cinnamate | C(=CC(=O)OCC=C)c1ccccc1 |
Propyl cinnamate | C(=CC(=O)OCCC)c1ccccc1 |
Vinyl carbinyl cinnamate | C(=CC(=O)OCC=C)c1ccccc1 |
n-Butyl cinnamate | C(=CC(=O)OCCCC)c1ccccc1 |
n-Propyl cinnamate | C(=CC(=O)OCCC)c1ccccc1 |