If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1',3', 3'-Trimethyl-6-nitrospiro(2H-1-benzopyran-2,2'-indoline) | CC1(C)c2ccccc2N(C)C13C=Cc4cc(ccc4O3)[N+](=O)[O-] |
1,3, 3-Trimethyl-2-(formylmethylene)indoline | CN1c2ccccc2C(C)(C)C1=CC=O |
Indoline, 1,3, 3-trimethyl-2-methylene- | CN1C(=C)C(C)(C)c2ccccc12 |
Indoline, 1-acetyl-5-nitro- | C(C)(=O)N1CCc2cc(ccc12)[N+](=O)[O-] |
Indoline, 2-methyl- | CC1Cc2ccccc2N1 |
Indoline, 2-methylene-1,3, 3-trimethyl- | CN1C(=C)C(C)(C)c2ccccc12 |
Indoline, 5-acetyl- | C(C)(=O)c1ccc2NCCc2c1 |
Indoline, 5-acetyl-, hydriodide | C(C)(=O)c1ccc2NCCc2c1 |
Indoline, 5-chloro-1,3,3-trimethyl-2-methylene- | CC1(C)C(=C)N(C)c2ccc(Cl)cc12 |
Indoline, 6-amino-, dihydrochloride | Nc1ccc2CCNc2c1 |
Indoline, 6-nitro- | [N+](=O)([O-])c1ccc2CCNc2c1 |
Spiro(2H-1-benzopyran-2,2'-indoline), 1',3',3'-trimethyl- | CC1(C)c2ccccc2N(C)C13C=Cc4ccccc4O3 |
Spiro(2H-1-benzopyran-2,2'-indoline), 1',3',3'-trimethyl-6-nitro- | CC1(C)c2ccccc2N(C)C13C=Cc4cc(ccc4O3)[N+](=O)[O-] |
Spiro(2H-1-benzopyran-2,2'-indoline), 6-nitro-1',3',3'-trimethyl- | CC1(C)c2ccccc2N(C)C13C=Cc4cc(ccc4O3)[N+](=O)[O-] |