If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Cochineal Red 4R | N(=Nc1ccc(c2ccccc12)S(=O)(=O)O)c3c(O)ccc4cc(cc(c34)S(=O)(=O)O)S(=O)(=O)O |
Cochineal Red A Specially Pure | N(=Nc1ccc(c2ccccc12)S(=O)(=O)O)c3c(O)ccc4cc(cc(c34)S(=O)(=O)O)S(=O)(=O)O |
Cochineal Red A | N(=Nc1ccc(c2ccccc12)S(=O)(=O)O)c3c(O)ccc4cc(cc(c34)S(=O)(=O)O)S(=O)(=O)O |
Cochineal Scarlet 2R | S(=O)(=O)(O)c1cccc2c1ccc(N=Nc3ccccc3C)c2O |
Cochineal Scarlet G | S(=O)(=O)(O)c1cccc2c1ccc(N=Nc3ccccc3)c2O |
Cochineal tincture | O=C1c2c(C)c(C(=O)O)c(O)cc2C(=O)c3c(O)c(O)c(c(O)c13)C4OC(CO)C(O)C(O)C4O |
Cochineal | O=C1c2c(C)c(C(=O)O)c(O)cc2C(=O)c3c(O)c(O)c(c(O)c13)C4OC(CO)C(O)C(O)C4O |
Eurocert Cochineal Red A | N(=Nc1ccc(c2ccccc12)S(=O)(=O)O)c3c(O)ccc4cc(cc(c34)S(=O)(=O)O)S(=O)(=O)O |