If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Swabettes Hoechst | C(CCCCCCCCCCCCCCC)n1ccccc1 |
Swartziol | O=C1C(O)=C(Oc2cc(O)cc(O)c12)c3ccc(O)cc3 |
Swascol 3L | C(CCCCCCCCCC)COS(=O)(=O)O |
Swascol 4L | C(CCCCCCCCCC)COS(=O)(=O)O |
swasconol | A sub-index is available for swasconol... |
Swazine | CC1C(=C)C(=O)OC2CCN3CC=C(COC(=O)C(C)(O)C14CO4)C23 |
Titandioxid (sweden) | [Ti](=O)=O |
4-Nitrochinolin N-oxid (SWEDISH) | [N+](=O)([O-])c1ccn(=O)c2ccccc12 |
4-Nitrochinolin_N-oxid_(SWEDISH) | [N+](=O)([O-])c1ccn(=O)c2ccccc12 |
Sweet birch oil | C(=O)(OC)c1ccccc1O |
Sweeta | O=S1(=O)NC(=O)c2ccccc12 |
Artificial sweetening substanz gendorf 450 | O=S1(=O)NC(=O)c2ccccc12 |
Sweetening Agent P-4000 | O(CCC)c1ccc(cc1N)[N+](=O)[O-] |
SWERTIANINE | O=C1c2c(O)cc(OC)cc2Oc3ccc(O)c(O)c13 |
Anthracene Blue SWGG | C(=O)(O)c1cc(O)c(O)c2oc3cc(ccc3nc12)N(C)C |
Furoxone Swine Mix | C(=NN1CCOC1=O)C2=CC=C(O2)[N+](=O)[O-] |
Swiss Blue | N(C)(C)c1ccc2nc3ccc(cc3sc2c1)N(C)C |
Naphtol AS-SWLL | C(=O)(Nc1ccc2ccccc2c1)c3cc4ccccc4cc3O |
WLN: E3SWMX1&1&1X1&1&1 | C(C)(C)(CC(C)(C)C)NS(=O)(=O)CCCBr |
WLN: T5SWTJ B1 D1 | O=S1(=O)CC(C)CC1C |
WLN: T5SWTJ CG DG | O=S1(=O)CC(Cl)C(Cl)C1 |
WLN: T5SWTJ | O=S1(=O)CCCC1 |