If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Aminotriazole (plant regulator) | N=C1N=CNN1 |
BCB (the plant regulator) | C(CBr)N(C)(C)C |
BTAB(the plant regulator) | C(CBr)N(C)(C)C |
CCC Plant growth regulant | C(CCl)N(C)(C)C |
EPC (the plant regulator) | N(C(=O)OCC)c1ccccc1 |
Epc(the plant regulator) | N(C(=O)OCC)c1ccccc1 |
From inner stem bark of Kokoona zeylanica Thwaites plant | C1CC(=O)C(C)C2(C)CCC3C(C)(CCC4(CO)C5CC(C)(C)C(=O)CC5(C)CCC34C)C12 |
From_inner_stem_bark_of_Kokoona_zeylanica_Thwaites_plant | C1CC(=O)C(C)C2(C)CCC3C(C)(CCC4(CO)C5CC(C)(C)C(=O)CC5(C)CCC34C)C12 |
Indican (plant indican) | O(C1OC(CO)C(O)C(O)C1O)C2=CNc3ccccc23 |
Kinetin (plant hormone) | N(CC1=CC=CO1)c2ncnc3NC=Nc23 |
Plant dithio aerosol | O(P(=S)(OCC)OCC)P(=S)(OCC)OCC |
Plant wax | C(=O)(Nc1ccccc1)C2=C(C)OCCS2(=O)=O |
Purple Mint Plant Extract | C(=O)(CCC(C)C)C1=COC=C1 |