If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Carbamyl-2-phenylhydrazine | N(NC(N)=O)c1ccccc1 |
2-((N,N-Diethyldithio)carbamyl)benzoathiazole | S(C(=S)N(CC)CC)C1=Nc2ccccc2S1 |
2-Benzothiazolyl-N, N-(diethylthio)carbamyl sulfide | S(C(=S)N(CC)CC)C1=Nc2ccccc2S1 |
5-Carbamyl-5H-dibenzo(b,f)azepine | C(N)(=O)N1c2ccccc2C=Cc3ccccc13 |
Carbamyl chloride, N, N-dimethyl- | C(Cl)(=O)N(C)C |
Carbamyl hydroxamate | C(N)(=O)NO |
Carbamyl_chloride__N__N-dimethyl- | C(Cl)(=O)N(C)C |
N-Carbamyl arsanilic acid | [As](=O)(O)(O)c1ccc(cc1)NC(N)=O |
S-Carbamyl-L-cysteine | C(N)(CSC(N)=O)C(=O)O |