If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(-)-Dopa | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
(.+-.)-Dopa | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
ALPHA_-Methyl dopa | C(c1ccc(O)c(O)c1)C(C)(N)C(=O)O |
ALPHA_-Methyl-L-dopa | C(c1ccc(O)c(O)c1)C(C)(N)C(=O)O |
D-Dopa | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
DL-3,4-DOPA | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
DL-DOPA | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
DOPA | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
Helfo-Dopa | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
L(-)-Dopa | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |
L-DOPA | C(C(N)C(=O)O)c1ccc(O)c(O)c1 |