If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Butenedioic acid (Z)-, mono(2,2-dimethylhydrazide) | C(=O)(C=CC(=O)O)NN(C)C |
2-Butenedioic_acid_(Z)-__mono(2_2-dimethylhydrazide) | C(=O)(C=CC(=O)O)NN(C)C |
4-Pyridinecarboxylic acid, 2,2-dimethylhydrazide | C(=O)(NN(C)C)c1ccncc1 |
4-Pyridinecarboxylic_acid__2_2-dimethylhydrazide | C(=O)(NN(C)C)c1ccncc1 |
Acetic acid N', N'-dimethylhydrazide | N(C(C)=O)N(C)C |
Acetic acid, 2,2-dimethylhydrazide | N(C(C)=O)N(C)C |
Acetic_acid_N'__N'-dimethylhydrazide | N(C(C)=O)N(C)C |
Benzoic acid, 2-benzoyl-1,2-dimethylhydrazide | C(=O)(c1ccccc1)N(C)N(C)C(=O)c2ccccc2 |
Benzoic_acid__2-benzoyl-1_2-dimethylhydrazide | C(=O)(c1ccccc1)N(C)N(C)C(=O)c2ccccc2 |
Hexadecanoic acid, 2,2-dimethylhydrazide | C(CCCCCCCCCCCCC)CC(=O)NN(C)C |
Hexadecanoic_acid__2_2-dimethylhydrazide | C(CCCCCCCCCCCCC)CC(=O)NN(C)C |
Maleic 1,1-dimethylhydrazide | C(=O)(C=CC(=O)O)NN(C)C |
Maleic acid, mono(2,2-dimethylhydrazide) | C(=O)(C=CC(=O)O)NN(C)C |
Palmitoyl N,N-dimethylhydrazide | C(CCCCCCCCCCCCC)CC(=O)NN(C)C |