If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Isonicotinoyl-2-salicylidenehydrazine | C(=NNC(=O)c1ccncc1)c2ccccc2O |
1-Isonicotinoyl-2-veratrylidenehydrazine | O(C)c1cc(C=NNC(=O)c2ccncc2)ccc1OC |
D(+)-Glucose isonicotinoyl hydrazone | C(O)(C=NNC(=O)c1ccncc1)C2OC(=O)C(O)C2O |
Isonicotinoyl hydrazide | C(=O)(NN)c1ccncc1 |
Isonicotinoyl hydrazone of ethyl acetoacetate | C(=O)(NN=C(C)CC(=O)OCC)c1ccncc1 |
Isonicotinoyl-m-hydroxybenzalhydrazone | C(=O)(NN=Cc1cccc(O)c1)c2ccncc2 |
N-Isonicotinoyl-N'-(BETA_-N-benzylcarboxamidoethyl)hydrazine | C(=O)(NNCCC(=O)NCc1ccccc1)c2ccncc2 |
N-Isonicotinoyl-N'-(salicylidene)hydrazine | C(=NNC(=O)c1ccncc1)c2ccccc2O |
Semicarbazide, 4-cyclohexyl-1-isonicotinoyl-3-thio- | C(=O)(NNC(=S)NC1CCCCC1)c2ccncc2 |
Semicarbazide__4-cyclohexyl-1-isonicotinoyl-3-thio- | C(=O)(NNC(=S)NC1CCCCC1)c2ccncc2 |