If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-Methyl-2-propenenitrile | C(C)(=C)C#N |
2-Methyl-3-phenyl-2-propenenitrile | C(=C(C)C#N)c1ccccc1 |
2-Propenenitrile | C(=C)C#N |
2-Propenenitrile, 2-(chloromethyl)- | C(=C)(CCl)C#N |
2-Propenenitrile, 2-(trifluoromethyl)- | C(=C)(C#N)C(F)(F)F |
2-Propenenitrile, 2-chloro- | C(=C)(Cl)C#N |
2-Propenenitrile, 2-methyl- | C(C)(=C)C#N |
2-Propenenitrile, 2-methyl-, homopolymer | C(C)(=C)C#N |
2-Propenenitrile, 2-methyl-3-phenyl- | C(=C(C)C#N)c1ccccc1 |
2-Propenenitrile, 3,3-diphenyl- | C(=CC#N)(c1ccccc1)c2ccccc2 |
2-Propenenitrile, 3-(2-furanyl)- | C(=CC#N)C1=CC=CO1 |
2-Propenenitrile, 3-(3,4-dimethoxyphenyl)- | O(C)c1cc(C=CC#N)ccc1OC |
2-Propenenitrile, 3-(4-(dimethylamino)phenyl)- | N(C)(C)c1ccc(C=CC#N)cc1 |
2-Propenenitrile, 3-ethoxy- | C(=CC#N)OCC |
2-Propenenitrile, 3-phenyl- | C(=CC#N)c1ccccc1 |
2-Propenenitrile, 3-phenyl-, (E)- | C(=CC#N)c1ccccc1 |
2-Propenenitrile, homopolymer | C(=C)C#N |
2-Propenenitrile__2-(trifluoromethyl)- | C(=C)(C#N)C(F)(F)F |
2-Propenenitrile__2-chloro- | C(=C)(Cl)C#N |
2-Propenenitrile__2-methyl- | C(C)(=C)C#N |
2-Propenenitrile__2-methyl-3-phenyl- | C(=C(C)C#N)c1ccccc1 |
2-Propenenitrile__2-methyl-__homopolymer | C(C)(=C)C#N |
2-Propenenitrile__3-(2-furanyl)- | C(=CC#N)C1=CC=CO1 |
2-Propenenitrile__3-(3_4-dimethoxyphenyl)- | O(C)c1cc(C=CC#N)ccc1OC |
2-Propenenitrile__3-(4-(dimethylamino)phenyl)- | N(C)(C)c1ccc(C=CC#N)cc1 |
2-Propenenitrile__3-ethoxy- | C(=CC#N)OCC |
2-Propenenitrile__3-phenyl- | C(=CC#N)c1ccccc1 |
2-Propenenitrile__3-phenyl-__(E)- | C(=CC#N)c1ccccc1 |
2-Propenenitrile__homopolymer | C(=C)C#N |
3-Phenyl-2-propenenitrile | C(=CC#N)c1ccccc1 |
Propenenitrile | C(=C)C#N |