If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1, 2-Benzenedicarboxylic acid, monoethenyl ester, homopolymer | C(=O)(OC=C)c1ccccc1C(=O)O |
1,2-Ethanediol homopolymer | C(O)CO |
1H-Imidazole, 1-ethenyl-, homopolymer | C(=C)N1C=CN=C1 |
1H-Imidazole__1-ethenyl-__homopolymer | C(=C)N1C=CN=C1 |
1__2-Benzenedicarboxylic_acid__monoethenyl_ester__homopolymer | C(=O)(OC=C)c1ccccc1C(=O)O |
2-Propenamide, homopolymer | C(N)(=O)C=C |
2-Propenamide__homopolymer | C(N)(=O)C=C |
2-Propenenitrile, 2-methyl-, homopolymer | C(C)(=C)C#N |
2-Propenenitrile, homopolymer | C(=C)C#N |
2-Propenenitrile__2-methyl-__homopolymer | C(C)(=C)C#N |
2-Propenenitrile__homopolymer | C(=C)C#N |
2-Propenoic acid, homopolymer | C(=O)(O)C=C |
2-Propenoic_acid__homopolymer | C(=O)(O)C=C |
2-Pyrrolidinone, 1-ethenyl, homopolymer | C(=C)N1CCCC1=O |
2-Pyrrolidinone, 1-ethenyl-, homopolymer | C(=C)N1CCCC1=O |
2-Pyrrolidinone, 1-ethenyl-, homopolymer, compd. with iodine | II.C=CN1CCCC1=O |
2-Pyrrolidinone__1-ethenyl-__homopolymer__compd._with_iodine | II.C=CN1CCCC1=O |
5'-Cytidylic acid, homopolymer | OC1C(O)C(COP(=O)(O)O)OC1N2C=CC(=N)NC2=O |
5'-Cytidylic_acid__homopolymer | OC1C(O)C(COP(=O)(O)O)OC1N2C=CC(=N)NC2=O |
5'-Inosinic acid, homopolymer | OC1C(O)C(COP(=O)(O)O)OC1N2C=Nc3c(O)ncnc23 |
5'-Inosinic_acid__homopolymer | OC1C(O)C(COP(=O)(O)O)OC1N2C=Nc3c(O)ncnc23 |
Acrylamide homopolymer | C(N)(=O)C=C |
Acrylic acid homopolymer | C(=O)(O)C=C |
Acrylonitrile homopolymer | C(=C)C#N |
Aziridine homopolymer | C1CN1 |
Aziridine, homopolymer | C1CN1 |
Benzaldehyde, 4-amino-, homopolymer | C(=O)c1ccc(N)cc1 |
Benzaldehyde__4-amino-__homopolymer | C(=O)c1ccc(N)cc1 |
Benzenamine, 4-ethenyl-, homopolymer | C(=C)c1ccc(N)cc1 |
Benzenamine__4-ethenyl-__homopolymer | C(=C)c1ccc(N)cc1 |
Ethenamine, homopolymer | C(=C)N |
Ethenamine__homopolymer | C(=C)N |
Ethene, methoxy-, homopolymer | C(=C)OC |
Ethenol, homopolymer | C(=C)O |
Ethylene glycol homopolymer | C(O)CO |
Ethylene oxide, homopolymer | C(O)CO |
Ethylenimine, homopolymer | C1CN1 |
GAMMA_-Benzyl L-glutamate homopolymer | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
Glutamic acid, homopolymer, L- | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
L-Glutamic acid, 5-(phenylmethyl) ester, homopolymer | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
L-Glutamic_acid__5-(phenylmethyl)_ester__homopolymer | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
L-Proline, 4-(acetyloxy)-, homopolymer | O(C(C)=O)C1CNC(C1)C(=O)O |
L-Proline, 4-hydroxy-, homopolymer | C(=O)(O)C1NCC(O)C1 |
L-Proline__4-(acetyloxy)-__homopolymer | O(C(C)=O)C1CNC(C1)C(=O)O |
L-Proline__4-hydroxy-__homopolymer | C(=O)(O)C1NCC(O)C1 |
Methyl vinyl ether homopolymer | C(=C)OC |
Methyl_vinyl_ether_homopolymer | C(=C)OC |
Oxirane homopolymer | C(O)CO |
PAA 1 (homopolymer) | C(N)(=O)C=C |
Phenol, 4-ethenyl-, homopolymer | C(=C)c1ccc(O)cc1 |
Phenol__4-ethenyl-__homopolymer | C(=C)c1ccc(O)cc1 |
Poly(1-vinyl-2-pyrrolidinone) homopolymer | C(=C)N1CCCC1=O |
Pyridine, 2-ethenyl-, 1-oxide, homopolymer | C(=C)c1ccccn1=O |
Pyridine__2-ethenyl-__1-oxide__homopolymer | C(=C)c1ccccn1=O |
Stannane, oxodiphenyl-, homopolymer | [Sn](=O)(c1ccccc1)c2ccccc2 |
Stannane__oxodiphenyl-__homopolymer | [Sn](=O)(c1ccccc1)c2ccccc2 |
p-Aminostyrene homopolymer | C(=C)c1ccc(N)cc1 |