If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-(5-Nitrofurfurylideneamino)imidazolidine-2-thione | C(=NN1CCNC1=S)C2=CC=C(O2)[N+](=O)[O-] |
Imidazolidine, 1,3-dibenzyl-2-phenyl- | C(c1ccccc1)N2CCN(Cc3ccccc3)C2c4ccccc4 |
Imidazolidine, 1,3-dibutyl-2-propyl- | C(CC)C1N(CCCC)CCN1CCCC |
Imidazolidine, 1,3-diethyl-2-phenyl- | C(C)N1CCN(CC)C1c2ccccc2 |
Imidazolidine, 2-phenyl-1, 3-bis(phenylmethyl)- | C(c1ccccc1)N2CCN(Cc3ccccc3)C2c4ccccc4 |
Imidazolidine__1_3-diethyl-2-phenyl- | C(C)N1CCN(CC)C1c2ccccc2 |
Imidazolidine__2-phenyl-1__3-bis(phenylmethyl)- | C(c1ccccc1)N2CCN(Cc3ccccc3)C2c4ccccc4 |
Pyrazolo(2,3-a)imidazolidine | C12=CC=NN1CCN2 |