If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Methylhydantoin-2-imide | N=C1NC(=O)CN1C |
2-Phenyl-2-ethylglutaric acid imide | C(C)C1(CCC(=O)NC1=O)c2ccccc2 |
ALPHA_-Phenyl-ALPHA_-ethylglutaric acid imide | C(C)C1(CCC(=O)NC1=O)c2ccccc2 |
ALPHA_-Phenyl-ALPHA_-ethylglutaric_acid_imide | C(C)C1(CCC(=O)NC1=O)c2ccccc2 |
Chlorendic imide | ClC12C(Cl)=C(Cl)C(Cl)(C3C(=O)NC(=O)C13)C2(Cl)Cl |
I Acid Imide | Oc1cc(cc2cc(ccc12)Nc3ccc4c(O)cc(cc4c3)S(=O)(=O)O)S(=O)(=O)O |
J Acid Imide | Oc1cc(cc2cc(ccc12)Nc3ccc4c(O)cc(cc4c3)S(=O)(=O)O)S(=O)(=O)O |
N-(p-Nitrophenyl)triphenylphosphine imide | P(=Nc1ccc(cc1)[N+](=O)[O-])(c2ccccc2)(c3ccccc3)c4ccccc4 |
N-Phthalylglutamic acid imide | O=C1c2ccccc2C(=O)N1C3CCC(=O)NC3=O |
P,P, P-Triphenyl-N-p-tolylphosphine imide | P(=Nc1ccc(C)cc1)(c2ccccc2)(c3ccccc3)c4ccccc4 |
Phosphine imide, N-(m-nitrophenyl)-P,P,P-triphenyl- | P(=Nc1cccc(c1)[N+](=O)[O-])(c2ccccc2)(c3ccccc3)c4ccccc4 |
Phosphine imide, N-(p-nitrophenyl)-P,P,P-triphenyl- | P(=Nc1ccc(cc1)[N+](=O)[O-])(c2ccccc2)(c3ccccc3)c4ccccc4 |
Phosphine imide, P,P, P-triphenyl-N-p-tolyl- | P(=Nc1ccc(C)cc1)(c2ccccc2)(c3ccccc3)c4ccccc4 |
Phosphine imide, tetraphenyl- | P(=Nc1ccccc1)(c2ccccc2)(c3ccccc3)c4ccccc4 |
Phosphoric acid triethylene imide | P(=O)(N1CC1)(N2CC2)N3CC3 |
Quinolinic acid imide | O=C1NC(=O)c2ncccc12 |
Succinic acid imide | O=C1CCC(=O)N1 |
Succinic imide | O=C1CCC(=O)N1 |
Sulfurous imide, phenyl- | N(=S=O)c1ccccc1 |
Tetrahydrophthalic acid imide | O=C1NC(=O)C2CC=CCC12 |
Thionyl imide, phenyl- | N(=S=O)c1ccccc1 |
cis-N-Cyclohexyl-N'-methyldi-imide N-oxide | N(=O)(=NC)C1CCCCC1 |
cis-N-Cyclohexyl-N'-methyldi-imide_N-oxide | N(=O)(=NC)C1CCCCC1 |
endo Methylenetetrahydrophthalic acid, N-2-ethylhexyl imide | O=C1N(CC(CC)CCCC)C(=O)C2C3C=CC(C3)C12 |
o-Phthalic imide | O=C1NC(=O)c2ccccc12 |
o-Sulfobenzoic acid imide | O=S1(=O)NC(=O)c2ccccc12 |
o-Sulfonbenzoic acid imide sodium salt | O=S1(=O)NC(=O)c2ccccc12 |
p-Phenylene phosphorodiamidate, cyclic tetrakis(ethylene imide) | P(=O)(Oc1ccc(cc1)OP(=O)(N2CC2)N3CC3)(N4CC4)N5CC5 |