If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
8-Bromoadenosine 3', 5'-cyclic monophosphate | BrC1=Nc2c(N)ncnc2N1C3OC4COP(=O)(O)OC4C3O |
8-Bromoadenosine 3',5'-monophosphate | BrC1=Nc2c(N)ncnc2N1C3OC4COP(=O)(O)OC4C3O |
8-Bromoadenosine cyclic 3',5'-phosphate | BrC1=Nc2c(N)ncnc2N1C3OC4COP(=O)(O)OC4C3O |
8-Bromoadenosine | BrC1=Nc2c(N)ncnc2N1C3OC(CO)C(O)C3O |
Bromoadenosine | BrC1=Nc2c(N)ncnc2N1C3OC(CO)C(O)C3O |
Cyclic 8-bromoadenosine 3', 5'-monophosphate | BrC1=Nc2c(N)ncnc2N1C3OC4COP(=O)(O)OC4C3O |