If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
FUMARIC ACID | C(=CC(=O)O)C(=O)O |
Fumaric acid dibenzyl ester | C(OC(=O)C=CC(=O)OCc1ccccc1)c2ccccc2 |
Fumaric acid dimethyl ester | C(=O)(OC)C=CC(=O)OC |
Fumaric acid monoamide | C(=CC(=O)O)C(N)=O |
Fumaric acid | C(=CC(=O)O)C(=O)O |
Fumaric acid, bis(2-chlorethyl) ester | C(=O)(OCCCl)C=CC(=O)OCCCl |
Fumaric acid, bis(2-chloroethyl) ester | C(=O)(OCCCl)C=CC(=O)OCCCl |
Fumaric acid, chloro- | C(Cl)(=CC(=O)O)C(=O)O |
Fumaric acid, diallyl ester | C(=O)(OCC=C)C=CC(=O)OCC=C |
Fumaric acid, dibenzyl ester | C(OC(=O)C=CC(=O)OCc1ccccc1)c2ccccc2 |
Fumaric acid, dibutyl ester | C(=O)(OCCCC)C=CC(=O)OCCCC |
Fumaric acid, diethyl ester | C(=O)(OCC)C=CC(=O)OCC |
Fumaric acid, dihydrazide | C(=O)(NN)C=CC(=O)NN |
Fumaric acid, dihydroxy- | C(O)(C(=O)O)=C(O)C(=O)O |
Fumaric acid, diisobutyl ester | C(=O)(OCC(C)C)C=CC(=O)OCC(C)C |
Fumaric acid, diisopropyl ester | C(=O)(C=CC(=O)OC(C)C)OC(C)C |
Fumaric acid, dimethyl ester | C(=O)(OC)C=CC(=O)OC |
Fumaric acid, methyl ester | C(=O)(OC)C=CC(=O)O |
Fumaric acid, methyl- | C(C)(=CC(=O)O)C(=O)O |
Fumaric acid, monomethyl ester | C(=O)(OC)C=CC(=O)O |
Fumaric diamide | C(=CC(N)=O)C(N)=O |
Fumaric dihydrazide | C(=O)(NN)C=CC(=O)NN |
Fumaric nitrile | C(C#N)=CC#N |
Fumaric_acid__bis(2-chloroethyl)_ester | C(=O)(OCCCl)C=CC(=O)OCCCl |