If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(+)-Camphor oxime | CC12CCC(CC2=NO)C1(C)C |
(-)-Camphor | CC12CCC(CC2=O)C1(C)C |
3-Bromo-d-camphor | CC12CCC(C(Br)C2=O)C1(C)C |
Alant camphor | CC12CCCC(C)C1=CC3C(=C)C(=O)OC3C2 |
Anise camphor | C(=CC)c1ccc(OC)cc1 |
Bitter almond oil camphor | C(O)(c1ccccc1)C(=O)c2ccccc2 |
Camphor bromide | CC12CCC(C(Br)C2=O)C1(C)C |
Camphor tar | c12ccccc1cccc2 |
Camphor | CC12CCC(CC2=O)C1(C)C |
Camphor, (1S,4S)-(-)- | CC12CCC(CC2=O)C1(C)C |
Camphor, d-oxime | CC12CCC(CC2=NO)C1(C)C |
Camphor, l-, (-)- | CC12CCC(CC2=O)C1(C)C |
Camphor, oxime (VAN8CI) | CC12CCC(CC2=NO)C1(C)C |
Camphor, oxime, (1R)- | CC12CCC(CC2=NO)C1(C)C |
Cantharides camphor | CC12C(=O)OC(=O)C1(C)C3CCC2O3 |
Champaca camphor | CC1CCC2=C1CC(CCC2C)C(C)(C)O |
D-Camphor oxime | CC12CCC(CC2=NO)C1(C)C |
Elecampane camphor | CC12CCCC(C)C1=CC3C(=C)C(=O)OC3C2 |
Inula camphor | CC12CCCC(C)C1=CC3C(=C)C(=O)OC3C2 |
Parsley camphor | O(C)c1c(CC=C)cc(OC)c2OCOc12 |
Peppermint camphor | C(C)(C)C1CCC(C)CC1O |
Tar camphor | c12ccccc1cccc2 |
Thyme camphor | C(C)(C)c1ccc(C)cc1O |
Tonka bean camphor | O=C1C=Cc2ccccc2O1 |
l-(-)-Camphor | CC12CCC(CC2=O)C1(C)C |
l-Camphor | CC12CCC(CC2=O)C1(C)C |