If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Phenylpropenamide | C(=CC(N)=O)c1ccccc1 |
N,N-Diethyl-3-phenylpropenamide | C(=CC(=O)N(CC)CC)c1ccccc1 |
N-ALPHA_-Naphthyl-3-phenylpropenamide | N(C(=O)C=Cc1ccccc1)c2cccc3ccccc23 |
N-BETA_-Naphthyl-3-phenylpropenamide | N(C(=O)C=Cc1ccccc1)c2ccc3ccccc3c2 |
N-Butyl-3-phenylpropenamide | C(=CC(=O)NCCCC)c1ccccc1 |
n-Propyl-3-phenylpropenamide | C(=CC(=O)NCCC)c1ccccc1 |