If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
ICDMT | N(=NN(C)C)C1=C(NC=N1)C(N)=O |
ICDT | N(=NN(C)C)C1=C(NC=N1)C(N)=O |
Ichtho-Bellol | S(=O)(=O)(O)O.OCC(C(=O)OC1CC2CCC(C1)N2C)c3ccccc3 |
ICIG 1105 | N(C(=O)N(N=O)CCCl)C1OC(COC(=O)c2ccc(cc2)[N+](=O)[O-])C3OC(C)(C)OC13 |
ICIG 1109 | N(C(=O)N(N=O)CCCl)C1CCCCC1 |
ICIG 1164 | O(C(C)=O)C1C(OCC(OC(C)=O)C1OC(C)=O)NC(=O)N(N=O)CCCl |
Poly ICLC | OC1C(O)C(COP(=O)(O)O)OC1N2C=Nc3c(O)ncnc23.NCCCCC(N)C(=O)O.N=C4C=CN(C(=O)N4)C5OC(COP(=O)(O)O)C(O)C5O |
Iconyl | N(CC(=O)O)c1ccc(O)cc1 |
ICRF 159 | C(C(C)N1CC(=O)NC(=O)C1)N2CC(=O)NC(=O)C2 |
ICRF 186 | C(C(C)N1CC(=O)NC(=O)C1)N2CC(=O)NC(=O)C2 |
ICRF 202 | C(CC)(C(C)N1CC(=O)NC(=O)C1)N2CC(=O)NC(=O)C2 |
ICRF-187 | C(C(C)N1CC(=O)NC(=O)C1)N2CC(=O)NC(=O)C2 |
Soluble ICRF (L-isomer) | C(C(C)N1CC(=O)NC(=O)C1)N2CC(=O)NC(=O)C2 |
Ictalis simple | O=C1NC(=O)NC1(c2ccccc2)c3ccccc3 |