If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,3-Benzodioxole, 5-(diethoxymethyl)- | C(OCC)(OCC)c1ccc2OCOc2c1 |
1-(Diethoxymethyl)-4-methoxybenzene | C(OCC)(OCC)c1ccc(OC)cc1 |
1_3-Benzodioxole__5-(diethoxymethyl)- | C(OCC)(OCC)c1ccc2OCOc2c1 |
Benzene, (diethoxymethyl)- | C(OCC)(OCC)c1ccccc1 |
Benzene, 1-(diethoxymethyl)-4-methoxy- | C(OCC)(OCC)c1ccc(OC)cc1 |
Benzene, 1-chloro-4-(diethoxymethyl)- | C(OCC)(OCC)c1ccc(Cl)cc1 |
Benzene__1-(diethoxymethyl)-4-methoxy- | C(OCC)(OCC)c1ccc(OC)cc1 |
Butanedioic acid, (diethoxymethyl)-, diethyl ester | C(CC(=O)OCC)(C(=O)OCC)C(OCC)OCC |
Butanedioic acid, 2-(diethoxymethyl)-3-formyl-, diethyl ester | C(C(=O)OCC)(C(OCC)OCC)C(C=O)C(=O)OCC |
Diethoxymethyl acetate | C(OCC)(OCC)OC(C)=O |
Silane, (3-(2, 3-epoxypropoxy)propyl)diethoxymethyl- | [Si](C)(OCC)(OCC)CCCOCC1CO1 |
Silane, (4-aminobutyl)diethoxymethyl- | [Si](C)(OCC)(OCC)CCCCN |
Silane, diethoxymethyl(3-(oxiranylmethoxy)propyl)- | [Si](C)(OCC)(OCC)CCCOCC1CO1 |
Silane, diethoxymethyl- | [Si](C)(OCC)OCC |
Silane__(3-(2__3-epoxypropoxy)propyl)diethoxymethyl- | [Si](C)(OCC)(OCC)CCCOCC1CO1 |
Silane__diethoxymethyl- | [Si](C)(OCC)OCC |