If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Butylcyclohexanol | C(CCC)C1(O)CCCCC1 |
1-n-Butylcyclohexanol | C(CCC)C1(O)CCCCC1 |
2-sec-Butylcyclohexanol | C(C)(CC)C1CCCCC1O |
2-sec-Butylcyclohexanol, acetate | O(C(C)=O)C1CCCCC1C(C)CC |
4-tert-Butylcyclohexanol acetate | C(C)(C)(C)C1CCC(CC1)OC(C)=O |
4-tert-Butylcyclohexanol | C(C)(C)(C)C1CCC(O)CC1 |
cis-2-tert-Butylcyclohexanol | C(C)(C)(C)C1CCCCC1O |
p-tert-Butylcyclohexanol | C(C)(C)(C)C1CCC(O)CC1 |
trans-2-tert-Butylcyclohexanol | C(C)(C)(C)C1CCCCC1O |