If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
D-Glucaric acid, calcium salt (1:1) | C(O)(C(O)C(=O)O)C(O)C(O)C(=O)O |
D-Glucaric acid, monopotassium salt | C(O)(C(O)C(=O)O)C(O)C(O)C(=O)O |
D-Glucaric_acid__monopotassium_salt | C(O)(C(O)C(=O)O)C(O)C(O)C(=O)O |
Glucaric acid, calcium salt (1:1), D- | C(O)(C(O)C(=O)O)C(O)C(O)C(=O)O |
Glucaric acid, potassium salt, D- | C(O)(C(O)C(=O)O)C(O)C(O)C(=O)O |
Glucaric_acid__calcium_salt_(1:1)__D- | C(O)(C(O)C(=O)O)C(O)C(O)C(=O)O |