If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,3,3-Triethoxy-1-propene | C(OCC)(OCC)C=COCC |
1-Propene, 1,3,3-triethoxy- | C(OCC)(OCC)C=COCC |
2-Chloro-1,1,3-triethoxy propane | C(OCC)(OCC)C(Cl)COCC |
Benzoic acid, 3,4,5-triethoxy-, ethyl ester | O(CC)c1c(OCC)cc(cc1OCC)C(=O)OCC |
Benzoic_acid__3_4_5-triethoxy-__ethyl_ester | O(CC)c1c(OCC)cc(cc1OCC)C(=O)OCC |
Borane, triethoxy- | B(OCC)(OCC)OCC |
Butane, 1,1,3-triethoxy- | C(OCC)(OCC)CC(C)OCC |
Ethane, 1,1,1-triethoxy- | C(C)(OCC)(OCC)OCC |
Methane, triethoxy- | C(OCC)(OCC)OCC |
Octyl(triethoxy)silane | [Si](OCC)(OCC)(OCC)CCCCCCCC |
Phosphine sulfide, triethoxy- | P(=S)(OCC)(OCC)OCC |
Propane, 1,1, 1-triethoxy- | C(CC)(OCC)(OCC)OCC |
Propane, 1,1, 3-triethoxy- | C(OCC)(OCC)CCOCC |
Propane, 1,3,3-triethoxy- | C(OCC)(OCC)CCOCC |
Propane, 2-chloro-1,1,3-triethoxy- | C(OCC)(OCC)C(Cl)COCC |
Propene, 1,3, 3-triethoxy- | C(OCC)(OCC)C=COCC |
Silane, (2-cyanoethyl)triethoxy- | [Si](OCC)(OCC)(OCC)CCC#N |
Silane, (3-aminopropyl)triethoxy- | [Si](OCC)(OCC)(OCC)CCCN |
Silane, (3-chloropropyl)triethoxy- | [Si](OCC)(OCC)(OCC)CCCCl |
Silane, (GAMMA_-aminopropyl)triethoxy- | [Si](OCC)(OCC)(OCC)CCCN |
Silane, triethoxy- | [Si](OCC)(OCC)OCC |
Silane, triethoxy-2-propenyl- | [Si](CC=C)(OCC)(OCC)OCC |
Silane__(GAMMA_-aminopropyl)triethoxy- | [Si](OCC)(OCC)(OCC)CCCN |
Silane__triethoxy-2-propenyl- | [Si](CC=C)(OCC)(OCC)OCC |
Triethoxy(3-aminopropyl)silane | [Si](OCC)(OCC)(OCC)CCCN |
Triethoxy(GAMMA_-chloropropyl)silane | [Si](OCC)(OCC)(OCC)CCCCl |