If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(-)-Nicotine hydrogen tartrate | CN1CCCC1c2cccnc2.O=C(O)C(O)C(O)C(=O)O |
(-)-Nicotine | CN1CCCC1c2cccnc2 |
L-Nicotine | CN1CCCC1c2cccnc2 |
NICOTINE | CN1CCCC1c2cccnc2 |
Nicotine acid amide | C(N)(=O)c1cccnc1 |
Nicotine acid tartrate | CN1CCCC1c2cccnc2.O=C(O)C(O)C(O)C(=O)O |
Nicotine acid | C(=O)(O)c1cccnc1 |
Nicotine alkaloid | CN1CCCC1c2cccnc2 |
Nicotine bitartrate | CN1CCCC1c2cccnc2.O=C(O)C(O)C(O)C(=O)O |
Nicotine hydrogen tartarate | CN1CCCC1c2cccnc2.O=C(O)C(O)C(O)C(=O)O |
Nicotine hydrogen tartrate | CN1CCCC1c2cccnc2.O=C(O)C(O)C(O)C(=O)O |
Nicotine tartrate (VAN) | CN1CCCC1c2cccnc2.O=C(O)C(O)C(O)C(=O)O |
Nicotine | CN1CCCC1c2cccnc2 |
Nicotine, liquid (DOT) | CN1CCCC1c2cccnc2 |
Nicotine, tartrate (1:2) | CN1CCCC1c2cccnc2.O=C(O)C(O)C(O)C(=O)O |
Tartrate de nicotine (FRENCH) | CN1CCCC1c2cccnc2.O=C(O)C(O)C(O)C(=O)O |