If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(Allylthio)acetic acid | C(SCC=C)C(=O)O |
2-(Allylthio)-2-thiazoline | S(CC=C)C1=NCCS1 |
2-Thiazoline, 2-(allylthio)- | S(CC=C)C1=NCCS1 |
4-(Allylthio)-2-phenylpyrimidine | S(CC=C)c1ccnc(n1)c2ccccc2 |
9H-Purine, 6-(allylthio)-9-BETA_-D-ribofuranosyl- | OC1C(O)C(CO)OC1N2C=Nc3c(SCC=C)ncnc23 |
Acetic acid, (allylthio)- | C(SCC=C)C(=O)O |
Butyramide, 2-allylthio-2-ethyl-N-methyl- | C(CC)(CC)(SCC=C)C(=O)NC |
Carbamic acid, N-allylthio-, o-ethyl ester | C(=S)(OCC)NCC=C |
Purine, 6-(allylthio)- | S(CC=C)c1ncnc2NC=Nc12 |
Purine, 6-(allylthio)-2-amino- | S(CC=C)c1nc(N)nc2NC=Nc12 |
Purine__6-(allylthio)- | S(CC=C)c1ncnc2NC=Nc12 |
Pyrimidine, 4-(allylthio)-2-phenyl- | S(CC=C)c1ccnc(n1)c2ccccc2 |
Pyrimidine__4-(allylthio)-2-phenyl- | S(CC=C)c1ccnc(n1)c2ccccc2 |
Pyrylium, 4-(allylthio)-2,6-dimethyl-, iodide | S(CC=C)c1cc(C)oc(C)c1 |
Theophylline, 8-(allylthio)-6-thio- | S=C1N(C)C(=O)N(C)C2=C1N=C(SCC=C)N2 |
Theophylline, 8-allylthio-6-thio- | S=C1N(C)C(=O)N(C)C2=C1N=C(SCC=C)N2 |
Uric acid, 8-allylthio-1,3-dimethyl-6-thio- | S=C1N(C)C(=O)N(C)C2=C1N=C(SCC=C)N2 |
Uric_acid__8-allylthio-1_3-dimethyl-6-thio- | S=C1N(C)C(=O)N(C)C2=C1N=C(SCC=C)N2 |