If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-(N-Ethylanilino)ethanol | N(CC)(CCO)c1ccccc1 |
3-(N-Ethylanilino)propionitrile | N(CC)(CCC#N)c1ccccc1 |
ALPHA_-(N-Ethylanilino)-p-toluenesulfonic acid | N(CC)(Cc1ccc(cc1)S(=O)(=O)O)c2ccccc2 |
BETA_-(Ethylanilino)ethyl alcohol | N(CC)(CCO)c1ccccc1 |
Ethanol, 2-(N-ethylanilino)- | N(CC)(CCO)c1ccccc1 |
Propionitrile, 3-(N-ethylanilino)- | N(CC)(CCC#N)c1ccccc1 |
p-Toluenesulfonic acid, ALPHA_-(N-ethylanilino)- | N(CC)(Cc1ccc(cc1)S(=O)(=O)O)c2ccccc2 |