If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Interchem Acetate Blue B | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Interchem Acetate Blue NBN | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Interchem Acetate Blue RBN | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Interchem Acetate Blue WNBN | N(CCO)c1ccc(NC)c2C(=O)c3ccccc3C(=O)c12 |
Interchem Acetate Fast Pink DNA | O=C1c2ccccc2C(=O)c3c(O)cc(OC)c(N)c13 |
Interchem Acetate Green Blue ALF | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Interchem Acetate Pink 3B | O=C1c2ccccc2C(=O)c3c(N)cc(OC)c(N)c13 |
Interchem Acetate Pink BLF | O=C1c2ccccc2C(=O)c3c(O)ccc(N)c13 |
Interchem Acetate Red Violet RRLF | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Interchem Acetate Scarlet B | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Interchem Acetate Violet R | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Interchem Acetate Yellow GSF (HDLF-40) | N(c1ccccc1)c2ccc(cc2[N+](=O)[O-])S(=O)(=O)Nc3ccccc3 |
Interchem Direct Black Z | Nc1c(N=Nc2ccc(cc2)c3ccc(N=Nc4ccc(N)cc4N)cc3)c(cc5cc(c(N=Nc6ccccc6)c(O)c15)S(=O)(=O)O)S(=O)(=O)O |
Interchem Hisperse Green Blue ALFH | N(CCO)c1ccc(NCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 |
Interchem Hisperse Pink BH | O=C1c2ccccc2C(=O)c3c(O)ccc(N)c13 |
Interchem Hisperse Scarlet BH | N(CC)(CCO)c1ccc(cc1)N=Nc2ccc(cc2)[N+](=O)[O-] |
Interchem Hisperse Violet 2RH | O=C1c2ccccc2C(=O)c3c(N)ccc(N)c13 |
Interchem Polydye Yellow GSFD | N(c1ccccc1)c2ccc(cc2[N+](=O)[O-])S(=O)(=O)Nc3ccccc3 |
Interchem Yellow GSF (HDLF) | N(c1ccccc1)c2ccc(cc2[N+](=O)[O-])S(=O)(=O)Nc3ccccc3 |