If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
3-(Aminopropyl)cyclohexylamine | N(CCCN)C1CCCCC1 |
Benzoic acid, compd. with cyclohexylamine (1:1) | C(=O)(O)c1ccccc1.NC2CCCCC2 |
Cupric chloride-cyclohexylamine complex | [Cu](Cl)(Cl)(n1ccccc1)n2ccccc2 |
Cupric_chloride-cyclohexylamine_complex | [Cu](Cl)(Cl)(n1ccccc1)n2ccccc2 |
Cyclohexylamine benzoate | C(=O)(O)c1ccccc1.NC2CCCCC2 |
Cyclohexylamine nitrogen mustard | N(CCCl)(CCCl)C1CCCCC1 |
Cyclohexylamine, 1-phenyl-, hydrochloride | NC1(CCCCC1)c2ccccc2 |
Cyclohexylamine, 2-methyl- | CC1CCCCC1N |
Cyclohexylamine, 4-methyl- | CC1CCC(N)CC1 |
Cyclohexylamine, N, N-bis(2-chloroethyl)-, hydrochloride | N(CCCl)(CCCl)C1CCCCC1 |
Cyclohexylamine, N, N-diethyl- | N(CC)(CC)C1CCCCC1 |
Cyclohexylamine, N,N'-(2-butynylene)bis- | N(CC#CCNC1CCCCC1)C2CCCCC2 |
Cyclohexylamine, N,N-dimethyl- | N(C)(C)C1CCCCC1 |
Cyclohexylamine, N-(2-ethylhexyl)- | N(CC(CC)CCCC)C1CCCCC1 |
Cyclohexylamine, N-(3-aminopropyl)- | N(CCCN)C1CCCCC1 |
Cyclohexylamine, N-benzylidene- | C(=NC1CCCCC1)c2ccccc2 |
Cyclohexylamine, N-ethyl- | N(CC)C1CCCCC1 |
Cyclohexylamine, N-ethyl-1-phenyl- | N(CC)C1(CCCCC1)c2ccccc2 |
Cyclohexylamine, N-methyl- | N(C)C1CCCCC1 |
Cyclohexylamine, N-methyl-N-nitroso- | N(C)(N=O)C1CCCCC1 |
Cyclohexylamine, N-nitroso-N-methyl- | N(C)(N=O)C1CCCCC1 |
Cyclohexylamine, N-phenyl- | N(C1CCCCC1)c2ccccc2 |
Cyclohexylamine, N-propoxylated | N(CC(C)O)C1CCCCC1 |
Cyclohexylamine, hydroxyethyl- | N(CCO)C1CCCCC1 |
Cyclohexylamine__N-(3-aminopropyl)- | N(CCCN)C1CCCCC1 |
Cyclohexylamine__N__N-diethyl- | N(CC)(CC)C1CCCCC1 |
Cytoxyl alcohol compd. with cyclohexylamine | N(CCCl)(CCCl)P(=O)(O)NCCCO.NC1CCCCC1 |
Cytoxyl alcohol cyclohexylamine salt | N(CCCl)(CCCl)P(=O)(O)NCCCO.NC1CCCCC1 |
N, N-Bis(2-chloroethyl)cyclohexylamine hydrochloride | N(CCCl)(CCCl)C1CCCCC1 |
N, N-Bis(2-hydroxyethyl)cyclohexylamine | N(CCO)(CCO)C1CCCCC1 |
N, N-Di(2-hydroxyethyl)cyclohexylamine | N(CCO)(CCO)C1CCCCC1 |
N,N-Dimethyl-N-cyclohexylamine | N(C)(C)C1CCCCC1 |
N-(2-Ethylhexyl)cyclohexylamine | N(CC(CC)CCCC)C1CCCCC1 |
N-(2-Hydroxyethyl) cyclohexylamine | N(CCO)C1CCCCC1 |
N-(2-Hydroxyethyl)cyclohexylamine | N(CCO)C1CCCCC1 |
N-(3-Aminopropyl)cyclohexylamine | N(CCCN)C1CCCCC1 |
N-Benzylidene cyclohexylamine | C(=NC1CCCCC1)c2ccccc2 |
N-Cyclohexyl-cyclohexylamine | N(C1CCCCC1)C2CCCCC2 |
N-Methyl-N-cyclohexylamine | N(C)C1CCCCC1 |
Nickel, bis(cyclohexylamine)bis(2,4-pentanedionato)- | N(C1CCCCC1)[Ni]2345(O=C(C)CC(C)=O2)(O3=C(C)CC(C)=O45)NC6CCCCC6 |
Nickel__bis(cyclohexylamine)bis(2_4-pentanedionato)- | N(C1CCCCC1)[Ni]2345(O=C(C)CC(C)=O2)(O3=C(C)CC(C)=O45)NC6CCCCC6 |
Phosphoramide mustard cyclohexylamine salt | N(CCCl)(CCCl)P(N)(=O)O.NC1CCCCC1 |
cis-Dichlorobis(cyclohexylamine)platinum(II) | N(C1CCCCC1)[Pt](Cl)(Cl)NC2CCCCC2 |