If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Acetoxy-1-methylethylene | O(C(C)=C)C(C)=O |
1-Methylethylene carbonate | CC1COC(=O)O1 |
1-Phenyl-1-methylethylene | C(C)(=C)c1ccccc1 |
Cyclic methylethylene carbonate | CC1COC(=O)O1 |
Methylethylene acetate | C(C)(COC(C)=O)OC(C)=O |
Methylethylene diacetate | C(C)(COC(C)=O)OC(C)=O |
Methylethylene glycol | C(C)(O)CO |
N,N', N''-Tris(1-methylethylene)phosphoramide | P(=O)(N1CC1C)(N2CC2C)N3CC3C |
Tris(1-methylethylene)phosphoric triamide | P(=O)(N1CC1C)(N2CC2C)N3CC3C |