If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Mercaptoethylamine thiosulfate | S(CCN)S(=O)(=O)O |
Disodium thiosulfate | S(=O)(=O)(O)S |
Ethanol, 2-amino-, thiosulfate | S(CCN)S(=O)(=O)O |
Methanethiol, N-(3-(3-indolyl)propyl)amidino-, hydrogen thiosulfate | C(CCNC(=N)CSS(=O)(=O)O)C1=CNc2ccccc12 |
Methanethiol, amidino-, hydrogen thiosulfate | S(CC(=N)N)S(=O)(=O)O |
Phenacyl sodium thiosulfate | C(=O)(CSS(=O)(=O)O)c1ccccc1 |
Phenacyl_sodium_thiosulfate | C(=O)(CSS(=O)(=O)O)c1ccccc1 |
S-((N-(3-(3-Indolyl)propyl)amidino)methyl) hydrogen thiosulfate | C(CCNC(=N)CSS(=O)(=O)O)C1=CNc2ccccc12 |
S-(2-Aminoethyl) hydrogen thiosulfate | S(CCN)S(=O)(=O)O |
S-(Amidinomethyl) hydrogen thiosulfate | S(CC(=N)N)S(=O)(=O)O |
Sodium thiosulfate (Na2S2O3) | S(=O)(=O)(O)S |
Sodium thiosulfate anhydrous | S(=O)(=O)(O)S |
Sodium thiosulfate | S(=O)(=O)(O)S |