If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(+)-Thalidomide | O=C1c2ccccc2C(=O)N1C3CCC(=O)NC3=O |
(-)-Thalidomide | O=C1c2ccccc2C(=O)N1C3CCC(=O)NC3=O |
D-Thalidomide | O=C1c2ccccc2C(=O)N1C3CCC(=O)NC3=O |
L-Thalidomide | O=C1c2ccccc2C(=O)N1C3CCC(=O)NC3=O |
Thalidomide (soluble form) | O=C1c2ccccc2C(=O)N1C3CCC(=O)NC3=O |
Thalidomide | O=C1c2ccccc2C(=O)N1C3CCC(=O)NC3=O |
Thalidomide(USAN) | O=C1c2ccccc2C(=O)N1C3CCC(=O)NC3=O |