If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Hydroxybenzamide | C(N)(=O)c1ccccc1O |
5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide | C(=O)(Nc1ccc(cc1Cl)[N+](=O)[O-])c2cc(Cl)ccc2O |
N-(4-Chlorophenyl)-2-hydroxybenzamide | C(=O)(Nc1ccc(Cl)cc1)c2ccccc2O |
N-Hydroxybenzamide potassium salt | C(=O)(NO)c1ccccc1 |
N-Hydroxybenzamide | C(=O)(NO)c1ccccc1 |
o-Hydroxybenzamide | C(N)(=O)c1ccccc1O |