If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(-)-Abietic acid | CC12CCCC(C)(C(=O)O)C1CC=C3C=C(CCC23)C(C)C |
Abietic acid dimer | CC12CCCC(C)(C(=O)O)C1CC=C3C=C(CCC23)C(C)C |
Abietic acid | CC12CCCC(C)(C(=O)O)C1CC=C3C=C(CCC23)C(C)C |
Abietic acid, dehydro- | CC12CCCC(C)(C(=O)O)C1CCc3cc(ccc23)C(C)C |
Abietic acid, dimer | CC12CCCC(C)(C(=O)O)C1CC=C3C=C(CCC23)C(C)C |
Abietic acid, methyl ester | CC12CCCC(C)(C(=O)OC)C1CC=C3C=C(CCC23)C(C)C |
Abietic_acid__dimer | CC12CCCC(C)(C(=O)O)C1CC=C3C=C(CCC23)C(C)C |
l-Abietic acid | CC12CCCC(C)(C(=O)O)C1CC=C3C=C(CCC23)C(C)C |