If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
P-Phenylphosphonic diamide | P(N)(N)(=O)c1ccccc1 |
Phenylphosphonic acid diamide | P(N)(N)(=O)c1ccccc1 |
Phenylphosphonic acid dichloride | P(Cl)(Cl)(=O)c1ccccc1 |
Phenylphosphonic acid diethyl ester | P(=O)(OCC)(OCC)c1ccccc1 |
Phenylphosphonic acid dioctyl ester | P(=O)(OCCCCCCCC)(OCCCCCCCC)c1ccccc1 |
Phenylphosphonic acid | P(=O)(O)(O)c1ccccc1 |
Phenylphosphonic diamide | P(N)(N)(=O)c1ccccc1 |
Phenylphosphonic dichloride | P(Cl)(Cl)(=O)c1ccccc1 |
Phenylphosphonic_acid_diamide | P(N)(N)(=O)c1ccccc1 |