If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Phenylbutyric acid | C(CCC(=O)O)c1ccccc1 |
2, 3-Epoxy-3-phenylbutyric acid, ethyl ester | CC1(OC1C(=O)OCC)c2ccccc2 |
2-Phenylbutyric acid | C(CC)(C(=O)O)c1ccccc1 |
2-Phenylbutyric acid, ethyl ester | C(CC)(C(=O)OCC)c1ccccc1 |
4-(Bis(2-chloroethyl)amino)phenylbutyric acid | N(CCCl)(CCCl)c1ccc(cc1)CCCC(=O)O |
4-Oxo-4-phenylbutyric acid | C(=O)(CCC(=O)O)c1ccccc1 |
4-Phenylbutyric acid | C(CCC(=O)O)c1ccccc1 |
ALPHA_-Amino-GAMMA_-(p-dichloroethylamino)phenylbutyric acid | N(CCCl)(CCCl)c1ccc(cc1)CCC(N)C(=O)O |
ALPHA_-Phenylbutyric acid | C(CC)(C(=O)O)c1ccccc1 |
GAMMA_-Phenylbutyric acid | C(CCC(=O)O)c1ccccc1 |
Phenylbutyric acid nitrogen mustard | N(CCCl)(CCCl)c1ccc(cc1)CCCC(=O)O |
Phenylbutyric acid | C(CCC(=O)O)c1ccccc1 |