If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
9-D-Psicofuranosyl-6-aminopurine | C(O)C1(OC(CO)C(O)C1O)N2C=Nc3c(N)ncnc23 |
9H-Purin-6-amine, 9-BETA_-D-psicofuranosyl- | C(O)C1(OC(CO)C(O)C1O)N2C=Nc3c(N)ncnc23 |
9H-Purine, 6-amino-9-BETA_-D-psicofuranosyl- | C(O)C1(OC(CO)C(O)C1O)N2C=Nc3c(N)ncnc23 |
9H-Purine__6-amino-9-BETA_-D-psicofuranosyl- | C(O)C1(OC(CO)C(O)C1O)N2C=Nc3c(N)ncnc23 |
Adenine, 9-BETA_-D-psicofuranosyl- | C(O)C1(OC(CO)C(O)C1O)N2C=Nc3c(N)ncnc23 |
Adenine, 9BETA_-D-psicofuranosyl- | C(O)C1(OC(CO)C(O)C1O)N2C=Nc3c(N)ncnc23 |