If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1,3-Butadiene, polymer with 2,5-furandione | O=C1C=CC(=O)O1.C=CC=C |
1-Vinyl-2-pyrrolidinone polymer | C(=C)N1CCCC1=O |
1-Vinyl-2-pyrrolidinone, polymer | C(=C)N1CCCC1=O |
1-Vinyl-2-pyrrolidone polymer | C(=C)N1CCCC1=O |
2, 2-Bis(4-hydroxyphenyl)propane-epichlorohydrin polymer | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
2, 2-Bis(p-hydroxyphenyl)propane-epichlorohydrin polymer | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
2, 2-Diphenylolpropane-epichlorohydrin polymer | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
2, 5-Furandione, polymer with 1,1'-oxybis(ethene) (MF2) | O=C1C=CC(=O)O1.C=COC=C |
2, 5-Furandione, polymer with 1,1'-oxybis(ethene) | O=C1C=CC(=O)O1.C=COC=C |
2, 5-Furandione, polymer with methoxyethene | O=C1C=CC(=O)O1.C=COC |
2,5-Furandione, polymer with 1,1'-oxybis(ethene) | O=C1C=CC(=O)O1.C=COC=C |
2,5-Furandione, polymer with 1,3-butadiene | O=C1C=CC(=O)O1.C=CC=C |
2,5-Furandione, polymer with ethenylbenzene | O=C1C=CC(=O)O1.C=Cc2ccccc2 |
2-Butenedioic acid (Z)-, polymer with methoxyethene | C(=CC(=O)O)C(=O)O.C=COC |
2-Propenal, polymer with formaldehyde | C(=C)C=O.C=O |
2-Propenal__polymer_with_formaldehyde | C(=C)C=O.C=O |
2-Propenamide, polymer with 2-propenoic acid | C(=O)(O)C=C.C=CC(N)=O |
2-Propenamide__polymer_with_2-propenoic_acid | C(=O)(O)C=C.C=CC(N)=O |
2-Propenoic acid, polymer with 2-propenal | C(=C)C=O.C=CC(=O)O |
2-Propenoic acid, polymer with 2-propenamide | C(=O)(O)C=C.C=CC(N)=O |
2-Propenoic_acid__polymer_with_2-propenal | C(=C)C=O.C=CC(=O)O |
2-Pyrrolidinone, 1-ethenyl-, polymer with ethenyl acetate | C(=C)N1CCCC1=O.C=COC(C)=O |
2-Vinylpyridine N-oxide polymer | C(=C)c1ccccn1=O |
2_5-Furandione__polymer_with_1_1'-oxybis(ethene) | O=C1C=CC(=O)O1.C=COC=C |
2__5-Furandione__polymer_with_1_1'-oxybis(ethene) | O=C1C=CC(=O)O1.C=COC=C |
2__5-Furandione__polymer_with_1_1'-oxybis(ethene)_(MF2) | O=C1C=CC(=O)O1.C=COC=C |
4, 4'-Dihydroxydiphenylpropane-epichlorohydrin polymer | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
4, 4'-Isopropylidenediphenol-epichlorohydrin polymer | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
4-Vinylphenol polymer | C(=C)c1ccc(O)cc1 |
5-Benzyl L-glutamate polymer | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
Acetic acid ethenyl ester, polymer with 1-ethenyl-2-pyrrolidinone | C(=C)N1CCCC1=O.C=COC(C)=O |
Acetic acid ethenyl ester, polymer with 2,5-furandione | O(C=C)C(C)=O.O=C1C=CC(=O)O1 |
Acetic acid vinyl ester, polymer with 1-vinyl-2-pyrrolidinone | C(=C)N1CCCC1=O.C=COC(C)=O |
Acetic_acid_ethenyl_ester__polymer_with_1-ethenyl-2-pyrrolidinone | C(=C)N1CCCC1=O.C=COC(C)=O |
Acetic_acid_ethenyl_ester__polymer_with_2_5-furandione | O(C=C)C(C)=O.O=C1C=CC(=O)O1 |
Acrolein, acrylic acid polymer | C(=C)C=O.C=CC(=O)O |
Acrolein, formaldehyde polymer | C(=C)C=O.C=O |
Acrylamide polymer | C(N)(=O)C=C |
Acrylamide, polymer | C(N)(=O)C=C |
Acrylamide-acrylate polymer | C(=O)(O)C=C.C=CC(N)=O |
Acrylamide-acrylic acid polymer | C(=O)(O)C=C.C=CC(N)=O |
Acrylic acid, polymer with acrylamide | C(=O)(O)C=C.C=CC(N)=O |
Acrylic acid, polymer | C(=O)(O)C=C |
Acrylic acid-acrylamide polymer | C(=O)(O)C=C.C=CC(N)=O |
Acrylic polymer | C(=O)(O)C=C |
Acrylonitrile polymer | C(=C)C#N |
Amylphenol Disulphide (polymer) | c12cc(cc(c1O)SSC23CC(C)(C)c4ccc(O)c3c4)C(C)(C)CC |
Amylphenol_Disulphide_(polymer) | c12cc(cc(c1O)SSC23CC(C)(C)c4ccc(O)c3c4)C(C)(C)CC |
Benzene, ethenyl-, polymer with 2,5-furandione | O=C1C=CC(=O)O1.C=Cc2ccccc2 |
Benzene__ethenyl-__polymer_with_2_5-furandione | O=C1C=CC(=O)O1.C=Cc2ccccc2 |
Bisphenol A, (chloromethyl)oxirane polymer | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
Bisphenol A, epichlorohydrin polymer | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
Bisphenol A-epichlorohydrin polymer | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
Butadiene-maleic anhydride alternating polymer | O=C1C=CC(=O)O1.C=CC=C |
Butadiene-maleic anhydride polymer | O=C1C=CC(=O)O1.C=CC=C |
Butadiene-maleic_anhydride_alternating_polymer | O=C1C=CC(=O)O1.C=CC=C |
CF 218 (polymer) | C1CN1 |
Carboxy vinyl polymer | C(=O)(O)C=C |
Dextrose (polymer) | C(O)(C(O)CO)C(O)C(O)C=O |
Dextrose_(polymer) | C(O)(C(O)CO)C(O)C(O)C=O |
Dian-epichlorohydrin polymer | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
Diphenylolpropane-epichlorohydrin polymer | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
Diphenyltin oxide polymer | [Sn](=O)(c1ccccc1)c2ccccc2 |
Divinyl ether- maleic anhydride polymer | O=C1C=CC(=O)O1.C=COC=C |
Epichlorohydrin, polymer with tetraethylenepentamine | C(Cl)C1CO1.NCCNCCNCCNCCN |
Epichlorohydrin, tetraethylenepentamine polymer | C(Cl)C1CO1.NCCNCCNCCNCCN |
Epichlorohydrin-2, 2-bis(4-hydroxyphenyl)propane polymer | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
Epichlorohydrin-4, 4'-isopropylidenediphenol polymer | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
Epichlorohydrin-bisphenol A polymer | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
Epichlorohydrin-diphenylolpropane polymer | C(C)(C)(c1ccc(O)cc1)c2ccc(O)cc2.ClCC3CO3 |
Epichlorohydrin-tetraethylenepentamine polymer | C(Cl)C1CO1.NCCNCCNCCNCCN |
Ethene, methoxy-, polymer with (Z)-2-butenedioic acid | C(=CC(=O)O)C(=O)O.C=COC |
Ethene, methoxy-, polymer with 2,5-furandione | O=C1C=CC(=O)O1.C=COC |
Ethene__methoxy-__polymer_with_(Z)-2-butenedioic_acid | C(=CC(=O)O)C(=O)O.C=COC |
Ethenyl acetate, polymer with 1-ethenyl-2-pyrrolidinone | C(=C)N1CCCC1=O.C=COC(C)=O |
Ethylene glycol polymer | C(O)CO |
Ethylene glycol-propylene glycol polymer | C1CO1.CC2CO2 |
Ethylene oxide polymer | C(O)CO |
Ethylene oxide-propylene oxide block polymer | C1CO1.CC2CO2 |
Ethylenimine polymer | C1CN1 |
GAMMA_-Benzyl L-glutamate polymer | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
GAMMA_-Benzyl-L-glutamic acid polymer | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
Glutamic acid GAMMA_-benzyl ester polymer | C(OC(=O)CCC(N)C(=O)O)c1ccccc1 |
J 100 (polymer) | C(N)(=O)C=C |
K 25 (polymer) | C(=C)N1CCCC1=O |
K 30 (polymer) | C(=C)N1CCCC1=O |
K 4 (acrylic polymer) | C(N)(=O)C=C |
K 60 (polymer) | C(=C)N1CCCC1=O |
Leucocyanidin, polymer | OC1C(O)C(Oc2cc(O)cc(O)c12)c3ccc(O)c(O)c3 |
Leucocyanidin__polymer | OC1C(O)C(Oc2cc(O)cc(O)c12)c3ccc(O)c(O)c3 |
Maleic acid, polymer with methyl vinyl ether | C(=CC(=O)O)C(=O)O.C=COC |
Maleic acid-methyl vinyl ether polymer | C(=CC(=O)O)C(=O)O.C=COC |
Maleic acid-vinylmethyl ether polymer | C(=CC(=O)O)C(=O)O.C=COC |
Maleic anhydride polymer with methyl vinyl ether | O=C1C=CC(=O)O1.C=COC |
Maleic anhydride, polymer with 1,3-butadiene | O=C1C=CC(=O)O1.C=CC=C |
Maleic anhydride, polymer with methyl vinyl ether | O=C1C=CC(=O)O1.C=COC |
Maleic anhydride, polymer with styrene | O=C1C=CC(=O)O1.C=Cc2ccccc2 |
Maleic anhydride, polymer with vinyl ether | O=C1C=CC(=O)O1.C=COC=C |
Maleic anhydride- vinyl ether polymer | O=C1C=CC(=O)O1.C=COC=C |
Maleic anhydride-methyl vinyl ether polymer | O=C1C=CC(=O)O1.C=COC |
Maleic anhydride-styrene polymer | O=C1C=CC(=O)O1.C=Cc2ccccc2 |
Maleic anhydride-vinyl methyl ether polymer | O=C1C=CC(=O)O1.C=COC |
Maleic_anhydride__polymer_with_methyl_vinyl_ether | O=C1C=CC(=O)O1.C=COC |
Methacrylonitrile polymer | C(C)(=C)C#N |
Methyl vinyl ether polymer | C(=C)OC |
Methyl vinyl ether-maleic acid polymer | C(=CC(=O)O)C(=O)O.C=COC |
Methyl vinyl ether-maleic anhydride polymer | O=C1C=CC(=O)O1.C=COC |
Methyl vinyl oxide-maleic anhydride polymer | O=C1C=CC(=O)O1.C=COC |
Methyloxirane-oxirane polymer | C1CO1.CC2CO2 |
N-Vinyl-2-pyrrolidone polymer | C(=C)N1CCCC1=O |
N-Vinylbutyrolactam polymer | C(=C)N1CCCC1=O |
N-Vinylpyrrolidinone polymer | C(=C)N1CCCC1=O |
N-Vinylpyrrolidone polymer | C(=C)N1CCCC1=O |
N-Vinylpyrrolidone-vinyl acetate polymer | C(=C)N1CCCC1=O.C=COC(C)=O |
Oxirane polymer | C(O)CO |
Oxirane, methyl-, polymer with oxirane | C1CO1.CC2CO2 |
Oxirane, polymer with methyloxirane | C1CO1.CC2CO2 |
Oxirane-methyloxirane polymer | C1CO1.CC2CO2 |
Oxyethylene polymer | C(O)CO |
P 250 (polymer) | C(N)(=O)C=C |
PAM (polymer) | C(N)(=O)C=C |
PAN (polymer) | C(=C)C#N |
Poly(1-vinyl-2-pyrrolidinone) hueper's polymer no.1 | C(=C)N1CCCC1=O |
Poly(1-vinyl-2-pyrrolidinone) hueper's polymer no.2 | C(=C)N1CCCC1=O |
Poly(1-vinyl-2-pyrrolidinone) hueper's polymer no.3 | C(=C)N1CCCC1=O |
Poly(1-vinyl-2-pyrrolidinone) hueper's polymer no.4 | C(=C)N1CCCC1=O |
Poly(1-vinyl-2-pyrrolidinone) hueper's polymer no.5 | C(=C)N1CCCC1=O |
Poly(1-vinyl-2-pyrrolidinone) hueper's polymer no.6 | C(=C)N1CCCC1=O |
Poly(1-vinyl-2-pyrrolidinone) hueper's polymer no.7 | C(=C)N1CCCC1=O |
Poly(oxyethylene)-poly(oxypropylene) polymer | C1CO1.CC2CO2 |
Polyoxyethylene-polyoxypropylene polymer | C1CO1.CC2CO2 |
Propenoic acid polymer | C(=O)(O)C=C |
Propylene oxide-ethylene oxide polymer | C1CO1.CC2CO2 |
Pyruvaldehyde polymer | C(C)(=O)C=O |
Pyruvaldehyde_polymer | C(C)(=O)C=O |
Stannane, diphenyloxo-, polymer | [Sn](=O)(c1ccccc1)c2ccccc2 |
Stannane, oxodiphenyl-, polymer | [Sn](=O)(c1ccccc1)c2ccccc2 |
Styrene polymer with maleic anhydride | O=C1C=CC(=O)O1.C=Cc2ccccc2 |
Styrene-maleic anhydride polymer | O=C1C=CC(=O)O1.C=Cc2ccccc2 |
Succinic acid, methylene-, polymer with acrylic acid | C(=C)(CC(=O)O)C(=O)O.C=CC(=O)O |
Succinic_acid__methylene-__polymer_with_acrylic_acid | C(=C)(CC(=O)O)C(=O)O.C=CC(=O)O |
Tetraethylenepentamine, polymer with 1-chloro-2,3-epoxypropane | C(Cl)C1CO1.NCCNCCNCCNCCN |
Tetraethylenepentamine-epichlorohydrin polymer | C(Cl)C1CO1.NCCNCCNCCNCCN |
Vinyl acetate-1-vinyl-2-pyrrolidinone polymer | C(=C)N1CCCC1=O.C=COC(C)=O |
Vinyl acetate-N-vinylpyrrolidinone polymer | C(=C)N1CCCC1=O.C=COC(C)=O |
Vinyl acetate-N-vinylpyrrolidone polymer | C(=C)N1CCCC1=O.C=COC(C)=O |
Vinyl acetate-vinylpyrrolidinone polymer | C(=C)N1CCCC1=O.C=COC(C)=O |
Vinyl acetate-vinylpyrrolidone polymer | C(=C)N1CCCC1=O.C=COC(C)=O |
Vinyl alcohol polymer | C(=C)O |
Vinyl ether- maleic anhydride polymer | O=C1C=CC(=O)O1.C=COC=C |
Vinyl hydrogen phthalate polymer | C(=O)(OC=C)c1ccccc1C(=O)O |
Vinyl methyl ether polymer | C(=C)OC |
Vinyl methyl ether-maleic anhydride polymer | O=C1C=CC(=O)O1.C=COC |
Vinylmethyl ether-maleic acid polymer | C(=CC(=O)O)C(=O)O.C=COC |
Vinylpyrrolidinone polymer | C(=C)N1CCCC1=O |
Vinylpyrrolidinone-vinyl acetate polymer | C(=C)N1CCCC1=O.C=COC(C)=O |
Vinylpyrrolidone polymer | C(=C)N1CCCC1=O |
Vinylpyrrolidone-vinyl acetate polymer | C(=C)N1CCCC1=O.C=COC(C)=O |
p-Aminostyrene polymer | C(=C)c1ccc(N)cc1 |
p-Diazodiphenylamine sulfate-paraformaldehyde polymer | S(=O)(=O)(O)O.C=O.N#Nc1ccc(cc1)Nc2ccccc2 |
p-Hydroxystyrene polymer | C(=C)c1ccc(O)cc1 |
p-Vinylphenol polymer | C(=C)c1ccc(O)cc1 |