If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Pentanone, 5,5'-((dibutylstannylene)bis(oxy))bis(5-oxo- | [Sn](CCCC)(CCCC)(OC(=O)CCC(C)=O)OC(=O)CCC(C)=O |
2-Pentanone__5_5'-((dibutylstannylene)bis(oxy))bis(5-oxo- | [Sn](CCCC)(CCCC)(OC(=O)CCC(C)=O)OC(=O)CCC(C)=O |
Cytidine, 2',3'-O-(dibutylstannylene)- | C(O)C1OC(N2C=CC(=N)NC2=O)C3O[Sn](CCCC)(CCCC)OC13 |
Cytidine__2'_3'-O-(dibutylstannylene)- | C(O)C1OC(N2C=CC(=N)NC2=O)C3O[Sn](CCCC)(CCCC)OC13 |
Dibutylstannylene dilaurate | [Sn](CCCC)(CCCC)(OC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC |
Lauric acid, dibutylstannylene deriv. | [Sn](CCCC)(CCCC)(OC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC |
Lauric acid, dibutylstannylene salt | [Sn](CCCC)(CCCC)(OC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC |