If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Nitrobenzo(b)thiophene | [N+](=O)([O-])C1=CSc2ccccc12 |
5-Nitrobenzo-1,2,3-triazole | [N+](=O)([O-])c1ccc2NN=Nc2c1 |
5-Nitrobenzo-1_2_3-triazole | [N+](=O)([O-])c1ccc2NN=Nc2c1 |
7-Chloro-4-nitrobenzo-2-oxa-1,3-diazole | [N+](=O)([O-])C1=CC=C(Cl)C2=NON=C12 |
7-Chloro-4-nitrobenzo-2-oxa-1_3-diazole | [N+](=O)([O-])C1=CC=C(Cl)C2=NON=C12 |
Methyl-6-nitrobenzo-thiazolyl-2-sulfone | S(C)(=O)(=O)C1=Nc2ccc(cc2S1)[N+](=O)[O-] |