If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1,3,4-Eugenol acetate | O(C(C)=O)c1ccc(CC=C)cc1OC |
1,3,4-Eugenol methyl ether | O(C)c1cc(CC=C)ccc1OC |
Benzoyl eugenol | O(C(=O)c1ccccc1)c2ccc(CC=C)cc2OC |
Benzyl eugenol | O(Cc1ccccc1)c2ccc(CC=C)cc2OC |
Cinnamyl eugenol | O(C(=O)C=Cc1ccccc1)c2ccc(CC=C)cc2OC |
EUGENOL | O(C)c1cc(CC=C)ccc1O |
Eugenol acetate | O(C(C)=O)c1ccc(CC=C)cc1OC |
Eugenol benzoate | O(C(=O)c1ccccc1)c2ccc(CC=C)cc2OC |
Eugenol benzyl ether | O(Cc1ccccc1)c2ccc(CC=C)cc2OC |
Eugenol cinnamate | O(C(=O)C=Cc1ccccc1)c2ccc(CC=C)cc2OC |
Eugenol methyl ether | O(C)c1cc(CC=C)ccc1OC |
Eugenol phenylacetate | O(C(=O)Cc1ccccc1)c2ccc(CC=C)cc2OC |
Eugenol propionate | O(C(=O)CC)c1ccc(CC=C)cc1OC |
Eugenol | O(C)c1cc(CC=C)ccc1O |
Methyl eugenol ether | O(C)c1cc(CC=C)ccc1OC |
Synthetic eugenol | O(C)c1cc(CC=C)ccc1O |
o-Eugenol | C(C=C)c1cccc(OC)c1O |
p-Eugenol | O(C)c1cc(CC=C)ccc1O |
p-Eugenol, benzoate | O(C(=O)c1ccccc1)c2ccc(CC=C)cc2OC |