If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Ahcovat Blue BCF | O=C1c2ccccc2C(=O)c3cc(Cl)c4Nc5c(Nc4c13)c(Cl)cc6C(=O)c7ccccc7C(=O)c56 |
Ahcovat Dark Blue BO | O=C1c2ccccc2c3ccc4c5ccc6c7ccccc7C(=O)c8ccc(c9ccc1c3c49)c5c68 |
Ahcovat Golden Orange G | O=C1c2ccccc2C3=Cc4ccc5C(=O)c6ccccc6c7cc8ccc1c3c8c4c57 |
Ahcovat Olive ARN | O=C1c2ccccc2C(=O)c3c(NC(=O)c4ccccc4)cc5c6cc(NC(=O)c7ccccc7)c8C(=O)c9ccccc9C(=O)c8c6Nc5c13 |
Ahcovat Olive R | O=C1c2ccccc2C(=O)c3c(NC(=O)c4ccccc4)cc5c6cc(NC(=O)c7ccccc7)c8C(=O)c9ccccc9C(=O)c8c6Nc5c13 |
Ahcovat Printing Blue 2BD | O=C1c2cc(Br)cc(Br)c2NC1=C3Nc4c(Br)cc(Br)cc4C3=O |
Ahcovat Printing Golden Yellow GK | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Ahcovat Printing Golden Yellow | O=C1c2ccccc2c3ccc4C(=O)c5ccccc5c6ccc1c3c46 |
Ahcovat Printing Orange R | O=C1c2ccc(OCC)cc2SC1=C3Sc4cc(OCC)ccc4C3=O |
Ahcovat Red FBB | Nc1c(ccc2C(=O)c3ccccc3C(=O)c12)C4=Nc5cc6C(=O)c7ccccc7C(=O)c6cc5O4 |
Ahcovat Yellow 4G | N(C(=O)c1ccc(cc1)C(=O)Nc2cccc3C(=O)c4c(cccc4C(=O)c23)NC(=O)c5ccccc5)c6cccc7C(=O)c8c(cccc8C(=O)c67)NC(=O)c9ccccc9 |