If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Methallyl-3-methyl-6-aminotetrahydropyrimidinedione | C(C(C)=C)N1C(N)=CC(=O)N(C)C1=O |
17ALPHA_-(2-Methallyl)-19-nortestosterone | CC12CCC3C4CCC(=O)C=C4CCC3C1CCC2(O)CC(C)=C |
ALPHA_-Methallyl chloride | C(C)(Cl)C=C |
BETA_-Methallyl chloride | C(C)(=C)CCl |
Methallyl alcohol | C(C)(=C)CO |
Methallyl carbamate | C(OC(N)=O)C(C)=C |
Methallyl carbinol | C(CO)C(C)=C |
Methallyl chloride | C(C)(=C)CCl |
Methallyl cyanide | C(C#N)C(C)=C |
Methallyl phenyl ether | O(CC(C)=C)c1ccccc1 |