If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Methylbenzenesulfonyl chloride | S(Cl)(=O)(=O)c1ccccc1C |
4-Methylbenzenesulfonyl chloride | S(Cl)(=O)(=O)c1ccc(C)cc1 |
4-Methylbenzenesulfonyl fluoride | S(F)(=O)(=O)c1ccc(C)cc1 |
N-(4-Methylbenzenesulfonyl)-N'-butylurea | S(=O)(=O)(NC(=O)NCCCC)c1ccc(C)cc1 |
N-(4-Methylbenzenesulfonyl)-N'-cyclohexylurea | S(=O)(=O)(NC(=O)NC1CCCCC1)c2ccc(C)cc2 |
p-Methylbenzenesulfonyl chloride | S(Cl)(=O)(=O)c1ccc(C)cc1 |
p-Methylbenzenesulfonyl fluoride | S(F)(=O)(=O)c1ccc(C)cc1 |