If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
3-Cyanobenzyl bromide | C(Br)c1cccc(C#N)c1 |
4-Cyanobenzyl bromide | C(Br)c1ccc(C#N)cc1 |
ALPHA_-Cyanobenzyl benzoate | C(C#N)(OC(=O)c1ccccc1)c2ccccc2 |
BETA_-D-Glucopyranosiduronic acid, ALPHA_-cyanobenzyl | O(C(C#N)c1ccccc1)C2OC(C(=O)O)C(O)C(O)C2O |
m-Cyanobenzyl bromide | C(Br)c1cccc(C#N)c1 |
o-Cyanobenzyl cyanide | C(C#N)c1ccccc1C#N |
p-Cyanobenzyl bromide | C(Br)c1ccc(C#N)cc1 |