If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
9-(m-Tolyl)hypoxanthine | Oc1ncnc2c1N=CN2c3cccc(C)c3 |
BETA_-D-Ribofuranoside, hypoxanthine-9 | OC1C(O)C(CO)OC1N2C=Nc3c(O)ncnc23 |
BETA_-D-Ribofuranoside__hypoxanthine-9 | OC1C(O)C(CO)OC1N2C=Nc3c(O)ncnc23 |
HYPOXANTHINE | Oc1ncnc2NC=Nc12 |
Hypoxanthine (VAN8CI) | Oc1ncnc2NC=Nc12 |
Hypoxanthine , 2,8-diamino- | Oc1nc(N)nc2NC(=N)Nc12 |
Hypoxanthine D-riboside | OC1C(O)C(CO)OC1N2C=Nc3c(O)ncnc23 |
Hypoxanthine enol | Oc1ncnc2NC=Nc12 |
Hypoxanthine nucleoside | OC1C(O)C(CO)OC1N2C=Nc3c(O)ncnc23 |
Hypoxanthine ribonucleoside | OC1C(O)C(CO)OC1N2C=Nc3c(O)ncnc23 |
Hypoxanthine riboside | OC1C(O)C(CO)OC1N2C=Nc3c(O)ncnc23 |
Hypoxanthine, 1,7-dimethyl- | O=C1N(C)C=NC2=C1N(C)C=N2 |
Hypoxanthine, 1-methyl- | O=C1N(C)C=NC2=C1N=CN2 |
Hypoxanthine, 2-mercapto-7-methyl- | Oc1nc(S)nc2N=CN(C)c12 |
Hypoxanthine, 3-methyl- | O=C1N=CN(C)C2=C1N=CN2 |
Hypoxanthine, 7-methyl- (VAN8CI) | Oc1ncnc2N=CN(C)c12 |
Hypoxanthine, 8-mercapto- | Oc1ncnc2NC(=S)Nc12 |
Hypoxanthine, 9-(m-tolyl)- | Oc1ncnc2c1N=CN2c3cccc(C)c3 |
Hypoxanthine, 9-BETA_-D-arabinofuranosyl- | OC1C(O)C(CO)OC1N2C=Nc3c(O)ncnc23 |
Hypoxanthine, 9-BETA_-D-ribofuranosyl- | OC1C(O)C(CO)OC1N2C=Nc3c(O)ncnc23 |
Hypoxanthine, 9-benzyl- | C(c1ccccc1)N2C=Nc3c(O)ncnc23 |
Hypoxanthine, thio- (VAN) | Sc1ncnc2NC=Nc12 |
Hypoxanthine-nicotinamide dinucleotide (VAN) | OC1C(O)C(COP(=O)(O)OP(=O)(O)OCC2OC(C(O)C2O)n3cccc(c3)C(N)=O)OC1N4C=Nc5c(O)ncnc45 |
Nicotinamide-hypoxanthine dinucleotide (VAN) | OC1C(O)C(COP(=O)(O)OP(=O)(O)OCC2OC(C(O)C2O)n3cccc(c3)C(N)=O)OC1N4C=Nc5c(O)ncnc45 |
Nicotinamide-hypoxanthine dinucleotide, 3-acetyl analog | OC1C(O)C(COP(=O)(O)OP(=O)(O)OCC2OC(C(O)C2O)n3cccc(c3)C(C)=O)OC1N4C=Nc5c(N)ncnc45 |