If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Butylmalonic acid | C(CCCC)(C(=O)O)C(=O)O |
2-n-Butylmalonic acid | C(CCCC)(C(=O)O)C(=O)O |
Butylmalonic acid diethyl ester | C(CCCC)(C(=O)OCC)C(=O)OCC |
Butylmalonic acid | C(CCCC)(C(=O)O)C(=O)O |
n-Butylmalonic acid | C(CCCC)(C(=O)O)C(=O)O |
sec-Butylmalonic acid, diethyl ester | C(C(C)CC)(C(=O)OCC)C(=O)OCC |