If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
Polyoxyethylene (13) octylphenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyoxyethylene (600) monoricinoleate | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Polyoxyethylene (9) octylphenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyoxyethylene 1500 | C(O)CO |
Polyoxyethylene 50 stearate | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyoxyethylene mono(octylphenyl) ether (VAN) | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyoxyethylene octyl phenyl ether | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Polyoxyethylene polyoxypropylene | C1CO1.CC2CO2 |
Polyoxyethylene ricinoleate | C(O)(CCCCCC)CC=CCCCCCCCC(=O)OCCO |
Polyoxyethylene stearate (mol. wt. 600-2000) | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyoxyethylene(4) lauryl ether | O(CCCCCCCCCCCC)CCOCCOCCOCCO |
Polyoxyethylene(8)stearate | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyoxyethylene-8-monostearate | C(CCCCCCCCCCCCCCC)CC(=O)OCCO |
Polyoxyethylene-polyoxypropylene polymer | C1CO1.CC2CO2 |
Polyoxyethylene-polyoxypropylene | C1CO1.CC2CO2 |