If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
1-Phenylbiguanide monohydrochloride | N(C(=N)NC(=N)N)c1ccccc1 |
N'-Phenylbiguanide monohydrochloride | N(C(=N)NC(=N)N)c1ccccc1 |
Phenylbiguanide hydrochloride | N(C(=N)NC(=N)N)c1ccccc1 |
Phenylbiguanide mbt-salt | S=C1Nc2ccccc2S1.N=C(N)NC(=N)Nc3ccccc3 |
Phenylbiguanide monohydrochloride | N(C(=N)NC(=N)N)c1ccccc1 |
Phenylbiguanide-p-sulfonic acid | N(C(=N)NC(=N)N)c1ccc(cc1)S(=O)(=O)O |