If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
(Bromomethyl)ethylene oxide | C(Br)C1CO1 |
(Bromomethyl)ethylene_oxide | C(Br)C1CO1 |
(Chloromethyl)ethylene oxide | C(Cl)C1CO1 |
(Hydroxymethyl)ethylene acetate | C(CO)(COC(C)=O)OC(C)=O |
(Trimethylsilyl)ethylene | [Si](C)(C)(C)C=C |
1, 1'-Bi(ethylene oxide) | C1(CO1)C2CO2 |
1, 1'-Ethylene-2,2'-bipyridinium dibromide | c12ccccn2CCn3c1cccc3 |
1, 1-Bis(4-chlorophenyl)ethylene | C(=C)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
1, 1-Bis(p-(dimethylamino)phenyl)ethylene | C(=C)(c1ccc(cc1)N(C)C)c2ccc(cc2)N(C)C |
1, 1-Dichloro-2,2-di-(p-tolyl)-ethylene | C(=C(Cl)Cl)(c1ccc(C)cc1)c2ccc(C)cc2 |
1, 1-Dichloro-2-(o-chlorophenyl)-2-(p-chlorophenyl)ethylene | C(=C(Cl)Cl)(c1ccc(Cl)cc1)c2ccccc2Cl |
1, 2-Bis(2-benzimidazolyl)ethylene | C(=CC1=Nc2ccccc2N1)C3=Nc4ccccc4N3 |
1, 2-Bis(2-naphthyl)ethylene | C(=Cc1ccc2ccccc2c1)c3ccc4ccccc4c3 |
1, 2-Bis(4-pyridyl)ethylene | C(=Cc1ccncc1)c2ccncc2 |
1, 2-Bis(biphenylene)ethylene | C1(c2ccccc2c3c1cccc3)=C4c5ccccc5c6ccccc46 |
1, 3-Ethylene-2-(3-trimethylamino)-propylisothiouronium dibromide | S(CCCN(C)(C)C)C1=NCCN1 |
1,1'-Ethylene 2,2'-dipyridylium dibromide | c12ccccn2CCn3c1cccc3 |
1,1'-Ethylene-2, 2'-bipyridylium dibromide | c12ccccn2CCn3c1cccc3 |
1,1'-Ethylene-2,2'-dipyridylium dibromide | c12ccccn2CCn3c1cccc3 |
1,1'-Undecanedicarboxylic acid, ester with ethylene glycol | O=C1CCCCCCCCCCCC(=O)OCCO1 |
1,1-Bis(4-dimethylaminophenyl)ethylene | C(=C)(c1ccc(cc1)N(C)C)c2ccc(cc2)N(C)C |
1,1-Bis(methylthio)ethylene | C(C)(SC)SC |
1,1-Bis(p-chlorophenyl)ethylene | C(=C)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
1,1-Dichloro-2, 2-bis(p-chlorophenyl)ethylene | C(=C(Cl)Cl)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
1,1-Dichloro-2, 2-bis(p-methoxyphenyl)ethylene | C(=C(Cl)Cl)(c1ccc(OC)cc1)c2ccc(OC)cc2 |
1,1-Dichloro-2, 2-di(p-chlorophenyl)ethylene | C(=C(Cl)Cl)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
1,2-Bis(ethylsulfonyl)ethylene | S(=O)(=O)(CC)C=CS(=O)(=O)CC |
1,2-Ethylene glycol monosalicylate | C(=O)(OCCO)c1ccccc1O |
1,2-Ethylene sulfite | O=S1OCCO1 |
1-(2-Pyridyl)-2(3-pyridly)ethylene | C(=Cc1ccccn1)c2cccnc2 |
1-(2-Pyridyl)-2-(4-pyridyl)ethylene | C(=Cc1ccccn1)c2ccncc2 |
1-(4-Bromophenyl)ethylene | C(=C)c1ccc(Br)cc1 |
1-Aziridinepropionic acid, ethylene ester | C(CC(=O)OCCOC(=O)CCN1CC1)N2CC2 |
1-Aziridinepropionic_acid__ethylene_ester | C(CC(=O)OCCOC(=O)CCN1CC1)N2CC2 |
1-Chloro-2, 2-bis(p-chlorophenyl)ethylene | C(=CCl)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
1-Nitro-2-(m-nitrophenyl)ethylene | C(=C[N+](=O)[O-])c1cccc(c1)[N+](=O)[O-] |
1-Nitro-2-(p-nitrophenyl)ethylene | [N+](=O)([O-])c1ccc(cc1)C=C[N+](=O)[O-] |
1-Phenyl-1, 2-ethylene carbonate | O=C1OCC(O1)c2ccccc2 |
1_1'-Undecanedicarboxylic_acid__ester_with_ethylene_glycol | O=C1CCCCCCCCCCCC(=O)OCCO1 |
2,2'-Ethylene-bis(2-thiopseudourea), dihydrobromide | C(CSC(=N)N)SC(=N)N |
2-(Chloromethyl)ethylene sulfide | C(Cl)C1CS1 |
2-(Chloromethyl)ethylene_sulfide | C(Cl)C1CS1 |
2-Butanone, cyclic ethylene acetal | C(C)C1(C)OCCO1 |
2-Furaldehyde, cyclic (hydroxymethyl)ethylene acetal | C(O)C1COC(O1)C2=CC=CO2 |
2-Furaldehyde__cyclic_(hydroxymethyl)ethylene_acetal | C(O)C1COC(O1)C2=CC=CO2 |
2-Heptanone, cyclic (hydroxymethyl)ethylene acetal | C(CCCC)C1(C)OCC(CO)O1 |
2-Heptanone__cyclic_(hydroxymethyl)ethylene_acetal | C(CCCC)C1(C)OCC(CO)O1 |
2-Octanone, cyclic (hydroxymethyl)ethylene acetal | C(CCCCC)C1(C)OCC(CO)O1 |
2-Octanone__cyclic_(hydroxymethyl)ethylene_acetal | C(CCCCC)C1(C)OCC(CO)O1 |
2-Pentanone, 4-methyl-, cyclic (hydroxymethyl)ethylene acetal | C(C(C)C)C1(C)OCC(CO)O1 |
2-Pentanone__4-methyl-__cyclic_(hydroxymethyl)ethylene_acetal | C(C(C)C)C1(C)OCC(CO)O1 |
3-Butene-2-one ethylene acetal | C(=C)C1(C)OCCO1 |
3-Phenylpropionaldehyde, ethylene acetal | C(CC1OCCO1)c2ccccc2 |
5-Nitronaphthalene ethylene | [N+](=O)([O-])c1ccc2CCc3cccc1c23 |
ALPHA_, .omega.-Hydroxypoly(ethylene oxide) | C(O)CO |
Acetate de l'ether monoethylique de l'ethylene-glycol(FRENCH) | C(COCC)OC(C)=O |
Acetate_de_l'ether_monoethylique_de_l'ethylene-glycol(FRENCH) | C(COCC)OC(C)=O |
Acetic acid, bromo-, diester with ethylene glycol | O(CCOC(=O)CBr)C(=O)CBr |
Acetic acid, bromo-, ethylene ester | O(CCOC(=O)CBr)C(=O)CBr |
Acetic acid, iodo-, diester with ethylene glycol | O(CCOC(=O)CI)C(=O)CI |
Acetic acid, iodo-, ethylene ester | O(CCOC(=O)CI)C(=O)CI |
Acetic acid, mercapto-, ethylene ester | O(CCOC(=O)CS)C(=O)CS |
Acetic acid, trichloro-, ethylene ester (2:1) | C(=O)(OCCOC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Acetic acid, trichloro-, ethylene ester | C(=O)(OCCOC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Acetic_acid__bromo-__diester_with_ethylene_glycol | O(CCOC(=O)CBr)C(=O)CBr |
Acetic_acid__iodo-__diester_with_ethylene_glycol | O(CCOC(=O)CI)C(=O)CI |
Acetophenone ethylene ketal | CC1(OCCO1)c2ccccc2 |
Acrylic acid, diester with ethylene glycol | O(CCOC(=O)C=C)C(=O)C=C |
Acrylic acid, ethylene ester | O(CCOC(=O)C=C)C(=O)C=C |
Acrylic acid, ethylene glycol diester | O(CCOC(=O)C=C)C(=O)C=C |
Acrylic_acid__diester_with_ethylene_glycol | O(CCOC(=O)C=C)C(=O)C=C |
Adipic acid, bis(ethylene glycol monobutyl ether) ester | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Adipic_acid__bis(ethylene_glycol_monobutyl_ether)_ester | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Benzaldehyde ethylene acetal | C1(OCCO1)c2ccccc2 |
Benzaldehyde ethylene dithioacetal | C1(SCCS1)c2ccccc2 |
Benzaldehyde, cyclic (hydroxymethyl)ethylene acetal | C(O)C1COC(O1)c2ccccc2 |
Benzaldehyde__cyclic_(hydroxymethyl)ethylene_acetal | C(O)C1COC(O1)c2ccccc2 |
Benzaldehyde_ethylene_acetal | C1(OCCO1)c2ccccc2 |
Benzaldehyde_ethylene_dithioacetal | C1(SCCS1)c2ccccc2 |
Bis(ethylene glycol monobutyl ether) adipate | C(=O)(OCCOCCCC)CCCCC(=O)OCCOCCCC |
Bis(p-dimethylaminophenyl)-1,1 ethylene | C(=C)(c1ccc(cc1)N(C)C)c2ccc(cc2)N(C)C |
Bromoacetic acid, ethylene ester | O(CCOC(=O)CBr)C(=O)CBr |
Carbamic acid, N, N-ethylene-, ethyl ester | C(=O)(OCC)N1CC1 |
Carbamic_acid__N__N-ethylene-__ethyl_ester | C(=O)(OCC)N1CC1 |
Carbonic acid, cyclic ethylene ester | O=C1OCCO1 |
Carbonic acid, trithio-, cyclic ethylene ester | S=C1SCCS1 |
Carbonic_acid__cyclic_ethylene_ester | O=C1OCCO1 |
Carbonic_acid__trithio-__cyclic_ethylene_ester | S=C1SCCS1 |
Cetyl ethylene | C(CCCCCCCCC)CCCCCCCCC=C |
Chloroacetaldehyde ethylene acetal | C(Cl)C1OCCO1 |
Chloroacetaldehyde_ethylene_acetal | C(Cl)C1OCCO1 |
Chlorotris(p-methoxyphenyl)ethylene | C(=C(Cl)c1ccc(OC)cc1)(c2ccc(OC)cc2)c3ccc(OC)cc3 |
Cinnamaldehyde ethylene glycol acetal | C(=CC1OCCO1)c2ccccc2 |
Cinnamaldehyde, cyclic ethylene acetal | C(=CC1OCCO1)c2ccccc2 |
Cinnamaldehyde__cyclic_ethylene_acetal | C(=CC1OCCO1)c2ccccc2 |
Copper N,N'-ethylene bis(salicylideneiminate) | [Cu]123Oc4ccccc4C=N2CCN1=Cc5ccccc5O3 |
Cyclic ethylene carbonate | O=C1OCCO1 |
Cyclic ethylene methyl phosphite | O(C)P1OCCO1 |
Cyclic ethylene phenyl phosphonotrithioate | S=P1(SCCS1)c2ccccc2 |
Cyclic ethylene sulfite | O=S1OCCO1 |
Cyclic ethylene trithiocarbonate | S=C1SCCS1 |
Cyclohexanone ethylene acetal | C123OCCO1.C2CCCC3 |
Cyclohexanone ethylene ketal | C123OCCO1.C2CCCC3 |
Cylic ethylene trithiocarbonate | S=C1SCCS1 |
D-Glucose ethylene dithioacetal | C(O)(C1SCCS1)C(O)C(O)C(O)CO |
D-Glucose, cyclic ethylene mercaptal | C(O)(C1SCCS1)C(O)C(O)C(O)CO |
DAUNOMYCINONE-13-ETHYLENE KETAL | Oc1c2CC(O)(CC(O)c2c(O)c3C(=O)c4c(OC)cccc4C(=O)c13)C5(C)OCCO5 |
DMC ethylene | C(=C)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
Daunomycinone-13-ethylene ketal | Oc1c2CC(O)(CC(O)c2c(O)c3C(=O)c4c(OC)cccc4C(=O)c13)C5(C)OCCO5 |
Daunomycinone-13-ethylene_ketal | Oc1c2CC(O)(CC(O)c2c(O)c3C(=O)c4c(OC)cccc4C(=O)c13)C5(C)OCCO5 |
Di(ethylene glycol monobutyl ether) phthalate | C(=O)(OCCOCCOCCCC)c1ccccc1C(=O)OCCOCCOCCCC |
Di(ethylene oxide) | C1COCCO1 |
Dibenzoyl ethylene glycol | C(=O)(OCCOC(=O)c1ccccc1)c2ccccc2 |
Disodium ethylene bisdithiocarbamate (ACN) | C(CNC(=S)S)NC(=S)S |
Disodium ethylene-1, 2-bis(dithiocarbamate) | C(CNC(=S)S)NC(=S)S |
Disodium ethylene-1,2-bis(dithiocarbamate) | C(CNC(=S)S)NC(=S)S |
Ether monoethylique de l'ethylene-glycol(FRENCH) | C(CO)OCC |
Ether monomethylique de l'ethylene-glycol(FRENCH) | C(CO)OC |
Ether_monoethylique_de_l'ethylene-glycol(FRENCH) | C(CO)OCC |
Ether_monomethylique_de_l'ethylene-glycol(FRENCH) | C(CO)OC |
Ethyl acetoacetate 3-ethylene acetal | C(C(=O)OCC)C1(C)OCCO1 |
Ethyl acetoacetate ethylene ketal | C(C(=O)OCC)C1(C)OCCO1 |
Ethylene acetate | C(COC(C)=O)OC(C)=O |
Ethylene acrylate | O(CCOC(=O)C=C)C(=O)C=C |
Ethylene alcohol | C(O)CO |
Ethylene aldehyde | C(=C)C=O |
Ethylene bis(bromoacetate) | O(CCOC(=O)CBr)C(=O)CBr |
Ethylene bis(butylxanthate) | C(=S)(OCCCC)SCCSC(=S)OCCCC |
Ethylene bis(iodoacetate) | O(CCOC(=O)CI)C(=O)CI |
Ethylene bis(mercaptoacetate) | O(CCOC(=O)CS)C(=O)CS |
Ethylene bis(methanesulfonate) | O(CCOS(C)(=O)=O)S(C)(=O)=O |
Ethylene bis(oleamide) | N(CCNC(=O)CCCCCCCC=CCCCCCCCC)C(=O)CCCCCCCC=CCCCCCCCC |
Ethylene brassylate | O=C1CCCCCCCCCCCC(=O)OCCO1 |
Ethylene bromoacetate | O(CCOC(=O)CBr)C(=O)CBr |
Ethylene bromohydrin | C(Br)CO |
Ethylene carbonate | O=C1OCCO1 |
Ethylene carbonic acid | O=C1OCCO1 |
Ethylene chlorhydrin | C(Cl)CO |
Ethylene chlorobromide | C(Br)CCl |
Ethylene chlorohydrin | C(Cl)CO |
Ethylene cyanide | C(C#N)CC#N |
Ethylene cyanohydrin | C(C#N)CO |
Ethylene diacetate | C(COC(C)=O)OC(C)=O |
Ethylene diacrylate | O(CCOC(=O)C=C)C(=O)C=C |
Ethylene dibenzoate | C(=O)(OCCOC(=O)c1ccccc1)c2ccccc2 |
Ethylene dicyanide | C(C#N)CC#N |
Ethylene diglycidyl ether | C(OCCOCC1CO1)C2CO2 |
Ethylene diglycol monoethyl ether | C(COCC)OCCO |
Ethylene diglycol monomethyl ether | C(COC)OCCO |
Ethylene diglycol | O(CCO)CCO |
Ethylene dihydrate | C(O)CO |
Ethylene dilaurate | C(=O)(CCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCC |
Ethylene dimethacrylate | C(=O)(OCCOC(=O)C(C)=C)C(C)=C |
Ethylene dimethanesulfonate | O(CCOS(C)(=O)=O)S(C)(=O)=O |
Ethylene dimethyl ether | C(OC)COC |
Ethylene dioleamide | N(CCNC(=O)CCCCCCCC=CCCCCCCCC)C(=O)CCCCCCCC=CCCCCCCCC |
Ethylene dipalmitate | C(=O)(CCCCCCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCCCCCC |
Ethylene dipropionate | O(CCOC(=O)CC)C(=O)CC |
Ethylene dipyridylium dibromide | c12ccccn2CCn3c1cccc3 |
Ethylene distearate | O(CCOC(=O)CCCCCCCCCCCCCCCCC)C(=O)CCCCCCCCCCCCCCCCC |
Ethylene dithioglycol | C(S)CS |
Ethylene episulfide | C1CS1 |
Ethylene fluorohydrin | C(F)CO |
Ethylene formate | C(OC=O)COC=O |
Ethylene glycol acetal of heptaldehyde | C(CCCCC)C1OCCO1 |
Ethylene glycol acetate | C(COC(C)=O)OC(C)=O |
Ethylene glycol bis(2,3-epoxy-2-methylpropyl) ether | C(OCCOCC1(C)CO1)C2(C)CO2 |
Ethylene glycol bis(2,3-epoxypropyl) ether | C(OCCOCC1CO1)C2CO2 |
Ethylene glycol bis(2-cyanoethyl) ether | C(OCCC#N)COCCC#N |
Ethylene glycol bis(chloromethyl) ether | C(OCCl)COCCl |
Ethylene glycol bis(cyanoethyl) ether | C(OCCC#N)COCCC#N |
Ethylene glycol bis(glycidyl ether) | C(OCCOCC1CO1)C2CO2 |
Ethylene glycol bis(mercaptoacetate) | O(CCOC(=O)CS)C(=O)CS |
Ethylene glycol bis(methacrylate) | C(=O)(OCCOC(=O)C(C)=C)C(C)=C |
Ethylene glycol bis(thioglycolate) | O(CCOC(=O)CS)C(=O)CS |
Ethylene glycol bis(thioglycolic ester) | O(CCOC(=O)CS)C(=O)CS |
Ethylene glycol bis(trichloroacetate) | C(=O)(OCCOC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Ethylene glycol butyl ether | C(CCC)OCCO |
Ethylene glycol carbonate | O=C1OCCO1 |
Ethylene glycol cyclic sulfite | O=S1OCCO1 |
Ethylene glycol di(2, 3-epoxy-2-methylpropyl) ether | C(OCCOCC1(C)CO1)C2(C)CO2 |
Ethylene glycol di-BETA_-cyanoethyl ether | C(OCCC#N)COCCC#N |
Ethylene glycol diacetate | C(COC(C)=O)OC(C)=O |
Ethylene glycol diacrylate | O(CCOC(=O)C=C)C(=O)C=C |
Ethylene glycol dibenzoate | C(=O)(OCCOC(=O)c1ccccc1)c2ccccc2 |
Ethylene glycol didodecanoate | C(=O)(CCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCC |
Ethylene glycol diglycidyl ether | C(OCCOCC1CO1)C2CO2 |
Ethylene glycol dihexadecanoate | C(=O)(CCCCCCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCCCCCC |
Ethylene glycol dihydroxydiethyl ether | C(OCCO)COCCO |
Ethylene glycol dilaurate | C(=O)(CCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCC |
Ethylene glycol dimethacrylate | C(=O)(OCCOC(=O)C(C)=C)C(C)=C |
Ethylene glycol dimethanesulfonate | O(CCOS(C)(=O)=O)S(C)(=O)=O |
Ethylene glycol dimethyl ether | C(OC)COC |
Ethylene glycol dioctadecanoate | O(CCOC(=O)CCCCCCCCCCCCCCCCC)C(=O)CCCCCCCCCCCCCCCCC |
Ethylene glycol dipalmitate | C(=O)(CCCCCCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCCCCCC |
Ethylene glycol diphenyl ether | O(CCOc1ccccc1)c2ccccc2 |
Ethylene glycol dipropionate | O(CCOC(=O)CC)C(=O)CC |
Ethylene glycol distearate | O(CCOC(=O)CCCCCCCCCCCCCCCCC)C(=O)CCCCCCCCCCCCCCCCC |
Ethylene glycol divinyl ether | C(OC=C)COC=C |
Ethylene glycol ether of pinene | CC1(C)C2CC(O)C(C)(O)C1C2 |
Ethylene glycol ethyl ether acetate | C(COCC)OC(C)=O |
Ethylene glycol ethyl ether | C(CO)OCC |
Ethylene glycol homopolymer | C(O)CO |
Ethylene glycol isopropyl ether | O(CCO)C(C)C |
Ethylene glycol m-cresyl ether | O(CCO)c1cccc(C)c1 |
Ethylene glycol methacrylate | C(=O)(OCCO)C(C)=C |
Ethylene glycol methyl ether | C(CO)OC |
Ethylene glycol mono-2-naphthyl ether | O(CCO)c1ccc2ccccc2c1 |
Ethylene glycol mono-p-tolyl ether | O(CCO)c1ccc(C)cc1 |
Ethylene glycol monoallyl ether | O(CC=C)CCO |
Ethylene glycol monobenzoate | C(=O)(OCCO)c1ccccc1 |
Ethylene glycol monobenzyl ether | C(OCCO)c1ccccc1 |
Ethylene glycol monobutyl ether laurate | C(CCCCCCCCCC)C(=O)OCCOCCCC |
Ethylene glycol monobutyl ether | C(CCC)OCCO |
Ethylene glycol monoethyl ether acetate | C(COCC)OC(C)=O |
Ethylene glycol monoethyl ether acrylate | C(=O)(C=C)OCCOCC |
Ethylene glycol monoethyl ether propenoate | C(=O)(C=C)OCCOCC |
Ethylene glycol monoethyl ether | C(CO)OCC |
Ethylene glycol monoisopropyl ether | O(CCO)C(C)C |
Ethylene glycol monomethacrylate | C(=O)(OCCO)C(C)=C |
Ethylene glycol monomethyl ether acetylricinoleate | C(CCCCCC)(CC=CCCCCCCCC(=O)OCCOC)OC(C)=O |
Ethylene glycol monomethyl ether acrylate | C(=O)(C=C)OCCOC |
Ethylene glycol monomethyl ether formal | C(OCCOC)OCCOC |
Ethylene glycol monomethyl ether oleate | C(CCCCCC=CCCCCCCCC)CC(=O)OCCOC |
Ethylene glycol monomethyl ether | C(CO)OC |
Ethylene glycol monomyristate | C(CCCCCCCCCCCC)C(=O)OCCO |
Ethylene glycol monopalmitate | C(CCCCCCCCCCCCC)CC(=O)OCCO |
Ethylene glycol monophenyl ether | O(CCO)c1ccccc1 |
Ethylene glycol monosalicylate | C(=O)(OCCO)c1ccccc1O |
Ethylene glycol n-butyl ether | C(CCC)OCCO |
Ethylene glycol phenyl ether acetate | O(CCOC(C)=O)c1ccccc1 |
Ethylene glycol phenyl ether | O(CCO)c1ccccc1 |
Ethylene glycol polymer | C(O)CO |
Ethylene glycol salicylate | C(=O)(OCCO)c1ccccc1O |
Ethylene glycol | C(O)CO |
Ethylene glycol, acetate | O(CCO)C(C)=O |
Ethylene glycol, bis(bromoacetate) | O(CCOC(=O)CBr)C(=O)CBr |
Ethylene glycol, bis(iodoacetate) | O(CCOC(=O)CI)C(=O)CI |
Ethylene glycol, chlorohydrin | C(Cl)CO |
Ethylene glycol, cyclic carbonate | O=C1OCCO1 |
Ethylene glycol, cyclic phenyl phosphite | O(c1ccccc1)P2OCCO2 |
Ethylene glycol, cyclic phosphite, phenyl ester | O(c1ccccc1)P2OCCO2 |
Ethylene glycol, cyclic sulfite | O=S1OCCO1 |
Ethylene glycol, diacetate | C(COC(C)=O)OC(C)=O |
Ethylene glycol, dibenzenesulfonate | S(=O)(=O)(OCCOS(=O)(=O)c1ccccc1)c2ccccc2 |
Ethylene glycol, dibenzoate | C(=O)(OCCOC(=O)c1ccccc1)c2ccccc2 |
Ethylene glycol, diformate | C(OC=O)COC=O |
Ethylene glycol, dimethanesulfonate | O(CCOS(C)(=O)=O)S(C)(=O)=O |
Ethylene glycol, dipropionate | O(CCOC(=O)CC)C(=O)CC |
Ethylene glycol, dithio- | C(S)CS |
Ethylene glycol, mono(benzylcarbamate) | C(NC(=O)OCCO)c1ccccc1 |
Ethylene glycol, monoacetate | O(CCO)C(C)=O |
Ethylene glycol, monobenzoate | C(=O)(OCCO)c1ccccc1 |
Ethylene glycol, monocarbamate | O(CCO)C(N)=O |
Ethylene glycol, monoformate | C(CO)OC=O |
Ethylene glycol, monomethanesulfonate | O(CCO)S(C)(=O)=O |
Ethylene glycol, monosalicylate | C(=O)(OCCO)c1ccccc1O |
Ethylene glycol, monothio- | C(O)CS |
Ethylene glycol, salicylate | C(=O)(OCCO)c1ccccc1O |
Ethylene glycol-propylene glycol polymer | C1CO1.CC2CO2 |
Ethylene glycolide, (2, 3-epoxy-2-methylpropyl) ether | C(OCCOCC1(C)CO1)C2(C)CO2 |
Ethylene hexachloride | C(Cl)(Cl)(Cl)C(Cl)(Cl)Cl |
Ethylene iodohydrin | C(I)CO |
Ethylene isocyanide, bis(p-hydroxybenzylidene)- | C(N#C)(=Cc1ccc(O)cc1)C(N#C)=Cc2ccc(O)cc2 |
Ethylene laurate | C(=O)(CCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCC |
Ethylene mercaptoacetate | O(CCOC(=O)CS)C(=O)CS |
Ethylene methacrylate | C(=O)(OCCOC(=O)C(C)=C)C(C)=C |
Ethylene methanesulfonate | O(CCOS(C)(=O)=O)S(C)(=O)=O |
Ethylene methyl phosphite, (C2H4O2)(MeO)P | O(C)P1OCCO1 |
Ethylene monothiocarbonate | O=C1OCCS1 |
Ethylene o-phenylene dioxide | c12ccccc1OCCO2 |
Ethylene oxide cyclic hexamer | C1COCCOCCOCCOCCOCCO1 |
Ethylene oxide polymer | C(O)CO |
Ethylene oxide, ethyl- | C(C)C1CO1 |
Ethylene oxide, homopolymer | C(O)CO |
Ethylene oxide-propylene oxide block polymer | C1CO1.CC2CO2 |
Ethylene oxide-propylene oxide copolymer | C1CO1.CC2CO2 |
Ethylene palmitate | C(=O)(CCCCCCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCCCCCC |
Ethylene periodide | C(I)(I)=C(I)I |
Ethylene phenyl phosphite, (C2H4O2)(PhO)P | O(c1ccccc1)P2OCCO2 |
Ethylene phosphite | OP1OCCO1 |
Ethylene piperidinophosphonite | P1(OCCO1)N2CCCCC2 |
Ethylene polyoxide | C(O)CO |
Ethylene propionate | O(CCOC(=O)CC)C(=O)CC |
Ethylene stearate | O(CCOC(=O)CCCCCCCCCCCCCCCCC)C(=O)CCCCCCCCCCCCCCCCC |
Ethylene sulfide | C1CS1 |
Ethylene sulfite | O=S1OCCO1 |
Ethylene tetrachloride | C(Cl)(Cl)=C(Cl)Cl |
Ethylene tetraiodide | C(I)(I)=C(I)I |
Ethylene trichloroacetate | C(=O)(OCCOC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Ethylene trithiocarbonate | S=C1SCCS1 |
Ethylene undecane dicarboxylate | O=C1CCCCCCCCCCCC(=O)OCCO1 |
Ethylene, 1, 1-dichloro-2,2-bis(p-methoxyphenyl)- | C(=C(Cl)Cl)(c1ccc(OC)cc1)c2ccc(OC)cc2 |
Ethylene, 1, 1-dichloro-2-(o-chlorophenyl)-2-(p-chlorophenyl)- | C(=C(Cl)Cl)(c1ccc(Cl)cc1)c2ccccc2Cl |
Ethylene, 1, 2-bis(ethylsulfonyl)- | S(=O)(=O)(CC)C=CS(=O)(=O)CC |
Ethylene, 1, 2-bis(methoxycarbonyl)-, trans- | C(=O)(OC)C=CC(=O)OC |
Ethylene, 1,1-bis(p-chlorophenyl)- | C(=C)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
Ethylene, 1,1-bis(p-chlorophenyl)-2-chloro- | C(=CCl)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
Ethylene, 1,1-bis(trimethylsilyl)- | C(=C)([Si](C)(C)C)[Si](C)(C)C |
Ethylene, 1,1-dichloro-2, 2-bis(p-chlorophenyl)- | C(=C(Cl)Cl)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
Ethylene, 1,1-dichloro-2,2-di-p-tolyl- | C(=C(Cl)Cl)(c1ccc(C)cc1)c2ccc(C)cc2 |
Ethylene, 1,1-diphenyl- | C(=C)(c1ccccc1)c2ccccc2 |
Ethylene, 1,2-bis(2-naphthyl)- | C(=Cc1ccc2ccccc2c1)c3ccc4ccccc4c3 |
Ethylene, 1,2-bis(propylsulfonyl)-, (E)- | S(=O)(=O)(CCC)C=CS(=O)(=O)CCC |
Ethylene, 1,2-di-2-naphthyl- | C(=Cc1ccc2ccccc2c1)c3ccc4ccccc4c3 |
Ethylene, 1,2-di-BETA_-naphthyl- | C(=Cc1ccc2ccccc2c1)c3ccc4ccccc4c3 |
Ethylene, 1,2-dibenzoyl- | C(=O)(C=CC(=O)c1ccccc1)c2ccccc2 |
Ethylene, 1,2-dibromo- | C(Br)=CBr |
Ethylene, 1,2-dichloro-, (E)- | C(Cl)=CCl |
Ethylene, 1,2-dichloro-, (Z)- | C(Cl)=CCl |
Ethylene, 1,2-dichloro-1,2-bis(p-tolylsulfonyl)-, (Z)- | S(=O)(=O)(c1ccc(C)cc1)C(Cl)=C(Cl)S(=O)(=O)c2ccc(C)cc2 |
Ethylene, 1-(2-furyl)-2-nitro- | C(=C[N+](=O)[O-])C1=CC=CO1 |
Ethylene, 2-chloro-1,1-bis(p-chlorophenyl)- | C(=CCl)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |
Ethylene, 2-chloro-1-(o-chlorophenyl)-1-(p-chlorophenyl)-, (E)- | C(=CCl)(c1ccc(Cl)cc1)c2ccccc2Cl |
Ethylene, 2-chloro-1-(o-chlorophenyl)-1-(p-chlorophenyl)-, (Z)- | C(=CCl)(c1ccc(Cl)cc1)c2ccccc2Cl |
Ethylene, 2-chloro-1-(o-chlorophenyl)-1-(p-chlorophenyl)-, cis- | C(=CCl)(c1ccc(Cl)cc1)c2ccccc2Cl |
Ethylene, 2-chloro-1-(o-chlorophenyl)-1-(p-chlorophenyl)-, trans- | C(=CCl)(c1ccc(Cl)cc1)c2ccccc2Cl |
Ethylene, benzoyl- | C(=O)(C=C)c1ccccc1 |
Ethylene, bromotriphenyl- | C(=C(Br)c1ccccc1)(c2ccccc2)c3ccccc3 |
Ethylene, chlorotriphenyl- | C(=C(Cl)c1ccccc1)(c2ccccc2)c3ccccc3 |
Ethylene, chlorotris(p-methoxyphenyl)- | C(=C(Cl)c1ccc(OC)cc1)(c2ccc(OC)cc2)c3ccc(OC)cc3 |
Ethylene, phenyl- | C(=C)c1ccccc1 |
Ethylene, tetrabromo- | C(Br)(Br)=C(Br)Br |
Ethylene, tetrachloro- | C(Cl)(Cl)=C(Cl)Cl |
Ethylene, tetraiodo- | C(I)(I)=C(I)I |
Ethylene, tetrakis(p-methoxyphenyl)- | C(c1ccc(OC)cc1)(c2ccc(OC)cc2)=C(c3ccc(OC)cc3)c4ccc(OC)cc4 |
Ethylene, tetraphenyl- | C(c1ccccc1)(c2ccccc2)=C(c3ccccc3)c4ccccc4 |
Ethylene, tribromo- (VAN8CI) | C(Br)(Br)=CBr |
Ethylene, trimethyl- | C(C)(C)=CC |
Ethylene, triphenyl- | C(=Cc1ccccc1)(c2ccccc2)c3ccccc3 |
Ethylene-1,2-bis((thiocarbamoyldimethyl)thiocarbamoyldisulfide) | C(=S)(NCCNC(=S)SSC(=S)N(C)C)SSC(=S)N(C)C |
Ethylene-1,2-bis(thiocarbamoyldimethylthiocarbamoyldisulfide) | C(=S)(NCCNC(=S)SSC(=S)N(C)C)SSC(=S)N(C)C |
Ethylene-bis-phenyl isothuronium dihydrobromide | N(C(=N)SCCSC(=N)Nc1ccccc1)c2ccccc2 |
Ethylene__1_2-dibromo- | C(Br)=CBr |
Ethylene__1_2-dichloro-1_2-bis(p-tolylsulfonyl)-__(Z)- | S(=O)(=O)(c1ccc(C)cc1)C(Cl)=C(Cl)S(=O)(=O)c2ccc(C)cc2 |
Ethylene__1_2-dichloro-__(E)- | C(Cl)=CCl |
Ethylene__1_2-dichloro-__(Z)- | C(Cl)=CCl |
Ethylene__1__2-bis(ethylsulfonyl)- | S(=O)(=O)(CC)C=CS(=O)(=O)CC |
Ethylene__2-chloro-1-(o-chlorophenyl)-1-(p-chlorophenyl)-__(Z)- | C(=CCl)(c1ccc(Cl)cc1)c2ccccc2Cl |
Ethylene__2-chloro-1-(o-chlorophenyl)-1-(p-chlorophenyl)-__trans- | C(=CCl)(c1ccc(Cl)cc1)c2ccccc2Cl |
Ethylene__tetrabromo- | C(Br)(Br)=C(Br)Br |
Ethylene__tribromo-_(VAN8CI) | C(Br)(Br)=CBr |
Ethylene_fluorohydrin | C(F)CO |
Ethylene_glycol__diacetate | C(COC(C)=O)OC(C)=O |
Ethylene_glycol__dibenzenesulfonate | S(=O)(=O)(OCCOS(=O)(=O)c1ccccc1)c2ccccc2 |
Ethylene_glycol__dibenzoate | C(=O)(OCCOC(=O)c1ccccc1)c2ccccc2 |
Ethylene_glycol__dipropionate | O(CCOC(=O)CC)C(=O)CC |
Ethylene_glycol__dithio- | C(S)CS |
Ethylene_glycol__monoacetate | O(CCO)C(C)=O |
Ethylene_glycol__monobenzoate | C(=O)(OCCO)c1ccccc1 |
Ethylene_glycol__monoformate | C(CO)OC=O |
Ethylene_glycol__monomethanesulfonate | O(CCO)S(C)(=O)=O |
Ethylene_glycol_acetal_of_heptaldehyde | C(CCCCC)C1OCCO1 |
Ethylene_glycol_bis(chloromethyl)_ether | C(OCCl)COCCl |
Ethylene_glycol_m-cresyl_ether | O(CCO)c1cccc(C)c1 |
Ethylene_glycol_monoallyl_ether | O(CC=C)CCO |
Ethylene_glycol_monobenzyl_ether | C(OCCO)c1ccccc1 |
Ethylene_glycol_monobutyl_ether_laurate | C(CCCCCCCCCC)C(=O)OCCOCCCC |
Ethylene_glycol_monoethyl_ether_propenoate | C(=O)(C=C)OCCOCC |
Ethylene_glycol_monomethyl_ether_acrylate | C(=O)(C=C)OCCOC |
Ethylene_glycol_monomethyl_ether_formal | C(OCCOC)OCCOC |
Ethylene_glycol_monophenyl_ether | O(CCO)c1ccccc1 |
Ethylene_glycol_phenyl_ether_acetate | O(CCOC(C)=O)c1ccccc1 |
Ethylene_iodohydrin | C(I)CO |
Ethylene_phosphite | OP1OCCO1 |
Ethylene_tetraiodide | C(I)(I)=C(I)I |
Formic acid, ethylene ester | C(OC=O)COC=O |
Formic_acid__ethylene_ester | C(OC=O)COC=O |
Glycol ethylene ether | C1COCCO1 |
Guaiacol ethylene ether | O(CCOc1ccccc1OC)c2ccccc2OC |
Heptaldehyde, ethylene glycol acetal | C(CCCCC)C1OCCO1 |
Heptanal, cyclic ethylene acetal | C(CCCCC)C1OCCO1 |
Hydrocinnamaldehyde, cyclic ethylene acetal | C(CC1OCCO1)c2ccccc2 |
Lauric acid, ethylene ester | C(=O)(CCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCC |
Manganese N,N'-ethylene(salicylideneiminate) | [Mn]123Oc4ccccc4C=N2CCN1=Cc5ccccc5O3 |
Manganese disodium ethylene diamine tetraacetate | O=C1CN23CCN45CC(=O)O[Mn]24(O1)(OC(=O)C3)OC(=O)C5 |
Methacrylic acid, ethylene ester | C(=O)(OCCOC(=O)C(C)=C)C(C)=C |
Methanesulfonic acid, ethylene ester | O(CCOS(C)(=O)=O)S(C)(=O)=O |
Methanesulfonic_acid__ethylene_ester | O(CCOS(C)(=O)=O)S(C)(=O)=O |
Methyl ethylene phosphite | O(C)P1OCCO1 |
Methyl vinyl ketone ethylene acetal | C(=C)C1(C)OCCO1 |
Methyl_vinyl_ketone_ethylene_acetal | C(=C)C1(C)OCCO1 |
Michler's ethylene | C(=C)(c1ccc(cc1)N(C)C)c2ccc(cc2)N(C)C |
Michlerhs ethylene | C(=C)(c1ccc(cc1)N(C)C)c2ccc(cc2)N(C)C |
Monobutyl ether of ethylene glycol | C(CCC)OCCO |
Monobutyl_ether_of_ethylene_glycol | C(CCC)OCCO |
Monoisopropyl ether of ethylene glycol | O(CCO)C(C)C |
Monoisopropyl_ether_of_ethylene_glycol | O(CCO)C(C)C |
Monomethyl ether of ethylene glycol | C(CO)OC |
Monophenyl cyclic ethylene phosphite | O(c1ccccc1)P2OCCO2 |
N, N'-Ethylene diimino di(o-cresol) | C(=NCCN=Cc1ccccc1O)c2ccccc2O |
N, N'-Ethylene distearylamide | N(CCNC(=O)CCCCCCCCCCCCCCCCC)C(=O)CCCCCCCCCCCCCCCCC |
N,N'-Bis(2-Hydroxyethyl) ethylene diamine | C(NCCO)CNCCO |
N,N'-Ethylene bis(dithiocarbamate de sodium)(FRENCH) | C(CNC(=S)S)NC(=S)S |
N,N'-Ethylene-bis(iodoacetamide) | N(CCNC(=O)CI)C(=O)CI |
N,N-Bis-(BETA_-cyanoethyl)ethylene diamine | C(NCCC#N)CNCCC#N |
O, O-Bis(ethylene)-O-methyl phosphite | O(C)P1OCCO1 |
O-Butyl ethylene glycol | C(CCC)OCCO |
Octyl phenol condensed with l2-l3 moles ethylene oxide | C(C)(C)(CC(C)(C)C)c1ccc(OCCO)cc1 |
Palmitic acid, ((hexadecyloxy)methyl)ethylene ester | C(COCCCCCCCCCCCCCCCC)(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC |
Palmitic acid, ethylene ester | C(=O)(CCCCCCCCCCCCCCC)OCCOC(=O)CCCCCCCCCCCCCCC |
Phenylacetaldehyde ethylene acetal | C(c1ccccc1)C2OCCO2 |
Phosphonotrithioic acid, phenyl-, cyclic ethylene ester | S=P1(SCCS1)c2ccccc2 |
Phosphonotrithioic_acid__phenyl-__cyclic_ethylene_ester | S=P1(SCCS1)c2ccccc2 |
Phosphonous acid, piperidino-, cyclic ethylene ester | P1(OCCO1)N2CCCCC2 |
Phosphonous_acid__piperidino-__cyclic_ethylene_ester | P1(OCCO1)N2CCCCC2 |
Phosphorotrithious acid, ethylene cyclic diethylene ester | S(CCSP1SCCS1)P2SCCS2 |
Phosphorous acid, cyclic ethylene ester, phenyl ester | O(c1ccccc1)P2OCCO2 |
Phosphorous acid, cyclic ethylene methyl ester | O(C)P1OCCO1 |
Phosphorous acid, cyclic ethylene phenyl ester | O(c1ccccc1)P2OCCO2 |
Phosphorous_acid__cyclic_ethylene_ester__phenyl_ester | O(c1ccccc1)P2OCCO2 |
Phosphorous_acid__cyclic_ethylene_methyl_ester | O(C)P1OCCO1 |
Picolinaldehyde, cyclic ethylene acetal | C1(OCCO1)c2ccccn2 |
Piperidinophosphonous acid cyclic ethylene ester | P1(OCCO1)N2CCCCC2 |
Poly(1-(2-oxo-1-pyrrolidinyl)ethylene) | C(=C)N1CCCC1=O |
Poly(1-(2-oxo-1-pyrrolidinyl)ethylene)iodine complex | II.C=CN1CCCC1=O |
Poly(ethylene ether) glycol | C(O)CO |
Poly(ethylene glycol) | C(O)CO |
Poly(ethylene oxide) | C(O)CO |
Poly(mixed ethylene, propylene)glycol | C1CO1.CC2CO2 |
Poly(propylene oxide-ethylene oxide) | C1CO1.CC2CO2 |
Polypropylene glycol-ethylene oxide copolymer | C1CO1.CC2CO2 |
Propylene oxide-ethylene oxide copolymer | C1CO1.CC2CO2 |
Propylene oxide-ethylene oxide polymer | C1CO1.CC2CO2 |
Pyrocatechol ethylene ether | c12ccccc1OCCO2 |
Stearic acid, ethylene ester | O(CCOC(=O)CCCCCCCCCCCCCCCCC)C(=O)CCCCCCCCCCCCCCCCC |
Sulfurous acid, cyclic ester with ethylene glycol | O=S1OCCO1 |
Sulfurous_acid__cyclic_ester_with_ethylene_glycol | O=S1OCCO1 |
Tetrakis(ethoxycarbonyl)ethylene | C(C(=O)OCC)(C(=O)OCC)=C(C(=O)OCC)C(=O)OCC |
Tetrakis(p-(dimethylamino)phenyl)ethylene | C(c1ccc(cc1)N(C)C)(c2ccc(cc2)N(C)C)=C(c3ccc(cc3)N(C)C)c4ccc(cc4)N(C)C |
Tetrakis(p-methoxyphenyl)ethylene | C(c1ccc(OC)cc1)(c2ccc(OC)cc2)=C(c3ccc(OC)cc3)c4ccc(OC)cc4 |
Thiocyanic acid, ethylene ester | C(SC#N)CSC#N |
Tridecanedioic acid, cyclic ethylene ester | O=C1CCCCCCCCCCCC(=O)OCCO1 |
Tris(N-ethylene)phosphorotriamidate | P(=O)(N1CC1)(N2CC2)N3CC3 |
Trithiocarbonic acid, cyclic ethylene ester | S=C1SCCS1 |
Urea, 1,3-ethylene- | O=C1NCCN1 |
a-Ethylene dimercaptan | C(S)CS |
d-Glucose ethylene thioketal | C(O)(C1SCCS1)C(O)C(O)C(O)CO |
p-Nitrobenzaldehyde ethylene acetal | [N+](=O)([O-])c1ccc(cc1)C2OCCO2 |
p-Nitrobenzaldehyde_ethylene_acetal | [N+](=O)([O-])c1ccc(cc1)C2OCCO2 |
p-Phenylene phosphorodiamidate, cyclic tetrakis(ethylene imide) | P(=O)(Oc1ccc(cc1)OP(=O)(N2CC2)N3CC3)(N4CC4)N5CC5 |
s-Ethylene dimercaptan | C(S)CS |
trans-1, 2-Bis(diphenylphosphinyl)ethylene | P(C=CP(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
trans-1, 2-Bis(propylsulfonyl)ethylene | S(=O)(=O)(CCC)C=CS(=O)(=O)CCC |
trans-1,2-(Dibenzoyl)ethylene | C(=O)(C=CC(=O)c1ccccc1)c2ccccc2 |
trans-1,2-Bis(n-propylsulfonyl)ethylene | S(=O)(=O)(CCC)C=CS(=O)(=O)CCC |
unsym-Bis(p-chlorophenyl)ethylene | C(=C)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 |