If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Benzothiazyl N, N-diethylthiocarbamoyl sulfide | S(C(=S)N(CC)CC)C1=Nc2ccccc2S1 |
Bis(N, N-diethylthiocarbamoyl) disulfide | N(CC)(CC)C(=S)SSC(=S)N(CC)CC |
Bis(N,N-diethylthiocarbamoyl) sulfide | N(CC)(CC)C(=S)SC(=S)N(CC)CC |
Bis(diethylthiocarbamoyl) disulfide | N(CC)(CC)C(=S)SSC(=S)N(CC)CC |
Bis(diethylthiocarbamoyl) sulfide | N(CC)(CC)C(=S)SC(=S)N(CC)CC |
Disulfide, bis(diethylthiocarbamoyl) | N(CC)(CC)C(=S)SSC(=S)N(CC)CC |
N, N-Diethylthiocarbamoyl 2-benzothiazolyl sulfide | S(C(=S)N(CC)CC)C1=Nc2ccccc2S1 |
N, N-Diethylthiocarbamoyl-2-benzothiazolyl sulfide | S(C(=S)N(CC)CC)C1=Nc2ccccc2S1 |
Sulfide, bis(diethylthiocarbamoyl) | N(CC)(CC)C(=S)SC(=S)N(CC)CC |