If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
D-Sarcolysin | N(CCCl)(CCCl)c1ccc(cc1)CC(N)C(=O)O |
DL-Sarcolysin hydrochloride | N(CCCl)(CCCl)c1ccc(cc1)CC(N)C(=O)O |
DL-Sarcolysin, monohydrochloride | N(CCCl)(CCCl)c1ccc(cc1)CC(N)C(=O)O |
L-Sarcolysin | N(CCCl)(CCCl)c1ccc(cc1)CC(N)C(=O)O |
L-m-Sarcolysin | N(CCCl)(CCCl)c1cccc(c1)CC(N)C(=O)O |
N-Formyl-DL-sarcolysin | N(CCCl)(CCCl)c1ccc(cc1)CC(NC=O)C(=O)O |
N-Formyl-L-sarcolysin | N(CCCl)(CCCl)c1ccc(cc1)CC(NC=O)C(=O)O |
Sarcolysin hydrochloride | N(CCCl)(CCCl)c1ccc(cc1)CC(N)C(=O)O |
Sarcolysin | N(CCCl)(CCCl)c1ccc(cc1)CC(N)C(=O)O |
m-DL-Sarcolysin | N(CCCl)(CCCl)c1cccc(c1)CC(N)C(=O)O |
o-DL-Sarcolysin | N(CCCl)(CCCl)c1ccccc1CC(N)C(=O)O |
p-L-Sarcolysin | N(CCCl)(CCCl)c1ccc(cc1)CC(N)C(=O)O |