If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
(-)-ALPHA_-Methyldopa | C(c1ccc(O)c(O)c1)C(C)(N)C(=O)O |
(-)-Methyldopa | C(c1ccc(O)c(O)c1)C(C)(N)C(=O)O |
(S)-(-)-ALPHA_-Methyldopa | C(c1ccc(O)c(O)c1)C(C)(N)C(=O)O |
ALPHA_-Methyldopa (VAN) | C(c1ccc(O)c(O)c1)C(C)(N)C(=O)O |
ALPHA_-Methyldopa, L- | C(c1ccc(O)c(O)c1)C(C)(N)C(=O)O |
L-ALPHA_-Methyldopa | C(c1ccc(O)c(O)c1)C(C)(N)C(=O)O |
L-Methyldopa | C(c1ccc(O)c(O)c1)C(C)(N)C(=O)O |
Methyldopa | C(c1ccc(O)c(O)c1)C(C)(N)C(=O)O |
l-ALPHA_-Methyldopa | C(c1ccc(O)c(O)c1)C(C)(N)C(=O)O |