If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
WLN: L6Y DYJ AUYR BSWQ&R DN2&1R CSWQ&& DUK2&1R CSWQ &Q &ZH 2 | C(c1ccc(cc1)N(CC)Cc2cccc(c2)S(=O)(=O)O)(=C3C=CC(C=C3)=N(CC)Cc4cccc(c4)S(=O)(=O)O)c5ccccc5S(=O)(=O)O |
WLN: L6Y DYJ AUYR DN1&1&R DN1&1& DUK1&1 &Q &G | C(c1ccc(cc1)N(C)C)(c2ccc(cc2)N(C)C)=C3C=CC(C=C3)=N(C)C |
WLN: L6Y DYJ AUYR DSWQ&R DN2&1R CSWQ&& DUK2& 1R CSWQ &Q &-NA- 2 | C(c1ccc(cc1)N(CC)Cc2cccc(c2)S(=O)(=O)O)(=C3C=CC(C=C3)=N(CC)Cc4cccc(c4)S(=O)(=O)O)c5ccc(cc5)S(=O)(=O)O |
WLN: L6Y DYJ AUYR DZ&R DZ C1& DUM &GH | C(c1ccc(N)cc1)(=C2C=CC(=N)C=C2)c3ccc(N)c(C)c3 |
WLN: L6Y DYJ AUYR&R DN1&1& DUK1&1 &Q &G | C(c1ccccc1)(c2ccc(cc2)N(C)C)=C3C=CC(C=C3)=N(C)C |
WLN: L6Y DYJ AUYR&R DN2&1R CSWQ&& DUK2&1R CSWQ &Q &-NA- | C(c1ccccc1)(c2ccc(cc2)N(CC)Cc3cccc(c3)S(=O)(=O)O)=C4C=CC(C=C4)=N(CC)Cc5cccc(c5)S(=O)(=O)O |
WLN: L6Y DYJ AUYR&R DN2&2& DUK2&2 &Q &S-O4 | S(=O)(=O)(O)O.CCN(CC)c1ccc(cc1)C(c2ccccc2)=C3C=CC(C=C3)=N(CC)CC |
WLN: T C555 A AY DVMV IUTJ AUYR&- BT6NJ& IXQR&- BT6NJ | C(c1ccccc1)(c2ccccn2)=C3C4C=C(C3C5C(=O)NC(=O)C45)C(O)(c6ccccc6)c7ccccn7 |