If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Aminobenzyl alcohol | C(O)c1ccccc1N |
3-Aminobenzyl alcohol | C(O)c1cccc(N)c1 |
4-(4-Aminobenzyl)aniline | C(c1ccc(N)cc1)c2ccc(N)cc2 |
6-(D-(-)-p-Hydroxy-ALPHA_-aminobenzyl)penicillin | C(=O)(O)C1N2C(=O)C(NC(=O)C(N)c3ccc(O)cc3)C2SC1(C)C |
Benzyl alcohol, ALPHA_-(ALPHA_-aminobenzyl)-, hydrochloride | C(N)(c1ccccc1)C(O)c2ccccc2 |
Benzyl_alcohol__ALPHA_-(ALPHA_-aminobenzyl)-__hydrochloride | C(N)(c1ccccc1)C(O)c2ccccc2 |
Diethyl (p-aminobenzyl)phosphonate | C(c1ccc(N)cc1)P(=O)(OCC)OCC |
Phosphonic acid, p-aminobenzyl-, diethyl ester | C(c1ccc(N)cc1)P(=O)(OCC)OCC |
m-Aminobenzyl alcohol | C(O)c1cccc(N)c1 |
o-Aminobenzyl alcohol | C(O)c1ccccc1N |