If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Chlorobenzamide | C(N)(=O)c1ccccc1Cl |
3-Nitro-4-chlorobenzamide | [N+](=O)([O-])c1cc(ccc1Cl)C(N)=O |
4-Chlorobenzamide | C(N)(=O)c1ccc(Cl)cc1 |
N, N-Dimethyl-2-chlorobenzamide | C(=O)(N(C)C)c1ccccc1Cl |
o-Chlorobenzamide | C(N)(=O)c1ccccc1Cl |
p-Chlorobenzamide | C(N)(=O)c1ccc(Cl)cc1 |