If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
2-Ethylhexanoic acid stannous salt | C(CC)(CCCC)C(=O)O |
Stannous 2-ethylhexanoate | C(CC)(CCCC)C(=O)O |
Stannous 2-ethylhexoate | C(CC)(CCCC)C(=O)O |
Stannous caprylate | C(CCCCC)CC(=O)O |
Stannous dioctanoate | C(CCCCC)CC(=O)O |
Stannous octanoate | C(CCCCC)CC(=O)O |
Stannous octate | C(CCCCC)CC(=O)O |
Stannous octoate | C(CC)(CCCC)C(=O)O |
Stannous oleate | C(CC=CCCCCCCCC)CCCCCC(=O)O |