If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
7-O-(BETA_-D-Glucosyl)apigenin | O=C1C=C(Oc2cc(cc(O)c12)OC3OC(CO)C(O)C(O)C3O)c4ccc(O)cc4 |
APIGENIN, 7-B-D-GLYCOPYRANOSIDE | O=C1C=C(Oc2cc(cc(O)c12)OC3OC(CO)C(O)C(O)C3O)c4ccc(O)cc4 |
Apigenin 4',7-dimethyl ether | O=C1C=C(Oc2cc(OC)cc(O)c12)c3ccc(OC)cc3 |
Apigenin 4'-dimethyl ether | O=C1C=C(Oc2cc(O)cc(O)c12)c3ccc(OC)cc3 |
Apigenin 4'-methyl ether | O=C1C=C(Oc2cc(O)cc(O)c12)c3ccc(OC)cc3 |
Apigenin 7,4'-dimethyl ether | O=C1C=C(Oc2cc(OC)cc(O)c12)c3ccc(OC)cc3 |
Apigenin 7-O-BETA_-D-glucopyranoside | O=C1C=C(Oc2cc(cc(O)c12)OC3OC(CO)C(O)C(O)C3O)c4ccc(O)cc4 |
Apigenin 7-O-BETA_-D-glucoside | O=C1C=C(Oc2cc(cc(O)c12)OC3OC(CO)C(O)C(O)C3O)c4ccc(O)cc4 |
Apigenin 7-O-glucoside | O=C1C=C(Oc2cc(cc(O)c12)OC3OC(CO)C(O)C(O)C3O)c4ccc(O)cc4 |
Apigenin | O=C1C=C(Oc2cc(O)cc(O)c12)c3ccc(O)cc3 |
Apigenin, 7-BETA_-D-glucopyranoside | O=C1C=C(Oc2cc(cc(O)c12)OC3OC(CO)C(O)C(O)C3O)c4ccc(O)cc4 |