If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
2-((N,N-Diethyldithio)carbamyl)benzoathiazole | S(C(=S)N(CC)CC)C1=Nc2ccccc2S1 |
2-Benzothiazolethiol, (diethyldithio)carbamate (ester) | S(C(=S)N(CC)CC)C1=Nc2ccccc2S1 |
Carbamic acid, diethyldithio-, 2-benzothiazolyl ester | S(C(=S)N(CC)CC)C1=Nc2ccccc2S1 |
Carbamic acid, diethyldithio-, 2-chloroallyl ester | N(CC)(CC)C(=S)SCC(=C)Cl |
Carbamic acid, diethyldithio-, anhydrosulfide | N(CC)(CC)C(=S)SC(=S)N(CC)CC |
Carbamic acid, diethyldithio-, cadmium salt | N(CC)(CC)C1=S[Cd]2(S1)SC(=S2)N(CC)CC |
Carbamic acid, diethyldithio-, compd. with diethylamine (1:1) | N(CC)CC.CCN(CC)C(=S)S |
Carbamic acid, diethyldithio-, copper(II) salt | N(CC)(CC)C1=S[Cu]2(S1)SC(=S2)N(CC)CC |
Carbamic acid, diethyldithio-, diethylamine salt | N(CC)CC.CCN(CC)C(=S)S |
Carbamic acid, diethyldithio-, ethyl ester | N(CC)(CC)C(=S)SCC |
Carbamic acid, diethyldithio-, methyl ester | N(CC)(CC)C(=S)SC |
Carbamic acid, diethyldithio-, sodium salt | N(CC)(CC)C(=S)S |
Carbamic acid, diethyldithio-, tin(II) salt | N(CC)(CC)C1=S[Sn]2(S1)SC(=S2)N(CC)CC |
Diethyldithio bis(thionoformate) | C(=S)(OCC)SSC(=S)OCC |
Oxamide, N,N'-diethyldithio- | C(=S)(NCC)C(=S)NCC |