If your browser is equipped with a CML aware plug-in, then the CML will be processed to render a 2D or 3D model of the molecular structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program included on the cdrom, to render the CML file.
Select from
4-Methylumbelliferone butyrate | CC1=CC(=O)Oc2cc(ccc12)OC(=O)CCC |
4-Methylumbelliferone | CC1=CC(=O)Oc2cc(O)ccc12 |
BETA_-Methylumbelliferone | CC1=CC(=O)Oc2cc(O)ccc12 |
Benzyl BETA_-methylumbelliferone | CC1=C(Cc2ccccc2)C(=O)Oc3cc(O)ccc13 |
Butyryl 4-methylumbelliferone | CC1=CC(=O)Oc2cc(ccc12)OC(=O)CCC |
METHYLUMBELLIFERONE, BETA | CC1=CC(=O)Oc2cc(O)ccc12 |
Methylumbelliferone | O(C)c1ccc2C=CC(=O)Oc2c1 |