If your browser is equipped with a CML aware plug-in, then the CML will be
processed to render a 2D or 3D model of the molecular
structure.
If your browser is NOT CML aware, then you can use the "Jumbo3" program
included on the cdrom, to render the CML file.
1-Naphthalenecarboxylic acid, 8-amino-, lactam | O=C1Nc2cccc3cccc1c23 |
1-Naphthalenecarboxylic_acid__8-amino-__lactam | O=C1Nc2cccc3cccc1c23 |
4-Aminobutyric acid lactam | O=C1CCCN1 |
4-Aminocyclohexanecarboxylic acid lactam | O=C1NC2CCC1CC2 |
8-Aminooctanoic acid lactam | O=C1CCCCCCCN1 |
Aminocaproic lactam | O=C1CCCCCN1 |
Butanoic acid, 4-amino-, lactam | O=C1CCCN1 |
Butanoic_acid__4-amino-__lactam | O=C1CCCN1 |
Chlordiazepoxide lactam | O=N1=C(c2ccccc2)c3cc(Cl)ccc3NC(=O)C1 |
Cyclohexanecarboxylic acid, 4-amino-, lactam | O=C1NC2CCC1CC2 |
Cyclohexanecarboxylic_acid__4-amino-__lactam | O=C1NC2CCC1CC2 |
Cyclooctanone lactam | O=C1CCCCCCCN1 |
Dodecanoic acid, 12-amino-, lactam | O=C1CCCCCCCCCCCN1 |
Dodecanoic_acid__12-amino-__lactam | O=C1CCCCCCCCCCCN1 |
GAMMA_-Aminobutyric lactam | O=C1CCCN1 |
Glycylglycine lactam | O=C1CNC(=O)CN1 |
Hexanoic acid, 6-amino-, cyclic lactam | O=C1CCCCCN1 |
Hexanoic acid, 6-amino-, lactam | O=C1CCCCCN1 |
Hexanoic_acid__6-amino-__cyclic_lactam | O=C1CCCCCN1 |
Isatic acid lactam | O=C1C(=O)Nc2ccccc12 |
Lambertellin lactam | O=C1c2nc(O)c(C)cc2C(=O)c3cccc(O)c13 |
Lambertellin_lactam | O=C1c2nc(O)c(C)cc2C(=O)c3cccc(O)c13 |
Laurin lactam | O=C1CCCCCCCCCCCN1 |
Lauryl lactam | O=C1CCCCCCCCCCCN1 |
Octanoic acid, 8-amino-, lactam | O=C1CCCCCCCN1 |
Octanoic_acid__8-amino-__lactam | O=C1CCCCCCCN1 |
Pentanoic acid, 5-amino-, lactam | O=C1CCCCN1 |
Pentanoic_acid__5-amino-__lactam | O=C1CCCCN1 |
Ro 5-2092 lactam | O=N1=C(c2ccccc2)c3cc(Cl)ccc3NC(=O)C1 |
o-Aminocinnamic acid lactam | Oc1ccc2ccccc2n1 |
o-Aminocinnamic_acid_lactam | Oc1ccc2ccccc2n1 |
o-Aminohydrocinnamic acid lactam | O=C1CCc2ccccc2N1 |